From f2be09f4e4c1b8f63f76f52c8c96972c3d93130a Mon Sep 17 00:00:00 2001 From: ulyssessouza Date: Wed, 11 Dec 2019 14:35:32 +0100 Subject: [PATCH] Bump microsoft/hcsshim to v0.8.7 Signed-off-by: ulyssessouza --- go.mod | 7 +- go.sum | 63 +- vendor/github.com/Microsoft/go-winio/go.mod | 2 +- vendor/github.com/Microsoft/go-winio/go.sum | 2 + .../Microsoft/hcsshim/Protobuild.toml | 54 + .../github.com/Microsoft/hcsshim/appveyor.yml | 20 +- .../github.com/Microsoft/hcsshim/container.go | 75 +- vendor/github.com/Microsoft/hcsshim/go.mod | 37 + vendor/github.com/Microsoft/hcsshim/go.sum | 131 + .../Microsoft/hcsshim/hnsendpoint.go | 10 + .../Microsoft/hcsshim/internal/cow/cow.go | 83 + .../hcsshim/internal/guestrequest/types.go | 100 - .../Microsoft/hcsshim/internal/guid/guid.go | 69 - .../hcsshim/internal/hcs/callback.go | 102 +- .../Microsoft/hcsshim/internal/hcs/errors.go | 75 +- .../Microsoft/hcsshim/internal/hcs/hcs.go | 48 - .../Microsoft/hcsshim/internal/hcs/log.go | 20 - .../Microsoft/hcsshim/internal/hcs/process.go | 425 +- .../Microsoft/hcsshim/internal/hcs/system.go | 629 +- .../hcsshim/internal/hcs/waithelper.go | 18 +- .../Microsoft/hcsshim/internal/hcs/watcher.go | 41 - .../hcsshim/internal/hns/hnsendpoint.go | 22 + .../hcsshim/internal/hns/hnsfuncs.go | 15 +- .../hcsshim/internal/hns/hnsnetwork.go | 10 +- .../hcsshim/internal/hns/hnspolicy.go | 5 +- .../hcsshim/internal/interop/interop.go | 4 - .../Microsoft/hcsshim/internal/log/g.go | 23 + .../Microsoft/hcsshim/internal/oc/exporter.go | 43 + .../Microsoft/hcsshim/internal/oc/span.go | 17 + .../hcsshim/internal/schema1/schema1.go | 9 +- .../hcsshim/internal/schema2/attachment.go | 1 - .../schema2/cache_query_stats_response.go | 1 - .../hcsshim/internal/schema2/close_handle.go | 1 - .../hcsshim/internal/schema2/com_port.go | 1 - .../internal/schema2/compute_system.go | 3 +- .../hcsshim/internal/schema2/configuration.go | 32 +- .../hcsshim/internal/schema2/console_size.go | 1 - .../hcsshim/internal/schema2/container.go | 1 - .../schema2/container_memory_information.go | 1 - .../hcsshim/internal/schema2/devices.go | 1 - .../internal/schema2/enhanced_mode_video.go | 1 - .../internal/schema2/flexible_io_device.go | 1 - .../internal/schema2/guest_crash_reporting.go | 1 - .../hcsshim/internal/schema2/guest_os.go | 1 - .../hcsshim/internal/schema2/hosted_system.go | 1 - .../hcsshim/internal/schema2/hv_socket.go | 1 - .../hcsshim/internal/schema2/hv_socket_2.go | 1 - .../hcsshim/internal/schema2/layer.go | 1 - .../internal/schema2/mapped_directory.go | 1 - .../hcsshim/internal/schema2/mapped_pipe.go | 1 - .../hcsshim/internal/schema2/memory.go | 1 - .../hcsshim/internal/schema2/memory_2.go | 5 + .../schema2/memory_information_for_vm.go | 3 +- .../hcsshim/internal/schema2/memory_stats.go | 7 +- .../internal/schema2/network_adapter.go | 1 - .../hcsshim/internal/schema2/networking.go | 1 - .../internal/schema2/pause_notification.go | 1 - .../hcsshim/internal/schema2/pause_options.go | 1 - .../hcsshim/internal/schema2/plan9.go | 1 - .../hcsshim/internal/schema2/plan9_share.go | 3 +- .../internal/schema2/process_details.go | 1 - .../schema2/process_modify_request.go | 1 - .../internal/schema2/process_parameters.go | 1 - .../internal/schema2/process_status.go | 1 - .../hcsshim/internal/schema2/processor.go | 1 - .../hcsshim/internal/schema2/processor_2.go | 1 - .../internal/schema2/processor_stats.go | 7 +- .../hcsshim/internal/schema2/properties.go | 9 +- .../internal/schema2/property_query.go | 5 +- .../hcsshim/internal/schema2/property_type.go | 23 + .../schema2/rdp_connection_options.go | 1 - .../internal/schema2/registry_changes.go | 1 - .../hcsshim/internal/schema2/registry_key.go | 1 - .../internal/schema2/registry_value.go | 1 - .../schema2/shared_memory_configuration.go | 1 - .../internal/schema2/shared_memory_region.go | 1 - .../schema2/shared_memory_region_info.go | 1 - .../internal/schema2/silo_properties.go | 1 - .../hcsshim/internal/schema2/statistics.go | 3 +- .../hcsshim/internal/schema2/storage_qo_s.go | 1 - .../hcsshim/internal/schema2/storage_stats.go | 9 +- .../hcsshim/internal/schema2/topology.go | 1 - .../hcsshim/internal/schema2/uefi.go | 1 - .../internal/schema2/uefi_boot_entry.go | 1 - .../hcsshim/internal/schema2/version.go | 1 - .../hcsshim/internal/schema2/video_monitor.go | 1 - .../internal/schema2/virtual_node_info.go | 1 - .../internal/schema2/virtual_p_mem_device.go | 1 - .../hcsshim/internal/schema2/virtual_smb.go | 1 - .../internal/schema2/virtual_smb_share.go | 1 - .../schema2/virtual_smb_share_options.go | 1 - .../hcsshim/internal/schema2/vm_memory.go | 5 +- .../schema2/windows_crash_reporting.go | 1 - .../hcsshim/internal/vmcompute/vmcompute.go | 565 ++ .../{hcs => vmcompute}/zsyscall_windows.go | 88 +- .../internal/wclayer/expandscratchsize.go | 115 + .../hcsshim/internal/wclayer/layerid.go | 2 +- .../hcsshim/internal/wclayer/layerutils.go | 2 +- .../hcsshim/internal/wclayer/nametoguid.go | 2 +- .../hcsshim/internal/wclayer/wclayer.go | 7 +- .../internal/wclayer/zsyscall_windows.go | 59 + vendor/github.com/Microsoft/hcsshim/layer.go | 6 +- .../{osversion.go => osversion_windows.go} | 6 + .../hcsshim/osversion/windowsbuilds.go | 21 +- .../github.com/Microsoft/hcsshim/process.go | 38 +- .../github.com/Microsoft/hcsshim/vendor.conf | 21 - vendor/github.com/containerd/cgroups/LICENSE | 201 + .../containerd/cgroups/stats/v1/doc.go | 17 + .../containerd/cgroups/stats/v1/metrics.pb.go | 5368 ++++++++++++ .../cgroups/stats/v1/metrics.pb.txt | 712 ++ .../containerd/cgroups/stats/v1/metrics.proto | 136 + vendor/github.com/docker/go-units/MAINTAINERS | 33 +- vendor/github.com/docker/go-units/circle.yml | 2 +- vendor/github.com/docker/go-units/duration.go | 6 +- vendor/github.com/docker/go-units/size.go | 26 +- vendor/github.com/docker/go-units/ulimit.go | 9 +- .../github.com/hashicorp/golang-lru/LICENSE | 362 + .../hashicorp/golang-lru/simplelru/lru.go | 161 + .../golang-lru/simplelru/lru_interface.go | 36 + vendor/github.com/prometheus/procfs/arp.go | 85 + .../github.com/prometheus/procfs/buddyinfo.go | 2 +- .../github.com/prometheus/procfs/cpuinfo.go | 166 + vendor/github.com/prometheus/procfs/crypto.go | 131 + .../prometheus/procfs/fixtures.ttar | 2631 +++++- .../prometheus/procfs/internal/util/parse.go | 88 + .../procfs/internal/util/sysreadfile.go | 45 + .../internal/util/sysreadfile_compat.go | 26 + .../procfs/internal/util/valueparser.go | 77 + .../prometheus/procfs/net_softnet.go | 91 + vendor/github.com/prometheus/procfs/proc.go | 30 + .../prometheus/procfs/proc_fdinfo.go | 132 + .../prometheus/procfs/proc_status.go | 7 +- .../github.com/prometheus/procfs/schedstat.go | 118 + vendor/github.com/prometheus/procfs/vm.go | 210 + .../github.com/prometheus/procfs/zoneinfo.go | 196 + .../xeipuuv/gojsonschema/.gitignore | 2 + .../xeipuuv/gojsonschema/.travis.yml | 6 +- .../github.com/xeipuuv/gojsonschema/README.md | 133 +- .../github.com/xeipuuv/gojsonschema/errors.go | 102 +- .../xeipuuv/gojsonschema/format_checkers.go | 136 +- .../xeipuuv/gojsonschema/glide.yaml | 7 +- .../xeipuuv/gojsonschema/jsonContext.go | 16 +- .../xeipuuv/gojsonschema/jsonLoader.go | 242 +- .../xeipuuv/gojsonschema/locales.go | 124 +- .../github.com/xeipuuv/gojsonschema/result.go | 44 +- .../github.com/xeipuuv/gojsonschema/schema.go | 362 +- .../xeipuuv/gojsonschema/schemaPool.go | 141 +- .../gojsonschema/schemaReferencePool.go | 5 +- .../xeipuuv/gojsonschema/schemaType.go | 2 +- .../xeipuuv/gojsonschema/subSchema.go | 64 +- .../github.com/xeipuuv/gojsonschema/utils.go | 66 +- .../xeipuuv/gojsonschema/validation.go | 261 +- vendor/go.opencensus.io/.gitignore | 9 + vendor/go.opencensus.io/.travis.yml | 17 + vendor/go.opencensus.io/AUTHORS | 1 + vendor/go.opencensus.io/CONTRIBUTING.md | 63 + vendor/go.opencensus.io/Gopkg.lock | 231 + vendor/go.opencensus.io/Gopkg.toml | 36 + vendor/go.opencensus.io/LICENSE | 202 + vendor/go.opencensus.io/Makefile | 96 + vendor/go.opencensus.io/README.md | 263 + vendor/go.opencensus.io/appveyor.yml | 25 + vendor/go.opencensus.io/go.mod | 12 + vendor/go.opencensus.io/go.sum | 61 + vendor/go.opencensus.io/internal/internal.go | 37 + vendor/go.opencensus.io/internal/sanitize.go | 50 + .../internal/traceinternals.go | 53 + vendor/go.opencensus.io/opencensus.go | 21 + vendor/go.opencensus.io/trace/basetypes.go | 119 + vendor/go.opencensus.io/trace/config.go | 86 + vendor/go.opencensus.io/trace/doc.go | 53 + vendor/go.opencensus.io/trace/evictedqueue.go | 38 + vendor/go.opencensus.io/trace/export.go | 97 + .../trace/internal/internal.go | 22 + vendor/go.opencensus.io/trace/lrumap.go | 37 + vendor/go.opencensus.io/trace/sampling.go | 75 + vendor/go.opencensus.io/trace/spanbucket.go | 130 + vendor/go.opencensus.io/trace/spanstore.go | 306 + vendor/go.opencensus.io/trace/status_codes.go | 37 + vendor/go.opencensus.io/trace/trace.go | 598 ++ vendor/go.opencensus.io/trace/trace_go11.go | 32 + .../go.opencensus.io/trace/trace_nongo11.go | 25 + .../trace/tracestate/tracestate.go | 147 + .../golang.org/x/text/transform/transform.go | 6 +- vendor/golang.org/x/text/unicode/bidi/bidi.go | 2 +- .../golang.org/x/text/unicode/bidi/bracket.go | 4 +- vendor/golang.org/x/text/unicode/bidi/core.go | 2 +- vendor/golang.org/x/text/unicode/bidi/gen.go | 2 +- .../x/text/unicode/bidi/gen_ranges.go | 2 +- .../x/text/unicode/bidi/tables10.0.0.go | 2 +- .../x/text/unicode/bidi/tables11.0.0.go | 1887 ++++ .../x/text/unicode/norm/composition.go | 8 +- .../x/text/unicode/norm/forminfo.go | 19 + vendor/golang.org/x/text/unicode/norm/iter.go | 3 +- .../x/text/unicode/norm/maketables.go | 20 +- .../x/text/unicode/norm/normalize.go | 4 +- .../x/text/unicode/norm/readwriter.go | 4 +- .../x/text/unicode/norm/tables10.0.0.go | 1892 ++-- .../x/text/unicode/norm/tables11.0.0.go | 7693 +++++++++++++++++ .../x/text/unicode/norm/tables9.0.0.go | 1890 ++-- .../x/text/unicode/norm/transform.go | 10 +- .../google.golang.org/appengine/.travis.yml | 30 +- .../google.golang.org/appengine/appengine.go | 24 + vendor/google.golang.org/appengine/go.mod | 7 + vendor/google.golang.org/appengine/go.sum | 6 + .../appengine/internal/api.go | 17 +- .../appengine/internal/api_pre17.go | 682 -- .../app_identity/app_identity_service.pb.go | 396 +- .../appengine/internal/base/api_base.pb.go | 248 +- .../internal/datastore/datastore_v3.pb.go | 2193 +++-- .../appengine/internal/identity.go | 47 +- .../appengine/internal/identity_classic.go | 4 + .../appengine/internal/identity_flex.go | 11 + .../appengine/internal/identity_vm.go | 43 +- .../appengine/internal/log/log_service.pb.go | 570 +- .../appengine/internal/main.go | 1 + .../appengine/internal/main_common.go | 7 + .../appengine/internal/main_vm.go | 21 + .../appengine/internal/metadata.go | 3 +- .../internal/modules/modules_service.pb.go | 596 +- .../internal/remote_api/remote_api.pb.go | 170 +- .../internal/urlfetch/urlfetch_service.pb.go | 178 +- .../appengine/travis_install.sh | 18 + .../appengine/travis_test.sh | 12 + .../googleapis/rpc/status/status.pb.go | 37 +- vendor/modules.txt | 35 +- 226 files changed, 32376 insertions(+), 5481 deletions(-) create mode 100644 vendor/github.com/Microsoft/hcsshim/Protobuild.toml create mode 100644 vendor/github.com/Microsoft/hcsshim/go.mod create mode 100644 vendor/github.com/Microsoft/hcsshim/go.sum create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go delete mode 100644 vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/log/g.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/oc/span.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go create mode 100644 vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go rename vendor/github.com/Microsoft/hcsshim/internal/{hcs => vmcompute}/zsyscall_windows.go (81%) rename vendor/github.com/Microsoft/hcsshim/osversion/{osversion.go => osversion_windows.go} (88%) delete mode 100644 vendor/github.com/Microsoft/hcsshim/vendor.conf create mode 100644 vendor/github.com/containerd/cgroups/LICENSE create mode 100644 vendor/github.com/containerd/cgroups/stats/v1/doc.go create mode 100644 vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go create mode 100644 vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt create mode 100644 vendor/github.com/containerd/cgroups/stats/v1/metrics.proto create mode 100644 vendor/github.com/hashicorp/golang-lru/LICENSE create mode 100644 vendor/github.com/hashicorp/golang-lru/simplelru/lru.go create mode 100644 vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go create mode 100644 vendor/github.com/prometheus/procfs/arp.go create mode 100644 vendor/github.com/prometheus/procfs/cpuinfo.go create mode 100644 vendor/github.com/prometheus/procfs/crypto.go create mode 100644 vendor/github.com/prometheus/procfs/internal/util/parse.go create mode 100644 vendor/github.com/prometheus/procfs/internal/util/sysreadfile.go create mode 100644 vendor/github.com/prometheus/procfs/internal/util/sysreadfile_compat.go create mode 100644 vendor/github.com/prometheus/procfs/internal/util/valueparser.go create mode 100644 vendor/github.com/prometheus/procfs/net_softnet.go create mode 100644 vendor/github.com/prometheus/procfs/proc_fdinfo.go create mode 100644 vendor/github.com/prometheus/procfs/schedstat.go create mode 100644 vendor/github.com/prometheus/procfs/vm.go create mode 100644 vendor/github.com/prometheus/procfs/zoneinfo.go create mode 100644 vendor/go.opencensus.io/.gitignore create mode 100644 vendor/go.opencensus.io/.travis.yml create mode 100644 vendor/go.opencensus.io/AUTHORS create mode 100644 vendor/go.opencensus.io/CONTRIBUTING.md create mode 100644 vendor/go.opencensus.io/Gopkg.lock create mode 100644 vendor/go.opencensus.io/Gopkg.toml create mode 100644 vendor/go.opencensus.io/LICENSE create mode 100644 vendor/go.opencensus.io/Makefile create mode 100644 vendor/go.opencensus.io/README.md create mode 100644 vendor/go.opencensus.io/appveyor.yml create mode 100644 vendor/go.opencensus.io/go.mod create mode 100644 vendor/go.opencensus.io/go.sum create mode 100644 vendor/go.opencensus.io/internal/internal.go create mode 100644 vendor/go.opencensus.io/internal/sanitize.go create mode 100644 vendor/go.opencensus.io/internal/traceinternals.go create mode 100644 vendor/go.opencensus.io/opencensus.go create mode 100644 vendor/go.opencensus.io/trace/basetypes.go create mode 100644 vendor/go.opencensus.io/trace/config.go create mode 100644 vendor/go.opencensus.io/trace/doc.go create mode 100644 vendor/go.opencensus.io/trace/evictedqueue.go create mode 100644 vendor/go.opencensus.io/trace/export.go create mode 100644 vendor/go.opencensus.io/trace/internal/internal.go create mode 100644 vendor/go.opencensus.io/trace/lrumap.go create mode 100644 vendor/go.opencensus.io/trace/sampling.go create mode 100644 vendor/go.opencensus.io/trace/spanbucket.go create mode 100644 vendor/go.opencensus.io/trace/spanstore.go create mode 100644 vendor/go.opencensus.io/trace/status_codes.go create mode 100644 vendor/go.opencensus.io/trace/trace.go create mode 100644 vendor/go.opencensus.io/trace/trace_go11.go create mode 100644 vendor/go.opencensus.io/trace/trace_nongo11.go create mode 100644 vendor/go.opencensus.io/trace/tracestate/tracestate.go create mode 100644 vendor/golang.org/x/text/unicode/bidi/tables11.0.0.go create mode 100644 vendor/golang.org/x/text/unicode/norm/tables11.0.0.go create mode 100644 vendor/google.golang.org/appengine/go.mod create mode 100644 vendor/google.golang.org/appengine/go.sum delete mode 100644 vendor/google.golang.org/appengine/internal/api_pre17.go create mode 100644 vendor/google.golang.org/appengine/internal/identity_flex.go create mode 100644 vendor/google.golang.org/appengine/internal/main_common.go create mode 100644 vendor/google.golang.org/appengine/travis_install.sh create mode 100644 vendor/google.golang.org/appengine/travis_test.sh diff --git a/go.mod b/go.mod index bfd3362a..7b8de81e 100644 --- a/go.mod +++ b/go.mod @@ -2,7 +2,7 @@ module github.com/docker/buildx require ( github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 // indirect - github.com/Microsoft/hcsshim v0.8.6 // indirect + github.com/Microsoft/hcsshim v0.8.7 // indirect github.com/Shopify/logrus-bugsnag v0.0.0-20171204204709-577dee27f20d // indirect github.com/agl/ed25519 v0.0.0-20170116200512-5312a6153412 // indirect github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973 // indirect @@ -34,7 +34,6 @@ require ( github.com/godbus/dbus v4.1.0+incompatible // indirect github.com/gofrs/flock v0.7.0 github.com/gofrs/uuid v3.2.0+incompatible // indirect - github.com/gogo/protobuf v1.2.1 // indirect github.com/google/btree v1.0.0 // indirect github.com/google/certificate-transparency-go v1.0.21 // indirect github.com/google/gofuzz v0.0.0-20170612174753-24818f796faf // indirect @@ -75,12 +74,10 @@ require ( github.com/spf13/viper v1.3.2 // indirect github.com/stretchr/testify v1.3.0 github.com/theupdateframework/notary v0.6.1 // indirect - github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f // indirect - github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect - github.com/xeipuuv/gojsonschema v0.0.0-20160323030313-93e72a773fad // indirect github.com/xlab/handysort v0.0.0-20150421192137-fb3537ed64a1 // indirect golang.org/x/sync v0.0.0-20190423024810-112230192c58 golang.org/x/time v0.0.0-20190308202827-9d24e82272b4 // indirect + google.golang.org/appengine v1.4.0 // indirect gopkg.in/dancannon/gorethink.v3 v3.0.5 // indirect gopkg.in/fatih/pool.v2 v2.0.0 // indirect gopkg.in/gorethink/gorethink.v3 v3.0.5 // indirect diff --git a/go.sum b/go.sum index 893843f9..e3948bb5 100644 --- a/go.sum +++ b/go.sum @@ -7,9 +7,11 @@ github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03 github.com/Microsoft/go-winio v0.4.11/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA= github.com/Microsoft/go-winio v0.4.14 h1:+hMXMk01us9KgxGb7ftKQt2Xpf5hH/yky+TDA+qxleU= github.com/Microsoft/go-winio v0.4.14/go.mod h1:qXqCSQ3Xa7+6tgxaGTIe4Kpcdsi+P8jBhyzoq1bpyYA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= github.com/Microsoft/hcsshim v0.8.5/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= -github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA= -github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= +github.com/Microsoft/hcsshim v0.8.7 h1:ptnOoufxGSzauVTsdE+wMYnCWA301PdoN4xg5oRdZpg= +github.com/Microsoft/hcsshim v0.8.7/go.mod h1:OHd7sQqRFrYd3RmSgbgji+ctCwkbq2wbEYNSzOYtcBQ= github.com/Shopify/logrus-bugsnag v0.0.0-20171204204709-577dee27f20d h1:UrqY+r/OJnIp5u0s1SbQ8dVfLCZJsnvazdBP5hS4iRs= github.com/Shopify/logrus-bugsnag v0.0.0-20171204204709-577dee27f20d/go.mod h1:HI8ITrYtUY+O+ZhtlqUnD8+KwNPOyugEhfP9fdUIaEQ= github.com/agl/ed25519 v0.0.0-20170116200512-5312a6153412 h1:w1UutsfOrms1J05zt7ISrnJIXKzwaspym5BTKGx93EI= @@ -22,6 +24,7 @@ github.com/bitly/go-hostpool v0.0.0-20171023180738-a3a6125de932 h1:mXoPYz/Ul5HYE github.com/bitly/go-hostpool v0.0.0-20171023180738-a3a6125de932/go.mod h1:NOuUCSz6Q9T7+igc/hlvDOUdtWKryOrtFyIVABv/p7k= github.com/bitly/go-simplejson v0.5.0 h1:6IH+V8/tVMab511d5bn4M7EwGXZf9Hj6i2xSwkNEM+Y= github.com/bitly/go-simplejson v0.5.0/go.mod h1:cXHtHw4XUPsvGaxgjIAn8PhEWG9NfngEKAMDJEczWVA= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= github.com/bmizerany/assert v0.0.0-20160611221934-b7ed37b82869 h1:DDGfHa7BWjL4YnC6+E63dPcxHo2sUxDIu8g3QgEJdRY= github.com/bmizerany/assert v0.0.0-20160611221934-b7ed37b82869/go.mod h1:Ekp36dRnpXw/yCqJaO+ZrUyxD+3VXMFFr56k5XYrpB4= github.com/bugsnag/bugsnag-go v1.4.1 h1:TT3P9AX69w8mbSGE8L7IJOO2KBlPN0iQtYD0dUlrWHc= @@ -36,20 +39,28 @@ github.com/cloudflare/cfssl v0.0.0-20181213083726-b94e044bb51e/go.mod h1:yMWuSON github.com/codahale/hdrhistogram v0.0.0-20160425231609-f8ad88b59a58/go.mod h1:sE/e/2PUdi/liOCUjSTXgM1o87ZssimdTWN964YiIeI= github.com/containerd/cgroups v0.0.0-20190717030353-c4b9ac5c7601 h1:6xW3ogNpFIly0umJGEKzFfGDNUk5rXFE1lJ3/gBmz3U= github.com/containerd/cgroups v0.0.0-20190717030353-c4b9ac5c7601/go.mod h1:X9rLEHIqSf/wfK8NsPqxJmeZgW4pcfzdXITDrUSJ6uI= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= github.com/containerd/console v0.0.0-20181022165439-0650fd9eeb50 h1:WMpHmC6AxwWb9hMqhudkqG7A/p14KiMnl6d3r1iUMjU= github.com/containerd/console v0.0.0-20181022165439-0650fd9eeb50/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= github.com/containerd/console v0.0.0-20191206165004-02ecf6a7291e h1:GdiIYd8ZDOrT++e1NjhSD4rGt9zaJukHm4rt5F4mRQc= github.com/containerd/console v0.0.0-20191206165004-02ecf6a7291e/go.mod h1:8Pf4gM6VEbTNRIT26AyyU7hxdQU3MvAvxVI0sc00XBE= github.com/containerd/containerd v1.2.4/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/containerd v1.4.0-0.20191014053712-acdcf13d5eaf h1:phUfu9w7+g1Vp149t3FThX2BmW+DkKkHj613PzZrQuU= github.com/containerd/containerd v1.4.0-0.20191014053712-acdcf13d5eaf/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/continuity v0.0.0-20181001140422-bd77b46c8352/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= github.com/containerd/continuity v0.0.0-20190827140505-75bee3e2ccb6 h1:NmTXa/uVnDyp0TY5MKi197+3HWcnYWfnHGyaFthlnGw= github.com/containerd/continuity v0.0.0-20190827140505-75bee3e2ccb6/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= github.com/containerd/fifo v0.0.0-20190816180239-bda0ff6ed73c h1:KFbqHhDeaHM7IfFtXHfUHMDaUStpM2YwBR+iJCIOsKk= github.com/containerd/fifo v0.0.0-20190816180239-bda0ff6ed73c/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= github.com/containerd/go-cni v0.0.0-20190813230227-49fbd9b210f3/go.mod h1:2wlRxCQdiBY+OcjNg5x8kI+5mEL1fGt25L4IzQHYJsM= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= github.com/containerd/go-runc v0.0.0-20190911050354-e029b79d8cda/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= github.com/containerd/ttrpc v0.0.0-20190828172938-92c8520ef9f8 h1:jYCTS/16RWXXtVHNHo1KWNegd1kKQ7lHd7BStj/0hKw= github.com/containerd/ttrpc v0.0.0-20190828172938-92c8520ef9f8/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= @@ -59,6 +70,7 @@ github.com/containernetworking/cni v0.7.1/go.mod h1:LGwApLUm2FpoOfxTDEeq8T9ipbpZ github.com/coreos/etcd v3.3.10+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE= github.com/coreos/go-etcd v2.0.0+incompatible/go.mod h1:Jez6KQU2B/sWsbdaef3ED8NzMklzPG4d5KIOhIy30Tk= github.com/coreos/go-semver v0.2.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= github.com/coreos/go-systemd v0.0.0-20190620071333-e64a0ec8b42a h1:W8b4lQ4tFF21aspRGoBuCNV6V2fFJBF+pm1J6OY8Lys= github.com/coreos/go-systemd v0.0.0-20190620071333-e64a0ec8b42a/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= @@ -92,6 +104,8 @@ github.com/docker/go-metrics v0.0.0-20170502235133-d466d4f6fd96 h1:HVQ/BC7Ze+bcV github.com/docker/go-metrics v0.0.0-20170502235133-d466d4f6fd96/go.mod h1:/u0gXw0Gay3ceNrsHubL3BtdOL2fHf93USgMTe0W5dI= github.com/docker/go-units v0.3.1 h1:QAFdsA6jLCnglbqE6mUsHuPcJlntY94DkxHf4deHKIU= github.com/docker/go-units v0.3.1/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= +github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw= +github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= github.com/docker/libnetwork v0.8.0-dev.2.0.20190604151032-3c26b4e7495e/go.mod h1:93m0aTqz6z+g32wla4l4WxTrdtvBRmVzYRkYvasA5Z8= github.com/docker/libtrust v0.0.0-20150526203908-9cbd2a1374f4 h1:k8TfKGeAcDQFFQOGCQMRN04N4a9YrPlRMMKnzAuvM9Q= github.com/docker/libtrust v0.0.0-20150526203908-9cbd2a1374f4/go.mod h1:cyGadeNEkKy96OOhEzfZl+yxihPEzKnqJwvfuSUqbZE= @@ -111,6 +125,7 @@ github.com/ghodss/yaml v1.0.0/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeME github.com/go-sql-driver/mysql v1.4.1 h1:g24URVg0OFbNUTx9qqY1IRZ9D9z3iPyi5zKhQZpNwpA= github.com/go-sql-driver/mysql v1.4.1/go.mod h1:zAC/RDZ24gD3HViQzih4MyKcchzm+sOG5ZlKdlhCg5w= github.com/godbus/dbus v0.0.0-20181101234600-2ff6f7ffd60f/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= github.com/godbus/dbus v4.1.0+incompatible h1:WqqLRTsQic3apZUK9qC5sGNfXthmPXzUZ7nQPrNITa4= github.com/godbus/dbus v4.1.0+incompatible/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw= github.com/gofrs/flock v0.7.0 h1:pGFUjl501gafK9HBt1VGL1KCOd/YhIooID+xgyJCf3g= @@ -128,6 +143,7 @@ github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfU github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= github.com/golang/protobuf v1.3.2 h1:6nsPYzhq5kReh6QImI3k5qWzO4PEbvbIW2cwSfR/6xs= github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= github.com/google/btree v1.0.0 h1:0udJVsspx3VBr5FwtLhQQtuAsVc79tTq0ocGIPAU6qo= @@ -155,12 +171,16 @@ github.com/grpc-ecosystem/grpc-opentracing v0.0.0-20180507213350-8e809c8a8645 h1 github.com/grpc-ecosystem/grpc-opentracing v0.0.0-20180507213350-8e809c8a8645/go.mod h1:6iZfnjpejD4L/4DwD7NryNaJyCQdzwWwH2MWhCA90Kw= github.com/hailocab/go-hostpool v0.0.0-20160125115350-e80d13ce29ed h1:5upAirOpQc1Q53c0bnx2ufif5kANL7bfZWcc6VJWJd8= github.com/hailocab/go-hostpool v0.0.0-20160125115350-e80d13ce29ed/go.mod h1:tMWxXQ9wFIaZeTI9F+hmhFiGpFmhOHzyShyFUhRm0H4= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= github.com/hashicorp/go-immutable-radix v1.0.0/go.mod h1:0y9vanUI8NX6FsYoO3zeMjhV/C5i9g4Q3DwcSNZ4P60= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= github.com/hashicorp/go-uuid v1.0.0/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro= github.com/hashicorp/go-version v1.1.0 h1:bPIoEKD27tNdebFGGxxYwcL4nepeY4j1QP23PFRGzg0= github.com/hashicorp/go-version v1.1.0/go.mod h1:fltr4n8CU8Ke44wwGCBoEymUuxUHl09ZGVZPK5anwXA= github.com/hashicorp/golang-lru v0.0.0-20160207214719-a0d98a5f2880/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= github.com/hashicorp/hcl v1.0.0 h1:0Anlzjpi4vEasTeNFn2mLJgTSwt0+6sfsiTG8qcWGx4= github.com/hashicorp/hcl v1.0.0/go.mod h1:E5yfLk+7swimpb2L/Alb/PJmXilQ/rhwaUYs4T20WEQ= github.com/hashicorp/uuid v0.0.0-20160311170451-ebb0a03e909c/go.mod h1:fHzc09UnyJyqyW+bFuq864eh+wC7dj65aXmXLRe5to0= @@ -215,16 +235,20 @@ github.com/morikuni/aec v0.0.0-20170113033406-39771216ff4c/go.mod h1:BbKIizmSmc5 github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= github.com/onsi/ginkgo v1.7.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= github.com/onsi/gomega v1.4.3/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ= github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/image-spec v1.0.1 h1:JMemWkRwHx4Zj+fVxWoMCFm/8sYGGrUVojFA6h/TRcI= github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v1.0.0-rc6/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runc v1.0.0-rc8.0.20190621203724-f4982d86f7fd h1:w9DJ/JL7fK4VjMoGo4e9gsq2xRhZThNI4PFuAwN8dJ0= github.com/opencontainers/runc v1.0.0-rc8.0.20190621203724-f4982d86f7fd/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runtime-spec v0.0.0-20180909173843-eba862dc2470/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= github.com/opencontainers/runtime-spec v1.0.1 h1:wY4pOY8fBdSIvs9+IDHC55thBuEulhzfSgKeC1yFvzQ= github.com/opencontainers/runtime-spec v1.0.1/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= github.com/opentracing-contrib/go-stdlib v0.0.0-20171029140428-b1a47cfbdd75/go.mod h1:PLldrQSroqzH70Xl+1DQcGnefIbqsKR7UDaiux3zV+w= github.com/opentracing/opentracing-go v0.0.0-20171003133519-1361b9cd60be h1:vn0ruyYif1hUWDS2aEUdh6JGUfgK8gOOLpz/iTjb6pQ= github.com/opentracing/opentracing-go v0.0.0-20171003133519-1361b9cd60be/go.mod h1:UkNAQd3GIcIGf0SeVgPpRdFStlNbqXla1AfSYxPUl2o= @@ -245,6 +269,8 @@ github.com/prometheus/common v0.0.0-20180518154759-7600349dcfe1 h1:osmNoEW2SCW3L github.com/prometheus/common v0.0.0-20180518154759-7600349dcfe1/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro= github.com/prometheus/procfs v0.0.3 h1:CTwfnzjQ+8dS6MhHHu4YswVAD99sL2wjPqP+VkURmKE= github.com/prometheus/procfs v0.0.3/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= github.com/rogpeppe/go-charset v0.0.0-20180617210344-2471d30d28b4/go.mod h1:qgYeAmZ5ZIpBWTGllZSQnw97Dj+woV0toclVaRGI8pc= github.com/serialx/hashring v0.0.0-20190422032157-8b2912629002 h1:ka9QPuQg2u4LGipiZGsgkg3rJCo4iIUCy75FddM0GRQ= github.com/serialx/hashring v0.0.0-20190422032157-8b2912629002/go.mod h1:/yeG0My1xr/u+HZrFQ1tOQQQQrOawfyMUH13ai5brBc= @@ -268,6 +294,7 @@ github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+ github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0Q= github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2 h1:b6uOv7YOFK0TYG7HtkIgExQo+2RdLuwRft63jn2HWj8= github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= github.com/theupdateframework/notary v0.6.1 h1:7wshjstgS9x9F5LuB1L5mBI2xNMObWqjz+cjWoom6l0= @@ -288,50 +315,76 @@ github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f h1:J9EGpcZtP github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0= github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= -github.com/xeipuuv/gojsonschema v0.0.0-20160323030313-93e72a773fad h1:LIwN+8bLzKvIuCiV5yT1nICcW/8yNfU5jVV1SHhcPco= -github.com/xeipuuv/gojsonschema v0.0.0-20160323030313-93e72a773fad/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f h1:mvXjJIHRZyhNuGassLTcXTwjiWq7NmjdavZsUnmFybQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= github.com/xlab/handysort v0.0.0-20150421192137-fb3537ed64a1 h1:j2hhcujLRHAg872RWAV5yaUrEjHEObwDv3aImCaNLek= github.com/xlab/handysort v0.0.0-20150421192137-fb3537ed64a1/go.mod h1:QcJo0QPSfTONNIgpN5RA8prR7fF8nkF6cTWTcNerRO8= github.com/xordataexchange/crypt v0.0.3-0.20170626215501-b2862e3d0a77/go.mod h1:aYKd//L2LvnjZzWKhF00oedf4jCCReLcmhLdhm1A27Q= go.etcd.io/bbolt v1.3.3 h1:MUGmc65QhB3pIlaQ5bB4LwqSj6GIonVJXpZiaKNyaKk= go.etcd.io/bbolt v1.3.3/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= golang.org/x/crypto v0.0.0-20190129210102-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2 h1:VklqNMn3ovrHsnt90PveolxSbWFaJdECFbxSq0Mqo2M= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190522155817-f3200d17e092 h1:4QSRKanuywn15aTZvI/mIDEgPQpswuFndXpOj3rKEco= golang.org/x/net v0.0.0-20190522155817-f3200d17e092/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks= golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be h1:vEDujvNQGv4jgYKudGeI/+DAX4Jffq6hpD55MmoEvKs= golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f h1:wMNYb4v58l5UBM7MYRLPG6ZhfOqbKu7X5eyFl8ZhKvA= golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20190423024810-112230192c58 h1:8gQV6CLnAEikrhgkHFbMAEhagSSnXWGV915qUMm9mrU= golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20181205085412-a5c9d58dba9a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190812073006-9eafafc0a87e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e h1:N7DeIrjYszNmSW409R3frPPwglRwMkXSBzwVbkOjLLA= golang.org/x/sys v0.0.0-20191120155948-bd437916bb0e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= golang.org/x/time v0.0.0-20161028155119-f51c12702a4d/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.0.0-20190308202827-9d24e82272b4 h1:SvFZT6jyqRaOeXpc5h/JSfZenJ2O330aBsf7JfSUXmQ= golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= google.golang.org/appengine v1.1.0 h1:igQkv0AAhEIvTEpD5LIpAfav2eeVO9HBTjvKHVJPRSs= google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0 h1:/wp5JvzpHIxhs/dumFmF7BXTf3Z+dd4uXta4kVyO508= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= google.golang.org/grpc v1.23.0 h1:AzbTB6ux+okLTzP8Ru1Xs41C303zdcfEht7MQnYJt5A= google.golang.org/grpc v1.23.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= gopkg.in/airbrake/gobrake.v2 v2.0.9/go.mod h1:/h5ZAUhDkGaJfjzjKLSjv6zCL6O0LLBxU4K+aSYdM/U= @@ -357,6 +410,7 @@ gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= gotest.tools v2.1.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= k8s.io/api v0.0.0-20180712090710-2d6f90ab1293 h1:hROmpFC7JMobXFXMmD7ZKZLhDKvr1IKfFJoYS/45G/8= k8s.io/api v0.0.0-20180712090710-2d6f90ab1293/go.mod h1:iuAfoD4hCxJ8Onx9kaTIt30j7jUFS00AXQi6QMi99vA= @@ -364,5 +418,6 @@ k8s.io/apimachinery v0.0.0-20180621070125-103fd098999d h1:MZjlsu9igBoVPZkXpIGoxI k8s.io/apimachinery v0.0.0-20180621070125-103fd098999d/go.mod h1:ccL7Eh7zubPUSh9A3USN90/OzHNSVN6zxzde07TDCL0= k8s.io/client-go v2.0.0-alpha.0.0.20180806134042-1f13a808da65+incompatible h1:Acx+j0h5biQofdqi4CveXrRuGy0ZKt2Jyewuun7bYGM= k8s.io/client-go v2.0.0-alpha.0.0.20180806134042-1f13a808da65+incompatible/go.mod h1:7vJpHMYJwNQCWgzmNV+VYUl1zCObLyodBc8nIyt8L5s= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= vbom.ml/util v0.0.0-20180919145318-efcd4e0f9787 h1:O69FD9pJA4WUZlEwYatBEEkRWKQ5cKodWpdKTrCS/iQ= vbom.ml/util v0.0.0-20180919145318-efcd4e0f9787/go.mod h1:so/NYdZXCz+E3ZpW0uAoCj6uzU2+8OWDFv/HxUSs7kI= diff --git a/vendor/github.com/Microsoft/go-winio/go.mod b/vendor/github.com/Microsoft/go-winio/go.mod index b3846826..50b9d6e2 100644 --- a/vendor/github.com/Microsoft/go-winio/go.mod +++ b/vendor/github.com/Microsoft/go-winio/go.mod @@ -5,5 +5,5 @@ go 1.12 require ( github.com/pkg/errors v0.8.1 github.com/sirupsen/logrus v1.4.1 - golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 ) diff --git a/vendor/github.com/Microsoft/go-winio/go.sum b/vendor/github.com/Microsoft/go-winio/go.sum index babb4a70..209aa8cf 100644 --- a/vendor/github.com/Microsoft/go-winio/go.sum +++ b/vendor/github.com/Microsoft/go-winio/go.sum @@ -14,3 +14,5 @@ github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXf golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b h1:ag/x1USPSsqHud38I9BAC88qdNLDHHtQ4mlgQIZPPNA= golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= diff --git a/vendor/github.com/Microsoft/hcsshim/Protobuild.toml b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml new file mode 100644 index 00000000..47d7650f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml @@ -0,0 +1,54 @@ +version = "unstable" +generator = "gogoctrd" +plugins = ["grpc", "fieldpath"] + +# Control protoc include paths. Below are usually some good defaults, but feel +# free to try it without them if it works for your project. +[includes] + # Include paths that will be added before all others. Typically, you want to + # treat the root of the project as an include, but this may not be necessary. + before = ["./protobuf"] + + # Paths that should be treated as include roots in relation to the vendor + # directory. These will be calculated with the vendor directory nearest the + # target package. + packages = ["github.com/gogo/protobuf"] + + # Paths that will be added untouched to the end of the includes. We use + # `/usr/local/include` to pickup the common install location of protobuf. + # This is the default. + after = ["/usr/local/include"] + +# This section maps protobuf imports to Go packages. These will become +# `-M` directives in the call to the go protobuf generator. +[packages] + "gogoproto/gogo.proto" = "github.com/gogo/protobuf/gogoproto" + "google/protobuf/any.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/empty.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/descriptor.proto" = "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + "google/protobuf/field_mask.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/timestamp.proto" = "github.com/gogo/protobuf/types" + "google/protobuf/duration.proto" = "github.com/gogo/protobuf/types" + "github/containerd/cgroups/stats/v1/metrics.proto" = "github.com/containerd/cgroups/stats/v1" + +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"] +plugins = ["ttrpc"] + +# Lock down runhcs config + +[[descriptors]] +prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options" +target = "cmd/containerd-shim-runhcs-v1/options/next.pb.txt" +ignore_files = [ + "google/protobuf/descriptor.proto", + "gogoproto/gogo.proto" +] + +[[descriptors]] +prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/stats" +target = "cmd/containerd-shim-runhcs-v1/stats/next.pb.txt" +ignore_files = [ + "google/protobuf/descriptor.proto", + "gogoproto/gogo.proto" +] \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/appveyor.yml b/vendor/github.com/Microsoft/hcsshim/appveyor.yml index a8ec5a59..661bc406 100644 --- a/vendor/github.com/Microsoft/hcsshim/appveyor.yml +++ b/vendor/github.com/Microsoft/hcsshim/appveyor.yml @@ -8,22 +8,34 @@ environment: GOPATH: c:\gopath PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH% -stack: go 1.11 +stack: go 1.13.4 build_script: - appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip - 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL - gometalinter.exe --config .gometalinter.json ./... - - go build ./cmd/wclayer + - go build ./cmd/containerd-shim-runhcs-v1 - go build ./cmd/runhcs - go build ./cmd/tar2ext4 + - go build ./cmd/wclayer + - go build ./internal/tools/grantvmgroupaccess + - go build ./internal/tools/uvmboot + - go build ./internal/tools/zapdir - go test -v ./... -tags admin + - go test -c ./test/containerd-shim-runhcs-v1/ -tags functional + - go test -c ./test/cri-containerd/ -tags functional - go test -c ./test/functional/ -tags functional - - go test -c ./test/runhcs/ -tags integration + - go test -c ./test/runhcs/ -tags functional artifacts: - - path: 'wclayer.exe' + - path: 'containerd-shim-runhcs-v1.exe' - path: 'runhcs.exe' - path: 'tar2ext4.exe' + - path: 'wclayer.exe' + - path: 'grantvmgroupaccess.exe' + - path: 'uvmboot.exe' + - path: 'zapdir.exe' + - path: 'containerd-shim-runhcs-v1.test.exe' + - path: 'cri-containerd.test.exe' - path: 'functional.test.exe' - path: 'runhcs.test.exe' \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go index e142c315..7205a62c 100644 --- a/vendor/github.com/Microsoft/hcsshim/container.go +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -1,8 +1,10 @@ package hcsshim import ( + "context" "fmt" "os" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -52,7 +54,10 @@ const ( type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse type container struct { - system *hcs.System + system *hcs.System + waitOnce sync.Once + waitErr error + waitCh chan struct{} } // createComputeSystemAdditionalJSON is read from the environment at initialisation @@ -71,61 +76,87 @@ func CreateContainer(id string, c *ContainerConfig) (Container, error) { return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) } - system, err := hcs.CreateComputeSystem(id, fullConfig) + system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // OpenContainer opens an existing container by ID. func OpenContainer(id string) (Container, error) { - system, err := hcs.OpenComputeSystem(id) + system, err := hcs.OpenComputeSystem(context.Background(), id) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // GetContainers gets a list of the containers on the system that match the query func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { - return hcs.GetComputeSystems(q) + return hcs.GetComputeSystems(context.Background(), q) } // Start synchronously starts the container. func (container *container) Start() error { - return convertSystemError(container.system.Start(), container) + return convertSystemError(container.system.Start(context.Background()), container) } // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. func (container *container) Shutdown() error { - return convertSystemError(container.system.Shutdown(), container) + err := container.system.Shutdown(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"} } // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. func (container *container) Terminate() error { - return convertSystemError(container.system.Terminate(), container) + err := container.system.Terminate(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"} } // Waits synchronously waits for the container to shutdown or terminate. func (container *container) Wait() error { - return convertSystemError(container.system.Wait(), container) + err := container.system.Wait() + if err == nil { + err = container.system.ExitError() + } + return convertSystemError(err, container) } // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It // returns false if timeout occurs. -func (container *container) WaitTimeout(t time.Duration) error { - return convertSystemError(container.system.WaitTimeout(t), container) +func (container *container) WaitTimeout(timeout time.Duration) error { + container.waitOnce.Do(func() { + container.waitCh = make(chan struct{}) + go func() { + container.waitErr = container.Wait() + close(container.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"} + case <-container.waitCh: + return container.waitErr + } } // Pause pauses the execution of a container. func (container *container) Pause() error { - return convertSystemError(container.system.Pause(), container) + return convertSystemError(container.system.Pause(context.Background()), container) } // Resume resumes the execution of a container. func (container *container) Resume() error { - return convertSystemError(container.system.Resume(), container) + return convertSystemError(container.system.Resume(context.Background()), container) } // HasPendingUpdates returns true if the container has updates pending to install @@ -135,7 +166,7 @@ func (container *container) HasPendingUpdates() (bool, error) { // Statistics returns statistics for the container. This is a legacy v1 call func (container *container) Statistics() (Statistics, error) { - properties, err := container.system.Properties(schema1.PropertyTypeStatistics) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics) if err != nil { return Statistics{}, convertSystemError(err, container) } @@ -145,7 +176,7 @@ func (container *container) Statistics() (Statistics, error) { // ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call func (container *container) ProcessList() ([]ProcessListItem, error) { - properties, err := container.system.Properties(schema1.PropertyTypeProcessList) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList) if err != nil { return nil, convertSystemError(err, container) } @@ -155,7 +186,7 @@ func (container *container) ProcessList() ([]ProcessListItem, error) { // This is a legacy v1 call func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { - properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk) if err != nil { return nil, convertSystemError(err, container) } @@ -165,20 +196,20 @@ func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskContr // CreateProcess launches a new process within the container. func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { - p, err := container.system.CreateProcess(c) + p, err := container.system.CreateProcess(context.Background(), c) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p.(*hcs.Process)}, nil } // OpenProcess gets an interface to an existing process within the container. func (container *container) OpenProcess(pid int) (Process, error) { - p, err := container.system.OpenProcess(pid) + p, err := container.system.OpenProcess(context.Background(), pid) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p}, nil } // Close cleans up any state associated with the container but does not terminate or wait for it. @@ -188,5 +219,5 @@ func (container *container) Close() error { // Modify the System func (container *container) Modify(config *ResourceModificationRequestResponse) error { - return convertSystemError(container.system.Modify(config), container) + return convertSystemError(container.system.Modify(context.Background(), config), container) } diff --git a/vendor/github.com/Microsoft/hcsshim/go.mod b/vendor/github.com/Microsoft/hcsshim/go.mod new file mode 100644 index 00000000..72d253da --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.mod @@ -0,0 +1,37 @@ +module github.com/Microsoft/hcsshim + +go 1.13 + +require ( + github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 + github.com/blang/semver v3.1.0+incompatible // indirect + github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f + github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 + github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 + github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect + github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect + github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 + github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de + github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd + github.com/gogo/protobuf v1.2.1 + github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce // indirect + github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 // indirect + github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 // indirect + github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f // indirect + github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 + github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 + github.com/pkg/errors v0.8.1 + github.com/prometheus/procfs v0.0.5 // indirect + github.com/sirupsen/logrus v1.4.1 + github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 // indirect + github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 + github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f // indirect + github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect + github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f // indirect + go.opencensus.io v0.22.0 + golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 + golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 + google.golang.org/grpc v1.20.1 + gotest.tools v2.2.0+incompatible // indirect + k8s.io/kubernetes v1.13.0 +) diff --git a/vendor/github.com/Microsoft/hcsshim/go.sum b/vendor/github.com/Microsoft/hcsshim/go.sum new file mode 100644 index 00000000..578b78e8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.sum @@ -0,0 +1,131 @@ +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 h1:ygIc8M6trr62pF5DucadTWGdEB4mEyvzi0e2nbcmcyA= +github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= +github.com/blang/semver v3.1.0+incompatible h1:7hqmJYuaEK3qwVjWubYiht3j93YI0WQBuysxHIfUriU= +github.com/blang/semver v3.1.0+incompatible/go.mod h1:kRBLl5iJ+tD4TcOOxsy/0fnwebNt5EWlYSAyrTnjyyk= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f h1:tSNMc+rJDfmYntojat8lljbt1mgKNpTxUZJsSzJ9Y1s= +github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f/go.mod h1:OApqhQ4XNSNC13gXIwDjhOQxjWa/NxkwZXJ1EvqT0ko= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 h1:uict5mhHFTzKLUCufdSLym7z/J0CbBJT59lYbP9wtbg= +github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 h1:rG1clvJbgsUcmb50J82YUJhUMopWNtZvyMZjb+4fqGw= +github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8= +github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 h1:PUD50EuOMkXVcpBIA/R95d56duJR9VxhwncsFbNnxW4= +github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 h1:esQOJREg8nw8aXj6uCN5dfW5cKUBiEJ/+nni1Q/D/sw= +github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de h1:dlfGmNcE3jDAecLqwKPMNX6nk2qh1c1Vg1/YTzpOOF4= +github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd h1:JNn81o/xG+8NEo3bC/vx9pbi/g2WI8mtP2/nXzu297Y= +github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e h1:Wf6HqHfScWJN9/ZjdUKyjop4mf3Qdd+1TvvltAvM3m8= +github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= +github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= +github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw= +github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e h1:BWhy2j3IXJhjCbC68FptL43tDKIq8FladmaTs3Xs7Z8= +github.com/godbus/dbus v0.0.0-20190422162347-ade71ed3457e/go.mod h1:bBOAhwG1umN6/6ZUMtDFBMQR8jRg9O75tm9K00oMsK4= +github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE= +github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce h1:prjrVgOk2Yg6w+PflHoszQNLTUh4kaByUcEWM/9uin4= +github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 h1:cAv7ZbSmyb1wjn6T4TIiyFCkpcfgpbcNNC3bM2srLaI= +github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874/go.mod h1:JMRHfdO9jKNzS/+BTlxCjKNQHg/jZAft8U7LloJvN7I= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q= +github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= +github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk= +github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 h1:QhPf3A2AZW3tTGvHPg0TA+CR3oHbVLlXUhlghqISp1I= +github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f h1:a969LJ4IQFwRHYqonHtUDMSh9i54WcKggeEkQ3fZMl4= +github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700 h1:eNUVfm/RFLIi1G7flU5/ZRTHvd4kcVuzfRnL6OFlzCI= +github.com/opencontainers/runtime-spec v0.1.2-0.20190507144316-5b71a03e2700/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 h1:H7DMc6FAjgwZZi8BRqjrAAHWoqEr5e5L6pS4V0ezet4= +github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39/go.mod h1:r3f7wjNzSs2extwzU3Y+6pKfobzPh+kKFJ3ofN+3nfs= +github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= +github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= +github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= +github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/prometheus/procfs v0.0.5 h1:3+auTFlqw+ZaQYJARz6ArODtkaIwtvBTx3N2NehQlL8= +github.com/prometheus/procfs v0.0.5/go.mod h1:4A/X28fw3Fc593LaREMrKMqOKvUAntwMDaekg4FpcdQ= +github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k= +github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= +github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w= +github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 h1:zLV6q4e8Jv9EHjNg/iHfzwDkCve6Ua5jCygptrtXHvI= +github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 h1:MCfT24H3f//U5+UCrZp1/riVO3B50BovxtDiNn0XKkk= +github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5/go.mod h1:70zkFmudgCuE/ngEzBv17Jvp/497gISqfk5gWijbERA= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f h1:J9EGpcZtP0E/raorCMxlFGSTBrsSlaDGf3jU/qvAE2c= +github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 h1:EzJWgHovont7NscjpAxXsDA8S8BMYve8Y5+7cuRE7R0= +github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415/go.mod h1:GwrjFmJcFw6At/Gs6z4yjiIwzuJ1/+UwLxMQDVQXShQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f h1:mvXjJIHRZyhNuGassLTcXTwjiWq7NmjdavZsUnmFybQ= +github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f/go.mod h1:5yf86TLmAcydyeJq5YvxkGPE2fm/u4myDekKRoLuqhs= +go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= +go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= +gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= +k8s.io/kubernetes v1.13.0 h1:qTfB+u5M92k2fCCCVP2iuhgwwSOv1EkAkvQY1tQODD8= +k8s.io/kubernetes v1.13.0/go.mod h1:ocZa8+6APFNC2tX1DZASIbocyYT5jHzqFVsY5aoB7Jk= diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go index eb013d2c..09b3860a 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -39,11 +39,21 @@ func HNSListEndpointRequest() ([]HNSEndpoint, error) { // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container func HotAttachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Add) } // HotDetachEndpoint makes a HCS Call to detach the endpoint from the container func HotDetachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if !isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Remove) } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go new file mode 100644 index 00000000..8193315f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go @@ -0,0 +1,83 @@ +package cow + +import ( + "context" + "io" + + "github.com/Microsoft/hcsshim/internal/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" +) + +// Process is the interface for an OS process running in a container or utility VM. +type Process interface { + // Close releases resources associated with the process and closes the + // writer and readers returned by Stdio. Depending on the implementation, + // this may also terminate the process. + Close() error + // CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever + // is appropriate to indicate that no more data is available. + CloseStdin(ctx context.Context) error + // Pid returns the process ID. + Pid() int + // Stdio returns the stdio streams for a process. These may be nil if a stream + // was not requested during CreateProcess. + Stdio() (_ io.Writer, _ io.Reader, _ io.Reader) + // ResizeConsole resizes the virtual terminal associated with the process. + ResizeConsole(ctx context.Context, width, height uint16) error + // Kill sends a SIGKILL or equivalent signal to the process and returns whether + // the signal was delivered. It does not wait for the process to terminate. + Kill(ctx context.Context) (bool, error) + // Signal sends a signal to the process and returns whether the signal was + // delivered. The input is OS specific (either + // guestrequest.SignalProcessOptionsWCOW or + // guestrequest.SignalProcessOptionsLCOW). It does not wait for the process + // to terminate. + Signal(ctx context.Context, options interface{}) (bool, error) + // Wait waits for the process to complete, or for a connection to the process to be + // terminated by some error condition (including calling Close). + Wait() error + // ExitCode returns the exit code of the process. Returns an error if the process is + // not running. + ExitCode() (int, error) +} + +// ProcessHost is the interface for creating processes. +type ProcessHost interface { + // CreateProcess creates a process. The configuration is host specific + // (either hcsschema.ProcessParameters or lcow.ProcessParameters). + CreateProcess(ctx context.Context, config interface{}) (Process, error) + // OS returns the host's operating system, "linux" or "windows". + OS() string + // IsOCI specifies whether this is an OCI-compliant process host. If true, + // then the configuration passed to CreateProcess should have an OCI process + // spec (or nil if this is the initial process in an OCI container). + // Otherwise, it should have the HCS-specific process parameters. + IsOCI() bool +} + +// Container is the interface for container objects, either running on the host or +// in a utility VM. +type Container interface { + ProcessHost + // Close releases the resources associated with the container. Depending on + // the implementation, this may also terminate the container. + Close() error + // ID returns the container ID. + ID() string + // Properties returns the requested container properties targeting a V1 schema container. + Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) + // PropertiesV2 returns the requested container properties targeting a V2 schema container. + PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) + // Start starts a container. + Start(ctx context.Context) error + // Shutdown sends a shutdown request to the container (but does not wait for + // the shutdown to complete). + Shutdown(ctx context.Context) error + // Terminate sends a terminate request to the container (but does not wait + // for the terminate to complete). + Terminate(ctx context.Context) error + // Wait waits for the container to terminate, or for the connection to the + // container to be terminated by some error condition (including calling + // Close). + Wait() error +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go deleted file mode 100644 index 5d3d0dfe..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go +++ /dev/null @@ -1,100 +0,0 @@ -package guestrequest - -import ( - "github.com/Microsoft/hcsshim/internal/schema2" -) - -// Arguably, many of these (at least CombinedLayers) should have been generated -// by swagger. -// -// This will also change package name due to an inbound breaking change. - -// This class is used by a modify request to add or remove a combined layers -// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath -// using the specified layers as the parent content. Ignores property ScratchPath -// since the container path is already the scratch path. For linux, the GCS unions -// the specified layers and ScratchPath together, placing the resulting union -// filesystem at ContainerRootPath. -type CombinedLayers struct { - ContainerRootPath string `json:"ContainerRootPath,omitempty"` - Layers []hcsschema.Layer `json:"Layers,omitempty"` - ScratchPath string `json:"ScratchPath,omitempty"` -} - -// Defines the schema for hosted settings passed to GCS and/or OpenGCS - -// SCSI. Scratch space for remote file-system commands, or R/W layer for containers -type LCOWMappedVirtualDisk struct { - MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM - Lun uint8 `json:"Lun,omitempty"` - Controller uint8 `json:"Controller,omitempty"` - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -type WCOWMappedVirtualDisk struct { - ContainerPath string `json:"ContainerPath,omitempty"` - Lun int32 `json:"Lun,omitempty"` -} - -type LCOWMappedDirectory struct { - MountPath string `json:"MountPath,omitempty"` - Port int32 `json:"Port,omitempty"` - ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported) - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -// Read-only layers over VPMem -type LCOWMappedVPMemDevice struct { - DeviceNumber uint32 `json:"DeviceNumber,omitempty"` - MountPath string `json:"MountPath,omitempty"` // /tmp/pN -} - -type LCOWNetworkAdapter struct { - NamespaceID string `json:",omitempty"` - ID string `json:",omitempty"` - MacAddress string `json:",omitempty"` - IPAddress string `json:",omitempty"` - PrefixLength uint8 `json:",omitempty"` - GatewayAddress string `json:",omitempty"` - DNSSuffix string `json:",omitempty"` - DNSServerList string `json:",omitempty"` - EnableLowMetric bool `json:",omitempty"` - EncapOverhead uint16 `json:",omitempty"` -} - -type ResourceType string - -const ( - // These are constants for v2 schema modify guest requests. - ResourceTypeMappedDirectory ResourceType = "MappedDirectory" - ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk" - ResourceTypeNetwork ResourceType = "Network" - ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace" - ResourceTypeCombinedLayers ResourceType = "CombinedLayers" - ResourceTypeVPMemDevice ResourceType = "VPMemDevice" -) - -// GuestRequest is for modify commands passed to the guest. -type GuestRequest struct { - RequestType string `json:"RequestType,omitempty"` - ResourceType ResourceType `json:"ResourceType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type NetworkModifyRequest struct { - AdapterId string `json:"AdapterId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type RS4NetworkModifyRequest struct { - AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -// SignalProcessOptions is the options passed to either WCOW or LCOW -// to signal a given process. -type SignalProcessOptions struct { - Signal int `json:,omitempty` -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go deleted file mode 100644 index e9e45c03..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go +++ /dev/null @@ -1,69 +0,0 @@ -package guid - -import ( - "crypto/rand" - "encoding/json" - "fmt" - "io" - "strconv" - "strings" -) - -var _ = (json.Marshaler)(&GUID{}) -var _ = (json.Unmarshaler)(&GUID{}) - -type GUID [16]byte - -func New() GUID { - g := GUID{} - _, err := io.ReadFull(rand.Reader, g[:]) - if err != nil { - panic(err) - } - return g -} - -func (g GUID) String() string { - return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) -} - -func FromString(s string) GUID { - if len(s) != 36 { - panic(fmt.Sprintf("invalid GUID length: %d", len(s))) - } - if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { - panic("invalid GUID format") - } - indexOrder := [16]int{ - 0, 2, 4, 6, - 9, 11, - 14, 16, - 19, 21, - 24, 26, 28, 30, 32, 34, - } - byteOrder := [16]int{ - 3, 2, 1, 0, - 5, 4, - 7, 6, - 8, 9, - 10, 11, 12, 13, 14, 15, - } - var g GUID - for i, x := range indexOrder { - b, err := strconv.ParseInt(s[x:x+2], 16, 16) - if err != nil { - panic(err) - } - g[byteOrder[i]] = byte(b) - } - return g -} - -func (g GUID) MarshalJSON() ([]byte, error) { - return json.Marshal(g.String()) -} - -func (g *GUID) UnmarshalJSON(data []byte) error { - *g = FromString(strings.Trim(string(data), "\"")) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go index f9a922a4..62ba8175 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -1,10 +1,13 @@ package hcs import ( + "fmt" "sync" "syscall" "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/vmcompute" "github.com/sirupsen/logrus" ) @@ -40,35 +43,83 @@ var ( ) type hcsNotification uint32 + +func (hn hcsNotification) String() string { + switch hn { + case hcsNotificationSystemExited: + return "SystemExited" + case hcsNotificationSystemCreateCompleted: + return "SystemCreateCompleted" + case hcsNotificationSystemStartCompleted: + return "SystemStartCompleted" + case hcsNotificationSystemPauseCompleted: + return "SystemPauseCompleted" + case hcsNotificationSystemResumeCompleted: + return "SystemResumeCompleted" + case hcsNotificationSystemCrashReport: + return "SystemCrashReport" + case hcsNotificationSystemSiloJobCreated: + return "SystemSiloJobCreated" + case hcsNotificationSystemSaveCompleted: + return "SystemSaveCompleted" + case hcsNotificationSystemRdpEnhancedModeStateChanged: + return "SystemRdpEnhancedModeStateChanged" + case hcsNotificationSystemShutdownFailed: + return "SystemShutdownFailed" + case hcsNotificationSystemGetPropertiesCompleted: + return "SystemGetPropertiesCompleted" + case hcsNotificationSystemModifyCompleted: + return "SystemModifyCompleted" + case hcsNotificationSystemCrashInitiated: + return "SystemCrashInitiated" + case hcsNotificationSystemGuestConnectionClosed: + return "SystemGuestConnectionClosed" + case hcsNotificationProcessExited: + return "ProcessExited" + case hcsNotificationInvalid: + return "Invalid" + case hcsNotificationServiceDisconnect: + return "ServiceDisconnect" + default: + return fmt.Sprintf("Unknown: %d", hn) + } +} + type notificationChannel chan error type notifcationWatcherContext struct { channels notificationChannels - handle hcsCallback + handle vmcompute.HcsCallback + + systemID string + processID int } type notificationChannels map[hcsNotification]notificationChannel -func newChannels() notificationChannels { +func newSystemChannels() notificationChannels { channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationSystemExited, + hcsNotificationSystemCreateCompleted, + hcsNotificationSystemStartCompleted, + hcsNotificationSystemPauseCompleted, + hcsNotificationSystemResumeCompleted, + } { + channels[notif] = make(notificationChannel, 1) + } + return channels +} - channels[hcsNotificationSystemExited] = make(notificationChannel, 1) - channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) - channels[hcsNotificationProcessExited] = make(notificationChannel, 1) - channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1) - channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1) - channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1) - channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1) - channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1) - channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1) - +func newProcessChannels() notificationChannels { + channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationProcessExited, + } { + channels[notif] = make(notificationChannel, 1) + } return channels } @@ -92,12 +143,17 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt return 0 } + log := logrus.WithFields(logrus.Fields{ + "notification-type": notificationType.String(), + "system-id": context.systemID, + }) + if context.processID != 0 { + log.Data[logfields.ProcessID] = context.processID + } + log.Debug("HCS notification") + if channel, ok := context.channels[notificationType]; ok { channel <- result - } else { - logrus.WithFields(logrus.Fields{ - "notification-type": notificationType, - }).Warn("Received a callback of an unsupported type") } return 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go index 079b5653..9a4705a4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -1,14 +1,14 @@ package hcs import ( + "context" "encoding/json" "errors" "fmt" + "net" "syscall" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) var ( @@ -117,17 +117,11 @@ func (ev *ErrorEvent) String() string { return evs } -func processHcsResult(resultp *uint16) []ErrorEvent { - if resultp != nil { - resultj := interop.ConvertAndFreeCoTaskMemString(resultp) - logrus.WithField(logfields.JSON, resultj). - Debug("HCS Result") +func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent { + if resultJSON != "" { result := &hcsResult{} - if err := json.Unmarshal([]byte(resultj), result); err != nil { - logrus.WithFields(logrus.Fields{ - logfields.JSON: resultj, - logrus.ErrorKey: err, - }).Warning("Could not unmarshal HCS result") + if err := json.Unmarshal([]byte(resultJSON), result); err != nil { + log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result") return nil } return result.ErrorEvents @@ -141,6 +135,8 @@ type HcsError struct { Events []ErrorEvent } +var _ net.Error = &HcsError{} + func (e *HcsError) Error() string { s := e.Op + ": " + e.Err.Error() for _, ev := range e.Events { @@ -149,6 +145,16 @@ func (e *HcsError) Error() string { return s } +func (e *HcsError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *HcsError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + // ProcessError is an error encountered in HCS during an operation on a Process object type ProcessError struct { SystemID string @@ -158,6 +164,8 @@ type ProcessError struct { Events []ErrorEvent } +var _ net.Error = &ProcessError{} + // SystemError is an error encountered in HCS during an operation on a Container object type SystemError struct { ID string @@ -167,6 +175,8 @@ type SystemError struct { Events []ErrorEvent } +var _ net.Error = &SystemError{} + func (e *SystemError) Error() string { s := e.Op + " " + e.ID + ": " + e.Err.Error() for _, ev := range e.Events { @@ -178,6 +188,16 @@ func (e *SystemError) Error() string { return s } +func (e *SystemError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *SystemError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*SystemError); ok { @@ -200,6 +220,16 @@ func (e *ProcessError) Error() string { return s } +func (e *ProcessError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *ProcessError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*ProcessError); ok { @@ -242,6 +272,9 @@ func IsPending(err error) bool { // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { + if err, ok := err.(net.Error); ok && err.Timeout() { + return true + } err = getInnerError(err) return err == ErrTimeout } @@ -272,6 +305,13 @@ func IsNotSupported(err error) bool { err == ErrVmcomputeUnknownMessage } +// IsOperationInvalidState returns true when err is caused by +// `ErrVmcomputeOperationInvalidState`. +func IsOperationInvalidState(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationInvalidState +} + func getInnerError(err error) error { switch pe := err.(type) { case nil: @@ -285,3 +325,12 @@ func getInnerError(err error) error { } return err } + +func getOperationLogResult(err error) (string, error) { + switch err { + case nil: + return "Success", nil + default: + return "Error", err + } +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go deleted file mode 100644 index b0d49cbc..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go +++ /dev/null @@ -1,48 +0,0 @@ -// Shim for the Host Compute Service (HCS) to manage Windows Server -// containers and Hyper-V containers. - -package hcs - -import ( - "syscall" -) - -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go - -//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? -//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? -//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? -//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? -//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? -//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? -//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? -//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? -//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? -//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? -//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? -//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? -//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? - -//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? -//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? -//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? -//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? -//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? -//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? -//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? -//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? -//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? - -type hcsSystem syscall.Handle -type hcsProcess syscall.Handle -type hcsCallback syscall.Handle - -type hcsProcessInformation struct { - ProcessId uint32 - Reserved uint32 - StdInput syscall.Handle - StdOutput syscall.Handle - StdError syscall.Handle -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go deleted file mode 100644 index 6d03b17a..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go +++ /dev/null @@ -1,20 +0,0 @@ -package hcs - -import "github.com/sirupsen/logrus" - -func logOperationBegin(ctx logrus.Fields, msg string) { - logrus.WithFields(ctx).Debug(msg) -} - -func logOperationEnd(ctx logrus.Fields, msg string, err error) { - // Copy the log and fields first. - log := logrus.WithFields(ctx) - if err == nil { - log.Debug(msg) - } else { - // Edit only the copied field data to avoid race conditions on the - // write. - log.Data[logrus.ErrorKey] = err - log.Error(msg) - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go index 41e20bbf..2ad978f2 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -1,48 +1,47 @@ package hcs import ( + "context" "encoding/json" "io" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/guestrequest" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // ContainerError is an error encountered in HCS type Process struct { handleLock sync.RWMutex - handle hcsProcess + handle vmcompute.HcsProcess processID int system *System - cachedPipes *cachedPipes + hasCachedStdio bool + stdioLock sync.Mutex + stdin io.WriteCloser + stdout io.ReadCloser + stderr io.ReadCloser callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + exitCode int + waitError error } -func newProcess(process hcsProcess, processID int, computeSystem *System) *Process { +func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process { return &Process{ handle: process, processID: processID, system: computeSystem, - logctx: logrus.Fields{ - logfields.ContainerID: computeSystem.ID(), - logfields.ProcessID: processID, - }, + waitBlock: make(chan struct{}), } } -type cachedPipes struct { - stdIn syscall.Handle - stdOut syscall.Handle - stdErr syscall.Handle -} - type processModifyRequest struct { Operation string ConsoleSize *consoleSize `json:",omitempty"` @@ -58,7 +57,7 @@ type closeHandle struct { Handle string } -type ProcessStatus struct { +type processStatus struct { ProcessID uint32 Exited bool ExitCode uint32 @@ -86,120 +85,153 @@ func (process *Process) SystemID() string { return process.system.ID() } -func (process *Process) logOperationBegin(operation string) { - logOperationBegin( - process.logctx, - operation+" - Begin Operation") -} - -func (process *Process) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" +func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) { + switch err { + case nil: + return true, nil + case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound: + select { + case <-process.waitBlock: + // The process exit notification has already arrived. + default: + // The process should be gone, but we have not received the notification. + // After a second, force unblock the process wait to work around a possible + // deadlock in the HCS. + go func() { + time.Sleep(time.Second) + process.closedWaitOnce.Do(func() { + log.G(ctx).WithError(err).Warn("force unblocking process waits") + process.exitCode = -1 + process.waitError = err + close(process.waitBlock) + }) + }() + } + return false, nil + default: + return false, err } - - logOperationEnd( - process.logctx, - operation+" - End Operation - "+result, - err) } // Signal signals the process with `options`. -func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) { +// +// For LCOW `guestrequest.SignalProcessOptionsLCOW`. +// +// For WCOW `guestrequest.SignalProcessOptionsWCOW`. +func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Signal" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } optionsb, err := json.Marshal(options) if err != nil { - return err + return false, err } - optionsStr := string(optionsb) - - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsSignalProcess(process.handle, optionsStr, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb)) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } // Kill signals the process to terminate but does not wait for it to finish terminating. -func (process *Process) Kill() (err error) { +func (process *Process) Kill(ctx context.Context) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Kill" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsTerminateProcess(process.handle, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } -// Wait waits for the process to exit. -func (process *Process) Wait() (err error) { - operation := "hcsshim::Process::Wait" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() +// waitBackground waits for the process exit notification. Once received sets +// `process.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `process.handle` but `Wait` is safe to +// call multiple times. +func (process *Process) waitBackground() { + operation := "hcsshim::Process::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + var ( + err error + exitCode = -1 + ) - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) + err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil) if err != nil { - return makeProcessError(process, operation, err, nil) + err = makeProcessError(process, operation, err, nil) + log.G(ctx).WithError(err).Error("failed wait") + } else { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + // Make sure we didnt race with Close() here + if process.handle != 0 { + propertiesJSON, resultJSON, err := vmcompute.HcsGetProcessProperties(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + err = makeProcessError(process, operation, err, events) + } else { + properties := &processStatus{} + err = json.Unmarshal([]byte(propertiesJSON), properties) + if err != nil { + err = makeProcessError(process, operation, err, nil) + } else { + if properties.LastWaitResult != 0 { + log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result") + } else { + exitCode = int(properties.ExitCode) + } + } + } + } } + log.G(ctx).WithField("exitCode", exitCode).Debug("process exited") - return nil + process.closedWaitOnce.Do(func() { + process.exitCode = exitCode + process.waitError = err + close(process.waitBlock) + }) + oc.SetSpanStatus(span, err) } -// WaitTimeout waits for the process to exit or the duration to elapse. It returns -// false if timeout occurs. -func (process *Process) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcssshim::Process::WaitTimeout" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) - if err != nil { - return makeProcessError(process, operation, err, nil) - } - - return nil +// Wait waits for the process to exit. If the process has already exited returns +// the pervious error (if any). +func (process *Process) Wait() error { + <-process.waitBlock + return process.waitError } // ResizeConsole resizes the console of the process. -func (process *Process) ResizeConsole(width, height uint16) (err error) { +func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::ResizeConsole" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -218,11 +250,8 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } @@ -230,104 +259,55 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return nil } -func (process *Process) Properties() (_ *ProcessStatus, err error) { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - - operation := "hcsshim::Process::Properties" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - if process.handle == 0 { - return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) - } - - var ( - resultp *uint16 - propertiesp *uint16 - ) - syscallWatcher(process.logctx, func() { - err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return nil, makeProcessError(process, operation, err, events) - } - - if propertiesp == nil { - return nil, ErrUnexpectedValue - } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) - - properties := &ProcessStatus{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeProcessError(process, operation, err, nil) - } - - return properties, nil -} - // ExitCode returns the exit code of the process. The process must have // already terminated. -func (process *Process) ExitCode() (_ int, err error) { - operation := "hcsshim::Process::ExitCode" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - properties, err := process.Properties() - if err != nil { - return 0, makeProcessError(process, operation, err, nil) - } - - if properties.Exited == false { - return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil) - } - - if properties.LastWaitResult != 0 { - return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil) +func (process *Process) ExitCode() (int, error) { + select { + case <-process.waitBlock: + if process.waitError != nil { + return -1, process.waitError + } + return process.exitCode, nil + default: + return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil) } - - return int(properties.ExitCode), nil } -// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing -// these pipes does not close the underlying pipes; it should be possible to -// call this multiple times to get multiple interfaces. -func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { +// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes. Once returned, these pipes +// are the responsibility of the caller to close. +func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { + operation := "hcsshim::Process::StdioLegacy" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.RLock() defer process.handleLock.RUnlock() - operation := "hcsshim::Process::Stdio" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - if process.handle == 0 { return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var stdIn, stdOut, stdErr syscall.Handle - - if process.cachedPipes == nil { - var ( - processInfo hcsProcessInformation - resultp *uint16 - ) - err = hcsGetProcessInfo(process.handle, &processInfo, &resultp) - events := processHcsResult(resultp) - if err != nil { - return nil, nil, nil, makeProcessError(process, operation, err, events) - } - - stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError - } else { - // Use cached pipes - stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr + process.stdioLock.Lock() + defer process.stdioLock.Unlock() + if process.hasCachedStdio { + stdin, stdout, stderr := process.stdin, process.stdout, process.stderr + process.stdin, process.stdout, process.stderr = nil, nil, nil + process.hasCachedStdio = false + return stdin, stdout, stderr, nil + } - // Invalidate the cache - process.cachedPipes = nil + processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, events) } - pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) if err != nil { return nil, nil, nil, makeProcessError(process, operation, err, nil) } @@ -335,15 +315,21 @@ func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadClo return pipes[0], pipes[1], pipes[2], nil } +// Stdio returns the stdin, stdout, and stderr pipes, respectively. +// To close them, close the process handle. +func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { + process.stdioLock.Lock() + defer process.stdioLock.Unlock() + return process.stdin, process.stdout, process.stderr +} + // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. -func (process *Process) CloseStdin() (err error) { +func (process *Process) CloseStdin(ctx context.Context) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::CloseStdin" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -361,96 +347,125 @@ func (process *Process) CloseStdin() (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } + process.stdioLock.Lock() + if process.stdin != nil { + process.stdin.Close() + process.stdin = nil + } + process.stdioLock.Unlock() + return nil } // Close cleans up any state associated with the process but does not kill // or wait on it. func (process *Process) Close() (err error) { + operation := "hcsshim::Process::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.Lock() defer process.handleLock.Unlock() - operation := "hcsshim::Process::Close" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - // Don't double free this if process.handle == 0 { return nil } - if err = process.unregisterCallback(); err != nil { + process.stdioLock.Lock() + if process.stdin != nil { + process.stdin.Close() + process.stdin = nil + } + if process.stdout != nil { + process.stdout.Close() + process.stdout = nil + } + if process.stderr != nil { + process.stderr.Close() + process.stderr = nil + } + process.stdioLock.Unlock() + + if err = process.unregisterCallback(ctx); err != nil { return makeProcessError(process, operation, err, nil) } - if err = hcsCloseProcess(process.handle); err != nil { + if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil { return makeProcessError(process, operation, err, nil) } process.handle = 0 + process.closedWaitOnce.Do(func() { + process.exitCode = -1 + process.waitError = ErrAlreadyClosed + close(process.waitBlock) + }) return nil } -func (process *Process) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (process *Process) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newProcessChannels(), + systemID: process.SystemID(), + processID: process.processID, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle process.callbackNumber = callbackNumber return nil } -func (process *Process) unregisterCallback() error { +func (process *Process) unregisterCallback(ctx context.Context) error { callbackNumber := process.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil } - // hcsUnregisterProcessCallback has its own syncronization - // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterProcessCallback(handle) + // vmcompute.HcsUnregisterProcessCallback has its own synchronization to + // wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := vmcompute.HcsUnregisterProcessCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go index 20b24252..6300a797 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -1,18 +1,24 @@ package hcs import ( + "context" "encoding/json" + "errors" "os" "strconv" + "strings" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/cow" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/schema1" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // currentContainerStarts is used to limit the number of concurrent container @@ -38,49 +44,37 @@ func init() { type System struct { handleLock sync.RWMutex - handle hcsSystem + handle vmcompute.HcsSystem id string callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + waitError error + exitError error + + os, typ string } func newSystem(id string) *System { return &System{ - id: id, - logctx: logrus.Fields{ - logfields.ContainerID: id, - }, + id: id, + waitBlock: make(chan struct{}), } } -func (computeSystem *System) logOperationBegin(operation string) { - logOperationBegin( - computeSystem.logctx, - operation+" - Begin Operation") -} - -func (computeSystem *System) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - computeSystem.logctx, - operation+" - End Operation - "+result, - err) -} - // CreateComputeSystem creates a new compute system with the given configuration but does not start it. -func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) { +func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) { operation := "hcsshim::CreateComputeSystem" + // hcsCreateComputeSystemContext is an async operation. Start the outer span + // here to measure the full create time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", id)) + computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() hcsDocumentB, err := json.Marshal(hcsDocumentInterface) if err != nil { @@ -89,126 +83,114 @@ func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System hcsDocument := string(hcsDocumentB) - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, hcsDocument). - Debug("HCS ComputeSystem Document") - var ( - resultp *uint16 identity syscall.Handle + resultJSON string createError error ) - syscallWatcher(computeSystem.logctx, func() { - createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp) - }) - + computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity) if createError == nil || IsPending(createError) { - if err = computeSystem.registerCallback(); err != nil { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) return nil, makeSystemError(computeSystem, operation, "", err, nil) } } - events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) if err != nil { if err == ErrTimeout { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) } return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events) } - + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } return computeSystem, nil } // OpenComputeSystem opens an existing compute system by ID. -func OpenComputeSystem(id string) (_ *System, err error) { +func OpenComputeSystem(ctx context.Context, id string) (*System, error) { operation := "hcsshim::OpenComputeSystem" computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) + handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, events) + } + computeSystem.handle = handle defer func() { - if IsNotExist(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) + if err != nil { + computeSystem.Close() } }() + if err = computeSystem.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + go computeSystem.waitBackground() + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } + return computeSystem, nil +} - var ( - handle hcsSystem - resultp *uint16 - ) - err = hcsOpenComputeSystem(id, &handle, &resultp) - events := processHcsResult(resultp) +func (computeSystem *System) getCachedProperties(ctx context.Context) error { + props, err := computeSystem.Properties(ctx) if err != nil { - return nil, makeSystemError(computeSystem, operation, "", err, events) + return err } - - computeSystem.handle = handle - - if err = computeSystem.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, operation, "", err, nil) + computeSystem.typ = strings.ToLower(props.SystemType) + computeSystem.os = strings.ToLower(props.RuntimeOSType) + if computeSystem.os == "" && computeSystem.typ == "container" { + // Pre-RS5 HCS did not return the OS, but it only supported containers + // that ran Windows. + computeSystem.os = "windows" } + return nil +} - return computeSystem, nil +// OS returns the operating system of the compute system, "linux" or "windows". +func (computeSystem *System) OS() string { + return computeSystem.os +} + +// IsOCI returns whether processes in the compute system should be created via +// OCI. +func (computeSystem *System) IsOCI() bool { + return computeSystem.os == "linux" && computeSystem.typ == "container" } // GetComputeSystems gets a list of the compute systems on the system that match the query -func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) { +func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) { operation := "hcsshim::GetComputeSystems" - fields := logrus.Fields{} - logOperationBegin( - fields, - operation+" - Begin Operation") - - defer func() { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - fields, - operation+" - End Operation - "+result, - err) - }() queryb, err := json.Marshal(q) if err != nil { return nil, err } - query := string(queryb) - - logrus.WithFields(fields). - WithField(logfields.JSON, query). - Debug("HCS ComputeSystem Query") - - var ( - resultp *uint16 - computeSystemsp *uint16 - ) - - syscallWatcher(fields, func() { - err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) - }) - events := processHcsResult(resultp) + computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return nil, &HcsError{Op: operation, Err: err, Events: events} } - if computeSystemsp == nil { + if computeSystemsJSON == "" { return nil, ErrUnexpectedValue } - computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp) computeSystems := []schema1.ContainerProperties{} - if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil { return nil, err } @@ -216,16 +198,21 @@ func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerPrope } // Start synchronously starts the computeSystem. -func (computeSystem *System) Start() (err error) { +func (computeSystem *System) Start(ctx context.Context) (err error) { + operation := "hcsshim::System::Start" + + // hcsStartComputeSystemContext is an async operation. Start the outer span + // here to measure the full start time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Start" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } // This is a very simple backoff-retry loop to limit the number @@ -254,13 +241,10 @@ func (computeSystem *System) Start() (err error) { }() } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsStartComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) if err != nil { - return makeSystemError(computeSystem, "Start", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil @@ -271,360 +255,357 @@ func (computeSystem *System) ID() string { return computeSystem.id } -// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Shutdown() (err error) { +// Shutdown requests a compute system shutdown. +func (computeSystem *System) Shutdown(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Shutdown" - computeSystem.logOperationBegin(operation) - defer func() { - if IsAlreadyStopped(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Shutdown" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return makeSystemError(computeSystem, "Shutdown", "", err, events) + resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } -// Terminate requests a compute system terminate, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Terminate() (err error) { +// Terminate requests a compute system terminate. +func (computeSystem *System) Terminate(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Terminate" - computeSystem.logOperationBegin(operation) - defer func() { - if IsPending(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Terminate" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil && err != ErrVmcomputeAlreadyStopped { - return makeSystemError(computeSystem, "Terminate", "", err, events) + resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } -// Wait synchronously waits for the compute system to shutdown or terminate. -func (computeSystem *System) Wait() (err error) { - operation := "hcsshim::ComputeSystem::Wait" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil { - return makeSystemError(computeSystem, "Wait", "", err, nil) - } - - return nil +// waitBackground waits for the compute system exit notification. Once received +// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls. +// +// This MUST be called exactly once per `computeSystem.handle` but `Wait` is +// safe to call multiple times. +func (computeSystem *System) waitBackground() { + operation := "hcsshim::System::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil) + switch err { + case nil: + log.G(ctx).Debug("system exited") + case ErrVmcomputeUnexpectedExit: + log.G(ctx).Debug("unexpected system exit") + computeSystem.exitError = makeSystemError(computeSystem, operation, "", err, nil) + err = nil + default: + err = makeSystemError(computeSystem, operation, "", err, nil) + } + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = err + close(computeSystem.waitBlock) + }) + oc.SetSpanStatus(span, err) } -// WaitExpectedError synchronously waits for the compute system to shutdown or -// terminate, and ignores the passed error if it occurs. -func (computeSystem *System) WaitExpectedError(expected error) (err error) { - operation := "hcsshim::ComputeSystem::WaitExpectedError" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() +// Wait synchronously waits for the compute system to shutdown or terminate. If +// the compute system has already exited returns the previous error (if any). +func (computeSystem *System) Wait() error { + <-computeSystem.waitBlock + return computeSystem.waitError +} - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil && getInnerError(err) != expected { - return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil) +// ExitError returns an error describing the reason the compute system terminated. +func (computeSystem *System) ExitError() error { + select { + case <-computeSystem.waitBlock: + if computeSystem.waitError != nil { + return computeSystem.waitError + } + return computeSystem.exitError + default: + return errors.New("container not exited") } - - return nil } -// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse. -// If the timeout expires, IsTimeout(err) == true -func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcsshim::ComputeSystem::WaitTimeout" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() +// Properties returns the requested container properties targeting a V1 schema container. +func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + operation := "hcsshim::System::Properties" - err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout) + queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types}) if err != nil { - return makeSystemError(computeSystem, "WaitTimeout", "", err, nil) + return nil, makeSystemError(computeSystem, operation, "", err, nil) } - return nil + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, events) + } + + if propertiesJSON == "" { + return nil, ErrUnexpectedValue + } + properties := &schema1.ContainerProperties{} + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + + return properties, nil } -func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) { +// PropertiesV2 returns the requested container properties targeting a V2 schema container. +func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Properties" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::PropertiesV2" - queryj, err := json.Marshal(schema1.PropertyQuery{types}) + queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types}) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + return nil, makeSystemError(computeSystem, operation, "", err, nil) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, queryj). - Debug("HCS ComputeSystem Properties Query") - - var resultp, propertiesp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp) - }) - events := processHcsResult(resultp) + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } - if propertiesp == nil { + if propertiesJSON == "" { return nil, ErrUnexpectedValue } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) - properties := &schema1.ContainerProperties{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + properties := &hcsschema.Properties{} + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } return properties, nil } // Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Pause() (err error) { +func (computeSystem *System) Pause(ctx context.Context) (err error) { + operation := "hcsshim::System::Pause" + + // hcsPauseComputeSystemContext is an async peration. Start the outer span + // here to measure the full pause time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Pause" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) if err != nil { - return makeSystemError(computeSystem, "Pause", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } // Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Resume() (err error) { +func (computeSystem *System) Resume(ctx context.Context) (err error) { + operation := "hcsshim::System::Resume" + + // hcsResumeComputeSystemContext is an async operation. Start the outer span + // here to measure the full restore time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Resume" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) if err != nil { - return makeSystemError(computeSystem, "Resume", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } -// CreateProcess launches a new process within the computeSystem. -func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) { +func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::CreateProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processInfo hcsProcessInformation - processHandle hcsProcess - resultp *uint16 - ) - if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } configurationb, err := json.Marshal(c) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", err, nil) } configuration := string(configurationb) + processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, makeSystemError(computeSystem, operation, configuration, err, events) + } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, configuration). - Debug("HCS ComputeSystem Process Document") + log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid") + return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil +} - syscallWatcher(computeSystem.logctx, func() { - err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp) - }) - events := processHcsResult(resultp) +// CreateProcess launches a new process within the computeSystem. +func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) { + operation := "hcsshim::System::CreateProcess" + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events) + return nil, err } + defer func() { + if err != nil { + process.Close() + } + }() - logrus.WithFields(computeSystem.logctx). - WithField(logfields.ProcessID, processInfo.ProcessId). - Debug("HCS ComputeSystem CreateProcess PID") - - process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem) - process.cachedPipes = &cachedPipes{ - stdIn: processInfo.StdInput, - stdOut: processInfo.StdOutput, - stdErr: processInfo.StdError, + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + process.stdin = pipes[0] + process.stdout = pipes[1] + process.stderr = pipes[2] + process.hasCachedStdio = true - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + go process.waitBackground() return process, nil } // OpenProcess gets an interface to an existing process within the computeSystem. -func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) { +func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - // Add PID for the context of this operation - computeSystem.logctx[logfields.ProcessID] = pid - defer delete(computeSystem.logctx, logfields.ProcessID) - - operation := "hcsshim::ComputeSystem::OpenProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processHandle hcsProcess - resultp *uint16 - ) + operation := "hcsshim::System::OpenProcess" if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil) + return nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } process := newProcess(processHandle, pid, computeSystem) - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } + go process.waitBackground() return process, nil } // Close cleans up any state associated with the compute system but does not terminate or wait for it. func (computeSystem *System) Close() (err error) { + operation := "hcsshim::System::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.Lock() defer computeSystem.handleLock.Unlock() - operation := "hcsshim::ComputeSystem::Close" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - // Don't double free this if computeSystem.handle == 0 { return nil } - if err = computeSystem.unregisterCallback(); err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + if err = computeSystem.unregisterCallback(ctx); err != nil { + return makeSystemError(computeSystem, operation, "", err, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsCloseComputeSystem(computeSystem.handle) - }) + err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle) if err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + return makeSystemError(computeSystem, operation, "", err, nil) } computeSystem.handle = 0 + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = ErrAlreadyClosed + close(computeSystem.waitBlock) + }) return nil } -func (computeSystem *System) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (computeSystem *System) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newSystemChannels(), + systemID: computeSystem.id, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle computeSystem.callbackNumber = callbackNumber return nil } -func (computeSystem *System) unregisterCallback() error { +func (computeSystem *System) unregisterCallback(ctx context.Context) error { callbackNumber := computeSystem.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil @@ -632,15 +613,15 @@ func (computeSystem *System) unregisterCallback() error { // hcsUnregisterComputeSystemCallback has its own syncronization // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterComputeSystemCallback(handle) + err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() - callbackMap[callbackNumber] = nil + delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 @@ -649,36 +630,26 @@ func (computeSystem *System) unregisterCallback() error { } // Modify the System by sending a request to HCS -func (computeSystem *System) Modify(config interface{}) (err error) { +func (computeSystem *System) Modify(ctx context.Context, config interface{}) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Modify" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Modify" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - requestJSON, err := json.Marshal(config) + requestBytes, err := json.Marshal(config) if err != nil { return err } - requestString := string(requestJSON) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, requestString). - Debug("HCS ComputeSystem Modify Document") - - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp) - }) - events := processHcsResult(resultp) + requestJSON := string(requestBytes) + resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON) + events := processHcsResult(ctx, resultJSON) if err != nil { - return makeSystemError(computeSystem, "Modify", requestString, err, events) + return makeSystemError(computeSystem, operation, requestJSON, err, events) } return nil diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go index 91e212c5..f07f532c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -1,28 +1,34 @@ package hcs import ( + "context" "time" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) -func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { - events := processHcsResult(resultp) +func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { + events := processHcsResult(ctx, resultJSON) if IsPending(err) { - return nil, waitForNotification(callbackNumber, expectedNotification, timeout) + return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout) } return events, err } -func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { +func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { callbackMapLock.RLock() + if _, ok := callbackMap[callbackNumber]; !ok { + callbackMapLock.RUnlock() + log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap") + return ErrHandleClose + } channels := callbackMap[callbackNumber].channels callbackMapLock.RUnlock() expectedChannel := channels[expectedNotification] if expectedChannel == nil { - logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification") return ErrInvalidNotificationType } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go deleted file mode 100644 index f85ed318..00000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go +++ /dev/null @@ -1,41 +0,0 @@ -package hcs - -import ( - "context" - - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" -) - -// syscallWatcher is used as a very simple goroutine around calls into -// the platform. In some cases, we have seen HCS APIs not returning due to -// various bugs, and the goroutine making the syscall ends up not returning, -// prior to its async callback. By spinning up a syscallWatcher, it allows -// us to at least log a warning if a syscall doesn't complete in a reasonable -// amount of time. -// -// Usage is: -// -// syscallWatcher(logContext, func() { -// err = (args...) -// }) -// - -func syscallWatcher(logContext logrus.Fields, syscallLambda func()) { - ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher) - defer cancel() - go watchFunc(ctx, logContext) - syscallLambda() -} - -func watchFunc(ctx context.Context, logContext logrus.Fields) { - select { - case <-ctx.Done(): - if ctx.Err() != context.Canceled { - logrus.WithFields(logContext). - WithField(logfields.Timeout, timeout.SyscallWatcher). - Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") - } - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go index 59ec7004..6a1c41e1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -3,6 +3,7 @@ package hns import ( "encoding/json" "net" + "strings" "github.com/sirupsen/logrus" ) @@ -94,6 +95,27 @@ func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { return nil, EndpointNotFoundError{EndpointName: endpointName} } +type endpointAttachInfo struct { + SharedContainers json.RawMessage `json:",omitempty"` +} + +func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) { + attachInfo := endpointAttachInfo{} + err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo) + + // Return false allows us to just return the err + if err != nil { + return false, err + } + + if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) { + return true, nil + } + + return false, nil + +} + // Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { operation := "Create" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go index 969d1b26..2df4a57f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -9,23 +9,30 @@ import ( "github.com/sirupsen/logrus" ) -func hnsCall(method, path, request string, returnResponse interface{}) error { +func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) { var responseBuffer *uint16 logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) err := _hnsCall(method, path, request, &responseBuffer) if err != nil { - return hcserror.New(err, "hnsCall ", "") + return nil, hcserror.New(err, "hnsCall ", "") } response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) hnsresponse := &hnsResponse{} if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { - return err + return nil, err } + return hnsresponse, nil +} +func hnsCall(method, path, request string, returnResponse interface{}) error { + hnsresponse, err := hnsCallRawResponse(method, path, request) + if err != nil { + return fmt.Errorf("failed during hnsCallRawResponse: %v", err) + } if !hnsresponse.Success { - return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + return fmt.Errorf("hns failed with error : %s", hnsresponse.Error) } if len(hnsresponse.Output) == 0 { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go index 7e859de9..b7ae96fd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go @@ -2,9 +2,9 @@ package hns import ( "encoding/json" - "net" - + "errors" "github.com/sirupsen/logrus" + "net" ) // Subnet is assoicated with a network and represents a list @@ -98,6 +98,12 @@ func (network *HNSNetwork) Create() (*HNSNetwork, error) { title := "hcsshim::HNSNetwork::" + operation logrus.Debugf(title+" id=%s", network.Id) + for _, subnet := range network.Subnets { + if (subnet.AddressPrefix != "") && (subnet.GatewayAddress == "") { + return nil, errors.New("network create error, subnet has address prefix but no gateway specified") + } + } + jsonString, err := json.Marshal(network) if err != nil { return nil, err diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go index 2318a4fc..61da242e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go @@ -55,8 +55,9 @@ type PaPolicy struct { type OutboundNatPolicy struct { Policy - VIP string `json:"VIP,omitempty"` - Exceptions []string `json:"ExceptionList,omitempty"` + VIP string `json:"VIP,omitempty"` + Exceptions []string `json:"ExceptionList,omitempty"` + Destinations []string `json:",omitempty"` } type ActionType string diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go index 2f6ec029..922f7c67 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -15,10 +15,6 @@ func ConvertAndFreeCoTaskMemString(buffer *uint16) string { return str } -func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte { - return []byte(ConvertAndFreeCoTaskMemString(buffer)) -} - func Win32FromHresult(hr uintptr) syscall.Errno { if hr&0x1fff0000 == 0x00070000 { return syscall.Errno(hr & 0xffff) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go new file mode 100644 index 00000000..ba6b1a4a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go @@ -0,0 +1,23 @@ +package log + +import ( + "context" + + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx` +// contains an OpenCensus `trace.Span`. +func G(ctx context.Context) *logrus.Entry { + span := trace.FromContext(ctx) + if span != nil { + sctx := span.SpanContext() + return logrus.WithFields(logrus.Fields{ + "traceID": sctx.TraceID.String(), + "spanID": sctx.SpanID.String(), + // "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this? + }) + } + return logrus.NewEntry(logrus.StandardLogger()) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go new file mode 100644 index 00000000..f428bdaf --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go @@ -0,0 +1,43 @@ +package oc + +import ( + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +var _ = (trace.Exporter)(&LogrusExporter{}) + +// LogrusExporter is an OpenCensus `trace.Exporter` that exports +// `trace.SpanData` to logrus output. +type LogrusExporter struct { +} + +// ExportSpan exports `s` based on the the following rules: +// +// 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`, +// `s.ParentSpanID` for correlation +// +// 2. Any calls to .Annotate will not be supported. +// +// 3. The span itself will be written at `logrus.InfoLevel` unless +// `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel` +// providing `s.Status.Message` as the error value. +func (le *LogrusExporter) ExportSpan(s *trace.SpanData) { + // Combine all span annotations with traceID, spanID, parentSpanID + baseEntry := logrus.WithFields(logrus.Fields(s.Attributes)) + baseEntry.Data["traceID"] = s.TraceID.String() + baseEntry.Data["spanID"] = s.SpanID.String() + baseEntry.Data["parentSpanID"] = s.ParentSpanID.String() + baseEntry.Data["startTime"] = s.StartTime + baseEntry.Data["endTime"] = s.EndTime + baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String() + baseEntry.Data["name"] = s.Name + baseEntry.Time = s.StartTime + + level := logrus.InfoLevel + if s.Status.Code != 0 { + level = logrus.ErrorLevel + baseEntry.Data[logrus.ErrorKey] = s.Status.Message + } + baseEntry.Log(level, "Span") +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go new file mode 100644 index 00000000..fee4765c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go @@ -0,0 +1,17 @@ +package oc + +import ( + "go.opencensus.io/trace" +) + +// SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If +// `err` is `nil` assumes `trace.StatusCodeOk`. +func SetSpanStatus(span *trace.Span, err error) { + status := trace.Status{} + if err != nil { + // TODO: JTERRY75 - Handle errors in a non-generic way + status.Code = trace.StatusCodeUnknown + status.Message = err.Error() + } + span.SetStatus(status) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go index 995433ac..fb23617f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go @@ -4,7 +4,8 @@ import ( "encoding/json" "time" - "github.com/Microsoft/hcsshim/internal/schema2" + "github.com/Microsoft/go-winio/pkg/guid" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" ) // ProcessConfig is used as both the input of Container.CreateProcess @@ -62,7 +63,7 @@ type MappedVirtualDisk struct { CreateInUtilityVM bool `json:",omitempty"` ReadOnly bool `json:",omitempty"` Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" - AttachOnly bool `json:",omitempty:` + AttachOnly bool `json:",omitempty"` } // AssignedDevice represents a device that has been directly assigned to a container @@ -133,9 +134,10 @@ type ContainerProperties struct { State string Name string SystemType string + RuntimeOSType string `json:"RuntimeOsType,omitempty"` Owner string SiloGUID string `json:"SiloGuid,omitempty"` - RuntimeID string `json:"RuntimeId,omitempty"` + RuntimeID guid.GUID `json:"RuntimeId,omitempty"` IsRuntimeTemplate bool `json:",omitempty"` RuntimeImagePath string `json:",omitempty"` Stopped bool `json:",omitempty"` @@ -214,6 +216,7 @@ type MappedVirtualDiskController struct { type GuestDefinedCapabilities struct { NamespaceAddRequestSupported bool `json:",omitempty"` SignalProcessSupported bool `json:",omitempty"` + DumpStacksSupported bool `json:",omitempty"` } // GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go index 09456cbc..bcfeb34d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go @@ -10,7 +10,6 @@ package hcsschema type Attachment struct { - Type_ string `json:"Type,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go index 243779ea..c1ea3953 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go @@ -10,7 +10,6 @@ package hcsschema type CacheQueryStatsResponse struct { - L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"` L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go index 88f01707..b4f9c315 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go @@ -10,6 +10,5 @@ package hcsschema type CloseHandle struct { - Handle string `json:"Handle,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go index c665be3d..8bf8cab6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go @@ -11,7 +11,6 @@ package hcsschema // ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port. type ComPort struct { - NamedPipe string `json:"NamedPipe,omitempty"` OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go index 85785d28..10cea67e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go @@ -10,14 +10,13 @@ package hcsschema type ComputeSystem struct { - Owner string `json:"Owner,omitempty"` SchemaVersion *Version `json:"SchemaVersion,omitempty"` HostingSystemId string `json:"HostingSystemId,omitempty"` - HostedSystem *HostedSystem `json:"HostedSystem,omitempty"` + HostedSystem interface{} `json:"HostedSystem,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go index 1a47db7d..1d5dfe68 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go @@ -25,37 +25,37 @@ func (c contextKey) String() string { var ( // ContextOAuth2 takes a oauth2.TokenSource as authentication for the request. - ContextOAuth2 = contextKey("token") + ContextOAuth2 = contextKey("token") // ContextBasicAuth takes BasicAuth as authentication for the request. - ContextBasicAuth = contextKey("basic") + ContextBasicAuth = contextKey("basic") // ContextAccessToken takes a string oauth2 access token as authentication for the request. - ContextAccessToken = contextKey("accesstoken") + ContextAccessToken = contextKey("accesstoken") // ContextAPIKey takes an APIKey as authentication for the request - ContextAPIKey = contextKey("apikey") + ContextAPIKey = contextKey("apikey") ) -// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth +// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth type BasicAuth struct { - UserName string `json:"userName,omitempty"` - Password string `json:"password,omitempty"` + UserName string `json:"userName,omitempty"` + Password string `json:"password,omitempty"` } // APIKey provides API key based authentication to a request passed via context using ContextAPIKey type APIKey struct { - Key string - Prefix string + Key string + Prefix string } type Configuration struct { - BasePath string `json:"basePath,omitempty"` - Host string `json:"host,omitempty"` - Scheme string `json:"scheme,omitempty"` - DefaultHeader map[string]string `json:"defaultHeader,omitempty"` - UserAgent string `json:"userAgent,omitempty"` - HTTPClient *http.Client + BasePath string `json:"basePath,omitempty"` + Host string `json:"host,omitempty"` + Scheme string `json:"scheme,omitempty"` + DefaultHeader map[string]string `json:"defaultHeader,omitempty"` + UserAgent string `json:"userAgent,omitempty"` + HTTPClient *http.Client } func NewConfiguration() *Configuration { @@ -69,4 +69,4 @@ func NewConfiguration() *Configuration { func (c *Configuration) AddDefaultHeader(key string, value string) { c.DefaultHeader[key] = value -} \ No newline at end of file +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go index adbe07fe..68aa04a5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go @@ -10,7 +10,6 @@ package hcsschema type ConsoleSize struct { - Height int32 `json:"Height,omitempty"` Width int32 `json:"Width,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go index 17dce28b..4fb23107 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go @@ -10,7 +10,6 @@ package hcsschema type Container struct { - GuestOs *GuestOs `json:"GuestOs,omitempty"` Storage *Storage `json:"Storage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go index 754797e2..1fd7ca5d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go @@ -11,7 +11,6 @@ package hcsschema // memory usage as viewed from within the container type ContainerMemoryInformation struct { - TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"` TotalUsage int32 `json:"TotalUsage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go index b2191c57..781a8840 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go @@ -10,7 +10,6 @@ package hcsschema type Devices struct { - ComPorts map[string]ComPort `json:"ComPorts,omitempty"` Scsi map[string]Scsi `json:"Scsi,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go index 4fe592f7..85450c41 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go @@ -10,6 +10,5 @@ package hcsschema type EnhancedModeVideo struct { - ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go index 51011afe..fe86cab6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go @@ -10,7 +10,6 @@ package hcsschema type FlexibleIoDevice struct { - EmulatorId string `json:"EmulatorId,omitempty"` HostingModel string `json:"HostingModel,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go index c5fa7673..af828004 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go @@ -10,6 +10,5 @@ package hcsschema type GuestCrashReporting struct { - WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go index c708fc7c..8838519a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go @@ -10,6 +10,5 @@ package hcsschema type GuestOs struct { - HostName string `json:"HostName,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go index 0797584c..ea3084bc 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go @@ -10,7 +10,6 @@ package hcsschema type HostedSystem struct { - SchemaVersion *Version `json:"SchemaVersion,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go index ef9ffb8d..23b2ee9e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go @@ -10,7 +10,6 @@ package hcsschema type HvSocket struct { - Config *HvSocketSystemConfig `json:"Config,omitempty"` EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go index a19ba15c..a017691f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go @@ -11,6 +11,5 @@ package hcsschema // HvSocket configuration for a VM type HvSocket2 struct { - HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go index b63b8ef1..176c49d4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go @@ -10,7 +10,6 @@ package hcsschema type Layer struct { - Id string `json:"Id,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go index a823a6d3..9b86a404 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go @@ -10,7 +10,6 @@ package hcsschema type MappedDirectory struct { - HostPath string `json:"HostPath,omitempty"` HostPathType string `json:"HostPathType,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go index 2d1d2604..208074e9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go @@ -10,7 +10,6 @@ package hcsschema type MappedPipe struct { - ContainerPipeName string `json:"ContainerPipeName,omitempty"` HostPath string `json:"HostPath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go index e1d135a3..ec93d004 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go @@ -10,6 +10,5 @@ package hcsschema type Memory struct { - SizeInMB int32 `json:"SizeInMB,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go index 27d0b8c4..b4a36954 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go @@ -22,4 +22,9 @@ type Memory2 struct { // EnableDeferredCommit is private in the schema. If regenerated need to add back. EnableDeferredCommit bool `json:"EnableDeferredCommit,omitempty"` + + // EnableColdDiscardHint if enabled, then the memory cold discard hint feature is exposed + // to the VM, allowing it to trim non-zeroed pages from the working set (if supported by + // the guest operating system). + EnableColdDiscardHint bool `json:"EnableColdDiscardHint,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go index bdd87dff..811779b0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go @@ -10,8 +10,7 @@ package hcsschema type MemoryInformationForVm struct { - - VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"` + VirtualNodeCount uint32 `json:"VirtualNodeCount,omitempty"` VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go index 6214970f..906ba597 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go @@ -11,10 +11,9 @@ package hcsschema // Memory runtime statistics type MemoryStats struct { + MemoryUsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` - MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"` + MemoryUsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` - MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"` - - MemoryUsagePrivateWorkingSetBytes int32 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` + MemoryUsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go index c586f66c..a9c750b3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go @@ -10,7 +10,6 @@ package hcsschema type NetworkAdapter struct { - EndpointId string `json:"EndpointId,omitempty"` MacAddress string `json:"MacAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go index 12c47827..e5ea187a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go @@ -10,7 +10,6 @@ package hcsschema type Networking struct { - AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"` DnsSearchList string `json:"DnsSearchList,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go index 1cd70d17..d96c9501 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go @@ -11,6 +11,5 @@ package hcsschema // Notification data that is indicated to components running in the Virtual Machine. type PauseNotification struct { - Reason string `json:"Reason,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go index 780a5cae..21707a88 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go @@ -11,7 +11,6 @@ package hcsschema // Options for HcsPauseComputeSystem type PauseOptions struct { - SuspensionLevel string `json:"SuspensionLevel,omitempty"` HostedNotification *PauseNotification `json:"HostedNotification,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go index 705c677e..29d8c801 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go @@ -10,6 +10,5 @@ package hcsschema type Plan9 struct { - Shares []Plan9Share `json:"Shares,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go index eb171817..41f8fdea 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go @@ -10,7 +10,6 @@ package hcsschema type Plan9Share struct { - Name string `json:"Name,omitempty"` // The name by which the guest operation system can access this share, via the aname parameter in the Plan9 protocol. @@ -30,4 +29,6 @@ type Plan9Share struct { ReadOnly bool `json:"ReadOnly,omitempty"` UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` + + AllowedFiles []string `json:"AllowedFiles,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go index 63e0b7f8..e9a662dd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go @@ -15,7 +15,6 @@ import ( // Information about a process running in a container type ProcessDetails struct { - ProcessId int32 `json:"ProcessId,omitempty"` ImageName string `json:"ImageName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go index 29bc2e3d..e4ed095c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go @@ -11,7 +11,6 @@ package hcsschema // Passed to HcsRpc_ModifyProcess type ProcessModifyRequest struct { - Operation string `json:"Operation,omitempty"` ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go index 470c5573..82b0d053 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go @@ -10,7 +10,6 @@ package hcsschema type ProcessParameters struct { - ApplicationName string `json:"ApplicationName,omitempty"` CommandLine string `json:"CommandLine,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go index 20793d15..ad9a4fa9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go @@ -11,7 +11,6 @@ package hcsschema // Status of a process running in a container type ProcessStatus struct { - ProcessId int32 `json:"ProcessId,omitempty"` Exited bool `json:"Exited,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go index 7a60b024..bb24e88d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go @@ -10,7 +10,6 @@ package hcsschema type Processor struct { - Count int32 `json:"Count,omitempty"` Maximum int32 `json:"Maximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go index 40d3e735..21fe4606 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go @@ -10,7 +10,6 @@ package hcsschema type Processor2 struct { - Count int32 `json:"Count,omitempty"` Limit int32 `json:"Limit,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go index 9d3b77e5..6157e252 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go @@ -11,10 +11,9 @@ package hcsschema // CPU runtime statistics type ProcessorStats struct { + TotalRuntime100ns uint64 `json:"TotalRuntime100ns,omitempty"` - TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"` + RuntimeUser100ns uint64 `json:"RuntimeUser100ns,omitempty"` - RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"` - - RuntimeKernel100ns int32 `json:"RuntimeKernel100ns,omitempty"` + RuntimeKernel100ns uint64 `json:"RuntimeKernel100ns,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go index 6db2a48f..17558cba 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go @@ -9,8 +9,11 @@ package hcsschema -type Properties struct { +import ( + v1 "github.com/containerd/cgroups/stats/v1" +) +type Properties struct { Id string `json:"Id,omitempty"` SystemType string `json:"SystemType,omitempty"` @@ -44,4 +47,8 @@ type Properties struct { SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"` GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"` + + // Metrics is not part of the API for HCS but this is used for LCOW v2 to + // return the full cgroup metrics from the guest. + Metrics *v1.Metrics `json:"LCOWMetrics,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go index 22b92ffd..d6d80df1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go @@ -9,8 +9,7 @@ package hcsschema -// By default the basic properties will be returned. This query provides a way to request specific properties. +// By default the basic properties will be returned. This query provides a way to request specific properties. type PropertyQuery struct { - - PropertyTypes []string `json:"PropertyTypes,omitempty"` + PropertyTypes []PropertyType `json:"PropertyTypes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go new file mode 100644 index 00000000..f092b737 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_type.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type PropertyType string + +const ( + PTMemory PropertyType = "Memory" + PTGuestMemory PropertyType = "GuestMemory" + PTStatistics PropertyType = "Statistics" + PTProcessList PropertyType = "ProcessList" + PTTerminateOnLastHandleClosed PropertyType = "TerminateOnLastHandleClosed" + PTSharedMemoryRegion PropertyType = "SharedMemoryRegion" + PTGuestConnection PropertyType = "GuestConnection" + PTICHeartbeatStatus PropertyType = "ICHeartbeatStatus" +) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go index 97e45312..8d5f5c17 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go @@ -10,7 +10,6 @@ package hcsschema type RdpConnectionOptions struct { - AccessSids []string `json:"AccessSids,omitempty"` NamedPipe string `json:"NamedPipe,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go index fa574ccc..006906f6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go @@ -10,7 +10,6 @@ package hcsschema type RegistryChanges struct { - AddValues []RegistryValue `json:"AddValues,omitempty"` DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go index fab03bc6..26fde99c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go @@ -10,7 +10,6 @@ package hcsschema type RegistryKey struct { - Hive string `json:"Hive,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go index 1589f484..3f203176 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go @@ -10,7 +10,6 @@ package hcsschema type RegistryValue struct { - Key *RegistryKey `json:"Key,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go index bd573f6c..df9baa92 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go @@ -10,6 +10,5 @@ package hcsschema type SharedMemoryConfiguration struct { - Regions []SharedMemoryRegion `json:"Regions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go index a57b2cba..825b7186 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegion struct { - SectionName string `json:"SectionName,omitempty"` StartOffset int32 `json:"StartOffset,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go index d9a50cc7..f67b08eb 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegionInfo struct { - SectionName string `json:"SectionName,omitempty"` GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go index 599c06e8..5eaf6a7f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go @@ -11,7 +11,6 @@ package hcsschema // Silo job information type SiloProperties struct { - Enabled bool `json:"Enabled,omitempty"` JobName string `json:"JobName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go index 5cb3ed93..ba7a6b39 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go @@ -15,12 +15,11 @@ import ( // Runtime statistics for a container type Statistics struct { - Timestamp time.Time `json:"Timestamp,omitempty"` ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"` - Uptime100ns int32 `json:"Uptime100ns,omitempty"` + Uptime100ns uint64 `json:"Uptime100ns,omitempty"` Processor *ProcessorStats `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go index 8c5255df..9c5e6eb5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go @@ -10,7 +10,6 @@ package hcsschema type StorageQoS struct { - IopsMaximum int32 `json:"IopsMaximum,omitempty"` BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go index 198ea57d..4f042ffd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go @@ -11,12 +11,11 @@ package hcsschema // Storage runtime statistics type StorageStats struct { + ReadCountNormalized uint64 `json:"ReadCountNormalized,omitempty"` - ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"` + ReadSizeBytes uint64 `json:"ReadSizeBytes,omitempty"` - ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"` + WriteCountNormalized uint64 `json:"WriteCountNormalized,omitempty"` - WriteCountNormalized int32 `json:"WriteCountNormalized,omitempty"` - - WriteSizeBytes int32 `json:"WriteSizeBytes,omitempty"` + WriteSizeBytes uint64 `json:"WriteSizeBytes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go index af2e3c82..83486994 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go @@ -10,7 +10,6 @@ package hcsschema type Topology struct { - Memory *Memory2 `json:"Memory,omitempty"` Processor *Processor2 `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go index ba91178f..0e48ece5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go @@ -10,7 +10,6 @@ package hcsschema type Uefi struct { - EnableDebugger bool `json:"EnableDebugger,omitempty"` SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go index 6620fb2b..3ab409d8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go @@ -10,7 +10,6 @@ package hcsschema type UefiBootEntry struct { - DeviceType string `json:"DeviceType,omitempty"` DevicePath string `json:"DevicePath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go index 62c0e4d1..2abfccca 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go @@ -10,7 +10,6 @@ package hcsschema type Version struct { - Major int32 `json:"Major,omitempty"` Minor int32 `json:"Minor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go index 0958e560..ec5d0fb9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go @@ -10,7 +10,6 @@ package hcsschema type VideoMonitor struct { - HorizontalResolution int32 `json:"HorizontalResolution,omitempty"` VerticalResolution int32 `json:"VerticalResolution,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go index 48402d8e..91a3c83d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go @@ -10,7 +10,6 @@ package hcsschema type VirtualNodeInfo struct { - VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"` PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go index 47714444..70cf2d90 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go @@ -10,7 +10,6 @@ package hcsschema type VirtualPMemDevice struct { - HostPath string `json:"HostPath,omitempty"` ReadOnly bool `json:"ReadOnly,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go index 76131b3a..362df363 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmb struct { - Shares []VirtualSmbShare `json:"Shares,omitempty"` DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go index b50098a4..915e9b63 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShare struct { - Name string `json:"Name,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go index c1894279..75196bd8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShareOptions struct { - ReadOnly bool `json:"ReadOnly,omitempty"` // convert exclusive access to shared read access diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go index 39f62866..8e1836dd 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go @@ -10,14 +10,13 @@ package hcsschema type VmMemory struct { - AvailableMemory int32 `json:"AvailableMemory,omitempty"` AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"` - ReservedMemory int32 `json:"ReservedMemory,omitempty"` + ReservedMemory uint64 `json:"ReservedMemory,omitempty"` - AssignedMemory int32 `json:"AssignedMemory,omitempty"` + AssignedMemory uint64 `json:"AssignedMemory,omitempty"` SlpActive bool `json:"SlpActive,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go index cf632bbc..8ed7e566 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go @@ -10,7 +10,6 @@ package hcsschema type WindowsCrashReporting struct { - DumpFileName string `json:"DumpFileName,omitempty"` MaxDumpSize int64 `json:"MaxDumpSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go new file mode 100644 index 00000000..7c2a0dc2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go @@ -0,0 +1,565 @@ +package vmcompute + +import ( + gcontext "context" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/timeout" + "go.opencensus.io/trace" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess? +//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously +const errVmcomputeOperationPending = syscall.Errno(0xC0370103) + +// HcsSystem is the handle associated with a created compute system. +type HcsSystem syscall.Handle + +// HcsProcess is the handle associated with a created process in a compute +// system. +type HcsProcess syscall.Handle + +// HcsCallback is the handle associated with the function to call when events +// occur. +type HcsCallback syscall.Handle + +// HcsProcessInformation is the structure used when creating or getting process +// info. +type HcsProcessInformation struct { + // ProcessId is the pid of the created process. + ProcessId uint32 + reserved uint32 + // StdInput is the handle associated with the stdin of the process. + StdInput syscall.Handle + // StdOutput is the handle associated with the stdout of the process. + StdOutput syscall.Handle + // StdError is the handle associated with the stderr of the process. + StdError syscall.Handle +} + +func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error { + if timeout > 0 { + var cancel gcontext.CancelFunc + ctx, cancel = gcontext.WithTimeout(ctx, timeout) + defer cancel() + } + + done := make(chan error, 1) + go func() { + done <- f() + }() + select { + case <-ctx.Done(): + if ctx.Err() == gcontext.DeadlineExceeded { + log.G(ctx).WithField(logfields.Timeout, timeout). + Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") + } + return ctx.Err() + case err := <-done: + return err + } +} + +func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("query", query)) + + return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + computeSystemsp *uint16 + resultp *uint16 + ) + err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + if computeSystemsp != nil { + computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes( + trace.StringAttribute("id", id), + trace.StringAttribute("configuration", configuration)) + + return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error { + var resultp *uint16 + err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenComputeSystem(id, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseComputeSystem(computeSystem) + }) +} + +func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemStart, func() error { + var resultp *uint16 + err := hcsStartComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsShutdownComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemPause, func() error { + var resultp *uint16 + err := hcsPauseComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemResume, func() error { + var resultp *uint16 + err := hcsResumeComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("configuration", configuration)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyComputeSystem(computeSystem, configuration, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterComputeSystemCallback(callbackHandle) + }) +} + +func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("processParameters", processParameters)) + + return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.Int64Attribute("pid", int64(pid))) + + return process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenProcess(computeSystem, pid, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseProcess") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseProcess(process) + }) +} + +func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateProcess(process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsSignalProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsSignalProcess(process, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsGetProcessInfo(process, &processInformation, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + processPropertiesp *uint16 + resultp *uint16 + ) + err := hcsGetProcessProperties(process, &processPropertiesp, &resultp) + if processPropertiesp != nil { + processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("settings", settings)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyProcess(process, settings, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterProcessCallback(process, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterProcessCallback(callbackHandle) + }) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go similarity index 81% rename from vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go rename to vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go index fcd5cdc8..0f2a69f6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go @@ -1,6 +1,6 @@ // Code generated mksyscall_windows.exe DO NOT EDIT -package hcs +package vmcompute import ( "syscall" @@ -56,13 +56,13 @@ var ( procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") - - procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") - procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") - procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") - procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") - procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") + procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") ) func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { @@ -88,7 +88,7 @@ func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result return } -func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -102,7 +102,7 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) } -func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsCreateComputeSystem.Find(); hr != nil { return } @@ -116,7 +116,7 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall return } -func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -125,7 +125,7 @@ func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) return _hcsOpenComputeSystem(_p0, computeSystem, result) } -func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsOpenComputeSystem.Find(); hr != nil { return } @@ -139,7 +139,7 @@ func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16 return } -func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { +func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { if hr = procHcsCloseComputeSystem.Find(); hr != nil { return } @@ -153,7 +153,7 @@ func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { return } -func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -162,7 +162,7 @@ func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsStartComputeSystem(computeSystem, _p0, result) } -func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsStartComputeSystem.Find(); hr != nil { return } @@ -176,7 +176,7 @@ func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -185,7 +185,7 @@ func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result ** return _hcsShutdownComputeSystem(computeSystem, _p0, result) } -func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsShutdownComputeSystem.Find(); hr != nil { return } @@ -199,7 +199,7 @@ func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -208,7 +208,7 @@ func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result * return _hcsTerminateComputeSystem(computeSystem, _p0, result) } -func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsTerminateComputeSystem.Find(); hr != nil { return } @@ -222,7 +222,7 @@ func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -231,7 +231,7 @@ func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsPauseComputeSystem(computeSystem, _p0, result) } -func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsPauseComputeSystem.Find(); hr != nil { return } @@ -245,7 +245,7 @@ func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -254,7 +254,7 @@ func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **ui return _hcsResumeComputeSystem(computeSystem, _p0, result) } -func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsResumeComputeSystem.Find(); hr != nil { return } @@ -268,7 +268,7 @@ func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result ** return } -func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { +func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { @@ -277,7 +277,7 @@ func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) } -func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { +func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { return } @@ -291,7 +291,7 @@ func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint return } -func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { +func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(configuration) if hr != nil { @@ -300,7 +300,7 @@ func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, resul return _hcsModifyComputeSystem(computeSystem, _p0, result) } -func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { +func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { if hr = procHcsModifyComputeSystem.Find(); hr != nil { return } @@ -314,7 +314,7 @@ func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, res return } -func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { return } @@ -328,7 +328,7 @@ func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, return } -func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { return } @@ -342,7 +342,7 @@ func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { return } -func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(processParameters) if hr != nil { @@ -351,7 +351,7 @@ func hcsCreateProcess(computeSystem hcsSystem, processParameters string, process return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) } -func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsCreateProcess.Find(); hr != nil { return } @@ -365,7 +365,7 @@ func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, proce return } -func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { +func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsOpenProcess.Find(); hr != nil { return } @@ -379,7 +379,7 @@ func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, re return } -func hcsCloseProcess(process hcsProcess) (hr error) { +func hcsCloseProcess(process HcsProcess) (hr error) { if hr = procHcsCloseProcess.Find(); hr != nil { return } @@ -393,7 +393,7 @@ func hcsCloseProcess(process hcsProcess) (hr error) { return } -func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { +func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { if hr = procHcsTerminateProcess.Find(); hr != nil { return } @@ -407,7 +407,7 @@ func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { return } -func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) { +func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -416,11 +416,11 @@ func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr e return _hcsSignalProcess(process, _p0, result) } -func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { +func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { + if hr = procHcsSignalProcess.Find(); hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -430,7 +430,7 @@ func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr return } -func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { +func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { if hr = procHcsGetProcessInfo.Find(); hr != nil { return } @@ -444,7 +444,7 @@ func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInforma return } -func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { +func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { if hr = procHcsGetProcessProperties.Find(); hr != nil { return } @@ -458,7 +458,7 @@ func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, res return } -func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { +func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { @@ -467,7 +467,7 @@ func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr return _hcsModifyProcess(process, _p0, result) } -func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { +func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { if hr = procHcsModifyProcess.Find(); hr != nil { return } @@ -504,7 +504,7 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result return } -func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterProcessCallback.Find(); hr != nil { return } @@ -518,7 +518,7 @@ func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context ui return } -func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { return } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go index 651676fb..b3b431e3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go @@ -1,7 +1,13 @@ package wclayer import ( + "os" + "path/filepath" + "syscall" + "unsafe" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/osversion" "github.com/sirupsen/logrus" ) @@ -26,5 +32,114 @@ func ExpandScratchSize(path string, size uint64) (err error) { if err != nil { return hcserror.New(err, title+" - failed", "") } + + // Manually expand the volume now in order to work around bugs in 19H1 and + // prerelease versions of Vb. Remove once this is fixed in Windows. + if build := osversion.Get().Build; build >= osversion.V19H1 && build < 19020 { + err = expandSandboxVolume(path) + if err != nil { + return err + } + } + return nil +} + +type virtualStorageType struct { + DeviceID uint32 + VendorID [16]byte +} + +type openVersion2 struct { + GetInfoOnly int32 // bool but 4-byte aligned + ReadOnly int32 // bool but 4-byte aligned + ResiliencyGUID [16]byte // GUID +} + +type openVirtualDiskParameters struct { + Version uint32 // Must always be set to 2 + Version2 openVersion2 +} + +func attachVhd(path string) (syscall.Handle, error) { + var ( + defaultType virtualStorageType + handle syscall.Handle + ) + parameters := openVirtualDiskParameters{Version: 2} + err := openVirtualDisk( + &defaultType, + path, + 0, + 0, + ¶meters, + &handle) + if err != nil { + return 0, &os.PathError{Op: "OpenVirtualDisk", Path: path, Err: err} + } + err = attachVirtualDisk(handle, 0, 0, 0, 0, 0) + if err != nil { + syscall.Close(handle) + return 0, &os.PathError{Op: "AttachVirtualDisk", Path: path, Err: err} + } + return handle, nil +} + +func expandSandboxVolume(path string) error { + // Mount the sandbox VHD temporarily. + vhdPath := filepath.Join(path, "sandbox.vhdx") + vhd, err := attachVhd(vhdPath) + if err != nil { + return &os.PathError{Op: "OpenVirtualDisk", Path: vhdPath, Err: err} + } + defer syscall.Close(vhd) + + // Open the volume. + volumePath, err := GetLayerMountPath(path) + if err != nil { + return err + } + if volumePath[len(volumePath)-1] == '\\' { + volumePath = volumePath[:len(volumePath)-1] + } + volume, err := os.OpenFile(volumePath, os.O_RDWR, 0) + if err != nil { + return err + } + defer volume.Close() + + // Get the volume's underlying partition size in NTFS clusters. + var ( + partitionSize int64 + bytes uint32 + ) + const _IOCTL_DISK_GET_LENGTH_INFO = 0x0007405C + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _IOCTL_DISK_GET_LENGTH_INFO, nil, 0, (*byte)(unsafe.Pointer(&partitionSize)), 8, &bytes, nil) + if err != nil { + return &os.PathError{Op: "IOCTL_DISK_GET_LENGTH_INFO", Path: volume.Name(), Err: err} + } + const ( + clusterSize = 4096 + sectorSize = 512 + ) + targetClusters := partitionSize / clusterSize + + // Get the volume's current size in NTFS clusters. + var volumeSize int64 + err = getDiskFreeSpaceEx(volume.Name()+"\\", nil, &volumeSize, nil) + if err != nil { + return &os.PathError{Op: "GetDiskFreeSpaceEx", Path: volume.Name(), Err: err} + } + volumeClusters := volumeSize / clusterSize + + // Only resize the volume if there is space to grow, otherwise this will + // fail with invalid parameter. NTFS reserves one cluster. + if volumeClusters+1 < targetClusters { + targetSectors := targetClusters * (clusterSize / sectorSize) + const _FSCTL_EXTEND_VOLUME = 0x000900F0 + err = syscall.DeviceIoControl(syscall.Handle(volume.Fd()), _FSCTL_EXTEND_VOLUME, (*byte)(unsafe.Pointer(&targetSectors)), 8, nil, 0, &bytes, nil) + if err != nil { + return &os.PathError{Op: "FSCTL_EXTEND_VOLUME", Path: volume.Name(), Err: err} + } + } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go index 90df3bed..443596fb 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -3,7 +3,7 @@ package wclayer import ( "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" ) // LayerID returns the layer ID of a layer on disk. diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go index 6d0ae8a0..06671309 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -6,7 +6,7 @@ package wclayer import ( "syscall" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go index 45a63cf6..a259c1b8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -1,7 +1,7 @@ package wclayer import ( - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go index 78f2aacd..dc40bf51 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -1,6 +1,6 @@ package wclayer -import "github.com/Microsoft/hcsshim/internal/guid" +import "github.com/Microsoft/go-winio/pkg/guid" //go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go @@ -24,4 +24,9 @@ import "github.com/Microsoft/hcsshim/internal/guid" //sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess? +//sys openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) [failretval != 0] = virtdisk.OpenVirtualDisk +//sys attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) [failretval != 0] = virtdisk.AttachVirtualDisk + +//sys getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) = GetDiskFreeSpaceExW + type _guid = guid.GUID diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go index d853ab25..67f917f0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go @@ -38,6 +38,8 @@ func errnoErr(e syscall.Errno) error { var ( modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") procActivateLayer = modvmcompute.NewProc("ActivateLayer") procCopyLayer = modvmcompute.NewProc("CopyLayer") @@ -57,6 +59,9 @@ var ( procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") + procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") + procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") + procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW") ) func activateLayer(info *driverInfo, id string) (hr error) { @@ -508,3 +513,57 @@ func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { } return } + +func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(path) + if err != nil { + return + } + return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle) +} + +func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { + r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) + if r1 != 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(directoryName) + if err != nil { + return + } + return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes) +} + +func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go index df0e63bb..f60ba550 100644 --- a/vendor/github.com/Microsoft/hcsshim/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -4,7 +4,7 @@ import ( "crypto/sha1" "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/wclayer" ) @@ -77,7 +77,7 @@ type GUID [16]byte func NameToGuid(name string) (id GUID, err error) { g, err := wclayer.NameToGuid(name) - return GUID(g), err + return g.ToWindowsArray(), err } func NewGUID(source string) *GUID { @@ -88,7 +88,7 @@ func NewGUID(source string) *GUID { } func (g *GUID) ToString() string { - return (guid.GUID)(*g).String() + return guid.FromWindowsArray(*g).String() } type LayerReader = wclayer.LayerReader diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/osversion.go b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go similarity index 88% rename from vendor/github.com/Microsoft/hcsshim/osversion/osversion.go rename to vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go index 916950c0..477fe707 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/osversion.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go @@ -46,6 +46,12 @@ func Get() OSVersion { return osv } +// Build gets the build-number on Windows +// The calling application must be manifested to get the correct version information. +func Build() uint16 { + return Get().Build +} + func (osv OSVersion) ToString() string { return fmt.Sprintf("%d.%d.%d", osv.MajorVersion, osv.MinorVersion, osv.Build) } diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go index 2d9567f6..726d1c8c 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go @@ -1,10 +1,27 @@ package osversion const ( - - // RS2 was a client-only release in case you're asking why it's not in the list. + // RS1 (version 1607, codename "Redstone 1") corresponds to Windows Server + // 2016 (ltsc2016) and Windows 10 (Anniversary Update). RS1 = 14393 + + // RS2 (version 1703, codename "Redstone 2") was a client-only update, and + // corresponds to Windows 10 (Creators Update). + RS2 = 15063 + + // RS3 (version 1709, codename "Redstone 3") corresponds to Windows Server + // 1709 (Semi-Annual Channel (SAC)), and Windows 10 (Fall Creators Update). RS3 = 16299 + + // RS4 (version 1803, codename "Redstone 4") corresponds to Windows Server + // 1803 (Semi-Annual Channel (SAC)), and Windows 10 (April 2018 Update). RS4 = 17134 + + // RS5 (version 1809, codename "Redstone 5") corresponds to Windows Server + // 2019 (ltsc2019), and Windows 10 (October 2018 Update). RS5 = 17763 + + // V19H1 (version 1903) corresponds to Windows Server 1903 (semi-annual + // channel). + V19H1 = 18362 ) diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go index ca8acbb7..3362c683 100644 --- a/vendor/github.com/Microsoft/hcsshim/process.go +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -1,7 +1,9 @@ package hcsshim import ( + "context" "io" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -9,7 +11,10 @@ import ( // ContainerError is an error encountered in HCS type process struct { - p *hcs.Process + p *hcs.Process + waitOnce sync.Once + waitCh chan struct{} + waitErr error } // Pid returns the process ID of the process within the container. @@ -19,7 +24,14 @@ func (process *process) Pid() int { // Kill signals the process to terminate but does not wait for it to finish terminating. func (process *process) Kill() error { - return convertProcessError(process.p.Kill(), process) + found, err := process.p.Kill(context.Background()) + if err != nil { + return convertProcessError(err, process) + } + if !found { + return &ProcessError{Process: process, Err: ErrElementNotFound, Operation: "hcsshim::Process::Kill"} + } + return nil } // Wait waits for the process to exit. @@ -30,7 +42,21 @@ func (process *process) Wait() error { // WaitTimeout waits for the process to exit or the duration to elapse. It returns // false if timeout occurs. func (process *process) WaitTimeout(timeout time.Duration) error { - return convertProcessError(process.p.WaitTimeout(timeout), process) + process.waitOnce.Do(func() { + process.waitCh = make(chan struct{}) + go func() { + process.waitErr = process.Wait() + close(process.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ProcessError{Process: process, Err: ErrTimeout, Operation: "hcsshim::Process::Wait"} + case <-process.waitCh: + return process.waitErr + } } // ExitCode returns the exit code of the process. The process must have @@ -45,14 +71,14 @@ func (process *process) ExitCode() (int, error) { // ResizeConsole resizes the console of the process. func (process *process) ResizeConsole(width, height uint16) error { - return convertProcessError(process.p.ResizeConsole(width, height), process) + return convertProcessError(process.p.ResizeConsole(context.Background(), width, height), process) } // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes; it should be possible to // call this multiple times to get multiple interfaces. func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { - stdin, stdout, stderr, err := process.p.Stdio() + stdin, stdout, stderr, err := process.p.StdioLegacy() if err != nil { err = convertProcessError(err, process) } @@ -62,7 +88,7 @@ func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, e // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. func (process *process) CloseStdin() error { - return convertProcessError(process.p.CloseStdin(), process) + return convertProcessError(process.p.CloseStdin(context.Background()), process) } // Close cleans up any state associated with the process but does not kill diff --git a/vendor/github.com/Microsoft/hcsshim/vendor.conf b/vendor/github.com/Microsoft/hcsshim/vendor.conf deleted file mode 100644 index 6e0ed156..00000000 --- a/vendor/github.com/Microsoft/hcsshim/vendor.conf +++ /dev/null @@ -1,21 +0,0 @@ -github.com/blang/semver v3.1.0 -github.com/containerd/console c12b1e7919c14469339a5d38f2f8ed9b64a9de23 -github.com/containerd/go-runc 5a6d9f37cfa36b15efba46dc7ea349fa9b7143c3 -github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55 -github.com/hashicorp/go-multierror ed905158d87462226a13fe39ddf685ea65f1c11f -github.com/konsorten/go-windows-terminal-sequences v1.0.1 -github.com/linuxkit/virtsock 8e79449dea0735c1c056d814934dd035734cc97c -github.com/Microsoft/go-winio 16cfc975803886a5e47c4257a24c8d8c52e178b2 -github.com/Microsoft/opengcs v0.3.9 -github.com/opencontainers/runtime-spec eba862dc2470385a233c7507392675cbeadf7353 -github.com/opencontainers/runtime-tools 1d69bd0f9c39677d0630e50664fbc3154ae61b88 -github.com/pkg/errors v0.8.1 -github.com/sirupsen/logrus v1.3.0 -github.com/syndtr/gocapability db04d3cc01c8b54962a58ec7e491717d06cfcc16 -github.com/urfave/cli 7bc6a0acffa589f415f88aca16cc1de5ffd66f9c -github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6 -github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b -github.com/xeipuuv/gojsonschema 1d523034197ff1f222f6429836dd36a2457a1874 -golang.org/x/crypto ff983b9c42bc9fbf91556e191cc8efb585c16908 -golang.org/x/sync 37e7f081c4d4c64e13b10787722085407fe5d15f -golang.org/x/sys e5ecc2a6747ce8d4af18ed98b3de5ae30eb3a5bb \ No newline at end of file diff --git a/vendor/github.com/containerd/cgroups/LICENSE b/vendor/github.com/containerd/cgroups/LICENSE new file mode 100644 index 00000000..261eeb9e --- /dev/null +++ b/vendor/github.com/containerd/cgroups/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/containerd/cgroups/stats/v1/doc.go b/vendor/github.com/containerd/cgroups/stats/v1/doc.go new file mode 100644 index 00000000..23f3cdd4 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/doc.go @@ -0,0 +1,17 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package v1 diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go new file mode 100644 index 00000000..c7884e8e --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.go @@ -0,0 +1,5368 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/containerd/cgroups/stats/v1/metrics.proto + +package v1 + +import ( + fmt "fmt" + _ "github.com/gogo/protobuf/gogoproto" + proto "github.com/gogo/protobuf/proto" + io "io" + math "math" + reflect "reflect" + strings "strings" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +type Metrics struct { + Hugetlb []*HugetlbStat `protobuf:"bytes,1,rep,name=hugetlb,proto3" json:"hugetlb,omitempty"` + Pids *PidsStat `protobuf:"bytes,2,opt,name=pids,proto3" json:"pids,omitempty"` + CPU *CPUStat `protobuf:"bytes,3,opt,name=cpu,proto3" json:"cpu,omitempty"` + Memory *MemoryStat `protobuf:"bytes,4,opt,name=memory,proto3" json:"memory,omitempty"` + Blkio *BlkIOStat `protobuf:"bytes,5,opt,name=blkio,proto3" json:"blkio,omitempty"` + Rdma *RdmaStat `protobuf:"bytes,6,opt,name=rdma,proto3" json:"rdma,omitempty"` + Network []*NetworkStat `protobuf:"bytes,7,rep,name=network,proto3" json:"network,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Metrics) Reset() { *m = Metrics{} } +func (*Metrics) ProtoMessage() {} +func (*Metrics) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{0} +} +func (m *Metrics) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Metrics) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Metrics.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Metrics) XXX_Merge(src proto.Message) { + xxx_messageInfo_Metrics.Merge(m, src) +} +func (m *Metrics) XXX_Size() int { + return m.Size() +} +func (m *Metrics) XXX_DiscardUnknown() { + xxx_messageInfo_Metrics.DiscardUnknown(m) +} + +var xxx_messageInfo_Metrics proto.InternalMessageInfo + +type HugetlbStat struct { + Usage uint64 `protobuf:"varint,1,opt,name=usage,proto3" json:"usage,omitempty"` + Max uint64 `protobuf:"varint,2,opt,name=max,proto3" json:"max,omitempty"` + Failcnt uint64 `protobuf:"varint,3,opt,name=failcnt,proto3" json:"failcnt,omitempty"` + Pagesize string `protobuf:"bytes,4,opt,name=pagesize,proto3" json:"pagesize,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *HugetlbStat) Reset() { *m = HugetlbStat{} } +func (*HugetlbStat) ProtoMessage() {} +func (*HugetlbStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{1} +} +func (m *HugetlbStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *HugetlbStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_HugetlbStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *HugetlbStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_HugetlbStat.Merge(m, src) +} +func (m *HugetlbStat) XXX_Size() int { + return m.Size() +} +func (m *HugetlbStat) XXX_DiscardUnknown() { + xxx_messageInfo_HugetlbStat.DiscardUnknown(m) +} + +var xxx_messageInfo_HugetlbStat proto.InternalMessageInfo + +type PidsStat struct { + Current uint64 `protobuf:"varint,1,opt,name=current,proto3" json:"current,omitempty"` + Limit uint64 `protobuf:"varint,2,opt,name=limit,proto3" json:"limit,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *PidsStat) Reset() { *m = PidsStat{} } +func (*PidsStat) ProtoMessage() {} +func (*PidsStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{2} +} +func (m *PidsStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *PidsStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_PidsStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *PidsStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_PidsStat.Merge(m, src) +} +func (m *PidsStat) XXX_Size() int { + return m.Size() +} +func (m *PidsStat) XXX_DiscardUnknown() { + xxx_messageInfo_PidsStat.DiscardUnknown(m) +} + +var xxx_messageInfo_PidsStat proto.InternalMessageInfo + +type CPUStat struct { + Usage *CPUUsage `protobuf:"bytes,1,opt,name=usage,proto3" json:"usage,omitempty"` + Throttling *Throttle `protobuf:"bytes,2,opt,name=throttling,proto3" json:"throttling,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CPUStat) Reset() { *m = CPUStat{} } +func (*CPUStat) ProtoMessage() {} +func (*CPUStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{3} +} +func (m *CPUStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CPUStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CPUStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CPUStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_CPUStat.Merge(m, src) +} +func (m *CPUStat) XXX_Size() int { + return m.Size() +} +func (m *CPUStat) XXX_DiscardUnknown() { + xxx_messageInfo_CPUStat.DiscardUnknown(m) +} + +var xxx_messageInfo_CPUStat proto.InternalMessageInfo + +type CPUUsage struct { + // values in nanoseconds + Total uint64 `protobuf:"varint,1,opt,name=total,proto3" json:"total,omitempty"` + Kernel uint64 `protobuf:"varint,2,opt,name=kernel,proto3" json:"kernel,omitempty"` + User uint64 `protobuf:"varint,3,opt,name=user,proto3" json:"user,omitempty"` + PerCPU []uint64 `protobuf:"varint,4,rep,packed,name=per_cpu,json=perCpu,proto3" json:"per_cpu,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CPUUsage) Reset() { *m = CPUUsage{} } +func (*CPUUsage) ProtoMessage() {} +func (*CPUUsage) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{4} +} +func (m *CPUUsage) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *CPUUsage) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_CPUUsage.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *CPUUsage) XXX_Merge(src proto.Message) { + xxx_messageInfo_CPUUsage.Merge(m, src) +} +func (m *CPUUsage) XXX_Size() int { + return m.Size() +} +func (m *CPUUsage) XXX_DiscardUnknown() { + xxx_messageInfo_CPUUsage.DiscardUnknown(m) +} + +var xxx_messageInfo_CPUUsage proto.InternalMessageInfo + +type Throttle struct { + Periods uint64 `protobuf:"varint,1,opt,name=periods,proto3" json:"periods,omitempty"` + ThrottledPeriods uint64 `protobuf:"varint,2,opt,name=throttled_periods,json=throttledPeriods,proto3" json:"throttled_periods,omitempty"` + ThrottledTime uint64 `protobuf:"varint,3,opt,name=throttled_time,json=throttledTime,proto3" json:"throttled_time,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Throttle) Reset() { *m = Throttle{} } +func (*Throttle) ProtoMessage() {} +func (*Throttle) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{5} +} +func (m *Throttle) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Throttle) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Throttle.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Throttle) XXX_Merge(src proto.Message) { + xxx_messageInfo_Throttle.Merge(m, src) +} +func (m *Throttle) XXX_Size() int { + return m.Size() +} +func (m *Throttle) XXX_DiscardUnknown() { + xxx_messageInfo_Throttle.DiscardUnknown(m) +} + +var xxx_messageInfo_Throttle proto.InternalMessageInfo + +type MemoryStat struct { + Cache uint64 `protobuf:"varint,1,opt,name=cache,proto3" json:"cache,omitempty"` + RSS uint64 `protobuf:"varint,2,opt,name=rss,proto3" json:"rss,omitempty"` + RSSHuge uint64 `protobuf:"varint,3,opt,name=rss_huge,json=rssHuge,proto3" json:"rss_huge,omitempty"` + MappedFile uint64 `protobuf:"varint,4,opt,name=mapped_file,json=mappedFile,proto3" json:"mapped_file,omitempty"` + Dirty uint64 `protobuf:"varint,5,opt,name=dirty,proto3" json:"dirty,omitempty"` + Writeback uint64 `protobuf:"varint,6,opt,name=writeback,proto3" json:"writeback,omitempty"` + PgPgIn uint64 `protobuf:"varint,7,opt,name=pg_pg_in,json=pgPgIn,proto3" json:"pg_pg_in,omitempty"` + PgPgOut uint64 `protobuf:"varint,8,opt,name=pg_pg_out,json=pgPgOut,proto3" json:"pg_pg_out,omitempty"` + PgFault uint64 `protobuf:"varint,9,opt,name=pg_fault,json=pgFault,proto3" json:"pg_fault,omitempty"` + PgMajFault uint64 `protobuf:"varint,10,opt,name=pg_maj_fault,json=pgMajFault,proto3" json:"pg_maj_fault,omitempty"` + InactiveAnon uint64 `protobuf:"varint,11,opt,name=inactive_anon,json=inactiveAnon,proto3" json:"inactive_anon,omitempty"` + ActiveAnon uint64 `protobuf:"varint,12,opt,name=active_anon,json=activeAnon,proto3" json:"active_anon,omitempty"` + InactiveFile uint64 `protobuf:"varint,13,opt,name=inactive_file,json=inactiveFile,proto3" json:"inactive_file,omitempty"` + ActiveFile uint64 `protobuf:"varint,14,opt,name=active_file,json=activeFile,proto3" json:"active_file,omitempty"` + Unevictable uint64 `protobuf:"varint,15,opt,name=unevictable,proto3" json:"unevictable,omitempty"` + HierarchicalMemoryLimit uint64 `protobuf:"varint,16,opt,name=hierarchical_memory_limit,json=hierarchicalMemoryLimit,proto3" json:"hierarchical_memory_limit,omitempty"` + HierarchicalSwapLimit uint64 `protobuf:"varint,17,opt,name=hierarchical_swap_limit,json=hierarchicalSwapLimit,proto3" json:"hierarchical_swap_limit,omitempty"` + TotalCache uint64 `protobuf:"varint,18,opt,name=total_cache,json=totalCache,proto3" json:"total_cache,omitempty"` + TotalRSS uint64 `protobuf:"varint,19,opt,name=total_rss,json=totalRss,proto3" json:"total_rss,omitempty"` + TotalRSSHuge uint64 `protobuf:"varint,20,opt,name=total_rss_huge,json=totalRssHuge,proto3" json:"total_rss_huge,omitempty"` + TotalMappedFile uint64 `protobuf:"varint,21,opt,name=total_mapped_file,json=totalMappedFile,proto3" json:"total_mapped_file,omitempty"` + TotalDirty uint64 `protobuf:"varint,22,opt,name=total_dirty,json=totalDirty,proto3" json:"total_dirty,omitempty"` + TotalWriteback uint64 `protobuf:"varint,23,opt,name=total_writeback,json=totalWriteback,proto3" json:"total_writeback,omitempty"` + TotalPgPgIn uint64 `protobuf:"varint,24,opt,name=total_pg_pg_in,json=totalPgPgIn,proto3" json:"total_pg_pg_in,omitempty"` + TotalPgPgOut uint64 `protobuf:"varint,25,opt,name=total_pg_pg_out,json=totalPgPgOut,proto3" json:"total_pg_pg_out,omitempty"` + TotalPgFault uint64 `protobuf:"varint,26,opt,name=total_pg_fault,json=totalPgFault,proto3" json:"total_pg_fault,omitempty"` + TotalPgMajFault uint64 `protobuf:"varint,27,opt,name=total_pg_maj_fault,json=totalPgMajFault,proto3" json:"total_pg_maj_fault,omitempty"` + TotalInactiveAnon uint64 `protobuf:"varint,28,opt,name=total_inactive_anon,json=totalInactiveAnon,proto3" json:"total_inactive_anon,omitempty"` + TotalActiveAnon uint64 `protobuf:"varint,29,opt,name=total_active_anon,json=totalActiveAnon,proto3" json:"total_active_anon,omitempty"` + TotalInactiveFile uint64 `protobuf:"varint,30,opt,name=total_inactive_file,json=totalInactiveFile,proto3" json:"total_inactive_file,omitempty"` + TotalActiveFile uint64 `protobuf:"varint,31,opt,name=total_active_file,json=totalActiveFile,proto3" json:"total_active_file,omitempty"` + TotalUnevictable uint64 `protobuf:"varint,32,opt,name=total_unevictable,json=totalUnevictable,proto3" json:"total_unevictable,omitempty"` + Usage *MemoryEntry `protobuf:"bytes,33,opt,name=usage,proto3" json:"usage,omitempty"` + Swap *MemoryEntry `protobuf:"bytes,34,opt,name=swap,proto3" json:"swap,omitempty"` + Kernel *MemoryEntry `protobuf:"bytes,35,opt,name=kernel,proto3" json:"kernel,omitempty"` + KernelTCP *MemoryEntry `protobuf:"bytes,36,opt,name=kernel_tcp,json=kernelTcp,proto3" json:"kernel_tcp,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryStat) Reset() { *m = MemoryStat{} } +func (*MemoryStat) ProtoMessage() {} +func (*MemoryStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{6} +} +func (m *MemoryStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryStat.Merge(m, src) +} +func (m *MemoryStat) XXX_Size() int { + return m.Size() +} +func (m *MemoryStat) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryStat.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryStat proto.InternalMessageInfo + +type MemoryEntry struct { + Limit uint64 `protobuf:"varint,1,opt,name=limit,proto3" json:"limit,omitempty"` + Usage uint64 `protobuf:"varint,2,opt,name=usage,proto3" json:"usage,omitempty"` + Max uint64 `protobuf:"varint,3,opt,name=max,proto3" json:"max,omitempty"` + Failcnt uint64 `protobuf:"varint,4,opt,name=failcnt,proto3" json:"failcnt,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *MemoryEntry) Reset() { *m = MemoryEntry{} } +func (*MemoryEntry) ProtoMessage() {} +func (*MemoryEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{7} +} +func (m *MemoryEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *MemoryEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_MemoryEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *MemoryEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_MemoryEntry.Merge(m, src) +} +func (m *MemoryEntry) XXX_Size() int { + return m.Size() +} +func (m *MemoryEntry) XXX_DiscardUnknown() { + xxx_messageInfo_MemoryEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_MemoryEntry proto.InternalMessageInfo + +type BlkIOStat struct { + IoServiceBytesRecursive []*BlkIOEntry `protobuf:"bytes,1,rep,name=io_service_bytes_recursive,json=ioServiceBytesRecursive,proto3" json:"io_service_bytes_recursive,omitempty"` + IoServicedRecursive []*BlkIOEntry `protobuf:"bytes,2,rep,name=io_serviced_recursive,json=ioServicedRecursive,proto3" json:"io_serviced_recursive,omitempty"` + IoQueuedRecursive []*BlkIOEntry `protobuf:"bytes,3,rep,name=io_queued_recursive,json=ioQueuedRecursive,proto3" json:"io_queued_recursive,omitempty"` + IoServiceTimeRecursive []*BlkIOEntry `protobuf:"bytes,4,rep,name=io_service_time_recursive,json=ioServiceTimeRecursive,proto3" json:"io_service_time_recursive,omitempty"` + IoWaitTimeRecursive []*BlkIOEntry `protobuf:"bytes,5,rep,name=io_wait_time_recursive,json=ioWaitTimeRecursive,proto3" json:"io_wait_time_recursive,omitempty"` + IoMergedRecursive []*BlkIOEntry `protobuf:"bytes,6,rep,name=io_merged_recursive,json=ioMergedRecursive,proto3" json:"io_merged_recursive,omitempty"` + IoTimeRecursive []*BlkIOEntry `protobuf:"bytes,7,rep,name=io_time_recursive,json=ioTimeRecursive,proto3" json:"io_time_recursive,omitempty"` + SectorsRecursive []*BlkIOEntry `protobuf:"bytes,8,rep,name=sectors_recursive,json=sectorsRecursive,proto3" json:"sectors_recursive,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BlkIOStat) Reset() { *m = BlkIOStat{} } +func (*BlkIOStat) ProtoMessage() {} +func (*BlkIOStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{8} +} +func (m *BlkIOStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *BlkIOStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_BlkIOStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *BlkIOStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_BlkIOStat.Merge(m, src) +} +func (m *BlkIOStat) XXX_Size() int { + return m.Size() +} +func (m *BlkIOStat) XXX_DiscardUnknown() { + xxx_messageInfo_BlkIOStat.DiscardUnknown(m) +} + +var xxx_messageInfo_BlkIOStat proto.InternalMessageInfo + +type BlkIOEntry struct { + Op string `protobuf:"bytes,1,opt,name=op,proto3" json:"op,omitempty"` + Device string `protobuf:"bytes,2,opt,name=device,proto3" json:"device,omitempty"` + Major uint64 `protobuf:"varint,3,opt,name=major,proto3" json:"major,omitempty"` + Minor uint64 `protobuf:"varint,4,opt,name=minor,proto3" json:"minor,omitempty"` + Value uint64 `protobuf:"varint,5,opt,name=value,proto3" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BlkIOEntry) Reset() { *m = BlkIOEntry{} } +func (*BlkIOEntry) ProtoMessage() {} +func (*BlkIOEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{9} +} +func (m *BlkIOEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *BlkIOEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_BlkIOEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *BlkIOEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_BlkIOEntry.Merge(m, src) +} +func (m *BlkIOEntry) XXX_Size() int { + return m.Size() +} +func (m *BlkIOEntry) XXX_DiscardUnknown() { + xxx_messageInfo_BlkIOEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_BlkIOEntry proto.InternalMessageInfo + +type RdmaStat struct { + Current []*RdmaEntry `protobuf:"bytes,1,rep,name=current,proto3" json:"current,omitempty"` + Limit []*RdmaEntry `protobuf:"bytes,2,rep,name=limit,proto3" json:"limit,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *RdmaStat) Reset() { *m = RdmaStat{} } +func (*RdmaStat) ProtoMessage() {} +func (*RdmaStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{10} +} +func (m *RdmaStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *RdmaStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_RdmaStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *RdmaStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_RdmaStat.Merge(m, src) +} +func (m *RdmaStat) XXX_Size() int { + return m.Size() +} +func (m *RdmaStat) XXX_DiscardUnknown() { + xxx_messageInfo_RdmaStat.DiscardUnknown(m) +} + +var xxx_messageInfo_RdmaStat proto.InternalMessageInfo + +type RdmaEntry struct { + Device string `protobuf:"bytes,1,opt,name=device,proto3" json:"device,omitempty"` + HcaHandles uint32 `protobuf:"varint,2,opt,name=hca_handles,json=hcaHandles,proto3" json:"hca_handles,omitempty"` + HcaObjects uint32 `protobuf:"varint,3,opt,name=hca_objects,json=hcaObjects,proto3" json:"hca_objects,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *RdmaEntry) Reset() { *m = RdmaEntry{} } +func (*RdmaEntry) ProtoMessage() {} +func (*RdmaEntry) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{11} +} +func (m *RdmaEntry) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *RdmaEntry) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_RdmaEntry.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *RdmaEntry) XXX_Merge(src proto.Message) { + xxx_messageInfo_RdmaEntry.Merge(m, src) +} +func (m *RdmaEntry) XXX_Size() int { + return m.Size() +} +func (m *RdmaEntry) XXX_DiscardUnknown() { + xxx_messageInfo_RdmaEntry.DiscardUnknown(m) +} + +var xxx_messageInfo_RdmaEntry proto.InternalMessageInfo + +type NetworkStat struct { + Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"` + RxBytes uint64 `protobuf:"varint,2,opt,name=rx_bytes,json=rxBytes,proto3" json:"rx_bytes,omitempty"` + RxPackets uint64 `protobuf:"varint,3,opt,name=rx_packets,json=rxPackets,proto3" json:"rx_packets,omitempty"` + RxErrors uint64 `protobuf:"varint,4,opt,name=rx_errors,json=rxErrors,proto3" json:"rx_errors,omitempty"` + RxDropped uint64 `protobuf:"varint,5,opt,name=rx_dropped,json=rxDropped,proto3" json:"rx_dropped,omitempty"` + TxBytes uint64 `protobuf:"varint,6,opt,name=tx_bytes,json=txBytes,proto3" json:"tx_bytes,omitempty"` + TxPackets uint64 `protobuf:"varint,7,opt,name=tx_packets,json=txPackets,proto3" json:"tx_packets,omitempty"` + TxErrors uint64 `protobuf:"varint,8,opt,name=tx_errors,json=txErrors,proto3" json:"tx_errors,omitempty"` + TxDropped uint64 `protobuf:"varint,9,opt,name=tx_dropped,json=txDropped,proto3" json:"tx_dropped,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *NetworkStat) Reset() { *m = NetworkStat{} } +func (*NetworkStat) ProtoMessage() {} +func (*NetworkStat) Descriptor() ([]byte, []int) { + return fileDescriptor_a17b2d87c332bfaa, []int{12} +} +func (m *NetworkStat) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *NetworkStat) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_NetworkStat.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *NetworkStat) XXX_Merge(src proto.Message) { + xxx_messageInfo_NetworkStat.Merge(m, src) +} +func (m *NetworkStat) XXX_Size() int { + return m.Size() +} +func (m *NetworkStat) XXX_DiscardUnknown() { + xxx_messageInfo_NetworkStat.DiscardUnknown(m) +} + +var xxx_messageInfo_NetworkStat proto.InternalMessageInfo + +func init() { + proto.RegisterType((*Metrics)(nil), "io.containerd.cgroups.v1.Metrics") + proto.RegisterType((*HugetlbStat)(nil), "io.containerd.cgroups.v1.HugetlbStat") + proto.RegisterType((*PidsStat)(nil), "io.containerd.cgroups.v1.PidsStat") + proto.RegisterType((*CPUStat)(nil), "io.containerd.cgroups.v1.CPUStat") + proto.RegisterType((*CPUUsage)(nil), "io.containerd.cgroups.v1.CPUUsage") + proto.RegisterType((*Throttle)(nil), "io.containerd.cgroups.v1.Throttle") + proto.RegisterType((*MemoryStat)(nil), "io.containerd.cgroups.v1.MemoryStat") + proto.RegisterType((*MemoryEntry)(nil), "io.containerd.cgroups.v1.MemoryEntry") + proto.RegisterType((*BlkIOStat)(nil), "io.containerd.cgroups.v1.BlkIOStat") + proto.RegisterType((*BlkIOEntry)(nil), "io.containerd.cgroups.v1.BlkIOEntry") + proto.RegisterType((*RdmaStat)(nil), "io.containerd.cgroups.v1.RdmaStat") + proto.RegisterType((*RdmaEntry)(nil), "io.containerd.cgroups.v1.RdmaEntry") + proto.RegisterType((*NetworkStat)(nil), "io.containerd.cgroups.v1.NetworkStat") +} + +func init() { + proto.RegisterFile("github.com/containerd/cgroups/stats/v1/metrics.proto", fileDescriptor_a17b2d87c332bfaa) +} + +var fileDescriptor_a17b2d87c332bfaa = []byte{ + // 1558 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x57, 0xcf, 0x73, 0x13, 0x39, + 0x16, 0xc6, 0xb1, 0x13, 0xbb, 0x9f, 0x93, 0x90, 0x28, 0x10, 0x3a, 0x01, 0xe2, 0xe0, 0x24, 0xbb, + 0xd9, 0xa5, 0xca, 0x29, 0xd8, 0x2d, 0x6a, 0x61, 0xa1, 0xb6, 0x70, 0x80, 0x82, 0xda, 0xcd, 0x62, + 0xda, 0x49, 0xb1, 0x7b, 0xea, 0x92, 0xdb, 0xa2, 0xad, 0xc4, 0x6e, 0x35, 0x6a, 0xb5, 0xe3, 0xcc, + 0x69, 0x0e, 0x53, 0x35, 0xa7, 0xf9, 0x67, 0xe6, 0xaf, 0xe0, 0x38, 0x97, 0xa9, 0x9a, 0xb9, 0xa4, + 0x06, 0xff, 0x25, 0x53, 0x92, 0xfa, 0x87, 0x0c, 0x84, 0x8c, 0x6f, 0x2d, 0xe9, 0xfb, 0xbe, 0xf7, + 0xf4, 0xfa, 0x53, 0xeb, 0x35, 0xfc, 0xdd, 0xa7, 0xa2, 0x17, 0x77, 0x1a, 0x1e, 0x1b, 0xec, 0x79, + 0x2c, 0x10, 0x98, 0x06, 0x84, 0x77, 0xf7, 0x3c, 0x9f, 0xb3, 0x38, 0x8c, 0xf6, 0x22, 0x81, 0x45, + 0xb4, 0x37, 0xbc, 0xb7, 0x37, 0x20, 0x82, 0x53, 0x2f, 0x6a, 0x84, 0x9c, 0x09, 0x86, 0x6c, 0xca, + 0x1a, 0x39, 0xba, 0x91, 0xa0, 0x1b, 0xc3, 0x7b, 0xeb, 0xd7, 0x7c, 0xe6, 0x33, 0x05, 0xda, 0x93, + 0x4f, 0x1a, 0x5f, 0xff, 0xb1, 0x08, 0xe5, 0x03, 0xad, 0x80, 0xfe, 0x05, 0xe5, 0x5e, 0xec, 0x13, + 0xd1, 0xef, 0xd8, 0x85, 0xcd, 0xe2, 0x6e, 0xf5, 0xfe, 0x4e, 0xe3, 0x22, 0xb5, 0xc6, 0x4b, 0x0d, + 0x6c, 0x0b, 0x2c, 0x9c, 0x94, 0x85, 0x1e, 0x40, 0x29, 0xa4, 0xdd, 0xc8, 0x9e, 0xd9, 0x2c, 0xec, + 0x56, 0xef, 0xd7, 0x2f, 0x66, 0xb7, 0x68, 0x37, 0x52, 0x54, 0x85, 0x47, 0x8f, 0xa1, 0xe8, 0x85, + 0xb1, 0x5d, 0x54, 0xb4, 0x3b, 0x17, 0xd3, 0xf6, 0x5b, 0x47, 0x92, 0xd5, 0x2c, 0x8f, 0xcf, 0x6b, + 0xc5, 0xfd, 0xd6, 0x91, 0x23, 0x69, 0xe8, 0x31, 0xcc, 0x0d, 0xc8, 0x80, 0xf1, 0x33, 0xbb, 0xa4, + 0x04, 0xb6, 0x2f, 0x16, 0x38, 0x50, 0x38, 0x15, 0x39, 0xe1, 0xa0, 0x87, 0x30, 0xdb, 0xe9, 0x9f, + 0x50, 0x66, 0xcf, 0x2a, 0xf2, 0xd6, 0xc5, 0xe4, 0x66, 0xff, 0xe4, 0xd5, 0x6b, 0xc5, 0xd5, 0x0c, + 0xb9, 0x5d, 0xde, 0x1d, 0x60, 0x7b, 0xee, 0xb2, 0xed, 0x3a, 0xdd, 0x01, 0xd6, 0xdb, 0x95, 0x78, + 0x59, 0xe7, 0x80, 0x88, 0x53, 0xc6, 0x4f, 0xec, 0xf2, 0x65, 0x75, 0xfe, 0xaf, 0x06, 0xea, 0x3a, + 0x27, 0xac, 0xfa, 0x09, 0x54, 0x8d, 0xfa, 0xa3, 0x6b, 0x30, 0x1b, 0x47, 0xd8, 0x27, 0x76, 0x61, + 0xb3, 0xb0, 0x5b, 0x72, 0xf4, 0x00, 0x2d, 0x41, 0x71, 0x80, 0x47, 0xea, 0x5d, 0x94, 0x1c, 0xf9, + 0x88, 0x6c, 0x28, 0xbf, 0xc3, 0xb4, 0xef, 0x05, 0x42, 0x95, 0xba, 0xe4, 0xa4, 0x43, 0xb4, 0x0e, + 0x95, 0x10, 0xfb, 0x24, 0xa2, 0xdf, 0x10, 0x55, 0x44, 0xcb, 0xc9, 0xc6, 0xf5, 0x47, 0x50, 0x49, + 0x5f, 0x97, 0x54, 0xf0, 0x62, 0xce, 0x49, 0x20, 0x92, 0x58, 0xe9, 0x50, 0xe6, 0xd0, 0xa7, 0x03, + 0x2a, 0x92, 0x78, 0x7a, 0x50, 0xff, 0xbe, 0x00, 0xe5, 0xe4, 0xa5, 0xa1, 0x7f, 0x98, 0x59, 0x7e, + 0xb5, 0x5c, 0xfb, 0xad, 0xa3, 0x23, 0x89, 0x4c, 0x77, 0xd2, 0x04, 0x10, 0x3d, 0xce, 0x84, 0xe8, + 0xd3, 0xc0, 0xbf, 0xdc, 0x5c, 0x87, 0x1a, 0x4b, 0x1c, 0x83, 0x55, 0x7f, 0x0f, 0x95, 0x54, 0x56, + 0xe6, 0x2a, 0x98, 0xc0, 0xfd, 0xb4, 0x5e, 0x6a, 0x80, 0x56, 0x61, 0xee, 0x84, 0xf0, 0x80, 0xf4, + 0x93, 0x2d, 0x24, 0x23, 0x84, 0xa0, 0x14, 0x47, 0x84, 0x27, 0x25, 0x53, 0xcf, 0x68, 0x0b, 0xca, + 0x21, 0xe1, 0xae, 0x34, 0x6d, 0x69, 0xb3, 0xb8, 0x5b, 0x6a, 0xc2, 0xf8, 0xbc, 0x36, 0xd7, 0x22, + 0x5c, 0x9a, 0x72, 0x2e, 0x24, 0x7c, 0x3f, 0x8c, 0xeb, 0x23, 0xa8, 0xa4, 0xa9, 0xc8, 0xc2, 0x85, + 0x84, 0x53, 0xd6, 0x8d, 0xd2, 0xc2, 0x25, 0x43, 0x74, 0x17, 0x96, 0x93, 0x34, 0x49, 0xd7, 0x4d, + 0x31, 0x3a, 0x83, 0xa5, 0x6c, 0xa1, 0x95, 0x80, 0x77, 0x60, 0x31, 0x07, 0x0b, 0x3a, 0x20, 0x49, + 0x56, 0x0b, 0xd9, 0xec, 0x21, 0x1d, 0x90, 0xfa, 0xaf, 0x55, 0x80, 0xdc, 0xea, 0x72, 0xbf, 0x1e, + 0xf6, 0x7a, 0x99, 0x3f, 0xd4, 0x00, 0xad, 0x41, 0x91, 0x47, 0x49, 0x28, 0x7d, 0xa2, 0x9c, 0x76, + 0xdb, 0x91, 0x73, 0xe8, 0x4f, 0x50, 0xe1, 0x51, 0xe4, 0xca, 0x63, 0xad, 0x03, 0x34, 0xab, 0xe3, + 0xf3, 0x5a, 0xd9, 0x69, 0xb7, 0xa5, 0xed, 0x9c, 0x32, 0x8f, 0x22, 0xf9, 0x80, 0x6a, 0x50, 0x1d, + 0xe0, 0x30, 0x24, 0x5d, 0xf7, 0x1d, 0xed, 0x6b, 0xe7, 0x94, 0x1c, 0xd0, 0x53, 0x2f, 0x68, 0x5f, + 0x55, 0xba, 0x4b, 0xb9, 0x38, 0x53, 0x87, 0xab, 0xe4, 0xe8, 0x01, 0xba, 0x05, 0xd6, 0x29, 0xa7, + 0x82, 0x74, 0xb0, 0x77, 0xa2, 0x0e, 0x4f, 0xc9, 0xc9, 0x27, 0x90, 0x0d, 0x95, 0xd0, 0x77, 0x43, + 0xdf, 0xa5, 0x81, 0x5d, 0xd6, 0x6f, 0x22, 0xf4, 0x5b, 0xfe, 0xab, 0x00, 0xad, 0x83, 0xa5, 0x57, + 0x58, 0x2c, 0xec, 0x4a, 0x52, 0x46, 0xbf, 0xe5, 0xbf, 0x8e, 0x05, 0x5a, 0x53, 0xac, 0x77, 0x38, + 0xee, 0x0b, 0xdb, 0x4a, 0x97, 0x5e, 0xc8, 0x21, 0xda, 0x84, 0xf9, 0xd0, 0x77, 0x07, 0xf8, 0x38, + 0x59, 0x06, 0x9d, 0x66, 0xe8, 0x1f, 0xe0, 0x63, 0x8d, 0xd8, 0x82, 0x05, 0x1a, 0x60, 0x4f, 0xd0, + 0x21, 0x71, 0x71, 0xc0, 0x02, 0xbb, 0xaa, 0x20, 0xf3, 0xe9, 0xe4, 0xd3, 0x80, 0x05, 0x72, 0xb3, + 0x26, 0x64, 0x5e, 0xab, 0x18, 0x00, 0x53, 0x45, 0xd5, 0x63, 0x61, 0x52, 0x45, 0x55, 0x24, 0x57, + 0x51, 0x90, 0x45, 0x53, 0x45, 0x01, 0x36, 0xa1, 0x1a, 0x07, 0x64, 0x48, 0x3d, 0x81, 0x3b, 0x7d, + 0x62, 0x5f, 0x55, 0x00, 0x73, 0x0a, 0x3d, 0x82, 0xb5, 0x1e, 0x25, 0x1c, 0x73, 0xaf, 0x47, 0x3d, + 0xdc, 0x77, 0xf5, 0x87, 0xcc, 0xd5, 0xc7, 0x6f, 0x49, 0xe1, 0x6f, 0x98, 0x00, 0xed, 0x84, 0xff, + 0xc8, 0x65, 0xf4, 0x00, 0x26, 0x96, 0xdc, 0xe8, 0x14, 0x87, 0x09, 0x73, 0x59, 0x31, 0xaf, 0x9b, + 0xcb, 0xed, 0x53, 0x1c, 0x6a, 0x5e, 0x0d, 0xaa, 0xea, 0x94, 0xb8, 0xda, 0x48, 0x48, 0xa7, 0xad, + 0xa6, 0xf6, 0x95, 0x9b, 0xfe, 0x02, 0x96, 0x06, 0x48, 0x4f, 0xad, 0x28, 0xcf, 0xcc, 0x8f, 0xcf, + 0x6b, 0x95, 0x43, 0x39, 0x29, 0x8d, 0x55, 0x51, 0xcb, 0x4e, 0x14, 0xa1, 0x07, 0xb0, 0x98, 0x41, + 0xb5, 0xc7, 0xae, 0x29, 0xfc, 0xd2, 0xf8, 0xbc, 0x36, 0x9f, 0xe2, 0x95, 0xd1, 0xe6, 0x53, 0x8e, + 0x72, 0xdb, 0x5f, 0x61, 0x59, 0xf3, 0x4c, 0xcf, 0x5d, 0x57, 0x99, 0x5c, 0x55, 0x0b, 0x07, 0xb9, + 0xf1, 0xb2, 0x7c, 0xb5, 0xfd, 0x56, 0x8d, 0x7c, 0x9f, 0x29, 0x0f, 0xfe, 0x19, 0x34, 0xc7, 0xcd, + 0x9d, 0x78, 0x43, 0x81, 0x74, 0x6e, 0x6f, 0x33, 0x3b, 0x6e, 0xa5, 0xd9, 0x66, 0xa6, 0xb4, 0xf5, + 0x2b, 0x51, 0xb3, 0x2d, 0xed, 0xcc, 0x9d, 0x54, 0x2d, 0xf7, 0xe7, 0x9a, 0x7e, 0xf9, 0x19, 0x4a, + 0x9a, 0x74, 0xdb, 0xd0, 0xd2, 0x5e, 0x5c, 0x9f, 0x40, 0x69, 0x37, 0xde, 0x05, 0x94, 0xa1, 0x72, + 0xd7, 0xde, 0x34, 0x36, 0xda, 0xca, 0xad, 0xdb, 0x80, 0x15, 0x0d, 0x9e, 0x34, 0xf0, 0x2d, 0x85, + 0xd6, 0xf5, 0x7a, 0x65, 0xba, 0x38, 0x2b, 0xa2, 0x89, 0xbe, 0x6d, 0x68, 0x3f, 0xcd, 0xb1, 0x9f, + 0x6b, 0xab, 0x92, 0x6f, 0x7c, 0x41, 0x5b, 0x15, 0xfd, 0x53, 0x6d, 0x85, 0xae, 0x7d, 0xa6, 0xad, + 0xb0, 0x77, 0x53, 0xac, 0x69, 0xf6, 0xcd, 0xe4, 0xb3, 0x27, 0x17, 0x8e, 0x0c, 0xc7, 0xff, 0x33, + 0xbd, 0x3a, 0xee, 0xa8, 0x6f, 0xff, 0xce, 0x65, 0x17, 0xfc, 0xf3, 0x40, 0xf0, 0xb3, 0xf4, 0xf6, + 0x78, 0x08, 0x25, 0xe9, 0x72, 0xbb, 0x3e, 0x0d, 0x57, 0x51, 0xd0, 0x93, 0xec, 0x4a, 0xd8, 0x9a, + 0x86, 0x9c, 0xde, 0x1c, 0x6d, 0x00, 0xfd, 0xe4, 0x0a, 0x2f, 0xb4, 0xb7, 0xa7, 0x90, 0x68, 0x2e, + 0x8c, 0xcf, 0x6b, 0xd6, 0xbf, 0x15, 0xf9, 0x70, 0xbf, 0xe5, 0x58, 0x5a, 0xe7, 0xd0, 0x0b, 0xeb, + 0x04, 0xaa, 0x06, 0x30, 0xbf, 0x77, 0x0b, 0xc6, 0xbd, 0x9b, 0x77, 0x04, 0x33, 0x5f, 0xe8, 0x08, + 0x8a, 0x5f, 0xec, 0x08, 0x4a, 0x13, 0x1d, 0x41, 0xfd, 0xe7, 0x59, 0xb0, 0xb2, 0x86, 0x07, 0x61, + 0x58, 0xa7, 0xcc, 0x8d, 0x08, 0x1f, 0x52, 0x8f, 0xb8, 0x9d, 0x33, 0x41, 0x22, 0x97, 0x13, 0x2f, + 0xe6, 0x11, 0x1d, 0x92, 0xa4, 0x59, 0xdc, 0xbe, 0xa4, 0x73, 0xd2, 0xb5, 0xb9, 0x41, 0x59, 0x5b, + 0xcb, 0x34, 0xa5, 0x8a, 0x93, 0x8a, 0xa0, 0xff, 0xc1, 0xf5, 0x3c, 0x44, 0xd7, 0x50, 0x9f, 0x99, + 0x42, 0x7d, 0x25, 0x53, 0xef, 0xe6, 0xca, 0x87, 0xb0, 0x42, 0x99, 0xfb, 0x3e, 0x26, 0xf1, 0x84, + 0x6e, 0x71, 0x0a, 0xdd, 0x65, 0xca, 0xde, 0x28, 0x7e, 0xae, 0xea, 0xc2, 0x9a, 0x51, 0x12, 0x79, + 0x17, 0x1b, 0xda, 0xa5, 0x29, 0xb4, 0x57, 0xb3, 0x9c, 0xe5, 0xdd, 0x9d, 0x07, 0xf8, 0x3f, 0xac, + 0x52, 0xe6, 0x9e, 0x62, 0x2a, 0x3e, 0x55, 0x9f, 0x9d, 0xae, 0x22, 0x6f, 0x31, 0x15, 0x93, 0xd2, + 0xba, 0x22, 0x03, 0xc2, 0xfd, 0x89, 0x8a, 0xcc, 0x4d, 0x57, 0x91, 0x03, 0xc5, 0xcf, 0x55, 0x5b, + 0xb0, 0x4c, 0xd9, 0xa7, 0xb9, 0x96, 0xa7, 0xd0, 0xbc, 0x4a, 0xd9, 0x64, 0x9e, 0x6f, 0x60, 0x39, + 0x22, 0x9e, 0x60, 0xdc, 0x74, 0x5b, 0x65, 0x0a, 0xc5, 0xa5, 0x84, 0x9e, 0x49, 0xd6, 0x87, 0x00, + 0xf9, 0x3a, 0x5a, 0x84, 0x19, 0x16, 0xaa, 0xa3, 0x63, 0x39, 0x33, 0x2c, 0x94, 0x3d, 0x60, 0x57, + 0x7e, 0x76, 0xf4, 0xc1, 0xb1, 0x9c, 0x64, 0x24, 0xcf, 0xd3, 0x00, 0x1f, 0xb3, 0xb4, 0x09, 0xd4, + 0x03, 0x35, 0x4b, 0x03, 0xc6, 0x93, 0xb3, 0xa3, 0x07, 0x72, 0x76, 0x88, 0xfb, 0x31, 0x49, 0x7b, + 0x1e, 0x35, 0xa8, 0x7f, 0x57, 0x80, 0x4a, 0xfa, 0x1b, 0x80, 0x9e, 0x98, 0x6d, 0x74, 0xf1, 0xeb, + 0x7f, 0x1d, 0x92, 0xa4, 0x37, 0x93, 0xf5, 0xda, 0x0f, 0xf3, 0x5e, 0xfb, 0x0f, 0x93, 0x93, 0x86, + 0x9c, 0x80, 0x95, 0xcd, 0x19, 0xbb, 0x2d, 0x4c, 0xec, 0xb6, 0x06, 0xd5, 0x9e, 0x87, 0xdd, 0x1e, + 0x0e, 0xba, 0x7d, 0xa2, 0x3b, 0xc4, 0x05, 0x07, 0x7a, 0x1e, 0x7e, 0xa9, 0x67, 0x52, 0x00, 0xeb, + 0x1c, 0x13, 0x4f, 0x44, 0xaa, 0x28, 0x1a, 0xf0, 0x5a, 0xcf, 0xd4, 0x7f, 0x98, 0x81, 0xaa, 0xf1, + 0xe7, 0x22, 0x7b, 0xe8, 0x00, 0x0f, 0xd2, 0x38, 0xea, 0x59, 0x76, 0x6c, 0x7c, 0xa4, 0xbf, 0x25, + 0xc9, 0x67, 0xaa, 0xcc, 0x47, 0xea, 0xa3, 0x80, 0x6e, 0x03, 0xf0, 0x91, 0x1b, 0x62, 0xef, 0x84, + 0x24, 0xf2, 0x25, 0xc7, 0xe2, 0xa3, 0x96, 0x9e, 0x40, 0x37, 0xc1, 0xe2, 0x23, 0x97, 0x70, 0xce, + 0x78, 0x94, 0xd4, 0xbe, 0xc2, 0x47, 0xcf, 0xd5, 0x38, 0xe1, 0x76, 0x39, 0x93, 0xbd, 0x40, 0xf2, + 0x0e, 0x2c, 0x3e, 0x7a, 0xa6, 0x27, 0x64, 0x54, 0x91, 0x46, 0xd5, 0xad, 0x67, 0x59, 0xe4, 0x51, + 0x45, 0x1e, 0x55, 0xb7, 0x9e, 0x96, 0x30, 0xa3, 0x8a, 0x2c, 0xaa, 0xee, 0x3e, 0x2b, 0xc2, 0x88, + 0x2a, 0xf2, 0xa8, 0x56, 0xca, 0x4d, 0xa2, 0x36, 0xed, 0x0f, 0x1f, 0x37, 0xae, 0xfc, 0xf2, 0x71, + 0xe3, 0xca, 0xb7, 0xe3, 0x8d, 0xc2, 0x87, 0xf1, 0x46, 0xe1, 0xa7, 0xf1, 0x46, 0xe1, 0xb7, 0xf1, + 0x46, 0xa1, 0x33, 0xa7, 0x7e, 0xc3, 0xff, 0xf6, 0x7b, 0x00, 0x00, 0x00, 0xff, 0xff, 0x2f, 0xc0, + 0x49, 0x92, 0xee, 0x0f, 0x00, 0x00, +} + +func (m *Metrics) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Metrics) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Hugetlb) > 0 { + for _, msg := range m.Hugetlb { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.Pids != nil { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Pids.Size())) + n1, err := m.Pids.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n1 + } + if m.CPU != nil { + dAtA[i] = 0x1a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.CPU.Size())) + n2, err := m.CPU.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n2 + } + if m.Memory != nil { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Memory.Size())) + n3, err := m.Memory.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n3 + } + if m.Blkio != nil { + dAtA[i] = 0x2a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Blkio.Size())) + n4, err := m.Blkio.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n4 + } + if m.Rdma != nil { + dAtA[i] = 0x32 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Rdma.Size())) + n5, err := m.Rdma.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n5 + } + if len(m.Network) > 0 { + for _, msg := range m.Network { + dAtA[i] = 0x3a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *HugetlbStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *HugetlbStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Usage != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage)) + } + if m.Max != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Max)) + } + if m.Failcnt != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Failcnt)) + } + if len(m.Pagesize) > 0 { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Pagesize))) + i += copy(dAtA[i:], m.Pagesize) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *PidsStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *PidsStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Current != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Current)) + } + if m.Limit != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Limit)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *CPUStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CPUStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Usage != nil { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage.Size())) + n6, err := m.Usage.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n6 + } + if m.Throttling != nil { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Throttling.Size())) + n7, err := m.Throttling.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n7 + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *CPUUsage) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *CPUUsage) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Total != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Total)) + } + if m.Kernel != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Kernel)) + } + if m.User != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.User)) + } + if len(m.PerCPU) > 0 { + dAtA9 := make([]byte, len(m.PerCPU)*10) + var j8 int + for _, num := range m.PerCPU { + for num >= 1<<7 { + dAtA9[j8] = uint8(uint64(num)&0x7f | 0x80) + num >>= 7 + j8++ + } + dAtA9[j8] = uint8(num) + j8++ + } + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(j8)) + i += copy(dAtA[i:], dAtA9[:j8]) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *Throttle) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Throttle) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Periods != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Periods)) + } + if m.ThrottledPeriods != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ThrottledPeriods)) + } + if m.ThrottledTime != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ThrottledTime)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *MemoryStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Cache != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Cache)) + } + if m.RSS != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RSS)) + } + if m.RSSHuge != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RSSHuge)) + } + if m.MappedFile != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.MappedFile)) + } + if m.Dirty != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Dirty)) + } + if m.Writeback != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Writeback)) + } + if m.PgPgIn != 0 { + dAtA[i] = 0x38 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgPgIn)) + } + if m.PgPgOut != 0 { + dAtA[i] = 0x40 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgPgOut)) + } + if m.PgFault != 0 { + dAtA[i] = 0x48 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgFault)) + } + if m.PgMajFault != 0 { + dAtA[i] = 0x50 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.PgMajFault)) + } + if m.InactiveAnon != 0 { + dAtA[i] = 0x58 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.InactiveAnon)) + } + if m.ActiveAnon != 0 { + dAtA[i] = 0x60 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ActiveAnon)) + } + if m.InactiveFile != 0 { + dAtA[i] = 0x68 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.InactiveFile)) + } + if m.ActiveFile != 0 { + dAtA[i] = 0x70 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.ActiveFile)) + } + if m.Unevictable != 0 { + dAtA[i] = 0x78 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Unevictable)) + } + if m.HierarchicalMemoryLimit != 0 { + dAtA[i] = 0x80 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HierarchicalMemoryLimit)) + } + if m.HierarchicalSwapLimit != 0 { + dAtA[i] = 0x88 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HierarchicalSwapLimit)) + } + if m.TotalCache != 0 { + dAtA[i] = 0x90 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalCache)) + } + if m.TotalRSS != 0 { + dAtA[i] = 0x98 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalRSS)) + } + if m.TotalRSSHuge != 0 { + dAtA[i] = 0xa0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalRSSHuge)) + } + if m.TotalMappedFile != 0 { + dAtA[i] = 0xa8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalMappedFile)) + } + if m.TotalDirty != 0 { + dAtA[i] = 0xb0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalDirty)) + } + if m.TotalWriteback != 0 { + dAtA[i] = 0xb8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalWriteback)) + } + if m.TotalPgPgIn != 0 { + dAtA[i] = 0xc0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgPgIn)) + } + if m.TotalPgPgOut != 0 { + dAtA[i] = 0xc8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgPgOut)) + } + if m.TotalPgFault != 0 { + dAtA[i] = 0xd0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgFault)) + } + if m.TotalPgMajFault != 0 { + dAtA[i] = 0xd8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalPgMajFault)) + } + if m.TotalInactiveAnon != 0 { + dAtA[i] = 0xe0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalInactiveAnon)) + } + if m.TotalActiveAnon != 0 { + dAtA[i] = 0xe8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalActiveAnon)) + } + if m.TotalInactiveFile != 0 { + dAtA[i] = 0xf0 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalInactiveFile)) + } + if m.TotalActiveFile != 0 { + dAtA[i] = 0xf8 + i++ + dAtA[i] = 0x1 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalActiveFile)) + } + if m.TotalUnevictable != 0 { + dAtA[i] = 0x80 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TotalUnevictable)) + } + if m.Usage != nil { + dAtA[i] = 0x8a + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage.Size())) + n10, err := m.Usage.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n10 + } + if m.Swap != nil { + dAtA[i] = 0x92 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Swap.Size())) + n11, err := m.Swap.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n11 + } + if m.Kernel != nil { + dAtA[i] = 0x9a + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Kernel.Size())) + n12, err := m.Kernel.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n12 + } + if m.KernelTCP != nil { + dAtA[i] = 0xa2 + i++ + dAtA[i] = 0x2 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.KernelTCP.Size())) + n13, err := m.KernelTCP.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n13 + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *MemoryEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MemoryEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Limit != 0 { + dAtA[i] = 0x8 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Limit)) + } + if m.Usage != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Usage)) + } + if m.Max != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Max)) + } + if m.Failcnt != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Failcnt)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *BlkIOStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *BlkIOStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.IoServiceBytesRecursive) > 0 { + for _, msg := range m.IoServiceBytesRecursive { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoServicedRecursive) > 0 { + for _, msg := range m.IoServicedRecursive { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoQueuedRecursive) > 0 { + for _, msg := range m.IoQueuedRecursive { + dAtA[i] = 0x1a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoServiceTimeRecursive) > 0 { + for _, msg := range m.IoServiceTimeRecursive { + dAtA[i] = 0x22 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoWaitTimeRecursive) > 0 { + for _, msg := range m.IoWaitTimeRecursive { + dAtA[i] = 0x2a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoMergedRecursive) > 0 { + for _, msg := range m.IoMergedRecursive { + dAtA[i] = 0x32 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.IoTimeRecursive) > 0 { + for _, msg := range m.IoTimeRecursive { + dAtA[i] = 0x3a + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.SectorsRecursive) > 0 { + for _, msg := range m.SectorsRecursive { + dAtA[i] = 0x42 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *BlkIOEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *BlkIOEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Op) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Op))) + i += copy(dAtA[i:], m.Op) + } + if len(m.Device) > 0 { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Device))) + i += copy(dAtA[i:], m.Device) + } + if m.Major != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Major)) + } + if m.Minor != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Minor)) + } + if m.Value != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.Value)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *RdmaStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *RdmaStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Current) > 0 { + for _, msg := range m.Current { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if len(m.Limit) > 0 { + for _, msg := range m.Limit { + dAtA[i] = 0x12 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(msg.Size())) + n, err := msg.MarshalTo(dAtA[i:]) + if err != nil { + return 0, err + } + i += n + } + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *RdmaEntry) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *RdmaEntry) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Device) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Device))) + i += copy(dAtA[i:], m.Device) + } + if m.HcaHandles != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HcaHandles)) + } + if m.HcaObjects != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.HcaObjects)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *NetworkStat) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *NetworkStat) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Name) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintMetrics(dAtA, i, uint64(len(m.Name))) + i += copy(dAtA[i:], m.Name) + } + if m.RxBytes != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxBytes)) + } + if m.RxPackets != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxPackets)) + } + if m.RxErrors != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxErrors)) + } + if m.RxDropped != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.RxDropped)) + } + if m.TxBytes != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxBytes)) + } + if m.TxPackets != 0 { + dAtA[i] = 0x38 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxPackets)) + } + if m.TxErrors != 0 { + dAtA[i] = 0x40 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxErrors)) + } + if m.TxDropped != 0 { + dAtA[i] = 0x48 + i++ + i = encodeVarintMetrics(dAtA, i, uint64(m.TxDropped)) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func encodeVarintMetrics(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *Metrics) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.Hugetlb) > 0 { + for _, e := range m.Hugetlb { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.Pids != nil { + l = m.Pids.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.CPU != nil { + l = m.CPU.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Memory != nil { + l = m.Memory.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Blkio != nil { + l = m.Blkio.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Rdma != nil { + l = m.Rdma.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if len(m.Network) > 0 { + for _, e := range m.Network { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *HugetlbStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Usage != 0 { + n += 1 + sovMetrics(uint64(m.Usage)) + } + if m.Max != 0 { + n += 1 + sovMetrics(uint64(m.Max)) + } + if m.Failcnt != 0 { + n += 1 + sovMetrics(uint64(m.Failcnt)) + } + l = len(m.Pagesize) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *PidsStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Current != 0 { + n += 1 + sovMetrics(uint64(m.Current)) + } + if m.Limit != 0 { + n += 1 + sovMetrics(uint64(m.Limit)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CPUStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Usage != nil { + l = m.Usage.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Throttling != nil { + l = m.Throttling.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *CPUUsage) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Total != 0 { + n += 1 + sovMetrics(uint64(m.Total)) + } + if m.Kernel != 0 { + n += 1 + sovMetrics(uint64(m.Kernel)) + } + if m.User != 0 { + n += 1 + sovMetrics(uint64(m.User)) + } + if len(m.PerCPU) > 0 { + l = 0 + for _, e := range m.PerCPU { + l += sovMetrics(uint64(e)) + } + n += 1 + sovMetrics(uint64(l)) + l + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *Throttle) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Periods != 0 { + n += 1 + sovMetrics(uint64(m.Periods)) + } + if m.ThrottledPeriods != 0 { + n += 1 + sovMetrics(uint64(m.ThrottledPeriods)) + } + if m.ThrottledTime != 0 { + n += 1 + sovMetrics(uint64(m.ThrottledTime)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Cache != 0 { + n += 1 + sovMetrics(uint64(m.Cache)) + } + if m.RSS != 0 { + n += 1 + sovMetrics(uint64(m.RSS)) + } + if m.RSSHuge != 0 { + n += 1 + sovMetrics(uint64(m.RSSHuge)) + } + if m.MappedFile != 0 { + n += 1 + sovMetrics(uint64(m.MappedFile)) + } + if m.Dirty != 0 { + n += 1 + sovMetrics(uint64(m.Dirty)) + } + if m.Writeback != 0 { + n += 1 + sovMetrics(uint64(m.Writeback)) + } + if m.PgPgIn != 0 { + n += 1 + sovMetrics(uint64(m.PgPgIn)) + } + if m.PgPgOut != 0 { + n += 1 + sovMetrics(uint64(m.PgPgOut)) + } + if m.PgFault != 0 { + n += 1 + sovMetrics(uint64(m.PgFault)) + } + if m.PgMajFault != 0 { + n += 1 + sovMetrics(uint64(m.PgMajFault)) + } + if m.InactiveAnon != 0 { + n += 1 + sovMetrics(uint64(m.InactiveAnon)) + } + if m.ActiveAnon != 0 { + n += 1 + sovMetrics(uint64(m.ActiveAnon)) + } + if m.InactiveFile != 0 { + n += 1 + sovMetrics(uint64(m.InactiveFile)) + } + if m.ActiveFile != 0 { + n += 1 + sovMetrics(uint64(m.ActiveFile)) + } + if m.Unevictable != 0 { + n += 1 + sovMetrics(uint64(m.Unevictable)) + } + if m.HierarchicalMemoryLimit != 0 { + n += 2 + sovMetrics(uint64(m.HierarchicalMemoryLimit)) + } + if m.HierarchicalSwapLimit != 0 { + n += 2 + sovMetrics(uint64(m.HierarchicalSwapLimit)) + } + if m.TotalCache != 0 { + n += 2 + sovMetrics(uint64(m.TotalCache)) + } + if m.TotalRSS != 0 { + n += 2 + sovMetrics(uint64(m.TotalRSS)) + } + if m.TotalRSSHuge != 0 { + n += 2 + sovMetrics(uint64(m.TotalRSSHuge)) + } + if m.TotalMappedFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalMappedFile)) + } + if m.TotalDirty != 0 { + n += 2 + sovMetrics(uint64(m.TotalDirty)) + } + if m.TotalWriteback != 0 { + n += 2 + sovMetrics(uint64(m.TotalWriteback)) + } + if m.TotalPgPgIn != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgPgIn)) + } + if m.TotalPgPgOut != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgPgOut)) + } + if m.TotalPgFault != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgFault)) + } + if m.TotalPgMajFault != 0 { + n += 2 + sovMetrics(uint64(m.TotalPgMajFault)) + } + if m.TotalInactiveAnon != 0 { + n += 2 + sovMetrics(uint64(m.TotalInactiveAnon)) + } + if m.TotalActiveAnon != 0 { + n += 2 + sovMetrics(uint64(m.TotalActiveAnon)) + } + if m.TotalInactiveFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalInactiveFile)) + } + if m.TotalActiveFile != 0 { + n += 2 + sovMetrics(uint64(m.TotalActiveFile)) + } + if m.TotalUnevictable != 0 { + n += 2 + sovMetrics(uint64(m.TotalUnevictable)) + } + if m.Usage != nil { + l = m.Usage.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.Swap != nil { + l = m.Swap.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.Kernel != nil { + l = m.Kernel.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.KernelTCP != nil { + l = m.KernelTCP.Size() + n += 2 + l + sovMetrics(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *MemoryEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Limit != 0 { + n += 1 + sovMetrics(uint64(m.Limit)) + } + if m.Usage != 0 { + n += 1 + sovMetrics(uint64(m.Usage)) + } + if m.Max != 0 { + n += 1 + sovMetrics(uint64(m.Max)) + } + if m.Failcnt != 0 { + n += 1 + sovMetrics(uint64(m.Failcnt)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *BlkIOStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.IoServiceBytesRecursive) > 0 { + for _, e := range m.IoServiceBytesRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoServicedRecursive) > 0 { + for _, e := range m.IoServicedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoQueuedRecursive) > 0 { + for _, e := range m.IoQueuedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoServiceTimeRecursive) > 0 { + for _, e := range m.IoServiceTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoWaitTimeRecursive) > 0 { + for _, e := range m.IoWaitTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoMergedRecursive) > 0 { + for _, e := range m.IoMergedRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.IoTimeRecursive) > 0 { + for _, e := range m.IoTimeRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.SectorsRecursive) > 0 { + for _, e := range m.SectorsRecursive { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *BlkIOEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Op) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + l = len(m.Device) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.Major != 0 { + n += 1 + sovMetrics(uint64(m.Major)) + } + if m.Minor != 0 { + n += 1 + sovMetrics(uint64(m.Minor)) + } + if m.Value != 0 { + n += 1 + sovMetrics(uint64(m.Value)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *RdmaStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.Current) > 0 { + for _, e := range m.Current { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if len(m.Limit) > 0 { + for _, e := range m.Limit { + l = e.Size() + n += 1 + l + sovMetrics(uint64(l)) + } + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *RdmaEntry) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Device) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.HcaHandles != 0 { + n += 1 + sovMetrics(uint64(m.HcaHandles)) + } + if m.HcaObjects != 0 { + n += 1 + sovMetrics(uint64(m.HcaObjects)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *NetworkStat) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Name) + if l > 0 { + n += 1 + l + sovMetrics(uint64(l)) + } + if m.RxBytes != 0 { + n += 1 + sovMetrics(uint64(m.RxBytes)) + } + if m.RxPackets != 0 { + n += 1 + sovMetrics(uint64(m.RxPackets)) + } + if m.RxErrors != 0 { + n += 1 + sovMetrics(uint64(m.RxErrors)) + } + if m.RxDropped != 0 { + n += 1 + sovMetrics(uint64(m.RxDropped)) + } + if m.TxBytes != 0 { + n += 1 + sovMetrics(uint64(m.TxBytes)) + } + if m.TxPackets != 0 { + n += 1 + sovMetrics(uint64(m.TxPackets)) + } + if m.TxErrors != 0 { + n += 1 + sovMetrics(uint64(m.TxErrors)) + } + if m.TxDropped != 0 { + n += 1 + sovMetrics(uint64(m.TxDropped)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func sovMetrics(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozMetrics(x uint64) (n int) { + return sovMetrics(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *Metrics) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Metrics{`, + `Hugetlb:` + strings.Replace(fmt.Sprintf("%v", this.Hugetlb), "HugetlbStat", "HugetlbStat", 1) + `,`, + `Pids:` + strings.Replace(fmt.Sprintf("%v", this.Pids), "PidsStat", "PidsStat", 1) + `,`, + `CPU:` + strings.Replace(fmt.Sprintf("%v", this.CPU), "CPUStat", "CPUStat", 1) + `,`, + `Memory:` + strings.Replace(fmt.Sprintf("%v", this.Memory), "MemoryStat", "MemoryStat", 1) + `,`, + `Blkio:` + strings.Replace(fmt.Sprintf("%v", this.Blkio), "BlkIOStat", "BlkIOStat", 1) + `,`, + `Rdma:` + strings.Replace(fmt.Sprintf("%v", this.Rdma), "RdmaStat", "RdmaStat", 1) + `,`, + `Network:` + strings.Replace(fmt.Sprintf("%v", this.Network), "NetworkStat", "NetworkStat", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *HugetlbStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&HugetlbStat{`, + `Usage:` + fmt.Sprintf("%v", this.Usage) + `,`, + `Max:` + fmt.Sprintf("%v", this.Max) + `,`, + `Failcnt:` + fmt.Sprintf("%v", this.Failcnt) + `,`, + `Pagesize:` + fmt.Sprintf("%v", this.Pagesize) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *PidsStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&PidsStat{`, + `Current:` + fmt.Sprintf("%v", this.Current) + `,`, + `Limit:` + fmt.Sprintf("%v", this.Limit) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CPUStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CPUStat{`, + `Usage:` + strings.Replace(fmt.Sprintf("%v", this.Usage), "CPUUsage", "CPUUsage", 1) + `,`, + `Throttling:` + strings.Replace(fmt.Sprintf("%v", this.Throttling), "Throttle", "Throttle", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *CPUUsage) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&CPUUsage{`, + `Total:` + fmt.Sprintf("%v", this.Total) + `,`, + `Kernel:` + fmt.Sprintf("%v", this.Kernel) + `,`, + `User:` + fmt.Sprintf("%v", this.User) + `,`, + `PerCPU:` + fmt.Sprintf("%v", this.PerCPU) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *Throttle) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Throttle{`, + `Periods:` + fmt.Sprintf("%v", this.Periods) + `,`, + `ThrottledPeriods:` + fmt.Sprintf("%v", this.ThrottledPeriods) + `,`, + `ThrottledTime:` + fmt.Sprintf("%v", this.ThrottledTime) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryStat{`, + `Cache:` + fmt.Sprintf("%v", this.Cache) + `,`, + `RSS:` + fmt.Sprintf("%v", this.RSS) + `,`, + `RSSHuge:` + fmt.Sprintf("%v", this.RSSHuge) + `,`, + `MappedFile:` + fmt.Sprintf("%v", this.MappedFile) + `,`, + `Dirty:` + fmt.Sprintf("%v", this.Dirty) + `,`, + `Writeback:` + fmt.Sprintf("%v", this.Writeback) + `,`, + `PgPgIn:` + fmt.Sprintf("%v", this.PgPgIn) + `,`, + `PgPgOut:` + fmt.Sprintf("%v", this.PgPgOut) + `,`, + `PgFault:` + fmt.Sprintf("%v", this.PgFault) + `,`, + `PgMajFault:` + fmt.Sprintf("%v", this.PgMajFault) + `,`, + `InactiveAnon:` + fmt.Sprintf("%v", this.InactiveAnon) + `,`, + `ActiveAnon:` + fmt.Sprintf("%v", this.ActiveAnon) + `,`, + `InactiveFile:` + fmt.Sprintf("%v", this.InactiveFile) + `,`, + `ActiveFile:` + fmt.Sprintf("%v", this.ActiveFile) + `,`, + `Unevictable:` + fmt.Sprintf("%v", this.Unevictable) + `,`, + `HierarchicalMemoryLimit:` + fmt.Sprintf("%v", this.HierarchicalMemoryLimit) + `,`, + `HierarchicalSwapLimit:` + fmt.Sprintf("%v", this.HierarchicalSwapLimit) + `,`, + `TotalCache:` + fmt.Sprintf("%v", this.TotalCache) + `,`, + `TotalRSS:` + fmt.Sprintf("%v", this.TotalRSS) + `,`, + `TotalRSSHuge:` + fmt.Sprintf("%v", this.TotalRSSHuge) + `,`, + `TotalMappedFile:` + fmt.Sprintf("%v", this.TotalMappedFile) + `,`, + `TotalDirty:` + fmt.Sprintf("%v", this.TotalDirty) + `,`, + `TotalWriteback:` + fmt.Sprintf("%v", this.TotalWriteback) + `,`, + `TotalPgPgIn:` + fmt.Sprintf("%v", this.TotalPgPgIn) + `,`, + `TotalPgPgOut:` + fmt.Sprintf("%v", this.TotalPgPgOut) + `,`, + `TotalPgFault:` + fmt.Sprintf("%v", this.TotalPgFault) + `,`, + `TotalPgMajFault:` + fmt.Sprintf("%v", this.TotalPgMajFault) + `,`, + `TotalInactiveAnon:` + fmt.Sprintf("%v", this.TotalInactiveAnon) + `,`, + `TotalActiveAnon:` + fmt.Sprintf("%v", this.TotalActiveAnon) + `,`, + `TotalInactiveFile:` + fmt.Sprintf("%v", this.TotalInactiveFile) + `,`, + `TotalActiveFile:` + fmt.Sprintf("%v", this.TotalActiveFile) + `,`, + `TotalUnevictable:` + fmt.Sprintf("%v", this.TotalUnevictable) + `,`, + `Usage:` + strings.Replace(fmt.Sprintf("%v", this.Usage), "MemoryEntry", "MemoryEntry", 1) + `,`, + `Swap:` + strings.Replace(fmt.Sprintf("%v", this.Swap), "MemoryEntry", "MemoryEntry", 1) + `,`, + `Kernel:` + strings.Replace(fmt.Sprintf("%v", this.Kernel), "MemoryEntry", "MemoryEntry", 1) + `,`, + `KernelTCP:` + strings.Replace(fmt.Sprintf("%v", this.KernelTCP), "MemoryEntry", "MemoryEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *MemoryEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&MemoryEntry{`, + `Limit:` + fmt.Sprintf("%v", this.Limit) + `,`, + `Usage:` + fmt.Sprintf("%v", this.Usage) + `,`, + `Max:` + fmt.Sprintf("%v", this.Max) + `,`, + `Failcnt:` + fmt.Sprintf("%v", this.Failcnt) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *BlkIOStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&BlkIOStat{`, + `IoServiceBytesRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServiceBytesRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoServicedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServicedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoQueuedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoQueuedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoServiceTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoServiceTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoWaitTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoWaitTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoMergedRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoMergedRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `IoTimeRecursive:` + strings.Replace(fmt.Sprintf("%v", this.IoTimeRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `SectorsRecursive:` + strings.Replace(fmt.Sprintf("%v", this.SectorsRecursive), "BlkIOEntry", "BlkIOEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *BlkIOEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&BlkIOEntry{`, + `Op:` + fmt.Sprintf("%v", this.Op) + `,`, + `Device:` + fmt.Sprintf("%v", this.Device) + `,`, + `Major:` + fmt.Sprintf("%v", this.Major) + `,`, + `Minor:` + fmt.Sprintf("%v", this.Minor) + `,`, + `Value:` + fmt.Sprintf("%v", this.Value) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *RdmaStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&RdmaStat{`, + `Current:` + strings.Replace(fmt.Sprintf("%v", this.Current), "RdmaEntry", "RdmaEntry", 1) + `,`, + `Limit:` + strings.Replace(fmt.Sprintf("%v", this.Limit), "RdmaEntry", "RdmaEntry", 1) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *RdmaEntry) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&RdmaEntry{`, + `Device:` + fmt.Sprintf("%v", this.Device) + `,`, + `HcaHandles:` + fmt.Sprintf("%v", this.HcaHandles) + `,`, + `HcaObjects:` + fmt.Sprintf("%v", this.HcaObjects) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *NetworkStat) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&NetworkStat{`, + `Name:` + fmt.Sprintf("%v", this.Name) + `,`, + `RxBytes:` + fmt.Sprintf("%v", this.RxBytes) + `,`, + `RxPackets:` + fmt.Sprintf("%v", this.RxPackets) + `,`, + `RxErrors:` + fmt.Sprintf("%v", this.RxErrors) + `,`, + `RxDropped:` + fmt.Sprintf("%v", this.RxDropped) + `,`, + `TxBytes:` + fmt.Sprintf("%v", this.TxBytes) + `,`, + `TxPackets:` + fmt.Sprintf("%v", this.TxPackets) + `,`, + `TxErrors:` + fmt.Sprintf("%v", this.TxErrors) + `,`, + `TxDropped:` + fmt.Sprintf("%v", this.TxDropped) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func valueToStringMetrics(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *Metrics) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Metrics: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Metrics: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Hugetlb", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Hugetlb = append(m.Hugetlb, &HugetlbStat{}) + if err := m.Hugetlb[len(m.Hugetlb)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Pids", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Pids == nil { + m.Pids = &PidsStat{} + } + if err := m.Pids.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field CPU", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.CPU == nil { + m.CPU = &CPUStat{} + } + if err := m.CPU.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Memory", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Memory == nil { + m.Memory = &MemoryStat{} + } + if err := m.Memory.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Blkio", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Blkio == nil { + m.Blkio = &BlkIOStat{} + } + if err := m.Blkio.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Rdma", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Rdma == nil { + m.Rdma = &RdmaStat{} + } + if err := m.Rdma.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Network", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Network = append(m.Network, &NetworkStat{}) + if err := m.Network[len(m.Network)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *HugetlbStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: HugetlbStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: HugetlbStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + m.Usage = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Usage |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Max", wireType) + } + m.Max = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Max |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Failcnt", wireType) + } + m.Failcnt = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Failcnt |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Pagesize", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Pagesize = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *PidsStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: PidsStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: PidsStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Current", wireType) + } + m.Current = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Current |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + m.Limit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Limit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CPUStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CPUStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CPUStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Usage == nil { + m.Usage = &CPUUsage{} + } + if err := m.Usage.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Throttling", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Throttling == nil { + m.Throttling = &Throttle{} + } + if err := m.Throttling.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CPUUsage) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CPUUsage: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CPUUsage: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Total", wireType) + } + m.Total = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Total |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Kernel", wireType) + } + m.Kernel = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Kernel |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field User", wireType) + } + m.User = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.User |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType == 0 { + var v uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.PerCPU = append(m.PerCPU, v) + } else if wireType == 2 { + var packedLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + packedLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if packedLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + packedLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + var elementCount int + var count int + for _, integer := range dAtA[iNdEx:postIndex] { + if integer < 128 { + count++ + } + } + elementCount = count + if elementCount != 0 && len(m.PerCPU) == 0 { + m.PerCPU = make([]uint64, 0, elementCount) + } + for iNdEx < postIndex { + var v uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.PerCPU = append(m.PerCPU, v) + } + } else { + return fmt.Errorf("proto: wrong wireType = %d for field PerCPU", wireType) + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *Throttle) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Throttle: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Throttle: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Periods", wireType) + } + m.Periods = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Periods |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ThrottledPeriods", wireType) + } + m.ThrottledPeriods = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ThrottledPeriods |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ThrottledTime", wireType) + } + m.ThrottledTime = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ThrottledTime |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Cache", wireType) + } + m.Cache = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Cache |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RSS", wireType) + } + m.RSS = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RSS |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RSSHuge", wireType) + } + m.RSSHuge = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RSSHuge |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MappedFile", wireType) + } + m.MappedFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.MappedFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Dirty", wireType) + } + m.Dirty = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Dirty |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Writeback", wireType) + } + m.Writeback = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Writeback |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgPgIn", wireType) + } + m.PgPgIn = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgPgIn |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgPgOut", wireType) + } + m.PgPgOut = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgPgOut |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgFault", wireType) + } + m.PgFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 10: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field PgMajFault", wireType) + } + m.PgMajFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.PgMajFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 11: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field InactiveAnon", wireType) + } + m.InactiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.InactiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 12: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ActiveAnon", wireType) + } + m.ActiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ActiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 13: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field InactiveFile", wireType) + } + m.InactiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.InactiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 14: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ActiveFile", wireType) + } + m.ActiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ActiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 15: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Unevictable", wireType) + } + m.Unevictable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Unevictable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 16: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HierarchicalMemoryLimit", wireType) + } + m.HierarchicalMemoryLimit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HierarchicalMemoryLimit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 17: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HierarchicalSwapLimit", wireType) + } + m.HierarchicalSwapLimit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HierarchicalSwapLimit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 18: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalCache", wireType) + } + m.TotalCache = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalCache |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 19: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalRSS", wireType) + } + m.TotalRSS = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalRSS |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 20: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalRSSHuge", wireType) + } + m.TotalRSSHuge = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalRSSHuge |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 21: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalMappedFile", wireType) + } + m.TotalMappedFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalMappedFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 22: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalDirty", wireType) + } + m.TotalDirty = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalDirty |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 23: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalWriteback", wireType) + } + m.TotalWriteback = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalWriteback |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 24: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgPgIn", wireType) + } + m.TotalPgPgIn = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgPgIn |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 25: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgPgOut", wireType) + } + m.TotalPgPgOut = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgPgOut |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 26: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgFault", wireType) + } + m.TotalPgFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 27: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalPgMajFault", wireType) + } + m.TotalPgMajFault = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalPgMajFault |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 28: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalInactiveAnon", wireType) + } + m.TotalInactiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalInactiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 29: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalActiveAnon", wireType) + } + m.TotalActiveAnon = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalActiveAnon |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 30: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalInactiveFile", wireType) + } + m.TotalInactiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalInactiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 31: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalActiveFile", wireType) + } + m.TotalActiveFile = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalActiveFile |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 32: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalUnevictable", wireType) + } + m.TotalUnevictable = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TotalUnevictable |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 33: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Usage == nil { + m.Usage = &MemoryEntry{} + } + if err := m.Usage.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 34: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Swap", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Swap == nil { + m.Swap = &MemoryEntry{} + } + if err := m.Swap.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 35: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Kernel", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Kernel == nil { + m.Kernel = &MemoryEntry{} + } + if err := m.Kernel.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 36: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field KernelTCP", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.KernelTCP == nil { + m.KernelTCP = &MemoryEntry{} + } + if err := m.KernelTCP.Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MemoryEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MemoryEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MemoryEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + m.Limit = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Limit |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Usage", wireType) + } + m.Usage = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Usage |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Max", wireType) + } + m.Max = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Max |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Failcnt", wireType) + } + m.Failcnt = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Failcnt |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *BlkIOStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: BlkIOStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: BlkIOStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServiceBytesRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServiceBytesRecursive = append(m.IoServiceBytesRecursive, &BlkIOEntry{}) + if err := m.IoServiceBytesRecursive[len(m.IoServiceBytesRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServicedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServicedRecursive = append(m.IoServicedRecursive, &BlkIOEntry{}) + if err := m.IoServicedRecursive[len(m.IoServicedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoQueuedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoQueuedRecursive = append(m.IoQueuedRecursive, &BlkIOEntry{}) + if err := m.IoQueuedRecursive[len(m.IoQueuedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoServiceTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoServiceTimeRecursive = append(m.IoServiceTimeRecursive, &BlkIOEntry{}) + if err := m.IoServiceTimeRecursive[len(m.IoServiceTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoWaitTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoWaitTimeRecursive = append(m.IoWaitTimeRecursive, &BlkIOEntry{}) + if err := m.IoWaitTimeRecursive[len(m.IoWaitTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoMergedRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoMergedRecursive = append(m.IoMergedRecursive, &BlkIOEntry{}) + if err := m.IoMergedRecursive[len(m.IoMergedRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IoTimeRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IoTimeRecursive = append(m.IoTimeRecursive, &BlkIOEntry{}) + if err := m.IoTimeRecursive[len(m.IoTimeRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 8: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SectorsRecursive", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SectorsRecursive = append(m.SectorsRecursive, &BlkIOEntry{}) + if err := m.SectorsRecursive[len(m.SectorsRecursive)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *BlkIOEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: BlkIOEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: BlkIOEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Op", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Op = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Device", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Device = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Major", wireType) + } + m.Major = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Major |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Minor", wireType) + } + m.Minor = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Minor |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Value", wireType) + } + m.Value = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Value |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *RdmaStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: RdmaStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: RdmaStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Current", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Current = append(m.Current, &RdmaEntry{}) + if err := m.Current[len(m.Current)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Limit", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Limit = append(m.Limit, &RdmaEntry{}) + if err := m.Limit[len(m.Limit)-1].Unmarshal(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *RdmaEntry) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: RdmaEntry: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: RdmaEntry: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Device", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Device = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HcaHandles", wireType) + } + m.HcaHandles = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HcaHandles |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field HcaObjects", wireType) + } + m.HcaObjects = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.HcaObjects |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *NetworkStat) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: NetworkStat: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: NetworkStat: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthMetrics + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthMetrics + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxBytes", wireType) + } + m.RxBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxPackets", wireType) + } + m.RxPackets = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxPackets |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxErrors", wireType) + } + m.RxErrors = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxErrors |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RxDropped", wireType) + } + m.RxDropped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RxDropped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxBytes", wireType) + } + m.TxBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxPackets", wireType) + } + m.TxPackets = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxPackets |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxErrors", wireType) + } + m.TxErrors = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxErrors |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TxDropped", wireType) + } + m.TxDropped = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowMetrics + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TxDropped |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipMetrics(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthMetrics + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipMetrics(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if length < 0 { + return 0, ErrInvalidLengthMetrics + } + iNdEx += length + if iNdEx < 0 { + return 0, ErrInvalidLengthMetrics + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowMetrics + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipMetrics(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + if iNdEx < 0 { + return 0, ErrInvalidLengthMetrics + } + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthMetrics = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowMetrics = fmt.Errorf("proto: integer overflow") +) diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt new file mode 100644 index 00000000..7a960c67 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.pb.txt @@ -0,0 +1,712 @@ +file { + name: "github.com/containerd/cgroups/stats/v1/metrics.proto" + package: "io.containerd.cgroups.v1" + dependency: "gogoproto/gogo.proto" + message_type { + name: "Metrics" + field { + name: "hugetlb" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.HugetlbStat" + json_name: "hugetlb" + } + field { + name: "pids" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.PidsStat" + json_name: "pids" + } + field { + name: "cpu" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CPUStat" + options { + 65004: "CPU" + } + json_name: "cpu" + } + field { + name: "memory" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryStat" + json_name: "memory" + } + field { + name: "blkio" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOStat" + json_name: "blkio" + } + field { + name: "rdma" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaStat" + json_name: "rdma" + } + field { + name: "network" + number: 7 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.NetworkStat" + json_name: "network" + } + } + message_type { + name: "HugetlbStat" + field { + name: "usage" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "usage" + } + field { + name: "max" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "max" + } + field { + name: "failcnt" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "failcnt" + } + field { + name: "pagesize" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "pagesize" + } + } + message_type { + name: "PidsStat" + field { + name: "current" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "current" + } + field { + name: "limit" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "limit" + } + } + message_type { + name: "CPUStat" + field { + name: "usage" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.CPUUsage" + json_name: "usage" + } + field { + name: "throttling" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.Throttle" + json_name: "throttling" + } + } + message_type { + name: "CPUUsage" + field { + name: "total" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "total" + } + field { + name: "kernel" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "kernel" + } + field { + name: "user" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "user" + } + field { + name: "per_cpu" + number: 4 + label: LABEL_REPEATED + type: TYPE_UINT64 + options { + 65004: "PerCPU" + } + json_name: "perCpu" + } + } + message_type { + name: "Throttle" + field { + name: "periods" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "periods" + } + field { + name: "throttled_periods" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "throttledPeriods" + } + field { + name: "throttled_time" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "throttledTime" + } + } + message_type { + name: "MemoryStat" + field { + name: "cache" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "cache" + } + field { + name: "rss" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "RSS" + } + json_name: "rss" + } + field { + name: "rss_huge" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "RSSHuge" + } + json_name: "rssHuge" + } + field { + name: "mapped_file" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "mappedFile" + } + field { + name: "dirty" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "dirty" + } + field { + name: "writeback" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "writeback" + } + field { + name: "pg_pg_in" + number: 7 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgPgIn" + } + field { + name: "pg_pg_out" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgPgOut" + } + field { + name: "pg_fault" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgFault" + } + field { + name: "pg_maj_fault" + number: 10 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "pgMajFault" + } + field { + name: "inactive_anon" + number: 11 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "inactiveAnon" + } + field { + name: "active_anon" + number: 12 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "activeAnon" + } + field { + name: "inactive_file" + number: 13 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "inactiveFile" + } + field { + name: "active_file" + number: 14 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "activeFile" + } + field { + name: "unevictable" + number: 15 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "unevictable" + } + field { + name: "hierarchical_memory_limit" + number: 16 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "hierarchicalMemoryLimit" + } + field { + name: "hierarchical_swap_limit" + number: 17 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "hierarchicalSwapLimit" + } + field { + name: "total_cache" + number: 18 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalCache" + } + field { + name: "total_rss" + number: 19 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "TotalRSS" + } + json_name: "totalRss" + } + field { + name: "total_rss_huge" + number: 20 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + options { + 65004: "TotalRSSHuge" + } + json_name: "totalRssHuge" + } + field { + name: "total_mapped_file" + number: 21 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalMappedFile" + } + field { + name: "total_dirty" + number: 22 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalDirty" + } + field { + name: "total_writeback" + number: 23 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalWriteback" + } + field { + name: "total_pg_pg_in" + number: 24 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgPgIn" + } + field { + name: "total_pg_pg_out" + number: 25 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgPgOut" + } + field { + name: "total_pg_fault" + number: 26 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgFault" + } + field { + name: "total_pg_maj_fault" + number: 27 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalPgMajFault" + } + field { + name: "total_inactive_anon" + number: 28 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalInactiveAnon" + } + field { + name: "total_active_anon" + number: 29 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalActiveAnon" + } + field { + name: "total_inactive_file" + number: 30 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalInactiveFile" + } + field { + name: "total_active_file" + number: 31 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalActiveFile" + } + field { + name: "total_unevictable" + number: 32 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "totalUnevictable" + } + field { + name: "usage" + number: 33 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "usage" + } + field { + name: "swap" + number: 34 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "swap" + } + field { + name: "kernel" + number: 35 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + json_name: "kernel" + } + field { + name: "kernel_tcp" + number: 36 + label: LABEL_OPTIONAL + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.MemoryEntry" + options { + 65004: "KernelTCP" + } + json_name: "kernelTcp" + } + } + message_type { + name: "MemoryEntry" + field { + name: "limit" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "limit" + } + field { + name: "usage" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "usage" + } + field { + name: "max" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "max" + } + field { + name: "failcnt" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "failcnt" + } + } + message_type { + name: "BlkIOStat" + field { + name: "io_service_bytes_recursive" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServiceBytesRecursive" + } + field { + name: "io_serviced_recursive" + number: 2 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServicedRecursive" + } + field { + name: "io_queued_recursive" + number: 3 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioQueuedRecursive" + } + field { + name: "io_service_time_recursive" + number: 4 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioServiceTimeRecursive" + } + field { + name: "io_wait_time_recursive" + number: 5 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioWaitTimeRecursive" + } + field { + name: "io_merged_recursive" + number: 6 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioMergedRecursive" + } + field { + name: "io_time_recursive" + number: 7 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "ioTimeRecursive" + } + field { + name: "sectors_recursive" + number: 8 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.BlkIOEntry" + json_name: "sectorsRecursive" + } + } + message_type { + name: "BlkIOEntry" + field { + name: "op" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "op" + } + field { + name: "device" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "device" + } + field { + name: "major" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "major" + } + field { + name: "minor" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "minor" + } + field { + name: "value" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "value" + } + } + message_type { + name: "RdmaStat" + field { + name: "current" + number: 1 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaEntry" + json_name: "current" + } + field { + name: "limit" + number: 2 + label: LABEL_REPEATED + type: TYPE_MESSAGE + type_name: ".io.containerd.cgroups.v1.RdmaEntry" + json_name: "limit" + } + } + message_type { + name: "RdmaEntry" + field { + name: "device" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "device" + } + field { + name: "hca_handles" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT32 + json_name: "hcaHandles" + } + field { + name: "hca_objects" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT32 + json_name: "hcaObjects" + } + } + message_type { + name: "NetworkStat" + field { + name: "name" + number: 1 + label: LABEL_OPTIONAL + type: TYPE_STRING + json_name: "name" + } + field { + name: "rx_bytes" + number: 2 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxBytes" + } + field { + name: "rx_packets" + number: 3 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxPackets" + } + field { + name: "rx_errors" + number: 4 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxErrors" + } + field { + name: "rx_dropped" + number: 5 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "rxDropped" + } + field { + name: "tx_bytes" + number: 6 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txBytes" + } + field { + name: "tx_packets" + number: 7 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txPackets" + } + field { + name: "tx_errors" + number: 8 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txErrors" + } + field { + name: "tx_dropped" + number: 9 + label: LABEL_OPTIONAL + type: TYPE_UINT64 + json_name: "txDropped" + } + } + syntax: "proto3" +} diff --git a/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto b/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto new file mode 100644 index 00000000..62b51980 --- /dev/null +++ b/vendor/github.com/containerd/cgroups/stats/v1/metrics.proto @@ -0,0 +1,136 @@ +syntax = "proto3"; + +package io.containerd.cgroups.v1; + +import "gogoproto/gogo.proto"; + +message Metrics { + repeated HugetlbStat hugetlb = 1; + PidsStat pids = 2; + CPUStat cpu = 3 [(gogoproto.customname) = "CPU"]; + MemoryStat memory = 4; + BlkIOStat blkio = 5; + RdmaStat rdma = 6; + repeated NetworkStat network = 7; +} + +message HugetlbStat { + uint64 usage = 1; + uint64 max = 2; + uint64 failcnt = 3; + string pagesize = 4; +} + +message PidsStat { + uint64 current = 1; + uint64 limit = 2; +} + +message CPUStat { + CPUUsage usage = 1; + Throttle throttling = 2; +} + +message CPUUsage { + // values in nanoseconds + uint64 total = 1; + uint64 kernel = 2; + uint64 user = 3; + repeated uint64 per_cpu = 4 [(gogoproto.customname) = "PerCPU"]; + +} + +message Throttle { + uint64 periods = 1; + uint64 throttled_periods = 2; + uint64 throttled_time = 3; +} + +message MemoryStat { + uint64 cache = 1; + uint64 rss = 2 [(gogoproto.customname) = "RSS"]; + uint64 rss_huge = 3 [(gogoproto.customname) = "RSSHuge"]; + uint64 mapped_file = 4; + uint64 dirty = 5; + uint64 writeback = 6; + uint64 pg_pg_in = 7; + uint64 pg_pg_out = 8; + uint64 pg_fault = 9; + uint64 pg_maj_fault = 10; + uint64 inactive_anon = 11; + uint64 active_anon = 12; + uint64 inactive_file = 13; + uint64 active_file = 14; + uint64 unevictable = 15; + uint64 hierarchical_memory_limit = 16; + uint64 hierarchical_swap_limit = 17; + uint64 total_cache = 18; + uint64 total_rss = 19 [(gogoproto.customname) = "TotalRSS"]; + uint64 total_rss_huge = 20 [(gogoproto.customname) = "TotalRSSHuge"]; + uint64 total_mapped_file = 21; + uint64 total_dirty = 22; + uint64 total_writeback = 23; + uint64 total_pg_pg_in = 24; + uint64 total_pg_pg_out = 25; + uint64 total_pg_fault = 26; + uint64 total_pg_maj_fault = 27; + uint64 total_inactive_anon = 28; + uint64 total_active_anon = 29; + uint64 total_inactive_file = 30; + uint64 total_active_file = 31; + uint64 total_unevictable = 32; + MemoryEntry usage = 33; + MemoryEntry swap = 34; + MemoryEntry kernel = 35; + MemoryEntry kernel_tcp = 36 [(gogoproto.customname) = "KernelTCP"]; + +} + +message MemoryEntry { + uint64 limit = 1; + uint64 usage = 2; + uint64 max = 3; + uint64 failcnt = 4; +} + +message BlkIOStat { + repeated BlkIOEntry io_service_bytes_recursive = 1; + repeated BlkIOEntry io_serviced_recursive = 2; + repeated BlkIOEntry io_queued_recursive = 3; + repeated BlkIOEntry io_service_time_recursive = 4; + repeated BlkIOEntry io_wait_time_recursive = 5; + repeated BlkIOEntry io_merged_recursive = 6; + repeated BlkIOEntry io_time_recursive = 7; + repeated BlkIOEntry sectors_recursive = 8; +} + +message BlkIOEntry { + string op = 1; + string device = 2; + uint64 major = 3; + uint64 minor = 4; + uint64 value = 5; +} + +message RdmaStat { + repeated RdmaEntry current = 1; + repeated RdmaEntry limit = 2; +} + +message RdmaEntry { + string device = 1; + uint32 hca_handles = 2; + uint32 hca_objects = 3; +} + +message NetworkStat { + string name = 1; + uint64 rx_bytes = 2; + uint64 rx_packets = 3; + uint64 rx_errors = 4; + uint64 rx_dropped = 5; + uint64 tx_bytes = 6; + uint64 tx_packets = 7; + uint64 tx_errors = 8; + uint64 tx_dropped = 9; +} diff --git a/vendor/github.com/docker/go-units/MAINTAINERS b/vendor/github.com/docker/go-units/MAINTAINERS index 477be8b2..4aac7c74 100644 --- a/vendor/github.com/docker/go-units/MAINTAINERS +++ b/vendor/github.com/docker/go-units/MAINTAINERS @@ -1,6 +1,6 @@ -# go-connections maintainers file +# go-units maintainers file # -# This file describes who runs the docker/go-connections project and how. +# This file describes who runs the docker/go-units project and how. # This is a living document - if you see something out of date or missing, speak up! # # It is structured to be consumable by both humans and programs. @@ -11,7 +11,10 @@ [Org] [Org."Core maintainers"] people = [ - "calavera", + "akihirosuda", + "dnephin", + "thajeztah", + "vdemeester", ] [people] @@ -21,7 +24,23 @@ # in the people section. # ADD YOURSELF HERE IN ALPHABETICAL ORDER - [people.calavera] - Name = "David Calavera" - Email = "david.calavera@gmail.com" - GitHub = "calavera" + + [people.akihirosuda] + Name = "Akihiro Suda" + Email = "akihiro.suda.cz@hco.ntt.co.jp" + GitHub = "AkihiroSuda" + + [people.dnephin] + Name = "Daniel Nephin" + Email = "dnephin@gmail.com" + GitHub = "dnephin" + + [people.thajeztah] + Name = "Sebastiaan van Stijn" + Email = "github@gone.nl" + GitHub = "thaJeztah" + + [people.vdemeester] + Name = "Vincent Demeester" + Email = "vincent@sbr.pm" + GitHub = "vdemeester" \ No newline at end of file diff --git a/vendor/github.com/docker/go-units/circle.yml b/vendor/github.com/docker/go-units/circle.yml index 9043b354..af9d6055 100644 --- a/vendor/github.com/docker/go-units/circle.yml +++ b/vendor/github.com/docker/go-units/circle.yml @@ -1,7 +1,7 @@ dependencies: post: # install golint - - go get github.com/golang/lint/golint + - go get golang.org/x/lint/golint test: pre: diff --git a/vendor/github.com/docker/go-units/duration.go b/vendor/github.com/docker/go-units/duration.go index c219a8a9..48dd8744 100644 --- a/vendor/github.com/docker/go-units/duration.go +++ b/vendor/github.com/docker/go-units/duration.go @@ -12,19 +12,21 @@ import ( func HumanDuration(d time.Duration) string { if seconds := int(d.Seconds()); seconds < 1 { return "Less than a second" + } else if seconds == 1 { + return "1 second" } else if seconds < 60 { return fmt.Sprintf("%d seconds", seconds) } else if minutes := int(d.Minutes()); minutes == 1 { return "About a minute" } else if minutes < 60 { return fmt.Sprintf("%d minutes", minutes) - } else if hours := int(d.Hours()); hours == 1 { + } else if hours := int(d.Hours() + 0.5); hours == 1 { return "About an hour" } else if hours < 48 { return fmt.Sprintf("%d hours", hours) } else if hours < 24*7*2 { return fmt.Sprintf("%d days", hours/24) - } else if hours < 24*30*3 { + } else if hours < 24*30*2 { return fmt.Sprintf("%d weeks", hours/24/7) } else if hours < 24*365*2 { return fmt.Sprintf("%d months", hours/24/30) diff --git a/vendor/github.com/docker/go-units/size.go b/vendor/github.com/docker/go-units/size.go index f5b82ea2..85f6ab07 100644 --- a/vendor/github.com/docker/go-units/size.go +++ b/vendor/github.com/docker/go-units/size.go @@ -31,34 +31,46 @@ type unitMap map[string]int64 var ( decimalMap = unitMap{"k": KB, "m": MB, "g": GB, "t": TB, "p": PB} binaryMap = unitMap{"k": KiB, "m": MiB, "g": GiB, "t": TiB, "p": PiB} - sizeRegex = regexp.MustCompile(`^(\d+(\.\d+)*) ?([kKmMgGtTpP])?[bB]?$`) + sizeRegex = regexp.MustCompile(`^(\d+(\.\d+)*) ?([kKmMgGtTpP])?[iI]?[bB]?$`) ) var decimapAbbrs = []string{"B", "kB", "MB", "GB", "TB", "PB", "EB", "ZB", "YB"} var binaryAbbrs = []string{"B", "KiB", "MiB", "GiB", "TiB", "PiB", "EiB", "ZiB", "YiB"} -// CustomSize returns a human-readable approximation of a size -// using custom format. -func CustomSize(format string, size float64, base float64, _map []string) string { +func getSizeAndUnit(size float64, base float64, _map []string) (float64, string) { i := 0 unitsLimit := len(_map) - 1 for size >= base && i < unitsLimit { size = size / base i++ } - return fmt.Sprintf(format, size, _map[i]) + return size, _map[i] +} + +// CustomSize returns a human-readable approximation of a size +// using custom format. +func CustomSize(format string, size float64, base float64, _map []string) string { + size, unit := getSizeAndUnit(size, base, _map) + return fmt.Sprintf(format, size, unit) +} + +// HumanSizeWithPrecision allows the size to be in any precision, +// instead of 4 digit precision used in units.HumanSize. +func HumanSizeWithPrecision(size float64, precision int) string { + size, unit := getSizeAndUnit(size, 1000.0, decimapAbbrs) + return fmt.Sprintf("%.*g%s", precision, size, unit) } // HumanSize returns a human-readable approximation of a size // capped at 4 valid numbers (eg. "2.746 MB", "796 KB"). func HumanSize(size float64) string { - return CustomSize("%.4g %s", size, 1000.0, decimapAbbrs) + return HumanSizeWithPrecision(size, 4) } // BytesSize returns a human-readable size in bytes, kibibytes, // mebibytes, gibibytes, or tebibytes (eg. "44kiB", "17MiB"). func BytesSize(size float64) string { - return CustomSize("%.4g %s", size, 1024.0, binaryAbbrs) + return CustomSize("%.4g%s", size, 1024.0, binaryAbbrs) } // FromHumanSize returns an integer from a human-readable specification of a diff --git a/vendor/github.com/docker/go-units/ulimit.go b/vendor/github.com/docker/go-units/ulimit.go index 5ac7fd82..fca0400c 100644 --- a/vendor/github.com/docker/go-units/ulimit.go +++ b/vendor/github.com/docker/go-units/ulimit.go @@ -96,8 +96,13 @@ func ParseUlimit(val string) (*Ulimit, error) { return nil, fmt.Errorf("too many limit value arguments - %s, can only have up to two, `soft[:hard]`", parts[1]) } - if soft > *hard { - return nil, fmt.Errorf("ulimit soft limit must be less than or equal to hard limit: %d > %d", soft, *hard) + if *hard != -1 { + if soft == -1 { + return nil, fmt.Errorf("ulimit soft limit must be less than or equal to hard limit: soft: -1 (unlimited), hard: %d", *hard) + } + if soft > *hard { + return nil, fmt.Errorf("ulimit soft limit must be less than or equal to hard limit: %d > %d", soft, *hard) + } } return &Ulimit{Name: parts[0], Soft: soft, Hard: *hard}, nil diff --git a/vendor/github.com/hashicorp/golang-lru/LICENSE b/vendor/github.com/hashicorp/golang-lru/LICENSE new file mode 100644 index 00000000..be2cc4df --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/LICENSE @@ -0,0 +1,362 @@ +Mozilla Public License, version 2.0 + +1. Definitions + +1.1. "Contributor" + + means each individual or legal entity that creates, contributes to the + creation of, or owns Covered Software. + +1.2. "Contributor Version" + + means the combination of the Contributions of others (if any) used by a + Contributor and that particular Contributor's Contribution. + +1.3. "Contribution" + + means Covered Software of a particular Contributor. + +1.4. "Covered Software" + + means Source Code Form to which the initial Contributor has attached the + notice in Exhibit A, the Executable Form of such Source Code Form, and + Modifications of such Source Code Form, in each case including portions + thereof. + +1.5. "Incompatible With Secondary Licenses" + means + + a. that the initial Contributor has attached the notice described in + Exhibit B to the Covered Software; or + + b. that the Covered Software was made available under the terms of + version 1.1 or earlier of the License, but not also under the terms of + a Secondary License. + +1.6. "Executable Form" + + means any form of the work other than Source Code Form. + +1.7. "Larger Work" + + means a work that combines Covered Software with other material, in a + separate file or files, that is not Covered Software. + +1.8. "License" + + means this document. + +1.9. "Licensable" + + means having the right to grant, to the maximum extent possible, whether + at the time of the initial grant or subsequently, any and all of the + rights conveyed by this License. + +1.10. "Modifications" + + means any of the following: + + a. any file in Source Code Form that results from an addition to, + deletion from, or modification of the contents of Covered Software; or + + b. any new file in Source Code Form that contains any Covered Software. + +1.11. "Patent Claims" of a Contributor + + means any patent claim(s), including without limitation, method, + process, and apparatus claims, in any patent Licensable by such + Contributor that would be infringed, but for the grant of the License, + by the making, using, selling, offering for sale, having made, import, + or transfer of either its Contributions or its Contributor Version. + +1.12. "Secondary License" + + means either the GNU General Public License, Version 2.0, the GNU Lesser + General Public License, Version 2.1, the GNU Affero General Public + License, Version 3.0, or any later versions of those licenses. + +1.13. "Source Code Form" + + means the form of the work preferred for making modifications. + +1.14. "You" (or "Your") + + means an individual or a legal entity exercising rights under this + License. For legal entities, "You" includes any entity that controls, is + controlled by, or is under common control with You. For purposes of this + definition, "control" means (a) the power, direct or indirect, to cause + the direction or management of such entity, whether by contract or + otherwise, or (b) ownership of more than fifty percent (50%) of the + outstanding shares or beneficial ownership of such entity. + + +2. License Grants and Conditions + +2.1. Grants + + Each Contributor hereby grants You a world-wide, royalty-free, + non-exclusive license: + + a. under intellectual property rights (other than patent or trademark) + Licensable by such Contributor to use, reproduce, make available, + modify, display, perform, distribute, and otherwise exploit its + Contributions, either on an unmodified basis, with Modifications, or + as part of a Larger Work; and + + b. under Patent Claims of such Contributor to make, use, sell, offer for + sale, have made, import, and otherwise transfer either its + Contributions or its Contributor Version. + +2.2. Effective Date + + The licenses granted in Section 2.1 with respect to any Contribution + become effective for each Contribution on the date the Contributor first + distributes such Contribution. + +2.3. Limitations on Grant Scope + + The licenses granted in this Section 2 are the only rights granted under + this License. No additional rights or licenses will be implied from the + distribution or licensing of Covered Software under this License. + Notwithstanding Section 2.1(b) above, no patent license is granted by a + Contributor: + + a. for any code that a Contributor has removed from Covered Software; or + + b. for infringements caused by: (i) Your and any other third party's + modifications of Covered Software, or (ii) the combination of its + Contributions with other software (except as part of its Contributor + Version); or + + c. under Patent Claims infringed by Covered Software in the absence of + its Contributions. + + This License does not grant any rights in the trademarks, service marks, + or logos of any Contributor (except as may be necessary to comply with + the notice requirements in Section 3.4). + +2.4. Subsequent Licenses + + No Contributor makes additional grants as a result of Your choice to + distribute the Covered Software under a subsequent version of this + License (see Section 10.2) or under the terms of a Secondary License (if + permitted under the terms of Section 3.3). + +2.5. Representation + + Each Contributor represents that the Contributor believes its + Contributions are its original creation(s) or it has sufficient rights to + grant the rights to its Contributions conveyed by this License. + +2.6. Fair Use + + This License is not intended to limit any rights You have under + applicable copyright doctrines of fair use, fair dealing, or other + equivalents. + +2.7. Conditions + + Sections 3.1, 3.2, 3.3, and 3.4 are conditions of the licenses granted in + Section 2.1. + + +3. Responsibilities + +3.1. Distribution of Source Form + + All distribution of Covered Software in Source Code Form, including any + Modifications that You create or to which You contribute, must be under + the terms of this License. You must inform recipients that the Source + Code Form of the Covered Software is governed by the terms of this + License, and how they can obtain a copy of this License. You may not + attempt to alter or restrict the recipients' rights in the Source Code + Form. + +3.2. Distribution of Executable Form + + If You distribute Covered Software in Executable Form then: + + a. such Covered Software must also be made available in Source Code Form, + as described in Section 3.1, and You must inform recipients of the + Executable Form how they can obtain a copy of such Source Code Form by + reasonable means in a timely manner, at a charge no more than the cost + of distribution to the recipient; and + + b. You may distribute such Executable Form under the terms of this + License, or sublicense it under different terms, provided that the + license for the Executable Form does not attempt to limit or alter the + recipients' rights in the Source Code Form under this License. + +3.3. Distribution of a Larger Work + + You may create and distribute a Larger Work under terms of Your choice, + provided that You also comply with the requirements of this License for + the Covered Software. If the Larger Work is a combination of Covered + Software with a work governed by one or more Secondary Licenses, and the + Covered Software is not Incompatible With Secondary Licenses, this + License permits You to additionally distribute such Covered Software + under the terms of such Secondary License(s), so that the recipient of + the Larger Work may, at their option, further distribute the Covered + Software under the terms of either this License or such Secondary + License(s). + +3.4. Notices + + You may not remove or alter the substance of any license notices + (including copyright notices, patent notices, disclaimers of warranty, or + limitations of liability) contained within the Source Code Form of the + Covered Software, except that You may alter any license notices to the + extent required to remedy known factual inaccuracies. + +3.5. Application of Additional Terms + + You may choose to offer, and to charge a fee for, warranty, support, + indemnity or liability obligations to one or more recipients of Covered + Software. However, You may do so only on Your own behalf, and not on + behalf of any Contributor. You must make it absolutely clear that any + such warranty, support, indemnity, or liability obligation is offered by + You alone, and You hereby agree to indemnify every Contributor for any + liability incurred by such Contributor as a result of warranty, support, + indemnity or liability terms You offer. You may include additional + disclaimers of warranty and limitations of liability specific to any + jurisdiction. + +4. Inability to Comply Due to Statute or Regulation + + If it is impossible for You to comply with any of the terms of this License + with respect to some or all of the Covered Software due to statute, + judicial order, or regulation then You must: (a) comply with the terms of + this License to the maximum extent possible; and (b) describe the + limitations and the code they affect. Such description must be placed in a + text file included with all distributions of the Covered Software under + this License. Except to the extent prohibited by statute or regulation, + such description must be sufficiently detailed for a recipient of ordinary + skill to be able to understand it. + +5. Termination + +5.1. The rights granted under this License will terminate automatically if You + fail to comply with any of its terms. However, if You become compliant, + then the rights granted under this License from a particular Contributor + are reinstated (a) provisionally, unless and until such Contributor + explicitly and finally terminates Your grants, and (b) on an ongoing + basis, if such Contributor fails to notify You of the non-compliance by + some reasonable means prior to 60 days after You have come back into + compliance. Moreover, Your grants from a particular Contributor are + reinstated on an ongoing basis if such Contributor notifies You of the + non-compliance by some reasonable means, this is the first time You have + received notice of non-compliance with this License from such + Contributor, and You become compliant prior to 30 days after Your receipt + of the notice. + +5.2. If You initiate litigation against any entity by asserting a patent + infringement claim (excluding declaratory judgment actions, + counter-claims, and cross-claims) alleging that a Contributor Version + directly or indirectly infringes any patent, then the rights granted to + You by any and all Contributors for the Covered Software under Section + 2.1 of this License shall terminate. + +5.3. In the event of termination under Sections 5.1 or 5.2 above, all end user + license agreements (excluding distributors and resellers) which have been + validly granted by You or Your distributors under this License prior to + termination shall survive termination. + +6. Disclaimer of Warranty + + Covered Software is provided under this License on an "as is" basis, + without warranty of any kind, either expressed, implied, or statutory, + including, without limitation, warranties that the Covered Software is free + of defects, merchantable, fit for a particular purpose or non-infringing. + The entire risk as to the quality and performance of the Covered Software + is with You. Should any Covered Software prove defective in any respect, + You (not any Contributor) assume the cost of any necessary servicing, + repair, or correction. This disclaimer of warranty constitutes an essential + part of this License. No use of any Covered Software is authorized under + this License except under this disclaimer. + +7. Limitation of Liability + + Under no circumstances and under no legal theory, whether tort (including + negligence), contract, or otherwise, shall any Contributor, or anyone who + distributes Covered Software as permitted above, be liable to You for any + direct, indirect, special, incidental, or consequential damages of any + character including, without limitation, damages for lost profits, loss of + goodwill, work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses, even if such party shall have been + informed of the possibility of such damages. This limitation of liability + shall not apply to liability for death or personal injury resulting from + such party's negligence to the extent applicable law prohibits such + limitation. Some jurisdictions do not allow the exclusion or limitation of + incidental or consequential damages, so this exclusion and limitation may + not apply to You. + +8. Litigation + + Any litigation relating to this License may be brought only in the courts + of a jurisdiction where the defendant maintains its principal place of + business and such litigation shall be governed by laws of that + jurisdiction, without reference to its conflict-of-law provisions. Nothing + in this Section shall prevent a party's ability to bring cross-claims or + counter-claims. + +9. Miscellaneous + + This License represents the complete agreement concerning the subject + matter hereof. If any provision of this License is held to be + unenforceable, such provision shall be reformed only to the extent + necessary to make it enforceable. Any law or regulation which provides that + the language of a contract shall be construed against the drafter shall not + be used to construe this License against a Contributor. + + +10. Versions of the License + +10.1. New Versions + + Mozilla Foundation is the license steward. Except as provided in Section + 10.3, no one other than the license steward has the right to modify or + publish new versions of this License. Each version will be given a + distinguishing version number. + +10.2. Effect of New Versions + + You may distribute the Covered Software under the terms of the version + of the License under which You originally received the Covered Software, + or under the terms of any subsequent version published by the license + steward. + +10.3. Modified Versions + + If you create software not governed by this License, and you want to + create a new license for such software, you may create and use a + modified version of this License if you rename the license and remove + any references to the name of the license steward (except to note that + such modified license differs from this License). + +10.4. Distributing Source Code Form that is Incompatible With Secondary + Licenses If You choose to distribute Source Code Form that is + Incompatible With Secondary Licenses under the terms of this version of + the License, the notice described in Exhibit B of this License must be + attached. + +Exhibit A - Source Code Form License Notice + + This Source Code Form is subject to the + terms of the Mozilla Public License, v. + 2.0. If a copy of the MPL was not + distributed with this file, You can + obtain one at + http://mozilla.org/MPL/2.0/. + +If it is not possible or desirable to put the notice in a particular file, +then You may include the notice in a location (such as a LICENSE file in a +relevant directory) where a recipient would be likely to look for such a +notice. + +You may add additional accurate notices of copyright ownership. + +Exhibit B - "Incompatible With Secondary Licenses" Notice + + This Source Code Form is "Incompatible + With Secondary Licenses", as defined by + the Mozilla Public License, v. 2.0. diff --git a/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go b/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go new file mode 100644 index 00000000..5673773b --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go @@ -0,0 +1,161 @@ +package simplelru + +import ( + "container/list" + "errors" +) + +// EvictCallback is used to get a callback when a cache entry is evicted +type EvictCallback func(key interface{}, value interface{}) + +// LRU implements a non-thread safe fixed size LRU cache +type LRU struct { + size int + evictList *list.List + items map[interface{}]*list.Element + onEvict EvictCallback +} + +// entry is used to hold a value in the evictList +type entry struct { + key interface{} + value interface{} +} + +// NewLRU constructs an LRU of the given size +func NewLRU(size int, onEvict EvictCallback) (*LRU, error) { + if size <= 0 { + return nil, errors.New("Must provide a positive size") + } + c := &LRU{ + size: size, + evictList: list.New(), + items: make(map[interface{}]*list.Element), + onEvict: onEvict, + } + return c, nil +} + +// Purge is used to completely clear the cache. +func (c *LRU) Purge() { + for k, v := range c.items { + if c.onEvict != nil { + c.onEvict(k, v.Value.(*entry).value) + } + delete(c.items, k) + } + c.evictList.Init() +} + +// Add adds a value to the cache. Returns true if an eviction occurred. +func (c *LRU) Add(key, value interface{}) (evicted bool) { + // Check for existing item + if ent, ok := c.items[key]; ok { + c.evictList.MoveToFront(ent) + ent.Value.(*entry).value = value + return false + } + + // Add new item + ent := &entry{key, value} + entry := c.evictList.PushFront(ent) + c.items[key] = entry + + evict := c.evictList.Len() > c.size + // Verify size not exceeded + if evict { + c.removeOldest() + } + return evict +} + +// Get looks up a key's value from the cache. +func (c *LRU) Get(key interface{}) (value interface{}, ok bool) { + if ent, ok := c.items[key]; ok { + c.evictList.MoveToFront(ent) + return ent.Value.(*entry).value, true + } + return +} + +// Contains checks if a key is in the cache, without updating the recent-ness +// or deleting it for being stale. +func (c *LRU) Contains(key interface{}) (ok bool) { + _, ok = c.items[key] + return ok +} + +// Peek returns the key value (or undefined if not found) without updating +// the "recently used"-ness of the key. +func (c *LRU) Peek(key interface{}) (value interface{}, ok bool) { + var ent *list.Element + if ent, ok = c.items[key]; ok { + return ent.Value.(*entry).value, true + } + return nil, ok +} + +// Remove removes the provided key from the cache, returning if the +// key was contained. +func (c *LRU) Remove(key interface{}) (present bool) { + if ent, ok := c.items[key]; ok { + c.removeElement(ent) + return true + } + return false +} + +// RemoveOldest removes the oldest item from the cache. +func (c *LRU) RemoveOldest() (key interface{}, value interface{}, ok bool) { + ent := c.evictList.Back() + if ent != nil { + c.removeElement(ent) + kv := ent.Value.(*entry) + return kv.key, kv.value, true + } + return nil, nil, false +} + +// GetOldest returns the oldest entry +func (c *LRU) GetOldest() (key interface{}, value interface{}, ok bool) { + ent := c.evictList.Back() + if ent != nil { + kv := ent.Value.(*entry) + return kv.key, kv.value, true + } + return nil, nil, false +} + +// Keys returns a slice of the keys in the cache, from oldest to newest. +func (c *LRU) Keys() []interface{} { + keys := make([]interface{}, len(c.items)) + i := 0 + for ent := c.evictList.Back(); ent != nil; ent = ent.Prev() { + keys[i] = ent.Value.(*entry).key + i++ + } + return keys +} + +// Len returns the number of items in the cache. +func (c *LRU) Len() int { + return c.evictList.Len() +} + +// removeOldest removes the oldest item from the cache. +func (c *LRU) removeOldest() { + ent := c.evictList.Back() + if ent != nil { + c.removeElement(ent) + } +} + +// removeElement is used to remove a given list element from the cache +func (c *LRU) removeElement(e *list.Element) { + c.evictList.Remove(e) + kv := e.Value.(*entry) + delete(c.items, kv.key) + if c.onEvict != nil { + c.onEvict(kv.key, kv.value) + } +} diff --git a/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go b/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go new file mode 100644 index 00000000..74c70774 --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go @@ -0,0 +1,36 @@ +package simplelru + +// LRUCache is the interface for simple LRU cache. +type LRUCache interface { + // Adds a value to the cache, returns true if an eviction occurred and + // updates the "recently used"-ness of the key. + Add(key, value interface{}) bool + + // Returns key's value from the cache and + // updates the "recently used"-ness of the key. #value, isFound + Get(key interface{}) (value interface{}, ok bool) + + // Check if a key exsists in cache without updating the recent-ness. + Contains(key interface{}) (ok bool) + + // Returns key's value without updating the "recently used"-ness of the key. + Peek(key interface{}) (value interface{}, ok bool) + + // Removes a key from the cache. + Remove(key interface{}) bool + + // Removes the oldest entry from cache. + RemoveOldest() (interface{}, interface{}, bool) + + // Returns the oldest entry from the cache. #key, value, isFound + GetOldest() (interface{}, interface{}, bool) + + // Returns a slice of the keys in the cache, from oldest to newest. + Keys() []interface{} + + // Returns the number of items in the cache. + Len() int + + // Clear all cache entries + Purge() +} diff --git a/vendor/github.com/prometheus/procfs/arp.go b/vendor/github.com/prometheus/procfs/arp.go new file mode 100644 index 00000000..916c9182 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/arp.go @@ -0,0 +1,85 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "fmt" + "io/ioutil" + "net" + "strings" +) + +// ARPEntry contains a single row of the columnar data represented in +// /proc/net/arp. +type ARPEntry struct { + // IP address + IPAddr net.IP + // MAC address + HWAddr net.HardwareAddr + // Name of the device + Device string +} + +// GatherARPEntries retrieves all the ARP entries, parse the relevant columns, +// and then return a slice of ARPEntry's. +func (fs FS) GatherARPEntries() ([]ARPEntry, error) { + data, err := ioutil.ReadFile(fs.proc.Path("net/arp")) + if err != nil { + return nil, fmt.Errorf("error reading arp %s: %s", fs.proc.Path("net/arp"), err) + } + + return parseARPEntries(data) +} + +func parseARPEntries(data []byte) ([]ARPEntry, error) { + lines := strings.Split(string(data), "\n") + entries := make([]ARPEntry, 0) + var err error + const ( + expectedDataWidth = 6 + expectedHeaderWidth = 9 + ) + for _, line := range lines { + columns := strings.Fields(line) + width := len(columns) + + if width == expectedHeaderWidth || width == 0 { + continue + } else if width == expectedDataWidth { + entry, err := parseARPEntry(columns) + if err != nil { + return []ARPEntry{}, fmt.Errorf("failed to parse ARP entry: %s", err) + } + entries = append(entries, entry) + } else { + return []ARPEntry{}, fmt.Errorf("%d columns were detected, but %d were expected", width, expectedDataWidth) + } + + } + + return entries, err +} + +func parseARPEntry(columns []string) (ARPEntry, error) { + ip := net.ParseIP(columns[0]) + mac := net.HardwareAddr(columns[3]) + + entry := ARPEntry{ + IPAddr: ip, + HWAddr: mac, + Device: columns[5], + } + + return entry, nil +} diff --git a/vendor/github.com/prometheus/procfs/buddyinfo.go b/vendor/github.com/prometheus/procfs/buddyinfo.go index 63d4229a..10bd067a 100644 --- a/vendor/github.com/prometheus/procfs/buddyinfo.go +++ b/vendor/github.com/prometheus/procfs/buddyinfo.go @@ -31,7 +31,7 @@ type BuddyInfo struct { Sizes []float64 } -// NewBuddyInfo reads the buddyinfo statistics from the specified `proc` filesystem. +// BuddyInfo reads the buddyinfo statistics from the specified `proc` filesystem. func (fs FS) BuddyInfo() ([]BuddyInfo, error) { file, err := os.Open(fs.proc.Path("buddyinfo")) if err != nil { diff --git a/vendor/github.com/prometheus/procfs/cpuinfo.go b/vendor/github.com/prometheus/procfs/cpuinfo.go new file mode 100644 index 00000000..16491d6a --- /dev/null +++ b/vendor/github.com/prometheus/procfs/cpuinfo.go @@ -0,0 +1,166 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "bufio" + "bytes" + "io/ioutil" + "strconv" + "strings" +) + +// CPUInfo contains general information about a system CPU found in /proc/cpuinfo +type CPUInfo struct { + Processor uint + VendorID string + CPUFamily string + Model string + ModelName string + Stepping string + Microcode string + CPUMHz float64 + CacheSize string + PhysicalID string + Siblings uint + CoreID string + CPUCores uint + APICID string + InitialAPICID string + FPU string + FPUException string + CPUIDLevel uint + WP string + Flags []string + Bugs []string + BogoMips float64 + CLFlushSize uint + CacheAlignment uint + AddressSizes string + PowerManagement string +} + +// CPUInfo returns information about current system CPUs. +// See https://www.kernel.org/doc/Documentation/filesystems/proc.txt +func (fs FS) CPUInfo() ([]CPUInfo, error) { + data, err := ioutil.ReadFile(fs.proc.Path("cpuinfo")) + if err != nil { + return nil, err + } + return parseCPUInfo(data) +} + +// parseCPUInfo parses data from /proc/cpuinfo +func parseCPUInfo(info []byte) ([]CPUInfo, error) { + cpuinfo := []CPUInfo{} + i := -1 + scanner := bufio.NewScanner(bytes.NewReader(info)) + for scanner.Scan() { + line := scanner.Text() + if strings.TrimSpace(line) == "" { + continue + } + field := strings.SplitN(line, ": ", 2) + switch strings.TrimSpace(field[0]) { + case "processor": + cpuinfo = append(cpuinfo, CPUInfo{}) // start of the next processor + i++ + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].Processor = uint(v) + case "vendor_id": + cpuinfo[i].VendorID = field[1] + case "cpu family": + cpuinfo[i].CPUFamily = field[1] + case "model": + cpuinfo[i].Model = field[1] + case "model name": + cpuinfo[i].ModelName = field[1] + case "stepping": + cpuinfo[i].Stepping = field[1] + case "microcode": + cpuinfo[i].Microcode = field[1] + case "cpu MHz": + v, err := strconv.ParseFloat(field[1], 64) + if err != nil { + return nil, err + } + cpuinfo[i].CPUMHz = v + case "cache size": + cpuinfo[i].CacheSize = field[1] + case "physical id": + cpuinfo[i].PhysicalID = field[1] + case "siblings": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].Siblings = uint(v) + case "core id": + cpuinfo[i].CoreID = field[1] + case "cpu cores": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].CPUCores = uint(v) + case "apicid": + cpuinfo[i].APICID = field[1] + case "initial apicid": + cpuinfo[i].InitialAPICID = field[1] + case "fpu": + cpuinfo[i].FPU = field[1] + case "fpu_exception": + cpuinfo[i].FPUException = field[1] + case "cpuid level": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].CPUIDLevel = uint(v) + case "wp": + cpuinfo[i].WP = field[1] + case "flags": + cpuinfo[i].Flags = strings.Fields(field[1]) + case "bugs": + cpuinfo[i].Bugs = strings.Fields(field[1]) + case "bogomips": + v, err := strconv.ParseFloat(field[1], 64) + if err != nil { + return nil, err + } + cpuinfo[i].BogoMips = v + case "clflush size": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].CLFlushSize = uint(v) + case "cache_alignment": + v, err := strconv.ParseUint(field[1], 0, 32) + if err != nil { + return nil, err + } + cpuinfo[i].CacheAlignment = uint(v) + case "address sizes": + cpuinfo[i].AddressSizes = field[1] + case "power management": + cpuinfo[i].PowerManagement = field[1] + } + } + return cpuinfo, nil + +} diff --git a/vendor/github.com/prometheus/procfs/crypto.go b/vendor/github.com/prometheus/procfs/crypto.go new file mode 100644 index 00000000..19d4041b --- /dev/null +++ b/vendor/github.com/prometheus/procfs/crypto.go @@ -0,0 +1,131 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "bytes" + "fmt" + "io/ioutil" + "strconv" + "strings" + + "github.com/prometheus/procfs/internal/util" +) + +// Crypto holds info parsed from /proc/crypto. +type Crypto struct { + Alignmask *uint64 + Async bool + Blocksize *uint64 + Chunksize *uint64 + Ctxsize *uint64 + Digestsize *uint64 + Driver string + Geniv string + Internal string + Ivsize *uint64 + Maxauthsize *uint64 + MaxKeysize *uint64 + MinKeysize *uint64 + Module string + Name string + Priority *int64 + Refcnt *int64 + Seedsize *uint64 + Selftest string + Type string + Walksize *uint64 +} + +// Crypto parses an crypto-file (/proc/crypto) and returns a slice of +// structs containing the relevant info. More information available here: +// https://kernel.readthedocs.io/en/sphinx-samples/crypto-API.html +func (fs FS) Crypto() ([]Crypto, error) { + data, err := ioutil.ReadFile(fs.proc.Path("crypto")) + if err != nil { + return nil, fmt.Errorf("error parsing crypto %s: %s", fs.proc.Path("crypto"), err) + } + crypto, err := parseCrypto(data) + if err != nil { + return nil, fmt.Errorf("error parsing crypto %s: %s", fs.proc.Path("crypto"), err) + } + return crypto, nil +} + +func parseCrypto(cryptoData []byte) ([]Crypto, error) { + crypto := []Crypto{} + + cryptoBlocks := bytes.Split(cryptoData, []byte("\n\n")) + + for _, block := range cryptoBlocks { + var newCryptoElem Crypto + + lines := strings.Split(string(block), "\n") + for _, line := range lines { + if strings.TrimSpace(line) == "" || line[0] == ' ' { + continue + } + fields := strings.Split(line, ":") + key := strings.TrimSpace(fields[0]) + value := strings.TrimSpace(fields[1]) + vp := util.NewValueParser(value) + + switch strings.TrimSpace(key) { + case "async": + b, err := strconv.ParseBool(value) + if err == nil { + newCryptoElem.Async = b + } + case "blocksize": + newCryptoElem.Blocksize = vp.PUInt64() + case "chunksize": + newCryptoElem.Chunksize = vp.PUInt64() + case "digestsize": + newCryptoElem.Digestsize = vp.PUInt64() + case "driver": + newCryptoElem.Driver = value + case "geniv": + newCryptoElem.Geniv = value + case "internal": + newCryptoElem.Internal = value + case "ivsize": + newCryptoElem.Ivsize = vp.PUInt64() + case "maxauthsize": + newCryptoElem.Maxauthsize = vp.PUInt64() + case "max keysize": + newCryptoElem.MaxKeysize = vp.PUInt64() + case "min keysize": + newCryptoElem.MinKeysize = vp.PUInt64() + case "module": + newCryptoElem.Module = value + case "name": + newCryptoElem.Name = value + case "priority": + newCryptoElem.Priority = vp.PInt64() + case "refcnt": + newCryptoElem.Refcnt = vp.PInt64() + case "seedsize": + newCryptoElem.Seedsize = vp.PUInt64() + case "selftest": + newCryptoElem.Selftest = value + case "type": + newCryptoElem.Type = value + case "walksize": + newCryptoElem.Walksize = vp.PUInt64() + } + } + crypto = append(crypto, newCryptoElem) + } + return crypto, nil +} diff --git a/vendor/github.com/prometheus/procfs/fixtures.ttar b/vendor/github.com/prometheus/procfs/fixtures.ttar index 6b42e7ba..0b290554 100644 --- a/vendor/github.com/prometheus/procfs/fixtures.ttar +++ b/vendor/github.com/prometheus/procfs/fixtures.ttar @@ -47,6 +47,48 @@ SymlinkTo: ../../symlinktargets/ghi Path: fixtures/proc/26231/fd/3 SymlinkTo: ../../symlinktargets/uvw # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/proc/26231/fdinfo +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/0 +Lines: 6 +pos: 0 +flags: 02004000 +mnt_id: 13 +inotify wd:3 ino:1 sdev:34 mask:fce ignored_mask:0 fhandle-bytes:c fhandle-type:81 f_handle:000000000100000000000000 +inotify wd:2 ino:1300016 sdev:fd00002 mask:fce ignored_mask:0 fhandle-bytes:8 fhandle-type:1 f_handle:16003001ed3f022a +inotify wd:1 ino:2e0001 sdev:fd00000 mask:fce ignored_mask:0 fhandle-bytes:8 fhandle-type:1 f_handle:01002e00138e7c65 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/1 +Lines: 4 +pos: 0 +flags: 02004002 +mnt_id: 13 +eventfd-count: 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/10 +Lines: 3 +pos: 0 +flags: 02004002 +mnt_id: 9 +Mode: 400 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/2 +Lines: 3 +pos: 0 +flags: 02004002 +mnt_id: 9 +Mode: 400 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/fdinfo/3 +Lines: 3 +pos: 0 +flags: 02004002 +mnt_id: 9 +Mode: 400 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/26231/io Lines: 7 rchar: 750339 @@ -126,6 +168,11 @@ SymlinkTo: net:[4026531993] Path: fixtures/proc/26231/root SymlinkTo: / # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26231/schedstat +Lines: 1 +411605849 93680043 79 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/26231/stat Lines: 1 26231 (vim) R 5392 7446 5392 34835 7446 4218880 32533 309516 26 82 1677 44 158 99 20 0 1 0 82375 56274944 1981 18446744073709551615 4194304 6294284 140736914091744 140736914087944 139965136429984 0 0 12288 1870679807 0 0 0 17 0 0 0 31 0 0 8391624 8481048 16420864 140736914093252 140736914093279 140736914093279 140736914096107 0 @@ -137,10 +184,10 @@ Lines: 53 Name: prometheus Umask: 0022 State: S (sleeping) -Tgid: 1 +Tgid: 26231 Ngid: 0 -Pid: 1 -PPid: 0 +Pid: 26231 +PPid: 1 TracerPid: 0 Uid: 0 0 0 0 Gid: 0 0 0 0 @@ -258,6 +305,18 @@ Lines: 1 com.github.uiautomatorNULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTENULLBYTEEOF Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/26233/schedstat +Lines: 8 + ____________________________________ +< this is a malformed schedstat file > + ------------------------------------ + \ ^__^ + \ (oo)\_______ + (__)\ )\/\ + ||----w | + || || +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/proc/584 Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -274,6 +333,1201 @@ Node 0, zone DMA32 759 572 791 475 194 45 12 0 Node 0, zone Normal 4381 1093 185 1530 567 102 4 0 0 0 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/cpuinfo +Lines: 216 +processor : 0 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 799.998 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 0 +cpu cores : 4 +apicid : 0 +initial apicid : 0 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 1 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.037 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 1 +cpu cores : 4 +apicid : 2 +initial apicid : 2 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 2 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.010 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 2 +cpu cores : 4 +apicid : 4 +initial apicid : 4 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 3 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.028 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 3 +cpu cores : 4 +apicid : 6 +initial apicid : 6 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 4 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 799.989 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 0 +cpu cores : 4 +apicid : 1 +initial apicid : 1 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 5 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.083 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 1 +cpu cores : 4 +apicid : 3 +initial apicid : 3 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 6 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.017 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 2 +cpu cores : 4 +apicid : 5 +initial apicid : 5 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +processor : 7 +vendor_id : GenuineIntel +cpu family : 6 +model : 142 +model name : Intel(R) Core(TM) i7-8650U CPU @ 1.90GHz +stepping : 10 +microcode : 0xb4 +cpu MHz : 800.030 +cache size : 8192 KB +physical id : 0 +siblings : 8 +core id : 3 +cpu cores : 4 +apicid : 7 +initial apicid : 7 +fpu : yes +fpu_exception : yes +cpuid level : 22 +wp : yes +flags : fpu vme de pse tsc msr pae mce cx8 apic sep mtrr pge mca cmov pat pse36 clflush dts acpi mmx fxsr sse sse2 ss ht tm pbe syscall nx pdpe1gb rdtscp lm constant_tsc art arch_perfmon pebs bts rep_good nopl xtopology nonstop_tsc cpuid aperfmperf tsc_known_freq pni pclmulqdq dtes64 monitor ds_cpl vmx smx est tm2 ssse3 sdbg fma cx16 xtpr pdcm pcid sse4_1 sse4_2 x2apic movbe popcnt tsc_deadline_timer aes xsave avx f16c rdrand lahf_lm abm 3dnowprefetch cpuid_fault epb invpcid_single pti ssbd ibrs ibpb stibp tpr_shadow vnmi flexpriority ept vpid ept_ad fsgsbase tsc_adjust bmi1 hle avx2 smep bmi2 erms invpcid rtm mpx rdseed adx smap clflushopt intel_pt xsaveopt xsavec xgetbv1 xsaves dtherm ida arat pln pts hwp hwp_notify hwp_act_window hwp_epp md_clear flush_l1d +bugs : cpu_meltdown spectre_v1 spectre_v2 spec_store_bypass l1tf mds swapgs +bogomips : 4224.00 +clflush size : 64 +cache_alignment : 64 +address sizes : 39 bits physical, 48 bits virtual +power management: + +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/crypto +Lines: 971 +name : ccm(aes) +driver : ccm_base(ctr(aes-aesni),cbcmac(aes-aesni)) +module : ccm +priority : 300 +refcnt : 4 +selftest : passed +internal : no +type : aead +async : no +blocksize : 1 +ivsize : 16 +maxauthsize : 16 +geniv : + +name : cbcmac(aes) +driver : cbcmac(aes-aesni) +module : ccm +priority : 300 +refcnt : 7 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 16 + +name : ecdh +driver : ecdh-generic +module : ecdh_generic +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : kpp + +name : ecb(arc4) +driver : ecb(arc4)-generic +module : arc4 +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : no +blocksize : 1 +min keysize : 1 +max keysize : 256 +ivsize : 0 +chunksize : 1 +walksize : 1 + +name : arc4 +driver : arc4-generic +module : arc4 +priority : 0 +refcnt : 3 +selftest : passed +internal : no +type : cipher +blocksize : 1 +min keysize : 1 +max keysize : 256 + +name : crct10dif +driver : crct10dif-pclmul +module : crct10dif_pclmul +priority : 200 +refcnt : 2 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 2 + +name : crc32 +driver : crc32-pclmul +module : crc32_pclmul +priority : 200 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 4 + +name : __ghash +driver : cryptd(__ghash-pclmulqdqni) +module : kernel +priority : 50 +refcnt : 1 +selftest : passed +internal : yes +type : ahash +async : yes +blocksize : 16 +digestsize : 16 + +name : ghash +driver : ghash-clmulni +module : ghash_clmulni_intel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : ahash +async : yes +blocksize : 16 +digestsize : 16 + +name : __ghash +driver : __ghash-pclmulqdqni +module : ghash_clmulni_intel +priority : 0 +refcnt : 1 +selftest : passed +internal : yes +type : shash +blocksize : 16 +digestsize : 16 + +name : crc32c +driver : crc32c-intel +module : crc32c_intel +priority : 200 +refcnt : 5 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 4 + +name : cbc(aes) +driver : cbc(aes-aesni) +module : kernel +priority : 300 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : no +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : ctr(aes) +driver : ctr(aes-aesni) +module : kernel +priority : 300 +refcnt : 5 +selftest : passed +internal : no +type : skcipher +async : no +blocksize : 1 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : pkcs1pad(rsa,sha256) +driver : pkcs1pad(rsa-generic,sha256) +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : akcipher + +name : __xts(aes) +driver : cryptd(__xts-aes-aesni) +module : kernel +priority : 451 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : yes +blocksize : 16 +min keysize : 32 +max keysize : 64 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : xts(aes) +driver : xts-aes-aesni +module : kernel +priority : 401 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : yes +blocksize : 16 +min keysize : 32 +max keysize : 64 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __ctr(aes) +driver : cryptd(__ctr-aes-aesni) +module : kernel +priority : 450 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : yes +blocksize : 1 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : ctr(aes) +driver : ctr-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : yes +blocksize : 1 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __cbc(aes) +driver : cryptd(__cbc-aes-aesni) +module : kernel +priority : 450 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : yes +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : cbc(aes) +driver : cbc-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : yes +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __ecb(aes) +driver : cryptd(__ecb-aes-aesni) +module : kernel +priority : 450 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : yes +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 0 +chunksize : 16 +walksize : 16 + +name : ecb(aes) +driver : ecb-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : yes +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 0 +chunksize : 16 +walksize : 16 + +name : __generic-gcm-aes-aesni +driver : cryptd(__driver-generic-gcm-aes-aesni) +module : kernel +priority : 50 +refcnt : 1 +selftest : passed +internal : yes +type : aead +async : yes +blocksize : 1 +ivsize : 12 +maxauthsize : 16 +geniv : + +name : gcm(aes) +driver : generic-gcm-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : aead +async : yes +blocksize : 1 +ivsize : 12 +maxauthsize : 16 +geniv : + +name : __generic-gcm-aes-aesni +driver : __driver-generic-gcm-aes-aesni +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : yes +type : aead +async : no +blocksize : 1 +ivsize : 12 +maxauthsize : 16 +geniv : + +name : __gcm-aes-aesni +driver : cryptd(__driver-gcm-aes-aesni) +module : kernel +priority : 50 +refcnt : 1 +selftest : passed +internal : yes +type : aead +async : yes +blocksize : 1 +ivsize : 8 +maxauthsize : 16 +geniv : + +name : rfc4106(gcm(aes)) +driver : rfc4106-gcm-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : no +type : aead +async : yes +blocksize : 1 +ivsize : 8 +maxauthsize : 16 +geniv : + +name : __gcm-aes-aesni +driver : __driver-gcm-aes-aesni +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : yes +type : aead +async : no +blocksize : 1 +ivsize : 8 +maxauthsize : 16 +geniv : + +name : __xts(aes) +driver : __xts-aes-aesni +module : kernel +priority : 401 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : no +blocksize : 16 +min keysize : 32 +max keysize : 64 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __ctr(aes) +driver : __ctr-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : no +blocksize : 1 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __cbc(aes) +driver : __cbc-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : no +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 16 +chunksize : 16 +walksize : 16 + +name : __ecb(aes) +driver : __ecb-aes-aesni +module : kernel +priority : 400 +refcnt : 1 +selftest : passed +internal : yes +type : skcipher +async : no +blocksize : 16 +min keysize : 16 +max keysize : 32 +ivsize : 0 +chunksize : 16 +walksize : 16 + +name : __aes +driver : __aes-aesni +module : kernel +priority : 300 +refcnt : 1 +selftest : passed +internal : yes +type : cipher +blocksize : 16 +min keysize : 16 +max keysize : 32 + +name : aes +driver : aes-aesni +module : kernel +priority : 300 +refcnt : 8 +selftest : passed +internal : no +type : cipher +blocksize : 16 +min keysize : 16 +max keysize : 32 + +name : hmac(sha1) +driver : hmac(sha1-generic) +module : kernel +priority : 100 +refcnt : 9 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 20 + +name : ghash +driver : ghash-generic +module : kernel +priority : 100 +refcnt : 3 +selftest : passed +internal : no +type : shash +blocksize : 16 +digestsize : 16 + +name : jitterentropy_rng +driver : jitterentropy_rng +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_hmac_sha256 +module : kernel +priority : 221 +refcnt : 2 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_hmac_sha512 +module : kernel +priority : 220 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_hmac_sha384 +module : kernel +priority : 219 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_hmac_sha1 +module : kernel +priority : 218 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_sha256 +module : kernel +priority : 217 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_sha512 +module : kernel +priority : 216 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_sha384 +module : kernel +priority : 215 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_sha1 +module : kernel +priority : 214 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_ctr_aes256 +module : kernel +priority : 213 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_ctr_aes192 +module : kernel +priority : 212 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_nopr_ctr_aes128 +module : kernel +priority : 211 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : hmac(sha256) +driver : hmac(sha256-generic) +module : kernel +priority : 100 +refcnt : 10 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 32 + +name : stdrng +driver : drbg_pr_hmac_sha256 +module : kernel +priority : 210 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_hmac_sha512 +module : kernel +priority : 209 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_hmac_sha384 +module : kernel +priority : 208 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_hmac_sha1 +module : kernel +priority : 207 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_sha256 +module : kernel +priority : 206 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_sha512 +module : kernel +priority : 205 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_sha384 +module : kernel +priority : 204 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_sha1 +module : kernel +priority : 203 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_ctr_aes256 +module : kernel +priority : 202 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_ctr_aes192 +module : kernel +priority : 201 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : stdrng +driver : drbg_pr_ctr_aes128 +module : kernel +priority : 200 +refcnt : 1 +selftest : passed +internal : no +type : rng +seedsize : 0 + +name : 842 +driver : 842-scomp +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : 842 +driver : 842-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : compression + +name : lzo-rle +driver : lzo-rle-scomp +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : lzo-rle +driver : lzo-rle-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : compression + +name : lzo +driver : lzo-scomp +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : lzo +driver : lzo-generic +module : kernel +priority : 0 +refcnt : 9 +selftest : passed +internal : no +type : compression + +name : crct10dif +driver : crct10dif-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 2 + +name : crc32c +driver : crc32c-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 4 + +name : zlib-deflate +driver : zlib-deflate-scomp +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : deflate +driver : deflate-scomp +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : scomp + +name : deflate +driver : deflate-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : compression + +name : aes +driver : aes-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : cipher +blocksize : 16 +min keysize : 16 +max keysize : 32 + +name : sha224 +driver : sha224-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 28 + +name : sha256 +driver : sha256-generic +module : kernel +priority : 100 +refcnt : 11 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 32 + +name : sha1 +driver : sha1-generic +module : kernel +priority : 100 +refcnt : 11 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 20 + +name : md5 +driver : md5-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 64 +digestsize : 16 + +name : ecb(cipher_null) +driver : ecb-cipher_null +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : skcipher +async : no +blocksize : 1 +min keysize : 0 +max keysize : 0 +ivsize : 0 +chunksize : 1 +walksize : 1 + +name : digest_null +driver : digest_null-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : shash +blocksize : 1 +digestsize : 0 + +name : compress_null +driver : compress_null-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : compression + +name : cipher_null +driver : cipher_null-generic +module : kernel +priority : 0 +refcnt : 1 +selftest : passed +internal : no +type : cipher +blocksize : 1 +min keysize : 0 +max keysize : 0 + +name : rsa +driver : rsa-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : akcipher + +name : dh +driver : dh-generic +module : kernel +priority : 100 +refcnt : 1 +selftest : passed +internal : no +type : kpp + +name : aes +driver : aes-asm +module : kernel +priority : 200 +refcnt : 1 +selftest : passed +internal : no +type : cipher +blocksize : 16 +min keysize : 16 +max keysize : 32 + +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/diskstats Lines: 49 1 0 ram0 0 0 0 0 0 0 0 0 0 0 0 @@ -423,6 +1677,12 @@ Mode: 644 Directory: fixtures/proc/net Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/net/arp +Lines: 2 +IP address HW type Flags HW address Mask Device +192.168.224.1 0x1 0x2 00:50:56:c0:00:08 * ens33 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/net/dev Lines: 6 Inter-| Receive | Transmit @@ -495,6 +1755,11 @@ proc4 2 2 10853 proc4ops 72 0 0 0 1098 2 0 0 0 0 8179 5896 0 0 0 0 5900 0 0 2 0 2 0 9609 0 2 150 1272 0 0 0 1236 0 0 0 0 3 3 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/net/softnet_stat +Lines: 1 +00015c73 00020e76 F0000769 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/net/unix Lines: 6 Num RefCount Protocol Flags Type St Inode Path @@ -567,6 +1832,16 @@ some avg10=0.10 avg60=2.00 avg300=3.85 total=15 full avg10=0.20 avg60=3.00 avg300=4.95 total=25 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/schedstat +Lines: 6 +version 15 +timestamp 15819019232 +cpu0 498494191 0 3533438552 2553969831 3853684107 2465731542 2045936778163039 343796328169361 4767485306 +domain0 00000000,00000003 212499247 210112015 1861015 1860405436 536440 369895 32599 210079416 25368550 24241256 384652 927363878 807233 6366 1647 24239609 2122447165 1886868564 121112060 2848625533 125678146 241025 1032026 1885836538 2545 12 2533 0 0 0 0 0 0 1387952561 21076581 0 +cpu1 518377256 0 4155211005 2778589869 10466382 2867629021 1904686152592476 364107263788241 5145567945 +domain0 00000000,00000003 217653037 215526982 1577949 1580427380 557469 393576 28538 215498444 28721913 27662819 371153 870843407 745912 5523 1639 27661180 2331056874 2107732788 111442342 652402556 123615235 196159 1045245 2106687543 2400 3 2397 0 0 0 0 0 0 1437804657 26220076 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/proc/self SymlinkTo: 26231 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -619,261 +1894,748 @@ Path: fixtures/proc/symlinktargets/xyz Lines: 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys -Mode: 755 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/block -Mode: 775 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/block/dm-0 +Directory: fixtures/proc/sys Mode: 775 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/block/dm-0/stat -Lines: 1 -6447303 0 710266738 1529043 953216 0 31201176 4557464 0 796160 6088971 -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/block/sda +Directory: fixtures/proc/sys/vm Mode: 775 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/block/sda/stat +Path: fixtures/proc/sys/vm/admin_reserve_kbytes Lines: 1 -9652963 396792 759304206 412943 8422549 6731723 286915323 13947418 0 5658367 19174573 1 2 3 12 -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class -Mode: 775 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/infiniband -Mode: 755 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/infiniband/mlx4_0 -Mode: 755 +8192 +Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/board_id +Path: fixtures/proc/sys/vm/block_dump Lines: 1 -SM_1141000001000 +0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/fw_ver +Path: fixtures/proc/sys/vm/compact_unevictable_allowed Lines: 1 -2.31.5050 +1 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/hca_type +Path: fixtures/proc/sys/vm/dirty_background_bytes Lines: 1 -MT4099 +0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/infiniband/mlx4_0/ports -Mode: 755 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/infiniband/mlx4_0/ports/1 -Mode: 755 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters -Mode: 755 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/excessive_buffer_overrun_errors +Path: fixtures/proc/sys/vm/dirty_background_ratio Lines: 1 -0 +10 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/link_downed +Path: fixtures/proc/sys/vm/dirty_bytes Lines: 1 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/link_error_recovery +Path: fixtures/proc/sys/vm/dirty_expire_centisecs Lines: 1 -0 +3000 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/local_link_integrity_errors +Path: fixtures/proc/sys/vm/dirty_ratio Lines: 1 -0 +20 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_rcv_constraint_errors +Path: fixtures/proc/sys/vm/dirty_writeback_centisecs Lines: 1 -0 +500 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_rcv_data +Path: fixtures/proc/sys/vm/dirtytime_expire_seconds Lines: 1 -2221223609 +43200 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_rcv_errors +Path: fixtures/proc/sys/vm/drop_caches Lines: 1 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_rcv_packets +Path: fixtures/proc/sys/vm/extfrag_threshold Lines: 1 -87169372 +500 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_rcv_remote_physical_errors +Path: fixtures/proc/sys/vm/hugetlb_shm_group Lines: 1 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_rcv_switch_relay_errors +Path: fixtures/proc/sys/vm/laptop_mode Lines: 1 -0 +5 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_xmit_constraint_errors +Path: fixtures/proc/sys/vm/legacy_va_layout Lines: 1 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_xmit_data +Path: fixtures/proc/sys/vm/lowmem_reserve_ratio Lines: 1 -26509113295 +256 256 32 0 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_xmit_discards +Path: fixtures/proc/sys/vm/max_map_count Lines: 1 -0 +65530 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_xmit_packets +Path: fixtures/proc/sys/vm/memory_failure_early_kill Lines: 1 -85734114 +0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_xmit_wait +Path: fixtures/proc/sys/vm/memory_failure_recovery Lines: 1 -3599 +1 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/symbol_error +Path: fixtures/proc/sys/vm/min_free_kbytes Lines: 1 -0 +67584 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/phys_state +Path: fixtures/proc/sys/vm/min_slab_ratio Lines: 1 -5: LinkUp +5 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/rate +Path: fixtures/proc/sys/vm/min_unmapped_ratio Lines: 1 -40 Gb/sec (4X QDR) +1 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/state +Path: fixtures/proc/sys/vm/mmap_min_addr Lines: 1 -4: ACTIVE +65536 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/infiniband/mlx4_0/ports/2 -Mode: 755 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters -Mode: 755 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/excessive_buffer_overrun_errors +Path: fixtures/proc/sys/vm/nr_hugepages Lines: 1 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/link_downed +Path: fixtures/proc/sys/vm/nr_hugepages_mempolicy Lines: 1 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/link_error_recovery +Path: fixtures/proc/sys/vm/nr_overcommit_hugepages Lines: 1 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/local_link_integrity_errors +Path: fixtures/proc/sys/vm/numa_stat Lines: 1 -0 +1 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_rcv_constraint_errors +Path: fixtures/proc/sys/vm/numa_zonelist_order Lines: 1 -0 +Node Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_rcv_data +Path: fixtures/proc/sys/vm/oom_dump_tasks Lines: 1 -2460436784 +1 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_rcv_errors +Path: fixtures/proc/sys/vm/oom_kill_allocating_task Lines: 1 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_rcv_packets +Path: fixtures/proc/sys/vm/overcommit_kbytes Lines: 1 -89332064 +0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_rcv_remote_physical_errors +Path: fixtures/proc/sys/vm/overcommit_memory Lines: 1 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_rcv_switch_relay_errors +Path: fixtures/proc/sys/vm/overcommit_ratio Lines: 1 -0 +50 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_xmit_constraint_errors +Path: fixtures/proc/sys/vm/page-cluster Lines: 1 -0 +3 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_xmit_data +Path: fixtures/proc/sys/vm/panic_on_oom Lines: 1 -26540356890 +0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_xmit_discards +Path: fixtures/proc/sys/vm/percpu_pagelist_fraction Lines: 1 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_xmit_packets +Path: fixtures/proc/sys/vm/stat_interval Lines: 1 -88622850 +1 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_xmit_wait +Path: fixtures/proc/sys/vm/swappiness Lines: 1 -3846 +60 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/symbol_error +Path: fixtures/proc/sys/vm/user_reserve_kbytes Lines: 1 -0 +131072 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/phys_state +Path: fixtures/proc/sys/vm/vfs_cache_pressure Lines: 1 -5: LinkUp +100 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/rate +Path: fixtures/proc/sys/vm/watermark_boost_factor Lines: 1 -40 Gb/sec (4X QDR) +15000 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/state +Path: fixtures/proc/sys/vm/watermark_scale_factor Lines: 1 -4: ACTIVE +10 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/net -Mode: 775 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/net/eth0 +Path: fixtures/proc/sys/vm/zone_reclaim_mode +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/proc/zoneinfo +Lines: 262 +Node 0, zone DMA + per-node stats + nr_inactive_anon 230981 + nr_active_anon 547580 + nr_inactive_file 316904 + nr_active_file 346282 + nr_unevictable 115467 + nr_slab_reclaimable 131220 + nr_slab_unreclaimable 47320 + nr_isolated_anon 0 + nr_isolated_file 0 + workingset_nodes 11627 + workingset_refault 466886 + workingset_activate 276925 + workingset_restore 84055 + workingset_nodereclaim 487 + nr_anon_pages 795576 + nr_mapped 215483 + nr_file_pages 761874 + nr_dirty 908 + nr_writeback 0 + nr_writeback_temp 0 + nr_shmem 224925 + nr_shmem_hugepages 0 + nr_shmem_pmdmapped 0 + nr_anon_transparent_hugepages 0 + nr_unstable 0 + nr_vmscan_write 12950 + nr_vmscan_immediate_reclaim 3033 + nr_dirtied 8007423 + nr_written 7752121 + nr_kernel_misc_reclaimable 0 + pages free 3952 + min 33 + low 41 + high 49 + spanned 4095 + present 3975 + managed 3956 + protection: (0, 2877, 7826, 7826, 7826) + nr_free_pages 3952 + nr_zone_inactive_anon 0 + nr_zone_active_anon 0 + nr_zone_inactive_file 0 + nr_zone_active_file 0 + nr_zone_unevictable 0 + nr_zone_write_pending 0 + nr_mlock 0 + nr_page_table_pages 0 + nr_kernel_stack 0 + nr_bounce 0 + nr_zspages 0 + nr_free_cma 0 + numa_hit 1 + numa_miss 0 + numa_foreign 0 + numa_interleave 0 + numa_local 1 + numa_other 0 + pagesets + cpu: 0 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 1 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 2 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 3 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 4 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 5 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 6 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + cpu: 7 + count: 0 + high: 0 + batch: 1 + vm stats threshold: 8 + node_unreclaimable: 0 + start_pfn: 1 +Node 0, zone DMA32 + pages free 204252 + min 19510 + low 21059 + high 22608 + spanned 1044480 + present 759231 + managed 742806 + protection: (0, 0, 4949, 4949, 4949) + nr_free_pages 204252 + nr_zone_inactive_anon 118558 + nr_zone_active_anon 106598 + nr_zone_inactive_file 75475 + nr_zone_active_file 70293 + nr_zone_unevictable 66195 + nr_zone_write_pending 64 + nr_mlock 4 + nr_page_table_pages 1756 + nr_kernel_stack 2208 + nr_bounce 0 + nr_zspages 0 + nr_free_cma 0 + numa_hit 113952967 + numa_miss 0 + numa_foreign 0 + numa_interleave 0 + numa_local 113952967 + numa_other 0 + pagesets + cpu: 0 + count: 345 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 1 + count: 356 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 2 + count: 325 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 3 + count: 346 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 4 + count: 321 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 5 + count: 316 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 6 + count: 373 + high: 378 + batch: 63 + vm stats threshold: 48 + cpu: 7 + count: 339 + high: 378 + batch: 63 + vm stats threshold: 48 + node_unreclaimable: 0 + start_pfn: 4096 +Node 0, zone Normal + pages free 18553 + min 11176 + low 13842 + high 16508 + spanned 1308160 + present 1308160 + managed 1268711 + protection: (0, 0, 0, 0, 0) + nr_free_pages 18553 + nr_zone_inactive_anon 112423 + nr_zone_active_anon 440982 + nr_zone_inactive_file 241429 + nr_zone_active_file 275989 + nr_zone_unevictable 49272 + nr_zone_write_pending 844 + nr_mlock 154 + nr_page_table_pages 9750 + nr_kernel_stack 15136 + nr_bounce 0 + nr_zspages 0 + nr_free_cma 0 + numa_hit 162718019 + numa_miss 0 + numa_foreign 0 + numa_interleave 26812 + numa_local 162718019 + numa_other 0 + pagesets + cpu: 0 + count: 316 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 1 + count: 366 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 2 + count: 60 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 3 + count: 256 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 4 + count: 253 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 5 + count: 159 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 6 + count: 311 + high: 378 + batch: 63 + vm stats threshold: 56 + cpu: 7 + count: 264 + high: 378 + batch: 63 + vm stats threshold: 56 + node_unreclaimable: 0 + start_pfn: 1048576 +Node 0, zone Movable + pages free 0 + min 0 + low 0 + high 0 + spanned 0 + present 0 + managed 0 + protection: (0, 0, 0, 0, 0) +Node 0, zone Device + pages free 0 + min 0 + low 0 + high 0 + spanned 0 + present 0 + managed 0 + protection: (0, 0, 0, 0, 0) +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/block +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/block/dm-0 +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/block/dm-0/stat +Lines: 1 +6447303 0 710266738 1529043 953216 0 31201176 4557464 0 796160 6088971 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/block/sda +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/block/sda/stat +Lines: 1 +9652963 396792 759304206 412943 8422549 6731723 286915323 13947418 0 5658367 19174573 1 2 3 12 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/infiniband +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/infiniband/mlx4_0 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/board_id +Lines: 1 +SM_1141000001000 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/fw_ver +Lines: 1 +2.31.5050 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/hca_type +Lines: 1 +MT4099 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/infiniband/mlx4_0/ports +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/infiniband/mlx4_0/ports/1 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/excessive_buffer_overrun_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/link_downed +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/link_error_recovery +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/local_link_integrity_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_rcv_constraint_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_rcv_data +Lines: 1 +2221223609 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_rcv_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_rcv_packets +Lines: 1 +87169372 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_rcv_remote_physical_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_rcv_switch_relay_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_xmit_constraint_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_xmit_data +Lines: 1 +26509113295 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_xmit_discards +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_xmit_packets +Lines: 1 +85734114 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/port_xmit_wait +Lines: 1 +3599 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/counters/symbol_error +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/phys_state +Lines: 1 +5: LinkUp +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/rate +Lines: 1 +40 Gb/sec (4X QDR) +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/1/state +Lines: 1 +4: ACTIVE +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/infiniband/mlx4_0/ports/2 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/excessive_buffer_overrun_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/link_downed +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/link_error_recovery +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/local_link_integrity_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_rcv_constraint_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_rcv_data +Lines: 1 +2460436784 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_rcv_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_rcv_packets +Lines: 1 +89332064 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_rcv_remote_physical_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_rcv_switch_relay_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_xmit_constraint_errors +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_xmit_data +Lines: 1 +26540356890 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_xmit_discards +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_xmit_packets +Lines: 1 +88622850 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/port_xmit_wait +Lines: 1 +3846 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/counters/symbol_error +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/phys_state +Lines: 1 +5: LinkUp +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/rate +Lines: 1 +40 Gb/sec (4X QDR) +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/infiniband/mlx4_0/ports/2/state +Lines: 1 +4: ACTIVE +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/net +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/net/eth0 Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/sys/class/net/eth0/addr_assign_type @@ -921,6 +2683,9 @@ Lines: 1 0x20 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/net/eth0/device +SymlinkTo: ../../../devices/pci0000:00/0000:00:1f.6/ +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Path: fixtures/sys/class/net/eth0/dormant Lines: 1 1 @@ -987,132 +2752,409 @@ Path: fixtures/sys/class/net/eth0/phys_switch_id Lines: 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/net/eth0/speed +Path: fixtures/sys/class/net/eth0/speed +Lines: 1 +1000 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/net/eth0/tx_queue_len +Lines: 1 +1000 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/net/eth0/type +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/power_supply +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/power_supply/AC +SymlinkTo: ../../devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/power_supply/BAT0 +SymlinkTo: ../../devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal/cooling_device0 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device0/cur_state +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device0/max_state +Lines: 1 +50 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device0/type +Lines: 1 +Processor +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal/cooling_device1 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device1/cur_state +Lines: 1 +-1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device1/max_state +Lines: 1 +27 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/cooling_device1/type +Lines: 1 +intel_powerclamp +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal/thermal_zone0 +Mode: 775 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone0/policy +Lines: 1 +step_wise +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone0/temp +Lines: 1 +49925 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone0/type +Lines: 1 +bcm2835_thermal +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/class/thermal/thermal_zone1 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/mode +Lines: 1 +enabled +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/passive +Lines: 1 +0 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/policy +Lines: 1 +step_wise +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/temp +Lines: 1 +44000 +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/class/thermal/thermal_zone1/type +Lines: 1 +acpitz +Mode: 664 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/device +SymlinkTo: ../../../ACPI0003:00 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/online +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/async +Lines: 1 +disabled +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/autosuspend_delay_ms +Lines: 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/control +Lines: 1 +auto +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_active_kids +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_active_time +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_enabled +Lines: 1 +disabled +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_status +Lines: 1 +unsupported +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_suspended_time +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/runtime_usage +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup Lines: 1 -1000 +enabled Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/net/eth0/tx_queue_len +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_abort_count Lines: 1 -1000 -Mode: 644 +0 +Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/net/eth0/type +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_active +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_active_count Lines: 1 1 -Mode: 644 +Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/power_supply -Mode: 755 +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_count +Lines: 1 +0 +Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/power_supply/AC -Mode: 755 +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_expire_count +Lines: 1 +0 +Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/AC/online +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_last_time_ms +Lines: 1 +10598 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_max_time_ms +Lines: 1 +1 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_prevent_sleep_time_ms Lines: 1 0 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/AC/type +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/power/wakeup_total_time_ms +Lines: 1 +1 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/subsystem +SymlinkTo: ../../../../../../../../../class/power_supply +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/type Lines: 1 Mains Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/AC/uevent +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/ACPI0003:00/power_supply/AC/uevent Lines: 2 POWER_SUPPLY_NAME=AC POWER_SUPPLY_ONLINE=0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/power_supply/BAT0 +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0 Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/alarm +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/alarm Lines: 1 -2503000 +2369000 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/capacity +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/capacity Lines: 1 98 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/capacity_level +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/capacity_level Lines: 1 Normal Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/charge_start_threshold +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/charge_start_threshold Lines: 1 95 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/charge_stop_threshold +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/charge_stop_threshold Lines: 1 100 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/cycle_count +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/cycle_count Lines: 1 0 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/energy_full +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/device +SymlinkTo: ../../../PNP0C0A:00 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/energy_full Lines: 1 50060000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/energy_full_design +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/energy_full_design Lines: 1 47520000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/energy_now +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/energy_now Lines: 1 49450000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/manufacturer +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/manufacturer Lines: 1 LGC Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/model_name +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/model_name Lines: 1 LNV-45N1 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/power_now +Directory: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/async +Lines: 1 +disabled +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/autosuspend_delay_ms +Lines: 0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/control +Lines: 1 +auto +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_active_kids +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_active_time +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_enabled +Lines: 1 +disabled +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_status +Lines: 1 +unsupported +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_suspended_time +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power/runtime_usage +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/power_now Lines: 1 4830000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/present +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/present Lines: 1 1 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/serial_number +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/serial_number Lines: 1 38109 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/status +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/status Lines: 1 Discharging Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/technology +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/subsystem +SymlinkTo: ../../../../../../../../../class/power_supply +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/technology Lines: 1 Li-ion Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/type +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/type Lines: 1 Battery Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/uevent +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/uevent Lines: 16 POWER_SUPPLY_NAME=BAT0 POWER_SUPPLY_STATUS=Discharging @@ -1120,80 +3162,28 @@ POWER_SUPPLY_PRESENT=1 POWER_SUPPLY_TECHNOLOGY=Li-ion POWER_SUPPLY_CYCLE_COUNT=0 POWER_SUPPLY_VOLTAGE_MIN_DESIGN=10800000 -POWER_SUPPLY_VOLTAGE_NOW=12229000 -POWER_SUPPLY_POWER_NOW=4830000 +POWER_SUPPLY_VOLTAGE_NOW=11750000 +POWER_SUPPLY_POWER_NOW=5064000 POWER_SUPPLY_ENERGY_FULL_DESIGN=47520000 -POWER_SUPPLY_ENERGY_FULL=50060000 -POWER_SUPPLY_ENERGY_NOW=49450000 -POWER_SUPPLY_CAPACITY=98 +POWER_SUPPLY_ENERGY_FULL=47390000 +POWER_SUPPLY_ENERGY_NOW=40730000 +POWER_SUPPLY_CAPACITY=85 POWER_SUPPLY_CAPACITY_LEVEL=Normal POWER_SUPPLY_MODEL_NAME=LNV-45N1 POWER_SUPPLY_MANUFACTURER=LGC POWER_SUPPLY_SERIAL_NUMBER=38109 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/voltage_min_design +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/voltage_min_design Lines: 1 10800000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/power_supply/BAT0/voltage_now +Path: fixtures/sys/devices/LNXSYSTM:00/LNXSYBUS:00/PNP0A08:00/device:00/PNP0C09:00/PNP0C0A:00/power_supply/BAT0/voltage_now Lines: 1 12229000 Mode: 444 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/thermal -Mode: 775 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/thermal/thermal_zone0 -Mode: 775 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone0/policy -Lines: 1 -step_wise -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone0/temp -Lines: 1 -49925 -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone0/type -Lines: 1 -bcm2835_thermal -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/class/thermal/thermal_zone1 -Mode: 755 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/mode -Lines: 1 -enabled -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/passive -Lines: 1 -0 -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/policy -Lines: 1 -step_wise -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/temp -Lines: 1 -44000 -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Path: fixtures/sys/class/thermal/thermal_zone1/type -Lines: 1 -acpitz -Mode: 664 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -Directory: fixtures/sys/devices -Mode: 755 -# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys/devices/pci0000:00 Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -1443,6 +3433,131 @@ Lines: 1 0 Mode: 644 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/pci0000:00/0000:00:1f.6 +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/ari_enabled +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/broken_parity_status +Lines: 1 +0 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/class +Lines: 1 +0x020000 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/consistent_dma_mask_bits +Lines: 1 +64 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/d3cold_allowed +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/device +Lines: 1 +0x15d7 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/dma_mask_bits +Lines: 1 +64 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/driver_override +Lines: 1 +(null) +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/enable +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/irq +Lines: 1 +140 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/local_cpulist +Lines: 1 +0-7 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/local_cpus +Lines: 1 +ff +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/modalias +Lines: 1 +pci:v00008086d000015D7sv000017AAsd0000225Abc02sc00i00 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/msi_bus +Lines: 1 +1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/numa_node +Lines: 1 +-1 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/resource +Lines: 13 +0x00000000ec200000 0x00000000ec21ffff 0x0000000000040200 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +0x0000000000000000 0x0000000000000000 0x0000000000000000 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/revision +Lines: 1 +0x21 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/subsystem_device +Lines: 1 +0x225a +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/subsystem_vendor +Lines: 1 +0x17aa +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/uevent +Lines: 6 +DRIVER=e1000e +PCI_CLASS=20000 +PCI_ID=8086:15D7 +PCI_SUBSYS_ID=17AA:225A +PCI_SLOT_NAME=0000:00:1f.6 +MODALIAS=pci:v00008086d000015D7sv000017AAsd0000225Abc02sc00i00 +Mode: 644 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/pci0000:00/0000:00:1f.6/vendor +Lines: 1 +0x8086 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys/devices/rbd Mode: 755 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -1500,6 +3615,52 @@ Mode: 775 Path: fixtures/sys/devices/system/cpu/cpu0/cpufreq SymlinkTo: ../cpufreq/policy0 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/system/cpu/cpu0/thermal_throttle +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/thermal_throttle/core_throttle_count +Lines: 1 +10084 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/thermal_throttle/package_throttle_count +Lines: 1 +34818 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/system/cpu/cpu0/topology +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/core_id +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/core_siblings +Lines: 1 +ff +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/core_siblings_list +Lines: 1 +0-7 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/physical_package_id +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/thread_siblings +Lines: 1 +11 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu0/topology/thread_siblings_list +Lines: 1 +0,4 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys/devices/system/cpu/cpu1 Mode: 775 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -1561,6 +3722,52 @@ Lines: 1 Mode: 664 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/system/cpu/cpu1/thermal_throttle +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/thermal_throttle/core_throttle_count +Lines: 1 +523 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/thermal_throttle/package_throttle_count +Lines: 1 +34818 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Directory: fixtures/sys/devices/system/cpu/cpu1/topology +Mode: 755 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/core_id +Lines: 1 +1 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/core_siblings +Lines: 1 +ff +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/core_siblings_list +Lines: 1 +0-7 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/physical_package_id +Lines: 1 +0 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/thread_siblings +Lines: 1 +22 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +Path: fixtures/sys/devices/system/cpu/cpu1/topology/thread_siblings_list +Lines: 1 +1,5 +Mode: 444 +# ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Directory: fixtures/sys/devices/system/cpu/cpufreq Mode: 775 # ttar - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - diff --git a/vendor/github.com/prometheus/procfs/internal/util/parse.go b/vendor/github.com/prometheus/procfs/internal/util/parse.go new file mode 100644 index 00000000..755591d9 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/internal/util/parse.go @@ -0,0 +1,88 @@ +// Copyright 2018 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package util + +import ( + "io/ioutil" + "strconv" + "strings" +) + +// ParseUint32s parses a slice of strings into a slice of uint32s. +func ParseUint32s(ss []string) ([]uint32, error) { + us := make([]uint32, 0, len(ss)) + for _, s := range ss { + u, err := strconv.ParseUint(s, 10, 32) + if err != nil { + return nil, err + } + + us = append(us, uint32(u)) + } + + return us, nil +} + +// ParseUint64s parses a slice of strings into a slice of uint64s. +func ParseUint64s(ss []string) ([]uint64, error) { + us := make([]uint64, 0, len(ss)) + for _, s := range ss { + u, err := strconv.ParseUint(s, 10, 64) + if err != nil { + return nil, err + } + + us = append(us, u) + } + + return us, nil +} + +// ParsePInt64s parses a slice of strings into a slice of int64 pointers. +func ParsePInt64s(ss []string) ([]*int64, error) { + us := make([]*int64, 0, len(ss)) + for _, s := range ss { + u, err := strconv.ParseInt(s, 10, 64) + if err != nil { + return nil, err + } + + us = append(us, &u) + } + + return us, nil +} + +// ReadUintFromFile reads a file and attempts to parse a uint64 from it. +func ReadUintFromFile(path string) (uint64, error) { + data, err := ioutil.ReadFile(path) + if err != nil { + return 0, err + } + return strconv.ParseUint(strings.TrimSpace(string(data)), 10, 64) +} + +// ParseBool parses a string into a boolean pointer. +func ParseBool(b string) *bool { + var truth bool + switch b { + case "enabled": + truth = true + case "disabled": + truth = false + default: + return nil + } + return &truth +} diff --git a/vendor/github.com/prometheus/procfs/internal/util/sysreadfile.go b/vendor/github.com/prometheus/procfs/internal/util/sysreadfile.go new file mode 100644 index 00000000..68b37c4b --- /dev/null +++ b/vendor/github.com/prometheus/procfs/internal/util/sysreadfile.go @@ -0,0 +1,45 @@ +// Copyright 2018 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build linux,!appengine + +package util + +import ( + "bytes" + "os" + "syscall" +) + +// SysReadFile is a simplified ioutil.ReadFile that invokes syscall.Read directly. +// https://github.com/prometheus/node_exporter/pull/728/files +func SysReadFile(file string) (string, error) { + f, err := os.Open(file) + if err != nil { + return "", err + } + defer f.Close() + + // On some machines, hwmon drivers are broken and return EAGAIN. This causes + // Go's ioutil.ReadFile implementation to poll forever. + // + // Since we either want to read data or bail immediately, do the simplest + // possible read using syscall directly. + b := make([]byte, 128) + n, err := syscall.Read(int(f.Fd()), b) + if err != nil { + return "", err + } + + return string(bytes.TrimSpace(b[:n])), nil +} diff --git a/vendor/github.com/prometheus/procfs/internal/util/sysreadfile_compat.go b/vendor/github.com/prometheus/procfs/internal/util/sysreadfile_compat.go new file mode 100644 index 00000000..bd55b453 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/internal/util/sysreadfile_compat.go @@ -0,0 +1,26 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build linux,appengine !linux + +package util + +import ( + "fmt" +) + +// SysReadFile is here implemented as a noop for builds that do not support +// the read syscall. For example Windows, or Linux on Google App Engine. +func SysReadFile(file string) (string, error) { + return "", fmt.Errorf("not supported on this platform") +} diff --git a/vendor/github.com/prometheus/procfs/internal/util/valueparser.go b/vendor/github.com/prometheus/procfs/internal/util/valueparser.go new file mode 100644 index 00000000..ac93cb42 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/internal/util/valueparser.go @@ -0,0 +1,77 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package util + +import ( + "strconv" +) + +// TODO(mdlayher): util packages are an anti-pattern and this should be moved +// somewhere else that is more focused in the future. + +// A ValueParser enables parsing a single string into a variety of data types +// in a concise and safe way. The Err method must be invoked after invoking +// any other methods to ensure a value was successfully parsed. +type ValueParser struct { + v string + err error +} + +// NewValueParser creates a ValueParser using the input string. +func NewValueParser(v string) *ValueParser { + return &ValueParser{v: v} +} + +// PInt64 interprets the underlying value as an int64 and returns a pointer to +// that value. +func (vp *ValueParser) PInt64() *int64 { + if vp.err != nil { + return nil + } + + // A base value of zero makes ParseInt infer the correct base using the + // string's prefix, if any. + const base = 0 + v, err := strconv.ParseInt(vp.v, base, 64) + if err != nil { + vp.err = err + return nil + } + + return &v +} + +// PUInt64 interprets the underlying value as an uint64 and returns a pointer to +// that value. +func (vp *ValueParser) PUInt64() *uint64 { + if vp.err != nil { + return nil + } + + // A base value of zero makes ParseInt infer the correct base using the + // string's prefix, if any. + const base = 0 + v, err := strconv.ParseUint(vp.v, base, 64) + if err != nil { + vp.err = err + return nil + } + + return &v +} + +// Err returns the last error, if any, encountered by the ValueParser. +func (vp *ValueParser) Err() error { + return vp.err +} diff --git a/vendor/github.com/prometheus/procfs/net_softnet.go b/vendor/github.com/prometheus/procfs/net_softnet.go new file mode 100644 index 00000000..6fcad20a --- /dev/null +++ b/vendor/github.com/prometheus/procfs/net_softnet.go @@ -0,0 +1,91 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "fmt" + "io/ioutil" + "strconv" + "strings" +) + +// For the proc file format details, +// see https://elixir.bootlin.com/linux/v4.17/source/net/core/net-procfs.c#L162 +// and https://elixir.bootlin.com/linux/v4.17/source/include/linux/netdevice.h#L2810. + +// SoftnetEntry contains a single row of data from /proc/net/softnet_stat +type SoftnetEntry struct { + // Number of processed packets + Processed uint + // Number of dropped packets + Dropped uint + // Number of times processing packets ran out of quota + TimeSqueezed uint +} + +// GatherSoftnetStats reads /proc/net/softnet_stat, parse the relevant columns, +// and then return a slice of SoftnetEntry's. +func (fs FS) GatherSoftnetStats() ([]SoftnetEntry, error) { + data, err := ioutil.ReadFile(fs.proc.Path("net/softnet_stat")) + if err != nil { + return nil, fmt.Errorf("error reading softnet %s: %s", fs.proc.Path("net/softnet_stat"), err) + } + + return parseSoftnetEntries(data) +} + +func parseSoftnetEntries(data []byte) ([]SoftnetEntry, error) { + lines := strings.Split(string(data), "\n") + entries := make([]SoftnetEntry, 0) + var err error + const ( + expectedColumns = 11 + ) + for _, line := range lines { + columns := strings.Fields(line) + width := len(columns) + if width == 0 { + continue + } + if width != expectedColumns { + return []SoftnetEntry{}, fmt.Errorf("%d columns were detected, but %d were expected", width, expectedColumns) + } + var entry SoftnetEntry + if entry, err = parseSoftnetEntry(columns); err != nil { + return []SoftnetEntry{}, err + } + entries = append(entries, entry) + } + + return entries, nil +} + +func parseSoftnetEntry(columns []string) (SoftnetEntry, error) { + var err error + var processed, dropped, timeSqueezed uint64 + if processed, err = strconv.ParseUint(columns[0], 16, 32); err != nil { + return SoftnetEntry{}, fmt.Errorf("Unable to parse column 0: %s", err) + } + if dropped, err = strconv.ParseUint(columns[1], 16, 32); err != nil { + return SoftnetEntry{}, fmt.Errorf("Unable to parse column 1: %s", err) + } + if timeSqueezed, err = strconv.ParseUint(columns[2], 16, 32); err != nil { + return SoftnetEntry{}, fmt.Errorf("Unable to parse column 2: %s", err) + } + return SoftnetEntry{ + Processed: uint(processed), + Dropped: uint(dropped), + TimeSqueezed: uint(timeSqueezed), + }, nil +} diff --git a/vendor/github.com/prometheus/procfs/proc.go b/vendor/github.com/prometheus/procfs/proc.go index 41c148d0..b7c79cf7 100644 --- a/vendor/github.com/prometheus/procfs/proc.go +++ b/vendor/github.com/prometheus/procfs/proc.go @@ -279,3 +279,33 @@ func (p Proc) fileDescriptors() ([]string, error) { func (p Proc) path(pa ...string) string { return p.fs.Path(append([]string{strconv.Itoa(p.PID)}, pa...)...) } + +// FileDescriptorsInfo retrieves information about all file descriptors of +// the process. +func (p Proc) FileDescriptorsInfo() (ProcFDInfos, error) { + names, err := p.fileDescriptors() + if err != nil { + return nil, err + } + + var fdinfos ProcFDInfos + + for _, n := range names { + fdinfo, err := p.FDInfo(n) + if err != nil { + continue + } + fdinfos = append(fdinfos, *fdinfo) + } + + return fdinfos, nil +} + +// Schedstat returns task scheduling information for the process. +func (p Proc) Schedstat() (ProcSchedstat, error) { + contents, err := ioutil.ReadFile(p.path("schedstat")) + if err != nil { + return ProcSchedstat{}, err + } + return parseProcSchedstat(string(contents)) +} diff --git a/vendor/github.com/prometheus/procfs/proc_fdinfo.go b/vendor/github.com/prometheus/procfs/proc_fdinfo.go new file mode 100644 index 00000000..83b67d1b --- /dev/null +++ b/vendor/github.com/prometheus/procfs/proc_fdinfo.go @@ -0,0 +1,132 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "bufio" + "fmt" + "io/ioutil" + "os" + "regexp" + "strings" +) + +// Regexp variables +var ( + rPos = regexp.MustCompile(`^pos:\s+(\d+)$`) + rFlags = regexp.MustCompile(`^flags:\s+(\d+)$`) + rMntID = regexp.MustCompile(`^mnt_id:\s+(\d+)$`) + rInotify = regexp.MustCompile(`^inotify`) +) + +// ProcFDInfo contains represents file descriptor information. +type ProcFDInfo struct { + // File descriptor + FD string + // File offset + Pos string + // File access mode and status flags + Flags string + // Mount point ID + MntID string + // List of inotify lines (structed) in the fdinfo file (kernel 3.8+ only) + InotifyInfos []InotifyInfo +} + +// FDInfo constructor. On kernels older than 3.8, InotifyInfos will always be empty. +func (p Proc) FDInfo(fd string) (*ProcFDInfo, error) { + f, err := os.Open(p.path("fdinfo", fd)) + if err != nil { + return nil, err + } + defer f.Close() + + fdinfo, err := ioutil.ReadAll(f) + if err != nil { + return nil, fmt.Errorf("could not read %s: %s", f.Name(), err) + } + + var text, pos, flags, mntid string + var inotify []InotifyInfo + + scanner := bufio.NewScanner(strings.NewReader(string(fdinfo))) + for scanner.Scan() { + text = scanner.Text() + if rPos.MatchString(text) { + pos = rPos.FindStringSubmatch(text)[1] + } else if rFlags.MatchString(text) { + flags = rFlags.FindStringSubmatch(text)[1] + } else if rMntID.MatchString(text) { + mntid = rMntID.FindStringSubmatch(text)[1] + } else if rInotify.MatchString(text) { + newInotify, err := parseInotifyInfo(text) + if err != nil { + return nil, err + } + inotify = append(inotify, *newInotify) + } + } + + i := &ProcFDInfo{ + FD: fd, + Pos: pos, + Flags: flags, + MntID: mntid, + InotifyInfos: inotify, + } + + return i, nil +} + +// InotifyInfo represents a single inotify line in the fdinfo file. +type InotifyInfo struct { + // Watch descriptor number + WD string + // Inode number + Ino string + // Device ID + Sdev string + // Mask of events being monitored + Mask string +} + +// InotifyInfo constructor. Only available on kernel 3.8+. +func parseInotifyInfo(line string) (*InotifyInfo, error) { + r := regexp.MustCompile(`^inotify\s+wd:([0-9a-f]+)\s+ino:([0-9a-f]+)\s+sdev:([0-9a-f]+)\s+mask:([0-9a-f]+)`) + m := r.FindStringSubmatch(line) + i := &InotifyInfo{ + WD: m[1], + Ino: m[2], + Sdev: m[3], + Mask: m[4], + } + return i, nil +} + +// ProcFDInfos represents a list of ProcFDInfo structs. +type ProcFDInfos []ProcFDInfo + +func (p ProcFDInfos) Len() int { return len(p) } +func (p ProcFDInfos) Swap(i, j int) { p[i], p[j] = p[j], p[i] } +func (p ProcFDInfos) Less(i, j int) bool { return p[i].FD < p[j].FD } + +// InotifyWatchLen returns the total number of inotify watches +func (p ProcFDInfos) InotifyWatchLen() (int, error) { + length := 0 + for _, f := range p { + length += len(f.InotifyInfos) + } + + return length, nil +} diff --git a/vendor/github.com/prometheus/procfs/proc_status.go b/vendor/github.com/prometheus/procfs/proc_status.go index 6b4b61f7..ad290fae 100644 --- a/vendor/github.com/prometheus/procfs/proc_status.go +++ b/vendor/github.com/prometheus/procfs/proc_status.go @@ -21,7 +21,7 @@ import ( "strings" ) -// ProcStat provides status information about the process, +// ProcStatus provides status information about the process, // read from /proc/[pid]/stat. type ProcStatus struct { // The process ID. @@ -29,6 +29,9 @@ type ProcStatus struct { // The process name. Name string + // Thread group ID. + TGID int + // Peak virtual memory size. VmPeak uint64 // Virtual memory size. @@ -113,6 +116,8 @@ func (p Proc) NewStatus() (ProcStatus, error) { func (s *ProcStatus) fillStatus(k string, vString string, vUint uint64, vUintBytes uint64) { switch k { + case "Tgid": + s.TGID = int(vUint) case "Name": s.Name = vString case "VmPeak": diff --git a/vendor/github.com/prometheus/procfs/schedstat.go b/vendor/github.com/prometheus/procfs/schedstat.go new file mode 100644 index 00000000..a4c4089a --- /dev/null +++ b/vendor/github.com/prometheus/procfs/schedstat.go @@ -0,0 +1,118 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package procfs + +import ( + "bufio" + "errors" + "os" + "regexp" + "strconv" +) + +var ( + cpuLineRE = regexp.MustCompile(`cpu(\d+) (\d+) (\d+) (\d+) (\d+) (\d+) (\d+) (\d+) (\d+) (\d+)`) + procLineRE = regexp.MustCompile(`(\d+) (\d+) (\d+)`) +) + +// Schedstat contains scheduler statistics from /proc/schedstat +// +// See +// https://www.kernel.org/doc/Documentation/scheduler/sched-stats.txt +// for a detailed description of what these numbers mean. +// +// Note the current kernel documentation claims some of the time units are in +// jiffies when they are actually in nanoseconds since 2.6.23 with the +// introduction of CFS. A fix to the documentation is pending. See +// https://lore.kernel.org/patchwork/project/lkml/list/?series=403473 +type Schedstat struct { + CPUs []*SchedstatCPU +} + +// SchedstatCPU contains the values from one "cpu" line +type SchedstatCPU struct { + CPUNum string + + RunningNanoseconds uint64 + WaitingNanoseconds uint64 + RunTimeslices uint64 +} + +// ProcSchedstat contains the values from /proc//schedstat +type ProcSchedstat struct { + RunningNanoseconds uint64 + WaitingNanoseconds uint64 + RunTimeslices uint64 +} + +// Schedstat reads data from /proc/schedstat +func (fs FS) Schedstat() (*Schedstat, error) { + file, err := os.Open(fs.proc.Path("schedstat")) + if err != nil { + return nil, err + } + defer file.Close() + + stats := &Schedstat{} + scanner := bufio.NewScanner(file) + + for scanner.Scan() { + match := cpuLineRE.FindStringSubmatch(scanner.Text()) + if match != nil { + cpu := &SchedstatCPU{} + cpu.CPUNum = match[1] + + cpu.RunningNanoseconds, err = strconv.ParseUint(match[8], 10, 64) + if err != nil { + continue + } + + cpu.WaitingNanoseconds, err = strconv.ParseUint(match[9], 10, 64) + if err != nil { + continue + } + + cpu.RunTimeslices, err = strconv.ParseUint(match[10], 10, 64) + if err != nil { + continue + } + + stats.CPUs = append(stats.CPUs, cpu) + } + } + + return stats, nil +} + +func parseProcSchedstat(contents string) (stats ProcSchedstat, err error) { + match := procLineRE.FindStringSubmatch(contents) + + if match != nil { + stats.RunningNanoseconds, err = strconv.ParseUint(match[1], 10, 64) + if err != nil { + return + } + + stats.WaitingNanoseconds, err = strconv.ParseUint(match[2], 10, 64) + if err != nil { + return + } + + stats.RunTimeslices, err = strconv.ParseUint(match[3], 10, 64) + return + } + + err = errors.New("could not parse schedstat") + return +} diff --git a/vendor/github.com/prometheus/procfs/vm.go b/vendor/github.com/prometheus/procfs/vm.go new file mode 100644 index 00000000..cb138914 --- /dev/null +++ b/vendor/github.com/prometheus/procfs/vm.go @@ -0,0 +1,210 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build !windows + +package procfs + +import ( + "fmt" + "io/ioutil" + "os" + "path/filepath" + "strings" + + "github.com/prometheus/procfs/internal/util" +) + +// The VM interface is described at +// https://www.kernel.org/doc/Documentation/sysctl/vm.txt +// Each setting is exposed as a single file. +// Each file contains one line with a single numerical value, except lowmem_reserve_ratio which holds an array +// and numa_zonelist_order (deprecated) which is a string +type VM struct { + AdminReserveKbytes *int64 // /proc/sys/vm/admin_reserve_kbytes + BlockDump *int64 // /proc/sys/vm/block_dump + CompactUnevictableAllowed *int64 // /proc/sys/vm/compact_unevictable_allowed + DirtyBackgroundBytes *int64 // /proc/sys/vm/dirty_background_bytes + DirtyBackgroundRatio *int64 // /proc/sys/vm/dirty_background_ratio + DirtyBytes *int64 // /proc/sys/vm/dirty_bytes + DirtyExpireCentisecs *int64 // /proc/sys/vm/dirty_expire_centisecs + DirtyRatio *int64 // /proc/sys/vm/dirty_ratio + DirtytimeExpireSeconds *int64 // /proc/sys/vm/dirtytime_expire_seconds + DirtyWritebackCentisecs *int64 // /proc/sys/vm/dirty_writeback_centisecs + DropCaches *int64 // /proc/sys/vm/drop_caches + ExtfragThreshold *int64 // /proc/sys/vm/extfrag_threshold + HugetlbShmGroup *int64 // /proc/sys/vm/hugetlb_shm_group + LaptopMode *int64 // /proc/sys/vm/laptop_mode + LegacyVaLayout *int64 // /proc/sys/vm/legacy_va_layout + LowmemReserveRatio []*int64 // /proc/sys/vm/lowmem_reserve_ratio + MaxMapCount *int64 // /proc/sys/vm/max_map_count + MemoryFailureEarlyKill *int64 // /proc/sys/vm/memory_failure_early_kill + MemoryFailureRecovery *int64 // /proc/sys/vm/memory_failure_recovery + MinFreeKbytes *int64 // /proc/sys/vm/min_free_kbytes + MinSlabRatio *int64 // /proc/sys/vm/min_slab_ratio + MinUnmappedRatio *int64 // /proc/sys/vm/min_unmapped_ratio + MmapMinAddr *int64 // /proc/sys/vm/mmap_min_addr + NrHugepages *int64 // /proc/sys/vm/nr_hugepages + NrHugepagesMempolicy *int64 // /proc/sys/vm/nr_hugepages_mempolicy + NrOvercommitHugepages *int64 // /proc/sys/vm/nr_overcommit_hugepages + NumaStat *int64 // /proc/sys/vm/numa_stat + NumaZonelistOrder string // /proc/sys/vm/numa_zonelist_order + OomDumpTasks *int64 // /proc/sys/vm/oom_dump_tasks + OomKillAllocatingTask *int64 // /proc/sys/vm/oom_kill_allocating_task + OvercommitKbytes *int64 // /proc/sys/vm/overcommit_kbytes + OvercommitMemory *int64 // /proc/sys/vm/overcommit_memory + OvercommitRatio *int64 // /proc/sys/vm/overcommit_ratio + PageCluster *int64 // /proc/sys/vm/page-cluster + PanicOnOom *int64 // /proc/sys/vm/panic_on_oom + PercpuPagelistFraction *int64 // /proc/sys/vm/percpu_pagelist_fraction + StatInterval *int64 // /proc/sys/vm/stat_interval + Swappiness *int64 // /proc/sys/vm/swappiness + UserReserveKbytes *int64 // /proc/sys/vm/user_reserve_kbytes + VfsCachePressure *int64 // /proc/sys/vm/vfs_cache_pressure + WatermarkBoostFactor *int64 // /proc/sys/vm/watermark_boost_factor + WatermarkScaleFactor *int64 // /proc/sys/vm/watermark_scale_factor + ZoneReclaimMode *int64 // /proc/sys/vm/zone_reclaim_mode +} + +// VM reads the VM statistics from the specified `proc` filesystem. +func (fs FS) VM() (*VM, error) { + path := fs.proc.Path("sys/vm") + file, err := os.Stat(path) + if err != nil { + return nil, err + } + if !file.Mode().IsDir() { + return nil, fmt.Errorf("%s is not a directory", path) + } + + files, err := ioutil.ReadDir(path) + if err != nil { + return nil, err + } + + var vm VM + for _, f := range files { + if f.IsDir() { + continue + } + + name := filepath.Join(path, f.Name()) + // ignore errors on read, as there are some write only + // in /proc/sys/vm + value, err := util.SysReadFile(name) + if err != nil { + continue + } + vp := util.NewValueParser(value) + + switch f.Name() { + case "admin_reserve_kbytes": + vm.AdminReserveKbytes = vp.PInt64() + case "block_dump": + vm.BlockDump = vp.PInt64() + case "compact_unevictable_allowed": + vm.CompactUnevictableAllowed = vp.PInt64() + case "dirty_background_bytes": + vm.DirtyBackgroundBytes = vp.PInt64() + case "dirty_background_ratio": + vm.DirtyBackgroundRatio = vp.PInt64() + case "dirty_bytes": + vm.DirtyBytes = vp.PInt64() + case "dirty_expire_centisecs": + vm.DirtyExpireCentisecs = vp.PInt64() + case "dirty_ratio": + vm.DirtyRatio = vp.PInt64() + case "dirtytime_expire_seconds": + vm.DirtytimeExpireSeconds = vp.PInt64() + case "dirty_writeback_centisecs": + vm.DirtyWritebackCentisecs = vp.PInt64() + case "drop_caches": + vm.DropCaches = vp.PInt64() + case "extfrag_threshold": + vm.ExtfragThreshold = vp.PInt64() + case "hugetlb_shm_group": + vm.HugetlbShmGroup = vp.PInt64() + case "laptop_mode": + vm.LaptopMode = vp.PInt64() + case "legacy_va_layout": + vm.LegacyVaLayout = vp.PInt64() + case "lowmem_reserve_ratio": + stringSlice := strings.Fields(value) + pint64Slice := make([]*int64, 0, len(stringSlice)) + for _, value := range stringSlice { + vp := util.NewValueParser(value) + pint64Slice = append(pint64Slice, vp.PInt64()) + } + vm.LowmemReserveRatio = pint64Slice + case "max_map_count": + vm.MaxMapCount = vp.PInt64() + case "memory_failure_early_kill": + vm.MemoryFailureEarlyKill = vp.PInt64() + case "memory_failure_recovery": + vm.MemoryFailureRecovery = vp.PInt64() + case "min_free_kbytes": + vm.MinFreeKbytes = vp.PInt64() + case "min_slab_ratio": + vm.MinSlabRatio = vp.PInt64() + case "min_unmapped_ratio": + vm.MinUnmappedRatio = vp.PInt64() + case "mmap_min_addr": + vm.MmapMinAddr = vp.PInt64() + case "nr_hugepages": + vm.NrHugepages = vp.PInt64() + case "nr_hugepages_mempolicy": + vm.NrHugepagesMempolicy = vp.PInt64() + case "nr_overcommit_hugepages": + vm.NrOvercommitHugepages = vp.PInt64() + case "numa_stat": + vm.NumaStat = vp.PInt64() + case "numa_zonelist_order": + vm.NumaZonelistOrder = value + case "oom_dump_tasks": + vm.OomDumpTasks = vp.PInt64() + case "oom_kill_allocating_task": + vm.OomKillAllocatingTask = vp.PInt64() + case "overcommit_kbytes": + vm.OvercommitKbytes = vp.PInt64() + case "overcommit_memory": + vm.OvercommitMemory = vp.PInt64() + case "overcommit_ratio": + vm.OvercommitRatio = vp.PInt64() + case "page-cluster": + vm.PageCluster = vp.PInt64() + case "panic_on_oom": + vm.PanicOnOom = vp.PInt64() + case "percpu_pagelist_fraction": + vm.PercpuPagelistFraction = vp.PInt64() + case "stat_interval": + vm.StatInterval = vp.PInt64() + case "swappiness": + vm.Swappiness = vp.PInt64() + case "user_reserve_kbytes": + vm.UserReserveKbytes = vp.PInt64() + case "vfs_cache_pressure": + vm.VfsCachePressure = vp.PInt64() + case "watermark_boost_factor": + vm.WatermarkBoostFactor = vp.PInt64() + case "watermark_scale_factor": + vm.WatermarkScaleFactor = vp.PInt64() + case "zone_reclaim_mode": + vm.ZoneReclaimMode = vp.PInt64() + } + if err := vp.Err(); err != nil { + return nil, err + } + } + + return &vm, nil +} diff --git a/vendor/github.com/prometheus/procfs/zoneinfo.go b/vendor/github.com/prometheus/procfs/zoneinfo.go new file mode 100644 index 00000000..e941503d --- /dev/null +++ b/vendor/github.com/prometheus/procfs/zoneinfo.go @@ -0,0 +1,196 @@ +// Copyright 2019 The Prometheus Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build !windows + +package procfs + +import ( + "bytes" + "fmt" + "io/ioutil" + "regexp" + "strings" + + "github.com/prometheus/procfs/internal/util" +) + +// Zoneinfo holds info parsed from /proc/zoneinfo. +type Zoneinfo struct { + Node string + Zone string + NrFreePages *int64 + Min *int64 + Low *int64 + High *int64 + Scanned *int64 + Spanned *int64 + Present *int64 + Managed *int64 + NrActiveAnon *int64 + NrInactiveAnon *int64 + NrIsolatedAnon *int64 + NrAnonPages *int64 + NrAnonTransparentHugepages *int64 + NrActiveFile *int64 + NrInactiveFile *int64 + NrIsolatedFile *int64 + NrFilePages *int64 + NrSlabReclaimable *int64 + NrSlabUnreclaimable *int64 + NrMlockStack *int64 + NrKernelStack *int64 + NrMapped *int64 + NrDirty *int64 + NrWriteback *int64 + NrUnevictable *int64 + NrShmem *int64 + NrDirtied *int64 + NrWritten *int64 + NumaHit *int64 + NumaMiss *int64 + NumaForeign *int64 + NumaInterleave *int64 + NumaLocal *int64 + NumaOther *int64 + Protection []*int64 +} + +var nodeZoneRE = regexp.MustCompile(`(\d+), zone\s+(\w+)`) + +// Zoneinfo parses an zoneinfo-file (/proc/zoneinfo) and returns a slice of +// structs containing the relevant info. More information available here: +// https://www.kernel.org/doc/Documentation/sysctl/vm.txt +func (fs FS) Zoneinfo() ([]Zoneinfo, error) { + data, err := ioutil.ReadFile(fs.proc.Path("zoneinfo")) + if err != nil { + return nil, fmt.Errorf("error reading zoneinfo %s: %s", fs.proc.Path("zoneinfo"), err) + } + zoneinfo, err := parseZoneinfo(data) + if err != nil { + return nil, fmt.Errorf("error parsing zoneinfo %s: %s", fs.proc.Path("zoneinfo"), err) + } + return zoneinfo, nil +} + +func parseZoneinfo(zoneinfoData []byte) ([]Zoneinfo, error) { + + zoneinfo := []Zoneinfo{} + + zoneinfoBlocks := bytes.Split(zoneinfoData, []byte("\nNode")) + for _, block := range zoneinfoBlocks { + var zoneinfoElement Zoneinfo + lines := strings.Split(string(block), "\n") + for _, line := range lines { + + if nodeZone := nodeZoneRE.FindStringSubmatch(line); nodeZone != nil { + zoneinfoElement.Node = nodeZone[1] + zoneinfoElement.Zone = nodeZone[2] + continue + } + if strings.HasPrefix(strings.TrimSpace(line), "per-node stats") { + zoneinfoElement.Zone = "" + continue + } + parts := strings.Fields(strings.TrimSpace(line)) + if len(parts) < 2 { + continue + } + vp := util.NewValueParser(parts[1]) + switch parts[0] { + case "nr_free_pages": + zoneinfoElement.NrFreePages = vp.PInt64() + case "min": + zoneinfoElement.Min = vp.PInt64() + case "low": + zoneinfoElement.Low = vp.PInt64() + case "high": + zoneinfoElement.High = vp.PInt64() + case "scanned": + zoneinfoElement.Scanned = vp.PInt64() + case "spanned": + zoneinfoElement.Spanned = vp.PInt64() + case "present": + zoneinfoElement.Present = vp.PInt64() + case "managed": + zoneinfoElement.Managed = vp.PInt64() + case "nr_active_anon": + zoneinfoElement.NrActiveAnon = vp.PInt64() + case "nr_inactive_anon": + zoneinfoElement.NrInactiveAnon = vp.PInt64() + case "nr_isolated_anon": + zoneinfoElement.NrIsolatedAnon = vp.PInt64() + case "nr_anon_pages": + zoneinfoElement.NrAnonPages = vp.PInt64() + case "nr_anon_transparent_hugepages": + zoneinfoElement.NrAnonTransparentHugepages = vp.PInt64() + case "nr_active_file": + zoneinfoElement.NrActiveFile = vp.PInt64() + case "nr_inactive_file": + zoneinfoElement.NrInactiveFile = vp.PInt64() + case "nr_isolated_file": + zoneinfoElement.NrIsolatedFile = vp.PInt64() + case "nr_file_pages": + zoneinfoElement.NrFilePages = vp.PInt64() + case "nr_slab_reclaimable": + zoneinfoElement.NrSlabReclaimable = vp.PInt64() + case "nr_slab_unreclaimable": + zoneinfoElement.NrSlabUnreclaimable = vp.PInt64() + case "nr_mlock_stack": + zoneinfoElement.NrMlockStack = vp.PInt64() + case "nr_kernel_stack": + zoneinfoElement.NrKernelStack = vp.PInt64() + case "nr_mapped": + zoneinfoElement.NrMapped = vp.PInt64() + case "nr_dirty": + zoneinfoElement.NrDirty = vp.PInt64() + case "nr_writeback": + zoneinfoElement.NrWriteback = vp.PInt64() + case "nr_unevictable": + zoneinfoElement.NrUnevictable = vp.PInt64() + case "nr_shmem": + zoneinfoElement.NrShmem = vp.PInt64() + case "nr_dirtied": + zoneinfoElement.NrDirtied = vp.PInt64() + case "nr_written": + zoneinfoElement.NrWritten = vp.PInt64() + case "numa_hit": + zoneinfoElement.NumaHit = vp.PInt64() + case "numa_miss": + zoneinfoElement.NumaMiss = vp.PInt64() + case "numa_foreign": + zoneinfoElement.NumaForeign = vp.PInt64() + case "numa_interleave": + zoneinfoElement.NumaInterleave = vp.PInt64() + case "numa_local": + zoneinfoElement.NumaLocal = vp.PInt64() + case "numa_other": + zoneinfoElement.NumaOther = vp.PInt64() + case "protection:": + protectionParts := strings.Split(line, ":") + protectionValues := strings.Replace(protectionParts[1], "(", "", 1) + protectionValues = strings.Replace(protectionValues, ")", "", 1) + protectionValues = strings.TrimSpace(protectionValues) + protectionStringMap := strings.Split(protectionValues, ", ") + val, err := util.ParsePInt64s(protectionStringMap) + if err == nil { + zoneinfoElement.Protection = val + } + } + + } + + zoneinfo = append(zoneinfo, zoneinfoElement) + } + return zoneinfo, nil +} diff --git a/vendor/github.com/xeipuuv/gojsonschema/.gitignore b/vendor/github.com/xeipuuv/gojsonschema/.gitignore index c1e0636f..68e993ce 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/.gitignore +++ b/vendor/github.com/xeipuuv/gojsonschema/.gitignore @@ -1 +1,3 @@ *.sw[nop] +*.iml +.vscode/ diff --git a/vendor/github.com/xeipuuv/gojsonschema/.travis.yml b/vendor/github.com/xeipuuv/gojsonschema/.travis.yml index 9cc01e8a..37ec1679 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/.travis.yml +++ b/vendor/github.com/xeipuuv/gojsonschema/.travis.yml @@ -1,7 +1,7 @@ language: go go: - - 1.3 + - 1.5 before_install: - - go get github.com/sigu-399/gojsonreference - - go get github.com/sigu-399/gojsonpointer + - go get github.com/xeipuuv/gojsonreference + - go get github.com/xeipuuv/gojsonpointer - go get github.com/stretchr/testify/assert diff --git a/vendor/github.com/xeipuuv/gojsonschema/README.md b/vendor/github.com/xeipuuv/gojsonschema/README.md index 187da61e..b890eee1 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/README.md +++ b/vendor/github.com/xeipuuv/gojsonschema/README.md @@ -1,10 +1,11 @@ +[![GoDoc](https://godoc.org/github.com/xeipuuv/gojsonschema?status.svg)](https://godoc.org/github.com/xeipuuv/gojsonschema) [![Build Status](https://travis-ci.org/xeipuuv/gojsonschema.svg)](https://travis-ci.org/xeipuuv/gojsonschema) # gojsonschema ## Description -An implementation of JSON Schema, based on IETF's draft v4 - Go language +An implementation of JSON Schema for the Go programming language. Supports draft-04, draft-06 and draft-07. References : @@ -155,7 +156,9 @@ The library handles string error codes which you can customize by creating your gojsonschema.Locale = YourCustomLocale{} ``` -However, each error contains additional contextual information. +However, each error contains additional contextual information. + +Newer versions of `gojsonschema` may have new additional errors, so code that uses a custom locale will need to be updated when this happens. **err.Type()**: *string* Returns the "type" of error that occurred. Note you can also type check. See below @@ -169,15 +172,18 @@ Note: An error of RequiredType has an err.Type() return value of "required" "number_not": NumberNotError "missing_dependency": MissingDependencyError "internal": InternalError + "const": ConstEror "enum": EnumError "array_no_additional_items": ArrayNoAdditionalItemsError "array_min_items": ArrayMinItemsError "array_max_items": ArrayMaxItemsError "unique": ItemsMustBeUniqueError + "contains" : ArrayContainsError "array_min_properties": ArrayMinPropertiesError "array_max_properties": ArrayMaxPropertiesError "additional_property_not_allowed": AdditionalPropertyNotAllowedError "invalid_property_pattern": InvalidPropertyPatternError + "invalid_property_name": InvalidPropertyNameError "string_gte": StringLengthGTEError "string_lte": StringLengthLTEError "pattern": DoesNotMatchPatternError @@ -189,25 +195,48 @@ Note: An error of RequiredType has an err.Type() return value of "required" **err.Value()**: *interface{}* Returns the value given -**err.Context()**: *gojsonschema.jsonContext* Returns the context. This has a String() method that will print something like this: (root).firstName +**err.Context()**: *gojsonschema.JsonContext* Returns the context. This has a String() method that will print something like this: (root).firstName **err.Field()**: *string* Returns the fieldname in the format firstName, or for embedded properties, person.firstName. This returns the same as the String() method on *err.Context()* but removes the (root). prefix. **err.Description()**: *string* The error description. This is based on the locale you are using. See the beginning of this section for overwriting the locale with a custom implementation. +**err.DescriptionFormat()**: *string* The error description format. This is relevant if you are adding custom validation errors afterwards to the result. + **err.Details()**: *gojsonschema.ErrorDetails* Returns a map[string]interface{} of additional error details specific to the error. For example, GTE errors will have a "min" value, LTE will have a "max" value. See errors.go for a full description of all the error details. Every error always contains a "field" key that holds the value of *err.Field()* -Note in most cases, the err.Details() will be used to generate replacement strings in your locales. and not used directly i.e. +Note in most cases, the err.Details() will be used to generate replacement strings in your locales, and not used directly. These strings follow the text/template format i.e. ``` -%field% must be greater than or equal to %min% +{{.field}} must be greater than or equal to {{.min}} ``` +The library allows you to specify custom template functions, should you require more complex error message handling. +```go +gojsonschema.ErrorTemplateFuncs = map[string]interface{}{ + "allcaps": func(s string) string { + return strings.ToUpper(s) + }, +} +``` + +Given the above definition, you can use the custom function `"allcaps"` in your localization templates: +``` +{{allcaps .field}} must be greater than or equal to {{.min}} +``` + +The above error message would then be rendered with the `field` value in capital letters. For example: +``` +"PASSWORD must be greater than or equal to 8" +``` + +Learn more about what types of template functions you can use in `ErrorTemplateFuncs` by referring to Go's [text/template FuncMap](https://golang.org/pkg/text/template/#FuncMap) type. + ## Formats -JSON Schema allows for optional "format" property to validate strings against well-known formats. gojsonschema ships with all of the formats defined in the spec that you can use like this: +JSON Schema allows for optional "format" property to validate instances against well-known formats. gojsonschema ships with all of the formats defined in the spec that you can use like this: ````json {"type": "string", "format": "email"} ```` -Available formats: date-time, hostname, email, ipv4, ipv6, uri. +Available formats: date-time, hostname, email, ipv4, ipv6, uri, uri-reference, uuid, regex. Some of the new formats in draft-06 and draft-07 are not yet implemented. For repetitive or more complex formats, you can create custom format checkers and add them to gojsonschema like this: @@ -216,8 +245,14 @@ For repetitive or more complex formats, you can create custom format checkers an type RoleFormatChecker struct {} // Ensure it meets the gojsonschema.FormatChecker interface -func (f RoleFormatChecker) IsFormat(input string) bool { - return strings.HasPrefix("ROLE_", input) +func (f RoleFormatChecker) IsFormat(input interface{}) bool { + + asString, ok := input.(string) + if ok == false { + return false + } + + return strings.HasPrefix("ROLE_", asString) } // Add it to the library @@ -229,6 +264,86 @@ Now to use in your json schema: {"type": "string", "format": "role"} ```` +Another example would be to check if the provided integer matches an id on database: + +JSON schema: +```json +{"type": "integer", "format": "ValidUserId"} +``` + +```go +// Define the format checker +type ValidUserIdFormatChecker struct {} + +// Ensure it meets the gojsonschema.FormatChecker interface +func (f ValidUserIdFormatChecker) IsFormat(input interface{}) bool { + + asFloat64, ok := input.(float64) // Numbers are always float64 here + if ok == false { + return false + } + + // XXX + // do the magic on the database looking for the int(asFloat64) + + return true +} + +// Add it to the library +gojsonschema.FormatCheckers.Add("ValidUserId", ValidUserIdFormatChecker{}) +```` + +## Additional custom validation +After the validation has run and you have the results, you may add additional +errors using `Result.AddError`. This is useful to maintain the same format within the resultset instead +of having to add special exceptions for your own errors. Below is an example. + +```go +type AnswerInvalidError struct { + gojsonschema.ResultErrorFields +} + +func newAnswerInvalidError(context *gojsonschema.JsonContext, value interface{}, details gojsonschema.ErrorDetails) *AnswerInvalidError { + err := AnswerInvalidError{} + err.SetContext(context) + err.SetType("custom_invalid_error") + // it is important to use SetDescriptionFormat() as this is used to call SetDescription() after it has been parsed + // using the description of err will be overridden by this. + err.SetDescriptionFormat("Answer to the Ultimate Question of Life, the Universe, and Everything is {{.answer}}") + err.SetValue(value) + err.SetDetails(details) + + return &err +} + +func main() { + // ... + schema, err := gojsonschema.NewSchema(schemaLoader) + result, err := gojsonschema.Validate(schemaLoader, documentLoader) + + if true { // some validation + jsonContext := gojsonschema.NewJsonContext("question", nil) + errDetail := gojsonschema.ErrorDetails{ + "answer": 42, + } + result.AddError( + newAnswerInvalidError( + gojsonschema.NewJsonContext("answer", jsonContext), + 52, + errDetail, + ), + errDetail, + ) + } + + return result, err + +} +``` + +This is especially useful if you want to add validation beyond what the +json schema drafts can provide such business specific logic. + ## Uses gojsonschema uses the following test suite : diff --git a/vendor/github.com/xeipuuv/gojsonschema/errors.go b/vendor/github.com/xeipuuv/gojsonschema/errors.go index 5146cbba..2f326a22 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/errors.go +++ b/vendor/github.com/xeipuuv/gojsonschema/errors.go @@ -1,10 +1,20 @@ package gojsonschema import ( - "fmt" - "strings" + "bytes" + "sync" + "text/template" ) +var errorTemplates errorTemplate = errorTemplate{template.New("errors-new"), sync.RWMutex{}} + +// template.Template is not thread-safe for writing, so some locking is done +// sync.RWMutex is used for efficiently locking when new templates are created +type errorTemplate struct { + *template.Template + sync.RWMutex +} + type ( // RequiredError. ErrorDetails: property string RequiredError struct { @@ -46,6 +56,11 @@ type ( ResultErrorFields } + // ConstError. ErrorDetails: allowed + ConstError struct { + ResultErrorFields + } + // EnumError. ErrorDetails: allowed EnumError struct { ResultErrorFields @@ -71,6 +86,11 @@ type ( ResultErrorFields } + // ArrayContainsError. ErrorDetails: + ArrayContainsError struct { + ResultErrorFields + } + // ArrayMinPropertiesError. ErrorDetails: min ArrayMinPropertiesError struct { ResultErrorFields @@ -91,6 +111,11 @@ type ( ResultErrorFields } + // InvalidPopertyNameError. ErrorDetails: property + InvalidPropertyNameError struct { + ResultErrorFields + } + // StringLengthGTEError. ErrorDetails: min StringLengthGTEError struct { ResultErrorFields @@ -135,10 +160,20 @@ type ( NumberLTError struct { ResultErrorFields } + + // ConditionThenError. ErrorDetails: - + ConditionThenError struct { + ResultErrorFields + } + + // ConditionElseError. ErrorDetails: - + ConditionElseError struct { + ResultErrorFields + } ) // newError takes a ResultError type and sets the type, context, description, details, value, and field -func newError(err ResultError, context *jsonContext, value interface{}, locale locale, details ErrorDetails) { +func newError(err ResultError, context *JsonContext, value interface{}, locale locale, details ErrorDetails) { var t string var d string switch err.(type) { @@ -166,6 +201,9 @@ func newError(err ResultError, context *jsonContext, value interface{}, locale l case *InternalError: t = "internal" d = locale.Internal() + case *ConstError: + t = "const" + d = locale.Const() case *EnumError: t = "enum" d = locale.Enum() @@ -181,6 +219,9 @@ func newError(err ResultError, context *jsonContext, value interface{}, locale l case *ItemsMustBeUniqueError: t = "unique" d = locale.Unique() + case *ArrayContainsError: + t = "contains" + d = locale.ArrayContains() case *ArrayMinPropertiesError: t = "array_min_properties" d = locale.ArrayMinProperties() @@ -193,6 +234,9 @@ func newError(err ResultError, context *jsonContext, value interface{}, locale l case *InvalidPropertyPatternError: t = "invalid_property_pattern" d = locale.InvalidPropertyPattern() + case *InvalidPropertyNameError: + t = "invalid_property_name" + d = locale.InvalidPropertyName() case *StringLengthGTEError: t = "string_gte" d = locale.StringGTE() @@ -220,23 +264,61 @@ func newError(err ResultError, context *jsonContext, value interface{}, locale l case *NumberLTError: t = "number_lt" d = locale.NumberLT() + case *ConditionThenError: + t = "condition_then" + d = locale.ConditionThen() + case *ConditionElseError: + t = "condition_else" + d = locale.ConditionElse() } err.SetType(t) err.SetContext(context) err.SetValue(value) err.SetDetails(details) + err.SetDescriptionFormat(d) details["field"] = err.Field() - err.SetDescription(formatErrorDescription(d, details)) + + if _, exists := details["context"]; !exists && context != nil { + details["context"] = context.String() + } + + err.SetDescription(formatErrorDescription(err.DescriptionFormat(), details)) } -// formatErrorDescription takes a string in this format: %field% is required -// and converts it to a string with replacements. The fields come from -// the ErrorDetails struct and vary for each type of error. +// formatErrorDescription takes a string in the default text/template +// format and converts it to a string with replacements. The fields come +// from the ErrorDetails struct and vary for each type of error. func formatErrorDescription(s string, details ErrorDetails) string { - for name, val := range details { - s = strings.Replace(s, "%"+strings.ToLower(name)+"%", fmt.Sprintf("%v", val), -1) + + var tpl *template.Template + var descrAsBuffer bytes.Buffer + var err error + + errorTemplates.RLock() + tpl = errorTemplates.Lookup(s) + errorTemplates.RUnlock() + + if tpl == nil { + errorTemplates.Lock() + tpl = errorTemplates.New(s) + + if ErrorTemplateFuncs != nil { + tpl.Funcs(ErrorTemplateFuncs) + } + + tpl, err = tpl.Parse(s) + errorTemplates.Unlock() + + if err != nil { + return err.Error() + } + } + + err = tpl.Execute(&descrAsBuffer, details) + if err != nil { + return err.Error() } - return s + return descrAsBuffer.String() } diff --git a/vendor/github.com/xeipuuv/gojsonschema/format_checkers.go b/vendor/github.com/xeipuuv/gojsonschema/format_checkers.go index b91c360a..20ead1f7 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/format_checkers.go +++ b/vendor/github.com/xeipuuv/gojsonschema/format_checkers.go @@ -3,7 +3,6 @@ package gojsonschema import ( "net" "net/url" - "reflect" "regexp" "strings" "time" @@ -12,7 +11,7 @@ import ( type ( // FormatChecker is the interface all formatters added to FormatCheckerChain must implement FormatChecker interface { - IsFormat(input string) bool + IsFormat(input interface{}) bool } // FormatCheckerChain holds the formatters @@ -52,14 +51,20 @@ type ( // http://tools.ietf.org/html/rfc3339#section-5.6 DateTimeFormatChecker struct{} - // URIFormatCheckers validates a URI with a valid Scheme per RFC3986 + // URIFormatChecker validates a URI with a valid Scheme per RFC3986 URIFormatChecker struct{} + // URIReferenceFormatChecker validates a URI or relative-reference per RFC3986 + URIReferenceFormatChecker struct{} + // HostnameFormatChecker validates a hostname is in the correct format HostnameFormatChecker struct{} // UUIDFormatChecker validates a UUID is in the correct format UUIDFormatChecker struct{} + + // RegexFormatChecker validates a regex is in the correct format + RegexFormatChecker struct{} ) var ( @@ -67,13 +72,15 @@ var ( // so library users can add custom formatters FormatCheckers = FormatCheckerChain{ formatters: map[string]FormatChecker{ - "date-time": DateTimeFormatChecker{}, - "hostname": HostnameFormatChecker{}, - "email": EmailFormatChecker{}, - "ipv4": IPV4FormatChecker{}, - "ipv6": IPV6FormatChecker{}, - "uri": URIFormatChecker{}, - "uuid": UUIDFormatChecker{}, + "date-time": DateTimeFormatChecker{}, + "hostname": HostnameFormatChecker{}, + "email": EmailFormatChecker{}, + "ipv4": IPV4FormatChecker{}, + "ipv6": IPV6FormatChecker{}, + "uri": URIFormatChecker{}, + "uri-reference": URIReferenceFormatChecker{}, + "uuid": UUIDFormatChecker{}, + "regex": RegexFormatChecker{}, }, } @@ -117,32 +124,50 @@ func (c *FormatCheckerChain) IsFormat(name string, input interface{}) bool { return false } - if !isKind(input, reflect.String) { - return false - } + return f.IsFormat(input) +} - inputString := input.(string) +func (f EmailFormatChecker) IsFormat(input interface{}) bool { - return f.IsFormat(inputString) -} + asString, ok := input.(string) + if ok == false { + return false + } -func (f EmailFormatChecker) IsFormat(input string) bool { - return rxEmail.MatchString(input) + return rxEmail.MatchString(asString) } // Credit: https://github.com/asaskevich/govalidator -func (f IPV4FormatChecker) IsFormat(input string) bool { - ip := net.ParseIP(input) - return ip != nil && strings.Contains(input, ".") +func (f IPV4FormatChecker) IsFormat(input interface{}) bool { + + asString, ok := input.(string) + if ok == false { + return false + } + + ip := net.ParseIP(asString) + return ip != nil && strings.Contains(asString, ".") } // Credit: https://github.com/asaskevich/govalidator -func (f IPV6FormatChecker) IsFormat(input string) bool { - ip := net.ParseIP(input) - return ip != nil && strings.Contains(input, ":") +func (f IPV6FormatChecker) IsFormat(input interface{}) bool { + + asString, ok := input.(string) + if ok == false { + return false + } + + ip := net.ParseIP(asString) + return ip != nil && strings.Contains(asString, ":") } -func (f DateTimeFormatChecker) IsFormat(input string) bool { +func (f DateTimeFormatChecker) IsFormat(input interface{}) bool { + + asString, ok := input.(string) + if ok == false { + return false + } + formats := []string{ "15:04:05", "15:04:05Z07:00", @@ -152,7 +177,7 @@ func (f DateTimeFormatChecker) IsFormat(input string) bool { } for _, format := range formats { - if _, err := time.Parse(format, input); err == nil { + if _, err := time.Parse(format, asString); err == nil { return true } } @@ -160,8 +185,14 @@ func (f DateTimeFormatChecker) IsFormat(input string) bool { return false } -func (f URIFormatChecker) IsFormat(input string) bool { - u, err := url.Parse(input) +func (f URIFormatChecker) IsFormat(input interface{}) bool { + + asString, ok := input.(string) + if ok == false { + return false + } + + u, err := url.Parse(asString) if err != nil || u.Scheme == "" { return false } @@ -169,10 +200,51 @@ func (f URIFormatChecker) IsFormat(input string) bool { return true } -func (f HostnameFormatChecker) IsFormat(input string) bool { - return rxHostname.MatchString(input) && len(input) < 256 +func (f URIReferenceFormatChecker) IsFormat(input interface{}) bool { + + asString, ok := input.(string) + if ok == false { + return false + } + + _, err := url.Parse(asString) + return err == nil +} + +func (f HostnameFormatChecker) IsFormat(input interface{}) bool { + + asString, ok := input.(string) + if ok == false { + return false + } + + return rxHostname.MatchString(asString) && len(asString) < 256 +} + +func (f UUIDFormatChecker) IsFormat(input interface{}) bool { + + asString, ok := input.(string) + if ok == false { + return false + } + + return rxUUID.MatchString(asString) } -func (f UUIDFormatChecker) IsFormat(input string) bool { - return rxUUID.MatchString(input) +// IsFormat implements FormatChecker interface. +func (f RegexFormatChecker) IsFormat(input interface{}) bool { + + asString, ok := input.(string) + if ok == false { + return false + } + + if asString == "" { + return true + } + _, err := regexp.Compile(asString) + if err != nil { + return false + } + return true } diff --git a/vendor/github.com/xeipuuv/gojsonschema/glide.yaml b/vendor/github.com/xeipuuv/gojsonschema/glide.yaml index 7aef8c09..ab6fb867 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/glide.yaml +++ b/vendor/github.com/xeipuuv/gojsonschema/glide.yaml @@ -7,6 +7,7 @@ import: - package: github.com/xeipuuv/gojsonreference -- package: github.com/stretchr/testify/assert - version: ^1.1.3 - +testImport: +- package: github.com/stretchr/testify + subpackages: + - assert diff --git a/vendor/github.com/xeipuuv/gojsonschema/jsonContext.go b/vendor/github.com/xeipuuv/gojsonschema/jsonContext.go index fcc8d9d6..f40668a7 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/jsonContext.go +++ b/vendor/github.com/xeipuuv/gojsonschema/jsonContext.go @@ -26,20 +26,20 @@ package gojsonschema import "bytes" -// jsonContext implements a persistent linked-list of strings -type jsonContext struct { +// JsonContext implements a persistent linked-list of strings +type JsonContext struct { head string - tail *jsonContext + tail *JsonContext } -func newJsonContext(head string, tail *jsonContext) *jsonContext { - return &jsonContext{head, tail} +func NewJsonContext(head string, tail *JsonContext) *JsonContext { + return &JsonContext{head, tail} } // String displays the context in reverse. // This plays well with the data structure's persistent nature with // Cons and a json document's tree structure. -func (c *jsonContext) String(del ...string) string { +func (c *JsonContext) String(del ...string) string { byteArr := make([]byte, 0, c.stringLen()) buf := bytes.NewBuffer(byteArr) c.writeStringToBuffer(buf, del) @@ -47,7 +47,7 @@ func (c *jsonContext) String(del ...string) string { return buf.String() } -func (c *jsonContext) stringLen() int { +func (c *JsonContext) stringLen() int { length := 0 if c.tail != nil { length = c.tail.stringLen() + 1 // add 1 for "." @@ -57,7 +57,7 @@ func (c *jsonContext) stringLen() int { return length } -func (c *jsonContext) writeStringToBuffer(buf *bytes.Buffer, del []string) { +func (c *JsonContext) writeStringToBuffer(buf *bytes.Buffer, del []string) { if c.tail != nil { c.tail.writeStringToBuffer(buf, del) diff --git a/vendor/github.com/xeipuuv/gojsonschema/jsonLoader.go b/vendor/github.com/xeipuuv/gojsonschema/jsonLoader.go index a9458a8e..3a3b6d5c 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/jsonLoader.go +++ b/vendor/github.com/xeipuuv/gojsonschema/jsonLoader.go @@ -33,6 +33,7 @@ import ( "io" "io/ioutil" "net/http" + "os" "path/filepath" "runtime" "strings" @@ -40,34 +41,92 @@ import ( "github.com/xeipuuv/gojsonreference" ) +var osFS = osFileSystem(os.Open) + // JSON loader interface type JSONLoader interface { - jsonSource() interface{} - loadJSON() (interface{}, error) - loadSchema() (*Schema, error) + JsonSource() interface{} + LoadJSON() (interface{}, error) + JsonReference() (gojsonreference.JsonReference, error) + LoaderFactory() JSONLoaderFactory +} + +type JSONLoaderFactory interface { + New(source string) JSONLoader +} + +type DefaultJSONLoaderFactory struct { +} + +type FileSystemJSONLoaderFactory struct { + fs http.FileSystem +} + +func (d DefaultJSONLoaderFactory) New(source string) JSONLoader { + return &jsonReferenceLoader{ + fs: osFS, + source: source, + } +} + +func (f FileSystemJSONLoaderFactory) New(source string) JSONLoader { + return &jsonReferenceLoader{ + fs: f.fs, + source: source, + } +} + +// osFileSystem is a functional wrapper for os.Open that implements http.FileSystem. +type osFileSystem func(string) (*os.File, error) + +func (o osFileSystem) Open(name string) (http.File, error) { + return o(name) } // JSON Reference loader // references are used to load JSONs from files and HTTP type jsonReferenceLoader struct { + fs http.FileSystem source string } -func (l *jsonReferenceLoader) jsonSource() interface{} { +func (l *jsonReferenceLoader) JsonSource() interface{} { return l.source } +func (l *jsonReferenceLoader) JsonReference() (gojsonreference.JsonReference, error) { + return gojsonreference.NewJsonReference(l.JsonSource().(string)) +} + +func (l *jsonReferenceLoader) LoaderFactory() JSONLoaderFactory { + return &FileSystemJSONLoaderFactory{ + fs: l.fs, + } +} + +// NewReferenceLoader returns a JSON reference loader using the given source and the local OS file system. func NewReferenceLoader(source string) *jsonReferenceLoader { - return &jsonReferenceLoader{source: source} + return &jsonReferenceLoader{ + fs: osFS, + source: source, + } +} + +// NewReferenceLoaderFileSystem returns a JSON reference loader using the given source and file system. +func NewReferenceLoaderFileSystem(source string, fs http.FileSystem) *jsonReferenceLoader { + return &jsonReferenceLoader{ + fs: fs, + source: source, + } } -func (l *jsonReferenceLoader) loadJSON() (interface{}, error) { +func (l *jsonReferenceLoader) LoadJSON() (interface{}, error) { var err error - reference, err := gojsonreference.NewJsonReference(l.jsonSource().(string)) + reference, err := gojsonreference.NewJsonReference(l.JsonSource().(string)) if err != nil { return nil, err } @@ -79,7 +138,7 @@ func (l *jsonReferenceLoader) loadJSON() (interface{}, error) { if reference.HasFileScheme { - filename := strings.Replace(refToUrl.String(), "file://", "", -1) + filename := strings.Replace(refToUrl.GetUrl().Path, "file://", "", -1) if runtime.GOOS == "windows" { // on Windows, a file URL may have an extra leading slash, use slashes // instead of backslashes, and have spaces escaped @@ -87,7 +146,6 @@ func (l *jsonReferenceLoader) loadJSON() (interface{}, error) { filename = filename[1:] } filename = filepath.FromSlash(filename) - filename = strings.Replace(filename, "%20", " ", -1) } document, err = l.loadFromFile(filename) @@ -108,33 +166,6 @@ func (l *jsonReferenceLoader) loadJSON() (interface{}, error) { } -func (l *jsonReferenceLoader) loadSchema() (*Schema, error) { - - var err error - - d := Schema{} - d.pool = newSchemaPool() - d.referencePool = newSchemaReferencePool() - - d.documentReference, err = gojsonreference.NewJsonReference(l.jsonSource().(string)) - if err != nil { - return nil, err - } - - spd, err := d.pool.GetDocument(d.documentReference) - if err != nil { - return nil, err - } - - err = d.parse(spd.Document) - if err != nil { - return nil, err - } - - return &d, nil - -} - func (l *jsonReferenceLoader) loadFromHTTP(address string) (interface{}, error) { resp, err := http.Get(address) @@ -144,7 +175,7 @@ func (l *jsonReferenceLoader) loadFromHTTP(address string) (interface{}, error) // must return HTTP Status 200 OK if resp.StatusCode != http.StatusOK { - return nil, errors.New(formatErrorDescription(Locale.httpBadStatus(), ErrorDetails{"status": resp.Status})) + return nil, errors.New(formatErrorDescription(Locale.HttpBadStatus(), ErrorDetails{"status": resp.Status})) } bodyBuff, err := ioutil.ReadAll(resp.Body) @@ -157,8 +188,13 @@ func (l *jsonReferenceLoader) loadFromHTTP(address string) (interface{}, error) } func (l *jsonReferenceLoader) loadFromFile(path string) (interface{}, error) { + f, err := l.fs.Open(path) + if err != nil { + return nil, err + } + defer f.Close() - bodyBuff, err := ioutil.ReadFile(path) + bodyBuff, err := ioutil.ReadAll(f) if err != nil { return nil, err } @@ -173,45 +209,52 @@ type jsonStringLoader struct { source string } -func (l *jsonStringLoader) jsonSource() interface{} { +func (l *jsonStringLoader) JsonSource() interface{} { return l.source } +func (l *jsonStringLoader) JsonReference() (gojsonreference.JsonReference, error) { + return gojsonreference.NewJsonReference("#") +} + +func (l *jsonStringLoader) LoaderFactory() JSONLoaderFactory { + return &DefaultJSONLoaderFactory{} +} + func NewStringLoader(source string) *jsonStringLoader { return &jsonStringLoader{source: source} } -func (l *jsonStringLoader) loadJSON() (interface{}, error) { +func (l *jsonStringLoader) LoadJSON() (interface{}, error) { - return decodeJsonUsingNumber(strings.NewReader(l.jsonSource().(string))) + return decodeJsonUsingNumber(strings.NewReader(l.JsonSource().(string))) } -func (l *jsonStringLoader) loadSchema() (*Schema, error) { +// JSON bytes loader - var err error +type jsonBytesLoader struct { + source []byte +} - document, err := l.loadJSON() - if err != nil { - return nil, err - } +func (l *jsonBytesLoader) JsonSource() interface{} { + return l.source +} - d := Schema{} - d.pool = newSchemaPool() - d.referencePool = newSchemaReferencePool() - d.documentReference, err = gojsonreference.NewJsonReference("#") - d.pool.SetStandaloneDocument(document) - if err != nil { - return nil, err - } +func (l *jsonBytesLoader) JsonReference() (gojsonreference.JsonReference, error) { + return gojsonreference.NewJsonReference("#") +} - err = d.parse(document) - if err != nil { - return nil, err - } +func (l *jsonBytesLoader) LoaderFactory() JSONLoaderFactory { + return &DefaultJSONLoaderFactory{} +} - return &d, nil +func NewBytesLoader(source []byte) *jsonBytesLoader { + return &jsonBytesLoader{source: source} +} +func (l *jsonBytesLoader) LoadJSON() (interface{}, error) { + return decodeJsonUsingNumber(bytes.NewReader(l.JsonSource().([]byte))) } // JSON Go (types) loader @@ -221,19 +264,27 @@ type jsonGoLoader struct { source interface{} } -func (l *jsonGoLoader) jsonSource() interface{} { +func (l *jsonGoLoader) JsonSource() interface{} { return l.source } +func (l *jsonGoLoader) JsonReference() (gojsonreference.JsonReference, error) { + return gojsonreference.NewJsonReference("#") +} + +func (l *jsonGoLoader) LoaderFactory() JSONLoaderFactory { + return &DefaultJSONLoaderFactory{} +} + func NewGoLoader(source interface{}) *jsonGoLoader { return &jsonGoLoader{source: source} } -func (l *jsonGoLoader) loadJSON() (interface{}, error) { +func (l *jsonGoLoader) LoadJSON() (interface{}, error) { // convert it to a compliant JSON first to avoid types "mismatches" - jsonBytes, err := json.Marshal(l.jsonSource()) + jsonBytes, err := json.Marshal(l.JsonSource()) if err != nil { return nil, err } @@ -242,31 +293,58 @@ func (l *jsonGoLoader) loadJSON() (interface{}, error) { } -func (l *jsonGoLoader) loadSchema() (*Schema, error) { +type jsonIOLoader struct { + buf *bytes.Buffer +} - var err error +func NewReaderLoader(source io.Reader) (*jsonIOLoader, io.Reader) { + buf := &bytes.Buffer{} + return &jsonIOLoader{buf: buf}, io.TeeReader(source, buf) +} - document, err := l.loadJSON() - if err != nil { - return nil, err - } +func NewWriterLoader(source io.Writer) (*jsonIOLoader, io.Writer) { + buf := &bytes.Buffer{} + return &jsonIOLoader{buf: buf}, io.MultiWriter(source, buf) +} - d := Schema{} - d.pool = newSchemaPool() - d.referencePool = newSchemaReferencePool() - d.documentReference, err = gojsonreference.NewJsonReference("#") - d.pool.SetStandaloneDocument(document) - if err != nil { - return nil, err - } +func (l *jsonIOLoader) JsonSource() interface{} { + return l.buf.String() +} - err = d.parse(document) - if err != nil { - return nil, err - } +func (l *jsonIOLoader) LoadJSON() (interface{}, error) { + return decodeJsonUsingNumber(l.buf) +} + +func (l *jsonIOLoader) JsonReference() (gojsonreference.JsonReference, error) { + return gojsonreference.NewJsonReference("#") +} - return &d, nil +func (l *jsonIOLoader) LoaderFactory() JSONLoaderFactory { + return &DefaultJSONLoaderFactory{} +} + +// JSON raw loader +// In case the JSON is already marshalled to interface{} use this loader +// This is used for testing as otherwise there is no guarantee the JSON is marshalled +// "properly" by using https://golang.org/pkg/encoding/json/#Decoder.UseNumber +type jsonRawLoader struct { + source interface{} +} +func NewRawLoader(source interface{}) *jsonRawLoader { + return &jsonRawLoader{source: source} +} +func (l *jsonRawLoader) JsonSource() interface{} { + return l.source +} +func (l *jsonRawLoader) LoadJSON() (interface{}, error) { + return l.source, nil +} +func (l *jsonRawLoader) JsonReference() (gojsonreference.JsonReference, error) { + return gojsonreference.NewJsonReference("#") +} +func (l *jsonRawLoader) LoaderFactory() JSONLoaderFactory { + return &DefaultJSONLoaderFactory{} } func decodeJsonUsingNumber(r io.Reader) (interface{}, error) { diff --git a/vendor/github.com/xeipuuv/gojsonschema/locales.go b/vendor/github.com/xeipuuv/gojsonschema/locales.go index de05d60d..7bd9a9dc 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/locales.go +++ b/vendor/github.com/xeipuuv/gojsonschema/locales.go @@ -26,7 +26,7 @@ package gojsonschema type ( - // locale is an interface for definining custom error strings + // locale is an interface for defining custom error strings locale interface { Required() string InvalidType() string @@ -36,15 +36,19 @@ type ( NumberNot() string MissingDependency() string Internal() string + Const() string Enum() string + ArrayNotEnoughItems() string ArrayNoAdditionalItems() string ArrayMinItems() string ArrayMaxItems() string Unique() string + ArrayContains() string ArrayMinProperties() string ArrayMaxProperties() string AdditionalPropertyNotAllowed() string InvalidPropertyPattern() string + InvalidPropertyName() string StringGTE() string StringLTE() string DoesNotMatchPattern() string @@ -72,7 +76,11 @@ type ( ReferenceMustBeCanonical() string NotAValidType() string Duplicated() string - httpBadStatus() string + HttpBadStatus() string + ParseError() string + + ConditionThen() string + ConditionElse() string // ErrorFormat ErrorFormat() string @@ -83,11 +91,11 @@ type ( ) func (l DefaultLocale) Required() string { - return `%property% is required` + return `{{.property}} is required` } func (l DefaultLocale) InvalidType() string { - return `Invalid type. Expected: %expected%, given: %given%` + return `Invalid type. Expected: {{.expected}}, given: {{.given}}` } func (l DefaultLocale) NumberAnyOf() string { @@ -107,164 +115,194 @@ func (l DefaultLocale) NumberNot() string { } func (l DefaultLocale) MissingDependency() string { - return `Has a dependency on %dependency%` + return `Has a dependency on {{.dependency}}` } func (l DefaultLocale) Internal() string { - return `Internal Error %error%` + return `Internal Error {{.error}}` +} + +func (l DefaultLocale) Const() string { + return `{{.field}} does not match: {{.allowed}}` } func (l DefaultLocale) Enum() string { - return `%field% must be one of the following: %allowed%` + return `{{.field}} must be one of the following: {{.allowed}}` } func (l DefaultLocale) ArrayNoAdditionalItems() string { return `No additional items allowed on array` } +func (l DefaultLocale) ArrayNotEnoughItems() string { + return `Not enough items on array to match positional list of schema` +} + func (l DefaultLocale) ArrayMinItems() string { - return `Array must have at least %min% items` + return `Array must have at least {{.min}} items` } func (l DefaultLocale) ArrayMaxItems() string { - return `Array must have at most %max% items` + return `Array must have at most {{.max}} items` } func (l DefaultLocale) Unique() string { - return `%type% items must be unique` + return `{{.type}} items must be unique` +} + +func (l DefaultLocale) ArrayContains() string { + return `At least one of the items must match` } func (l DefaultLocale) ArrayMinProperties() string { - return `Must have at least %min% properties` + return `Must have at least {{.min}} properties` } func (l DefaultLocale) ArrayMaxProperties() string { - return `Must have at most %max% properties` + return `Must have at most {{.max}} properties` } func (l DefaultLocale) AdditionalPropertyNotAllowed() string { - return `Additional property %property% is not allowed` + return `Additional property {{.property}} is not allowed` } func (l DefaultLocale) InvalidPropertyPattern() string { - return `Property "%property%" does not match pattern %pattern%` + return `Property "{{.property}}" does not match pattern {{.pattern}}` +} + +func (l DefaultLocale) InvalidPropertyName() string { + return `Property name of "{{.property}}" does not match` } func (l DefaultLocale) StringGTE() string { - return `String length must be greater than or equal to %min%` + return `String length must be greater than or equal to {{.min}}` } func (l DefaultLocale) StringLTE() string { - return `String length must be less than or equal to %max%` + return `String length must be less than or equal to {{.max}}` } func (l DefaultLocale) DoesNotMatchPattern() string { - return `Does not match pattern '%pattern%'` + return `Does not match pattern '{{.pattern}}'` } func (l DefaultLocale) DoesNotMatchFormat() string { - return `Does not match format '%format%'` + return `Does not match format '{{.format}}'` } func (l DefaultLocale) MultipleOf() string { - return `Must be a multiple of %multiple%` + return `Must be a multiple of {{.multiple}}` } func (l DefaultLocale) NumberGTE() string { - return `Must be greater than or equal to %min%` + return `Must be greater than or equal to {{.min}}` } func (l DefaultLocale) NumberGT() string { - return `Must be greater than %min%` + return `Must be greater than {{.min}}` } func (l DefaultLocale) NumberLTE() string { - return `Must be less than or equal to %max%` + return `Must be less than or equal to {{.max}}` } func (l DefaultLocale) NumberLT() string { - return `Must be less than %max%` + return `Must be less than {{.max}}` } // Schema validators func (l DefaultLocale) RegexPattern() string { - return `Invalid regex pattern '%pattern%'` + return `Invalid regex pattern '{{.pattern}}'` } func (l DefaultLocale) GreaterThanZero() string { - return `%number% must be strictly greater than 0` + return `{{.number}} must be strictly greater than 0` } func (l DefaultLocale) MustBeOfA() string { - return `%x% must be of a %y%` + return `{{.x}} must be of a {{.y}}` } func (l DefaultLocale) MustBeOfAn() string { - return `%x% must be of an %y%` + return `{{.x}} must be of an {{.y}}` } func (l DefaultLocale) CannotBeUsedWithout() string { - return `%x% cannot be used without %y%` + return `{{.x}} cannot be used without {{.y}}` } func (l DefaultLocale) CannotBeGT() string { - return `%x% cannot be greater than %y%` + return `{{.x}} cannot be greater than {{.y}}` } func (l DefaultLocale) MustBeOfType() string { - return `%key% must be of type %type%` + return `{{.key}} must be of type {{.type}}` } func (l DefaultLocale) MustBeValidRegex() string { - return `%key% must be a valid regex` + return `{{.key}} must be a valid regex` } func (l DefaultLocale) MustBeValidFormat() string { - return `%key% must be a valid format %given%` + return `{{.key}} must be a valid format {{.given}}` } func (l DefaultLocale) MustBeGTEZero() string { - return `%key% must be greater than or equal to 0` + return `{{.key}} must be greater than or equal to 0` } func (l DefaultLocale) KeyCannotBeGreaterThan() string { - return `%key% cannot be greater than %y%` + return `{{.key}} cannot be greater than {{.y}}` } func (l DefaultLocale) KeyItemsMustBeOfType() string { - return `%key% items must be %type%` + return `{{.key}} items must be {{.type}}` } func (l DefaultLocale) KeyItemsMustBeUnique() string { - return `%key% items must be unique` + return `{{.key}} items must be unique` } func (l DefaultLocale) ReferenceMustBeCanonical() string { - return `Reference %reference% must be canonical` + return `Reference {{.reference}} must be canonical` } func (l DefaultLocale) NotAValidType() string { - return `%type% is not a valid type -- ` + return `has a primitive type that is NOT VALID -- given: {{.given}} Expected valid values are:{{.expected}}` } func (l DefaultLocale) Duplicated() string { - return `%type% type is duplicated` + return `{{.type}} type is duplicated` } -func (l DefaultLocale) httpBadStatus() string { - return `Could not read schema from HTTP, response status is %status%` +func (l DefaultLocale) HttpBadStatus() string { + return `Could not read schema from HTTP, response status is {{.status}}` } // Replacement options: field, description, context, value func (l DefaultLocale) ErrorFormat() string { - return `%field%: %description%` + return `{{.field}}: {{.description}}` +} + +//Parse error +func (l DefaultLocale) ParseError() string { + return `Expected: {{.expected}}, given: Invalid JSON` +} + +//If/Else +func (l DefaultLocale) ConditionThen() string { + return `Must validate "then" as "if" was valid` +} + +func (l DefaultLocale) ConditionElse() string { + return `Must validate "else" as "if" was not valid` } const ( STRING_NUMBER = "number" STRING_ARRAY_OF_STRINGS = "array of strings" STRING_ARRAY_OF_SCHEMAS = "array of schemas" - STRING_SCHEMA = "schema" + STRING_SCHEMA = "valid schema" STRING_SCHEMA_OR_ARRAY_OF_STRINGS = "schema or array of strings" STRING_PROPERTIES = "properties" STRING_DEPENDENCY = "dependency" diff --git a/vendor/github.com/xeipuuv/gojsonschema/result.go b/vendor/github.com/xeipuuv/gojsonschema/result.go index c6d33758..7896f312 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/result.go +++ b/vendor/github.com/xeipuuv/gojsonschema/result.go @@ -40,25 +40,29 @@ type ( Field() string SetType(string) Type() string - SetContext(*jsonContext) - Context() *jsonContext + SetContext(*JsonContext) + Context() *JsonContext SetDescription(string) Description() string + SetDescriptionFormat(string) + DescriptionFormat() string SetValue(interface{}) Value() interface{} SetDetails(ErrorDetails) Details() ErrorDetails + String() string } // ResultErrorFields holds the fields for each ResultError implementation. // ResultErrorFields implements the ResultError interface, so custom errors // can be defined by just embedding this type ResultErrorFields struct { - errorType string // A string with the type of error (i.e. invalid_type) - context *jsonContext // Tree like notation of the part that failed the validation. ex (root).a.b ... - description string // A human readable error message - value interface{} // Value given by the JSON file that is the source of the error - details ErrorDetails + errorType string // A string with the type of error (i.e. invalid_type) + context *JsonContext // Tree like notation of the part that failed the validation. ex (root).a.b ... + description string // A human readable error message + descriptionFormat string // A format for human readable error message + value interface{} // Value given by the JSON file that is the source of the error + details ErrorDetails } Result struct { @@ -89,11 +93,11 @@ func (v *ResultErrorFields) Type() string { return v.errorType } -func (v *ResultErrorFields) SetContext(context *jsonContext) { +func (v *ResultErrorFields) SetContext(context *JsonContext) { v.context = context } -func (v *ResultErrorFields) Context() *jsonContext { +func (v *ResultErrorFields) Context() *JsonContext { return v.context } @@ -105,6 +109,14 @@ func (v *ResultErrorFields) Description() string { return v.description } +func (v *ResultErrorFields) SetDescriptionFormat(descriptionFormat string) { + v.descriptionFormat = descriptionFormat +} + +func (v *ResultErrorFields) DescriptionFormat() string { + return v.descriptionFormat +} + func (v *ResultErrorFields) SetValue(value interface{}) { v.value = value } @@ -154,7 +166,19 @@ func (v *Result) Errors() []ResultError { return v.errors } -func (v *Result) addError(err ResultError, context *jsonContext, value interface{}, details ErrorDetails) { +// Add a fully filled error to the error set +// SetDescription() will be called with the result of the parsed err.DescriptionFormat() +func (v *Result) AddError(err ResultError, details ErrorDetails) { + if _, exists := details["context"]; !exists && err.Context() != nil { + details["context"] = err.Context().String() + } + + err.SetDescription(formatErrorDescription(err.DescriptionFormat(), details)) + + v.errors = append(v.errors, err) +} + +func (v *Result) addInternalError(err ResultError, context *JsonContext, value interface{}, details ErrorDetails) { newError(err, context, value, Locale, details) v.errors = append(v.errors, err) v.score -= 2 // results in a net -1 when added to the +1 we get at the end of the validation function diff --git a/vendor/github.com/xeipuuv/gojsonschema/schema.go b/vendor/github.com/xeipuuv/gojsonschema/schema.go index 577c7863..0746a597 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/schema.go +++ b/vendor/github.com/xeipuuv/gojsonschema/schema.go @@ -27,10 +27,11 @@ package gojsonschema import ( - // "encoding/json" "errors" + "math/big" "reflect" "regexp" + "text/template" "github.com/xeipuuv/gojsonreference" ) @@ -39,10 +40,47 @@ var ( // Locale is the default locale to use // Library users can overwrite with their own implementation Locale locale = DefaultLocale{} + + // ErrorTemplateFuncs allows you to define custom template funcs for use in localization. + ErrorTemplateFuncs template.FuncMap ) func NewSchema(l JSONLoader) (*Schema, error) { - return l.loadSchema() + ref, err := l.JsonReference() + if err != nil { + return nil, err + } + + d := Schema{} + d.pool = newSchemaPool(l.LoaderFactory()) + d.documentReference = ref + d.referencePool = newSchemaReferencePool() + + var spd *schemaPoolDocument + var doc interface{} + if ref.String() != "" { + // Get document from schema pool + spd, err = d.pool.GetDocument(d.documentReference) + if err != nil { + return nil, err + } + doc = spd.Document + } else { + // Load JSON directly + doc, err = l.LoadJSON() + if err != nil { + return nil, err + } + } + + d.pool.ParseReferences(doc, ref) + + err = d.parse(doc) + if err != nil { + return nil, err + } + + return &d, nil } type Schema struct { @@ -69,80 +107,91 @@ func (d *Schema) SetRootSchemaName(name string) { // func (d *Schema) parseSchema(documentNode interface{}, currentSchema *subSchema) error { + // As of draft 6 "true" is equivalent to an empty schema "{}" and false equals "{"not":{}}" + if isKind(documentNode, reflect.Bool) { + b := documentNode.(bool) + if b { + documentNode = map[string]interface{}{} + } else { + documentNode = map[string]interface{}{"not": true} + } + } + if !isKind(documentNode, reflect.Map) { return errors.New(formatErrorDescription( - Locale.InvalidType(), + Locale.ParseError(), ErrorDetails{ - "expected": TYPE_OBJECT, - "given": STRING_SCHEMA, + "expected": STRING_SCHEMA, }, )) } m := documentNode.(map[string]interface{}) - if currentSchema == d.rootSchema { + if currentSchema.parent == nil { currentSchema.ref = &d.documentReference - } + currentSchema.id = &d.documentReference - // $subSchema - if existsMapKey(m, KEY_SCHEMA) { - if !isKind(m[KEY_SCHEMA], reflect.String) { - return errors.New(formatErrorDescription( - Locale.InvalidType(), - ErrorDetails{ - "expected": TYPE_STRING, - "given": KEY_SCHEMA, - }, - )) - } - schemaRef := m[KEY_SCHEMA].(string) - schemaReference, err := gojsonreference.NewJsonReference(schemaRef) - currentSchema.subSchema = &schemaReference - if err != nil { - return err + if existsMapKey(m, KEY_SCHEMA) && false { + if !isKind(m[KEY_SCHEMA], reflect.String) { + return errors.New(formatErrorDescription( + Locale.InvalidType(), + ErrorDetails{ + "expected": TYPE_STRING, + "given": KEY_SCHEMA, + }, + )) + } } } - // $ref - if existsMapKey(m, KEY_REF) && !isKind(m[KEY_REF], reflect.String) { + if currentSchema.id == nil && currentSchema.parent != nil { + currentSchema.id = currentSchema.parent.id + } + + // In draft 6 the id keyword was renamed to $id + // Use the old id by default + keyID := KEY_ID_NEW + if existsMapKey(m, KEY_ID) { + keyID = KEY_ID + } + if existsMapKey(m, keyID) && !isKind(m[keyID], reflect.String) { return errors.New(formatErrorDescription( Locale.InvalidType(), ErrorDetails{ "expected": TYPE_STRING, - "given": KEY_REF, + "given": keyID, }, )) } - if k, ok := m[KEY_REF].(string); ok { - - if sch, ok := d.referencePool.Get(currentSchema.ref.String() + k); ok { - - currentSchema.refSchema = sch - + if k, ok := m[keyID].(string); ok { + jsonReference, err := gojsonreference.NewJsonReference(k) + if err != nil { + return err + } + if currentSchema == d.rootSchema { + currentSchema.id = &jsonReference } else { - - var err error - err = d.parseReference(documentNode, currentSchema, k) + ref, err := currentSchema.parent.id.Inherits(jsonReference) if err != nil { return err } - - return nil + currentSchema.id = ref } } // definitions if existsMapKey(m, KEY_DEFINITIONS) { - if isKind(m[KEY_DEFINITIONS], reflect.Map) { - currentSchema.definitions = make(map[string]*subSchema) - for dk, dv := range m[KEY_DEFINITIONS].(map[string]interface{}) { - if isKind(dv, reflect.Map) { - newSchema := &subSchema{property: KEY_DEFINITIONS, parent: currentSchema, ref: currentSchema.ref} - currentSchema.definitions[dk] = newSchema + if isKind(m[KEY_DEFINITIONS], reflect.Map, reflect.Bool) { + for _, dv := range m[KEY_DEFINITIONS].(map[string]interface{}) { + if isKind(dv, reflect.Map, reflect.Bool) { + + newSchema := &subSchema{property: KEY_DEFINITIONS, parent: currentSchema} + err := d.parseSchema(dv, newSchema) + if err != nil { - return errors.New(err.Error()) + return err } } else { return errors.New(formatErrorDescription( @@ -166,20 +215,6 @@ func (d *Schema) parseSchema(documentNode interface{}, currentSchema *subSchema) } - // id - if existsMapKey(m, KEY_ID) && !isKind(m[KEY_ID], reflect.String) { - return errors.New(formatErrorDescription( - Locale.InvalidType(), - ErrorDetails{ - "expected": TYPE_STRING, - "given": KEY_ID, - }, - )) - } - if k, ok := m[KEY_ID].(string); ok { - currentSchema.id = &k - } - // title if existsMapKey(m, KEY_TITLE) && !isKind(m[KEY_TITLE], reflect.String) { return errors.New(formatErrorDescription( @@ -208,6 +243,39 @@ func (d *Schema) parseSchema(documentNode interface{}, currentSchema *subSchema) currentSchema.description = &k } + // $ref + if existsMapKey(m, KEY_REF) && !isKind(m[KEY_REF], reflect.String) { + return errors.New(formatErrorDescription( + Locale.InvalidType(), + ErrorDetails{ + "expected": TYPE_STRING, + "given": KEY_REF, + }, + )) + } + + if k, ok := m[KEY_REF].(string); ok { + + jsonReference, err := gojsonreference.NewJsonReference(k) + if err != nil { + return err + } + + currentSchema.ref = &jsonReference + + if sch, ok := d.referencePool.Get(currentSchema.ref.String()); ok { + currentSchema.refSchema = sch + } else { + err := d.parseReference(documentNode, currentSchema) + + if err != nil { + return err + } + + return nil + } + } + // type if existsMapKey(m, KEY_TYPE) { if isKind(m[KEY_TYPE], reflect.String) { @@ -309,6 +377,26 @@ func (d *Schema) parseSchema(documentNode interface{}, currentSchema *subSchema) } } + // propertyNames + if existsMapKey(m, KEY_PROPERTY_NAMES) { + if isKind(m[KEY_PROPERTY_NAMES], reflect.Map, reflect.Bool) { + newSchema := &subSchema{property: KEY_PROPERTY_NAMES, parent: currentSchema, ref: currentSchema.ref} + currentSchema.propertyNames = newSchema + err := d.parseSchema(m[KEY_PROPERTY_NAMES], newSchema) + if err != nil { + return err + } + } else { + return errors.New(formatErrorDescription( + Locale.InvalidType(), + ErrorDetails{ + "expected": STRING_SCHEMA, + "given": KEY_PATTERN_PROPERTIES, + }, + )) + } + } + // dependencies if existsMapKey(m, KEY_DEPENDENCIES) { err := d.parseDependencies(m[KEY_DEPENDENCIES], currentSchema) @@ -321,7 +409,7 @@ func (d *Schema) parseSchema(documentNode interface{}, currentSchema *subSchema) if existsMapKey(m, KEY_ITEMS) { if isKind(m[KEY_ITEMS], reflect.Slice) { for _, itemElement := range m[KEY_ITEMS].([]interface{}) { - if isKind(itemElement, reflect.Map) { + if isKind(itemElement, reflect.Map, reflect.Bool) { newSchema := &subSchema{parent: currentSchema, property: KEY_ITEMS} newSchema.ref = currentSchema.ref currentSchema.AddItemsChild(newSchema) @@ -340,7 +428,7 @@ func (d *Schema) parseSchema(documentNode interface{}, currentSchema *subSchema) } currentSchema.itemsChildrenIsSingleSchema = false } - } else if isKind(m[KEY_ITEMS], reflect.Map) { + } else if isKind(m[KEY_ITEMS], reflect.Map, reflect.Bool) { newSchema := &subSchema{parent: currentSchema, property: KEY_ITEMS} newSchema.ref = currentSchema.ref currentSchema.AddItemsChild(newSchema) @@ -395,7 +483,7 @@ func (d *Schema) parseSchema(documentNode interface{}, currentSchema *subSchema) }, )) } - if *multipleOfValue <= 0 { + if multipleOfValue.Cmp(big.NewFloat(0)) <= 0 { return errors.New(formatErrorDescription( Locale.GreaterThanZero(), ErrorDetails{"number": KEY_MULTIPLE_OF}, @@ -425,10 +513,15 @@ func (d *Schema) parseSchema(documentNode interface{}, currentSchema *subSchema) } exclusiveMinimumValue := m[KEY_EXCLUSIVE_MINIMUM].(bool) currentSchema.exclusiveMinimum = exclusiveMinimumValue + } else if isJsonNumber(m[KEY_EXCLUSIVE_MINIMUM]) { + minimumValue := mustBeNumber(m[KEY_EXCLUSIVE_MINIMUM]) + + currentSchema.minimum = minimumValue + currentSchema.exclusiveMinimum = true } else { return errors.New(formatErrorDescription( - Locale.MustBeOfA(), - ErrorDetails{"x": KEY_EXCLUSIVE_MINIMUM, "y": TYPE_BOOLEAN}, + Locale.InvalidType(), + ErrorDetails{"expected": TYPE_BOOLEAN + ", " + TYPE_NUMBER, "given": KEY_EXCLUSIVE_MINIMUM}, )) } } @@ -454,16 +547,21 @@ func (d *Schema) parseSchema(documentNode interface{}, currentSchema *subSchema) } exclusiveMaximumValue := m[KEY_EXCLUSIVE_MAXIMUM].(bool) currentSchema.exclusiveMaximum = exclusiveMaximumValue + } else if isJsonNumber(m[KEY_EXCLUSIVE_MAXIMUM]) { + maximumValue := mustBeNumber(m[KEY_EXCLUSIVE_MAXIMUM]) + + currentSchema.maximum = maximumValue + currentSchema.exclusiveMaximum = true } else { return errors.New(formatErrorDescription( - Locale.MustBeOfA(), - ErrorDetails{"x": KEY_EXCLUSIVE_MAXIMUM, "y": STRING_NUMBER}, + Locale.InvalidType(), + ErrorDetails{"expected": TYPE_BOOLEAN + ", " + TYPE_NUMBER, "given": KEY_EXCLUSIVE_MAXIMUM}, )) } } if currentSchema.minimum != nil && currentSchema.maximum != nil { - if *currentSchema.minimum > *currentSchema.maximum { + if currentSchema.minimum.Cmp(currentSchema.maximum) == 1 { return errors.New(formatErrorDescription( Locale.CannotBeGT(), ErrorDetails{"x": KEY_MINIMUM, "y": KEY_MAXIMUM}, @@ -538,11 +636,6 @@ func (d *Schema) parseSchema(documentNode interface{}, currentSchema *subSchema) formatString, ok := m[KEY_FORMAT].(string) if ok && FormatCheckers.Has(formatString) { currentSchema.format = formatString - } else { - return errors.New(formatErrorDescription( - Locale.MustBeValidFormat(), - ErrorDetails{"key": KEY_FORMAT, "given": m[KEY_FORMAT]}, - )) } } @@ -662,8 +755,24 @@ func (d *Schema) parseSchema(documentNode interface{}, currentSchema *subSchema) } } + if existsMapKey(m, KEY_CONTAINS) { + newSchema := &subSchema{property: KEY_CONTAINS, parent: currentSchema, ref: currentSchema.ref} + currentSchema.contains = newSchema + err := d.parseSchema(m[KEY_CONTAINS], newSchema) + if err != nil { + return err + } + } + // validation : all + if existsMapKey(m, KEY_CONST) { + err := currentSchema.AddConst(m[KEY_CONST]) + if err != nil { + return err + } + } + if existsMapKey(m, KEY_ENUM) { if isKind(m[KEY_ENUM], reflect.Slice) { for _, v := range m[KEY_ENUM].([]interface{}) { @@ -737,7 +846,7 @@ func (d *Schema) parseSchema(documentNode interface{}, currentSchema *subSchema) } if existsMapKey(m, KEY_NOT) { - if isKind(m[KEY_NOT], reflect.Map) { + if isKind(m[KEY_NOT], reflect.Map, reflect.Bool) { newSchema := &subSchema{property: KEY_NOT, parent: currentSchema, ref: currentSchema.ref} currentSchema.SetNot(newSchema) err := d.parseSchema(m[KEY_NOT], newSchema) @@ -752,71 +861,88 @@ func (d *Schema) parseSchema(documentNode interface{}, currentSchema *subSchema) } } - return nil -} - -func (d *Schema) parseReference(documentNode interface{}, currentSchema *subSchema, reference string) (e error) { - - var err error - - jsonReference, err := gojsonreference.NewJsonReference(reference) - if err != nil { - return err + if existsMapKey(m, KEY_IF) { + if isKind(m[KEY_IF], reflect.Map, reflect.Bool) { + newSchema := &subSchema{property: KEY_IF, parent: currentSchema, ref: currentSchema.ref} + currentSchema.SetIf(newSchema) + err := d.parseSchema(m[KEY_IF], newSchema) + if err != nil { + return err + } + } else { + return errors.New(formatErrorDescription( + Locale.MustBeOfAn(), + ErrorDetails{"x": KEY_IF, "y": TYPE_OBJECT}, + )) + } } - standaloneDocument := d.pool.GetStandaloneDocument() - - if jsonReference.HasFullUrl { - currentSchema.ref = &jsonReference - } else { - inheritedReference, err := currentSchema.ref.Inherits(jsonReference) - if err != nil { - return err + if existsMapKey(m, KEY_THEN) { + if isKind(m[KEY_THEN], reflect.Map, reflect.Bool) { + newSchema := &subSchema{property: KEY_THEN, parent: currentSchema, ref: currentSchema.ref} + currentSchema.SetThen(newSchema) + err := d.parseSchema(m[KEY_THEN], newSchema) + if err != nil { + return err + } + } else { + return errors.New(formatErrorDescription( + Locale.MustBeOfAn(), + ErrorDetails{"x": KEY_THEN, "y": TYPE_OBJECT}, + )) } - currentSchema.ref = inheritedReference } - jsonPointer := currentSchema.ref.GetPointer() + if existsMapKey(m, KEY_ELSE) { + if isKind(m[KEY_ELSE], reflect.Map, reflect.Bool) { + newSchema := &subSchema{property: KEY_ELSE, parent: currentSchema, ref: currentSchema.ref} + currentSchema.SetElse(newSchema) + err := d.parseSchema(m[KEY_ELSE], newSchema) + if err != nil { + return err + } + } else { + return errors.New(formatErrorDescription( + Locale.MustBeOfAn(), + ErrorDetails{"x": KEY_ELSE, "y": TYPE_OBJECT}, + )) + } + } - var refdDocumentNode interface{} + return nil +} - if standaloneDocument != nil { +func (d *Schema) parseReference(documentNode interface{}, currentSchema *subSchema) error { + var ( + refdDocumentNode interface{} + dsp *schemaPoolDocument + err error + ) - var err error - refdDocumentNode, _, err = jsonPointer.Get(standaloneDocument) - if err != nil { - return err - } + newSchema := &subSchema{property: KEY_REF, parent: currentSchema, ref: currentSchema.ref} - } else { + d.referencePool.Add(currentSchema.ref.String(), newSchema) - var err error - dsp, err := d.pool.GetDocument(*currentSchema.ref) - if err != nil { - return err - } + dsp, err = d.pool.GetDocument(*currentSchema.ref) + if err != nil { + return err + } + newSchema.id = currentSchema.ref - refdDocumentNode, _, err = jsonPointer.Get(dsp.Document) - if err != nil { - return err - } + refdDocumentNode = dsp.Document + if err != nil { + return err } - if !isKind(refdDocumentNode, reflect.Map) { + if !isKind(refdDocumentNode, reflect.Map, reflect.Bool) { return errors.New(formatErrorDescription( Locale.MustBeOfType(), ErrorDetails{"key": STRING_SCHEMA, "type": TYPE_OBJECT}, )) } - // returns the loaded referenced subSchema for the caller to update its current subSchema - newSchemaDocument := refdDocumentNode.(map[string]interface{}) - - newSchema := &subSchema{property: KEY_REF, parent: currentSchema, ref: currentSchema.ref} - d.referencePool.Add(currentSchema.ref.String()+reference, newSchema) - - err = d.parseSchema(newSchemaDocument, newSchema) + err = d.parseSchema(refdDocumentNode, newSchema) if err != nil { return err } @@ -884,7 +1010,7 @@ func (d *Schema) parseDependencies(documentNode interface{}, currentSchema *subS currentSchema.dependencies[k] = valuesToRegister } - case reflect.Map: + case reflect.Map, reflect.Bool: depSchema := &subSchema{property: k, parent: currentSchema, ref: currentSchema.ref} err := d.parseSchema(m[k], depSchema) if err != nil { diff --git a/vendor/github.com/xeipuuv/gojsonschema/schemaPool.go b/vendor/github.com/xeipuuv/gojsonschema/schemaPool.go index 79fbb60c..65c91e45 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/schemaPool.go +++ b/vendor/github.com/xeipuuv/gojsonschema/schemaPool.go @@ -28,6 +28,7 @@ package gojsonschema import ( "errors" + "reflect" "github.com/xeipuuv/gojsonreference" ) @@ -38,70 +39,154 @@ type schemaPoolDocument struct { type schemaPool struct { schemaPoolDocuments map[string]*schemaPoolDocument - standaloneDocument interface{} + jsonLoaderFactory JSONLoaderFactory } -func newSchemaPool() *schemaPool { +func newSchemaPool(f JSONLoaderFactory) *schemaPool { p := &schemaPool{} p.schemaPoolDocuments = make(map[string]*schemaPoolDocument) - p.standaloneDocument = nil + p.jsonLoaderFactory = f return p } -func (p *schemaPool) SetStandaloneDocument(document interface{}) { - p.standaloneDocument = document +func (p *schemaPool) ParseReferences(document interface{}, ref gojsonreference.JsonReference) { + // Only the root document should be added to the schema pool + p.schemaPoolDocuments[ref.String()] = &schemaPoolDocument{Document: document} + p.parseReferencesRecursive(document, ref) } -func (p *schemaPool) GetStandaloneDocument() (document interface{}) { - return p.standaloneDocument +func (p *schemaPool) parseReferencesRecursive(document interface{}, ref gojsonreference.JsonReference) { + // parseReferencesRecursive parses a JSON document and resolves all $id and $ref references. + // For $ref references it takes into account the $id scope it is in and replaces + // the reference by the absolute resolved reference + + // When encountering errors it fails silently. Error handling is done when the schema + // is syntactically parsed and any error encountered here should also come up there. + switch m := document.(type) { + case []interface{}: + for _, v := range m { + p.parseReferencesRecursive(v, ref) + } + case map[string]interface{}: + localRef := &ref + + keyID := KEY_ID_NEW + if existsMapKey(m, KEY_ID) { + keyID = KEY_ID + } + if existsMapKey(m, keyID) && isKind(m[keyID], reflect.String) { + jsonReference, err := gojsonreference.NewJsonReference(m[keyID].(string)) + if err == nil { + localRef, err = ref.Inherits(jsonReference) + if err == nil { + p.schemaPoolDocuments[localRef.String()] = &schemaPoolDocument{Document: document} + } + } + } + + if existsMapKey(m, KEY_REF) && isKind(m[KEY_REF], reflect.String) { + jsonReference, err := gojsonreference.NewJsonReference(m[KEY_REF].(string)) + if err == nil { + absoluteRef, err := localRef.Inherits(jsonReference) + if err == nil { + m[KEY_REF] = absoluteRef.String() + } + } + } + + for k, v := range m { + // const and enums should be interpreted literally, so ignore them + if k == KEY_CONST || k == KEY_ENUM { + continue + } + // Something like a property or a dependency is not a valid schema, as it might describe properties named "$ref", "$id" or "const", etc + // Therefore don't treat it like a schema. + if k == KEY_PROPERTIES || k == KEY_DEPENDENCIES || k == KEY_PATTERN_PROPERTIES { + if child, ok := v.(map[string]interface{}); ok { + for _, v := range child { + p.parseReferencesRecursive(v, *localRef) + } + } + } else { + p.parseReferencesRecursive(v, *localRef) + } + } + } } func (p *schemaPool) GetDocument(reference gojsonreference.JsonReference) (*schemaPoolDocument, error) { + var ( + spd *schemaPoolDocument + ok bool + err error + ) + if internalLogEnabled { internalLog("Get Document ( %s )", reference.String()) } - var err error + // Create a deep copy, so we can remove the fragment part later on without altering the original + refToUrl, _ := gojsonreference.NewJsonReference(reference.String()) - // It is not possible to load anything that is not canonical... - if !reference.IsCanonical() { - return nil, errors.New(formatErrorDescription( - Locale.ReferenceMustBeCanonical(), - ErrorDetails{"reference": reference}, - )) + // First check if the given fragment is a location independent identifier + // http://json-schema.org/latest/json-schema-core.html#rfc.section.8.2.3 + + if spd, ok = p.schemaPoolDocuments[refToUrl.String()]; ok { + if internalLogEnabled { + internalLog(" From pool") + } + return spd, nil } - refToUrl := reference + // If the given reference is not a location independent identifier, + // strip the fragment and look for a document with it's base URI + refToUrl.GetUrl().Fragment = "" - var spd *schemaPoolDocument + if cachedSpd, ok := p.schemaPoolDocuments[refToUrl.String()]; ok { + document, _, err := reference.GetPointer().Get(cachedSpd.Document) - // Try to find the requested document in the pool - for k := range p.schemaPoolDocuments { - if k == refToUrl.String() { - spd = p.schemaPoolDocuments[k] + if err != nil { + return nil, err } - } - if spd != nil { if internalLogEnabled { internalLog(" From pool") } + + spd = &schemaPoolDocument{Document: document} + p.schemaPoolDocuments[reference.String()] = spd + return spd, nil } - jsonReferenceLoader := NewReferenceLoader(reference.String()) - document, err := jsonReferenceLoader.loadJSON() + // It is not possible to load anything remotely that is not canonical... + if !reference.IsCanonical() { + return nil, errors.New(formatErrorDescription( + Locale.ReferenceMustBeCanonical(), + ErrorDetails{"reference": reference.String()}, + )) + } + + jsonReferenceLoader := p.jsonLoaderFactory.New(reference.String()) + document, err := jsonReferenceLoader.LoadJSON() + if err != nil { return nil, err } - spd = &schemaPoolDocument{Document: document} - // add the document to the pool for potential later use - p.schemaPoolDocuments[refToUrl.String()] = spd + // add the whole document to the pool for potential re-use + p.ParseReferences(document, refToUrl) + + // resolve the potential fragment and also cache it + document, _, err = reference.GetPointer().Get(document) + + if err != nil { + return nil, err + } - return spd, nil + return &schemaPoolDocument{Document: document}, nil } diff --git a/vendor/github.com/xeipuuv/gojsonschema/schemaReferencePool.go b/vendor/github.com/xeipuuv/gojsonschema/schemaReferencePool.go index 294e36a7..6e5e1b5c 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/schemaReferencePool.go +++ b/vendor/github.com/xeipuuv/gojsonschema/schemaReferencePool.go @@ -62,6 +62,7 @@ func (p *schemaReferencePool) Add(ref string, sch *subSchema) { if internalLogEnabled { internalLog(fmt.Sprintf("Add Schema Reference %s to pool", ref)) } - - p.documents[ref] = sch + if _, ok := p.documents[ref]; !ok { + p.documents[ref] = sch + } } diff --git a/vendor/github.com/xeipuuv/gojsonschema/schemaType.go b/vendor/github.com/xeipuuv/gojsonschema/schemaType.go index e13a0fb0..36b447a2 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/schemaType.go +++ b/vendor/github.com/xeipuuv/gojsonschema/schemaType.go @@ -44,7 +44,7 @@ func (t *jsonSchemaType) IsTyped() bool { func (t *jsonSchemaType) Add(etype string) error { if !isStringInSlice(JSON_TYPES, etype) { - return errors.New(formatErrorDescription(Locale.NotAValidType(), ErrorDetails{"type": etype})) + return errors.New(formatErrorDescription(Locale.NotAValidType(), ErrorDetails{"given": "/" + etype + "/", "expected": JSON_TYPES})) } if t.Contains(etype) { diff --git a/vendor/github.com/xeipuuv/gojsonschema/subSchema.go b/vendor/github.com/xeipuuv/gojsonschema/subSchema.go index b249b7e5..ea792a11 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/subSchema.go +++ b/vendor/github.com/xeipuuv/gojsonschema/subSchema.go @@ -28,6 +28,7 @@ package gojsonschema import ( "errors" + "math/big" "regexp" "strings" @@ -35,8 +36,9 @@ import ( ) const ( - KEY_SCHEMA = "$subSchema" - KEY_ID = "$id" + KEY_SCHEMA = "$schema" + KEY_ID = "id" + KEY_ID_NEW = "$id" KEY_REF = "$ref" KEY_TITLE = "title" KEY_DESCRIPTION = "description" @@ -46,6 +48,7 @@ const ( KEY_PROPERTIES = "properties" KEY_PATTERN_PROPERTIES = "patternProperties" KEY_ADDITIONAL_PROPERTIES = "additionalProperties" + KEY_PROPERTY_NAMES = "propertyNames" KEY_DEFINITIONS = "definitions" KEY_MULTIPLE_OF = "multipleOf" KEY_MINIMUM = "minimum" @@ -63,17 +66,22 @@ const ( KEY_MIN_ITEMS = "minItems" KEY_MAX_ITEMS = "maxItems" KEY_UNIQUE_ITEMS = "uniqueItems" + KEY_CONTAINS = "contains" + KEY_CONST = "const" KEY_ENUM = "enum" KEY_ONE_OF = "oneOf" KEY_ANY_OF = "anyOf" KEY_ALL_OF = "allOf" KEY_NOT = "not" + KEY_IF = "if" + KEY_THEN = "then" + KEY_ELSE = "else" ) type subSchema struct { // basic subSchema meta properties - id *string + id *gojsonreference.JsonReference title *string description *string @@ -86,22 +94,18 @@ type subSchema struct { ref *gojsonreference.JsonReference // Schema referenced refSchema *subSchema - // Json reference - subSchema *gojsonreference.JsonReference // hierarchy parent *subSchema - definitions map[string]*subSchema - definitionsChildren []*subSchema itemsChildren []*subSchema itemsChildrenIsSingleSchema bool propertiesChildren []*subSchema // validation : number / integer - multipleOf *float64 - maximum *float64 + multipleOf *big.Float + maximum *big.Float exclusiveMaximum bool - minimum *float64 + minimum *big.Float exclusiveMinimum bool // validation : string @@ -118,27 +122,43 @@ type subSchema struct { dependencies map[string]interface{} additionalProperties interface{} patternProperties map[string]*subSchema + propertyNames *subSchema // validation : array minItems *int maxItems *int uniqueItems bool + contains *subSchema additionalItems interface{} // validation : all - enum []string + _const *string //const is a golang keyword + enum []string // validation : subSchema oneOf []*subSchema anyOf []*subSchema allOf []*subSchema not *subSchema + _if *subSchema // if/else are golang keywords + _then *subSchema + _else *subSchema +} + +func (s *subSchema) AddConst(i interface{}) error { + + is, err := marshalWithoutNumber(i) + if err != nil { + return err + } + s._const = is + return nil } func (s *subSchema) AddEnum(i interface{}) error { - is, err := marshalToJsonString(i) + is, err := marshalWithoutNumber(i) if err != nil { return err } @@ -157,7 +177,7 @@ func (s *subSchema) AddEnum(i interface{}) error { func (s *subSchema) ContainsEnum(i interface{}) (bool, error) { - is, err := marshalToJsonString(i) + is, err := marshalWithoutNumber(i) if err != nil { return false, err } @@ -181,6 +201,18 @@ func (s *subSchema) SetNot(subSchema *subSchema) { s.not = subSchema } +func (s *subSchema) SetIf(subSchema *subSchema) { + s._if = subSchema +} + +func (s *subSchema) SetThen(subSchema *subSchema) { + s._then = subSchema +} + +func (s *subSchema) SetElse(subSchema *subSchema) { + s._else = subSchema +} + func (s *subSchema) AddRequired(value string) error { if isStringInSlice(s.required, value) { @@ -195,10 +227,6 @@ func (s *subSchema) AddRequired(value string) error { return nil } -func (s *subSchema) AddDefinitionChild(child *subSchema) { - s.definitionsChildren = append(s.definitionsChildren, child) -} - func (s *subSchema) AddItemsChild(child *subSchema) { s.itemsChildren = append(s.itemsChildren, child) } @@ -214,7 +242,7 @@ func (s *subSchema) PatternPropertiesString() string { } patternPropertiesKeySlice := []string{} - for pk, _ := range s.patternProperties { + for pk := range s.patternProperties { patternPropertiesKeySlice = append(patternPropertiesKeySlice, `"`+pk+`"`) } diff --git a/vendor/github.com/xeipuuv/gojsonschema/utils.go b/vendor/github.com/xeipuuv/gojsonschema/utils.go index cfeb628e..cc3100a7 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/utils.go +++ b/vendor/github.com/xeipuuv/gojsonschema/utils.go @@ -29,12 +29,23 @@ import ( "encoding/json" "fmt" "math" + "math/big" "reflect" - "strconv" ) -func isKind(what interface{}, kind reflect.Kind) bool { - return reflect.ValueOf(what).Kind() == kind +func isKind(what interface{}, kinds ...reflect.Kind) bool { + target := what + if isJsonNumber(what) { + // JSON Numbers are strings! + target = *mustBeNumber(what) + } + targetKind := reflect.ValueOf(target).Kind() + for _, kind := range kinds { + if targetKind == kind { + return true + } + } + return false } func existsMapKey(m map[string]interface{}, k string) bool { @@ -62,6 +73,28 @@ func marshalToJsonString(value interface{}) (*string, error) { return &sBytes, nil } +func marshalWithoutNumber(value interface{}) (*string, error) { + + // The JSON is decoded using https://golang.org/pkg/encoding/json/#Decoder.UseNumber + // This means the numbers are internally still represented as strings and therefore 1.00 is unequal to 1 + // One way to eliminate these differences is to decode and encode the JSON one more time without Decoder.UseNumber + // so that these differences in representation are removed + + jsonString, err := marshalToJsonString(value) + if err != nil { + return nil, err + } + + var document interface{} + + err = json.Unmarshal([]byte(*jsonString), &document) + if err != nil { + return nil, err + } + + return marshalToJsonString(document) +} + func isJsonNumber(what interface{}) bool { switch what.(type) { @@ -73,20 +106,13 @@ func isJsonNumber(what interface{}) bool { return false } -func checkJsonNumber(what interface{}) (isValidFloat64 bool, isValidInt64 bool, isValidInt32 bool) { +func checkJsonInteger(what interface{}) (isInt bool) { jsonNumber := what.(json.Number) - _, errFloat64 := jsonNumber.Float64() - _, errInt64 := jsonNumber.Int64() - - isValidFloat64 = errFloat64 == nil - isValidInt64 = errInt64 == nil - - _, errInt32 := strconv.ParseInt(jsonNumber.String(), 10, 32) - isValidInt32 = isValidInt64 && errInt32 == nil + bigFloat, isValidNumber := new(big.Float).SetString(string(jsonNumber)) - return + return isValidNumber && bigFloat.IsInt() } @@ -111,9 +137,9 @@ func mustBeInteger(what interface{}) *int { number := what.(json.Number) - _, _, isValidInt32 := checkJsonNumber(number) + isInt := checkJsonInteger(number) - if isValidInt32 { + if isInt { int64Value, err := number.Int64() if err != nil { @@ -132,15 +158,13 @@ func mustBeInteger(what interface{}) *int { return nil } -func mustBeNumber(what interface{}) *float64 { +func mustBeNumber(what interface{}) *big.Float { if isJsonNumber(what) { - number := what.(json.Number) - float64Value, err := number.Float64() - - if err == nil { - return &float64Value + float64Value, success := new(big.Float).SetString(string(number)) + if success { + return float64Value } else { return nil } diff --git a/vendor/github.com/xeipuuv/gojsonschema/validation.go b/vendor/github.com/xeipuuv/gojsonschema/validation.go index 2dc0df22..63786d5f 100644 --- a/vendor/github.com/xeipuuv/gojsonschema/validation.go +++ b/vendor/github.com/xeipuuv/gojsonschema/validation.go @@ -27,6 +27,7 @@ package gojsonschema import ( "encoding/json" + "math/big" "reflect" "regexp" "strconv" @@ -55,29 +56,32 @@ func (v *Schema) Validate(l JSONLoader) (*Result, error) { // load document - root, err := l.loadJSON() + root, err := l.LoadJSON() if err != nil { return nil, err } + return v.validateDocument(root), nil +} + +func (v *Schema) validateDocument(root interface{}) *Result { // begin validation result := &Result{} - context := newJsonContext(STRING_CONTEXT_ROOT, nil) + context := NewJsonContext(STRING_CONTEXT_ROOT, nil) v.rootSchema.validateRecursive(v.rootSchema, root, result, context) - return result, nil - + return result } -func (v *subSchema) subValidateWithContext(document interface{}, context *jsonContext) *Result { +func (v *subSchema) subValidateWithContext(document interface{}, context *JsonContext) *Result { result := &Result{} v.validateRecursive(v, document, result, context) return result } // Walker function to validate the json recursively against the subSchema -func (v *subSchema) validateRecursive(currentSubSchema *subSchema, currentNode interface{}, result *Result, context *jsonContext) { +func (v *subSchema) validateRecursive(currentSubSchema *subSchema, currentNode interface{}, result *Result, context *JsonContext) { if internalLogEnabled { internalLog("validateRecursive %s", context.String()) @@ -93,7 +97,7 @@ func (v *subSchema) validateRecursive(currentSubSchema *subSchema, currentNode i // Check for null value if currentNode == nil { if currentSubSchema.types.IsTyped() && !currentSubSchema.types.Contains(TYPE_NULL) { - result.addError( + result.addInternalError( new(InvalidTypeError), context, currentNode, @@ -114,18 +118,18 @@ func (v *subSchema) validateRecursive(currentSubSchema *subSchema, currentNode i value := currentNode.(json.Number) - _, isValidInt64, _ := checkJsonNumber(value) + isInt := checkJsonInteger(value) - validType := currentSubSchema.types.Contains(TYPE_NUMBER) || (isValidInt64 && currentSubSchema.types.Contains(TYPE_INTEGER)) + validType := currentSubSchema.types.Contains(TYPE_NUMBER) || (isInt && currentSubSchema.types.Contains(TYPE_INTEGER)) if currentSubSchema.types.IsTyped() && !validType { givenType := TYPE_INTEGER - if !isValidInt64 { + if !isInt { givenType = TYPE_NUMBER } - result.addError( + result.addInternalError( new(InvalidTypeError), context, currentNode, @@ -154,7 +158,7 @@ func (v *subSchema) validateRecursive(currentSubSchema *subSchema, currentNode i case reflect.Slice: if currentSubSchema.types.IsTyped() && !currentSubSchema.types.Contains(TYPE_ARRAY) { - result.addError( + result.addInternalError( new(InvalidTypeError), context, currentNode, @@ -177,7 +181,7 @@ func (v *subSchema) validateRecursive(currentSubSchema *subSchema, currentNode i case reflect.Map: if currentSubSchema.types.IsTyped() && !currentSubSchema.types.Contains(TYPE_OBJECT) { - result.addError( + result.addInternalError( new(InvalidTypeError), context, currentNode, @@ -202,7 +206,7 @@ func (v *subSchema) validateRecursive(currentSubSchema *subSchema, currentNode i for _, pSchema := range currentSubSchema.propertiesChildren { nextNode, ok := castCurrentNode[pSchema.property] if ok { - subContext := newJsonContext(pSchema.property, context) + subContext := NewJsonContext(pSchema.property, context) v.validateRecursive(pSchema, nextNode, result, subContext) } } @@ -212,7 +216,7 @@ func (v *subSchema) validateRecursive(currentSubSchema *subSchema, currentNode i case reflect.Bool: if currentSubSchema.types.IsTyped() && !currentSubSchema.types.Contains(TYPE_BOOLEAN) { - result.addError( + result.addInternalError( new(InvalidTypeError), context, currentNode, @@ -234,7 +238,7 @@ func (v *subSchema) validateRecursive(currentSubSchema *subSchema, currentNode i case reflect.String: if currentSubSchema.types.IsTyped() && !currentSubSchema.types.Contains(TYPE_STRING) { - result.addError( + result.addInternalError( new(InvalidTypeError), context, currentNode, @@ -263,7 +267,7 @@ func (v *subSchema) validateRecursive(currentSubSchema *subSchema, currentNode i } // Different kinds of validation there, subSchema / common / array / object / string... -func (v *subSchema) validateSchema(currentSubSchema *subSchema, currentNode interface{}, result *Result, context *jsonContext) { +func (v *subSchema) validateSchema(currentSubSchema *subSchema, currentNode interface{}, result *Result, context *JsonContext) { if internalLogEnabled { internalLog("validateSchema %s", context.String()) @@ -287,7 +291,7 @@ func (v *subSchema) validateSchema(currentSubSchema *subSchema, currentNode inte } if !validatedAnyOf { - result.addError(new(NumberAnyOfError), context, currentNode, ErrorDetails{}) + result.addInternalError(new(NumberAnyOfError), context, currentNode, ErrorDetails{}) if bestValidationResult != nil { // add error messages of closest matching subSchema as @@ -313,7 +317,7 @@ func (v *subSchema) validateSchema(currentSubSchema *subSchema, currentNode inte if nbValidated != 1 { - result.addError(new(NumberOneOfError), context, currentNode, ErrorDetails{}) + result.addInternalError(new(NumberOneOfError), context, currentNode, ErrorDetails{}) if nbValidated == 0 { // add error messages of closest matching subSchema as @@ -336,14 +340,14 @@ func (v *subSchema) validateSchema(currentSubSchema *subSchema, currentNode inte } if nbValidated != len(currentSubSchema.allOf) { - result.addError(new(NumberAllOfError), context, currentNode, ErrorDetails{}) + result.addInternalError(new(NumberAllOfError), context, currentNode, ErrorDetails{}) } } if currentSubSchema.not != nil { validationResult := currentSubSchema.not.subValidateWithContext(currentNode, context) if validationResult.Valid() { - result.addError(new(NumberNotError), context, currentNode, ErrorDetails{}) + result.addInternalError(new(NumberNotError), context, currentNode, ErrorDetails{}) } } @@ -356,7 +360,7 @@ func (v *subSchema) validateSchema(currentSubSchema *subSchema, currentNode inte case []string: for _, dependOnKey := range dependency { if _, dependencyResolved := currentNode.(map[string]interface{})[dependOnKey]; !dependencyResolved { - result.addError( + result.addInternalError( new(MissingDependencyError), context, currentNode, @@ -367,31 +371,65 @@ func (v *subSchema) validateSchema(currentSubSchema *subSchema, currentNode inte case *subSchema: dependency.validateRecursive(dependency, currentNode, result, context) - } } } } } + if currentSubSchema._if != nil { + validationResultIf := currentSubSchema._if.subValidateWithContext(currentNode, context) + if currentSubSchema._then != nil && validationResultIf.Valid() { + validationResultThen := currentSubSchema._then.subValidateWithContext(currentNode, context) + if !validationResultThen.Valid() { + result.addInternalError(new(ConditionThenError), context, currentNode, ErrorDetails{}) + result.mergeErrors(validationResultThen) + } + } + if currentSubSchema._else != nil && !validationResultIf.Valid() { + validationResultElse := currentSubSchema._else.subValidateWithContext(currentNode, context) + if !validationResultElse.Valid() { + result.addInternalError(new(ConditionElseError), context, currentNode, ErrorDetails{}) + result.mergeErrors(validationResultElse) + } + } + } + result.incrementScore() } -func (v *subSchema) validateCommon(currentSubSchema *subSchema, value interface{}, result *Result, context *jsonContext) { +func (v *subSchema) validateCommon(currentSubSchema *subSchema, value interface{}, result *Result, context *JsonContext) { if internalLogEnabled { internalLog("validateCommon %s", context.String()) internalLog(" %v", value) } + // const: + if currentSubSchema._const != nil { + vString, err := marshalWithoutNumber(value) + if err != nil { + result.addInternalError(new(InternalError), context, value, ErrorDetails{"error": err}) + } + if *vString != *currentSubSchema._const { + result.addInternalError(new(ConstError), + context, + value, + ErrorDetails{ + "allowed": *currentSubSchema._const, + }, + ) + } + } + // enum: if len(currentSubSchema.enum) > 0 { has, err := currentSubSchema.ContainsEnum(value) if err != nil { - result.addError(new(InternalError), context, value, ErrorDetails{"error": err}) + result.addInternalError(new(InternalError), context, value, ErrorDetails{"error": err}) } if !has { - result.addError( + result.addInternalError( new(EnumError), context, value, @@ -405,19 +443,19 @@ func (v *subSchema) validateCommon(currentSubSchema *subSchema, value interface{ result.incrementScore() } -func (v *subSchema) validateArray(currentSubSchema *subSchema, value []interface{}, result *Result, context *jsonContext) { +func (v *subSchema) validateArray(currentSubSchema *subSchema, value []interface{}, result *Result, context *JsonContext) { if internalLogEnabled { internalLog("validateArray %s", context.String()) internalLog(" %v", value) } - nbItems := len(value) + nbValues := len(value) // TODO explain if currentSubSchema.itemsChildrenIsSingleSchema { for i := range value { - subContext := newJsonContext(strconv.Itoa(i), context) + subContext := NewJsonContext(strconv.Itoa(i), context) validationResult := currentSubSchema.itemsChildren[0].subValidateWithContext(value[i], subContext) result.mergeErrors(validationResult) } @@ -425,24 +463,27 @@ func (v *subSchema) validateArray(currentSubSchema *subSchema, value []interface if currentSubSchema.itemsChildren != nil && len(currentSubSchema.itemsChildren) > 0 { nbItems := len(currentSubSchema.itemsChildren) - nbValues := len(value) - if nbItems == nbValues { - for i := 0; i != nbItems; i++ { - subContext := newJsonContext(strconv.Itoa(i), context) - validationResult := currentSubSchema.itemsChildren[i].subValidateWithContext(value[i], subContext) - result.mergeErrors(validationResult) - } - } else if nbItems < nbValues { + // while we have both schemas and values, check them against each other + for i := 0; i != nbItems && i != nbValues; i++ { + subContext := NewJsonContext(strconv.Itoa(i), context) + validationResult := currentSubSchema.itemsChildren[i].subValidateWithContext(value[i], subContext) + result.mergeErrors(validationResult) + } + + if nbItems < nbValues { + // we have less schemas than elements in the instance array, + // but that might be ok if "additionalItems" is specified. + switch currentSubSchema.additionalItems.(type) { case bool: if !currentSubSchema.additionalItems.(bool) { - result.addError(new(ArrayNoAdditionalItemsError), context, value, ErrorDetails{}) + result.addInternalError(new(ArrayNoAdditionalItemsError), context, value, ErrorDetails{}) } case *subSchema: additionalItemSchema := currentSubSchema.additionalItems.(*subSchema) for i := nbItems; i != nbValues; i++ { - subContext := newJsonContext(strconv.Itoa(i), context) + subContext := NewJsonContext(strconv.Itoa(i), context) validationResult := additionalItemSchema.subValidateWithContext(value[i], subContext) result.mergeErrors(validationResult) } @@ -453,8 +494,8 @@ func (v *subSchema) validateArray(currentSubSchema *subSchema, value []interface // minItems & maxItems if currentSubSchema.minItems != nil { - if nbItems < int(*currentSubSchema.minItems) { - result.addError( + if nbValues < int(*currentSubSchema.minItems) { + result.addInternalError( new(ArrayMinItemsError), context, value, @@ -463,8 +504,8 @@ func (v *subSchema) validateArray(currentSubSchema *subSchema, value []interface } } if currentSubSchema.maxItems != nil { - if nbItems > int(*currentSubSchema.maxItems) { - result.addError( + if nbValues > int(*currentSubSchema.maxItems) { + result.addInternalError( new(ArrayMaxItemsError), context, value, @@ -477,12 +518,12 @@ func (v *subSchema) validateArray(currentSubSchema *subSchema, value []interface if currentSubSchema.uniqueItems { var stringifiedItems []string for _, v := range value { - vString, err := marshalToJsonString(v) + vString, err := marshalWithoutNumber(v) if err != nil { - result.addError(new(InternalError), context, value, ErrorDetails{"err": err}) + result.addInternalError(new(InternalError), context, value, ErrorDetails{"err": err}) } if isStringInSlice(stringifiedItems, *vString) { - result.addError( + result.addInternalError( new(ItemsMustBeUniqueError), context, value, @@ -493,10 +534,42 @@ func (v *subSchema) validateArray(currentSubSchema *subSchema, value []interface } } + // contains: + + if currentSubSchema.contains != nil { + validatedOne := false + var bestValidationResult *Result + + for i, v := range value { + subContext := NewJsonContext(strconv.Itoa(i), context) + + validationResult := currentSubSchema.contains.subValidateWithContext(v, subContext) + if validationResult.Valid() { + validatedOne = true + break + } else { + if bestValidationResult == nil || validationResult.score > bestValidationResult.score { + bestValidationResult = validationResult + } + } + } + if !validatedOne { + result.addInternalError( + new(ArrayContainsError), + context, + value, + ErrorDetails{}, + ) + if bestValidationResult != nil { + result.mergeErrors(bestValidationResult) + } + } + } + result.incrementScore() } -func (v *subSchema) validateObject(currentSubSchema *subSchema, value map[string]interface{}, result *Result, context *jsonContext) { +func (v *subSchema) validateObject(currentSubSchema *subSchema, value map[string]interface{}, result *Result, context *JsonContext) { if internalLogEnabled { internalLog("validateObject %s", context.String()) @@ -506,7 +579,7 @@ func (v *subSchema) validateObject(currentSubSchema *subSchema, value map[string // minProperties & maxProperties: if currentSubSchema.minProperties != nil { if len(value) < int(*currentSubSchema.minProperties) { - result.addError( + result.addInternalError( new(ArrayMinPropertiesError), context, value, @@ -516,7 +589,7 @@ func (v *subSchema) validateObject(currentSubSchema *subSchema, value map[string } if currentSubSchema.maxProperties != nil { if len(value) > int(*currentSubSchema.maxProperties) { - result.addError( + result.addInternalError( new(ArrayMaxPropertiesError), context, value, @@ -531,7 +604,7 @@ func (v *subSchema) validateObject(currentSubSchema *subSchema, value map[string if ok { result.incrementScore() } else { - result.addError( + result.addInternalError( new(RequiredError), context, value, @@ -562,10 +635,10 @@ func (v *subSchema) validateObject(currentSubSchema *subSchema, value map[string if found { if pp_has && !pp_match { - result.addError( + result.addInternalError( new(AdditionalPropertyNotAllowedError), context, - value, + value[pk], ErrorDetails{"property": pk}, ) } @@ -573,10 +646,10 @@ func (v *subSchema) validateObject(currentSubSchema *subSchema, value map[string } else { if !pp_has || !pp_match { - result.addError( + result.addInternalError( new(AdditionalPropertyNotAllowedError), context, - value, + value[pk], ErrorDetails{"property": pk}, ) } @@ -625,10 +698,10 @@ func (v *subSchema) validateObject(currentSubSchema *subSchema, value map[string if pp_has && !pp_match { - result.addError( + result.addInternalError( new(InvalidPropertyPatternError), context, - value, + value[pk], ErrorDetails{ "property": pk, "pattern": currentSubSchema.PatternPropertiesString(), @@ -639,10 +712,25 @@ func (v *subSchema) validateObject(currentSubSchema *subSchema, value map[string } } + // propertyNames: + if currentSubSchema.propertyNames != nil { + for pk := range value { + validationResult := currentSubSchema.propertyNames.subValidateWithContext(pk, context) + if !validationResult.Valid() { + result.addInternalError(new(InvalidPropertyNameError), + context, + value, ErrorDetails{ + "property": pk, + }) + result.mergeErrors(validationResult) + } + } + } + result.incrementScore() } -func (v *subSchema) validatePatternProperty(currentSubSchema *subSchema, key string, value interface{}, result *Result, context *jsonContext) (has bool, matched bool) { +func (v *subSchema) validatePatternProperty(currentSubSchema *subSchema, key string, value interface{}, result *Result, context *JsonContext) (has bool, matched bool) { if internalLogEnabled { internalLog("validatePatternProperty %s", context.String()) @@ -656,7 +744,7 @@ func (v *subSchema) validatePatternProperty(currentSubSchema *subSchema, key str for pk, pv := range currentSubSchema.patternProperties { if matches, _ := regexp.MatchString(pk, key); matches { has = true - subContext := newJsonContext(key, context) + subContext := NewJsonContext(key, context) validationResult := pv.subValidateWithContext(value, subContext) result.mergeErrors(validationResult) if validationResult.Valid() { @@ -674,7 +762,7 @@ func (v *subSchema) validatePatternProperty(currentSubSchema *subSchema, key str return has, true } -func (v *subSchema) validateString(currentSubSchema *subSchema, value interface{}, result *Result, context *jsonContext) { +func (v *subSchema) validateString(currentSubSchema *subSchema, value interface{}, result *Result, context *JsonContext) { // Ignore JSON numbers if isJsonNumber(value) { @@ -696,7 +784,7 @@ func (v *subSchema) validateString(currentSubSchema *subSchema, value interface{ // minLength & maxLength: if currentSubSchema.minLength != nil { if utf8.RuneCount([]byte(stringValue)) < int(*currentSubSchema.minLength) { - result.addError( + result.addInternalError( new(StringLengthGTEError), context, value, @@ -706,7 +794,7 @@ func (v *subSchema) validateString(currentSubSchema *subSchema, value interface{ } if currentSubSchema.maxLength != nil { if utf8.RuneCount([]byte(stringValue)) > int(*currentSubSchema.maxLength) { - result.addError( + result.addInternalError( new(StringLengthLTEError), context, value, @@ -718,7 +806,7 @@ func (v *subSchema) validateString(currentSubSchema *subSchema, value interface{ // pattern: if currentSubSchema.pattern != nil { if !currentSubSchema.pattern.MatchString(stringValue) { - result.addError( + result.addInternalError( new(DoesNotMatchPatternError), context, value, @@ -731,7 +819,7 @@ func (v *subSchema) validateString(currentSubSchema *subSchema, value interface{ // format if currentSubSchema.format != "" { if !FormatCheckers.IsFormat(currentSubSchema.format, stringValue) { - result.addError( + result.addInternalError( new(DoesNotMatchFormatError), context, value, @@ -743,7 +831,7 @@ func (v *subSchema) validateString(currentSubSchema *subSchema, value interface{ result.incrementScore() } -func (v *subSchema) validateNumber(currentSubSchema *subSchema, value interface{}, result *Result, context *jsonContext) { +func (v *subSchema) validateNumber(currentSubSchema *subSchema, value interface{}, result *Result, context *JsonContext) { // Ignore non numbers if !isJsonNumber(value) { @@ -756,17 +844,17 @@ func (v *subSchema) validateNumber(currentSubSchema *subSchema, value interface{ } number := value.(json.Number) - float64Value, _ := number.Float64() + float64Value, _ := new(big.Float).SetString(string(number)) // multipleOf: if currentSubSchema.multipleOf != nil { - if !isFloat64AnInteger(float64Value / *currentSubSchema.multipleOf) { - result.addError( + if q := new(big.Float).Quo(float64Value, currentSubSchema.multipleOf); !q.IsInt() { + result.addInternalError( new(MultipleOfError), context, resultErrorFormatJsonNumber(number), - ErrorDetails{"multiple": *currentSubSchema.multipleOf}, + ErrorDetails{"multiple": currentSubSchema.multipleOf}, ) } } @@ -774,24 +862,24 @@ func (v *subSchema) validateNumber(currentSubSchema *subSchema, value interface{ //maximum & exclusiveMaximum: if currentSubSchema.maximum != nil { if currentSubSchema.exclusiveMaximum { - if float64Value >= *currentSubSchema.maximum { - result.addError( + if float64Value.Cmp(currentSubSchema.maximum) >= 0 { + result.addInternalError( new(NumberLTError), context, resultErrorFormatJsonNumber(number), ErrorDetails{ - "max": resultErrorFormatNumber(*currentSubSchema.maximum), + "max": currentSubSchema.maximum, }, ) } } else { - if float64Value > *currentSubSchema.maximum { - result.addError( + if float64Value.Cmp(currentSubSchema.maximum) == 1 { + result.addInternalError( new(NumberLTEError), context, resultErrorFormatJsonNumber(number), ErrorDetails{ - "max": resultErrorFormatNumber(*currentSubSchema.maximum), + "max": currentSubSchema.maximum, }, ) } @@ -801,29 +889,42 @@ func (v *subSchema) validateNumber(currentSubSchema *subSchema, value interface{ //minimum & exclusiveMinimum: if currentSubSchema.minimum != nil { if currentSubSchema.exclusiveMinimum { - if float64Value <= *currentSubSchema.minimum { - result.addError( + if float64Value.Cmp(currentSubSchema.minimum) <= 0 { + // if float64Value <= *currentSubSchema.minimum { + result.addInternalError( new(NumberGTError), context, resultErrorFormatJsonNumber(number), ErrorDetails{ - "min": resultErrorFormatNumber(*currentSubSchema.minimum), + "min": currentSubSchema.minimum, }, ) } } else { - if float64Value < *currentSubSchema.minimum { - result.addError( + if float64Value.Cmp(currentSubSchema.minimum) == -1 { + result.addInternalError( new(NumberGTEError), context, resultErrorFormatJsonNumber(number), ErrorDetails{ - "min": resultErrorFormatNumber(*currentSubSchema.minimum), + "min": currentSubSchema.minimum, }, ) } } } + // format + if currentSubSchema.format != "" { + if !FormatCheckers.IsFormat(currentSubSchema.format, float64Value) { + result.addInternalError( + new(DoesNotMatchFormatError), + context, + value, + ErrorDetails{"format": currentSubSchema.format}, + ) + } + } + result.incrementScore() } diff --git a/vendor/go.opencensus.io/.gitignore b/vendor/go.opencensus.io/.gitignore new file mode 100644 index 00000000..74a6db47 --- /dev/null +++ b/vendor/go.opencensus.io/.gitignore @@ -0,0 +1,9 @@ +/.idea/ + +# go.opencensus.io/exporter/aws +/exporter/aws/ + +# Exclude vendor, use dep ensure after checkout: +/vendor/github.com/ +/vendor/golang.org/ +/vendor/google.golang.org/ diff --git a/vendor/go.opencensus.io/.travis.yml b/vendor/go.opencensus.io/.travis.yml new file mode 100644 index 00000000..bd6b66ee --- /dev/null +++ b/vendor/go.opencensus.io/.travis.yml @@ -0,0 +1,17 @@ +language: go + +go_import_path: go.opencensus.io + +go: + - 1.11.x + +env: + global: + GO111MODULE=on + +before_script: + - make install-tools + +script: + - make travis-ci + - go run internal/check/version.go # TODO move this to makefile diff --git a/vendor/go.opencensus.io/AUTHORS b/vendor/go.opencensus.io/AUTHORS new file mode 100644 index 00000000..e491a9e7 --- /dev/null +++ b/vendor/go.opencensus.io/AUTHORS @@ -0,0 +1 @@ +Google Inc. diff --git a/vendor/go.opencensus.io/CONTRIBUTING.md b/vendor/go.opencensus.io/CONTRIBUTING.md new file mode 100644 index 00000000..1ba3962c --- /dev/null +++ b/vendor/go.opencensus.io/CONTRIBUTING.md @@ -0,0 +1,63 @@ +# How to contribute + +We'd love to accept your patches and contributions to this project. There are +just a few small guidelines you need to follow. + +## Contributor License Agreement + +Contributions to this project must be accompanied by a Contributor License +Agreement. You (or your employer) retain the copyright to your contribution, +this simply gives us permission to use and redistribute your contributions as +part of the project. Head over to to see +your current agreements on file or to sign a new one. + +You generally only need to submit a CLA once, so if you've already submitted one +(even if it was for a different project), you probably don't need to do it +again. + +## Code reviews + +All submissions, including submissions by project members, require review. We +use GitHub pull requests for this purpose. Consult [GitHub Help] for more +information on using pull requests. + +[GitHub Help]: https://help.github.com/articles/about-pull-requests/ + +## Instructions + +Fork the repo, checkout the upstream repo to your GOPATH by: + +``` +$ go get -d go.opencensus.io +``` + +Add your fork as an origin: + +``` +cd $(go env GOPATH)/src/go.opencensus.io +git remote add fork git@github.com:YOUR_GITHUB_USERNAME/opencensus-go.git +``` + +Run tests: + +``` +$ make install-tools # Only first time. +$ make +``` + +Checkout a new branch, make modifications and push the branch to your fork: + +``` +$ git checkout -b feature +# edit files +$ git commit +$ git push fork feature +``` + +Open a pull request against the main opencensus-go repo. + +## General Notes +This project uses Appveyor and Travis for CI. + +The dependencies are managed with `go mod` if you work with the sources under your +`$GOPATH` you need to set the environment variable `GO111MODULE=on`. \ No newline at end of file diff --git a/vendor/go.opencensus.io/Gopkg.lock b/vendor/go.opencensus.io/Gopkg.lock new file mode 100644 index 00000000..3be12ac8 --- /dev/null +++ b/vendor/go.opencensus.io/Gopkg.lock @@ -0,0 +1,231 @@ +# This file is autogenerated, do not edit; changes may be undone by the next 'dep ensure'. + + +[[projects]] + branch = "master" + digest = "1:eee9386329f4fcdf8d6c0def0c9771b634bdd5ba460d888aa98c17d59b37a76c" + name = "git.apache.org/thrift.git" + packages = ["lib/go/thrift"] + pruneopts = "UT" + revision = "6e67faa92827ece022380b211c2caaadd6145bf5" + source = "github.com/apache/thrift" + +[[projects]] + branch = "master" + digest = "1:d6afaeed1502aa28e80a4ed0981d570ad91b2579193404256ce672ed0a609e0d" + name = "github.com/beorn7/perks" + packages = ["quantile"] + pruneopts = "UT" + revision = "3a771d992973f24aa725d07868b467d1ddfceafb" + +[[projects]] + digest = "1:4c0989ca0bcd10799064318923b9bc2db6b4d6338dd75f3f2d86c3511aaaf5cf" + name = "github.com/golang/protobuf" + packages = [ + "proto", + "ptypes", + "ptypes/any", + "ptypes/duration", + "ptypes/timestamp", + ] + pruneopts = "UT" + revision = "aa810b61a9c79d51363740d207bb46cf8e620ed5" + version = "v1.2.0" + +[[projects]] + digest = "1:ff5ebae34cfbf047d505ee150de27e60570e8c394b3b8fdbb720ff6ac71985fc" + name = "github.com/matttproud/golang_protobuf_extensions" + packages = ["pbutil"] + pruneopts = "UT" + revision = "c12348ce28de40eed0136aa2b644d0ee0650e56c" + version = "v1.0.1" + +[[projects]] + digest = "1:824c8f3aa4c5f23928fa84ebbd5ed2e9443b3f0cb958a40c1f2fbed5cf5e64b1" + name = "github.com/openzipkin/zipkin-go" + packages = [ + ".", + "idgenerator", + "model", + "propagation", + "reporter", + "reporter/http", + ] + pruneopts = "UT" + revision = "d455a5674050831c1e187644faa4046d653433c2" + version = "v0.1.1" + +[[projects]] + digest = "1:d14a5f4bfecf017cb780bdde1b6483e5deb87e12c332544d2c430eda58734bcb" + name = "github.com/prometheus/client_golang" + packages = [ + "prometheus", + "prometheus/promhttp", + ] + pruneopts = "UT" + revision = "c5b7fccd204277076155f10851dad72b76a49317" + version = "v0.8.0" + +[[projects]] + branch = "master" + digest = "1:2d5cd61daa5565187e1d96bae64dbbc6080dacf741448e9629c64fd93203b0d4" + name = "github.com/prometheus/client_model" + packages = ["go"] + pruneopts = "UT" + revision = "5c3871d89910bfb32f5fcab2aa4b9ec68e65a99f" + +[[projects]] + branch = "master" + digest = "1:63b68062b8968092eb86bedc4e68894bd096ea6b24920faca8b9dcf451f54bb5" + name = "github.com/prometheus/common" + packages = [ + "expfmt", + "internal/bitbucket.org/ww/goautoneg", + "model", + ] + pruneopts = "UT" + revision = "c7de2306084e37d54b8be01f3541a8464345e9a5" + +[[projects]] + branch = "master" + digest = "1:8c49953a1414305f2ff5465147ee576dd705487c35b15918fcd4efdc0cb7a290" + name = "github.com/prometheus/procfs" + packages = [ + ".", + "internal/util", + "nfs", + "xfs", + ] + pruneopts = "UT" + revision = "05ee40e3a273f7245e8777337fc7b46e533a9a92" + +[[projects]] + branch = "master" + digest = "1:deafe4ab271911fec7de5b693d7faae3f38796d9eb8622e2b9e7df42bb3dfea9" + name = "golang.org/x/net" + packages = [ + "context", + "http/httpguts", + "http2", + "http2/hpack", + "idna", + "internal/timeseries", + "trace", + ] + pruneopts = "UT" + revision = "922f4815f713f213882e8ef45e0d315b164d705c" + +[[projects]] + branch = "master" + digest = "1:e0140c0c868c6e0f01c0380865194592c011fe521d6e12d78bfd33e756fe018a" + name = "golang.org/x/sync" + packages = ["semaphore"] + pruneopts = "UT" + revision = "1d60e4601c6fd243af51cc01ddf169918a5407ca" + +[[projects]] + branch = "master" + digest = "1:a3f00ac457c955fe86a41e1495e8f4c54cb5399d609374c5cc26aa7d72e542c8" + name = "golang.org/x/sys" + packages = ["unix"] + pruneopts = "UT" + revision = "3b58ed4ad3395d483fc92d5d14123ce2c3581fec" + +[[projects]] + digest = "1:a2ab62866c75542dd18d2b069fec854577a20211d7c0ea6ae746072a1dccdd18" + name = "golang.org/x/text" + packages = [ + "collate", + "collate/build", + "internal/colltab", + "internal/gen", + "internal/tag", + "internal/triegen", + "internal/ucd", + "language", + "secure/bidirule", + "transform", + "unicode/bidi", + "unicode/cldr", + "unicode/norm", + "unicode/rangetable", + ] + pruneopts = "UT" + revision = "f21a4dfb5e38f5895301dc265a8def02365cc3d0" + version = "v0.3.0" + +[[projects]] + branch = "master" + digest = "1:c0c17c94fe8bc1ab34e7f586a4a8b788c5e1f4f9f750ff23395b8b2f5a523530" + name = "google.golang.org/api" + packages = ["support/bundler"] + pruneopts = "UT" + revision = "e21acd801f91da814261b938941d193bb036441a" + +[[projects]] + branch = "master" + digest = "1:077c1c599507b3b3e9156d17d36e1e61928ee9b53a5b420f10f28ebd4a0b275c" + name = "google.golang.org/genproto" + packages = ["googleapis/rpc/status"] + pruneopts = "UT" + revision = "c66870c02cf823ceb633bcd05be3c7cda29976f4" + +[[projects]] + digest = "1:3dd7996ce6bf52dec6a2f69fa43e7c4cefea1d4dfa3c8ab7a5f8a9f7434e239d" + name = "google.golang.org/grpc" + packages = [ + ".", + "balancer", + "balancer/base", + "balancer/roundrobin", + "codes", + "connectivity", + "credentials", + "encoding", + "encoding/proto", + "grpclog", + "internal", + "internal/backoff", + "internal/channelz", + "internal/envconfig", + "internal/grpcrand", + "internal/transport", + "keepalive", + "metadata", + "naming", + "peer", + "resolver", + "resolver/dns", + "resolver/passthrough", + "stats", + "status", + "tap", + ] + pruneopts = "UT" + revision = "32fb0ac620c32ba40a4626ddf94d90d12cce3455" + version = "v1.14.0" + +[solve-meta] + analyzer-name = "dep" + analyzer-version = 1 + input-imports = [ + "git.apache.org/thrift.git/lib/go/thrift", + "github.com/golang/protobuf/proto", + "github.com/openzipkin/zipkin-go", + "github.com/openzipkin/zipkin-go/model", + "github.com/openzipkin/zipkin-go/reporter", + "github.com/openzipkin/zipkin-go/reporter/http", + "github.com/prometheus/client_golang/prometheus", + "github.com/prometheus/client_golang/prometheus/promhttp", + "golang.org/x/net/context", + "golang.org/x/net/http2", + "google.golang.org/api/support/bundler", + "google.golang.org/grpc", + "google.golang.org/grpc/codes", + "google.golang.org/grpc/grpclog", + "google.golang.org/grpc/metadata", + "google.golang.org/grpc/stats", + "google.golang.org/grpc/status", + ] + solver-name = "gps-cdcl" + solver-version = 1 diff --git a/vendor/go.opencensus.io/Gopkg.toml b/vendor/go.opencensus.io/Gopkg.toml new file mode 100644 index 00000000..a9f3cd68 --- /dev/null +++ b/vendor/go.opencensus.io/Gopkg.toml @@ -0,0 +1,36 @@ +# For v0.x.y dependencies, prefer adding a constraints of the form: version=">= 0.x.y" +# to avoid locking to a particular minor version which can cause dep to not be +# able to find a satisfying dependency graph. + +[[constraint]] + branch = "master" + name = "git.apache.org/thrift.git" + source = "github.com/apache/thrift" + +[[constraint]] + name = "github.com/golang/protobuf" + version = "1.0.0" + +[[constraint]] + name = "github.com/openzipkin/zipkin-go" + version = ">=0.1.0" + +[[constraint]] + name = "github.com/prometheus/client_golang" + version = ">=0.8.0" + +[[constraint]] + branch = "master" + name = "golang.org/x/net" + +[[constraint]] + branch = "master" + name = "google.golang.org/api" + +[[constraint]] + name = "google.golang.org/grpc" + version = "1.11.3" + +[prune] + go-tests = true + unused-packages = true diff --git a/vendor/go.opencensus.io/LICENSE b/vendor/go.opencensus.io/LICENSE new file mode 100644 index 00000000..7a4a3ea2 --- /dev/null +++ b/vendor/go.opencensus.io/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. \ No newline at end of file diff --git a/vendor/go.opencensus.io/Makefile b/vendor/go.opencensus.io/Makefile new file mode 100644 index 00000000..457866cb --- /dev/null +++ b/vendor/go.opencensus.io/Makefile @@ -0,0 +1,96 @@ +# TODO: Fix this on windows. +ALL_SRC := $(shell find . -name '*.go' \ + -not -path './vendor/*' \ + -not -path '*/gen-go/*' \ + -type f | sort) +ALL_PKGS := $(shell go list $(sort $(dir $(ALL_SRC)))) + +GOTEST_OPT?=-v -race -timeout 30s +GOTEST_OPT_WITH_COVERAGE = $(GOTEST_OPT) -coverprofile=coverage.txt -covermode=atomic +GOTEST=go test +GOFMT=gofmt +GOLINT=golint +GOVET=go vet +EMBEDMD=embedmd +# TODO decide if we need to change these names. +TRACE_ID_LINT_EXCEPTION="type name will be used as trace.TraceID by other packages" +TRACE_OPTION_LINT_EXCEPTION="type name will be used as trace.TraceOptions by other packages" +README_FILES := $(shell find . -name '*README.md' | sort | tr '\n' ' ') + +.DEFAULT_GOAL := fmt-lint-vet-embedmd-test + +.PHONY: fmt-lint-vet-embedmd-test +fmt-lint-vet-embedmd-test: fmt lint vet embedmd test + +# TODO enable test-with-coverage in tavis +.PHONY: travis-ci +travis-ci: fmt lint vet embedmd test test-386 + +all-pkgs: + @echo $(ALL_PKGS) | tr ' ' '\n' | sort + +all-srcs: + @echo $(ALL_SRC) | tr ' ' '\n' | sort + +.PHONY: test +test: + $(GOTEST) $(GOTEST_OPT) $(ALL_PKGS) + +.PHONY: test-386 +test-386: + GOARCH=386 $(GOTEST) -v -timeout 30s $(ALL_PKGS) + +.PHONY: test-with-coverage +test-with-coverage: + $(GOTEST) $(GOTEST_OPT_WITH_COVERAGE) $(ALL_PKGS) + +.PHONY: fmt +fmt: + @FMTOUT=`$(GOFMT) -s -l $(ALL_SRC) 2>&1`; \ + if [ "$$FMTOUT" ]; then \ + echo "$(GOFMT) FAILED => gofmt the following files:\n"; \ + echo "$$FMTOUT\n"; \ + exit 1; \ + else \ + echo "Fmt finished successfully"; \ + fi + +.PHONY: lint +lint: + @LINTOUT=`$(GOLINT) $(ALL_PKGS) | grep -v $(TRACE_ID_LINT_EXCEPTION) | grep -v $(TRACE_OPTION_LINT_EXCEPTION) 2>&1`; \ + if [ "$$LINTOUT" ]; then \ + echo "$(GOLINT) FAILED => clean the following lint errors:\n"; \ + echo "$$LINTOUT\n"; \ + exit 1; \ + else \ + echo "Lint finished successfully"; \ + fi + +.PHONY: vet +vet: + # TODO: Understand why go vet downloads "github.com/google/go-cmp v0.2.0" + @VETOUT=`$(GOVET) ./... | grep -v "go: downloading" 2>&1`; \ + if [ "$$VETOUT" ]; then \ + echo "$(GOVET) FAILED => go vet the following files:\n"; \ + echo "$$VETOUT\n"; \ + exit 1; \ + else \ + echo "Vet finished successfully"; \ + fi + +.PHONY: embedmd +embedmd: + @EMBEDMDOUT=`$(EMBEDMD) -d $(README_FILES) 2>&1`; \ + if [ "$$EMBEDMDOUT" ]; then \ + echo "$(EMBEDMD) FAILED => embedmd the following files:\n"; \ + echo "$$EMBEDMDOUT\n"; \ + exit 1; \ + else \ + echo "Embedmd finished successfully"; \ + fi + +.PHONY: install-tools +install-tools: + go get -u golang.org/x/tools/cmd/cover + go get -u golang.org/x/lint/golint + go get -u github.com/rakyll/embedmd diff --git a/vendor/go.opencensus.io/README.md b/vendor/go.opencensus.io/README.md new file mode 100644 index 00000000..fabab2e0 --- /dev/null +++ b/vendor/go.opencensus.io/README.md @@ -0,0 +1,263 @@ +# OpenCensus Libraries for Go + +[![Build Status][travis-image]][travis-url] +[![Windows Build Status][appveyor-image]][appveyor-url] +[![GoDoc][godoc-image]][godoc-url] +[![Gitter chat][gitter-image]][gitter-url] + +OpenCensus Go is a Go implementation of OpenCensus, a toolkit for +collecting application performance and behavior monitoring data. +Currently it consists of three major components: tags, stats and tracing. + +## Installation + +``` +$ go get -u go.opencensus.io +``` + +The API of this project is still evolving, see: [Deprecation Policy](#deprecation-policy). +The use of vendoring or a dependency management tool is recommended. + +## Prerequisites + +OpenCensus Go libraries require Go 1.8 or later. + +## Getting Started + +The easiest way to get started using OpenCensus in your application is to use an existing +integration with your RPC framework: + +* [net/http](https://godoc.org/go.opencensus.io/plugin/ochttp) +* [gRPC](https://godoc.org/go.opencensus.io/plugin/ocgrpc) +* [database/sql](https://godoc.org/github.com/opencensus-integrations/ocsql) +* [Go kit](https://godoc.org/github.com/go-kit/kit/tracing/opencensus) +* [Groupcache](https://godoc.org/github.com/orijtech/groupcache) +* [Caddy webserver](https://godoc.org/github.com/orijtech/caddy) +* [MongoDB](https://godoc.org/github.com/orijtech/mongo-go-driver) +* [Redis gomodule/redigo](https://godoc.org/github.com/orijtech/redigo) +* [Redis goredis/redis](https://godoc.org/github.com/orijtech/redis) +* [Memcache](https://godoc.org/github.com/orijtech/gomemcache) + +If you're using a framework not listed here, you could either implement your own middleware for your +framework or use [custom stats](#stats) and [spans](#spans) directly in your application. + +## Exporters + +OpenCensus can export instrumentation data to various backends. +OpenCensus has exporter implementations for the following, users +can implement their own exporters by implementing the exporter interfaces +([stats](https://godoc.org/go.opencensus.io/stats/view#Exporter), +[trace](https://godoc.org/go.opencensus.io/trace#Exporter)): + +* [Prometheus][exporter-prom] for stats +* [OpenZipkin][exporter-zipkin] for traces +* [Stackdriver][exporter-stackdriver] Monitoring for stats and Trace for traces +* [Jaeger][exporter-jaeger] for traces +* [AWS X-Ray][exporter-xray] for traces +* [Datadog][exporter-datadog] for stats and traces +* [Graphite][exporter-graphite] for stats +* [Honeycomb][exporter-honeycomb] for traces + +## Overview + +![OpenCensus Overview](https://i.imgur.com/cf4ElHE.jpg) + +In a microservices environment, a user request may go through +multiple services until there is a response. OpenCensus allows +you to instrument your services and collect diagnostics data all +through your services end-to-end. + +## Tags + +Tags represent propagated key-value pairs. They are propagated using `context.Context` +in the same process or can be encoded to be transmitted on the wire. Usually, this will +be handled by an integration plugin, e.g. `ocgrpc.ServerHandler` and `ocgrpc.ClientHandler` +for gRPC. + +Package `tag` allows adding or modifying tags in the current context. + +[embedmd]:# (internal/readme/tags.go new) +```go +ctx, err = tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Upsert(userIDKey, "cde36753ed"), +) +if err != nil { + log.Fatal(err) +} +``` + +## Stats + +OpenCensus is a low-overhead framework even if instrumentation is always enabled. +In order to be so, it is optimized to make recording of data points fast +and separate from the data aggregation. + +OpenCensus stats collection happens in two stages: + +* Definition of measures and recording of data points +* Definition of views and aggregation of the recorded data + +### Recording + +Measurements are data points associated with a measure. +Recording implicitly tags the set of Measurements with the tags from the +provided context: + +[embedmd]:# (internal/readme/stats.go record) +```go +stats.Record(ctx, videoSize.M(102478)) +``` + +### Views + +Views are how Measures are aggregated. You can think of them as queries over the +set of recorded data points (measurements). + +Views have two parts: the tags to group by and the aggregation type used. + +Currently three types of aggregations are supported: +* CountAggregation is used to count the number of times a sample was recorded. +* DistributionAggregation is used to provide a histogram of the values of the samples. +* SumAggregation is used to sum up all sample values. + +[embedmd]:# (internal/readme/stats.go aggs) +```go +distAgg := view.Distribution(1<<32, 2<<32, 3<<32) +countAgg := view.Count() +sumAgg := view.Sum() +``` + +Here we create a view with the DistributionAggregation over our measure. + +[embedmd]:# (internal/readme/stats.go view) +```go +if err := view.Register(&view.View{ + Name: "example.com/video_size_distribution", + Description: "distribution of processed video size over time", + Measure: videoSize, + Aggregation: view.Distribution(1<<32, 2<<32, 3<<32), +}); err != nil { + log.Fatalf("Failed to register view: %v", err) +} +``` + +Register begins collecting data for the view. Registered views' data will be +exported via the registered exporters. + +## Traces + +A distributed trace tracks the progression of a single user request as +it is handled by the services and processes that make up an application. +Each step is called a span in the trace. Spans include metadata about the step, +including especially the time spent in the step, called the span’s latency. + +Below you see a trace and several spans underneath it. + +![Traces and spans](https://i.imgur.com/7hZwRVj.png) + +### Spans + +Span is the unit step in a trace. Each span has a name, latency, status and +additional metadata. + +Below we are starting a span for a cache read and ending it +when we are done: + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +### Propagation + +Spans can have parents or can be root spans if they don't have any parents. +The current span is propagated in-process and across the network to allow associating +new child spans with the parent. + +In the same process, `context.Context` is used to propagate spans. +`trace.StartSpan` creates a new span as a root if the current context +doesn't contain a span. Or, it creates a child of the span that is +already in current context. The returned context can be used to keep +propagating the newly created span in the current context. + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +Across the network, OpenCensus provides different propagation +methods for different protocols. + +* gRPC integrations use the OpenCensus' [binary propagation format](https://godoc.org/go.opencensus.io/trace/propagation). +* HTTP integrations use Zipkin's [B3](https://github.com/openzipkin/b3-propagation) + by default but can be configured to use a custom propagation method by setting another + [propagation.HTTPFormat](https://godoc.org/go.opencensus.io/trace/propagation#HTTPFormat). + +## Execution Tracer + +With Go 1.11, OpenCensus Go will support integration with the Go execution tracer. +See [Debugging Latency in Go](https://medium.com/observability/debugging-latency-in-go-1-11-9f97a7910d68) +for an example of their mutual use. + +## Profiles + +OpenCensus tags can be applied as profiler labels +for users who are on Go 1.9 and above. + +[embedmd]:# (internal/readme/tags.go profiler) +```go +ctx, err = tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Insert(userIDKey, "fff0989878"), +) +if err != nil { + log.Fatal(err) +} +tag.Do(ctx, func(ctx context.Context) { + // Do work. + // When profiling is on, samples will be + // recorded with the key/values from the tag map. +}) +``` + +A screenshot of the CPU profile from the program above: + +![CPU profile](https://i.imgur.com/jBKjlkw.png) + +## Deprecation Policy + +Before version 1.0.0, the following deprecation policy will be observed: + +No backwards-incompatible changes will be made except for the removal of symbols that have +been marked as *Deprecated* for at least one minor release (e.g. 0.9.0 to 0.10.0). A release +removing the *Deprecated* functionality will be made no sooner than 28 days after the first +release in which the functionality was marked *Deprecated*. + +[travis-image]: https://travis-ci.org/census-instrumentation/opencensus-go.svg?branch=master +[travis-url]: https://travis-ci.org/census-instrumentation/opencensus-go +[appveyor-image]: https://ci.appveyor.com/api/projects/status/vgtt29ps1783ig38?svg=true +[appveyor-url]: https://ci.appveyor.com/project/opencensusgoteam/opencensus-go/branch/master +[godoc-image]: https://godoc.org/go.opencensus.io?status.svg +[godoc-url]: https://godoc.org/go.opencensus.io +[gitter-image]: https://badges.gitter.im/census-instrumentation/lobby.svg +[gitter-url]: https://gitter.im/census-instrumentation/lobby?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge + + +[new-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap +[new-replace-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap--Replace + +[exporter-prom]: https://godoc.org/contrib.go.opencensus.io/exporter/prometheus +[exporter-stackdriver]: https://godoc.org/contrib.go.opencensus.io/exporter/stackdriver +[exporter-zipkin]: https://godoc.org/contrib.go.opencensus.io/exporter/zipkin +[exporter-jaeger]: https://godoc.org/contrib.go.opencensus.io/exporter/jaeger +[exporter-xray]: https://github.com/census-ecosystem/opencensus-go-exporter-aws +[exporter-datadog]: https://github.com/DataDog/opencensus-go-exporter-datadog +[exporter-graphite]: https://github.com/census-ecosystem/opencensus-go-exporter-graphite +[exporter-honeycomb]: https://github.com/honeycombio/opencensus-exporter diff --git a/vendor/go.opencensus.io/appveyor.yml b/vendor/go.opencensus.io/appveyor.yml new file mode 100644 index 00000000..12bd7c4c --- /dev/null +++ b/vendor/go.opencensus.io/appveyor.yml @@ -0,0 +1,25 @@ +version: "{build}" + +platform: x64 + +clone_folder: c:\gopath\src\go.opencensus.io + +environment: + GOPATH: 'c:\gopath' + GOVERSION: '1.11' + GO111MODULE: 'on' + CGO_ENABLED: '0' # See: https://github.com/appveyor/ci/issues/2613 + +install: + - set PATH=%GOPATH%\bin;c:\go\bin;%PATH% + - choco upgrade golang --version 1.11.5 # Temporary fix because of a go.sum bug in 1.11 + - go version + - go env + +build: false +deploy: false + +test_script: + - cd %APPVEYOR_BUILD_FOLDER% + - go build -v .\... + - go test -v .\... # No -race because cgo is disabled diff --git a/vendor/go.opencensus.io/go.mod b/vendor/go.opencensus.io/go.mod new file mode 100644 index 00000000..cb4de80f --- /dev/null +++ b/vendor/go.opencensus.io/go.mod @@ -0,0 +1,12 @@ +module go.opencensus.io + +require ( + github.com/golang/protobuf v1.3.1 + github.com/google/go-cmp v0.3.0 + github.com/hashicorp/golang-lru v0.5.1 + golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 + golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd // indirect + golang.org/x/text v0.3.2 // indirect + google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb // indirect + google.golang.org/grpc v1.20.1 +) diff --git a/vendor/go.opencensus.io/go.sum b/vendor/go.opencensus.io/go.sum new file mode 100644 index 00000000..0b948c2b --- /dev/null +++ b/vendor/go.opencensus.io/go.sum @@ -0,0 +1,61 @@ +cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= +github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= +github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= +github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= +github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= +github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= +github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY= +github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= +github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= +github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= +golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= +golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= +golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= +golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= +golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= +golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo= +golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= +golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f h1:wMNYb4v58l5UBM7MYRLPG6ZhfOqbKu7X5eyFl8ZhKvA= +golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f h1:Bl/8QSvNqXvPGPGXa2z5xUTmV7VDcZyvRZ+QQXkXTZQ= +golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI= +golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a h1:1BGLXjeY4akVXGgbC9HugT3Jv3hCI0z56oJR5vAMgBU= +golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd h1:r7DufRZuZbWB7j439YfAzP8RPDa9unLkpwQKUYbIMPI= +golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= +golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= +golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= +golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= +golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= +google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= +google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= +google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= +google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= +google.golang.org/grpc v1.19.0 h1:cfg4PD8YEdSFnm7qLV4++93WcmhH2nIUhMjhdCvl3j8= +google.golang.org/grpc v1.19.0 h1:cfg4PD8YEdSFnm7qLV4++93WcmhH2nIUhMjhdCvl3j8= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= +google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU= +google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= +honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= diff --git a/vendor/go.opencensus.io/internal/internal.go b/vendor/go.opencensus.io/internal/internal.go new file mode 100644 index 00000000..9a638781 --- /dev/null +++ b/vendor/go.opencensus.io/internal/internal.go @@ -0,0 +1,37 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal // import "go.opencensus.io/internal" + +import ( + "fmt" + "time" + + opencensus "go.opencensus.io" +) + +// UserAgent is the user agent to be added to the outgoing +// requests from the exporters. +var UserAgent = fmt.Sprintf("opencensus-go/%s", opencensus.Version()) + +// MonotonicEndTime returns the end time at present +// but offset from start, monotonically. +// +// The monotonic clock is used in subtractions hence +// the duration since start added back to start gives +// end as a monotonic time. +// See https://golang.org/pkg/time/#hdr-Monotonic_Clocks +func MonotonicEndTime(start time.Time) time.Time { + return start.Add(time.Now().Sub(start)) +} diff --git a/vendor/go.opencensus.io/internal/sanitize.go b/vendor/go.opencensus.io/internal/sanitize.go new file mode 100644 index 00000000..de8ccf23 --- /dev/null +++ b/vendor/go.opencensus.io/internal/sanitize.go @@ -0,0 +1,50 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "strings" + "unicode" +) + +const labelKeySizeLimit = 100 + +// Sanitize returns a string that is trunacated to 100 characters if it's too +// long, and replaces non-alphanumeric characters to underscores. +func Sanitize(s string) string { + if len(s) == 0 { + return s + } + if len(s) > labelKeySizeLimit { + s = s[:labelKeySizeLimit] + } + s = strings.Map(sanitizeRune, s) + if unicode.IsDigit(rune(s[0])) { + s = "key_" + s + } + if s[0] == '_' { + s = "key" + s + } + return s +} + +// converts anything that is not a letter or digit to an underscore +func sanitizeRune(r rune) rune { + if unicode.IsLetter(r) || unicode.IsDigit(r) { + return r + } + // Everything else turns into an underscore + return '_' +} diff --git a/vendor/go.opencensus.io/internal/traceinternals.go b/vendor/go.opencensus.io/internal/traceinternals.go new file mode 100644 index 00000000..073af7b4 --- /dev/null +++ b/vendor/go.opencensus.io/internal/traceinternals.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "time" +) + +// Trace allows internal access to some trace functionality. +// TODO(#412): remove this +var Trace interface{} + +// LocalSpanStoreEnabled true if the local span store is enabled. +var LocalSpanStoreEnabled bool + +// BucketConfiguration stores the number of samples to store for span buckets +// for successful and failed spans for a particular span name. +type BucketConfiguration struct { + Name string + MaxRequestsSucceeded int + MaxRequestsErrors int +} + +// PerMethodSummary is a summary of the spans stored for a single span name. +type PerMethodSummary struct { + Active int + LatencyBuckets []LatencyBucketSummary + ErrorBuckets []ErrorBucketSummary +} + +// LatencyBucketSummary is a summary of a latency bucket. +type LatencyBucketSummary struct { + MinLatency, MaxLatency time.Duration + Size int +} + +// ErrorBucketSummary is a summary of an error bucket. +type ErrorBucketSummary struct { + ErrorCode int32 + Size int +} diff --git a/vendor/go.opencensus.io/opencensus.go b/vendor/go.opencensus.io/opencensus.go new file mode 100644 index 00000000..626d7364 --- /dev/null +++ b/vendor/go.opencensus.io/opencensus.go @@ -0,0 +1,21 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package opencensus contains Go support for OpenCensus. +package opencensus // import "go.opencensus.io" + +// Version is the current release version of OpenCensus in use. +func Version() string { + return "0.22.0" +} diff --git a/vendor/go.opencensus.io/trace/basetypes.go b/vendor/go.opencensus.io/trace/basetypes.go new file mode 100644 index 00000000..0c54492a --- /dev/null +++ b/vendor/go.opencensus.io/trace/basetypes.go @@ -0,0 +1,119 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "fmt" + "time" +) + +type ( + // TraceID is a 16-byte identifier for a set of spans. + TraceID [16]byte + + // SpanID is an 8-byte identifier for a single span. + SpanID [8]byte +) + +func (t TraceID) String() string { + return fmt.Sprintf("%02x", t[:]) +} + +func (s SpanID) String() string { + return fmt.Sprintf("%02x", s[:]) +} + +// Annotation represents a text annotation with a set of attributes and a timestamp. +type Annotation struct { + Time time.Time + Message string + Attributes map[string]interface{} +} + +// Attribute represents a key-value pair on a span, link or annotation. +// Construct with one of: BoolAttribute, Int64Attribute, or StringAttribute. +type Attribute struct { + key string + value interface{} +} + +// BoolAttribute returns a bool-valued attribute. +func BoolAttribute(key string, value bool) Attribute { + return Attribute{key: key, value: value} +} + +// Int64Attribute returns an int64-valued attribute. +func Int64Attribute(key string, value int64) Attribute { + return Attribute{key: key, value: value} +} + +// Float64Attribute returns a float64-valued attribute. +func Float64Attribute(key string, value float64) Attribute { + return Attribute{key: key, value: value} +} + +// StringAttribute returns a string-valued attribute. +func StringAttribute(key string, value string) Attribute { + return Attribute{key: key, value: value} +} + +// LinkType specifies the relationship between the span that had the link +// added, and the linked span. +type LinkType int32 + +// LinkType values. +const ( + LinkTypeUnspecified LinkType = iota // The relationship of the two spans is unknown. + LinkTypeChild // The linked span is a child of the current span. + LinkTypeParent // The linked span is the parent of the current span. +) + +// Link represents a reference from one span to another span. +type Link struct { + TraceID TraceID + SpanID SpanID + Type LinkType + // Attributes is a set of attributes on the link. + Attributes map[string]interface{} +} + +// MessageEventType specifies the type of message event. +type MessageEventType int32 + +// MessageEventType values. +const ( + MessageEventTypeUnspecified MessageEventType = iota // Unknown event type. + MessageEventTypeSent // Indicates a sent RPC message. + MessageEventTypeRecv // Indicates a received RPC message. +) + +// MessageEvent represents an event describing a message sent or received on the network. +type MessageEvent struct { + Time time.Time + EventType MessageEventType + MessageID int64 + UncompressedByteSize int64 + CompressedByteSize int64 +} + +// Status is the status of a Span. +type Status struct { + // Code is a status code. Zero indicates success. + // + // If Code will be propagated to Google APIs, it ideally should be a value from + // https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto . + Code int32 + Message string +} diff --git a/vendor/go.opencensus.io/trace/config.go b/vendor/go.opencensus.io/trace/config.go new file mode 100644 index 00000000..775f8274 --- /dev/null +++ b/vendor/go.opencensus.io/trace/config.go @@ -0,0 +1,86 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + + "go.opencensus.io/trace/internal" +) + +// Config represents the global tracing configuration. +type Config struct { + // DefaultSampler is the default sampler used when creating new spans. + DefaultSampler Sampler + + // IDGenerator is for internal use only. + IDGenerator internal.IDGenerator + + // MaxAnnotationEventsPerSpan is max number of annotation events per span + MaxAnnotationEventsPerSpan int + + // MaxMessageEventsPerSpan is max number of message events per span + MaxMessageEventsPerSpan int + + // MaxAnnotationEventsPerSpan is max number of attributes per span + MaxAttributesPerSpan int + + // MaxLinksPerSpan is max number of links per span + MaxLinksPerSpan int +} + +var configWriteMu sync.Mutex + +const ( + // DefaultMaxAnnotationEventsPerSpan is default max number of annotation events per span + DefaultMaxAnnotationEventsPerSpan = 32 + + // DefaultMaxMessageEventsPerSpan is default max number of message events per span + DefaultMaxMessageEventsPerSpan = 128 + + // DefaultMaxAttributesPerSpan is default max number of attributes per span + DefaultMaxAttributesPerSpan = 32 + + // DefaultMaxLinksPerSpan is default max number of links per span + DefaultMaxLinksPerSpan = 32 +) + +// ApplyConfig applies changes to the global tracing configuration. +// +// Fields not provided in the given config are going to be preserved. +func ApplyConfig(cfg Config) { + configWriteMu.Lock() + defer configWriteMu.Unlock() + c := *config.Load().(*Config) + if cfg.DefaultSampler != nil { + c.DefaultSampler = cfg.DefaultSampler + } + if cfg.IDGenerator != nil { + c.IDGenerator = cfg.IDGenerator + } + if cfg.MaxAnnotationEventsPerSpan > 0 { + c.MaxAnnotationEventsPerSpan = cfg.MaxAnnotationEventsPerSpan + } + if cfg.MaxMessageEventsPerSpan > 0 { + c.MaxMessageEventsPerSpan = cfg.MaxMessageEventsPerSpan + } + if cfg.MaxAttributesPerSpan > 0 { + c.MaxAttributesPerSpan = cfg.MaxAttributesPerSpan + } + if cfg.MaxLinksPerSpan > 0 { + c.MaxLinksPerSpan = cfg.MaxLinksPerSpan + } + config.Store(&c) +} diff --git a/vendor/go.opencensus.io/trace/doc.go b/vendor/go.opencensus.io/trace/doc.go new file mode 100644 index 00000000..04b1ee4f --- /dev/null +++ b/vendor/go.opencensus.io/trace/doc.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +/* +Package trace contains support for OpenCensus distributed tracing. + +The following assumes a basic familiarity with OpenCensus concepts. +See http://opencensus.io + + +Exporting Traces + +To export collected tracing data, register at least one exporter. You can use +one of the provided exporters or write your own. + + trace.RegisterExporter(exporter) + +By default, traces will be sampled relatively rarely. To change the sampling +frequency for your entire program, call ApplyConfig. Use a ProbabilitySampler +to sample a subset of traces, or use AlwaysSample to collect a trace on every run: + + trace.ApplyConfig(trace.Config{DefaultSampler: trace.AlwaysSample()}) + +Be careful about using trace.AlwaysSample in a production application with +significant traffic: a new trace will be started and exported for every request. + +Adding Spans to a Trace + +A trace consists of a tree of spans. In Go, the current span is carried in a +context.Context. + +It is common to want to capture all the activity of a function call in a span. For +this to work, the function must take a context.Context as a parameter. Add these two +lines to the top of the function: + + ctx, span := trace.StartSpan(ctx, "example.com/Run") + defer span.End() + +StartSpan will create a new top-level span if the context +doesn't contain another span, otherwise it will create a child span. +*/ +package trace // import "go.opencensus.io/trace" diff --git a/vendor/go.opencensus.io/trace/evictedqueue.go b/vendor/go.opencensus.io/trace/evictedqueue.go new file mode 100644 index 00000000..ffc264f2 --- /dev/null +++ b/vendor/go.opencensus.io/trace/evictedqueue.go @@ -0,0 +1,38 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +type evictedQueue struct { + queue []interface{} + capacity int + droppedCount int +} + +func newEvictedQueue(capacity int) *evictedQueue { + eq := &evictedQueue{ + capacity: capacity, + queue: make([]interface{}, 0), + } + + return eq +} + +func (eq *evictedQueue) add(value interface{}) { + if len(eq.queue) == eq.capacity { + eq.queue = eq.queue[1:] + eq.droppedCount++ + } + eq.queue = append(eq.queue, value) +} diff --git a/vendor/go.opencensus.io/trace/export.go b/vendor/go.opencensus.io/trace/export.go new file mode 100644 index 00000000..e0d9a4b9 --- /dev/null +++ b/vendor/go.opencensus.io/trace/export.go @@ -0,0 +1,97 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "sync/atomic" + "time" +) + +// Exporter is a type for functions that receive sampled trace spans. +// +// The ExportSpan method should be safe for concurrent use and should return +// quickly; if an Exporter takes a significant amount of time to process a +// SpanData, that work should be done on another goroutine. +// +// The SpanData should not be modified, but a pointer to it can be kept. +type Exporter interface { + ExportSpan(s *SpanData) +} + +type exportersMap map[Exporter]struct{} + +var ( + exporterMu sync.Mutex + exporters atomic.Value +) + +// RegisterExporter adds to the list of Exporters that will receive sampled +// trace spans. +// +// Binaries can register exporters, libraries shouldn't register exporters. +func RegisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + new[e] = struct{}{} + exporters.Store(new) + exporterMu.Unlock() +} + +// UnregisterExporter removes from the list of Exporters the Exporter that was +// registered with the given name. +func UnregisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + delete(new, e) + exporters.Store(new) + exporterMu.Unlock() +} + +// SpanData contains all the information collected by a Span. +type SpanData struct { + SpanContext + ParentSpanID SpanID + SpanKind int + Name string + StartTime time.Time + // The wall clock time of EndTime will be adjusted to always be offset + // from StartTime by the duration of the span. + EndTime time.Time + // The values of Attributes each have type string, bool, or int64. + Attributes map[string]interface{} + Annotations []Annotation + MessageEvents []MessageEvent + Status + Links []Link + HasRemoteParent bool + DroppedAttributeCount int + DroppedAnnotationCount int + DroppedMessageEventCount int + DroppedLinkCount int + + // ChildSpanCount holds the number of child span created for this span. + ChildSpanCount int +} diff --git a/vendor/go.opencensus.io/trace/internal/internal.go b/vendor/go.opencensus.io/trace/internal/internal.go new file mode 100644 index 00000000..7e808d8f --- /dev/null +++ b/vendor/go.opencensus.io/trace/internal/internal.go @@ -0,0 +1,22 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package internal provides trace internals. +package internal + +// IDGenerator allows custom generators for TraceId and SpanId. +type IDGenerator interface { + NewTraceID() [16]byte + NewSpanID() [8]byte +} diff --git a/vendor/go.opencensus.io/trace/lrumap.go b/vendor/go.opencensus.io/trace/lrumap.go new file mode 100644 index 00000000..3f80a336 --- /dev/null +++ b/vendor/go.opencensus.io/trace/lrumap.go @@ -0,0 +1,37 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "github.com/hashicorp/golang-lru/simplelru" +) + +type lruMap struct { + simpleLruMap *simplelru.LRU + droppedCount int +} + +func newLruMap(size int) *lruMap { + lm := &lruMap{} + lm.simpleLruMap, _ = simplelru.NewLRU(size, nil) + return lm +} + +func (lm *lruMap) add(key, value interface{}) { + evicted := lm.simpleLruMap.Add(key, value) + if evicted { + lm.droppedCount++ + } +} diff --git a/vendor/go.opencensus.io/trace/sampling.go b/vendor/go.opencensus.io/trace/sampling.go new file mode 100644 index 00000000..71c10f9e --- /dev/null +++ b/vendor/go.opencensus.io/trace/sampling.go @@ -0,0 +1,75 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "encoding/binary" +) + +const defaultSamplingProbability = 1e-4 + +// Sampler decides whether a trace should be sampled and exported. +type Sampler func(SamplingParameters) SamplingDecision + +// SamplingParameters contains the values passed to a Sampler. +type SamplingParameters struct { + ParentContext SpanContext + TraceID TraceID + SpanID SpanID + Name string + HasRemoteParent bool +} + +// SamplingDecision is the value returned by a Sampler. +type SamplingDecision struct { + Sample bool +} + +// ProbabilitySampler returns a Sampler that samples a given fraction of traces. +// +// It also samples spans whose parents are sampled. +func ProbabilitySampler(fraction float64) Sampler { + if !(fraction >= 0) { + fraction = 0 + } else if fraction >= 1 { + return AlwaysSample() + } + + traceIDUpperBound := uint64(fraction * (1 << 63)) + return Sampler(func(p SamplingParameters) SamplingDecision { + if p.ParentContext.IsSampled() { + return SamplingDecision{Sample: true} + } + x := binary.BigEndian.Uint64(p.TraceID[0:8]) >> 1 + return SamplingDecision{Sample: x < traceIDUpperBound} + }) +} + +// AlwaysSample returns a Sampler that samples every trace. +// Be careful about using this sampler in a production application with +// significant traffic: a new trace will be started and exported for every +// request. +func AlwaysSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: true} + } +} + +// NeverSample returns a Sampler that samples no traces. +func NeverSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: false} + } +} diff --git a/vendor/go.opencensus.io/trace/spanbucket.go b/vendor/go.opencensus.io/trace/spanbucket.go new file mode 100644 index 00000000..fbabad34 --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanbucket.go @@ -0,0 +1,130 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "time" +) + +// samplePeriod is the minimum time between accepting spans in a single bucket. +const samplePeriod = time.Second + +// defaultLatencies contains the default latency bucket bounds. +// TODO: consider defaults, make configurable +var defaultLatencies = [...]time.Duration{ + 10 * time.Microsecond, + 100 * time.Microsecond, + time.Millisecond, + 10 * time.Millisecond, + 100 * time.Millisecond, + time.Second, + 10 * time.Second, + time.Minute, +} + +// bucket is a container for a set of spans for a particular error code or latency range. +type bucket struct { + nextTime time.Time // next time we can accept a span + buffer []*SpanData // circular buffer of spans + nextIndex int // location next SpanData should be placed in buffer + overflow bool // whether the circular buffer has wrapped around +} + +func makeBucket(bufferSize int) bucket { + return bucket{ + buffer: make([]*SpanData, bufferSize), + } +} + +// add adds a span to the bucket, if nextTime has been reached. +func (b *bucket) add(s *SpanData) { + if s.EndTime.Before(b.nextTime) { + return + } + if len(b.buffer) == 0 { + return + } + b.nextTime = s.EndTime.Add(samplePeriod) + b.buffer[b.nextIndex] = s + b.nextIndex++ + if b.nextIndex == len(b.buffer) { + b.nextIndex = 0 + b.overflow = true + } +} + +// size returns the number of spans in the bucket. +func (b *bucket) size() int { + if b.overflow { + return len(b.buffer) + } + return b.nextIndex +} + +// span returns the ith span in the bucket. +func (b *bucket) span(i int) *SpanData { + if !b.overflow { + return b.buffer[i] + } + if i < len(b.buffer)-b.nextIndex { + return b.buffer[b.nextIndex+i] + } + return b.buffer[b.nextIndex+i-len(b.buffer)] +} + +// resize changes the size of the bucket to n, keeping up to n existing spans. +func (b *bucket) resize(n int) { + cur := b.size() + newBuffer := make([]*SpanData, n) + if cur < n { + for i := 0; i < cur; i++ { + newBuffer[i] = b.span(i) + } + b.buffer = newBuffer + b.nextIndex = cur + b.overflow = false + return + } + for i := 0; i < n; i++ { + newBuffer[i] = b.span(i + cur - n) + } + b.buffer = newBuffer + b.nextIndex = 0 + b.overflow = true +} + +// latencyBucket returns the appropriate bucket number for a given latency. +func latencyBucket(latency time.Duration) int { + i := 0 + for i < len(defaultLatencies) && latency >= defaultLatencies[i] { + i++ + } + return i +} + +// latencyBucketBounds returns the lower and upper bounds for a latency bucket +// number. +// +// The lower bound is inclusive, the upper bound is exclusive (except for the +// last bucket.) +func latencyBucketBounds(index int) (lower time.Duration, upper time.Duration) { + if index == 0 { + return 0, defaultLatencies[index] + } + if index == len(defaultLatencies) { + return defaultLatencies[index-1], 1<<63 - 1 + } + return defaultLatencies[index-1], defaultLatencies[index] +} diff --git a/vendor/go.opencensus.io/trace/spanstore.go b/vendor/go.opencensus.io/trace/spanstore.go new file mode 100644 index 00000000..c442d990 --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanstore.go @@ -0,0 +1,306 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "time" + + "go.opencensus.io/internal" +) + +const ( + maxBucketSize = 100000 + defaultBucketSize = 10 +) + +var ( + ssmu sync.RWMutex // protects spanStores + spanStores = make(map[string]*spanStore) +) + +// This exists purely to avoid exposing internal methods used by z-Pages externally. +type internalOnly struct{} + +func init() { + //TODO(#412): remove + internal.Trace = &internalOnly{} +} + +// ReportActiveSpans returns the active spans for the given name. +func (i internalOnly) ReportActiveSpans(name string) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for span := range s.active { + out = append(out, span.makeSpanData()) + } + return out +} + +// ReportSpansByError returns a sample of error spans. +// +// If code is nonzero, only spans with that status code are returned. +func (i internalOnly) ReportSpansByError(name string, code int32) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + if code != 0 { + if b, ok := s.errors[code]; ok { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } else { + for _, b := range s.errors { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } + return out +} + +// ConfigureBucketSizes sets the number of spans to keep per latency and error +// bucket for different span names. +func (i internalOnly) ConfigureBucketSizes(bcs []internal.BucketConfiguration) { + for _, bc := range bcs { + latencyBucketSize := bc.MaxRequestsSucceeded + if latencyBucketSize < 0 { + latencyBucketSize = 0 + } + if latencyBucketSize > maxBucketSize { + latencyBucketSize = maxBucketSize + } + errorBucketSize := bc.MaxRequestsErrors + if errorBucketSize < 0 { + errorBucketSize = 0 + } + if errorBucketSize > maxBucketSize { + errorBucketSize = maxBucketSize + } + spanStoreSetSize(bc.Name, latencyBucketSize, errorBucketSize) + } +} + +// ReportSpansPerMethod returns a summary of what spans are being stored for each span name. +func (i internalOnly) ReportSpansPerMethod() map[string]internal.PerMethodSummary { + out := make(map[string]internal.PerMethodSummary) + ssmu.RLock() + defer ssmu.RUnlock() + for name, s := range spanStores { + s.mu.Lock() + p := internal.PerMethodSummary{ + Active: len(s.active), + } + for code, b := range s.errors { + p.ErrorBuckets = append(p.ErrorBuckets, internal.ErrorBucketSummary{ + ErrorCode: code, + Size: b.size(), + }) + } + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + p.LatencyBuckets = append(p.LatencyBuckets, internal.LatencyBucketSummary{ + MinLatency: min, + MaxLatency: max, + Size: b.size(), + }) + } + s.mu.Unlock() + out[name] = p + } + return out +} + +// ReportSpansByLatency returns a sample of successful spans. +// +// minLatency is the minimum latency of spans to be returned. +// maxLatency, if nonzero, is the maximum latency of spans to be returned. +func (i internalOnly) ReportSpansByLatency(name string, minLatency, maxLatency time.Duration) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + if i+1 != len(s.latency) && max <= minLatency { + continue + } + if maxLatency != 0 && maxLatency < min { + continue + } + for _, sd := range b.buffer { + if sd == nil { + break + } + if minLatency != 0 || maxLatency != 0 { + d := sd.EndTime.Sub(sd.StartTime) + if d < minLatency { + continue + } + if maxLatency != 0 && d > maxLatency { + continue + } + } + out = append(out, sd) + } + } + return out +} + +// spanStore keeps track of spans stored for a particular span name. +// +// It contains all active spans; a sample of spans for failed requests, +// categorized by error code; and a sample of spans for successful requests, +// bucketed by latency. +type spanStore struct { + mu sync.Mutex // protects everything below. + active map[*Span]struct{} + errors map[int32]*bucket + latency []bucket + maxSpansPerErrorBucket int +} + +// newSpanStore creates a span store. +func newSpanStore(name string, latencyBucketSize int, errorBucketSize int) *spanStore { + s := &spanStore{ + active: make(map[*Span]struct{}), + latency: make([]bucket, len(defaultLatencies)+1), + maxSpansPerErrorBucket: errorBucketSize, + } + for i := range s.latency { + s.latency[i] = makeBucket(latencyBucketSize) + } + return s +} + +// spanStoreForName returns the spanStore for the given name. +// +// It returns nil if it doesn't exist. +func spanStoreForName(name string) *spanStore { + var s *spanStore + ssmu.RLock() + s, _ = spanStores[name] + ssmu.RUnlock() + return s +} + +// spanStoreForNameCreateIfNew returns the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreForNameCreateIfNew(name string) *spanStore { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + return s + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + return s + } + s = newSpanStore(name, defaultBucketSize, defaultBucketSize) + spanStores[name] = s + return s +} + +// spanStoreSetSize resizes the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreSetSize(name string, latencyBucketSize int, errorBucketSize int) { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + s = newSpanStore(name, latencyBucketSize, errorBucketSize) + spanStores[name] = s +} + +func (s *spanStore) resize(latencyBucketSize int, errorBucketSize int) { + s.mu.Lock() + for i := range s.latency { + s.latency[i].resize(latencyBucketSize) + } + for _, b := range s.errors { + b.resize(errorBucketSize) + } + s.maxSpansPerErrorBucket = errorBucketSize + s.mu.Unlock() +} + +// add adds a span to the active bucket of the spanStore. +func (s *spanStore) add(span *Span) { + s.mu.Lock() + s.active[span] = struct{}{} + s.mu.Unlock() +} + +// finished removes a span from the active set, and adds a corresponding +// SpanData to a latency or error bucket. +func (s *spanStore) finished(span *Span, sd *SpanData) { + latency := sd.EndTime.Sub(sd.StartTime) + if latency < 0 { + latency = 0 + } + code := sd.Status.Code + + s.mu.Lock() + delete(s.active, span) + if code == 0 { + s.latency[latencyBucket(latency)].add(sd) + } else { + if s.errors == nil { + s.errors = make(map[int32]*bucket) + } + if b := s.errors[code]; b != nil { + b.add(sd) + } else { + b := makeBucket(s.maxSpansPerErrorBucket) + s.errors[code] = &b + b.add(sd) + } + } + s.mu.Unlock() +} diff --git a/vendor/go.opencensus.io/trace/status_codes.go b/vendor/go.opencensus.io/trace/status_codes.go new file mode 100644 index 00000000..ec60effd --- /dev/null +++ b/vendor/go.opencensus.io/trace/status_codes.go @@ -0,0 +1,37 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +// Status codes for use with Span.SetStatus. These correspond to the status +// codes used by gRPC defined here: https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto +const ( + StatusCodeOK = 0 + StatusCodeCancelled = 1 + StatusCodeUnknown = 2 + StatusCodeInvalidArgument = 3 + StatusCodeDeadlineExceeded = 4 + StatusCodeNotFound = 5 + StatusCodeAlreadyExists = 6 + StatusCodePermissionDenied = 7 + StatusCodeResourceExhausted = 8 + StatusCodeFailedPrecondition = 9 + StatusCodeAborted = 10 + StatusCodeOutOfRange = 11 + StatusCodeUnimplemented = 12 + StatusCodeInternal = 13 + StatusCodeUnavailable = 14 + StatusCodeDataLoss = 15 + StatusCodeUnauthenticated = 16 +) diff --git a/vendor/go.opencensus.io/trace/trace.go b/vendor/go.opencensus.io/trace/trace.go new file mode 100644 index 00000000..38ead7bf --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace.go @@ -0,0 +1,598 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "context" + crand "crypto/rand" + "encoding/binary" + "fmt" + "math/rand" + "sync" + "sync/atomic" + "time" + + "go.opencensus.io/internal" + "go.opencensus.io/trace/tracestate" +) + +// Span represents a span of a trace. It has an associated SpanContext, and +// stores data accumulated while the span is active. +// +// Ideally users should interact with Spans by calling the functions in this +// package that take a Context parameter. +type Span struct { + // data contains information recorded about the span. + // + // It will be non-nil if we are exporting the span or recording events for it. + // Otherwise, data is nil, and the Span is simply a carrier for the + // SpanContext, so that the trace ID is propagated. + data *SpanData + mu sync.Mutex // protects the contents of *data (but not the pointer value.) + spanContext SpanContext + + // lruAttributes are capped at configured limit. When the capacity is reached an oldest entry + // is removed to create room for a new entry. + lruAttributes *lruMap + + // annotations are stored in FIFO queue capped by configured limit. + annotations *evictedQueue + + // messageEvents are stored in FIFO queue capped by configured limit. + messageEvents *evictedQueue + + // links are stored in FIFO queue capped by configured limit. + links *evictedQueue + + // spanStore is the spanStore this span belongs to, if any, otherwise it is nil. + *spanStore + endOnce sync.Once + + executionTracerTaskEnd func() // ends the execution tracer span +} + +// IsRecordingEvents returns true if events are being recorded for this span. +// Use this check to avoid computing expensive annotations when they will never +// be used. +func (s *Span) IsRecordingEvents() bool { + if s == nil { + return false + } + return s.data != nil +} + +// TraceOptions contains options associated with a trace span. +type TraceOptions uint32 + +// IsSampled returns true if the span will be exported. +func (sc SpanContext) IsSampled() bool { + return sc.TraceOptions.IsSampled() +} + +// setIsSampled sets the TraceOptions bit that determines whether the span will be exported. +func (sc *SpanContext) setIsSampled(sampled bool) { + if sampled { + sc.TraceOptions |= 1 + } else { + sc.TraceOptions &= ^TraceOptions(1) + } +} + +// IsSampled returns true if the span will be exported. +func (t TraceOptions) IsSampled() bool { + return t&1 == 1 +} + +// SpanContext contains the state that must propagate across process boundaries. +// +// SpanContext is not an implementation of context.Context. +// TODO: add reference to external Census docs for SpanContext. +type SpanContext struct { + TraceID TraceID + SpanID SpanID + TraceOptions TraceOptions + Tracestate *tracestate.Tracestate +} + +type contextKey struct{} + +// FromContext returns the Span stored in a context, or nil if there isn't one. +func FromContext(ctx context.Context) *Span { + s, _ := ctx.Value(contextKey{}).(*Span) + return s +} + +// NewContext returns a new context with the given Span attached. +func NewContext(parent context.Context, s *Span) context.Context { + return context.WithValue(parent, contextKey{}, s) +} + +// All available span kinds. Span kind must be either one of these values. +const ( + SpanKindUnspecified = iota + SpanKindServer + SpanKindClient +) + +// StartOptions contains options concerning how a span is started. +type StartOptions struct { + // Sampler to consult for this Span. If provided, it is always consulted. + // + // If not provided, then the behavior differs based on whether + // the parent of this Span is remote, local, or there is no parent. + // In the case of a remote parent or no parent, the + // default sampler (see Config) will be consulted. Otherwise, + // when there is a non-remote parent, no new sampling decision will be made: + // we will preserve the sampling of the parent. + Sampler Sampler + + // SpanKind represents the kind of a span. If none is set, + // SpanKindUnspecified is used. + SpanKind int +} + +// StartOption apply changes to StartOptions. +type StartOption func(*StartOptions) + +// WithSpanKind makes new spans to be created with the given kind. +func WithSpanKind(spanKind int) StartOption { + return func(o *StartOptions) { + o.SpanKind = spanKind + } +} + +// WithSampler makes new spans to be be created with a custom sampler. +// Otherwise, the global sampler is used. +func WithSampler(sampler Sampler) StartOption { + return func(o *StartOptions) { + o.Sampler = sampler + } +} + +// StartSpan starts a new child span of the current span in the context. If +// there is no span in the context, creates a new trace and span. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpan(ctx context.Context, name string, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + var parent SpanContext + if p := FromContext(ctx); p != nil { + p.addChild() + parent = p.spanContext + } + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, false, opts) + + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +// StartSpanWithRemoteParent starts a new child span of the span from the given parent. +// +// If the incoming context contains a parent, it ignores. StartSpanWithRemoteParent is +// preferred for cases where the parent is propagated via an incoming request. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpanWithRemoteParent(ctx context.Context, name string, parent SpanContext, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, true, opts) + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +func startSpanInternal(name string, hasParent bool, parent SpanContext, remoteParent bool, o StartOptions) *Span { + span := &Span{} + span.spanContext = parent + + cfg := config.Load().(*Config) + + if !hasParent { + span.spanContext.TraceID = cfg.IDGenerator.NewTraceID() + } + span.spanContext.SpanID = cfg.IDGenerator.NewSpanID() + sampler := cfg.DefaultSampler + + if !hasParent || remoteParent || o.Sampler != nil { + // If this span is the child of a local span and no Sampler is set in the + // options, keep the parent's TraceOptions. + // + // Otherwise, consult the Sampler in the options if it is non-nil, otherwise + // the default sampler. + if o.Sampler != nil { + sampler = o.Sampler + } + span.spanContext.setIsSampled(sampler(SamplingParameters{ + ParentContext: parent, + TraceID: span.spanContext.TraceID, + SpanID: span.spanContext.SpanID, + Name: name, + HasRemoteParent: remoteParent}).Sample) + } + + if !internal.LocalSpanStoreEnabled && !span.spanContext.IsSampled() { + return span + } + + span.data = &SpanData{ + SpanContext: span.spanContext, + StartTime: time.Now(), + SpanKind: o.SpanKind, + Name: name, + HasRemoteParent: remoteParent, + } + span.lruAttributes = newLruMap(cfg.MaxAttributesPerSpan) + span.annotations = newEvictedQueue(cfg.MaxAnnotationEventsPerSpan) + span.messageEvents = newEvictedQueue(cfg.MaxMessageEventsPerSpan) + span.links = newEvictedQueue(cfg.MaxLinksPerSpan) + + if hasParent { + span.data.ParentSpanID = parent.SpanID + } + if internal.LocalSpanStoreEnabled { + var ss *spanStore + ss = spanStoreForNameCreateIfNew(name) + if ss != nil { + span.spanStore = ss + ss.add(span) + } + } + + return span +} + +// End ends the span. +func (s *Span) End() { + if s == nil { + return + } + if s.executionTracerTaskEnd != nil { + s.executionTracerTaskEnd() + } + if !s.IsRecordingEvents() { + return + } + s.endOnce.Do(func() { + exp, _ := exporters.Load().(exportersMap) + mustExport := s.spanContext.IsSampled() && len(exp) > 0 + if s.spanStore != nil || mustExport { + sd := s.makeSpanData() + sd.EndTime = internal.MonotonicEndTime(sd.StartTime) + if s.spanStore != nil { + s.spanStore.finished(s, sd) + } + if mustExport { + for e := range exp { + e.ExportSpan(sd) + } + } + } + }) +} + +// makeSpanData produces a SpanData representing the current state of the Span. +// It requires that s.data is non-nil. +func (s *Span) makeSpanData() *SpanData { + var sd SpanData + s.mu.Lock() + sd = *s.data + if s.lruAttributes.simpleLruMap.Len() > 0 { + sd.Attributes = s.lruAttributesToAttributeMap() + sd.DroppedAttributeCount = s.lruAttributes.droppedCount + } + if len(s.annotations.queue) > 0 { + sd.Annotations = s.interfaceArrayToAnnotationArray() + sd.DroppedAnnotationCount = s.annotations.droppedCount + } + if len(s.messageEvents.queue) > 0 { + sd.MessageEvents = s.interfaceArrayToMessageEventArray() + sd.DroppedMessageEventCount = s.messageEvents.droppedCount + } + if len(s.links.queue) > 0 { + sd.Links = s.interfaceArrayToLinksArray() + sd.DroppedLinkCount = s.links.droppedCount + } + s.mu.Unlock() + return &sd +} + +// SpanContext returns the SpanContext of the span. +func (s *Span) SpanContext() SpanContext { + if s == nil { + return SpanContext{} + } + return s.spanContext +} + +// SetName sets the name of the span, if it is recording events. +func (s *Span) SetName(name string) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Name = name + s.mu.Unlock() +} + +// SetStatus sets the status of the span, if it is recording events. +func (s *Span) SetStatus(status Status) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Status = status + s.mu.Unlock() +} + +func (s *Span) interfaceArrayToLinksArray() []Link { + linksArr := make([]Link, 0) + for _, value := range s.links.queue { + linksArr = append(linksArr, value.(Link)) + } + return linksArr +} + +func (s *Span) interfaceArrayToMessageEventArray() []MessageEvent { + messageEventArr := make([]MessageEvent, 0) + for _, value := range s.messageEvents.queue { + messageEventArr = append(messageEventArr, value.(MessageEvent)) + } + return messageEventArr +} + +func (s *Span) interfaceArrayToAnnotationArray() []Annotation { + annotationArr := make([]Annotation, 0) + for _, value := range s.annotations.queue { + annotationArr = append(annotationArr, value.(Annotation)) + } + return annotationArr +} + +func (s *Span) lruAttributesToAttributeMap() map[string]interface{} { + attributes := make(map[string]interface{}) + for _, key := range s.lruAttributes.simpleLruMap.Keys() { + value, ok := s.lruAttributes.simpleLruMap.Get(key) + if ok { + keyStr := key.(string) + attributes[keyStr] = value + } + } + return attributes +} + +func (s *Span) copyToCappedAttributes(attributes []Attribute) { + for _, a := range attributes { + s.lruAttributes.add(a.key, a.value) + } +} + +func (s *Span) addChild() { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.ChildSpanCount++ + s.mu.Unlock() +} + +// AddAttributes sets attributes in the span. +// +// Existing attributes whose keys appear in the attributes parameter are overwritten. +func (s *Span) AddAttributes(attributes ...Attribute) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.copyToCappedAttributes(attributes) + s.mu.Unlock() +} + +// copyAttributes copies a slice of Attributes into a map. +func copyAttributes(m map[string]interface{}, attributes []Attribute) { + for _, a := range attributes { + m[a.key] = a.value + } +} + +func (s *Span) lazyPrintfInternal(attributes []Attribute, format string, a ...interface{}) { + now := time.Now() + msg := fmt.Sprintf(format, a...) + var m map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + m = make(map[string]interface{}) + copyAttributes(m, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: msg, + Attributes: m, + }) + s.mu.Unlock() +} + +func (s *Span) printStringInternal(attributes []Attribute, str string) { + now := time.Now() + var a map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + a = make(map[string]interface{}) + copyAttributes(a, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: str, + Attributes: a, + }) + s.mu.Unlock() +} + +// Annotate adds an annotation with attributes. +// Attributes can be nil. +func (s *Span) Annotate(attributes []Attribute, str string) { + if !s.IsRecordingEvents() { + return + } + s.printStringInternal(attributes, str) +} + +// Annotatef adds an annotation with attributes. +func (s *Span) Annotatef(attributes []Attribute, format string, a ...interface{}) { + if !s.IsRecordingEvents() { + return + } + s.lazyPrintfInternal(attributes, format, a...) +} + +// AddMessageSendEvent adds a message send event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageSendEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeSent, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddMessageReceiveEvent adds a message receive event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageReceiveEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeRecv, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddLink adds a link to the span. +func (s *Span) AddLink(l Link) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.links.add(l) + s.mu.Unlock() +} + +func (s *Span) String() string { + if s == nil { + return "" + } + if s.data == nil { + return fmt.Sprintf("span %s", s.spanContext.SpanID) + } + s.mu.Lock() + str := fmt.Sprintf("span %s %q", s.spanContext.SpanID, s.data.Name) + s.mu.Unlock() + return str +} + +var config atomic.Value // access atomically + +func init() { + gen := &defaultIDGenerator{} + // initialize traceID and spanID generators. + var rngSeed int64 + for _, p := range []interface{}{ + &rngSeed, &gen.traceIDAdd, &gen.nextSpanID, &gen.spanIDInc, + } { + binary.Read(crand.Reader, binary.LittleEndian, p) + } + gen.traceIDRand = rand.New(rand.NewSource(rngSeed)) + gen.spanIDInc |= 1 + + config.Store(&Config{ + DefaultSampler: ProbabilitySampler(defaultSamplingProbability), + IDGenerator: gen, + MaxAttributesPerSpan: DefaultMaxAttributesPerSpan, + MaxAnnotationEventsPerSpan: DefaultMaxAnnotationEventsPerSpan, + MaxMessageEventsPerSpan: DefaultMaxMessageEventsPerSpan, + MaxLinksPerSpan: DefaultMaxLinksPerSpan, + }) +} + +type defaultIDGenerator struct { + sync.Mutex + + // Please keep these as the first fields + // so that these 8 byte fields will be aligned on addresses + // divisible by 8, on both 32-bit and 64-bit machines when + // performing atomic increments and accesses. + // See: + // * https://github.com/census-instrumentation/opencensus-go/issues/587 + // * https://github.com/census-instrumentation/opencensus-go/issues/865 + // * https://golang.org/pkg/sync/atomic/#pkg-note-BUG + nextSpanID uint64 + spanIDInc uint64 + + traceIDAdd [2]uint64 + traceIDRand *rand.Rand +} + +// NewSpanID returns a non-zero span ID from a randomly-chosen sequence. +func (gen *defaultIDGenerator) NewSpanID() [8]byte { + var id uint64 + for id == 0 { + id = atomic.AddUint64(&gen.nextSpanID, gen.spanIDInc) + } + var sid [8]byte + binary.LittleEndian.PutUint64(sid[:], id) + return sid +} + +// NewTraceID returns a non-zero trace ID from a randomly-chosen sequence. +// mu should be held while this function is called. +func (gen *defaultIDGenerator) NewTraceID() [16]byte { + var tid [16]byte + // Construct the trace ID from two outputs of traceIDRand, with a constant + // added to each half for additional entropy. + gen.Lock() + binary.LittleEndian.PutUint64(tid[0:8], gen.traceIDRand.Uint64()+gen.traceIDAdd[0]) + binary.LittleEndian.PutUint64(tid[8:16], gen.traceIDRand.Uint64()+gen.traceIDAdd[1]) + gen.Unlock() + return tid +} diff --git a/vendor/go.opencensus.io/trace/trace_go11.go b/vendor/go.opencensus.io/trace/trace_go11.go new file mode 100644 index 00000000..b7d8aaf2 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_go11.go @@ -0,0 +1,32 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build go1.11 + +package trace + +import ( + "context" + t "runtime/trace" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + if !t.IsEnabled() { + // Avoid additional overhead if + // runtime/trace is not enabled. + return ctx, func() {} + } + nctx, task := t.NewTask(ctx, name) + return nctx, task.End +} diff --git a/vendor/go.opencensus.io/trace/trace_nongo11.go b/vendor/go.opencensus.io/trace/trace_nongo11.go new file mode 100644 index 00000000..e2541985 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_nongo11.go @@ -0,0 +1,25 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build !go1.11 + +package trace + +import ( + "context" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + return ctx, func() {} +} diff --git a/vendor/go.opencensus.io/trace/tracestate/tracestate.go b/vendor/go.opencensus.io/trace/tracestate/tracestate.go new file mode 100644 index 00000000..2d6c713e --- /dev/null +++ b/vendor/go.opencensus.io/trace/tracestate/tracestate.go @@ -0,0 +1,147 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package tracestate implements support for the Tracestate header of the +// W3C TraceContext propagation format. +package tracestate + +import ( + "fmt" + "regexp" +) + +const ( + keyMaxSize = 256 + valueMaxSize = 256 + maxKeyValuePairs = 32 +) + +const ( + keyWithoutVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,255}` + keyWithVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,240}@[a-z][_0-9a-z\-\*\/]{0,13}` + keyFormat = `(` + keyWithoutVendorFormat + `)|(` + keyWithVendorFormat + `)` + valueFormat = `[\x20-\x2b\x2d-\x3c\x3e-\x7e]{0,255}[\x21-\x2b\x2d-\x3c\x3e-\x7e]` +) + +var keyValidationRegExp = regexp.MustCompile(`^(` + keyFormat + `)$`) +var valueValidationRegExp = regexp.MustCompile(`^(` + valueFormat + `)$`) + +// Tracestate represents tracing-system specific context in a list of key-value pairs. Tracestate allows different +// vendors propagate additional information and inter-operate with their legacy Id formats. +type Tracestate struct { + entries []Entry +} + +// Entry represents one key-value pair in a list of key-value pair of Tracestate. +type Entry struct { + // Key is an opaque string up to 256 characters printable. It MUST begin with a lowercase letter, + // and can only contain lowercase letters a-z, digits 0-9, underscores _, dashes -, asterisks *, and + // forward slashes /. + Key string + + // Value is an opaque string up to 256 characters printable ASCII RFC0020 characters (i.e., the + // range 0x20 to 0x7E) except comma , and =. + Value string +} + +// Entries returns a slice of Entry. +func (ts *Tracestate) Entries() []Entry { + if ts == nil { + return nil + } + return ts.entries +} + +func (ts *Tracestate) remove(key string) *Entry { + for index, entry := range ts.entries { + if entry.Key == key { + ts.entries = append(ts.entries[:index], ts.entries[index+1:]...) + return &entry + } + } + return nil +} + +func (ts *Tracestate) add(entries []Entry) error { + for _, entry := range entries { + ts.remove(entry.Key) + } + if len(ts.entries)+len(entries) > maxKeyValuePairs { + return fmt.Errorf("adding %d key-value pairs to current %d pairs exceeds the limit of %d", + len(entries), len(ts.entries), maxKeyValuePairs) + } + ts.entries = append(entries, ts.entries...) + return nil +} + +func isValid(entry Entry) bool { + return keyValidationRegExp.MatchString(entry.Key) && + valueValidationRegExp.MatchString(entry.Value) +} + +func containsDuplicateKey(entries ...Entry) (string, bool) { + keyMap := make(map[string]int) + for _, entry := range entries { + if _, ok := keyMap[entry.Key]; ok { + return entry.Key, true + } + keyMap[entry.Key] = 1 + } + return "", false +} + +func areEntriesValid(entries ...Entry) (*Entry, bool) { + for _, entry := range entries { + if !isValid(entry) { + return &entry, false + } + } + return nil, true +} + +// New creates a Tracestate object from a parent and/or entries (key-value pair). +// Entries from the parent are copied if present. The entries passed to this function +// are inserted in front of those copied from the parent. If an entry copied from the +// parent contains the same key as one of the entry in entries then the entry copied +// from the parent is removed. See add func. +// +// An error is returned with nil Tracestate if +// 1. one or more entry in entries is invalid. +// 2. two or more entries in the input entries have the same key. +// 3. the number of entries combined from the parent and the input entries exceeds maxKeyValuePairs. +// (duplicate entry is counted only once). +func New(parent *Tracestate, entries ...Entry) (*Tracestate, error) { + if parent == nil && len(entries) == 0 { + return nil, nil + } + if entry, ok := areEntriesValid(entries...); !ok { + return nil, fmt.Errorf("key-value pair {%s, %s} is invalid", entry.Key, entry.Value) + } + + if key, duplicate := containsDuplicateKey(entries...); duplicate { + return nil, fmt.Errorf("contains duplicate keys (%s)", key) + } + + tracestate := Tracestate{} + + if parent != nil && len(parent.entries) > 0 { + tracestate.entries = append([]Entry{}, parent.entries...) + } + + err := tracestate.add(entries) + if err != nil { + return nil, err + } + return &tracestate, nil +} diff --git a/vendor/golang.org/x/text/transform/transform.go b/vendor/golang.org/x/text/transform/transform.go index fe47b9b3..520b9ada 100644 --- a/vendor/golang.org/x/text/transform/transform.go +++ b/vendor/golang.org/x/text/transform/transform.go @@ -78,8 +78,8 @@ type SpanningTransformer interface { // considering the error err. // // A nil error means that all input bytes are known to be identical to the - // output produced by the Transformer. A nil error can be be returned - // regardless of whether atEOF is true. If err is nil, then then n must + // output produced by the Transformer. A nil error can be returned + // regardless of whether atEOF is true. If err is nil, then n must // equal len(src); the converse is not necessarily true. // // ErrEndOfSpan means that the Transformer output may differ from the @@ -493,7 +493,7 @@ func (c *chain) Transform(dst, src []byte, atEOF bool) (nDst, nSrc int, err erro return dstL.n, srcL.p, err } -// Deprecated: use runes.Remove instead. +// Deprecated: Use runes.Remove instead. func RemoveFunc(f func(r rune) bool) Transformer { return removeF(f) } diff --git a/vendor/golang.org/x/text/unicode/bidi/bidi.go b/vendor/golang.org/x/text/unicode/bidi/bidi.go index 3fc4a625..e8edc54c 100644 --- a/vendor/golang.org/x/text/unicode/bidi/bidi.go +++ b/vendor/golang.org/x/text/unicode/bidi/bidi.go @@ -6,7 +6,7 @@ // Package bidi contains functionality for bidirectional text support. // -// See http://www.unicode.org/reports/tr9. +// See https://www.unicode.org/reports/tr9. // // NOTE: UNDER CONSTRUCTION. This API may change in backwards incompatible ways // and without notice. diff --git a/vendor/golang.org/x/text/unicode/bidi/bracket.go b/vendor/golang.org/x/text/unicode/bidi/bracket.go index 601e2592..18539397 100644 --- a/vendor/golang.org/x/text/unicode/bidi/bracket.go +++ b/vendor/golang.org/x/text/unicode/bidi/bracket.go @@ -12,7 +12,7 @@ import ( // This file contains a port of the reference implementation of the // Bidi Parentheses Algorithm: -// http://www.unicode.org/Public/PROGRAMS/BidiReferenceJava/BidiPBAReference.java +// https://www.unicode.org/Public/PROGRAMS/BidiReferenceJava/BidiPBAReference.java // // The implementation in this file covers definitions BD14-BD16 and rule N0 // of UAX#9. @@ -246,7 +246,7 @@ func (p *bracketPairer) getStrongTypeN0(index int) Class { // assuming the given embedding direction. // // It returns ON if no strong type is found. If a single strong type is found, -// it returns this this type. Otherwise it returns the embedding direction. +// it returns this type. Otherwise it returns the embedding direction. // // TODO: use separate type for "strong" directionality. func (p *bracketPairer) classifyPairContent(loc bracketPair, dirEmbed Class) Class { diff --git a/vendor/golang.org/x/text/unicode/bidi/core.go b/vendor/golang.org/x/text/unicode/bidi/core.go index d4c1399f..48d14400 100644 --- a/vendor/golang.org/x/text/unicode/bidi/core.go +++ b/vendor/golang.org/x/text/unicode/bidi/core.go @@ -7,7 +7,7 @@ package bidi import "log" // This implementation is a port based on the reference implementation found at: -// http://www.unicode.org/Public/PROGRAMS/BidiReferenceJava/ +// https://www.unicode.org/Public/PROGRAMS/BidiReferenceJava/ // // described in Unicode Bidirectional Algorithm (UAX #9). // diff --git a/vendor/golang.org/x/text/unicode/bidi/gen.go b/vendor/golang.org/x/text/unicode/bidi/gen.go index 4e1c7ba0..987fc169 100644 --- a/vendor/golang.org/x/text/unicode/bidi/gen.go +++ b/vendor/golang.org/x/text/unicode/bidi/gen.go @@ -26,7 +26,7 @@ func main() { } // bidiClass names and codes taken from class "bc" in -// http://www.unicode.org/Public/8.0.0/ucd/PropertyValueAliases.txt +// https://www.unicode.org/Public/8.0.0/ucd/PropertyValueAliases.txt var bidiClass = map[string]Class{ "AL": AL, // ArabicLetter "AN": AN, // ArabicNumber diff --git a/vendor/golang.org/x/text/unicode/bidi/gen_ranges.go b/vendor/golang.org/x/text/unicode/bidi/gen_ranges.go index 51bd68fa..02c3b505 100644 --- a/vendor/golang.org/x/text/unicode/bidi/gen_ranges.go +++ b/vendor/golang.org/x/text/unicode/bidi/gen_ranges.go @@ -15,7 +15,7 @@ import ( ) // These tables are hand-extracted from: -// http://www.unicode.org/Public/8.0.0/ucd/extracted/DerivedBidiClass.txt +// https://www.unicode.org/Public/8.0.0/ucd/extracted/DerivedBidiClass.txt func visitDefaults(fn func(r rune, c Class)) { // first write default values for ranges listed above. visitRunes(fn, AL, []rune{ diff --git a/vendor/golang.org/x/text/unicode/bidi/tables10.0.0.go b/vendor/golang.org/x/text/unicode/bidi/tables10.0.0.go index 2e1ff195..d8c94e1b 100644 --- a/vendor/golang.org/x/text/unicode/bidi/tables10.0.0.go +++ b/vendor/golang.org/x/text/unicode/bidi/tables10.0.0.go @@ -1,6 +1,6 @@ // Code generated by running "go generate" in golang.org/x/text. DO NOT EDIT. -// +build go1.10 +// +build go1.10,!go1.13 package bidi diff --git a/vendor/golang.org/x/text/unicode/bidi/tables11.0.0.go b/vendor/golang.org/x/text/unicode/bidi/tables11.0.0.go new file mode 100644 index 00000000..022e3c69 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/bidi/tables11.0.0.go @@ -0,0 +1,1887 @@ +// Code generated by running "go generate" in golang.org/x/text. DO NOT EDIT. + +// +build go1.13 + +package bidi + +// UnicodeVersion is the Unicode version from which the tables in this package are derived. +const UnicodeVersion = "11.0.0" + +// xorMasks contains masks to be xor-ed with brackets to get the reverse +// version. +var xorMasks = []int32{ // 8 elements + 0, 1, 6, 7, 3, 15, 29, 63, +} // Size: 56 bytes + +// lookup returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *bidiTrie) lookup(s []byte) (v uint8, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return bidiValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = bidiIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = bidiIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = bidiIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *bidiTrie) lookupUnsafe(s []byte) uint8 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return bidiValues[c0] + } + i := bidiIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = bidiIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = bidiIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// lookupString returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *bidiTrie) lookupString(s string) (v uint8, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return bidiValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = bidiIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = bidiIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = bidiIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupStringUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *bidiTrie) lookupStringUnsafe(s string) uint8 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return bidiValues[c0] + } + i := bidiIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = bidiIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = bidiIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// bidiTrie. Total size: 16512 bytes (16.12 KiB). Checksum: 2a9cf1317f2ffaa. +type bidiTrie struct{} + +func newBidiTrie(i int) *bidiTrie { + return &bidiTrie{} +} + +// lookupValue determines the type of block n and looks up the value for b. +func (t *bidiTrie) lookupValue(n uint32, b byte) uint8 { + switch { + default: + return uint8(bidiValues[n<<6+uint32(b)]) + } +} + +// bidiValues: 234 blocks, 14976 entries, 14976 bytes +// The third block is the zero block. +var bidiValues = [14976]uint8{ + // Block 0x0, offset 0x0 + 0x00: 0x000b, 0x01: 0x000b, 0x02: 0x000b, 0x03: 0x000b, 0x04: 0x000b, 0x05: 0x000b, + 0x06: 0x000b, 0x07: 0x000b, 0x08: 0x000b, 0x09: 0x0008, 0x0a: 0x0007, 0x0b: 0x0008, + 0x0c: 0x0009, 0x0d: 0x0007, 0x0e: 0x000b, 0x0f: 0x000b, 0x10: 0x000b, 0x11: 0x000b, + 0x12: 0x000b, 0x13: 0x000b, 0x14: 0x000b, 0x15: 0x000b, 0x16: 0x000b, 0x17: 0x000b, + 0x18: 0x000b, 0x19: 0x000b, 0x1a: 0x000b, 0x1b: 0x000b, 0x1c: 0x0007, 0x1d: 0x0007, + 0x1e: 0x0007, 0x1f: 0x0008, 0x20: 0x0009, 0x21: 0x000a, 0x22: 0x000a, 0x23: 0x0004, + 0x24: 0x0004, 0x25: 0x0004, 0x26: 0x000a, 0x27: 0x000a, 0x28: 0x003a, 0x29: 0x002a, + 0x2a: 0x000a, 0x2b: 0x0003, 0x2c: 0x0006, 0x2d: 0x0003, 0x2e: 0x0006, 0x2f: 0x0006, + 0x30: 0x0002, 0x31: 0x0002, 0x32: 0x0002, 0x33: 0x0002, 0x34: 0x0002, 0x35: 0x0002, + 0x36: 0x0002, 0x37: 0x0002, 0x38: 0x0002, 0x39: 0x0002, 0x3a: 0x0006, 0x3b: 0x000a, + 0x3c: 0x000a, 0x3d: 0x000a, 0x3e: 0x000a, 0x3f: 0x000a, + // Block 0x1, offset 0x40 + 0x40: 0x000a, + 0x5b: 0x005a, 0x5c: 0x000a, 0x5d: 0x004a, + 0x5e: 0x000a, 0x5f: 0x000a, 0x60: 0x000a, + 0x7b: 0x005a, + 0x7c: 0x000a, 0x7d: 0x004a, 0x7e: 0x000a, 0x7f: 0x000b, + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc0: 0x000b, 0xc1: 0x000b, 0xc2: 0x000b, 0xc3: 0x000b, 0xc4: 0x000b, 0xc5: 0x0007, + 0xc6: 0x000b, 0xc7: 0x000b, 0xc8: 0x000b, 0xc9: 0x000b, 0xca: 0x000b, 0xcb: 0x000b, + 0xcc: 0x000b, 0xcd: 0x000b, 0xce: 0x000b, 0xcf: 0x000b, 0xd0: 0x000b, 0xd1: 0x000b, + 0xd2: 0x000b, 0xd3: 0x000b, 0xd4: 0x000b, 0xd5: 0x000b, 0xd6: 0x000b, 0xd7: 0x000b, + 0xd8: 0x000b, 0xd9: 0x000b, 0xda: 0x000b, 0xdb: 0x000b, 0xdc: 0x000b, 0xdd: 0x000b, + 0xde: 0x000b, 0xdf: 0x000b, 0xe0: 0x0006, 0xe1: 0x000a, 0xe2: 0x0004, 0xe3: 0x0004, + 0xe4: 0x0004, 0xe5: 0x0004, 0xe6: 0x000a, 0xe7: 0x000a, 0xe8: 0x000a, 0xe9: 0x000a, + 0xeb: 0x000a, 0xec: 0x000a, 0xed: 0x000b, 0xee: 0x000a, 0xef: 0x000a, + 0xf0: 0x0004, 0xf1: 0x0004, 0xf2: 0x0002, 0xf3: 0x0002, 0xf4: 0x000a, + 0xf6: 0x000a, 0xf7: 0x000a, 0xf8: 0x000a, 0xf9: 0x0002, 0xfb: 0x000a, + 0xfc: 0x000a, 0xfd: 0x000a, 0xfe: 0x000a, 0xff: 0x000a, + // Block 0x4, offset 0x100 + 0x117: 0x000a, + 0x137: 0x000a, + // Block 0x5, offset 0x140 + 0x179: 0x000a, 0x17a: 0x000a, + // Block 0x6, offset 0x180 + 0x182: 0x000a, 0x183: 0x000a, 0x184: 0x000a, 0x185: 0x000a, + 0x186: 0x000a, 0x187: 0x000a, 0x188: 0x000a, 0x189: 0x000a, 0x18a: 0x000a, 0x18b: 0x000a, + 0x18c: 0x000a, 0x18d: 0x000a, 0x18e: 0x000a, 0x18f: 0x000a, + 0x192: 0x000a, 0x193: 0x000a, 0x194: 0x000a, 0x195: 0x000a, 0x196: 0x000a, 0x197: 0x000a, + 0x198: 0x000a, 0x199: 0x000a, 0x19a: 0x000a, 0x19b: 0x000a, 0x19c: 0x000a, 0x19d: 0x000a, + 0x19e: 0x000a, 0x19f: 0x000a, + 0x1a5: 0x000a, 0x1a6: 0x000a, 0x1a7: 0x000a, 0x1a8: 0x000a, 0x1a9: 0x000a, + 0x1aa: 0x000a, 0x1ab: 0x000a, 0x1ac: 0x000a, 0x1ad: 0x000a, 0x1af: 0x000a, + 0x1b0: 0x000a, 0x1b1: 0x000a, 0x1b2: 0x000a, 0x1b3: 0x000a, 0x1b4: 0x000a, 0x1b5: 0x000a, + 0x1b6: 0x000a, 0x1b7: 0x000a, 0x1b8: 0x000a, 0x1b9: 0x000a, 0x1ba: 0x000a, 0x1bb: 0x000a, + 0x1bc: 0x000a, 0x1bd: 0x000a, 0x1be: 0x000a, 0x1bf: 0x000a, + // Block 0x7, offset 0x1c0 + 0x1c0: 0x000c, 0x1c1: 0x000c, 0x1c2: 0x000c, 0x1c3: 0x000c, 0x1c4: 0x000c, 0x1c5: 0x000c, + 0x1c6: 0x000c, 0x1c7: 0x000c, 0x1c8: 0x000c, 0x1c9: 0x000c, 0x1ca: 0x000c, 0x1cb: 0x000c, + 0x1cc: 0x000c, 0x1cd: 0x000c, 0x1ce: 0x000c, 0x1cf: 0x000c, 0x1d0: 0x000c, 0x1d1: 0x000c, + 0x1d2: 0x000c, 0x1d3: 0x000c, 0x1d4: 0x000c, 0x1d5: 0x000c, 0x1d6: 0x000c, 0x1d7: 0x000c, + 0x1d8: 0x000c, 0x1d9: 0x000c, 0x1da: 0x000c, 0x1db: 0x000c, 0x1dc: 0x000c, 0x1dd: 0x000c, + 0x1de: 0x000c, 0x1df: 0x000c, 0x1e0: 0x000c, 0x1e1: 0x000c, 0x1e2: 0x000c, 0x1e3: 0x000c, + 0x1e4: 0x000c, 0x1e5: 0x000c, 0x1e6: 0x000c, 0x1e7: 0x000c, 0x1e8: 0x000c, 0x1e9: 0x000c, + 0x1ea: 0x000c, 0x1eb: 0x000c, 0x1ec: 0x000c, 0x1ed: 0x000c, 0x1ee: 0x000c, 0x1ef: 0x000c, + 0x1f0: 0x000c, 0x1f1: 0x000c, 0x1f2: 0x000c, 0x1f3: 0x000c, 0x1f4: 0x000c, 0x1f5: 0x000c, + 0x1f6: 0x000c, 0x1f7: 0x000c, 0x1f8: 0x000c, 0x1f9: 0x000c, 0x1fa: 0x000c, 0x1fb: 0x000c, + 0x1fc: 0x000c, 0x1fd: 0x000c, 0x1fe: 0x000c, 0x1ff: 0x000c, + // Block 0x8, offset 0x200 + 0x200: 0x000c, 0x201: 0x000c, 0x202: 0x000c, 0x203: 0x000c, 0x204: 0x000c, 0x205: 0x000c, + 0x206: 0x000c, 0x207: 0x000c, 0x208: 0x000c, 0x209: 0x000c, 0x20a: 0x000c, 0x20b: 0x000c, + 0x20c: 0x000c, 0x20d: 0x000c, 0x20e: 0x000c, 0x20f: 0x000c, 0x210: 0x000c, 0x211: 0x000c, + 0x212: 0x000c, 0x213: 0x000c, 0x214: 0x000c, 0x215: 0x000c, 0x216: 0x000c, 0x217: 0x000c, + 0x218: 0x000c, 0x219: 0x000c, 0x21a: 0x000c, 0x21b: 0x000c, 0x21c: 0x000c, 0x21d: 0x000c, + 0x21e: 0x000c, 0x21f: 0x000c, 0x220: 0x000c, 0x221: 0x000c, 0x222: 0x000c, 0x223: 0x000c, + 0x224: 0x000c, 0x225: 0x000c, 0x226: 0x000c, 0x227: 0x000c, 0x228: 0x000c, 0x229: 0x000c, + 0x22a: 0x000c, 0x22b: 0x000c, 0x22c: 0x000c, 0x22d: 0x000c, 0x22e: 0x000c, 0x22f: 0x000c, + 0x234: 0x000a, 0x235: 0x000a, + 0x23e: 0x000a, + // Block 0x9, offset 0x240 + 0x244: 0x000a, 0x245: 0x000a, + 0x247: 0x000a, + // Block 0xa, offset 0x280 + 0x2b6: 0x000a, + // Block 0xb, offset 0x2c0 + 0x2c3: 0x000c, 0x2c4: 0x000c, 0x2c5: 0x000c, + 0x2c6: 0x000c, 0x2c7: 0x000c, 0x2c8: 0x000c, 0x2c9: 0x000c, + // Block 0xc, offset 0x300 + 0x30a: 0x000a, + 0x30d: 0x000a, 0x30e: 0x000a, 0x30f: 0x0004, 0x310: 0x0001, 0x311: 0x000c, + 0x312: 0x000c, 0x313: 0x000c, 0x314: 0x000c, 0x315: 0x000c, 0x316: 0x000c, 0x317: 0x000c, + 0x318: 0x000c, 0x319: 0x000c, 0x31a: 0x000c, 0x31b: 0x000c, 0x31c: 0x000c, 0x31d: 0x000c, + 0x31e: 0x000c, 0x31f: 0x000c, 0x320: 0x000c, 0x321: 0x000c, 0x322: 0x000c, 0x323: 0x000c, + 0x324: 0x000c, 0x325: 0x000c, 0x326: 0x000c, 0x327: 0x000c, 0x328: 0x000c, 0x329: 0x000c, + 0x32a: 0x000c, 0x32b: 0x000c, 0x32c: 0x000c, 0x32d: 0x000c, 0x32e: 0x000c, 0x32f: 0x000c, + 0x330: 0x000c, 0x331: 0x000c, 0x332: 0x000c, 0x333: 0x000c, 0x334: 0x000c, 0x335: 0x000c, + 0x336: 0x000c, 0x337: 0x000c, 0x338: 0x000c, 0x339: 0x000c, 0x33a: 0x000c, 0x33b: 0x000c, + 0x33c: 0x000c, 0x33d: 0x000c, 0x33e: 0x0001, 0x33f: 0x000c, + // Block 0xd, offset 0x340 + 0x340: 0x0001, 0x341: 0x000c, 0x342: 0x000c, 0x343: 0x0001, 0x344: 0x000c, 0x345: 0x000c, + 0x346: 0x0001, 0x347: 0x000c, 0x348: 0x0001, 0x349: 0x0001, 0x34a: 0x0001, 0x34b: 0x0001, + 0x34c: 0x0001, 0x34d: 0x0001, 0x34e: 0x0001, 0x34f: 0x0001, 0x350: 0x0001, 0x351: 0x0001, + 0x352: 0x0001, 0x353: 0x0001, 0x354: 0x0001, 0x355: 0x0001, 0x356: 0x0001, 0x357: 0x0001, + 0x358: 0x0001, 0x359: 0x0001, 0x35a: 0x0001, 0x35b: 0x0001, 0x35c: 0x0001, 0x35d: 0x0001, + 0x35e: 0x0001, 0x35f: 0x0001, 0x360: 0x0001, 0x361: 0x0001, 0x362: 0x0001, 0x363: 0x0001, + 0x364: 0x0001, 0x365: 0x0001, 0x366: 0x0001, 0x367: 0x0001, 0x368: 0x0001, 0x369: 0x0001, + 0x36a: 0x0001, 0x36b: 0x0001, 0x36c: 0x0001, 0x36d: 0x0001, 0x36e: 0x0001, 0x36f: 0x0001, + 0x370: 0x0001, 0x371: 0x0001, 0x372: 0x0001, 0x373: 0x0001, 0x374: 0x0001, 0x375: 0x0001, + 0x376: 0x0001, 0x377: 0x0001, 0x378: 0x0001, 0x379: 0x0001, 0x37a: 0x0001, 0x37b: 0x0001, + 0x37c: 0x0001, 0x37d: 0x0001, 0x37e: 0x0001, 0x37f: 0x0001, + // Block 0xe, offset 0x380 + 0x380: 0x0005, 0x381: 0x0005, 0x382: 0x0005, 0x383: 0x0005, 0x384: 0x0005, 0x385: 0x0005, + 0x386: 0x000a, 0x387: 0x000a, 0x388: 0x000d, 0x389: 0x0004, 0x38a: 0x0004, 0x38b: 0x000d, + 0x38c: 0x0006, 0x38d: 0x000d, 0x38e: 0x000a, 0x38f: 0x000a, 0x390: 0x000c, 0x391: 0x000c, + 0x392: 0x000c, 0x393: 0x000c, 0x394: 0x000c, 0x395: 0x000c, 0x396: 0x000c, 0x397: 0x000c, + 0x398: 0x000c, 0x399: 0x000c, 0x39a: 0x000c, 0x39b: 0x000d, 0x39c: 0x000d, 0x39d: 0x000d, + 0x39e: 0x000d, 0x39f: 0x000d, 0x3a0: 0x000d, 0x3a1: 0x000d, 0x3a2: 0x000d, 0x3a3: 0x000d, + 0x3a4: 0x000d, 0x3a5: 0x000d, 0x3a6: 0x000d, 0x3a7: 0x000d, 0x3a8: 0x000d, 0x3a9: 0x000d, + 0x3aa: 0x000d, 0x3ab: 0x000d, 0x3ac: 0x000d, 0x3ad: 0x000d, 0x3ae: 0x000d, 0x3af: 0x000d, + 0x3b0: 0x000d, 0x3b1: 0x000d, 0x3b2: 0x000d, 0x3b3: 0x000d, 0x3b4: 0x000d, 0x3b5: 0x000d, + 0x3b6: 0x000d, 0x3b7: 0x000d, 0x3b8: 0x000d, 0x3b9: 0x000d, 0x3ba: 0x000d, 0x3bb: 0x000d, + 0x3bc: 0x000d, 0x3bd: 0x000d, 0x3be: 0x000d, 0x3bf: 0x000d, + // Block 0xf, offset 0x3c0 + 0x3c0: 0x000d, 0x3c1: 0x000d, 0x3c2: 0x000d, 0x3c3: 0x000d, 0x3c4: 0x000d, 0x3c5: 0x000d, + 0x3c6: 0x000d, 0x3c7: 0x000d, 0x3c8: 0x000d, 0x3c9: 0x000d, 0x3ca: 0x000d, 0x3cb: 0x000c, + 0x3cc: 0x000c, 0x3cd: 0x000c, 0x3ce: 0x000c, 0x3cf: 0x000c, 0x3d0: 0x000c, 0x3d1: 0x000c, + 0x3d2: 0x000c, 0x3d3: 0x000c, 0x3d4: 0x000c, 0x3d5: 0x000c, 0x3d6: 0x000c, 0x3d7: 0x000c, + 0x3d8: 0x000c, 0x3d9: 0x000c, 0x3da: 0x000c, 0x3db: 0x000c, 0x3dc: 0x000c, 0x3dd: 0x000c, + 0x3de: 0x000c, 0x3df: 0x000c, 0x3e0: 0x0005, 0x3e1: 0x0005, 0x3e2: 0x0005, 0x3e3: 0x0005, + 0x3e4: 0x0005, 0x3e5: 0x0005, 0x3e6: 0x0005, 0x3e7: 0x0005, 0x3e8: 0x0005, 0x3e9: 0x0005, + 0x3ea: 0x0004, 0x3eb: 0x0005, 0x3ec: 0x0005, 0x3ed: 0x000d, 0x3ee: 0x000d, 0x3ef: 0x000d, + 0x3f0: 0x000c, 0x3f1: 0x000d, 0x3f2: 0x000d, 0x3f3: 0x000d, 0x3f4: 0x000d, 0x3f5: 0x000d, + 0x3f6: 0x000d, 0x3f7: 0x000d, 0x3f8: 0x000d, 0x3f9: 0x000d, 0x3fa: 0x000d, 0x3fb: 0x000d, + 0x3fc: 0x000d, 0x3fd: 0x000d, 0x3fe: 0x000d, 0x3ff: 0x000d, + // Block 0x10, offset 0x400 + 0x400: 0x000d, 0x401: 0x000d, 0x402: 0x000d, 0x403: 0x000d, 0x404: 0x000d, 0x405: 0x000d, + 0x406: 0x000d, 0x407: 0x000d, 0x408: 0x000d, 0x409: 0x000d, 0x40a: 0x000d, 0x40b: 0x000d, + 0x40c: 0x000d, 0x40d: 0x000d, 0x40e: 0x000d, 0x40f: 0x000d, 0x410: 0x000d, 0x411: 0x000d, + 0x412: 0x000d, 0x413: 0x000d, 0x414: 0x000d, 0x415: 0x000d, 0x416: 0x000d, 0x417: 0x000d, + 0x418: 0x000d, 0x419: 0x000d, 0x41a: 0x000d, 0x41b: 0x000d, 0x41c: 0x000d, 0x41d: 0x000d, + 0x41e: 0x000d, 0x41f: 0x000d, 0x420: 0x000d, 0x421: 0x000d, 0x422: 0x000d, 0x423: 0x000d, + 0x424: 0x000d, 0x425: 0x000d, 0x426: 0x000d, 0x427: 0x000d, 0x428: 0x000d, 0x429: 0x000d, + 0x42a: 0x000d, 0x42b: 0x000d, 0x42c: 0x000d, 0x42d: 0x000d, 0x42e: 0x000d, 0x42f: 0x000d, + 0x430: 0x000d, 0x431: 0x000d, 0x432: 0x000d, 0x433: 0x000d, 0x434: 0x000d, 0x435: 0x000d, + 0x436: 0x000d, 0x437: 0x000d, 0x438: 0x000d, 0x439: 0x000d, 0x43a: 0x000d, 0x43b: 0x000d, + 0x43c: 0x000d, 0x43d: 0x000d, 0x43e: 0x000d, 0x43f: 0x000d, + // Block 0x11, offset 0x440 + 0x440: 0x000d, 0x441: 0x000d, 0x442: 0x000d, 0x443: 0x000d, 0x444: 0x000d, 0x445: 0x000d, + 0x446: 0x000d, 0x447: 0x000d, 0x448: 0x000d, 0x449: 0x000d, 0x44a: 0x000d, 0x44b: 0x000d, + 0x44c: 0x000d, 0x44d: 0x000d, 0x44e: 0x000d, 0x44f: 0x000d, 0x450: 0x000d, 0x451: 0x000d, + 0x452: 0x000d, 0x453: 0x000d, 0x454: 0x000d, 0x455: 0x000d, 0x456: 0x000c, 0x457: 0x000c, + 0x458: 0x000c, 0x459: 0x000c, 0x45a: 0x000c, 0x45b: 0x000c, 0x45c: 0x000c, 0x45d: 0x0005, + 0x45e: 0x000a, 0x45f: 0x000c, 0x460: 0x000c, 0x461: 0x000c, 0x462: 0x000c, 0x463: 0x000c, + 0x464: 0x000c, 0x465: 0x000d, 0x466: 0x000d, 0x467: 0x000c, 0x468: 0x000c, 0x469: 0x000a, + 0x46a: 0x000c, 0x46b: 0x000c, 0x46c: 0x000c, 0x46d: 0x000c, 0x46e: 0x000d, 0x46f: 0x000d, + 0x470: 0x0002, 0x471: 0x0002, 0x472: 0x0002, 0x473: 0x0002, 0x474: 0x0002, 0x475: 0x0002, + 0x476: 0x0002, 0x477: 0x0002, 0x478: 0x0002, 0x479: 0x0002, 0x47a: 0x000d, 0x47b: 0x000d, + 0x47c: 0x000d, 0x47d: 0x000d, 0x47e: 0x000d, 0x47f: 0x000d, + // Block 0x12, offset 0x480 + 0x480: 0x000d, 0x481: 0x000d, 0x482: 0x000d, 0x483: 0x000d, 0x484: 0x000d, 0x485: 0x000d, + 0x486: 0x000d, 0x487: 0x000d, 0x488: 0x000d, 0x489: 0x000d, 0x48a: 0x000d, 0x48b: 0x000d, + 0x48c: 0x000d, 0x48d: 0x000d, 0x48e: 0x000d, 0x48f: 0x000d, 0x490: 0x000d, 0x491: 0x000c, + 0x492: 0x000d, 0x493: 0x000d, 0x494: 0x000d, 0x495: 0x000d, 0x496: 0x000d, 0x497: 0x000d, + 0x498: 0x000d, 0x499: 0x000d, 0x49a: 0x000d, 0x49b: 0x000d, 0x49c: 0x000d, 0x49d: 0x000d, + 0x49e: 0x000d, 0x49f: 0x000d, 0x4a0: 0x000d, 0x4a1: 0x000d, 0x4a2: 0x000d, 0x4a3: 0x000d, + 0x4a4: 0x000d, 0x4a5: 0x000d, 0x4a6: 0x000d, 0x4a7: 0x000d, 0x4a8: 0x000d, 0x4a9: 0x000d, + 0x4aa: 0x000d, 0x4ab: 0x000d, 0x4ac: 0x000d, 0x4ad: 0x000d, 0x4ae: 0x000d, 0x4af: 0x000d, + 0x4b0: 0x000c, 0x4b1: 0x000c, 0x4b2: 0x000c, 0x4b3: 0x000c, 0x4b4: 0x000c, 0x4b5: 0x000c, + 0x4b6: 0x000c, 0x4b7: 0x000c, 0x4b8: 0x000c, 0x4b9: 0x000c, 0x4ba: 0x000c, 0x4bb: 0x000c, + 0x4bc: 0x000c, 0x4bd: 0x000c, 0x4be: 0x000c, 0x4bf: 0x000c, + // Block 0x13, offset 0x4c0 + 0x4c0: 0x000c, 0x4c1: 0x000c, 0x4c2: 0x000c, 0x4c3: 0x000c, 0x4c4: 0x000c, 0x4c5: 0x000c, + 0x4c6: 0x000c, 0x4c7: 0x000c, 0x4c8: 0x000c, 0x4c9: 0x000c, 0x4ca: 0x000c, 0x4cb: 0x000d, + 0x4cc: 0x000d, 0x4cd: 0x000d, 0x4ce: 0x000d, 0x4cf: 0x000d, 0x4d0: 0x000d, 0x4d1: 0x000d, + 0x4d2: 0x000d, 0x4d3: 0x000d, 0x4d4: 0x000d, 0x4d5: 0x000d, 0x4d6: 0x000d, 0x4d7: 0x000d, + 0x4d8: 0x000d, 0x4d9: 0x000d, 0x4da: 0x000d, 0x4db: 0x000d, 0x4dc: 0x000d, 0x4dd: 0x000d, + 0x4de: 0x000d, 0x4df: 0x000d, 0x4e0: 0x000d, 0x4e1: 0x000d, 0x4e2: 0x000d, 0x4e3: 0x000d, + 0x4e4: 0x000d, 0x4e5: 0x000d, 0x4e6: 0x000d, 0x4e7: 0x000d, 0x4e8: 0x000d, 0x4e9: 0x000d, + 0x4ea: 0x000d, 0x4eb: 0x000d, 0x4ec: 0x000d, 0x4ed: 0x000d, 0x4ee: 0x000d, 0x4ef: 0x000d, + 0x4f0: 0x000d, 0x4f1: 0x000d, 0x4f2: 0x000d, 0x4f3: 0x000d, 0x4f4: 0x000d, 0x4f5: 0x000d, + 0x4f6: 0x000d, 0x4f7: 0x000d, 0x4f8: 0x000d, 0x4f9: 0x000d, 0x4fa: 0x000d, 0x4fb: 0x000d, + 0x4fc: 0x000d, 0x4fd: 0x000d, 0x4fe: 0x000d, 0x4ff: 0x000d, + // Block 0x14, offset 0x500 + 0x500: 0x000d, 0x501: 0x000d, 0x502: 0x000d, 0x503: 0x000d, 0x504: 0x000d, 0x505: 0x000d, + 0x506: 0x000d, 0x507: 0x000d, 0x508: 0x000d, 0x509: 0x000d, 0x50a: 0x000d, 0x50b: 0x000d, + 0x50c: 0x000d, 0x50d: 0x000d, 0x50e: 0x000d, 0x50f: 0x000d, 0x510: 0x000d, 0x511: 0x000d, + 0x512: 0x000d, 0x513: 0x000d, 0x514: 0x000d, 0x515: 0x000d, 0x516: 0x000d, 0x517: 0x000d, + 0x518: 0x000d, 0x519: 0x000d, 0x51a: 0x000d, 0x51b: 0x000d, 0x51c: 0x000d, 0x51d: 0x000d, + 0x51e: 0x000d, 0x51f: 0x000d, 0x520: 0x000d, 0x521: 0x000d, 0x522: 0x000d, 0x523: 0x000d, + 0x524: 0x000d, 0x525: 0x000d, 0x526: 0x000c, 0x527: 0x000c, 0x528: 0x000c, 0x529: 0x000c, + 0x52a: 0x000c, 0x52b: 0x000c, 0x52c: 0x000c, 0x52d: 0x000c, 0x52e: 0x000c, 0x52f: 0x000c, + 0x530: 0x000c, 0x531: 0x000d, 0x532: 0x000d, 0x533: 0x000d, 0x534: 0x000d, 0x535: 0x000d, + 0x536: 0x000d, 0x537: 0x000d, 0x538: 0x000d, 0x539: 0x000d, 0x53a: 0x000d, 0x53b: 0x000d, + 0x53c: 0x000d, 0x53d: 0x000d, 0x53e: 0x000d, 0x53f: 0x000d, + // Block 0x15, offset 0x540 + 0x540: 0x0001, 0x541: 0x0001, 0x542: 0x0001, 0x543: 0x0001, 0x544: 0x0001, 0x545: 0x0001, + 0x546: 0x0001, 0x547: 0x0001, 0x548: 0x0001, 0x549: 0x0001, 0x54a: 0x0001, 0x54b: 0x0001, + 0x54c: 0x0001, 0x54d: 0x0001, 0x54e: 0x0001, 0x54f: 0x0001, 0x550: 0x0001, 0x551: 0x0001, + 0x552: 0x0001, 0x553: 0x0001, 0x554: 0x0001, 0x555: 0x0001, 0x556: 0x0001, 0x557: 0x0001, + 0x558: 0x0001, 0x559: 0x0001, 0x55a: 0x0001, 0x55b: 0x0001, 0x55c: 0x0001, 0x55d: 0x0001, + 0x55e: 0x0001, 0x55f: 0x0001, 0x560: 0x0001, 0x561: 0x0001, 0x562: 0x0001, 0x563: 0x0001, + 0x564: 0x0001, 0x565: 0x0001, 0x566: 0x0001, 0x567: 0x0001, 0x568: 0x0001, 0x569: 0x0001, + 0x56a: 0x0001, 0x56b: 0x000c, 0x56c: 0x000c, 0x56d: 0x000c, 0x56e: 0x000c, 0x56f: 0x000c, + 0x570: 0x000c, 0x571: 0x000c, 0x572: 0x000c, 0x573: 0x000c, 0x574: 0x0001, 0x575: 0x0001, + 0x576: 0x000a, 0x577: 0x000a, 0x578: 0x000a, 0x579: 0x000a, 0x57a: 0x0001, 0x57b: 0x0001, + 0x57c: 0x0001, 0x57d: 0x000c, 0x57e: 0x0001, 0x57f: 0x0001, + // Block 0x16, offset 0x580 + 0x580: 0x0001, 0x581: 0x0001, 0x582: 0x0001, 0x583: 0x0001, 0x584: 0x0001, 0x585: 0x0001, + 0x586: 0x0001, 0x587: 0x0001, 0x588: 0x0001, 0x589: 0x0001, 0x58a: 0x0001, 0x58b: 0x0001, + 0x58c: 0x0001, 0x58d: 0x0001, 0x58e: 0x0001, 0x58f: 0x0001, 0x590: 0x0001, 0x591: 0x0001, + 0x592: 0x0001, 0x593: 0x0001, 0x594: 0x0001, 0x595: 0x0001, 0x596: 0x000c, 0x597: 0x000c, + 0x598: 0x000c, 0x599: 0x000c, 0x59a: 0x0001, 0x59b: 0x000c, 0x59c: 0x000c, 0x59d: 0x000c, + 0x59e: 0x000c, 0x59f: 0x000c, 0x5a0: 0x000c, 0x5a1: 0x000c, 0x5a2: 0x000c, 0x5a3: 0x000c, + 0x5a4: 0x0001, 0x5a5: 0x000c, 0x5a6: 0x000c, 0x5a7: 0x000c, 0x5a8: 0x0001, 0x5a9: 0x000c, + 0x5aa: 0x000c, 0x5ab: 0x000c, 0x5ac: 0x000c, 0x5ad: 0x000c, 0x5ae: 0x0001, 0x5af: 0x0001, + 0x5b0: 0x0001, 0x5b1: 0x0001, 0x5b2: 0x0001, 0x5b3: 0x0001, 0x5b4: 0x0001, 0x5b5: 0x0001, + 0x5b6: 0x0001, 0x5b7: 0x0001, 0x5b8: 0x0001, 0x5b9: 0x0001, 0x5ba: 0x0001, 0x5bb: 0x0001, + 0x5bc: 0x0001, 0x5bd: 0x0001, 0x5be: 0x0001, 0x5bf: 0x0001, + // Block 0x17, offset 0x5c0 + 0x5c0: 0x0001, 0x5c1: 0x0001, 0x5c2: 0x0001, 0x5c3: 0x0001, 0x5c4: 0x0001, 0x5c5: 0x0001, + 0x5c6: 0x0001, 0x5c7: 0x0001, 0x5c8: 0x0001, 0x5c9: 0x0001, 0x5ca: 0x0001, 0x5cb: 0x0001, + 0x5cc: 0x0001, 0x5cd: 0x0001, 0x5ce: 0x0001, 0x5cf: 0x0001, 0x5d0: 0x0001, 0x5d1: 0x0001, + 0x5d2: 0x0001, 0x5d3: 0x0001, 0x5d4: 0x0001, 0x5d5: 0x0001, 0x5d6: 0x0001, 0x5d7: 0x0001, + 0x5d8: 0x0001, 0x5d9: 0x000c, 0x5da: 0x000c, 0x5db: 0x000c, 0x5dc: 0x0001, 0x5dd: 0x0001, + 0x5de: 0x0001, 0x5df: 0x0001, 0x5e0: 0x000d, 0x5e1: 0x000d, 0x5e2: 0x000d, 0x5e3: 0x000d, + 0x5e4: 0x000d, 0x5e5: 0x000d, 0x5e6: 0x000d, 0x5e7: 0x000d, 0x5e8: 0x000d, 0x5e9: 0x000d, + 0x5ea: 0x000d, 0x5eb: 0x000d, 0x5ec: 0x000d, 0x5ed: 0x000d, 0x5ee: 0x000d, 0x5ef: 0x000d, + 0x5f0: 0x0001, 0x5f1: 0x0001, 0x5f2: 0x0001, 0x5f3: 0x0001, 0x5f4: 0x0001, 0x5f5: 0x0001, + 0x5f6: 0x0001, 0x5f7: 0x0001, 0x5f8: 0x0001, 0x5f9: 0x0001, 0x5fa: 0x0001, 0x5fb: 0x0001, + 0x5fc: 0x0001, 0x5fd: 0x0001, 0x5fe: 0x0001, 0x5ff: 0x0001, + // Block 0x18, offset 0x600 + 0x600: 0x0001, 0x601: 0x0001, 0x602: 0x0001, 0x603: 0x0001, 0x604: 0x0001, 0x605: 0x0001, + 0x606: 0x0001, 0x607: 0x0001, 0x608: 0x0001, 0x609: 0x0001, 0x60a: 0x0001, 0x60b: 0x0001, + 0x60c: 0x0001, 0x60d: 0x0001, 0x60e: 0x0001, 0x60f: 0x0001, 0x610: 0x0001, 0x611: 0x0001, + 0x612: 0x0001, 0x613: 0x0001, 0x614: 0x0001, 0x615: 0x0001, 0x616: 0x0001, 0x617: 0x0001, + 0x618: 0x0001, 0x619: 0x0001, 0x61a: 0x0001, 0x61b: 0x0001, 0x61c: 0x0001, 0x61d: 0x0001, + 0x61e: 0x0001, 0x61f: 0x0001, 0x620: 0x000d, 0x621: 0x000d, 0x622: 0x000d, 0x623: 0x000d, + 0x624: 0x000d, 0x625: 0x000d, 0x626: 0x000d, 0x627: 0x000d, 0x628: 0x000d, 0x629: 0x000d, + 0x62a: 0x000d, 0x62b: 0x000d, 0x62c: 0x000d, 0x62d: 0x000d, 0x62e: 0x000d, 0x62f: 0x000d, + 0x630: 0x000d, 0x631: 0x000d, 0x632: 0x000d, 0x633: 0x000d, 0x634: 0x000d, 0x635: 0x000d, + 0x636: 0x000d, 0x637: 0x000d, 0x638: 0x000d, 0x639: 0x000d, 0x63a: 0x000d, 0x63b: 0x000d, + 0x63c: 0x000d, 0x63d: 0x000d, 0x63e: 0x000d, 0x63f: 0x000d, + // Block 0x19, offset 0x640 + 0x640: 0x000d, 0x641: 0x000d, 0x642: 0x000d, 0x643: 0x000d, 0x644: 0x000d, 0x645: 0x000d, + 0x646: 0x000d, 0x647: 0x000d, 0x648: 0x000d, 0x649: 0x000d, 0x64a: 0x000d, 0x64b: 0x000d, + 0x64c: 0x000d, 0x64d: 0x000d, 0x64e: 0x000d, 0x64f: 0x000d, 0x650: 0x000d, 0x651: 0x000d, + 0x652: 0x000d, 0x653: 0x000c, 0x654: 0x000c, 0x655: 0x000c, 0x656: 0x000c, 0x657: 0x000c, + 0x658: 0x000c, 0x659: 0x000c, 0x65a: 0x000c, 0x65b: 0x000c, 0x65c: 0x000c, 0x65d: 0x000c, + 0x65e: 0x000c, 0x65f: 0x000c, 0x660: 0x000c, 0x661: 0x000c, 0x662: 0x0005, 0x663: 0x000c, + 0x664: 0x000c, 0x665: 0x000c, 0x666: 0x000c, 0x667: 0x000c, 0x668: 0x000c, 0x669: 0x000c, + 0x66a: 0x000c, 0x66b: 0x000c, 0x66c: 0x000c, 0x66d: 0x000c, 0x66e: 0x000c, 0x66f: 0x000c, + 0x670: 0x000c, 0x671: 0x000c, 0x672: 0x000c, 0x673: 0x000c, 0x674: 0x000c, 0x675: 0x000c, + 0x676: 0x000c, 0x677: 0x000c, 0x678: 0x000c, 0x679: 0x000c, 0x67a: 0x000c, 0x67b: 0x000c, + 0x67c: 0x000c, 0x67d: 0x000c, 0x67e: 0x000c, 0x67f: 0x000c, + // Block 0x1a, offset 0x680 + 0x680: 0x000c, 0x681: 0x000c, 0x682: 0x000c, + 0x6ba: 0x000c, + 0x6bc: 0x000c, + // Block 0x1b, offset 0x6c0 + 0x6c1: 0x000c, 0x6c2: 0x000c, 0x6c3: 0x000c, 0x6c4: 0x000c, 0x6c5: 0x000c, + 0x6c6: 0x000c, 0x6c7: 0x000c, 0x6c8: 0x000c, + 0x6cd: 0x000c, 0x6d1: 0x000c, + 0x6d2: 0x000c, 0x6d3: 0x000c, 0x6d4: 0x000c, 0x6d5: 0x000c, 0x6d6: 0x000c, 0x6d7: 0x000c, + 0x6e2: 0x000c, 0x6e3: 0x000c, + // Block 0x1c, offset 0x700 + 0x701: 0x000c, + 0x73c: 0x000c, + // Block 0x1d, offset 0x740 + 0x741: 0x000c, 0x742: 0x000c, 0x743: 0x000c, 0x744: 0x000c, + 0x74d: 0x000c, + 0x762: 0x000c, 0x763: 0x000c, + 0x772: 0x0004, 0x773: 0x0004, + 0x77b: 0x0004, + 0x77e: 0x000c, + // Block 0x1e, offset 0x780 + 0x781: 0x000c, 0x782: 0x000c, + 0x7bc: 0x000c, + // Block 0x1f, offset 0x7c0 + 0x7c1: 0x000c, 0x7c2: 0x000c, + 0x7c7: 0x000c, 0x7c8: 0x000c, 0x7cb: 0x000c, + 0x7cc: 0x000c, 0x7cd: 0x000c, 0x7d1: 0x000c, + 0x7f0: 0x000c, 0x7f1: 0x000c, 0x7f5: 0x000c, + // Block 0x20, offset 0x800 + 0x801: 0x000c, 0x802: 0x000c, 0x803: 0x000c, 0x804: 0x000c, 0x805: 0x000c, + 0x807: 0x000c, 0x808: 0x000c, + 0x80d: 0x000c, + 0x822: 0x000c, 0x823: 0x000c, + 0x831: 0x0004, + 0x83a: 0x000c, 0x83b: 0x000c, + 0x83c: 0x000c, 0x83d: 0x000c, 0x83e: 0x000c, 0x83f: 0x000c, + // Block 0x21, offset 0x840 + 0x841: 0x000c, + 0x87c: 0x000c, 0x87f: 0x000c, + // Block 0x22, offset 0x880 + 0x881: 0x000c, 0x882: 0x000c, 0x883: 0x000c, 0x884: 0x000c, + 0x88d: 0x000c, + 0x896: 0x000c, + 0x8a2: 0x000c, 0x8a3: 0x000c, + // Block 0x23, offset 0x8c0 + 0x8c2: 0x000c, + // Block 0x24, offset 0x900 + 0x900: 0x000c, + 0x90d: 0x000c, + 0x933: 0x000a, 0x934: 0x000a, 0x935: 0x000a, + 0x936: 0x000a, 0x937: 0x000a, 0x938: 0x000a, 0x939: 0x0004, 0x93a: 0x000a, + // Block 0x25, offset 0x940 + 0x940: 0x000c, 0x944: 0x000c, + 0x97e: 0x000c, 0x97f: 0x000c, + // Block 0x26, offset 0x980 + 0x980: 0x000c, + 0x986: 0x000c, 0x987: 0x000c, 0x988: 0x000c, 0x98a: 0x000c, 0x98b: 0x000c, + 0x98c: 0x000c, 0x98d: 0x000c, + 0x995: 0x000c, 0x996: 0x000c, + 0x9a2: 0x000c, 0x9a3: 0x000c, + 0x9b8: 0x000a, 0x9b9: 0x000a, 0x9ba: 0x000a, 0x9bb: 0x000a, + 0x9bc: 0x000a, 0x9bd: 0x000a, 0x9be: 0x000a, + // Block 0x27, offset 0x9c0 + 0x9cc: 0x000c, 0x9cd: 0x000c, + 0x9e2: 0x000c, 0x9e3: 0x000c, + // Block 0x28, offset 0xa00 + 0xa00: 0x000c, 0xa01: 0x000c, + 0xa3b: 0x000c, + 0xa3c: 0x000c, + // Block 0x29, offset 0xa40 + 0xa41: 0x000c, 0xa42: 0x000c, 0xa43: 0x000c, 0xa44: 0x000c, + 0xa4d: 0x000c, + 0xa62: 0x000c, 0xa63: 0x000c, + // Block 0x2a, offset 0xa80 + 0xa8a: 0x000c, + 0xa92: 0x000c, 0xa93: 0x000c, 0xa94: 0x000c, 0xa96: 0x000c, + // Block 0x2b, offset 0xac0 + 0xaf1: 0x000c, 0xaf4: 0x000c, 0xaf5: 0x000c, + 0xaf6: 0x000c, 0xaf7: 0x000c, 0xaf8: 0x000c, 0xaf9: 0x000c, 0xafa: 0x000c, + 0xaff: 0x0004, + // Block 0x2c, offset 0xb00 + 0xb07: 0x000c, 0xb08: 0x000c, 0xb09: 0x000c, 0xb0a: 0x000c, 0xb0b: 0x000c, + 0xb0c: 0x000c, 0xb0d: 0x000c, 0xb0e: 0x000c, + // Block 0x2d, offset 0xb40 + 0xb71: 0x000c, 0xb74: 0x000c, 0xb75: 0x000c, + 0xb76: 0x000c, 0xb77: 0x000c, 0xb78: 0x000c, 0xb79: 0x000c, 0xb7b: 0x000c, + 0xb7c: 0x000c, + // Block 0x2e, offset 0xb80 + 0xb88: 0x000c, 0xb89: 0x000c, 0xb8a: 0x000c, 0xb8b: 0x000c, + 0xb8c: 0x000c, 0xb8d: 0x000c, + // Block 0x2f, offset 0xbc0 + 0xbd8: 0x000c, 0xbd9: 0x000c, + 0xbf5: 0x000c, + 0xbf7: 0x000c, 0xbf9: 0x000c, 0xbfa: 0x003a, 0xbfb: 0x002a, + 0xbfc: 0x003a, 0xbfd: 0x002a, + // Block 0x30, offset 0xc00 + 0xc31: 0x000c, 0xc32: 0x000c, 0xc33: 0x000c, 0xc34: 0x000c, 0xc35: 0x000c, + 0xc36: 0x000c, 0xc37: 0x000c, 0xc38: 0x000c, 0xc39: 0x000c, 0xc3a: 0x000c, 0xc3b: 0x000c, + 0xc3c: 0x000c, 0xc3d: 0x000c, 0xc3e: 0x000c, + // Block 0x31, offset 0xc40 + 0xc40: 0x000c, 0xc41: 0x000c, 0xc42: 0x000c, 0xc43: 0x000c, 0xc44: 0x000c, + 0xc46: 0x000c, 0xc47: 0x000c, + 0xc4d: 0x000c, 0xc4e: 0x000c, 0xc4f: 0x000c, 0xc50: 0x000c, 0xc51: 0x000c, + 0xc52: 0x000c, 0xc53: 0x000c, 0xc54: 0x000c, 0xc55: 0x000c, 0xc56: 0x000c, 0xc57: 0x000c, + 0xc59: 0x000c, 0xc5a: 0x000c, 0xc5b: 0x000c, 0xc5c: 0x000c, 0xc5d: 0x000c, + 0xc5e: 0x000c, 0xc5f: 0x000c, 0xc60: 0x000c, 0xc61: 0x000c, 0xc62: 0x000c, 0xc63: 0x000c, + 0xc64: 0x000c, 0xc65: 0x000c, 0xc66: 0x000c, 0xc67: 0x000c, 0xc68: 0x000c, 0xc69: 0x000c, + 0xc6a: 0x000c, 0xc6b: 0x000c, 0xc6c: 0x000c, 0xc6d: 0x000c, 0xc6e: 0x000c, 0xc6f: 0x000c, + 0xc70: 0x000c, 0xc71: 0x000c, 0xc72: 0x000c, 0xc73: 0x000c, 0xc74: 0x000c, 0xc75: 0x000c, + 0xc76: 0x000c, 0xc77: 0x000c, 0xc78: 0x000c, 0xc79: 0x000c, 0xc7a: 0x000c, 0xc7b: 0x000c, + 0xc7c: 0x000c, + // Block 0x32, offset 0xc80 + 0xc86: 0x000c, + // Block 0x33, offset 0xcc0 + 0xced: 0x000c, 0xcee: 0x000c, 0xcef: 0x000c, + 0xcf0: 0x000c, 0xcf2: 0x000c, 0xcf3: 0x000c, 0xcf4: 0x000c, 0xcf5: 0x000c, + 0xcf6: 0x000c, 0xcf7: 0x000c, 0xcf9: 0x000c, 0xcfa: 0x000c, + 0xcfd: 0x000c, 0xcfe: 0x000c, + // Block 0x34, offset 0xd00 + 0xd18: 0x000c, 0xd19: 0x000c, + 0xd1e: 0x000c, 0xd1f: 0x000c, 0xd20: 0x000c, + 0xd31: 0x000c, 0xd32: 0x000c, 0xd33: 0x000c, 0xd34: 0x000c, + // Block 0x35, offset 0xd40 + 0xd42: 0x000c, 0xd45: 0x000c, + 0xd46: 0x000c, + 0xd4d: 0x000c, + 0xd5d: 0x000c, + // Block 0x36, offset 0xd80 + 0xd9d: 0x000c, + 0xd9e: 0x000c, 0xd9f: 0x000c, + // Block 0x37, offset 0xdc0 + 0xdd0: 0x000a, 0xdd1: 0x000a, + 0xdd2: 0x000a, 0xdd3: 0x000a, 0xdd4: 0x000a, 0xdd5: 0x000a, 0xdd6: 0x000a, 0xdd7: 0x000a, + 0xdd8: 0x000a, 0xdd9: 0x000a, + // Block 0x38, offset 0xe00 + 0xe00: 0x000a, + // Block 0x39, offset 0xe40 + 0xe40: 0x0009, + 0xe5b: 0x007a, 0xe5c: 0x006a, + // Block 0x3a, offset 0xe80 + 0xe92: 0x000c, 0xe93: 0x000c, 0xe94: 0x000c, + 0xeb2: 0x000c, 0xeb3: 0x000c, 0xeb4: 0x000c, + // Block 0x3b, offset 0xec0 + 0xed2: 0x000c, 0xed3: 0x000c, + 0xef2: 0x000c, 0xef3: 0x000c, + // Block 0x3c, offset 0xf00 + 0xf34: 0x000c, 0xf35: 0x000c, + 0xf37: 0x000c, 0xf38: 0x000c, 0xf39: 0x000c, 0xf3a: 0x000c, 0xf3b: 0x000c, + 0xf3c: 0x000c, 0xf3d: 0x000c, + // Block 0x3d, offset 0xf40 + 0xf46: 0x000c, 0xf49: 0x000c, 0xf4a: 0x000c, 0xf4b: 0x000c, + 0xf4c: 0x000c, 0xf4d: 0x000c, 0xf4e: 0x000c, 0xf4f: 0x000c, 0xf50: 0x000c, 0xf51: 0x000c, + 0xf52: 0x000c, 0xf53: 0x000c, + 0xf5b: 0x0004, 0xf5d: 0x000c, + 0xf70: 0x000a, 0xf71: 0x000a, 0xf72: 0x000a, 0xf73: 0x000a, 0xf74: 0x000a, 0xf75: 0x000a, + 0xf76: 0x000a, 0xf77: 0x000a, 0xf78: 0x000a, 0xf79: 0x000a, + // Block 0x3e, offset 0xf80 + 0xf80: 0x000a, 0xf81: 0x000a, 0xf82: 0x000a, 0xf83: 0x000a, 0xf84: 0x000a, 0xf85: 0x000a, + 0xf86: 0x000a, 0xf87: 0x000a, 0xf88: 0x000a, 0xf89: 0x000a, 0xf8a: 0x000a, 0xf8b: 0x000c, + 0xf8c: 0x000c, 0xf8d: 0x000c, 0xf8e: 0x000b, + // Block 0x3f, offset 0xfc0 + 0xfc5: 0x000c, + 0xfc6: 0x000c, + 0xfe9: 0x000c, + // Block 0x40, offset 0x1000 + 0x1020: 0x000c, 0x1021: 0x000c, 0x1022: 0x000c, + 0x1027: 0x000c, 0x1028: 0x000c, + 0x1032: 0x000c, + 0x1039: 0x000c, 0x103a: 0x000c, 0x103b: 0x000c, + // Block 0x41, offset 0x1040 + 0x1040: 0x000a, 0x1044: 0x000a, 0x1045: 0x000a, + // Block 0x42, offset 0x1080 + 0x109e: 0x000a, 0x109f: 0x000a, 0x10a0: 0x000a, 0x10a1: 0x000a, 0x10a2: 0x000a, 0x10a3: 0x000a, + 0x10a4: 0x000a, 0x10a5: 0x000a, 0x10a6: 0x000a, 0x10a7: 0x000a, 0x10a8: 0x000a, 0x10a9: 0x000a, + 0x10aa: 0x000a, 0x10ab: 0x000a, 0x10ac: 0x000a, 0x10ad: 0x000a, 0x10ae: 0x000a, 0x10af: 0x000a, + 0x10b0: 0x000a, 0x10b1: 0x000a, 0x10b2: 0x000a, 0x10b3: 0x000a, 0x10b4: 0x000a, 0x10b5: 0x000a, + 0x10b6: 0x000a, 0x10b7: 0x000a, 0x10b8: 0x000a, 0x10b9: 0x000a, 0x10ba: 0x000a, 0x10bb: 0x000a, + 0x10bc: 0x000a, 0x10bd: 0x000a, 0x10be: 0x000a, 0x10bf: 0x000a, + // Block 0x43, offset 0x10c0 + 0x10d7: 0x000c, + 0x10d8: 0x000c, 0x10db: 0x000c, + // Block 0x44, offset 0x1100 + 0x1116: 0x000c, + 0x1118: 0x000c, 0x1119: 0x000c, 0x111a: 0x000c, 0x111b: 0x000c, 0x111c: 0x000c, 0x111d: 0x000c, + 0x111e: 0x000c, 0x1120: 0x000c, 0x1122: 0x000c, + 0x1125: 0x000c, 0x1126: 0x000c, 0x1127: 0x000c, 0x1128: 0x000c, 0x1129: 0x000c, + 0x112a: 0x000c, 0x112b: 0x000c, 0x112c: 0x000c, + 0x1133: 0x000c, 0x1134: 0x000c, 0x1135: 0x000c, + 0x1136: 0x000c, 0x1137: 0x000c, 0x1138: 0x000c, 0x1139: 0x000c, 0x113a: 0x000c, 0x113b: 0x000c, + 0x113c: 0x000c, 0x113f: 0x000c, + // Block 0x45, offset 0x1140 + 0x1170: 0x000c, 0x1171: 0x000c, 0x1172: 0x000c, 0x1173: 0x000c, 0x1174: 0x000c, 0x1175: 0x000c, + 0x1176: 0x000c, 0x1177: 0x000c, 0x1178: 0x000c, 0x1179: 0x000c, 0x117a: 0x000c, 0x117b: 0x000c, + 0x117c: 0x000c, 0x117d: 0x000c, 0x117e: 0x000c, + // Block 0x46, offset 0x1180 + 0x1180: 0x000c, 0x1181: 0x000c, 0x1182: 0x000c, 0x1183: 0x000c, + 0x11b4: 0x000c, + 0x11b6: 0x000c, 0x11b7: 0x000c, 0x11b8: 0x000c, 0x11b9: 0x000c, 0x11ba: 0x000c, + 0x11bc: 0x000c, + // Block 0x47, offset 0x11c0 + 0x11c2: 0x000c, + 0x11eb: 0x000c, 0x11ec: 0x000c, 0x11ed: 0x000c, 0x11ee: 0x000c, 0x11ef: 0x000c, + 0x11f0: 0x000c, 0x11f1: 0x000c, 0x11f2: 0x000c, 0x11f3: 0x000c, + // Block 0x48, offset 0x1200 + 0x1200: 0x000c, 0x1201: 0x000c, + 0x1222: 0x000c, 0x1223: 0x000c, + 0x1224: 0x000c, 0x1225: 0x000c, 0x1228: 0x000c, 0x1229: 0x000c, + 0x122b: 0x000c, 0x122c: 0x000c, 0x122d: 0x000c, + // Block 0x49, offset 0x1240 + 0x1266: 0x000c, 0x1268: 0x000c, 0x1269: 0x000c, + 0x126d: 0x000c, 0x126f: 0x000c, + 0x1270: 0x000c, 0x1271: 0x000c, + // Block 0x4a, offset 0x1280 + 0x12ac: 0x000c, 0x12ad: 0x000c, 0x12ae: 0x000c, 0x12af: 0x000c, + 0x12b0: 0x000c, 0x12b1: 0x000c, 0x12b2: 0x000c, 0x12b3: 0x000c, + 0x12b6: 0x000c, 0x12b7: 0x000c, + // Block 0x4b, offset 0x12c0 + 0x12d0: 0x000c, 0x12d1: 0x000c, + 0x12d2: 0x000c, 0x12d4: 0x000c, 0x12d5: 0x000c, 0x12d6: 0x000c, 0x12d7: 0x000c, + 0x12d8: 0x000c, 0x12d9: 0x000c, 0x12da: 0x000c, 0x12db: 0x000c, 0x12dc: 0x000c, 0x12dd: 0x000c, + 0x12de: 0x000c, 0x12df: 0x000c, 0x12e0: 0x000c, 0x12e2: 0x000c, 0x12e3: 0x000c, + 0x12e4: 0x000c, 0x12e5: 0x000c, 0x12e6: 0x000c, 0x12e7: 0x000c, 0x12e8: 0x000c, + 0x12ed: 0x000c, + 0x12f4: 0x000c, + 0x12f8: 0x000c, 0x12f9: 0x000c, + // Block 0x4c, offset 0x1300 + 0x1300: 0x000c, 0x1301: 0x000c, 0x1302: 0x000c, 0x1303: 0x000c, 0x1304: 0x000c, 0x1305: 0x000c, + 0x1306: 0x000c, 0x1307: 0x000c, 0x1308: 0x000c, 0x1309: 0x000c, 0x130a: 0x000c, 0x130b: 0x000c, + 0x130c: 0x000c, 0x130d: 0x000c, 0x130e: 0x000c, 0x130f: 0x000c, 0x1310: 0x000c, 0x1311: 0x000c, + 0x1312: 0x000c, 0x1313: 0x000c, 0x1314: 0x000c, 0x1315: 0x000c, 0x1316: 0x000c, 0x1317: 0x000c, + 0x1318: 0x000c, 0x1319: 0x000c, 0x131a: 0x000c, 0x131b: 0x000c, 0x131c: 0x000c, 0x131d: 0x000c, + 0x131e: 0x000c, 0x131f: 0x000c, 0x1320: 0x000c, 0x1321: 0x000c, 0x1322: 0x000c, 0x1323: 0x000c, + 0x1324: 0x000c, 0x1325: 0x000c, 0x1326: 0x000c, 0x1327: 0x000c, 0x1328: 0x000c, 0x1329: 0x000c, + 0x132a: 0x000c, 0x132b: 0x000c, 0x132c: 0x000c, 0x132d: 0x000c, 0x132e: 0x000c, 0x132f: 0x000c, + 0x1330: 0x000c, 0x1331: 0x000c, 0x1332: 0x000c, 0x1333: 0x000c, 0x1334: 0x000c, 0x1335: 0x000c, + 0x1336: 0x000c, 0x1337: 0x000c, 0x1338: 0x000c, 0x1339: 0x000c, 0x133b: 0x000c, + 0x133c: 0x000c, 0x133d: 0x000c, 0x133e: 0x000c, 0x133f: 0x000c, + // Block 0x4d, offset 0x1340 + 0x137d: 0x000a, 0x137f: 0x000a, + // Block 0x4e, offset 0x1380 + 0x1380: 0x000a, 0x1381: 0x000a, + 0x138d: 0x000a, 0x138e: 0x000a, 0x138f: 0x000a, + 0x139d: 0x000a, + 0x139e: 0x000a, 0x139f: 0x000a, + 0x13ad: 0x000a, 0x13ae: 0x000a, 0x13af: 0x000a, + 0x13bd: 0x000a, 0x13be: 0x000a, + // Block 0x4f, offset 0x13c0 + 0x13c0: 0x0009, 0x13c1: 0x0009, 0x13c2: 0x0009, 0x13c3: 0x0009, 0x13c4: 0x0009, 0x13c5: 0x0009, + 0x13c6: 0x0009, 0x13c7: 0x0009, 0x13c8: 0x0009, 0x13c9: 0x0009, 0x13ca: 0x0009, 0x13cb: 0x000b, + 0x13cc: 0x000b, 0x13cd: 0x000b, 0x13cf: 0x0001, 0x13d0: 0x000a, 0x13d1: 0x000a, + 0x13d2: 0x000a, 0x13d3: 0x000a, 0x13d4: 0x000a, 0x13d5: 0x000a, 0x13d6: 0x000a, 0x13d7: 0x000a, + 0x13d8: 0x000a, 0x13d9: 0x000a, 0x13da: 0x000a, 0x13db: 0x000a, 0x13dc: 0x000a, 0x13dd: 0x000a, + 0x13de: 0x000a, 0x13df: 0x000a, 0x13e0: 0x000a, 0x13e1: 0x000a, 0x13e2: 0x000a, 0x13e3: 0x000a, + 0x13e4: 0x000a, 0x13e5: 0x000a, 0x13e6: 0x000a, 0x13e7: 0x000a, 0x13e8: 0x0009, 0x13e9: 0x0007, + 0x13ea: 0x000e, 0x13eb: 0x000e, 0x13ec: 0x000e, 0x13ed: 0x000e, 0x13ee: 0x000e, 0x13ef: 0x0006, + 0x13f0: 0x0004, 0x13f1: 0x0004, 0x13f2: 0x0004, 0x13f3: 0x0004, 0x13f4: 0x0004, 0x13f5: 0x000a, + 0x13f6: 0x000a, 0x13f7: 0x000a, 0x13f8: 0x000a, 0x13f9: 0x000a, 0x13fa: 0x000a, 0x13fb: 0x000a, + 0x13fc: 0x000a, 0x13fd: 0x000a, 0x13fe: 0x000a, 0x13ff: 0x000a, + // Block 0x50, offset 0x1400 + 0x1400: 0x000a, 0x1401: 0x000a, 0x1402: 0x000a, 0x1403: 0x000a, 0x1404: 0x0006, 0x1405: 0x009a, + 0x1406: 0x008a, 0x1407: 0x000a, 0x1408: 0x000a, 0x1409: 0x000a, 0x140a: 0x000a, 0x140b: 0x000a, + 0x140c: 0x000a, 0x140d: 0x000a, 0x140e: 0x000a, 0x140f: 0x000a, 0x1410: 0x000a, 0x1411: 0x000a, + 0x1412: 0x000a, 0x1413: 0x000a, 0x1414: 0x000a, 0x1415: 0x000a, 0x1416: 0x000a, 0x1417: 0x000a, + 0x1418: 0x000a, 0x1419: 0x000a, 0x141a: 0x000a, 0x141b: 0x000a, 0x141c: 0x000a, 0x141d: 0x000a, + 0x141e: 0x000a, 0x141f: 0x0009, 0x1420: 0x000b, 0x1421: 0x000b, 0x1422: 0x000b, 0x1423: 0x000b, + 0x1424: 0x000b, 0x1425: 0x000b, 0x1426: 0x000e, 0x1427: 0x000e, 0x1428: 0x000e, 0x1429: 0x000e, + 0x142a: 0x000b, 0x142b: 0x000b, 0x142c: 0x000b, 0x142d: 0x000b, 0x142e: 0x000b, 0x142f: 0x000b, + 0x1430: 0x0002, 0x1434: 0x0002, 0x1435: 0x0002, + 0x1436: 0x0002, 0x1437: 0x0002, 0x1438: 0x0002, 0x1439: 0x0002, 0x143a: 0x0003, 0x143b: 0x0003, + 0x143c: 0x000a, 0x143d: 0x009a, 0x143e: 0x008a, + // Block 0x51, offset 0x1440 + 0x1440: 0x0002, 0x1441: 0x0002, 0x1442: 0x0002, 0x1443: 0x0002, 0x1444: 0x0002, 0x1445: 0x0002, + 0x1446: 0x0002, 0x1447: 0x0002, 0x1448: 0x0002, 0x1449: 0x0002, 0x144a: 0x0003, 0x144b: 0x0003, + 0x144c: 0x000a, 0x144d: 0x009a, 0x144e: 0x008a, + 0x1460: 0x0004, 0x1461: 0x0004, 0x1462: 0x0004, 0x1463: 0x0004, + 0x1464: 0x0004, 0x1465: 0x0004, 0x1466: 0x0004, 0x1467: 0x0004, 0x1468: 0x0004, 0x1469: 0x0004, + 0x146a: 0x0004, 0x146b: 0x0004, 0x146c: 0x0004, 0x146d: 0x0004, 0x146e: 0x0004, 0x146f: 0x0004, + 0x1470: 0x0004, 0x1471: 0x0004, 0x1472: 0x0004, 0x1473: 0x0004, 0x1474: 0x0004, 0x1475: 0x0004, + 0x1476: 0x0004, 0x1477: 0x0004, 0x1478: 0x0004, 0x1479: 0x0004, 0x147a: 0x0004, 0x147b: 0x0004, + 0x147c: 0x0004, 0x147d: 0x0004, 0x147e: 0x0004, 0x147f: 0x0004, + // Block 0x52, offset 0x1480 + 0x1480: 0x0004, 0x1481: 0x0004, 0x1482: 0x0004, 0x1483: 0x0004, 0x1484: 0x0004, 0x1485: 0x0004, + 0x1486: 0x0004, 0x1487: 0x0004, 0x1488: 0x0004, 0x1489: 0x0004, 0x148a: 0x0004, 0x148b: 0x0004, + 0x148c: 0x0004, 0x148d: 0x0004, 0x148e: 0x0004, 0x148f: 0x0004, 0x1490: 0x000c, 0x1491: 0x000c, + 0x1492: 0x000c, 0x1493: 0x000c, 0x1494: 0x000c, 0x1495: 0x000c, 0x1496: 0x000c, 0x1497: 0x000c, + 0x1498: 0x000c, 0x1499: 0x000c, 0x149a: 0x000c, 0x149b: 0x000c, 0x149c: 0x000c, 0x149d: 0x000c, + 0x149e: 0x000c, 0x149f: 0x000c, 0x14a0: 0x000c, 0x14a1: 0x000c, 0x14a2: 0x000c, 0x14a3: 0x000c, + 0x14a4: 0x000c, 0x14a5: 0x000c, 0x14a6: 0x000c, 0x14a7: 0x000c, 0x14a8: 0x000c, 0x14a9: 0x000c, + 0x14aa: 0x000c, 0x14ab: 0x000c, 0x14ac: 0x000c, 0x14ad: 0x000c, 0x14ae: 0x000c, 0x14af: 0x000c, + 0x14b0: 0x000c, + // Block 0x53, offset 0x14c0 + 0x14c0: 0x000a, 0x14c1: 0x000a, 0x14c3: 0x000a, 0x14c4: 0x000a, 0x14c5: 0x000a, + 0x14c6: 0x000a, 0x14c8: 0x000a, 0x14c9: 0x000a, + 0x14d4: 0x000a, 0x14d6: 0x000a, 0x14d7: 0x000a, + 0x14d8: 0x000a, + 0x14de: 0x000a, 0x14df: 0x000a, 0x14e0: 0x000a, 0x14e1: 0x000a, 0x14e2: 0x000a, 0x14e3: 0x000a, + 0x14e5: 0x000a, 0x14e7: 0x000a, 0x14e9: 0x000a, + 0x14ee: 0x0004, + 0x14fa: 0x000a, 0x14fb: 0x000a, + // Block 0x54, offset 0x1500 + 0x1500: 0x000a, 0x1501: 0x000a, 0x1502: 0x000a, 0x1503: 0x000a, 0x1504: 0x000a, + 0x150a: 0x000a, 0x150b: 0x000a, + 0x150c: 0x000a, 0x150d: 0x000a, 0x1510: 0x000a, 0x1511: 0x000a, + 0x1512: 0x000a, 0x1513: 0x000a, 0x1514: 0x000a, 0x1515: 0x000a, 0x1516: 0x000a, 0x1517: 0x000a, + 0x1518: 0x000a, 0x1519: 0x000a, 0x151a: 0x000a, 0x151b: 0x000a, 0x151c: 0x000a, 0x151d: 0x000a, + 0x151e: 0x000a, 0x151f: 0x000a, + // Block 0x55, offset 0x1540 + 0x1549: 0x000a, 0x154a: 0x000a, 0x154b: 0x000a, + 0x1550: 0x000a, 0x1551: 0x000a, + 0x1552: 0x000a, 0x1553: 0x000a, 0x1554: 0x000a, 0x1555: 0x000a, 0x1556: 0x000a, 0x1557: 0x000a, + 0x1558: 0x000a, 0x1559: 0x000a, 0x155a: 0x000a, 0x155b: 0x000a, 0x155c: 0x000a, 0x155d: 0x000a, + 0x155e: 0x000a, 0x155f: 0x000a, 0x1560: 0x000a, 0x1561: 0x000a, 0x1562: 0x000a, 0x1563: 0x000a, + 0x1564: 0x000a, 0x1565: 0x000a, 0x1566: 0x000a, 0x1567: 0x000a, 0x1568: 0x000a, 0x1569: 0x000a, + 0x156a: 0x000a, 0x156b: 0x000a, 0x156c: 0x000a, 0x156d: 0x000a, 0x156e: 0x000a, 0x156f: 0x000a, + 0x1570: 0x000a, 0x1571: 0x000a, 0x1572: 0x000a, 0x1573: 0x000a, 0x1574: 0x000a, 0x1575: 0x000a, + 0x1576: 0x000a, 0x1577: 0x000a, 0x1578: 0x000a, 0x1579: 0x000a, 0x157a: 0x000a, 0x157b: 0x000a, + 0x157c: 0x000a, 0x157d: 0x000a, 0x157e: 0x000a, 0x157f: 0x000a, + // Block 0x56, offset 0x1580 + 0x1580: 0x000a, 0x1581: 0x000a, 0x1582: 0x000a, 0x1583: 0x000a, 0x1584: 0x000a, 0x1585: 0x000a, + 0x1586: 0x000a, 0x1587: 0x000a, 0x1588: 0x000a, 0x1589: 0x000a, 0x158a: 0x000a, 0x158b: 0x000a, + 0x158c: 0x000a, 0x158d: 0x000a, 0x158e: 0x000a, 0x158f: 0x000a, 0x1590: 0x000a, 0x1591: 0x000a, + 0x1592: 0x000a, 0x1593: 0x000a, 0x1594: 0x000a, 0x1595: 0x000a, 0x1596: 0x000a, 0x1597: 0x000a, + 0x1598: 0x000a, 0x1599: 0x000a, 0x159a: 0x000a, 0x159b: 0x000a, 0x159c: 0x000a, 0x159d: 0x000a, + 0x159e: 0x000a, 0x159f: 0x000a, 0x15a0: 0x000a, 0x15a1: 0x000a, 0x15a2: 0x000a, 0x15a3: 0x000a, + 0x15a4: 0x000a, 0x15a5: 0x000a, 0x15a6: 0x000a, 0x15a7: 0x000a, 0x15a8: 0x000a, 0x15a9: 0x000a, + 0x15aa: 0x000a, 0x15ab: 0x000a, 0x15ac: 0x000a, 0x15ad: 0x000a, 0x15ae: 0x000a, 0x15af: 0x000a, + 0x15b0: 0x000a, 0x15b1: 0x000a, 0x15b2: 0x000a, 0x15b3: 0x000a, 0x15b4: 0x000a, 0x15b5: 0x000a, + 0x15b6: 0x000a, 0x15b7: 0x000a, 0x15b8: 0x000a, 0x15b9: 0x000a, 0x15ba: 0x000a, 0x15bb: 0x000a, + 0x15bc: 0x000a, 0x15bd: 0x000a, 0x15be: 0x000a, 0x15bf: 0x000a, + // Block 0x57, offset 0x15c0 + 0x15c0: 0x000a, 0x15c1: 0x000a, 0x15c2: 0x000a, 0x15c3: 0x000a, 0x15c4: 0x000a, 0x15c5: 0x000a, + 0x15c6: 0x000a, 0x15c7: 0x000a, 0x15c8: 0x000a, 0x15c9: 0x000a, 0x15ca: 0x000a, 0x15cb: 0x000a, + 0x15cc: 0x000a, 0x15cd: 0x000a, 0x15ce: 0x000a, 0x15cf: 0x000a, 0x15d0: 0x000a, 0x15d1: 0x000a, + 0x15d2: 0x0003, 0x15d3: 0x0004, 0x15d4: 0x000a, 0x15d5: 0x000a, 0x15d6: 0x000a, 0x15d7: 0x000a, + 0x15d8: 0x000a, 0x15d9: 0x000a, 0x15da: 0x000a, 0x15db: 0x000a, 0x15dc: 0x000a, 0x15dd: 0x000a, + 0x15de: 0x000a, 0x15df: 0x000a, 0x15e0: 0x000a, 0x15e1: 0x000a, 0x15e2: 0x000a, 0x15e3: 0x000a, + 0x15e4: 0x000a, 0x15e5: 0x000a, 0x15e6: 0x000a, 0x15e7: 0x000a, 0x15e8: 0x000a, 0x15e9: 0x000a, + 0x15ea: 0x000a, 0x15eb: 0x000a, 0x15ec: 0x000a, 0x15ed: 0x000a, 0x15ee: 0x000a, 0x15ef: 0x000a, + 0x15f0: 0x000a, 0x15f1: 0x000a, 0x15f2: 0x000a, 0x15f3: 0x000a, 0x15f4: 0x000a, 0x15f5: 0x000a, + 0x15f6: 0x000a, 0x15f7: 0x000a, 0x15f8: 0x000a, 0x15f9: 0x000a, 0x15fa: 0x000a, 0x15fb: 0x000a, + 0x15fc: 0x000a, 0x15fd: 0x000a, 0x15fe: 0x000a, 0x15ff: 0x000a, + // Block 0x58, offset 0x1600 + 0x1600: 0x000a, 0x1601: 0x000a, 0x1602: 0x000a, 0x1603: 0x000a, 0x1604: 0x000a, 0x1605: 0x000a, + 0x1606: 0x000a, 0x1607: 0x000a, 0x1608: 0x003a, 0x1609: 0x002a, 0x160a: 0x003a, 0x160b: 0x002a, + 0x160c: 0x000a, 0x160d: 0x000a, 0x160e: 0x000a, 0x160f: 0x000a, 0x1610: 0x000a, 0x1611: 0x000a, + 0x1612: 0x000a, 0x1613: 0x000a, 0x1614: 0x000a, 0x1615: 0x000a, 0x1616: 0x000a, 0x1617: 0x000a, + 0x1618: 0x000a, 0x1619: 0x000a, 0x161a: 0x000a, 0x161b: 0x000a, 0x161c: 0x000a, 0x161d: 0x000a, + 0x161e: 0x000a, 0x161f: 0x000a, 0x1620: 0x000a, 0x1621: 0x000a, 0x1622: 0x000a, 0x1623: 0x000a, + 0x1624: 0x000a, 0x1625: 0x000a, 0x1626: 0x000a, 0x1627: 0x000a, 0x1628: 0x000a, 0x1629: 0x009a, + 0x162a: 0x008a, 0x162b: 0x000a, 0x162c: 0x000a, 0x162d: 0x000a, 0x162e: 0x000a, 0x162f: 0x000a, + 0x1630: 0x000a, 0x1631: 0x000a, 0x1632: 0x000a, 0x1633: 0x000a, 0x1634: 0x000a, 0x1635: 0x000a, + // Block 0x59, offset 0x1640 + 0x167b: 0x000a, + 0x167c: 0x000a, 0x167d: 0x000a, 0x167e: 0x000a, 0x167f: 0x000a, + // Block 0x5a, offset 0x1680 + 0x1680: 0x000a, 0x1681: 0x000a, 0x1682: 0x000a, 0x1683: 0x000a, 0x1684: 0x000a, 0x1685: 0x000a, + 0x1686: 0x000a, 0x1687: 0x000a, 0x1688: 0x000a, 0x1689: 0x000a, 0x168a: 0x000a, 0x168b: 0x000a, + 0x168c: 0x000a, 0x168d: 0x000a, 0x168e: 0x000a, 0x168f: 0x000a, 0x1690: 0x000a, 0x1691: 0x000a, + 0x1692: 0x000a, 0x1693: 0x000a, 0x1694: 0x000a, 0x1696: 0x000a, 0x1697: 0x000a, + 0x1698: 0x000a, 0x1699: 0x000a, 0x169a: 0x000a, 0x169b: 0x000a, 0x169c: 0x000a, 0x169d: 0x000a, + 0x169e: 0x000a, 0x169f: 0x000a, 0x16a0: 0x000a, 0x16a1: 0x000a, 0x16a2: 0x000a, 0x16a3: 0x000a, + 0x16a4: 0x000a, 0x16a5: 0x000a, 0x16a6: 0x000a, 0x16a7: 0x000a, 0x16a8: 0x000a, 0x16a9: 0x000a, + 0x16aa: 0x000a, 0x16ab: 0x000a, 0x16ac: 0x000a, 0x16ad: 0x000a, 0x16ae: 0x000a, 0x16af: 0x000a, + 0x16b0: 0x000a, 0x16b1: 0x000a, 0x16b2: 0x000a, 0x16b3: 0x000a, 0x16b4: 0x000a, 0x16b5: 0x000a, + 0x16b6: 0x000a, 0x16b7: 0x000a, 0x16b8: 0x000a, 0x16b9: 0x000a, 0x16ba: 0x000a, 0x16bb: 0x000a, + 0x16bc: 0x000a, 0x16bd: 0x000a, 0x16be: 0x000a, 0x16bf: 0x000a, + // Block 0x5b, offset 0x16c0 + 0x16c0: 0x000a, 0x16c1: 0x000a, 0x16c2: 0x000a, 0x16c3: 0x000a, 0x16c4: 0x000a, 0x16c5: 0x000a, + 0x16c6: 0x000a, 0x16c7: 0x000a, 0x16c8: 0x000a, 0x16c9: 0x000a, 0x16ca: 0x000a, 0x16cb: 0x000a, + 0x16cc: 0x000a, 0x16cd: 0x000a, 0x16ce: 0x000a, 0x16cf: 0x000a, 0x16d0: 0x000a, 0x16d1: 0x000a, + 0x16d2: 0x000a, 0x16d3: 0x000a, 0x16d4: 0x000a, 0x16d5: 0x000a, 0x16d6: 0x000a, 0x16d7: 0x000a, + 0x16d8: 0x000a, 0x16d9: 0x000a, 0x16da: 0x000a, 0x16db: 0x000a, 0x16dc: 0x000a, 0x16dd: 0x000a, + 0x16de: 0x000a, 0x16df: 0x000a, 0x16e0: 0x000a, 0x16e1: 0x000a, 0x16e2: 0x000a, 0x16e3: 0x000a, + 0x16e4: 0x000a, 0x16e5: 0x000a, 0x16e6: 0x000a, + // Block 0x5c, offset 0x1700 + 0x1700: 0x000a, 0x1701: 0x000a, 0x1702: 0x000a, 0x1703: 0x000a, 0x1704: 0x000a, 0x1705: 0x000a, + 0x1706: 0x000a, 0x1707: 0x000a, 0x1708: 0x000a, 0x1709: 0x000a, 0x170a: 0x000a, + 0x1720: 0x000a, 0x1721: 0x000a, 0x1722: 0x000a, 0x1723: 0x000a, + 0x1724: 0x000a, 0x1725: 0x000a, 0x1726: 0x000a, 0x1727: 0x000a, 0x1728: 0x000a, 0x1729: 0x000a, + 0x172a: 0x000a, 0x172b: 0x000a, 0x172c: 0x000a, 0x172d: 0x000a, 0x172e: 0x000a, 0x172f: 0x000a, + 0x1730: 0x000a, 0x1731: 0x000a, 0x1732: 0x000a, 0x1733: 0x000a, 0x1734: 0x000a, 0x1735: 0x000a, + 0x1736: 0x000a, 0x1737: 0x000a, 0x1738: 0x000a, 0x1739: 0x000a, 0x173a: 0x000a, 0x173b: 0x000a, + 0x173c: 0x000a, 0x173d: 0x000a, 0x173e: 0x000a, 0x173f: 0x000a, + // Block 0x5d, offset 0x1740 + 0x1740: 0x000a, 0x1741: 0x000a, 0x1742: 0x000a, 0x1743: 0x000a, 0x1744: 0x000a, 0x1745: 0x000a, + 0x1746: 0x000a, 0x1747: 0x000a, 0x1748: 0x0002, 0x1749: 0x0002, 0x174a: 0x0002, 0x174b: 0x0002, + 0x174c: 0x0002, 0x174d: 0x0002, 0x174e: 0x0002, 0x174f: 0x0002, 0x1750: 0x0002, 0x1751: 0x0002, + 0x1752: 0x0002, 0x1753: 0x0002, 0x1754: 0x0002, 0x1755: 0x0002, 0x1756: 0x0002, 0x1757: 0x0002, + 0x1758: 0x0002, 0x1759: 0x0002, 0x175a: 0x0002, 0x175b: 0x0002, + // Block 0x5e, offset 0x1780 + 0x17aa: 0x000a, 0x17ab: 0x000a, 0x17ac: 0x000a, 0x17ad: 0x000a, 0x17ae: 0x000a, 0x17af: 0x000a, + 0x17b0: 0x000a, 0x17b1: 0x000a, 0x17b2: 0x000a, 0x17b3: 0x000a, 0x17b4: 0x000a, 0x17b5: 0x000a, + 0x17b6: 0x000a, 0x17b7: 0x000a, 0x17b8: 0x000a, 0x17b9: 0x000a, 0x17ba: 0x000a, 0x17bb: 0x000a, + 0x17bc: 0x000a, 0x17bd: 0x000a, 0x17be: 0x000a, 0x17bf: 0x000a, + // Block 0x5f, offset 0x17c0 + 0x17c0: 0x000a, 0x17c1: 0x000a, 0x17c2: 0x000a, 0x17c3: 0x000a, 0x17c4: 0x000a, 0x17c5: 0x000a, + 0x17c6: 0x000a, 0x17c7: 0x000a, 0x17c8: 0x000a, 0x17c9: 0x000a, 0x17ca: 0x000a, 0x17cb: 0x000a, + 0x17cc: 0x000a, 0x17cd: 0x000a, 0x17ce: 0x000a, 0x17cf: 0x000a, 0x17d0: 0x000a, 0x17d1: 0x000a, + 0x17d2: 0x000a, 0x17d3: 0x000a, 0x17d4: 0x000a, 0x17d5: 0x000a, 0x17d6: 0x000a, 0x17d7: 0x000a, + 0x17d8: 0x000a, 0x17d9: 0x000a, 0x17da: 0x000a, 0x17db: 0x000a, 0x17dc: 0x000a, 0x17dd: 0x000a, + 0x17de: 0x000a, 0x17df: 0x000a, 0x17e0: 0x000a, 0x17e1: 0x000a, 0x17e2: 0x000a, 0x17e3: 0x000a, + 0x17e4: 0x000a, 0x17e5: 0x000a, 0x17e6: 0x000a, 0x17e7: 0x000a, 0x17e8: 0x000a, 0x17e9: 0x000a, + 0x17ea: 0x000a, 0x17eb: 0x000a, 0x17ed: 0x000a, 0x17ee: 0x000a, 0x17ef: 0x000a, + 0x17f0: 0x000a, 0x17f1: 0x000a, 0x17f2: 0x000a, 0x17f3: 0x000a, 0x17f4: 0x000a, 0x17f5: 0x000a, + 0x17f6: 0x000a, 0x17f7: 0x000a, 0x17f8: 0x000a, 0x17f9: 0x000a, 0x17fa: 0x000a, 0x17fb: 0x000a, + 0x17fc: 0x000a, 0x17fd: 0x000a, 0x17fe: 0x000a, 0x17ff: 0x000a, + // Block 0x60, offset 0x1800 + 0x1800: 0x000a, 0x1801: 0x000a, 0x1802: 0x000a, 0x1803: 0x000a, 0x1804: 0x000a, 0x1805: 0x000a, + 0x1806: 0x000a, 0x1807: 0x000a, 0x1808: 0x000a, 0x1809: 0x000a, 0x180a: 0x000a, 0x180b: 0x000a, + 0x180c: 0x000a, 0x180d: 0x000a, 0x180e: 0x000a, 0x180f: 0x000a, 0x1810: 0x000a, 0x1811: 0x000a, + 0x1812: 0x000a, 0x1813: 0x000a, 0x1814: 0x000a, 0x1815: 0x000a, 0x1816: 0x000a, 0x1817: 0x000a, + 0x1818: 0x000a, 0x1819: 0x000a, 0x181a: 0x000a, 0x181b: 0x000a, 0x181c: 0x000a, 0x181d: 0x000a, + 0x181e: 0x000a, 0x181f: 0x000a, 0x1820: 0x000a, 0x1821: 0x000a, 0x1822: 0x000a, 0x1823: 0x000a, + 0x1824: 0x000a, 0x1825: 0x000a, 0x1826: 0x000a, 0x1827: 0x000a, 0x1828: 0x003a, 0x1829: 0x002a, + 0x182a: 0x003a, 0x182b: 0x002a, 0x182c: 0x003a, 0x182d: 0x002a, 0x182e: 0x003a, 0x182f: 0x002a, + 0x1830: 0x003a, 0x1831: 0x002a, 0x1832: 0x003a, 0x1833: 0x002a, 0x1834: 0x003a, 0x1835: 0x002a, + 0x1836: 0x000a, 0x1837: 0x000a, 0x1838: 0x000a, 0x1839: 0x000a, 0x183a: 0x000a, 0x183b: 0x000a, + 0x183c: 0x000a, 0x183d: 0x000a, 0x183e: 0x000a, 0x183f: 0x000a, + // Block 0x61, offset 0x1840 + 0x1840: 0x000a, 0x1841: 0x000a, 0x1842: 0x000a, 0x1843: 0x000a, 0x1844: 0x000a, 0x1845: 0x009a, + 0x1846: 0x008a, 0x1847: 0x000a, 0x1848: 0x000a, 0x1849: 0x000a, 0x184a: 0x000a, 0x184b: 0x000a, + 0x184c: 0x000a, 0x184d: 0x000a, 0x184e: 0x000a, 0x184f: 0x000a, 0x1850: 0x000a, 0x1851: 0x000a, + 0x1852: 0x000a, 0x1853: 0x000a, 0x1854: 0x000a, 0x1855: 0x000a, 0x1856: 0x000a, 0x1857: 0x000a, + 0x1858: 0x000a, 0x1859: 0x000a, 0x185a: 0x000a, 0x185b: 0x000a, 0x185c: 0x000a, 0x185d: 0x000a, + 0x185e: 0x000a, 0x185f: 0x000a, 0x1860: 0x000a, 0x1861: 0x000a, 0x1862: 0x000a, 0x1863: 0x000a, + 0x1864: 0x000a, 0x1865: 0x000a, 0x1866: 0x003a, 0x1867: 0x002a, 0x1868: 0x003a, 0x1869: 0x002a, + 0x186a: 0x003a, 0x186b: 0x002a, 0x186c: 0x003a, 0x186d: 0x002a, 0x186e: 0x003a, 0x186f: 0x002a, + 0x1870: 0x000a, 0x1871: 0x000a, 0x1872: 0x000a, 0x1873: 0x000a, 0x1874: 0x000a, 0x1875: 0x000a, + 0x1876: 0x000a, 0x1877: 0x000a, 0x1878: 0x000a, 0x1879: 0x000a, 0x187a: 0x000a, 0x187b: 0x000a, + 0x187c: 0x000a, 0x187d: 0x000a, 0x187e: 0x000a, 0x187f: 0x000a, + // Block 0x62, offset 0x1880 + 0x1880: 0x000a, 0x1881: 0x000a, 0x1882: 0x000a, 0x1883: 0x007a, 0x1884: 0x006a, 0x1885: 0x009a, + 0x1886: 0x008a, 0x1887: 0x00ba, 0x1888: 0x00aa, 0x1889: 0x009a, 0x188a: 0x008a, 0x188b: 0x007a, + 0x188c: 0x006a, 0x188d: 0x00da, 0x188e: 0x002a, 0x188f: 0x003a, 0x1890: 0x00ca, 0x1891: 0x009a, + 0x1892: 0x008a, 0x1893: 0x007a, 0x1894: 0x006a, 0x1895: 0x009a, 0x1896: 0x008a, 0x1897: 0x00ba, + 0x1898: 0x00aa, 0x1899: 0x000a, 0x189a: 0x000a, 0x189b: 0x000a, 0x189c: 0x000a, 0x189d: 0x000a, + 0x189e: 0x000a, 0x189f: 0x000a, 0x18a0: 0x000a, 0x18a1: 0x000a, 0x18a2: 0x000a, 0x18a3: 0x000a, + 0x18a4: 0x000a, 0x18a5: 0x000a, 0x18a6: 0x000a, 0x18a7: 0x000a, 0x18a8: 0x000a, 0x18a9: 0x000a, + 0x18aa: 0x000a, 0x18ab: 0x000a, 0x18ac: 0x000a, 0x18ad: 0x000a, 0x18ae: 0x000a, 0x18af: 0x000a, + 0x18b0: 0x000a, 0x18b1: 0x000a, 0x18b2: 0x000a, 0x18b3: 0x000a, 0x18b4: 0x000a, 0x18b5: 0x000a, + 0x18b6: 0x000a, 0x18b7: 0x000a, 0x18b8: 0x000a, 0x18b9: 0x000a, 0x18ba: 0x000a, 0x18bb: 0x000a, + 0x18bc: 0x000a, 0x18bd: 0x000a, 0x18be: 0x000a, 0x18bf: 0x000a, + // Block 0x63, offset 0x18c0 + 0x18c0: 0x000a, 0x18c1: 0x000a, 0x18c2: 0x000a, 0x18c3: 0x000a, 0x18c4: 0x000a, 0x18c5: 0x000a, + 0x18c6: 0x000a, 0x18c7: 0x000a, 0x18c8: 0x000a, 0x18c9: 0x000a, 0x18ca: 0x000a, 0x18cb: 0x000a, + 0x18cc: 0x000a, 0x18cd: 0x000a, 0x18ce: 0x000a, 0x18cf: 0x000a, 0x18d0: 0x000a, 0x18d1: 0x000a, + 0x18d2: 0x000a, 0x18d3: 0x000a, 0x18d4: 0x000a, 0x18d5: 0x000a, 0x18d6: 0x000a, 0x18d7: 0x000a, + 0x18d8: 0x003a, 0x18d9: 0x002a, 0x18da: 0x003a, 0x18db: 0x002a, 0x18dc: 0x000a, 0x18dd: 0x000a, + 0x18de: 0x000a, 0x18df: 0x000a, 0x18e0: 0x000a, 0x18e1: 0x000a, 0x18e2: 0x000a, 0x18e3: 0x000a, + 0x18e4: 0x000a, 0x18e5: 0x000a, 0x18e6: 0x000a, 0x18e7: 0x000a, 0x18e8: 0x000a, 0x18e9: 0x000a, + 0x18ea: 0x000a, 0x18eb: 0x000a, 0x18ec: 0x000a, 0x18ed: 0x000a, 0x18ee: 0x000a, 0x18ef: 0x000a, + 0x18f0: 0x000a, 0x18f1: 0x000a, 0x18f2: 0x000a, 0x18f3: 0x000a, 0x18f4: 0x000a, 0x18f5: 0x000a, + 0x18f6: 0x000a, 0x18f7: 0x000a, 0x18f8: 0x000a, 0x18f9: 0x000a, 0x18fa: 0x000a, 0x18fb: 0x000a, + 0x18fc: 0x003a, 0x18fd: 0x002a, 0x18fe: 0x000a, 0x18ff: 0x000a, + // Block 0x64, offset 0x1900 + 0x1900: 0x000a, 0x1901: 0x000a, 0x1902: 0x000a, 0x1903: 0x000a, 0x1904: 0x000a, 0x1905: 0x000a, + 0x1906: 0x000a, 0x1907: 0x000a, 0x1908: 0x000a, 0x1909: 0x000a, 0x190a: 0x000a, 0x190b: 0x000a, + 0x190c: 0x000a, 0x190d: 0x000a, 0x190e: 0x000a, 0x190f: 0x000a, 0x1910: 0x000a, 0x1911: 0x000a, + 0x1912: 0x000a, 0x1913: 0x000a, 0x1914: 0x000a, 0x1915: 0x000a, 0x1916: 0x000a, 0x1917: 0x000a, + 0x1918: 0x000a, 0x1919: 0x000a, 0x191a: 0x000a, 0x191b: 0x000a, 0x191c: 0x000a, 0x191d: 0x000a, + 0x191e: 0x000a, 0x191f: 0x000a, 0x1920: 0x000a, 0x1921: 0x000a, 0x1922: 0x000a, 0x1923: 0x000a, + 0x1924: 0x000a, 0x1925: 0x000a, 0x1926: 0x000a, 0x1927: 0x000a, 0x1928: 0x000a, 0x1929: 0x000a, + 0x192a: 0x000a, 0x192b: 0x000a, 0x192c: 0x000a, 0x192d: 0x000a, 0x192e: 0x000a, 0x192f: 0x000a, + 0x1930: 0x000a, 0x1931: 0x000a, 0x1932: 0x000a, 0x1933: 0x000a, + 0x1936: 0x000a, 0x1937: 0x000a, 0x1938: 0x000a, 0x1939: 0x000a, 0x193a: 0x000a, 0x193b: 0x000a, + 0x193c: 0x000a, 0x193d: 0x000a, 0x193e: 0x000a, 0x193f: 0x000a, + // Block 0x65, offset 0x1940 + 0x1940: 0x000a, 0x1941: 0x000a, 0x1942: 0x000a, 0x1943: 0x000a, 0x1944: 0x000a, 0x1945: 0x000a, + 0x1946: 0x000a, 0x1947: 0x000a, 0x1948: 0x000a, 0x1949: 0x000a, 0x194a: 0x000a, 0x194b: 0x000a, + 0x194c: 0x000a, 0x194d: 0x000a, 0x194e: 0x000a, 0x194f: 0x000a, 0x1950: 0x000a, 0x1951: 0x000a, + 0x1952: 0x000a, 0x1953: 0x000a, 0x1954: 0x000a, 0x1955: 0x000a, + 0x1958: 0x000a, 0x1959: 0x000a, 0x195a: 0x000a, 0x195b: 0x000a, 0x195c: 0x000a, 0x195d: 0x000a, + 0x195e: 0x000a, 0x195f: 0x000a, 0x1960: 0x000a, 0x1961: 0x000a, 0x1962: 0x000a, 0x1963: 0x000a, + 0x1964: 0x000a, 0x1965: 0x000a, 0x1966: 0x000a, 0x1967: 0x000a, 0x1968: 0x000a, 0x1969: 0x000a, + 0x196a: 0x000a, 0x196b: 0x000a, 0x196c: 0x000a, 0x196d: 0x000a, 0x196e: 0x000a, 0x196f: 0x000a, + 0x1970: 0x000a, 0x1971: 0x000a, 0x1972: 0x000a, 0x1973: 0x000a, 0x1974: 0x000a, 0x1975: 0x000a, + 0x1976: 0x000a, 0x1977: 0x000a, 0x1978: 0x000a, 0x1979: 0x000a, 0x197a: 0x000a, 0x197b: 0x000a, + 0x197c: 0x000a, 0x197d: 0x000a, 0x197e: 0x000a, 0x197f: 0x000a, + // Block 0x66, offset 0x1980 + 0x1980: 0x000a, 0x1981: 0x000a, 0x1982: 0x000a, 0x1983: 0x000a, 0x1984: 0x000a, 0x1985: 0x000a, + 0x1986: 0x000a, 0x1987: 0x000a, 0x1988: 0x000a, 0x198a: 0x000a, 0x198b: 0x000a, + 0x198c: 0x000a, 0x198d: 0x000a, 0x198e: 0x000a, 0x198f: 0x000a, 0x1990: 0x000a, 0x1991: 0x000a, + 0x1992: 0x000a, 0x1993: 0x000a, 0x1994: 0x000a, 0x1995: 0x000a, 0x1996: 0x000a, 0x1997: 0x000a, + 0x1998: 0x000a, 0x1999: 0x000a, 0x199a: 0x000a, 0x199b: 0x000a, 0x199c: 0x000a, 0x199d: 0x000a, + 0x199e: 0x000a, 0x199f: 0x000a, 0x19a0: 0x000a, 0x19a1: 0x000a, 0x19a2: 0x000a, 0x19a3: 0x000a, + 0x19a4: 0x000a, 0x19a5: 0x000a, 0x19a6: 0x000a, 0x19a7: 0x000a, 0x19a8: 0x000a, 0x19a9: 0x000a, + 0x19aa: 0x000a, 0x19ab: 0x000a, 0x19ac: 0x000a, 0x19ad: 0x000a, 0x19ae: 0x000a, 0x19af: 0x000a, + 0x19b0: 0x000a, 0x19b1: 0x000a, 0x19b2: 0x000a, 0x19b3: 0x000a, 0x19b4: 0x000a, 0x19b5: 0x000a, + 0x19b6: 0x000a, 0x19b7: 0x000a, 0x19b8: 0x000a, 0x19b9: 0x000a, 0x19ba: 0x000a, 0x19bb: 0x000a, + 0x19bc: 0x000a, 0x19bd: 0x000a, 0x19be: 0x000a, + // Block 0x67, offset 0x19c0 + 0x19e5: 0x000a, 0x19e6: 0x000a, 0x19e7: 0x000a, 0x19e8: 0x000a, 0x19e9: 0x000a, + 0x19ea: 0x000a, 0x19ef: 0x000c, + 0x19f0: 0x000c, 0x19f1: 0x000c, + 0x19f9: 0x000a, 0x19fa: 0x000a, 0x19fb: 0x000a, + 0x19fc: 0x000a, 0x19fd: 0x000a, 0x19fe: 0x000a, 0x19ff: 0x000a, + // Block 0x68, offset 0x1a00 + 0x1a3f: 0x000c, + // Block 0x69, offset 0x1a40 + 0x1a60: 0x000c, 0x1a61: 0x000c, 0x1a62: 0x000c, 0x1a63: 0x000c, + 0x1a64: 0x000c, 0x1a65: 0x000c, 0x1a66: 0x000c, 0x1a67: 0x000c, 0x1a68: 0x000c, 0x1a69: 0x000c, + 0x1a6a: 0x000c, 0x1a6b: 0x000c, 0x1a6c: 0x000c, 0x1a6d: 0x000c, 0x1a6e: 0x000c, 0x1a6f: 0x000c, + 0x1a70: 0x000c, 0x1a71: 0x000c, 0x1a72: 0x000c, 0x1a73: 0x000c, 0x1a74: 0x000c, 0x1a75: 0x000c, + 0x1a76: 0x000c, 0x1a77: 0x000c, 0x1a78: 0x000c, 0x1a79: 0x000c, 0x1a7a: 0x000c, 0x1a7b: 0x000c, + 0x1a7c: 0x000c, 0x1a7d: 0x000c, 0x1a7e: 0x000c, 0x1a7f: 0x000c, + // Block 0x6a, offset 0x1a80 + 0x1a80: 0x000a, 0x1a81: 0x000a, 0x1a82: 0x000a, 0x1a83: 0x000a, 0x1a84: 0x000a, 0x1a85: 0x000a, + 0x1a86: 0x000a, 0x1a87: 0x000a, 0x1a88: 0x000a, 0x1a89: 0x000a, 0x1a8a: 0x000a, 0x1a8b: 0x000a, + 0x1a8c: 0x000a, 0x1a8d: 0x000a, 0x1a8e: 0x000a, 0x1a8f: 0x000a, 0x1a90: 0x000a, 0x1a91: 0x000a, + 0x1a92: 0x000a, 0x1a93: 0x000a, 0x1a94: 0x000a, 0x1a95: 0x000a, 0x1a96: 0x000a, 0x1a97: 0x000a, + 0x1a98: 0x000a, 0x1a99: 0x000a, 0x1a9a: 0x000a, 0x1a9b: 0x000a, 0x1a9c: 0x000a, 0x1a9d: 0x000a, + 0x1a9e: 0x000a, 0x1a9f: 0x000a, 0x1aa0: 0x000a, 0x1aa1: 0x000a, 0x1aa2: 0x003a, 0x1aa3: 0x002a, + 0x1aa4: 0x003a, 0x1aa5: 0x002a, 0x1aa6: 0x003a, 0x1aa7: 0x002a, 0x1aa8: 0x003a, 0x1aa9: 0x002a, + 0x1aaa: 0x000a, 0x1aab: 0x000a, 0x1aac: 0x000a, 0x1aad: 0x000a, 0x1aae: 0x000a, 0x1aaf: 0x000a, + 0x1ab0: 0x000a, 0x1ab1: 0x000a, 0x1ab2: 0x000a, 0x1ab3: 0x000a, 0x1ab4: 0x000a, 0x1ab5: 0x000a, + 0x1ab6: 0x000a, 0x1ab7: 0x000a, 0x1ab8: 0x000a, 0x1ab9: 0x000a, 0x1aba: 0x000a, 0x1abb: 0x000a, + 0x1abc: 0x000a, 0x1abd: 0x000a, 0x1abe: 0x000a, 0x1abf: 0x000a, + // Block 0x6b, offset 0x1ac0 + 0x1ac0: 0x000a, 0x1ac1: 0x000a, 0x1ac2: 0x000a, 0x1ac3: 0x000a, 0x1ac4: 0x000a, 0x1ac5: 0x000a, + 0x1ac6: 0x000a, 0x1ac7: 0x000a, 0x1ac8: 0x000a, 0x1ac9: 0x000a, 0x1aca: 0x000a, 0x1acb: 0x000a, + 0x1acc: 0x000a, 0x1acd: 0x000a, 0x1ace: 0x000a, + // Block 0x6c, offset 0x1b00 + 0x1b00: 0x000a, 0x1b01: 0x000a, 0x1b02: 0x000a, 0x1b03: 0x000a, 0x1b04: 0x000a, 0x1b05: 0x000a, + 0x1b06: 0x000a, 0x1b07: 0x000a, 0x1b08: 0x000a, 0x1b09: 0x000a, 0x1b0a: 0x000a, 0x1b0b: 0x000a, + 0x1b0c: 0x000a, 0x1b0d: 0x000a, 0x1b0e: 0x000a, 0x1b0f: 0x000a, 0x1b10: 0x000a, 0x1b11: 0x000a, + 0x1b12: 0x000a, 0x1b13: 0x000a, 0x1b14: 0x000a, 0x1b15: 0x000a, 0x1b16: 0x000a, 0x1b17: 0x000a, + 0x1b18: 0x000a, 0x1b19: 0x000a, 0x1b1b: 0x000a, 0x1b1c: 0x000a, 0x1b1d: 0x000a, + 0x1b1e: 0x000a, 0x1b1f: 0x000a, 0x1b20: 0x000a, 0x1b21: 0x000a, 0x1b22: 0x000a, 0x1b23: 0x000a, + 0x1b24: 0x000a, 0x1b25: 0x000a, 0x1b26: 0x000a, 0x1b27: 0x000a, 0x1b28: 0x000a, 0x1b29: 0x000a, + 0x1b2a: 0x000a, 0x1b2b: 0x000a, 0x1b2c: 0x000a, 0x1b2d: 0x000a, 0x1b2e: 0x000a, 0x1b2f: 0x000a, + 0x1b30: 0x000a, 0x1b31: 0x000a, 0x1b32: 0x000a, 0x1b33: 0x000a, 0x1b34: 0x000a, 0x1b35: 0x000a, + 0x1b36: 0x000a, 0x1b37: 0x000a, 0x1b38: 0x000a, 0x1b39: 0x000a, 0x1b3a: 0x000a, 0x1b3b: 0x000a, + 0x1b3c: 0x000a, 0x1b3d: 0x000a, 0x1b3e: 0x000a, 0x1b3f: 0x000a, + // Block 0x6d, offset 0x1b40 + 0x1b40: 0x000a, 0x1b41: 0x000a, 0x1b42: 0x000a, 0x1b43: 0x000a, 0x1b44: 0x000a, 0x1b45: 0x000a, + 0x1b46: 0x000a, 0x1b47: 0x000a, 0x1b48: 0x000a, 0x1b49: 0x000a, 0x1b4a: 0x000a, 0x1b4b: 0x000a, + 0x1b4c: 0x000a, 0x1b4d: 0x000a, 0x1b4e: 0x000a, 0x1b4f: 0x000a, 0x1b50: 0x000a, 0x1b51: 0x000a, + 0x1b52: 0x000a, 0x1b53: 0x000a, 0x1b54: 0x000a, 0x1b55: 0x000a, 0x1b56: 0x000a, 0x1b57: 0x000a, + 0x1b58: 0x000a, 0x1b59: 0x000a, 0x1b5a: 0x000a, 0x1b5b: 0x000a, 0x1b5c: 0x000a, 0x1b5d: 0x000a, + 0x1b5e: 0x000a, 0x1b5f: 0x000a, 0x1b60: 0x000a, 0x1b61: 0x000a, 0x1b62: 0x000a, 0x1b63: 0x000a, + 0x1b64: 0x000a, 0x1b65: 0x000a, 0x1b66: 0x000a, 0x1b67: 0x000a, 0x1b68: 0x000a, 0x1b69: 0x000a, + 0x1b6a: 0x000a, 0x1b6b: 0x000a, 0x1b6c: 0x000a, 0x1b6d: 0x000a, 0x1b6e: 0x000a, 0x1b6f: 0x000a, + 0x1b70: 0x000a, 0x1b71: 0x000a, 0x1b72: 0x000a, 0x1b73: 0x000a, + // Block 0x6e, offset 0x1b80 + 0x1b80: 0x000a, 0x1b81: 0x000a, 0x1b82: 0x000a, 0x1b83: 0x000a, 0x1b84: 0x000a, 0x1b85: 0x000a, + 0x1b86: 0x000a, 0x1b87: 0x000a, 0x1b88: 0x000a, 0x1b89: 0x000a, 0x1b8a: 0x000a, 0x1b8b: 0x000a, + 0x1b8c: 0x000a, 0x1b8d: 0x000a, 0x1b8e: 0x000a, 0x1b8f: 0x000a, 0x1b90: 0x000a, 0x1b91: 0x000a, + 0x1b92: 0x000a, 0x1b93: 0x000a, 0x1b94: 0x000a, 0x1b95: 0x000a, + 0x1bb0: 0x000a, 0x1bb1: 0x000a, 0x1bb2: 0x000a, 0x1bb3: 0x000a, 0x1bb4: 0x000a, 0x1bb5: 0x000a, + 0x1bb6: 0x000a, 0x1bb7: 0x000a, 0x1bb8: 0x000a, 0x1bb9: 0x000a, 0x1bba: 0x000a, 0x1bbb: 0x000a, + // Block 0x6f, offset 0x1bc0 + 0x1bc0: 0x0009, 0x1bc1: 0x000a, 0x1bc2: 0x000a, 0x1bc3: 0x000a, 0x1bc4: 0x000a, + 0x1bc8: 0x003a, 0x1bc9: 0x002a, 0x1bca: 0x003a, 0x1bcb: 0x002a, + 0x1bcc: 0x003a, 0x1bcd: 0x002a, 0x1bce: 0x003a, 0x1bcf: 0x002a, 0x1bd0: 0x003a, 0x1bd1: 0x002a, + 0x1bd2: 0x000a, 0x1bd3: 0x000a, 0x1bd4: 0x003a, 0x1bd5: 0x002a, 0x1bd6: 0x003a, 0x1bd7: 0x002a, + 0x1bd8: 0x003a, 0x1bd9: 0x002a, 0x1bda: 0x003a, 0x1bdb: 0x002a, 0x1bdc: 0x000a, 0x1bdd: 0x000a, + 0x1bde: 0x000a, 0x1bdf: 0x000a, 0x1be0: 0x000a, + 0x1bea: 0x000c, 0x1beb: 0x000c, 0x1bec: 0x000c, 0x1bed: 0x000c, + 0x1bf0: 0x000a, + 0x1bf6: 0x000a, 0x1bf7: 0x000a, + 0x1bfd: 0x000a, 0x1bfe: 0x000a, 0x1bff: 0x000a, + // Block 0x70, offset 0x1c00 + 0x1c19: 0x000c, 0x1c1a: 0x000c, 0x1c1b: 0x000a, 0x1c1c: 0x000a, + 0x1c20: 0x000a, + // Block 0x71, offset 0x1c40 + 0x1c7b: 0x000a, + // Block 0x72, offset 0x1c80 + 0x1c80: 0x000a, 0x1c81: 0x000a, 0x1c82: 0x000a, 0x1c83: 0x000a, 0x1c84: 0x000a, 0x1c85: 0x000a, + 0x1c86: 0x000a, 0x1c87: 0x000a, 0x1c88: 0x000a, 0x1c89: 0x000a, 0x1c8a: 0x000a, 0x1c8b: 0x000a, + 0x1c8c: 0x000a, 0x1c8d: 0x000a, 0x1c8e: 0x000a, 0x1c8f: 0x000a, 0x1c90: 0x000a, 0x1c91: 0x000a, + 0x1c92: 0x000a, 0x1c93: 0x000a, 0x1c94: 0x000a, 0x1c95: 0x000a, 0x1c96: 0x000a, 0x1c97: 0x000a, + 0x1c98: 0x000a, 0x1c99: 0x000a, 0x1c9a: 0x000a, 0x1c9b: 0x000a, 0x1c9c: 0x000a, 0x1c9d: 0x000a, + 0x1c9e: 0x000a, 0x1c9f: 0x000a, 0x1ca0: 0x000a, 0x1ca1: 0x000a, 0x1ca2: 0x000a, 0x1ca3: 0x000a, + // Block 0x73, offset 0x1cc0 + 0x1cdd: 0x000a, + 0x1cde: 0x000a, + // Block 0x74, offset 0x1d00 + 0x1d10: 0x000a, 0x1d11: 0x000a, + 0x1d12: 0x000a, 0x1d13: 0x000a, 0x1d14: 0x000a, 0x1d15: 0x000a, 0x1d16: 0x000a, 0x1d17: 0x000a, + 0x1d18: 0x000a, 0x1d19: 0x000a, 0x1d1a: 0x000a, 0x1d1b: 0x000a, 0x1d1c: 0x000a, 0x1d1d: 0x000a, + 0x1d1e: 0x000a, 0x1d1f: 0x000a, + 0x1d3c: 0x000a, 0x1d3d: 0x000a, 0x1d3e: 0x000a, + // Block 0x75, offset 0x1d40 + 0x1d71: 0x000a, 0x1d72: 0x000a, 0x1d73: 0x000a, 0x1d74: 0x000a, 0x1d75: 0x000a, + 0x1d76: 0x000a, 0x1d77: 0x000a, 0x1d78: 0x000a, 0x1d79: 0x000a, 0x1d7a: 0x000a, 0x1d7b: 0x000a, + 0x1d7c: 0x000a, 0x1d7d: 0x000a, 0x1d7e: 0x000a, 0x1d7f: 0x000a, + // Block 0x76, offset 0x1d80 + 0x1d8c: 0x000a, 0x1d8d: 0x000a, 0x1d8e: 0x000a, 0x1d8f: 0x000a, + // Block 0x77, offset 0x1dc0 + 0x1df7: 0x000a, 0x1df8: 0x000a, 0x1df9: 0x000a, 0x1dfa: 0x000a, + // Block 0x78, offset 0x1e00 + 0x1e1e: 0x000a, 0x1e1f: 0x000a, + 0x1e3f: 0x000a, + // Block 0x79, offset 0x1e40 + 0x1e50: 0x000a, 0x1e51: 0x000a, + 0x1e52: 0x000a, 0x1e53: 0x000a, 0x1e54: 0x000a, 0x1e55: 0x000a, 0x1e56: 0x000a, 0x1e57: 0x000a, + 0x1e58: 0x000a, 0x1e59: 0x000a, 0x1e5a: 0x000a, 0x1e5b: 0x000a, 0x1e5c: 0x000a, 0x1e5d: 0x000a, + 0x1e5e: 0x000a, 0x1e5f: 0x000a, 0x1e60: 0x000a, 0x1e61: 0x000a, 0x1e62: 0x000a, 0x1e63: 0x000a, + 0x1e64: 0x000a, 0x1e65: 0x000a, 0x1e66: 0x000a, 0x1e67: 0x000a, 0x1e68: 0x000a, 0x1e69: 0x000a, + 0x1e6a: 0x000a, 0x1e6b: 0x000a, 0x1e6c: 0x000a, 0x1e6d: 0x000a, 0x1e6e: 0x000a, 0x1e6f: 0x000a, + 0x1e70: 0x000a, 0x1e71: 0x000a, 0x1e72: 0x000a, 0x1e73: 0x000a, 0x1e74: 0x000a, 0x1e75: 0x000a, + 0x1e76: 0x000a, 0x1e77: 0x000a, 0x1e78: 0x000a, 0x1e79: 0x000a, 0x1e7a: 0x000a, 0x1e7b: 0x000a, + 0x1e7c: 0x000a, 0x1e7d: 0x000a, 0x1e7e: 0x000a, 0x1e7f: 0x000a, + // Block 0x7a, offset 0x1e80 + 0x1e80: 0x000a, 0x1e81: 0x000a, 0x1e82: 0x000a, 0x1e83: 0x000a, 0x1e84: 0x000a, 0x1e85: 0x000a, + 0x1e86: 0x000a, + // Block 0x7b, offset 0x1ec0 + 0x1ecd: 0x000a, 0x1ece: 0x000a, 0x1ecf: 0x000a, + // Block 0x7c, offset 0x1f00 + 0x1f2f: 0x000c, + 0x1f30: 0x000c, 0x1f31: 0x000c, 0x1f32: 0x000c, 0x1f33: 0x000a, 0x1f34: 0x000c, 0x1f35: 0x000c, + 0x1f36: 0x000c, 0x1f37: 0x000c, 0x1f38: 0x000c, 0x1f39: 0x000c, 0x1f3a: 0x000c, 0x1f3b: 0x000c, + 0x1f3c: 0x000c, 0x1f3d: 0x000c, 0x1f3e: 0x000a, 0x1f3f: 0x000a, + // Block 0x7d, offset 0x1f40 + 0x1f5e: 0x000c, 0x1f5f: 0x000c, + // Block 0x7e, offset 0x1f80 + 0x1fb0: 0x000c, 0x1fb1: 0x000c, + // Block 0x7f, offset 0x1fc0 + 0x1fc0: 0x000a, 0x1fc1: 0x000a, 0x1fc2: 0x000a, 0x1fc3: 0x000a, 0x1fc4: 0x000a, 0x1fc5: 0x000a, + 0x1fc6: 0x000a, 0x1fc7: 0x000a, 0x1fc8: 0x000a, 0x1fc9: 0x000a, 0x1fca: 0x000a, 0x1fcb: 0x000a, + 0x1fcc: 0x000a, 0x1fcd: 0x000a, 0x1fce: 0x000a, 0x1fcf: 0x000a, 0x1fd0: 0x000a, 0x1fd1: 0x000a, + 0x1fd2: 0x000a, 0x1fd3: 0x000a, 0x1fd4: 0x000a, 0x1fd5: 0x000a, 0x1fd6: 0x000a, 0x1fd7: 0x000a, + 0x1fd8: 0x000a, 0x1fd9: 0x000a, 0x1fda: 0x000a, 0x1fdb: 0x000a, 0x1fdc: 0x000a, 0x1fdd: 0x000a, + 0x1fde: 0x000a, 0x1fdf: 0x000a, 0x1fe0: 0x000a, 0x1fe1: 0x000a, + // Block 0x80, offset 0x2000 + 0x2008: 0x000a, + // Block 0x81, offset 0x2040 + 0x2042: 0x000c, + 0x2046: 0x000c, 0x204b: 0x000c, + 0x2065: 0x000c, 0x2066: 0x000c, 0x2068: 0x000a, 0x2069: 0x000a, + 0x206a: 0x000a, 0x206b: 0x000a, + 0x2078: 0x0004, 0x2079: 0x0004, + // Block 0x82, offset 0x2080 + 0x20b4: 0x000a, 0x20b5: 0x000a, + 0x20b6: 0x000a, 0x20b7: 0x000a, + // Block 0x83, offset 0x20c0 + 0x20c4: 0x000c, 0x20c5: 0x000c, + 0x20e0: 0x000c, 0x20e1: 0x000c, 0x20e2: 0x000c, 0x20e3: 0x000c, + 0x20e4: 0x000c, 0x20e5: 0x000c, 0x20e6: 0x000c, 0x20e7: 0x000c, 0x20e8: 0x000c, 0x20e9: 0x000c, + 0x20ea: 0x000c, 0x20eb: 0x000c, 0x20ec: 0x000c, 0x20ed: 0x000c, 0x20ee: 0x000c, 0x20ef: 0x000c, + 0x20f0: 0x000c, 0x20f1: 0x000c, + 0x20ff: 0x000c, + // Block 0x84, offset 0x2100 + 0x2126: 0x000c, 0x2127: 0x000c, 0x2128: 0x000c, 0x2129: 0x000c, + 0x212a: 0x000c, 0x212b: 0x000c, 0x212c: 0x000c, 0x212d: 0x000c, + // Block 0x85, offset 0x2140 + 0x2147: 0x000c, 0x2148: 0x000c, 0x2149: 0x000c, 0x214a: 0x000c, 0x214b: 0x000c, + 0x214c: 0x000c, 0x214d: 0x000c, 0x214e: 0x000c, 0x214f: 0x000c, 0x2150: 0x000c, 0x2151: 0x000c, + // Block 0x86, offset 0x2180 + 0x2180: 0x000c, 0x2181: 0x000c, 0x2182: 0x000c, + 0x21b3: 0x000c, + 0x21b6: 0x000c, 0x21b7: 0x000c, 0x21b8: 0x000c, 0x21b9: 0x000c, + 0x21bc: 0x000c, + // Block 0x87, offset 0x21c0 + 0x21e5: 0x000c, + // Block 0x88, offset 0x2200 + 0x2229: 0x000c, + 0x222a: 0x000c, 0x222b: 0x000c, 0x222c: 0x000c, 0x222d: 0x000c, 0x222e: 0x000c, + 0x2231: 0x000c, 0x2232: 0x000c, 0x2235: 0x000c, + 0x2236: 0x000c, + // Block 0x89, offset 0x2240 + 0x2243: 0x000c, + 0x224c: 0x000c, + 0x227c: 0x000c, + // Block 0x8a, offset 0x2280 + 0x22b0: 0x000c, 0x22b2: 0x000c, 0x22b3: 0x000c, 0x22b4: 0x000c, + 0x22b7: 0x000c, 0x22b8: 0x000c, + 0x22be: 0x000c, 0x22bf: 0x000c, + // Block 0x8b, offset 0x22c0 + 0x22c1: 0x000c, + 0x22ec: 0x000c, 0x22ed: 0x000c, + 0x22f6: 0x000c, + // Block 0x8c, offset 0x2300 + 0x2325: 0x000c, 0x2328: 0x000c, + 0x232d: 0x000c, + // Block 0x8d, offset 0x2340 + 0x235d: 0x0001, + 0x235e: 0x000c, 0x235f: 0x0001, 0x2360: 0x0001, 0x2361: 0x0001, 0x2362: 0x0001, 0x2363: 0x0001, + 0x2364: 0x0001, 0x2365: 0x0001, 0x2366: 0x0001, 0x2367: 0x0001, 0x2368: 0x0001, 0x2369: 0x0003, + 0x236a: 0x0001, 0x236b: 0x0001, 0x236c: 0x0001, 0x236d: 0x0001, 0x236e: 0x0001, 0x236f: 0x0001, + 0x2370: 0x0001, 0x2371: 0x0001, 0x2372: 0x0001, 0x2373: 0x0001, 0x2374: 0x0001, 0x2375: 0x0001, + 0x2376: 0x0001, 0x2377: 0x0001, 0x2378: 0x0001, 0x2379: 0x0001, 0x237a: 0x0001, 0x237b: 0x0001, + 0x237c: 0x0001, 0x237d: 0x0001, 0x237e: 0x0001, 0x237f: 0x0001, + // Block 0x8e, offset 0x2380 + 0x2380: 0x0001, 0x2381: 0x0001, 0x2382: 0x0001, 0x2383: 0x0001, 0x2384: 0x0001, 0x2385: 0x0001, + 0x2386: 0x0001, 0x2387: 0x0001, 0x2388: 0x0001, 0x2389: 0x0001, 0x238a: 0x0001, 0x238b: 0x0001, + 0x238c: 0x0001, 0x238d: 0x0001, 0x238e: 0x0001, 0x238f: 0x0001, 0x2390: 0x000d, 0x2391: 0x000d, + 0x2392: 0x000d, 0x2393: 0x000d, 0x2394: 0x000d, 0x2395: 0x000d, 0x2396: 0x000d, 0x2397: 0x000d, + 0x2398: 0x000d, 0x2399: 0x000d, 0x239a: 0x000d, 0x239b: 0x000d, 0x239c: 0x000d, 0x239d: 0x000d, + 0x239e: 0x000d, 0x239f: 0x000d, 0x23a0: 0x000d, 0x23a1: 0x000d, 0x23a2: 0x000d, 0x23a3: 0x000d, + 0x23a4: 0x000d, 0x23a5: 0x000d, 0x23a6: 0x000d, 0x23a7: 0x000d, 0x23a8: 0x000d, 0x23a9: 0x000d, + 0x23aa: 0x000d, 0x23ab: 0x000d, 0x23ac: 0x000d, 0x23ad: 0x000d, 0x23ae: 0x000d, 0x23af: 0x000d, + 0x23b0: 0x000d, 0x23b1: 0x000d, 0x23b2: 0x000d, 0x23b3: 0x000d, 0x23b4: 0x000d, 0x23b5: 0x000d, + 0x23b6: 0x000d, 0x23b7: 0x000d, 0x23b8: 0x000d, 0x23b9: 0x000d, 0x23ba: 0x000d, 0x23bb: 0x000d, + 0x23bc: 0x000d, 0x23bd: 0x000d, 0x23be: 0x000d, 0x23bf: 0x000d, + // Block 0x8f, offset 0x23c0 + 0x23c0: 0x000d, 0x23c1: 0x000d, 0x23c2: 0x000d, 0x23c3: 0x000d, 0x23c4: 0x000d, 0x23c5: 0x000d, + 0x23c6: 0x000d, 0x23c7: 0x000d, 0x23c8: 0x000d, 0x23c9: 0x000d, 0x23ca: 0x000d, 0x23cb: 0x000d, + 0x23cc: 0x000d, 0x23cd: 0x000d, 0x23ce: 0x000d, 0x23cf: 0x000d, 0x23d0: 0x000d, 0x23d1: 0x000d, + 0x23d2: 0x000d, 0x23d3: 0x000d, 0x23d4: 0x000d, 0x23d5: 0x000d, 0x23d6: 0x000d, 0x23d7: 0x000d, + 0x23d8: 0x000d, 0x23d9: 0x000d, 0x23da: 0x000d, 0x23db: 0x000d, 0x23dc: 0x000d, 0x23dd: 0x000d, + 0x23de: 0x000d, 0x23df: 0x000d, 0x23e0: 0x000d, 0x23e1: 0x000d, 0x23e2: 0x000d, 0x23e3: 0x000d, + 0x23e4: 0x000d, 0x23e5: 0x000d, 0x23e6: 0x000d, 0x23e7: 0x000d, 0x23e8: 0x000d, 0x23e9: 0x000d, + 0x23ea: 0x000d, 0x23eb: 0x000d, 0x23ec: 0x000d, 0x23ed: 0x000d, 0x23ee: 0x000d, 0x23ef: 0x000d, + 0x23f0: 0x000d, 0x23f1: 0x000d, 0x23f2: 0x000d, 0x23f3: 0x000d, 0x23f4: 0x000d, 0x23f5: 0x000d, + 0x23f6: 0x000d, 0x23f7: 0x000d, 0x23f8: 0x000d, 0x23f9: 0x000d, 0x23fa: 0x000d, 0x23fb: 0x000d, + 0x23fc: 0x000d, 0x23fd: 0x000d, 0x23fe: 0x000a, 0x23ff: 0x000a, + // Block 0x90, offset 0x2400 + 0x2400: 0x000d, 0x2401: 0x000d, 0x2402: 0x000d, 0x2403: 0x000d, 0x2404: 0x000d, 0x2405: 0x000d, + 0x2406: 0x000d, 0x2407: 0x000d, 0x2408: 0x000d, 0x2409: 0x000d, 0x240a: 0x000d, 0x240b: 0x000d, + 0x240c: 0x000d, 0x240d: 0x000d, 0x240e: 0x000d, 0x240f: 0x000d, 0x2410: 0x000b, 0x2411: 0x000b, + 0x2412: 0x000b, 0x2413: 0x000b, 0x2414: 0x000b, 0x2415: 0x000b, 0x2416: 0x000b, 0x2417: 0x000b, + 0x2418: 0x000b, 0x2419: 0x000b, 0x241a: 0x000b, 0x241b: 0x000b, 0x241c: 0x000b, 0x241d: 0x000b, + 0x241e: 0x000b, 0x241f: 0x000b, 0x2420: 0x000b, 0x2421: 0x000b, 0x2422: 0x000b, 0x2423: 0x000b, + 0x2424: 0x000b, 0x2425: 0x000b, 0x2426: 0x000b, 0x2427: 0x000b, 0x2428: 0x000b, 0x2429: 0x000b, + 0x242a: 0x000b, 0x242b: 0x000b, 0x242c: 0x000b, 0x242d: 0x000b, 0x242e: 0x000b, 0x242f: 0x000b, + 0x2430: 0x000d, 0x2431: 0x000d, 0x2432: 0x000d, 0x2433: 0x000d, 0x2434: 0x000d, 0x2435: 0x000d, + 0x2436: 0x000d, 0x2437: 0x000d, 0x2438: 0x000d, 0x2439: 0x000d, 0x243a: 0x000d, 0x243b: 0x000d, + 0x243c: 0x000d, 0x243d: 0x000a, 0x243e: 0x000d, 0x243f: 0x000d, + // Block 0x91, offset 0x2440 + 0x2440: 0x000c, 0x2441: 0x000c, 0x2442: 0x000c, 0x2443: 0x000c, 0x2444: 0x000c, 0x2445: 0x000c, + 0x2446: 0x000c, 0x2447: 0x000c, 0x2448: 0x000c, 0x2449: 0x000c, 0x244a: 0x000c, 0x244b: 0x000c, + 0x244c: 0x000c, 0x244d: 0x000c, 0x244e: 0x000c, 0x244f: 0x000c, 0x2450: 0x000a, 0x2451: 0x000a, + 0x2452: 0x000a, 0x2453: 0x000a, 0x2454: 0x000a, 0x2455: 0x000a, 0x2456: 0x000a, 0x2457: 0x000a, + 0x2458: 0x000a, 0x2459: 0x000a, + 0x2460: 0x000c, 0x2461: 0x000c, 0x2462: 0x000c, 0x2463: 0x000c, + 0x2464: 0x000c, 0x2465: 0x000c, 0x2466: 0x000c, 0x2467: 0x000c, 0x2468: 0x000c, 0x2469: 0x000c, + 0x246a: 0x000c, 0x246b: 0x000c, 0x246c: 0x000c, 0x246d: 0x000c, 0x246e: 0x000c, 0x246f: 0x000c, + 0x2470: 0x000a, 0x2471: 0x000a, 0x2472: 0x000a, 0x2473: 0x000a, 0x2474: 0x000a, 0x2475: 0x000a, + 0x2476: 0x000a, 0x2477: 0x000a, 0x2478: 0x000a, 0x2479: 0x000a, 0x247a: 0x000a, 0x247b: 0x000a, + 0x247c: 0x000a, 0x247d: 0x000a, 0x247e: 0x000a, 0x247f: 0x000a, + // Block 0x92, offset 0x2480 + 0x2480: 0x000a, 0x2481: 0x000a, 0x2482: 0x000a, 0x2483: 0x000a, 0x2484: 0x000a, 0x2485: 0x000a, + 0x2486: 0x000a, 0x2487: 0x000a, 0x2488: 0x000a, 0x2489: 0x000a, 0x248a: 0x000a, 0x248b: 0x000a, + 0x248c: 0x000a, 0x248d: 0x000a, 0x248e: 0x000a, 0x248f: 0x000a, 0x2490: 0x0006, 0x2491: 0x000a, + 0x2492: 0x0006, 0x2494: 0x000a, 0x2495: 0x0006, 0x2496: 0x000a, 0x2497: 0x000a, + 0x2498: 0x000a, 0x2499: 0x009a, 0x249a: 0x008a, 0x249b: 0x007a, 0x249c: 0x006a, 0x249d: 0x009a, + 0x249e: 0x008a, 0x249f: 0x0004, 0x24a0: 0x000a, 0x24a1: 0x000a, 0x24a2: 0x0003, 0x24a3: 0x0003, + 0x24a4: 0x000a, 0x24a5: 0x000a, 0x24a6: 0x000a, 0x24a8: 0x000a, 0x24a9: 0x0004, + 0x24aa: 0x0004, 0x24ab: 0x000a, + 0x24b0: 0x000d, 0x24b1: 0x000d, 0x24b2: 0x000d, 0x24b3: 0x000d, 0x24b4: 0x000d, 0x24b5: 0x000d, + 0x24b6: 0x000d, 0x24b7: 0x000d, 0x24b8: 0x000d, 0x24b9: 0x000d, 0x24ba: 0x000d, 0x24bb: 0x000d, + 0x24bc: 0x000d, 0x24bd: 0x000d, 0x24be: 0x000d, 0x24bf: 0x000d, + // Block 0x93, offset 0x24c0 + 0x24c0: 0x000d, 0x24c1: 0x000d, 0x24c2: 0x000d, 0x24c3: 0x000d, 0x24c4: 0x000d, 0x24c5: 0x000d, + 0x24c6: 0x000d, 0x24c7: 0x000d, 0x24c8: 0x000d, 0x24c9: 0x000d, 0x24ca: 0x000d, 0x24cb: 0x000d, + 0x24cc: 0x000d, 0x24cd: 0x000d, 0x24ce: 0x000d, 0x24cf: 0x000d, 0x24d0: 0x000d, 0x24d1: 0x000d, + 0x24d2: 0x000d, 0x24d3: 0x000d, 0x24d4: 0x000d, 0x24d5: 0x000d, 0x24d6: 0x000d, 0x24d7: 0x000d, + 0x24d8: 0x000d, 0x24d9: 0x000d, 0x24da: 0x000d, 0x24db: 0x000d, 0x24dc: 0x000d, 0x24dd: 0x000d, + 0x24de: 0x000d, 0x24df: 0x000d, 0x24e0: 0x000d, 0x24e1: 0x000d, 0x24e2: 0x000d, 0x24e3: 0x000d, + 0x24e4: 0x000d, 0x24e5: 0x000d, 0x24e6: 0x000d, 0x24e7: 0x000d, 0x24e8: 0x000d, 0x24e9: 0x000d, + 0x24ea: 0x000d, 0x24eb: 0x000d, 0x24ec: 0x000d, 0x24ed: 0x000d, 0x24ee: 0x000d, 0x24ef: 0x000d, + 0x24f0: 0x000d, 0x24f1: 0x000d, 0x24f2: 0x000d, 0x24f3: 0x000d, 0x24f4: 0x000d, 0x24f5: 0x000d, + 0x24f6: 0x000d, 0x24f7: 0x000d, 0x24f8: 0x000d, 0x24f9: 0x000d, 0x24fa: 0x000d, 0x24fb: 0x000d, + 0x24fc: 0x000d, 0x24fd: 0x000d, 0x24fe: 0x000d, 0x24ff: 0x000b, + // Block 0x94, offset 0x2500 + 0x2501: 0x000a, 0x2502: 0x000a, 0x2503: 0x0004, 0x2504: 0x0004, 0x2505: 0x0004, + 0x2506: 0x000a, 0x2507: 0x000a, 0x2508: 0x003a, 0x2509: 0x002a, 0x250a: 0x000a, 0x250b: 0x0003, + 0x250c: 0x0006, 0x250d: 0x0003, 0x250e: 0x0006, 0x250f: 0x0006, 0x2510: 0x0002, 0x2511: 0x0002, + 0x2512: 0x0002, 0x2513: 0x0002, 0x2514: 0x0002, 0x2515: 0x0002, 0x2516: 0x0002, 0x2517: 0x0002, + 0x2518: 0x0002, 0x2519: 0x0002, 0x251a: 0x0006, 0x251b: 0x000a, 0x251c: 0x000a, 0x251d: 0x000a, + 0x251e: 0x000a, 0x251f: 0x000a, 0x2520: 0x000a, + 0x253b: 0x005a, + 0x253c: 0x000a, 0x253d: 0x004a, 0x253e: 0x000a, 0x253f: 0x000a, + // Block 0x95, offset 0x2540 + 0x2540: 0x000a, + 0x255b: 0x005a, 0x255c: 0x000a, 0x255d: 0x004a, + 0x255e: 0x000a, 0x255f: 0x00fa, 0x2560: 0x00ea, 0x2561: 0x000a, 0x2562: 0x003a, 0x2563: 0x002a, + 0x2564: 0x000a, 0x2565: 0x000a, + // Block 0x96, offset 0x2580 + 0x25a0: 0x0004, 0x25a1: 0x0004, 0x25a2: 0x000a, 0x25a3: 0x000a, + 0x25a4: 0x000a, 0x25a5: 0x0004, 0x25a6: 0x0004, 0x25a8: 0x000a, 0x25a9: 0x000a, + 0x25aa: 0x000a, 0x25ab: 0x000a, 0x25ac: 0x000a, 0x25ad: 0x000a, 0x25ae: 0x000a, + 0x25b0: 0x000b, 0x25b1: 0x000b, 0x25b2: 0x000b, 0x25b3: 0x000b, 0x25b4: 0x000b, 0x25b5: 0x000b, + 0x25b6: 0x000b, 0x25b7: 0x000b, 0x25b8: 0x000b, 0x25b9: 0x000a, 0x25ba: 0x000a, 0x25bb: 0x000a, + 0x25bc: 0x000a, 0x25bd: 0x000a, 0x25be: 0x000b, 0x25bf: 0x000b, + // Block 0x97, offset 0x25c0 + 0x25c1: 0x000a, + // Block 0x98, offset 0x2600 + 0x2600: 0x000a, 0x2601: 0x000a, 0x2602: 0x000a, 0x2603: 0x000a, 0x2604: 0x000a, 0x2605: 0x000a, + 0x2606: 0x000a, 0x2607: 0x000a, 0x2608: 0x000a, 0x2609: 0x000a, 0x260a: 0x000a, 0x260b: 0x000a, + 0x260c: 0x000a, 0x2610: 0x000a, 0x2611: 0x000a, + 0x2612: 0x000a, 0x2613: 0x000a, 0x2614: 0x000a, 0x2615: 0x000a, 0x2616: 0x000a, 0x2617: 0x000a, + 0x2618: 0x000a, 0x2619: 0x000a, 0x261a: 0x000a, 0x261b: 0x000a, + 0x2620: 0x000a, + // Block 0x99, offset 0x2640 + 0x267d: 0x000c, + // Block 0x9a, offset 0x2680 + 0x26a0: 0x000c, 0x26a1: 0x0002, 0x26a2: 0x0002, 0x26a3: 0x0002, + 0x26a4: 0x0002, 0x26a5: 0x0002, 0x26a6: 0x0002, 0x26a7: 0x0002, 0x26a8: 0x0002, 0x26a9: 0x0002, + 0x26aa: 0x0002, 0x26ab: 0x0002, 0x26ac: 0x0002, 0x26ad: 0x0002, 0x26ae: 0x0002, 0x26af: 0x0002, + 0x26b0: 0x0002, 0x26b1: 0x0002, 0x26b2: 0x0002, 0x26b3: 0x0002, 0x26b4: 0x0002, 0x26b5: 0x0002, + 0x26b6: 0x0002, 0x26b7: 0x0002, 0x26b8: 0x0002, 0x26b9: 0x0002, 0x26ba: 0x0002, 0x26bb: 0x0002, + // Block 0x9b, offset 0x26c0 + 0x26f6: 0x000c, 0x26f7: 0x000c, 0x26f8: 0x000c, 0x26f9: 0x000c, 0x26fa: 0x000c, + // Block 0x9c, offset 0x2700 + 0x2700: 0x0001, 0x2701: 0x0001, 0x2702: 0x0001, 0x2703: 0x0001, 0x2704: 0x0001, 0x2705: 0x0001, + 0x2706: 0x0001, 0x2707: 0x0001, 0x2708: 0x0001, 0x2709: 0x0001, 0x270a: 0x0001, 0x270b: 0x0001, + 0x270c: 0x0001, 0x270d: 0x0001, 0x270e: 0x0001, 0x270f: 0x0001, 0x2710: 0x0001, 0x2711: 0x0001, + 0x2712: 0x0001, 0x2713: 0x0001, 0x2714: 0x0001, 0x2715: 0x0001, 0x2716: 0x0001, 0x2717: 0x0001, + 0x2718: 0x0001, 0x2719: 0x0001, 0x271a: 0x0001, 0x271b: 0x0001, 0x271c: 0x0001, 0x271d: 0x0001, + 0x271e: 0x0001, 0x271f: 0x0001, 0x2720: 0x0001, 0x2721: 0x0001, 0x2722: 0x0001, 0x2723: 0x0001, + 0x2724: 0x0001, 0x2725: 0x0001, 0x2726: 0x0001, 0x2727: 0x0001, 0x2728: 0x0001, 0x2729: 0x0001, + 0x272a: 0x0001, 0x272b: 0x0001, 0x272c: 0x0001, 0x272d: 0x0001, 0x272e: 0x0001, 0x272f: 0x0001, + 0x2730: 0x0001, 0x2731: 0x0001, 0x2732: 0x0001, 0x2733: 0x0001, 0x2734: 0x0001, 0x2735: 0x0001, + 0x2736: 0x0001, 0x2737: 0x0001, 0x2738: 0x0001, 0x2739: 0x0001, 0x273a: 0x0001, 0x273b: 0x0001, + 0x273c: 0x0001, 0x273d: 0x0001, 0x273e: 0x0001, 0x273f: 0x0001, + // Block 0x9d, offset 0x2740 + 0x2740: 0x0001, 0x2741: 0x0001, 0x2742: 0x0001, 0x2743: 0x0001, 0x2744: 0x0001, 0x2745: 0x0001, + 0x2746: 0x0001, 0x2747: 0x0001, 0x2748: 0x0001, 0x2749: 0x0001, 0x274a: 0x0001, 0x274b: 0x0001, + 0x274c: 0x0001, 0x274d: 0x0001, 0x274e: 0x0001, 0x274f: 0x0001, 0x2750: 0x0001, 0x2751: 0x0001, + 0x2752: 0x0001, 0x2753: 0x0001, 0x2754: 0x0001, 0x2755: 0x0001, 0x2756: 0x0001, 0x2757: 0x0001, + 0x2758: 0x0001, 0x2759: 0x0001, 0x275a: 0x0001, 0x275b: 0x0001, 0x275c: 0x0001, 0x275d: 0x0001, + 0x275e: 0x0001, 0x275f: 0x000a, 0x2760: 0x0001, 0x2761: 0x0001, 0x2762: 0x0001, 0x2763: 0x0001, + 0x2764: 0x0001, 0x2765: 0x0001, 0x2766: 0x0001, 0x2767: 0x0001, 0x2768: 0x0001, 0x2769: 0x0001, + 0x276a: 0x0001, 0x276b: 0x0001, 0x276c: 0x0001, 0x276d: 0x0001, 0x276e: 0x0001, 0x276f: 0x0001, + 0x2770: 0x0001, 0x2771: 0x0001, 0x2772: 0x0001, 0x2773: 0x0001, 0x2774: 0x0001, 0x2775: 0x0001, + 0x2776: 0x0001, 0x2777: 0x0001, 0x2778: 0x0001, 0x2779: 0x0001, 0x277a: 0x0001, 0x277b: 0x0001, + 0x277c: 0x0001, 0x277d: 0x0001, 0x277e: 0x0001, 0x277f: 0x0001, + // Block 0x9e, offset 0x2780 + 0x2780: 0x0001, 0x2781: 0x000c, 0x2782: 0x000c, 0x2783: 0x000c, 0x2784: 0x0001, 0x2785: 0x000c, + 0x2786: 0x000c, 0x2787: 0x0001, 0x2788: 0x0001, 0x2789: 0x0001, 0x278a: 0x0001, 0x278b: 0x0001, + 0x278c: 0x000c, 0x278d: 0x000c, 0x278e: 0x000c, 0x278f: 0x000c, 0x2790: 0x0001, 0x2791: 0x0001, + 0x2792: 0x0001, 0x2793: 0x0001, 0x2794: 0x0001, 0x2795: 0x0001, 0x2796: 0x0001, 0x2797: 0x0001, + 0x2798: 0x0001, 0x2799: 0x0001, 0x279a: 0x0001, 0x279b: 0x0001, 0x279c: 0x0001, 0x279d: 0x0001, + 0x279e: 0x0001, 0x279f: 0x0001, 0x27a0: 0x0001, 0x27a1: 0x0001, 0x27a2: 0x0001, 0x27a3: 0x0001, + 0x27a4: 0x0001, 0x27a5: 0x0001, 0x27a6: 0x0001, 0x27a7: 0x0001, 0x27a8: 0x0001, 0x27a9: 0x0001, + 0x27aa: 0x0001, 0x27ab: 0x0001, 0x27ac: 0x0001, 0x27ad: 0x0001, 0x27ae: 0x0001, 0x27af: 0x0001, + 0x27b0: 0x0001, 0x27b1: 0x0001, 0x27b2: 0x0001, 0x27b3: 0x0001, 0x27b4: 0x0001, 0x27b5: 0x0001, + 0x27b6: 0x0001, 0x27b7: 0x0001, 0x27b8: 0x000c, 0x27b9: 0x000c, 0x27ba: 0x000c, 0x27bb: 0x0001, + 0x27bc: 0x0001, 0x27bd: 0x0001, 0x27be: 0x0001, 0x27bf: 0x000c, + // Block 0x9f, offset 0x27c0 + 0x27c0: 0x0001, 0x27c1: 0x0001, 0x27c2: 0x0001, 0x27c3: 0x0001, 0x27c4: 0x0001, 0x27c5: 0x0001, + 0x27c6: 0x0001, 0x27c7: 0x0001, 0x27c8: 0x0001, 0x27c9: 0x0001, 0x27ca: 0x0001, 0x27cb: 0x0001, + 0x27cc: 0x0001, 0x27cd: 0x0001, 0x27ce: 0x0001, 0x27cf: 0x0001, 0x27d0: 0x0001, 0x27d1: 0x0001, + 0x27d2: 0x0001, 0x27d3: 0x0001, 0x27d4: 0x0001, 0x27d5: 0x0001, 0x27d6: 0x0001, 0x27d7: 0x0001, + 0x27d8: 0x0001, 0x27d9: 0x0001, 0x27da: 0x0001, 0x27db: 0x0001, 0x27dc: 0x0001, 0x27dd: 0x0001, + 0x27de: 0x0001, 0x27df: 0x0001, 0x27e0: 0x0001, 0x27e1: 0x0001, 0x27e2: 0x0001, 0x27e3: 0x0001, + 0x27e4: 0x0001, 0x27e5: 0x000c, 0x27e6: 0x000c, 0x27e7: 0x0001, 0x27e8: 0x0001, 0x27e9: 0x0001, + 0x27ea: 0x0001, 0x27eb: 0x0001, 0x27ec: 0x0001, 0x27ed: 0x0001, 0x27ee: 0x0001, 0x27ef: 0x0001, + 0x27f0: 0x0001, 0x27f1: 0x0001, 0x27f2: 0x0001, 0x27f3: 0x0001, 0x27f4: 0x0001, 0x27f5: 0x0001, + 0x27f6: 0x0001, 0x27f7: 0x0001, 0x27f8: 0x0001, 0x27f9: 0x0001, 0x27fa: 0x0001, 0x27fb: 0x0001, + 0x27fc: 0x0001, 0x27fd: 0x0001, 0x27fe: 0x0001, 0x27ff: 0x0001, + // Block 0xa0, offset 0x2800 + 0x2800: 0x0001, 0x2801: 0x0001, 0x2802: 0x0001, 0x2803: 0x0001, 0x2804: 0x0001, 0x2805: 0x0001, + 0x2806: 0x0001, 0x2807: 0x0001, 0x2808: 0x0001, 0x2809: 0x0001, 0x280a: 0x0001, 0x280b: 0x0001, + 0x280c: 0x0001, 0x280d: 0x0001, 0x280e: 0x0001, 0x280f: 0x0001, 0x2810: 0x0001, 0x2811: 0x0001, + 0x2812: 0x0001, 0x2813: 0x0001, 0x2814: 0x0001, 0x2815: 0x0001, 0x2816: 0x0001, 0x2817: 0x0001, + 0x2818: 0x0001, 0x2819: 0x0001, 0x281a: 0x0001, 0x281b: 0x0001, 0x281c: 0x0001, 0x281d: 0x0001, + 0x281e: 0x0001, 0x281f: 0x0001, 0x2820: 0x0001, 0x2821: 0x0001, 0x2822: 0x0001, 0x2823: 0x0001, + 0x2824: 0x0001, 0x2825: 0x0001, 0x2826: 0x0001, 0x2827: 0x0001, 0x2828: 0x0001, 0x2829: 0x0001, + 0x282a: 0x0001, 0x282b: 0x0001, 0x282c: 0x0001, 0x282d: 0x0001, 0x282e: 0x0001, 0x282f: 0x0001, + 0x2830: 0x0001, 0x2831: 0x0001, 0x2832: 0x0001, 0x2833: 0x0001, 0x2834: 0x0001, 0x2835: 0x0001, + 0x2836: 0x0001, 0x2837: 0x0001, 0x2838: 0x0001, 0x2839: 0x000a, 0x283a: 0x000a, 0x283b: 0x000a, + 0x283c: 0x000a, 0x283d: 0x000a, 0x283e: 0x000a, 0x283f: 0x000a, + // Block 0xa1, offset 0x2840 + 0x2840: 0x000d, 0x2841: 0x000d, 0x2842: 0x000d, 0x2843: 0x000d, 0x2844: 0x000d, 0x2845: 0x000d, + 0x2846: 0x000d, 0x2847: 0x000d, 0x2848: 0x000d, 0x2849: 0x000d, 0x284a: 0x000d, 0x284b: 0x000d, + 0x284c: 0x000d, 0x284d: 0x000d, 0x284e: 0x000d, 0x284f: 0x000d, 0x2850: 0x000d, 0x2851: 0x000d, + 0x2852: 0x000d, 0x2853: 0x000d, 0x2854: 0x000d, 0x2855: 0x000d, 0x2856: 0x000d, 0x2857: 0x000d, + 0x2858: 0x000d, 0x2859: 0x000d, 0x285a: 0x000d, 0x285b: 0x000d, 0x285c: 0x000d, 0x285d: 0x000d, + 0x285e: 0x000d, 0x285f: 0x000d, 0x2860: 0x000d, 0x2861: 0x000d, 0x2862: 0x000d, 0x2863: 0x000d, + 0x2864: 0x000c, 0x2865: 0x000c, 0x2866: 0x000c, 0x2867: 0x000c, 0x2868: 0x000d, 0x2869: 0x000d, + 0x286a: 0x000d, 0x286b: 0x000d, 0x286c: 0x000d, 0x286d: 0x000d, 0x286e: 0x000d, 0x286f: 0x000d, + 0x2870: 0x0005, 0x2871: 0x0005, 0x2872: 0x0005, 0x2873: 0x0005, 0x2874: 0x0005, 0x2875: 0x0005, + 0x2876: 0x0005, 0x2877: 0x0005, 0x2878: 0x0005, 0x2879: 0x0005, 0x287a: 0x000d, 0x287b: 0x000d, + 0x287c: 0x000d, 0x287d: 0x000d, 0x287e: 0x000d, 0x287f: 0x000d, + // Block 0xa2, offset 0x2880 + 0x2880: 0x0001, 0x2881: 0x0001, 0x2882: 0x0001, 0x2883: 0x0001, 0x2884: 0x0001, 0x2885: 0x0001, + 0x2886: 0x0001, 0x2887: 0x0001, 0x2888: 0x0001, 0x2889: 0x0001, 0x288a: 0x0001, 0x288b: 0x0001, + 0x288c: 0x0001, 0x288d: 0x0001, 0x288e: 0x0001, 0x288f: 0x0001, 0x2890: 0x0001, 0x2891: 0x0001, + 0x2892: 0x0001, 0x2893: 0x0001, 0x2894: 0x0001, 0x2895: 0x0001, 0x2896: 0x0001, 0x2897: 0x0001, + 0x2898: 0x0001, 0x2899: 0x0001, 0x289a: 0x0001, 0x289b: 0x0001, 0x289c: 0x0001, 0x289d: 0x0001, + 0x289e: 0x0001, 0x289f: 0x0001, 0x28a0: 0x0005, 0x28a1: 0x0005, 0x28a2: 0x0005, 0x28a3: 0x0005, + 0x28a4: 0x0005, 0x28a5: 0x0005, 0x28a6: 0x0005, 0x28a7: 0x0005, 0x28a8: 0x0005, 0x28a9: 0x0005, + 0x28aa: 0x0005, 0x28ab: 0x0005, 0x28ac: 0x0005, 0x28ad: 0x0005, 0x28ae: 0x0005, 0x28af: 0x0005, + 0x28b0: 0x0005, 0x28b1: 0x0005, 0x28b2: 0x0005, 0x28b3: 0x0005, 0x28b4: 0x0005, 0x28b5: 0x0005, + 0x28b6: 0x0005, 0x28b7: 0x0005, 0x28b8: 0x0005, 0x28b9: 0x0005, 0x28ba: 0x0005, 0x28bb: 0x0005, + 0x28bc: 0x0005, 0x28bd: 0x0005, 0x28be: 0x0005, 0x28bf: 0x0001, + // Block 0xa3, offset 0x28c0 + 0x28c0: 0x0001, 0x28c1: 0x0001, 0x28c2: 0x0001, 0x28c3: 0x0001, 0x28c4: 0x0001, 0x28c5: 0x0001, + 0x28c6: 0x0001, 0x28c7: 0x0001, 0x28c8: 0x0001, 0x28c9: 0x0001, 0x28ca: 0x0001, 0x28cb: 0x0001, + 0x28cc: 0x0001, 0x28cd: 0x0001, 0x28ce: 0x0001, 0x28cf: 0x0001, 0x28d0: 0x0001, 0x28d1: 0x0001, + 0x28d2: 0x0001, 0x28d3: 0x0001, 0x28d4: 0x0001, 0x28d5: 0x0001, 0x28d6: 0x0001, 0x28d7: 0x0001, + 0x28d8: 0x0001, 0x28d9: 0x0001, 0x28da: 0x0001, 0x28db: 0x0001, 0x28dc: 0x0001, 0x28dd: 0x0001, + 0x28de: 0x0001, 0x28df: 0x0001, 0x28e0: 0x0001, 0x28e1: 0x0001, 0x28e2: 0x0001, 0x28e3: 0x0001, + 0x28e4: 0x0001, 0x28e5: 0x0001, 0x28e6: 0x0001, 0x28e7: 0x0001, 0x28e8: 0x0001, 0x28e9: 0x0001, + 0x28ea: 0x0001, 0x28eb: 0x0001, 0x28ec: 0x0001, 0x28ed: 0x0001, 0x28ee: 0x0001, 0x28ef: 0x0001, + 0x28f0: 0x000d, 0x28f1: 0x000d, 0x28f2: 0x000d, 0x28f3: 0x000d, 0x28f4: 0x000d, 0x28f5: 0x000d, + 0x28f6: 0x000d, 0x28f7: 0x000d, 0x28f8: 0x000d, 0x28f9: 0x000d, 0x28fa: 0x000d, 0x28fb: 0x000d, + 0x28fc: 0x000d, 0x28fd: 0x000d, 0x28fe: 0x000d, 0x28ff: 0x000d, + // Block 0xa4, offset 0x2900 + 0x2900: 0x000d, 0x2901: 0x000d, 0x2902: 0x000d, 0x2903: 0x000d, 0x2904: 0x000d, 0x2905: 0x000d, + 0x2906: 0x000c, 0x2907: 0x000c, 0x2908: 0x000c, 0x2909: 0x000c, 0x290a: 0x000c, 0x290b: 0x000c, + 0x290c: 0x000c, 0x290d: 0x000c, 0x290e: 0x000c, 0x290f: 0x000c, 0x2910: 0x000c, 0x2911: 0x000d, + 0x2912: 0x000d, 0x2913: 0x000d, 0x2914: 0x000d, 0x2915: 0x000d, 0x2916: 0x000d, 0x2917: 0x000d, + 0x2918: 0x000d, 0x2919: 0x000d, 0x291a: 0x000d, 0x291b: 0x000d, 0x291c: 0x000d, 0x291d: 0x000d, + 0x291e: 0x000d, 0x291f: 0x000d, 0x2920: 0x000d, 0x2921: 0x000d, 0x2922: 0x000d, 0x2923: 0x000d, + 0x2924: 0x000d, 0x2925: 0x000d, 0x2926: 0x000d, 0x2927: 0x000d, 0x2928: 0x000d, 0x2929: 0x000d, + 0x292a: 0x000d, 0x292b: 0x000d, 0x292c: 0x000d, 0x292d: 0x000d, 0x292e: 0x000d, 0x292f: 0x000d, + 0x2930: 0x0001, 0x2931: 0x0001, 0x2932: 0x0001, 0x2933: 0x0001, 0x2934: 0x0001, 0x2935: 0x0001, + 0x2936: 0x0001, 0x2937: 0x0001, 0x2938: 0x0001, 0x2939: 0x0001, 0x293a: 0x0001, 0x293b: 0x0001, + 0x293c: 0x0001, 0x293d: 0x0001, 0x293e: 0x0001, 0x293f: 0x0001, + // Block 0xa5, offset 0x2940 + 0x2941: 0x000c, + 0x2978: 0x000c, 0x2979: 0x000c, 0x297a: 0x000c, 0x297b: 0x000c, + 0x297c: 0x000c, 0x297d: 0x000c, 0x297e: 0x000c, 0x297f: 0x000c, + // Block 0xa6, offset 0x2980 + 0x2980: 0x000c, 0x2981: 0x000c, 0x2982: 0x000c, 0x2983: 0x000c, 0x2984: 0x000c, 0x2985: 0x000c, + 0x2986: 0x000c, + 0x2992: 0x000a, 0x2993: 0x000a, 0x2994: 0x000a, 0x2995: 0x000a, 0x2996: 0x000a, 0x2997: 0x000a, + 0x2998: 0x000a, 0x2999: 0x000a, 0x299a: 0x000a, 0x299b: 0x000a, 0x299c: 0x000a, 0x299d: 0x000a, + 0x299e: 0x000a, 0x299f: 0x000a, 0x29a0: 0x000a, 0x29a1: 0x000a, 0x29a2: 0x000a, 0x29a3: 0x000a, + 0x29a4: 0x000a, 0x29a5: 0x000a, + 0x29bf: 0x000c, + // Block 0xa7, offset 0x29c0 + 0x29c0: 0x000c, 0x29c1: 0x000c, + 0x29f3: 0x000c, 0x29f4: 0x000c, 0x29f5: 0x000c, + 0x29f6: 0x000c, 0x29f9: 0x000c, 0x29fa: 0x000c, + // Block 0xa8, offset 0x2a00 + 0x2a00: 0x000c, 0x2a01: 0x000c, 0x2a02: 0x000c, + 0x2a27: 0x000c, 0x2a28: 0x000c, 0x2a29: 0x000c, + 0x2a2a: 0x000c, 0x2a2b: 0x000c, 0x2a2d: 0x000c, 0x2a2e: 0x000c, 0x2a2f: 0x000c, + 0x2a30: 0x000c, 0x2a31: 0x000c, 0x2a32: 0x000c, 0x2a33: 0x000c, 0x2a34: 0x000c, + // Block 0xa9, offset 0x2a40 + 0x2a73: 0x000c, + // Block 0xaa, offset 0x2a80 + 0x2a80: 0x000c, 0x2a81: 0x000c, + 0x2ab6: 0x000c, 0x2ab7: 0x000c, 0x2ab8: 0x000c, 0x2ab9: 0x000c, 0x2aba: 0x000c, 0x2abb: 0x000c, + 0x2abc: 0x000c, 0x2abd: 0x000c, 0x2abe: 0x000c, + // Block 0xab, offset 0x2ac0 + 0x2ac9: 0x000c, 0x2aca: 0x000c, 0x2acb: 0x000c, + 0x2acc: 0x000c, + // Block 0xac, offset 0x2b00 + 0x2b2f: 0x000c, + 0x2b30: 0x000c, 0x2b31: 0x000c, 0x2b34: 0x000c, + 0x2b36: 0x000c, 0x2b37: 0x000c, + 0x2b3e: 0x000c, + // Block 0xad, offset 0x2b40 + 0x2b5f: 0x000c, 0x2b63: 0x000c, + 0x2b64: 0x000c, 0x2b65: 0x000c, 0x2b66: 0x000c, 0x2b67: 0x000c, 0x2b68: 0x000c, 0x2b69: 0x000c, + 0x2b6a: 0x000c, + // Block 0xae, offset 0x2b80 + 0x2b80: 0x000c, + 0x2ba6: 0x000c, 0x2ba7: 0x000c, 0x2ba8: 0x000c, 0x2ba9: 0x000c, + 0x2baa: 0x000c, 0x2bab: 0x000c, 0x2bac: 0x000c, + 0x2bb0: 0x000c, 0x2bb1: 0x000c, 0x2bb2: 0x000c, 0x2bb3: 0x000c, 0x2bb4: 0x000c, + // Block 0xaf, offset 0x2bc0 + 0x2bf8: 0x000c, 0x2bf9: 0x000c, 0x2bfa: 0x000c, 0x2bfb: 0x000c, + 0x2bfc: 0x000c, 0x2bfd: 0x000c, 0x2bfe: 0x000c, 0x2bff: 0x000c, + // Block 0xb0, offset 0x2c00 + 0x2c02: 0x000c, 0x2c03: 0x000c, 0x2c04: 0x000c, + 0x2c06: 0x000c, + 0x2c1e: 0x000c, + // Block 0xb1, offset 0x2c40 + 0x2c73: 0x000c, 0x2c74: 0x000c, 0x2c75: 0x000c, + 0x2c76: 0x000c, 0x2c77: 0x000c, 0x2c78: 0x000c, 0x2c7a: 0x000c, + 0x2c7f: 0x000c, + // Block 0xb2, offset 0x2c80 + 0x2c80: 0x000c, 0x2c82: 0x000c, 0x2c83: 0x000c, + // Block 0xb3, offset 0x2cc0 + 0x2cf2: 0x000c, 0x2cf3: 0x000c, 0x2cf4: 0x000c, 0x2cf5: 0x000c, + 0x2cfc: 0x000c, 0x2cfd: 0x000c, 0x2cff: 0x000c, + // Block 0xb4, offset 0x2d00 + 0x2d00: 0x000c, + 0x2d1c: 0x000c, 0x2d1d: 0x000c, + // Block 0xb5, offset 0x2d40 + 0x2d73: 0x000c, 0x2d74: 0x000c, 0x2d75: 0x000c, + 0x2d76: 0x000c, 0x2d77: 0x000c, 0x2d78: 0x000c, 0x2d79: 0x000c, 0x2d7a: 0x000c, + 0x2d7d: 0x000c, 0x2d7f: 0x000c, + // Block 0xb6, offset 0x2d80 + 0x2d80: 0x000c, + 0x2da0: 0x000a, 0x2da1: 0x000a, 0x2da2: 0x000a, 0x2da3: 0x000a, + 0x2da4: 0x000a, 0x2da5: 0x000a, 0x2da6: 0x000a, 0x2da7: 0x000a, 0x2da8: 0x000a, 0x2da9: 0x000a, + 0x2daa: 0x000a, 0x2dab: 0x000a, 0x2dac: 0x000a, + // Block 0xb7, offset 0x2dc0 + 0x2deb: 0x000c, 0x2ded: 0x000c, + 0x2df0: 0x000c, 0x2df1: 0x000c, 0x2df2: 0x000c, 0x2df3: 0x000c, 0x2df4: 0x000c, 0x2df5: 0x000c, + 0x2df7: 0x000c, + // Block 0xb8, offset 0x2e00 + 0x2e1d: 0x000c, + 0x2e1e: 0x000c, 0x2e1f: 0x000c, 0x2e22: 0x000c, 0x2e23: 0x000c, + 0x2e24: 0x000c, 0x2e25: 0x000c, 0x2e27: 0x000c, 0x2e28: 0x000c, 0x2e29: 0x000c, + 0x2e2a: 0x000c, 0x2e2b: 0x000c, + // Block 0xb9, offset 0x2e40 + 0x2e6f: 0x000c, + 0x2e70: 0x000c, 0x2e71: 0x000c, 0x2e72: 0x000c, 0x2e73: 0x000c, 0x2e74: 0x000c, 0x2e75: 0x000c, + 0x2e76: 0x000c, 0x2e77: 0x000c, 0x2e79: 0x000c, 0x2e7a: 0x000c, + // Block 0xba, offset 0x2e80 + 0x2e81: 0x000c, 0x2e82: 0x000c, 0x2e83: 0x000c, 0x2e84: 0x000c, 0x2e85: 0x000c, + 0x2e86: 0x000c, 0x2e89: 0x000c, 0x2e8a: 0x000c, + 0x2eb3: 0x000c, 0x2eb4: 0x000c, 0x2eb5: 0x000c, + 0x2eb6: 0x000c, 0x2eb7: 0x000c, 0x2eb8: 0x000c, 0x2ebb: 0x000c, + 0x2ebc: 0x000c, 0x2ebd: 0x000c, 0x2ebe: 0x000c, + // Block 0xbb, offset 0x2ec0 + 0x2ec7: 0x000c, + 0x2ed1: 0x000c, + 0x2ed2: 0x000c, 0x2ed3: 0x000c, 0x2ed4: 0x000c, 0x2ed5: 0x000c, 0x2ed6: 0x000c, + 0x2ed9: 0x000c, 0x2eda: 0x000c, 0x2edb: 0x000c, + // Block 0xbc, offset 0x2f00 + 0x2f0a: 0x000c, 0x2f0b: 0x000c, + 0x2f0c: 0x000c, 0x2f0d: 0x000c, 0x2f0e: 0x000c, 0x2f0f: 0x000c, 0x2f10: 0x000c, 0x2f11: 0x000c, + 0x2f12: 0x000c, 0x2f13: 0x000c, 0x2f14: 0x000c, 0x2f15: 0x000c, 0x2f16: 0x000c, + 0x2f18: 0x000c, 0x2f19: 0x000c, + // Block 0xbd, offset 0x2f40 + 0x2f70: 0x000c, 0x2f71: 0x000c, 0x2f72: 0x000c, 0x2f73: 0x000c, 0x2f74: 0x000c, 0x2f75: 0x000c, + 0x2f76: 0x000c, 0x2f78: 0x000c, 0x2f79: 0x000c, 0x2f7a: 0x000c, 0x2f7b: 0x000c, + 0x2f7c: 0x000c, 0x2f7d: 0x000c, + // Block 0xbe, offset 0x2f80 + 0x2f92: 0x000c, 0x2f93: 0x000c, 0x2f94: 0x000c, 0x2f95: 0x000c, 0x2f96: 0x000c, 0x2f97: 0x000c, + 0x2f98: 0x000c, 0x2f99: 0x000c, 0x2f9a: 0x000c, 0x2f9b: 0x000c, 0x2f9c: 0x000c, 0x2f9d: 0x000c, + 0x2f9e: 0x000c, 0x2f9f: 0x000c, 0x2fa0: 0x000c, 0x2fa1: 0x000c, 0x2fa2: 0x000c, 0x2fa3: 0x000c, + 0x2fa4: 0x000c, 0x2fa5: 0x000c, 0x2fa6: 0x000c, 0x2fa7: 0x000c, + 0x2faa: 0x000c, 0x2fab: 0x000c, 0x2fac: 0x000c, 0x2fad: 0x000c, 0x2fae: 0x000c, 0x2faf: 0x000c, + 0x2fb0: 0x000c, 0x2fb2: 0x000c, 0x2fb3: 0x000c, 0x2fb5: 0x000c, + 0x2fb6: 0x000c, + // Block 0xbf, offset 0x2fc0 + 0x2ff1: 0x000c, 0x2ff2: 0x000c, 0x2ff3: 0x000c, 0x2ff4: 0x000c, 0x2ff5: 0x000c, + 0x2ff6: 0x000c, 0x2ffa: 0x000c, + 0x2ffc: 0x000c, 0x2ffd: 0x000c, 0x2fff: 0x000c, + // Block 0xc0, offset 0x3000 + 0x3000: 0x000c, 0x3001: 0x000c, 0x3002: 0x000c, 0x3003: 0x000c, 0x3004: 0x000c, 0x3005: 0x000c, + 0x3007: 0x000c, + // Block 0xc1, offset 0x3040 + 0x3050: 0x000c, 0x3051: 0x000c, + 0x3055: 0x000c, 0x3057: 0x000c, + // Block 0xc2, offset 0x3080 + 0x30b3: 0x000c, 0x30b4: 0x000c, + // Block 0xc3, offset 0x30c0 + 0x30f0: 0x000c, 0x30f1: 0x000c, 0x30f2: 0x000c, 0x30f3: 0x000c, 0x30f4: 0x000c, + // Block 0xc4, offset 0x3100 + 0x3130: 0x000c, 0x3131: 0x000c, 0x3132: 0x000c, 0x3133: 0x000c, 0x3134: 0x000c, 0x3135: 0x000c, + 0x3136: 0x000c, + // Block 0xc5, offset 0x3140 + 0x314f: 0x000c, 0x3150: 0x000c, 0x3151: 0x000c, + 0x3152: 0x000c, + // Block 0xc6, offset 0x3180 + 0x319d: 0x000c, + 0x319e: 0x000c, 0x31a0: 0x000b, 0x31a1: 0x000b, 0x31a2: 0x000b, 0x31a3: 0x000b, + // Block 0xc7, offset 0x31c0 + 0x31e7: 0x000c, 0x31e8: 0x000c, 0x31e9: 0x000c, + 0x31f3: 0x000b, 0x31f4: 0x000b, 0x31f5: 0x000b, + 0x31f6: 0x000b, 0x31f7: 0x000b, 0x31f8: 0x000b, 0x31f9: 0x000b, 0x31fa: 0x000b, 0x31fb: 0x000c, + 0x31fc: 0x000c, 0x31fd: 0x000c, 0x31fe: 0x000c, 0x31ff: 0x000c, + // Block 0xc8, offset 0x3200 + 0x3200: 0x000c, 0x3201: 0x000c, 0x3202: 0x000c, 0x3205: 0x000c, + 0x3206: 0x000c, 0x3207: 0x000c, 0x3208: 0x000c, 0x3209: 0x000c, 0x320a: 0x000c, 0x320b: 0x000c, + 0x322a: 0x000c, 0x322b: 0x000c, 0x322c: 0x000c, 0x322d: 0x000c, + // Block 0xc9, offset 0x3240 + 0x3240: 0x000a, 0x3241: 0x000a, 0x3242: 0x000c, 0x3243: 0x000c, 0x3244: 0x000c, 0x3245: 0x000a, + // Block 0xca, offset 0x3280 + 0x3280: 0x000a, 0x3281: 0x000a, 0x3282: 0x000a, 0x3283: 0x000a, 0x3284: 0x000a, 0x3285: 0x000a, + 0x3286: 0x000a, 0x3287: 0x000a, 0x3288: 0x000a, 0x3289: 0x000a, 0x328a: 0x000a, 0x328b: 0x000a, + 0x328c: 0x000a, 0x328d: 0x000a, 0x328e: 0x000a, 0x328f: 0x000a, 0x3290: 0x000a, 0x3291: 0x000a, + 0x3292: 0x000a, 0x3293: 0x000a, 0x3294: 0x000a, 0x3295: 0x000a, 0x3296: 0x000a, + // Block 0xcb, offset 0x32c0 + 0x32db: 0x000a, + // Block 0xcc, offset 0x3300 + 0x3315: 0x000a, + // Block 0xcd, offset 0x3340 + 0x334f: 0x000a, + // Block 0xce, offset 0x3380 + 0x3389: 0x000a, + // Block 0xcf, offset 0x33c0 + 0x33c3: 0x000a, + 0x33ce: 0x0002, 0x33cf: 0x0002, 0x33d0: 0x0002, 0x33d1: 0x0002, + 0x33d2: 0x0002, 0x33d3: 0x0002, 0x33d4: 0x0002, 0x33d5: 0x0002, 0x33d6: 0x0002, 0x33d7: 0x0002, + 0x33d8: 0x0002, 0x33d9: 0x0002, 0x33da: 0x0002, 0x33db: 0x0002, 0x33dc: 0x0002, 0x33dd: 0x0002, + 0x33de: 0x0002, 0x33df: 0x0002, 0x33e0: 0x0002, 0x33e1: 0x0002, 0x33e2: 0x0002, 0x33e3: 0x0002, + 0x33e4: 0x0002, 0x33e5: 0x0002, 0x33e6: 0x0002, 0x33e7: 0x0002, 0x33e8: 0x0002, 0x33e9: 0x0002, + 0x33ea: 0x0002, 0x33eb: 0x0002, 0x33ec: 0x0002, 0x33ed: 0x0002, 0x33ee: 0x0002, 0x33ef: 0x0002, + 0x33f0: 0x0002, 0x33f1: 0x0002, 0x33f2: 0x0002, 0x33f3: 0x0002, 0x33f4: 0x0002, 0x33f5: 0x0002, + 0x33f6: 0x0002, 0x33f7: 0x0002, 0x33f8: 0x0002, 0x33f9: 0x0002, 0x33fa: 0x0002, 0x33fb: 0x0002, + 0x33fc: 0x0002, 0x33fd: 0x0002, 0x33fe: 0x0002, 0x33ff: 0x0002, + // Block 0xd0, offset 0x3400 + 0x3400: 0x000c, 0x3401: 0x000c, 0x3402: 0x000c, 0x3403: 0x000c, 0x3404: 0x000c, 0x3405: 0x000c, + 0x3406: 0x000c, 0x3407: 0x000c, 0x3408: 0x000c, 0x3409: 0x000c, 0x340a: 0x000c, 0x340b: 0x000c, + 0x340c: 0x000c, 0x340d: 0x000c, 0x340e: 0x000c, 0x340f: 0x000c, 0x3410: 0x000c, 0x3411: 0x000c, + 0x3412: 0x000c, 0x3413: 0x000c, 0x3414: 0x000c, 0x3415: 0x000c, 0x3416: 0x000c, 0x3417: 0x000c, + 0x3418: 0x000c, 0x3419: 0x000c, 0x341a: 0x000c, 0x341b: 0x000c, 0x341c: 0x000c, 0x341d: 0x000c, + 0x341e: 0x000c, 0x341f: 0x000c, 0x3420: 0x000c, 0x3421: 0x000c, 0x3422: 0x000c, 0x3423: 0x000c, + 0x3424: 0x000c, 0x3425: 0x000c, 0x3426: 0x000c, 0x3427: 0x000c, 0x3428: 0x000c, 0x3429: 0x000c, + 0x342a: 0x000c, 0x342b: 0x000c, 0x342c: 0x000c, 0x342d: 0x000c, 0x342e: 0x000c, 0x342f: 0x000c, + 0x3430: 0x000c, 0x3431: 0x000c, 0x3432: 0x000c, 0x3433: 0x000c, 0x3434: 0x000c, 0x3435: 0x000c, + 0x3436: 0x000c, 0x343b: 0x000c, + 0x343c: 0x000c, 0x343d: 0x000c, 0x343e: 0x000c, 0x343f: 0x000c, + // Block 0xd1, offset 0x3440 + 0x3440: 0x000c, 0x3441: 0x000c, 0x3442: 0x000c, 0x3443: 0x000c, 0x3444: 0x000c, 0x3445: 0x000c, + 0x3446: 0x000c, 0x3447: 0x000c, 0x3448: 0x000c, 0x3449: 0x000c, 0x344a: 0x000c, 0x344b: 0x000c, + 0x344c: 0x000c, 0x344d: 0x000c, 0x344e: 0x000c, 0x344f: 0x000c, 0x3450: 0x000c, 0x3451: 0x000c, + 0x3452: 0x000c, 0x3453: 0x000c, 0x3454: 0x000c, 0x3455: 0x000c, 0x3456: 0x000c, 0x3457: 0x000c, + 0x3458: 0x000c, 0x3459: 0x000c, 0x345a: 0x000c, 0x345b: 0x000c, 0x345c: 0x000c, 0x345d: 0x000c, + 0x345e: 0x000c, 0x345f: 0x000c, 0x3460: 0x000c, 0x3461: 0x000c, 0x3462: 0x000c, 0x3463: 0x000c, + 0x3464: 0x000c, 0x3465: 0x000c, 0x3466: 0x000c, 0x3467: 0x000c, 0x3468: 0x000c, 0x3469: 0x000c, + 0x346a: 0x000c, 0x346b: 0x000c, 0x346c: 0x000c, + 0x3475: 0x000c, + // Block 0xd2, offset 0x3480 + 0x3484: 0x000c, + 0x349b: 0x000c, 0x349c: 0x000c, 0x349d: 0x000c, + 0x349e: 0x000c, 0x349f: 0x000c, 0x34a1: 0x000c, 0x34a2: 0x000c, 0x34a3: 0x000c, + 0x34a4: 0x000c, 0x34a5: 0x000c, 0x34a6: 0x000c, 0x34a7: 0x000c, 0x34a8: 0x000c, 0x34a9: 0x000c, + 0x34aa: 0x000c, 0x34ab: 0x000c, 0x34ac: 0x000c, 0x34ad: 0x000c, 0x34ae: 0x000c, 0x34af: 0x000c, + // Block 0xd3, offset 0x34c0 + 0x34c0: 0x000c, 0x34c1: 0x000c, 0x34c2: 0x000c, 0x34c3: 0x000c, 0x34c4: 0x000c, 0x34c5: 0x000c, + 0x34c6: 0x000c, 0x34c8: 0x000c, 0x34c9: 0x000c, 0x34ca: 0x000c, 0x34cb: 0x000c, + 0x34cc: 0x000c, 0x34cd: 0x000c, 0x34ce: 0x000c, 0x34cf: 0x000c, 0x34d0: 0x000c, 0x34d1: 0x000c, + 0x34d2: 0x000c, 0x34d3: 0x000c, 0x34d4: 0x000c, 0x34d5: 0x000c, 0x34d6: 0x000c, 0x34d7: 0x000c, + 0x34d8: 0x000c, 0x34db: 0x000c, 0x34dc: 0x000c, 0x34dd: 0x000c, + 0x34de: 0x000c, 0x34df: 0x000c, 0x34e0: 0x000c, 0x34e1: 0x000c, 0x34e3: 0x000c, + 0x34e4: 0x000c, 0x34e6: 0x000c, 0x34e7: 0x000c, 0x34e8: 0x000c, 0x34e9: 0x000c, + 0x34ea: 0x000c, + // Block 0xd4, offset 0x3500 + 0x3500: 0x0001, 0x3501: 0x0001, 0x3502: 0x0001, 0x3503: 0x0001, 0x3504: 0x0001, 0x3505: 0x0001, + 0x3506: 0x0001, 0x3507: 0x0001, 0x3508: 0x0001, 0x3509: 0x0001, 0x350a: 0x0001, 0x350b: 0x0001, + 0x350c: 0x0001, 0x350d: 0x0001, 0x350e: 0x0001, 0x350f: 0x0001, 0x3510: 0x000c, 0x3511: 0x000c, + 0x3512: 0x000c, 0x3513: 0x000c, 0x3514: 0x000c, 0x3515: 0x000c, 0x3516: 0x000c, 0x3517: 0x0001, + 0x3518: 0x0001, 0x3519: 0x0001, 0x351a: 0x0001, 0x351b: 0x0001, 0x351c: 0x0001, 0x351d: 0x0001, + 0x351e: 0x0001, 0x351f: 0x0001, 0x3520: 0x0001, 0x3521: 0x0001, 0x3522: 0x0001, 0x3523: 0x0001, + 0x3524: 0x0001, 0x3525: 0x0001, 0x3526: 0x0001, 0x3527: 0x0001, 0x3528: 0x0001, 0x3529: 0x0001, + 0x352a: 0x0001, 0x352b: 0x0001, 0x352c: 0x0001, 0x352d: 0x0001, 0x352e: 0x0001, 0x352f: 0x0001, + 0x3530: 0x0001, 0x3531: 0x0001, 0x3532: 0x0001, 0x3533: 0x0001, 0x3534: 0x0001, 0x3535: 0x0001, + 0x3536: 0x0001, 0x3537: 0x0001, 0x3538: 0x0001, 0x3539: 0x0001, 0x353a: 0x0001, 0x353b: 0x0001, + 0x353c: 0x0001, 0x353d: 0x0001, 0x353e: 0x0001, 0x353f: 0x0001, + // Block 0xd5, offset 0x3540 + 0x3540: 0x0001, 0x3541: 0x0001, 0x3542: 0x0001, 0x3543: 0x0001, 0x3544: 0x000c, 0x3545: 0x000c, + 0x3546: 0x000c, 0x3547: 0x000c, 0x3548: 0x000c, 0x3549: 0x000c, 0x354a: 0x000c, 0x354b: 0x0001, + 0x354c: 0x0001, 0x354d: 0x0001, 0x354e: 0x0001, 0x354f: 0x0001, 0x3550: 0x0001, 0x3551: 0x0001, + 0x3552: 0x0001, 0x3553: 0x0001, 0x3554: 0x0001, 0x3555: 0x0001, 0x3556: 0x0001, 0x3557: 0x0001, + 0x3558: 0x0001, 0x3559: 0x0001, 0x355a: 0x0001, 0x355b: 0x0001, 0x355c: 0x0001, 0x355d: 0x0001, + 0x355e: 0x0001, 0x355f: 0x0001, 0x3560: 0x0001, 0x3561: 0x0001, 0x3562: 0x0001, 0x3563: 0x0001, + 0x3564: 0x0001, 0x3565: 0x0001, 0x3566: 0x0001, 0x3567: 0x0001, 0x3568: 0x0001, 0x3569: 0x0001, + 0x356a: 0x0001, 0x356b: 0x0001, 0x356c: 0x0001, 0x356d: 0x0001, 0x356e: 0x0001, 0x356f: 0x0001, + 0x3570: 0x0001, 0x3571: 0x0001, 0x3572: 0x0001, 0x3573: 0x0001, 0x3574: 0x0001, 0x3575: 0x0001, + 0x3576: 0x0001, 0x3577: 0x0001, 0x3578: 0x0001, 0x3579: 0x0001, 0x357a: 0x0001, 0x357b: 0x0001, + 0x357c: 0x0001, 0x357d: 0x0001, 0x357e: 0x0001, 0x357f: 0x0001, + // Block 0xd6, offset 0x3580 + 0x3580: 0x000d, 0x3581: 0x000d, 0x3582: 0x000d, 0x3583: 0x000d, 0x3584: 0x000d, 0x3585: 0x000d, + 0x3586: 0x000d, 0x3587: 0x000d, 0x3588: 0x000d, 0x3589: 0x000d, 0x358a: 0x000d, 0x358b: 0x000d, + 0x358c: 0x000d, 0x358d: 0x000d, 0x358e: 0x000d, 0x358f: 0x000d, 0x3590: 0x000d, 0x3591: 0x000d, + 0x3592: 0x000d, 0x3593: 0x000d, 0x3594: 0x000d, 0x3595: 0x000d, 0x3596: 0x000d, 0x3597: 0x000d, + 0x3598: 0x000d, 0x3599: 0x000d, 0x359a: 0x000d, 0x359b: 0x000d, 0x359c: 0x000d, 0x359d: 0x000d, + 0x359e: 0x000d, 0x359f: 0x000d, 0x35a0: 0x000d, 0x35a1: 0x000d, 0x35a2: 0x000d, 0x35a3: 0x000d, + 0x35a4: 0x000d, 0x35a5: 0x000d, 0x35a6: 0x000d, 0x35a7: 0x000d, 0x35a8: 0x000d, 0x35a9: 0x000d, + 0x35aa: 0x000d, 0x35ab: 0x000d, 0x35ac: 0x000d, 0x35ad: 0x000d, 0x35ae: 0x000d, 0x35af: 0x000d, + 0x35b0: 0x000a, 0x35b1: 0x000a, 0x35b2: 0x000d, 0x35b3: 0x000d, 0x35b4: 0x000d, 0x35b5: 0x000d, + 0x35b6: 0x000d, 0x35b7: 0x000d, 0x35b8: 0x000d, 0x35b9: 0x000d, 0x35ba: 0x000d, 0x35bb: 0x000d, + 0x35bc: 0x000d, 0x35bd: 0x000d, 0x35be: 0x000d, 0x35bf: 0x000d, + // Block 0xd7, offset 0x35c0 + 0x35c0: 0x000a, 0x35c1: 0x000a, 0x35c2: 0x000a, 0x35c3: 0x000a, 0x35c4: 0x000a, 0x35c5: 0x000a, + 0x35c6: 0x000a, 0x35c7: 0x000a, 0x35c8: 0x000a, 0x35c9: 0x000a, 0x35ca: 0x000a, 0x35cb: 0x000a, + 0x35cc: 0x000a, 0x35cd: 0x000a, 0x35ce: 0x000a, 0x35cf: 0x000a, 0x35d0: 0x000a, 0x35d1: 0x000a, + 0x35d2: 0x000a, 0x35d3: 0x000a, 0x35d4: 0x000a, 0x35d5: 0x000a, 0x35d6: 0x000a, 0x35d7: 0x000a, + 0x35d8: 0x000a, 0x35d9: 0x000a, 0x35da: 0x000a, 0x35db: 0x000a, 0x35dc: 0x000a, 0x35dd: 0x000a, + 0x35de: 0x000a, 0x35df: 0x000a, 0x35e0: 0x000a, 0x35e1: 0x000a, 0x35e2: 0x000a, 0x35e3: 0x000a, + 0x35e4: 0x000a, 0x35e5: 0x000a, 0x35e6: 0x000a, 0x35e7: 0x000a, 0x35e8: 0x000a, 0x35e9: 0x000a, + 0x35ea: 0x000a, 0x35eb: 0x000a, + 0x35f0: 0x000a, 0x35f1: 0x000a, 0x35f2: 0x000a, 0x35f3: 0x000a, 0x35f4: 0x000a, 0x35f5: 0x000a, + 0x35f6: 0x000a, 0x35f7: 0x000a, 0x35f8: 0x000a, 0x35f9: 0x000a, 0x35fa: 0x000a, 0x35fb: 0x000a, + 0x35fc: 0x000a, 0x35fd: 0x000a, 0x35fe: 0x000a, 0x35ff: 0x000a, + // Block 0xd8, offset 0x3600 + 0x3600: 0x000a, 0x3601: 0x000a, 0x3602: 0x000a, 0x3603: 0x000a, 0x3604: 0x000a, 0x3605: 0x000a, + 0x3606: 0x000a, 0x3607: 0x000a, 0x3608: 0x000a, 0x3609: 0x000a, 0x360a: 0x000a, 0x360b: 0x000a, + 0x360c: 0x000a, 0x360d: 0x000a, 0x360e: 0x000a, 0x360f: 0x000a, 0x3610: 0x000a, 0x3611: 0x000a, + 0x3612: 0x000a, 0x3613: 0x000a, + 0x3620: 0x000a, 0x3621: 0x000a, 0x3622: 0x000a, 0x3623: 0x000a, + 0x3624: 0x000a, 0x3625: 0x000a, 0x3626: 0x000a, 0x3627: 0x000a, 0x3628: 0x000a, 0x3629: 0x000a, + 0x362a: 0x000a, 0x362b: 0x000a, 0x362c: 0x000a, 0x362d: 0x000a, 0x362e: 0x000a, + 0x3631: 0x000a, 0x3632: 0x000a, 0x3633: 0x000a, 0x3634: 0x000a, 0x3635: 0x000a, + 0x3636: 0x000a, 0x3637: 0x000a, 0x3638: 0x000a, 0x3639: 0x000a, 0x363a: 0x000a, 0x363b: 0x000a, + 0x363c: 0x000a, 0x363d: 0x000a, 0x363e: 0x000a, 0x363f: 0x000a, + // Block 0xd9, offset 0x3640 + 0x3641: 0x000a, 0x3642: 0x000a, 0x3643: 0x000a, 0x3644: 0x000a, 0x3645: 0x000a, + 0x3646: 0x000a, 0x3647: 0x000a, 0x3648: 0x000a, 0x3649: 0x000a, 0x364a: 0x000a, 0x364b: 0x000a, + 0x364c: 0x000a, 0x364d: 0x000a, 0x364e: 0x000a, 0x364f: 0x000a, 0x3651: 0x000a, + 0x3652: 0x000a, 0x3653: 0x000a, 0x3654: 0x000a, 0x3655: 0x000a, 0x3656: 0x000a, 0x3657: 0x000a, + 0x3658: 0x000a, 0x3659: 0x000a, 0x365a: 0x000a, 0x365b: 0x000a, 0x365c: 0x000a, 0x365d: 0x000a, + 0x365e: 0x000a, 0x365f: 0x000a, 0x3660: 0x000a, 0x3661: 0x000a, 0x3662: 0x000a, 0x3663: 0x000a, + 0x3664: 0x000a, 0x3665: 0x000a, 0x3666: 0x000a, 0x3667: 0x000a, 0x3668: 0x000a, 0x3669: 0x000a, + 0x366a: 0x000a, 0x366b: 0x000a, 0x366c: 0x000a, 0x366d: 0x000a, 0x366e: 0x000a, 0x366f: 0x000a, + 0x3670: 0x000a, 0x3671: 0x000a, 0x3672: 0x000a, 0x3673: 0x000a, 0x3674: 0x000a, 0x3675: 0x000a, + // Block 0xda, offset 0x3680 + 0x3680: 0x0002, 0x3681: 0x0002, 0x3682: 0x0002, 0x3683: 0x0002, 0x3684: 0x0002, 0x3685: 0x0002, + 0x3686: 0x0002, 0x3687: 0x0002, 0x3688: 0x0002, 0x3689: 0x0002, 0x368a: 0x0002, 0x368b: 0x000a, + 0x368c: 0x000a, + 0x36af: 0x000a, + // Block 0xdb, offset 0x36c0 + 0x36ea: 0x000a, 0x36eb: 0x000a, + // Block 0xdc, offset 0x3700 + 0x3720: 0x000a, 0x3721: 0x000a, 0x3722: 0x000a, 0x3723: 0x000a, + 0x3724: 0x000a, 0x3725: 0x000a, + // Block 0xdd, offset 0x3740 + 0x3740: 0x000a, 0x3741: 0x000a, 0x3742: 0x000a, 0x3743: 0x000a, 0x3744: 0x000a, 0x3745: 0x000a, + 0x3746: 0x000a, 0x3747: 0x000a, 0x3748: 0x000a, 0x3749: 0x000a, 0x374a: 0x000a, 0x374b: 0x000a, + 0x374c: 0x000a, 0x374d: 0x000a, 0x374e: 0x000a, 0x374f: 0x000a, 0x3750: 0x000a, 0x3751: 0x000a, + 0x3752: 0x000a, 0x3753: 0x000a, 0x3754: 0x000a, + 0x3760: 0x000a, 0x3761: 0x000a, 0x3762: 0x000a, 0x3763: 0x000a, + 0x3764: 0x000a, 0x3765: 0x000a, 0x3766: 0x000a, 0x3767: 0x000a, 0x3768: 0x000a, 0x3769: 0x000a, + 0x376a: 0x000a, 0x376b: 0x000a, 0x376c: 0x000a, + 0x3770: 0x000a, 0x3771: 0x000a, 0x3772: 0x000a, 0x3773: 0x000a, 0x3774: 0x000a, 0x3775: 0x000a, + 0x3776: 0x000a, 0x3777: 0x000a, 0x3778: 0x000a, 0x3779: 0x000a, + // Block 0xde, offset 0x3780 + 0x3780: 0x000a, 0x3781: 0x000a, 0x3782: 0x000a, 0x3783: 0x000a, 0x3784: 0x000a, 0x3785: 0x000a, + 0x3786: 0x000a, 0x3787: 0x000a, 0x3788: 0x000a, 0x3789: 0x000a, 0x378a: 0x000a, 0x378b: 0x000a, + 0x378c: 0x000a, 0x378d: 0x000a, 0x378e: 0x000a, 0x378f: 0x000a, 0x3790: 0x000a, 0x3791: 0x000a, + 0x3792: 0x000a, 0x3793: 0x000a, 0x3794: 0x000a, 0x3795: 0x000a, 0x3796: 0x000a, 0x3797: 0x000a, + 0x3798: 0x000a, + // Block 0xdf, offset 0x37c0 + 0x37c0: 0x000a, 0x37c1: 0x000a, 0x37c2: 0x000a, 0x37c3: 0x000a, 0x37c4: 0x000a, 0x37c5: 0x000a, + 0x37c6: 0x000a, 0x37c7: 0x000a, 0x37c8: 0x000a, 0x37c9: 0x000a, 0x37ca: 0x000a, 0x37cb: 0x000a, + 0x37d0: 0x000a, 0x37d1: 0x000a, + 0x37d2: 0x000a, 0x37d3: 0x000a, 0x37d4: 0x000a, 0x37d5: 0x000a, 0x37d6: 0x000a, 0x37d7: 0x000a, + 0x37d8: 0x000a, 0x37d9: 0x000a, 0x37da: 0x000a, 0x37db: 0x000a, 0x37dc: 0x000a, 0x37dd: 0x000a, + 0x37de: 0x000a, 0x37df: 0x000a, 0x37e0: 0x000a, 0x37e1: 0x000a, 0x37e2: 0x000a, 0x37e3: 0x000a, + 0x37e4: 0x000a, 0x37e5: 0x000a, 0x37e6: 0x000a, 0x37e7: 0x000a, 0x37e8: 0x000a, 0x37e9: 0x000a, + 0x37ea: 0x000a, 0x37eb: 0x000a, 0x37ec: 0x000a, 0x37ed: 0x000a, 0x37ee: 0x000a, 0x37ef: 0x000a, + 0x37f0: 0x000a, 0x37f1: 0x000a, 0x37f2: 0x000a, 0x37f3: 0x000a, 0x37f4: 0x000a, 0x37f5: 0x000a, + 0x37f6: 0x000a, 0x37f7: 0x000a, 0x37f8: 0x000a, 0x37f9: 0x000a, 0x37fa: 0x000a, 0x37fb: 0x000a, + 0x37fc: 0x000a, 0x37fd: 0x000a, 0x37fe: 0x000a, 0x37ff: 0x000a, + // Block 0xe0, offset 0x3800 + 0x3800: 0x000a, 0x3801: 0x000a, 0x3802: 0x000a, 0x3803: 0x000a, 0x3804: 0x000a, 0x3805: 0x000a, + 0x3806: 0x000a, 0x3807: 0x000a, + 0x3810: 0x000a, 0x3811: 0x000a, + 0x3812: 0x000a, 0x3813: 0x000a, 0x3814: 0x000a, 0x3815: 0x000a, 0x3816: 0x000a, 0x3817: 0x000a, + 0x3818: 0x000a, 0x3819: 0x000a, + 0x3820: 0x000a, 0x3821: 0x000a, 0x3822: 0x000a, 0x3823: 0x000a, + 0x3824: 0x000a, 0x3825: 0x000a, 0x3826: 0x000a, 0x3827: 0x000a, 0x3828: 0x000a, 0x3829: 0x000a, + 0x382a: 0x000a, 0x382b: 0x000a, 0x382c: 0x000a, 0x382d: 0x000a, 0x382e: 0x000a, 0x382f: 0x000a, + 0x3830: 0x000a, 0x3831: 0x000a, 0x3832: 0x000a, 0x3833: 0x000a, 0x3834: 0x000a, 0x3835: 0x000a, + 0x3836: 0x000a, 0x3837: 0x000a, 0x3838: 0x000a, 0x3839: 0x000a, 0x383a: 0x000a, 0x383b: 0x000a, + 0x383c: 0x000a, 0x383d: 0x000a, 0x383e: 0x000a, 0x383f: 0x000a, + // Block 0xe1, offset 0x3840 + 0x3840: 0x000a, 0x3841: 0x000a, 0x3842: 0x000a, 0x3843: 0x000a, 0x3844: 0x000a, 0x3845: 0x000a, + 0x3846: 0x000a, 0x3847: 0x000a, + 0x3850: 0x000a, 0x3851: 0x000a, + 0x3852: 0x000a, 0x3853: 0x000a, 0x3854: 0x000a, 0x3855: 0x000a, 0x3856: 0x000a, 0x3857: 0x000a, + 0x3858: 0x000a, 0x3859: 0x000a, 0x385a: 0x000a, 0x385b: 0x000a, 0x385c: 0x000a, 0x385d: 0x000a, + 0x385e: 0x000a, 0x385f: 0x000a, 0x3860: 0x000a, 0x3861: 0x000a, 0x3862: 0x000a, 0x3863: 0x000a, + 0x3864: 0x000a, 0x3865: 0x000a, 0x3866: 0x000a, 0x3867: 0x000a, 0x3868: 0x000a, 0x3869: 0x000a, + 0x386a: 0x000a, 0x386b: 0x000a, 0x386c: 0x000a, 0x386d: 0x000a, + // Block 0xe2, offset 0x3880 + 0x3880: 0x000a, 0x3881: 0x000a, 0x3882: 0x000a, 0x3883: 0x000a, 0x3884: 0x000a, 0x3885: 0x000a, + 0x3886: 0x000a, 0x3887: 0x000a, 0x3888: 0x000a, 0x3889: 0x000a, 0x388a: 0x000a, 0x388b: 0x000a, + 0x3890: 0x000a, 0x3891: 0x000a, + 0x3892: 0x000a, 0x3893: 0x000a, 0x3894: 0x000a, 0x3895: 0x000a, 0x3896: 0x000a, 0x3897: 0x000a, + 0x3898: 0x000a, 0x3899: 0x000a, 0x389a: 0x000a, 0x389b: 0x000a, 0x389c: 0x000a, 0x389d: 0x000a, + 0x389e: 0x000a, 0x389f: 0x000a, 0x38a0: 0x000a, 0x38a1: 0x000a, 0x38a2: 0x000a, 0x38a3: 0x000a, + 0x38a4: 0x000a, 0x38a5: 0x000a, 0x38a6: 0x000a, 0x38a7: 0x000a, 0x38a8: 0x000a, 0x38a9: 0x000a, + 0x38aa: 0x000a, 0x38ab: 0x000a, 0x38ac: 0x000a, 0x38ad: 0x000a, 0x38ae: 0x000a, 0x38af: 0x000a, + 0x38b0: 0x000a, 0x38b1: 0x000a, 0x38b2: 0x000a, 0x38b3: 0x000a, 0x38b4: 0x000a, 0x38b5: 0x000a, + 0x38b6: 0x000a, 0x38b7: 0x000a, 0x38b8: 0x000a, 0x38b9: 0x000a, 0x38ba: 0x000a, 0x38bb: 0x000a, + 0x38bc: 0x000a, 0x38bd: 0x000a, 0x38be: 0x000a, + // Block 0xe3, offset 0x38c0 + 0x38c0: 0x000a, 0x38c1: 0x000a, 0x38c2: 0x000a, 0x38c3: 0x000a, 0x38c4: 0x000a, 0x38c5: 0x000a, + 0x38c6: 0x000a, 0x38c7: 0x000a, 0x38c8: 0x000a, 0x38c9: 0x000a, 0x38ca: 0x000a, 0x38cb: 0x000a, + 0x38cc: 0x000a, 0x38cd: 0x000a, 0x38ce: 0x000a, 0x38cf: 0x000a, 0x38d0: 0x000a, 0x38d1: 0x000a, + 0x38d2: 0x000a, 0x38d3: 0x000a, 0x38d4: 0x000a, 0x38d5: 0x000a, 0x38d6: 0x000a, 0x38d7: 0x000a, + 0x38d8: 0x000a, 0x38d9: 0x000a, 0x38da: 0x000a, 0x38db: 0x000a, 0x38dc: 0x000a, 0x38dd: 0x000a, + 0x38de: 0x000a, 0x38df: 0x000a, 0x38e0: 0x000a, 0x38e1: 0x000a, 0x38e2: 0x000a, 0x38e3: 0x000a, + 0x38e4: 0x000a, 0x38e5: 0x000a, 0x38e6: 0x000a, 0x38e7: 0x000a, 0x38e8: 0x000a, 0x38e9: 0x000a, + 0x38ea: 0x000a, 0x38eb: 0x000a, 0x38ec: 0x000a, 0x38ed: 0x000a, 0x38ee: 0x000a, 0x38ef: 0x000a, + 0x38f0: 0x000a, 0x38f3: 0x000a, 0x38f4: 0x000a, 0x38f5: 0x000a, + 0x38f6: 0x000a, 0x38fa: 0x000a, + 0x38fc: 0x000a, 0x38fd: 0x000a, 0x38fe: 0x000a, 0x38ff: 0x000a, + // Block 0xe4, offset 0x3900 + 0x3900: 0x000a, 0x3901: 0x000a, 0x3902: 0x000a, 0x3903: 0x000a, 0x3904: 0x000a, 0x3905: 0x000a, + 0x3906: 0x000a, 0x3907: 0x000a, 0x3908: 0x000a, 0x3909: 0x000a, 0x390a: 0x000a, 0x390b: 0x000a, + 0x390c: 0x000a, 0x390d: 0x000a, 0x390e: 0x000a, 0x390f: 0x000a, 0x3910: 0x000a, 0x3911: 0x000a, + 0x3912: 0x000a, 0x3913: 0x000a, 0x3914: 0x000a, 0x3915: 0x000a, 0x3916: 0x000a, 0x3917: 0x000a, + 0x3918: 0x000a, 0x3919: 0x000a, 0x391a: 0x000a, 0x391b: 0x000a, 0x391c: 0x000a, 0x391d: 0x000a, + 0x391e: 0x000a, 0x391f: 0x000a, 0x3920: 0x000a, 0x3921: 0x000a, 0x3922: 0x000a, + 0x3930: 0x000a, 0x3931: 0x000a, 0x3932: 0x000a, 0x3933: 0x000a, 0x3934: 0x000a, 0x3935: 0x000a, + 0x3936: 0x000a, 0x3937: 0x000a, 0x3938: 0x000a, 0x3939: 0x000a, + // Block 0xe5, offset 0x3940 + 0x3940: 0x000a, 0x3941: 0x000a, 0x3942: 0x000a, + 0x3950: 0x000a, 0x3951: 0x000a, + 0x3952: 0x000a, 0x3953: 0x000a, 0x3954: 0x000a, 0x3955: 0x000a, 0x3956: 0x000a, 0x3957: 0x000a, + 0x3958: 0x000a, 0x3959: 0x000a, 0x395a: 0x000a, 0x395b: 0x000a, 0x395c: 0x000a, 0x395d: 0x000a, + 0x395e: 0x000a, 0x395f: 0x000a, 0x3960: 0x000a, 0x3961: 0x000a, 0x3962: 0x000a, 0x3963: 0x000a, + 0x3964: 0x000a, 0x3965: 0x000a, 0x3966: 0x000a, 0x3967: 0x000a, 0x3968: 0x000a, 0x3969: 0x000a, + 0x396a: 0x000a, 0x396b: 0x000a, 0x396c: 0x000a, 0x396d: 0x000a, 0x396e: 0x000a, 0x396f: 0x000a, + 0x3970: 0x000a, 0x3971: 0x000a, 0x3972: 0x000a, 0x3973: 0x000a, 0x3974: 0x000a, 0x3975: 0x000a, + 0x3976: 0x000a, 0x3977: 0x000a, 0x3978: 0x000a, 0x3979: 0x000a, 0x397a: 0x000a, 0x397b: 0x000a, + 0x397c: 0x000a, 0x397d: 0x000a, 0x397e: 0x000a, 0x397f: 0x000a, + // Block 0xe6, offset 0x3980 + 0x39a0: 0x000a, 0x39a1: 0x000a, 0x39a2: 0x000a, 0x39a3: 0x000a, + 0x39a4: 0x000a, 0x39a5: 0x000a, 0x39a6: 0x000a, 0x39a7: 0x000a, 0x39a8: 0x000a, 0x39a9: 0x000a, + 0x39aa: 0x000a, 0x39ab: 0x000a, 0x39ac: 0x000a, 0x39ad: 0x000a, + // Block 0xe7, offset 0x39c0 + 0x39fe: 0x000b, 0x39ff: 0x000b, + // Block 0xe8, offset 0x3a00 + 0x3a00: 0x000b, 0x3a01: 0x000b, 0x3a02: 0x000b, 0x3a03: 0x000b, 0x3a04: 0x000b, 0x3a05: 0x000b, + 0x3a06: 0x000b, 0x3a07: 0x000b, 0x3a08: 0x000b, 0x3a09: 0x000b, 0x3a0a: 0x000b, 0x3a0b: 0x000b, + 0x3a0c: 0x000b, 0x3a0d: 0x000b, 0x3a0e: 0x000b, 0x3a0f: 0x000b, 0x3a10: 0x000b, 0x3a11: 0x000b, + 0x3a12: 0x000b, 0x3a13: 0x000b, 0x3a14: 0x000b, 0x3a15: 0x000b, 0x3a16: 0x000b, 0x3a17: 0x000b, + 0x3a18: 0x000b, 0x3a19: 0x000b, 0x3a1a: 0x000b, 0x3a1b: 0x000b, 0x3a1c: 0x000b, 0x3a1d: 0x000b, + 0x3a1e: 0x000b, 0x3a1f: 0x000b, 0x3a20: 0x000b, 0x3a21: 0x000b, 0x3a22: 0x000b, 0x3a23: 0x000b, + 0x3a24: 0x000b, 0x3a25: 0x000b, 0x3a26: 0x000b, 0x3a27: 0x000b, 0x3a28: 0x000b, 0x3a29: 0x000b, + 0x3a2a: 0x000b, 0x3a2b: 0x000b, 0x3a2c: 0x000b, 0x3a2d: 0x000b, 0x3a2e: 0x000b, 0x3a2f: 0x000b, + 0x3a30: 0x000b, 0x3a31: 0x000b, 0x3a32: 0x000b, 0x3a33: 0x000b, 0x3a34: 0x000b, 0x3a35: 0x000b, + 0x3a36: 0x000b, 0x3a37: 0x000b, 0x3a38: 0x000b, 0x3a39: 0x000b, 0x3a3a: 0x000b, 0x3a3b: 0x000b, + 0x3a3c: 0x000b, 0x3a3d: 0x000b, 0x3a3e: 0x000b, 0x3a3f: 0x000b, + // Block 0xe9, offset 0x3a40 + 0x3a40: 0x000c, 0x3a41: 0x000c, 0x3a42: 0x000c, 0x3a43: 0x000c, 0x3a44: 0x000c, 0x3a45: 0x000c, + 0x3a46: 0x000c, 0x3a47: 0x000c, 0x3a48: 0x000c, 0x3a49: 0x000c, 0x3a4a: 0x000c, 0x3a4b: 0x000c, + 0x3a4c: 0x000c, 0x3a4d: 0x000c, 0x3a4e: 0x000c, 0x3a4f: 0x000c, 0x3a50: 0x000c, 0x3a51: 0x000c, + 0x3a52: 0x000c, 0x3a53: 0x000c, 0x3a54: 0x000c, 0x3a55: 0x000c, 0x3a56: 0x000c, 0x3a57: 0x000c, + 0x3a58: 0x000c, 0x3a59: 0x000c, 0x3a5a: 0x000c, 0x3a5b: 0x000c, 0x3a5c: 0x000c, 0x3a5d: 0x000c, + 0x3a5e: 0x000c, 0x3a5f: 0x000c, 0x3a60: 0x000c, 0x3a61: 0x000c, 0x3a62: 0x000c, 0x3a63: 0x000c, + 0x3a64: 0x000c, 0x3a65: 0x000c, 0x3a66: 0x000c, 0x3a67: 0x000c, 0x3a68: 0x000c, 0x3a69: 0x000c, + 0x3a6a: 0x000c, 0x3a6b: 0x000c, 0x3a6c: 0x000c, 0x3a6d: 0x000c, 0x3a6e: 0x000c, 0x3a6f: 0x000c, + 0x3a70: 0x000b, 0x3a71: 0x000b, 0x3a72: 0x000b, 0x3a73: 0x000b, 0x3a74: 0x000b, 0x3a75: 0x000b, + 0x3a76: 0x000b, 0x3a77: 0x000b, 0x3a78: 0x000b, 0x3a79: 0x000b, 0x3a7a: 0x000b, 0x3a7b: 0x000b, + 0x3a7c: 0x000b, 0x3a7d: 0x000b, 0x3a7e: 0x000b, 0x3a7f: 0x000b, +} + +// bidiIndex: 24 blocks, 1536 entries, 1536 bytes +// Block 0 is the zero block. +var bidiIndex = [1536]uint8{ + // Block 0x0, offset 0x0 + // Block 0x1, offset 0x40 + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc2: 0x01, 0xc3: 0x02, + 0xca: 0x03, 0xcb: 0x04, 0xcc: 0x05, 0xcd: 0x06, 0xce: 0x07, 0xcf: 0x08, + 0xd2: 0x09, 0xd6: 0x0a, 0xd7: 0x0b, + 0xd8: 0x0c, 0xd9: 0x0d, 0xda: 0x0e, 0xdb: 0x0f, 0xdc: 0x10, 0xdd: 0x11, 0xde: 0x12, 0xdf: 0x13, + 0xe0: 0x02, 0xe1: 0x03, 0xe2: 0x04, 0xe3: 0x05, 0xe4: 0x06, + 0xea: 0x07, 0xef: 0x08, + 0xf0: 0x11, 0xf1: 0x12, 0xf2: 0x12, 0xf3: 0x14, 0xf4: 0x15, + // Block 0x4, offset 0x100 + 0x120: 0x14, 0x121: 0x15, 0x122: 0x16, 0x123: 0x17, 0x124: 0x18, 0x125: 0x19, 0x126: 0x1a, 0x127: 0x1b, + 0x128: 0x1c, 0x129: 0x1d, 0x12a: 0x1c, 0x12b: 0x1e, 0x12c: 0x1f, 0x12d: 0x20, 0x12e: 0x21, 0x12f: 0x22, + 0x130: 0x23, 0x131: 0x24, 0x132: 0x1a, 0x133: 0x25, 0x134: 0x26, 0x135: 0x27, 0x137: 0x28, + 0x138: 0x29, 0x139: 0x2a, 0x13a: 0x2b, 0x13b: 0x2c, 0x13c: 0x2d, 0x13d: 0x2e, 0x13e: 0x2f, 0x13f: 0x30, + // Block 0x5, offset 0x140 + 0x140: 0x31, 0x141: 0x32, 0x142: 0x33, + 0x14d: 0x34, 0x14e: 0x35, + 0x150: 0x36, + 0x15a: 0x37, 0x15c: 0x38, 0x15d: 0x39, 0x15e: 0x3a, 0x15f: 0x3b, + 0x160: 0x3c, 0x162: 0x3d, 0x164: 0x3e, 0x165: 0x3f, 0x167: 0x40, + 0x168: 0x41, 0x169: 0x42, 0x16a: 0x43, 0x16c: 0x44, 0x16d: 0x45, 0x16e: 0x46, 0x16f: 0x47, + 0x170: 0x48, 0x173: 0x49, 0x177: 0x4a, + 0x17e: 0x4b, 0x17f: 0x4c, + // Block 0x6, offset 0x180 + 0x180: 0x4d, 0x181: 0x4e, 0x182: 0x4f, 0x183: 0x50, 0x184: 0x51, 0x185: 0x52, 0x186: 0x53, 0x187: 0x54, + 0x188: 0x55, 0x189: 0x54, 0x18a: 0x54, 0x18b: 0x54, 0x18c: 0x56, 0x18d: 0x57, 0x18e: 0x58, 0x18f: 0x54, + 0x190: 0x59, 0x191: 0x5a, 0x192: 0x5b, 0x193: 0x5c, 0x194: 0x54, 0x195: 0x54, 0x196: 0x54, 0x197: 0x54, + 0x198: 0x54, 0x199: 0x54, 0x19a: 0x5d, 0x19b: 0x54, 0x19c: 0x54, 0x19d: 0x5e, 0x19e: 0x54, 0x19f: 0x5f, + 0x1a4: 0x54, 0x1a5: 0x54, 0x1a6: 0x60, 0x1a7: 0x61, + 0x1a8: 0x54, 0x1a9: 0x54, 0x1aa: 0x54, 0x1ab: 0x54, 0x1ac: 0x54, 0x1ad: 0x62, 0x1ae: 0x63, 0x1af: 0x64, + 0x1b3: 0x65, 0x1b5: 0x66, 0x1b7: 0x67, + 0x1b8: 0x68, 0x1b9: 0x69, 0x1ba: 0x6a, 0x1bb: 0x6b, 0x1bc: 0x54, 0x1bd: 0x54, 0x1be: 0x54, 0x1bf: 0x6c, + // Block 0x7, offset 0x1c0 + 0x1c0: 0x6d, 0x1c2: 0x6e, 0x1c3: 0x6f, 0x1c7: 0x70, + 0x1c8: 0x71, 0x1c9: 0x72, 0x1ca: 0x73, 0x1cb: 0x74, 0x1cd: 0x75, 0x1cf: 0x76, + // Block 0x8, offset 0x200 + 0x237: 0x54, + // Block 0x9, offset 0x240 + 0x252: 0x77, 0x253: 0x78, + 0x258: 0x79, 0x259: 0x7a, 0x25a: 0x7b, 0x25b: 0x7c, 0x25c: 0x7d, 0x25e: 0x7e, + 0x260: 0x7f, 0x261: 0x80, 0x263: 0x81, 0x264: 0x82, 0x265: 0x83, 0x266: 0x84, 0x267: 0x85, + 0x268: 0x86, 0x269: 0x87, 0x26a: 0x88, 0x26b: 0x89, 0x26f: 0x8a, + // Block 0xa, offset 0x280 + 0x2ac: 0x8b, 0x2ad: 0x8c, 0x2ae: 0x0e, 0x2af: 0x0e, + 0x2b0: 0x0e, 0x2b1: 0x0e, 0x2b2: 0x0e, 0x2b3: 0x0e, 0x2b4: 0x8d, 0x2b5: 0x0e, 0x2b6: 0x0e, 0x2b7: 0x8e, + 0x2b8: 0x8f, 0x2b9: 0x90, 0x2ba: 0x0e, 0x2bb: 0x91, 0x2bc: 0x92, 0x2bd: 0x93, 0x2bf: 0x94, + // Block 0xb, offset 0x2c0 + 0x2c4: 0x95, 0x2c5: 0x54, 0x2c6: 0x96, 0x2c7: 0x97, + 0x2cb: 0x98, 0x2cd: 0x99, + 0x2e0: 0x9a, 0x2e1: 0x9a, 0x2e2: 0x9a, 0x2e3: 0x9a, 0x2e4: 0x9b, 0x2e5: 0x9a, 0x2e6: 0x9a, 0x2e7: 0x9a, + 0x2e8: 0x9c, 0x2e9: 0x9a, 0x2ea: 0x9a, 0x2eb: 0x9d, 0x2ec: 0x9e, 0x2ed: 0x9a, 0x2ee: 0x9a, 0x2ef: 0x9a, + 0x2f0: 0x9a, 0x2f1: 0x9a, 0x2f2: 0x9a, 0x2f3: 0x9a, 0x2f4: 0x9f, 0x2f5: 0x9a, 0x2f6: 0x9a, 0x2f7: 0x9a, + 0x2f8: 0x9a, 0x2f9: 0xa0, 0x2fa: 0x9a, 0x2fb: 0x9a, 0x2fc: 0xa1, 0x2fd: 0xa2, 0x2fe: 0x9a, 0x2ff: 0x9a, + // Block 0xc, offset 0x300 + 0x300: 0xa3, 0x301: 0xa4, 0x302: 0xa5, 0x304: 0xa6, 0x305: 0xa7, 0x306: 0xa8, 0x307: 0xa9, + 0x308: 0xaa, 0x30b: 0xab, 0x30c: 0x26, 0x30d: 0xac, + 0x310: 0xad, 0x311: 0xae, 0x312: 0xaf, 0x313: 0xb0, 0x316: 0xb1, 0x317: 0xb2, + 0x318: 0xb3, 0x319: 0xb4, 0x31a: 0xb5, 0x31c: 0xb6, + 0x320: 0xb7, + 0x328: 0xb8, 0x329: 0xb9, 0x32a: 0xba, + 0x330: 0xbb, 0x332: 0xbc, 0x334: 0xbd, 0x335: 0xbe, 0x336: 0xbf, + 0x33b: 0xc0, + // Block 0xd, offset 0x340 + 0x36b: 0xc1, 0x36c: 0xc2, + 0x37e: 0xc3, + // Block 0xe, offset 0x380 + 0x3b2: 0xc4, + // Block 0xf, offset 0x3c0 + 0x3c5: 0xc5, 0x3c6: 0xc6, + 0x3c8: 0x54, 0x3c9: 0xc7, 0x3cc: 0x54, 0x3cd: 0xc8, + 0x3db: 0xc9, 0x3dc: 0xca, 0x3dd: 0xcb, 0x3de: 0xcc, 0x3df: 0xcd, + 0x3e8: 0xce, 0x3e9: 0xcf, 0x3ea: 0xd0, + // Block 0x10, offset 0x400 + 0x400: 0xd1, + 0x420: 0x9a, 0x421: 0x9a, 0x422: 0x9a, 0x423: 0xd2, 0x424: 0x9a, 0x425: 0xd3, 0x426: 0x9a, 0x427: 0x9a, + 0x428: 0x9a, 0x429: 0x9a, 0x42a: 0x9a, 0x42b: 0x9a, 0x42c: 0x9a, 0x42d: 0x9a, 0x42e: 0x9a, 0x42f: 0x9a, + 0x430: 0x9a, 0x431: 0xa1, 0x432: 0x0e, 0x433: 0x9a, 0x434: 0x9a, 0x435: 0x9a, 0x436: 0x9a, 0x437: 0x9a, + 0x438: 0x0e, 0x439: 0x0e, 0x43a: 0x0e, 0x43b: 0xd4, 0x43c: 0x9a, 0x43d: 0x9a, 0x43e: 0x9a, 0x43f: 0x9a, + // Block 0x11, offset 0x440 + 0x440: 0xd5, 0x441: 0x54, 0x442: 0xd6, 0x443: 0xd7, 0x444: 0xd8, 0x445: 0xd9, + 0x449: 0xda, 0x44c: 0x54, 0x44d: 0x54, 0x44e: 0x54, 0x44f: 0x54, + 0x450: 0x54, 0x451: 0x54, 0x452: 0x54, 0x453: 0x54, 0x454: 0x54, 0x455: 0x54, 0x456: 0x54, 0x457: 0x54, + 0x458: 0x54, 0x459: 0x54, 0x45a: 0x54, 0x45b: 0xdb, 0x45c: 0x54, 0x45d: 0x6b, 0x45e: 0x54, 0x45f: 0xdc, + 0x460: 0xdd, 0x461: 0xde, 0x462: 0xdf, 0x464: 0xe0, 0x465: 0xe1, 0x466: 0xe2, 0x467: 0xe3, + 0x469: 0xe4, + 0x47f: 0xe5, + // Block 0x12, offset 0x480 + 0x4bf: 0xe5, + // Block 0x13, offset 0x4c0 + 0x4d0: 0x09, 0x4d1: 0x0a, 0x4d6: 0x0b, + 0x4db: 0x0c, 0x4dd: 0x0d, 0x4de: 0x0e, 0x4df: 0x0f, + 0x4ef: 0x10, + 0x4ff: 0x10, + // Block 0x14, offset 0x500 + 0x50f: 0x10, + 0x51f: 0x10, + 0x52f: 0x10, + 0x53f: 0x10, + // Block 0x15, offset 0x540 + 0x540: 0xe6, 0x541: 0xe6, 0x542: 0xe6, 0x543: 0xe6, 0x544: 0x05, 0x545: 0x05, 0x546: 0x05, 0x547: 0xe7, + 0x548: 0xe6, 0x549: 0xe6, 0x54a: 0xe6, 0x54b: 0xe6, 0x54c: 0xe6, 0x54d: 0xe6, 0x54e: 0xe6, 0x54f: 0xe6, + 0x550: 0xe6, 0x551: 0xe6, 0x552: 0xe6, 0x553: 0xe6, 0x554: 0xe6, 0x555: 0xe6, 0x556: 0xe6, 0x557: 0xe6, + 0x558: 0xe6, 0x559: 0xe6, 0x55a: 0xe6, 0x55b: 0xe6, 0x55c: 0xe6, 0x55d: 0xe6, 0x55e: 0xe6, 0x55f: 0xe6, + 0x560: 0xe6, 0x561: 0xe6, 0x562: 0xe6, 0x563: 0xe6, 0x564: 0xe6, 0x565: 0xe6, 0x566: 0xe6, 0x567: 0xe6, + 0x568: 0xe6, 0x569: 0xe6, 0x56a: 0xe6, 0x56b: 0xe6, 0x56c: 0xe6, 0x56d: 0xe6, 0x56e: 0xe6, 0x56f: 0xe6, + 0x570: 0xe6, 0x571: 0xe6, 0x572: 0xe6, 0x573: 0xe6, 0x574: 0xe6, 0x575: 0xe6, 0x576: 0xe6, 0x577: 0xe6, + 0x578: 0xe6, 0x579: 0xe6, 0x57a: 0xe6, 0x57b: 0xe6, 0x57c: 0xe6, 0x57d: 0xe6, 0x57e: 0xe6, 0x57f: 0xe6, + // Block 0x16, offset 0x580 + 0x58f: 0x10, + 0x59f: 0x10, + 0x5a0: 0x13, + 0x5af: 0x10, + 0x5bf: 0x10, + // Block 0x17, offset 0x5c0 + 0x5cf: 0x10, +} + +// Total table size 16568 bytes (16KiB); checksum: F50EF68C diff --git a/vendor/golang.org/x/text/unicode/norm/composition.go b/vendor/golang.org/x/text/unicode/norm/composition.go index bab4c5de..e2087bce 100644 --- a/vendor/golang.org/x/text/unicode/norm/composition.go +++ b/vendor/golang.org/x/text/unicode/norm/composition.go @@ -407,7 +407,7 @@ func decomposeHangul(buf []byte, r rune) int { // decomposeHangul algorithmically decomposes a Hangul rune into // its Jamo components. -// See http://unicode.org/reports/tr15/#Hangul for details on decomposing Hangul. +// See https://unicode.org/reports/tr15/#Hangul for details on decomposing Hangul. func (rb *reorderBuffer) decomposeHangul(r rune) { r -= hangulBase x := r % jamoTCount @@ -420,7 +420,7 @@ func (rb *reorderBuffer) decomposeHangul(r rune) { } // combineHangul algorithmically combines Jamo character components into Hangul. -// See http://unicode.org/reports/tr15/#Hangul for details on combining Hangul. +// See https://unicode.org/reports/tr15/#Hangul for details on combining Hangul. func (rb *reorderBuffer) combineHangul(s, i, k int) { b := rb.rune[:] bn := rb.nrune @@ -461,6 +461,10 @@ func (rb *reorderBuffer) combineHangul(s, i, k int) { // It should only be used to recompose a single segment, as it will not // handle alternations between Hangul and non-Hangul characters correctly. func (rb *reorderBuffer) compose() { + // Lazily load the map used by the combine func below, but do + // it outside of the loop. + recompMapOnce.Do(buildRecompMap) + // UAX #15, section X5 , including Corrigendum #5 // "In any character sequence beginning with starter S, a character C is // blocked from S if and only if there is some character B between S diff --git a/vendor/golang.org/x/text/unicode/norm/forminfo.go b/vendor/golang.org/x/text/unicode/norm/forminfo.go index e67e7655..526c7033 100644 --- a/vendor/golang.org/x/text/unicode/norm/forminfo.go +++ b/vendor/golang.org/x/text/unicode/norm/forminfo.go @@ -4,6 +4,8 @@ package norm +import "encoding/binary" + // This file contains Form-specific logic and wrappers for data in tables.go. // Rune info is stored in a separate trie per composing form. A composing form @@ -178,6 +180,17 @@ func (p Properties) TrailCCC() uint8 { return ccc[p.tccc] } +func buildRecompMap() { + recompMap = make(map[uint32]rune, len(recompMapPacked)/8) + var buf [8]byte + for i := 0; i < len(recompMapPacked); i += 8 { + copy(buf[:], recompMapPacked[i:i+8]) + key := binary.BigEndian.Uint32(buf[:4]) + val := binary.BigEndian.Uint32(buf[4:]) + recompMap[key] = rune(val) + } +} + // Recomposition // We use 32-bit keys instead of 64-bit for the two codepoint keys. // This clips off the bits of three entries, but we know this will not @@ -186,8 +199,14 @@ func (p Properties) TrailCCC() uint8 { // Note that the recomposition map for NFC and NFKC are identical. // combine returns the combined rune or 0 if it doesn't exist. +// +// The caller is responsible for calling +// recompMapOnce.Do(buildRecompMap) sometime before this is called. func combine(a, b rune) rune { key := uint32(uint16(a))<<16 + uint32(uint16(b)) + if recompMap == nil { + panic("caller error") // see func comment + } return recompMap[key] } diff --git a/vendor/golang.org/x/text/unicode/norm/iter.go b/vendor/golang.org/x/text/unicode/norm/iter.go index ce17f96c..417c6b26 100644 --- a/vendor/golang.org/x/text/unicode/norm/iter.go +++ b/vendor/golang.org/x/text/unicode/norm/iter.go @@ -128,8 +128,9 @@ func (i *Iter) Next() []byte { func nextASCIIBytes(i *Iter) []byte { p := i.p + 1 if p >= i.rb.nsrc { + p0 := i.p i.setDone() - return i.rb.src.bytes[i.p:p] + return i.rb.src.bytes[p0:p] } if i.rb.src.bytes[p] < utf8.RuneSelf { p0 := i.p diff --git a/vendor/golang.org/x/text/unicode/norm/maketables.go b/vendor/golang.org/x/text/unicode/norm/maketables.go index 338c395e..30a3aa93 100644 --- a/vendor/golang.org/x/text/unicode/norm/maketables.go +++ b/vendor/golang.org/x/text/unicode/norm/maketables.go @@ -12,6 +12,7 @@ package main import ( "bytes" + "encoding/binary" "flag" "fmt" "io" @@ -261,7 +262,7 @@ func compactCCC() { // CompositionExclusions.txt has form: // 0958 # ... -// See http://unicode.org/reports/tr44/ for full explanation +// See https://unicode.org/reports/tr44/ for full explanation func loadCompositionExclusions() { f := gen.OpenUCDFile("CompositionExclusions.txt") defer f.Close() @@ -735,6 +736,8 @@ func makeTables() { max = n } } + fmt.Fprintln(w, `import "sync"`) + fmt.Fprintln(w) fmt.Fprintln(w, "const (") fmt.Fprintln(w, "\t// Version is the Unicode edition from which the tables are derived.") @@ -782,16 +785,23 @@ func makeTables() { sz := nrentries * 8 size += sz fmt.Fprintf(w, "// recompMap: %d bytes (entries only)\n", sz) - fmt.Fprintln(w, "var recompMap = map[uint32]rune{") + fmt.Fprintln(w, "var recompMap map[uint32]rune") + fmt.Fprintln(w, "var recompMapOnce sync.Once\n") + fmt.Fprintln(w, `const recompMapPacked = "" +`) + var buf [8]byte for i, c := range chars { f := c.forms[FCanonical] d := f.decomp if !f.isOneWay && len(d) > 0 { key := uint32(uint16(d[0]))<<16 + uint32(uint16(d[1])) - fmt.Fprintf(w, "0x%.8X: 0x%.4X,\n", key, i) + binary.BigEndian.PutUint32(buf[:4], key) + binary.BigEndian.PutUint32(buf[4:], uint32(i)) + fmt.Fprintf(w, "\t\t%q + // 0x%.8X: 0x%.8X\n", string(buf[:]), key, uint32(i)) } } - fmt.Fprintf(w, "}\n\n") + // hack so we don't have to special case the trailing plus sign + fmt.Fprintf(w, ` ""`) + fmt.Fprintln(w) } fmt.Fprintf(w, "// Total size of tables: %dKB (%d bytes)\n", (size+512)/1024, size) @@ -857,7 +867,7 @@ func verifyComputed() { // DerivedNormalizationProps.txt has form: // 00C0..00C5 ; NFD_QC; N # ... // 0374 ; NFD_QC; N # ... -// See http://unicode.org/reports/tr44/ for full explanation +// See https://unicode.org/reports/tr44/ for full explanation func testDerived() { f := gen.OpenUCDFile("DerivedNormalizationProps.txt") defer f.Close() diff --git a/vendor/golang.org/x/text/unicode/norm/normalize.go b/vendor/golang.org/x/text/unicode/norm/normalize.go index e28ac641..95efcf26 100644 --- a/vendor/golang.org/x/text/unicode/norm/normalize.go +++ b/vendor/golang.org/x/text/unicode/norm/normalize.go @@ -29,8 +29,8 @@ import ( // proceed independently on both sides: // f(x) == append(f(x[0:n]), f(x[n:])...) // -// References: http://unicode.org/reports/tr15/ and -// http://unicode.org/notes/tn5/. +// References: https://unicode.org/reports/tr15/ and +// https://unicode.org/notes/tn5/. type Form int const ( diff --git a/vendor/golang.org/x/text/unicode/norm/readwriter.go b/vendor/golang.org/x/text/unicode/norm/readwriter.go index d926ee90..b38096f5 100644 --- a/vendor/golang.org/x/text/unicode/norm/readwriter.go +++ b/vendor/golang.org/x/text/unicode/norm/readwriter.go @@ -60,8 +60,8 @@ func (w *normWriter) Close() error { } // Writer returns a new writer that implements Write(b) -// by writing f(b) to w. The returned writer may use an -// an internal buffer to maintain state across Write calls. +// by writing f(b) to w. The returned writer may use an +// internal buffer to maintain state across Write calls. // Calling its Close method writes any buffered data to w. func (f Form) Writer(w io.Writer) io.WriteCloser { wr := &normWriter{rb: reorderBuffer{}, w: w} diff --git a/vendor/golang.org/x/text/unicode/norm/tables10.0.0.go b/vendor/golang.org/x/text/unicode/norm/tables10.0.0.go index 44dd3978..26fbd55a 100644 --- a/vendor/golang.org/x/text/unicode/norm/tables10.0.0.go +++ b/vendor/golang.org/x/text/unicode/norm/tables10.0.0.go @@ -1,9 +1,11 @@ // Code generated by running "go generate" in golang.org/x/text. DO NOT EDIT. -// +build go1.10 +// +build go1.10,!go1.13 package norm +import "sync" + const ( // Version is the Unicode edition from which the tables are derived. Version = "10.0.0" @@ -6707,947 +6709,949 @@ var nfkcSparseValues = [869]valueRange{ } // recompMap: 7520 bytes (entries only) -var recompMap = map[uint32]rune{ - 0x00410300: 0x00C0, - 0x00410301: 0x00C1, - 0x00410302: 0x00C2, - 0x00410303: 0x00C3, - 0x00410308: 0x00C4, - 0x0041030A: 0x00C5, - 0x00430327: 0x00C7, - 0x00450300: 0x00C8, - 0x00450301: 0x00C9, - 0x00450302: 0x00CA, - 0x00450308: 0x00CB, - 0x00490300: 0x00CC, - 0x00490301: 0x00CD, - 0x00490302: 0x00CE, - 0x00490308: 0x00CF, - 0x004E0303: 0x00D1, - 0x004F0300: 0x00D2, - 0x004F0301: 0x00D3, - 0x004F0302: 0x00D4, - 0x004F0303: 0x00D5, - 0x004F0308: 0x00D6, - 0x00550300: 0x00D9, - 0x00550301: 0x00DA, - 0x00550302: 0x00DB, - 0x00550308: 0x00DC, - 0x00590301: 0x00DD, - 0x00610300: 0x00E0, - 0x00610301: 0x00E1, - 0x00610302: 0x00E2, - 0x00610303: 0x00E3, - 0x00610308: 0x00E4, - 0x0061030A: 0x00E5, - 0x00630327: 0x00E7, - 0x00650300: 0x00E8, - 0x00650301: 0x00E9, - 0x00650302: 0x00EA, - 0x00650308: 0x00EB, - 0x00690300: 0x00EC, - 0x00690301: 0x00ED, - 0x00690302: 0x00EE, - 0x00690308: 0x00EF, - 0x006E0303: 0x00F1, - 0x006F0300: 0x00F2, - 0x006F0301: 0x00F3, - 0x006F0302: 0x00F4, - 0x006F0303: 0x00F5, - 0x006F0308: 0x00F6, - 0x00750300: 0x00F9, - 0x00750301: 0x00FA, - 0x00750302: 0x00FB, - 0x00750308: 0x00FC, - 0x00790301: 0x00FD, - 0x00790308: 0x00FF, - 0x00410304: 0x0100, - 0x00610304: 0x0101, - 0x00410306: 0x0102, - 0x00610306: 0x0103, - 0x00410328: 0x0104, - 0x00610328: 0x0105, - 0x00430301: 0x0106, - 0x00630301: 0x0107, - 0x00430302: 0x0108, - 0x00630302: 0x0109, - 0x00430307: 0x010A, - 0x00630307: 0x010B, - 0x0043030C: 0x010C, - 0x0063030C: 0x010D, - 0x0044030C: 0x010E, - 0x0064030C: 0x010F, - 0x00450304: 0x0112, - 0x00650304: 0x0113, - 0x00450306: 0x0114, - 0x00650306: 0x0115, - 0x00450307: 0x0116, - 0x00650307: 0x0117, - 0x00450328: 0x0118, - 0x00650328: 0x0119, - 0x0045030C: 0x011A, - 0x0065030C: 0x011B, - 0x00470302: 0x011C, - 0x00670302: 0x011D, - 0x00470306: 0x011E, - 0x00670306: 0x011F, - 0x00470307: 0x0120, - 0x00670307: 0x0121, - 0x00470327: 0x0122, - 0x00670327: 0x0123, - 0x00480302: 0x0124, - 0x00680302: 0x0125, - 0x00490303: 0x0128, - 0x00690303: 0x0129, - 0x00490304: 0x012A, - 0x00690304: 0x012B, - 0x00490306: 0x012C, - 0x00690306: 0x012D, - 0x00490328: 0x012E, - 0x00690328: 0x012F, - 0x00490307: 0x0130, - 0x004A0302: 0x0134, - 0x006A0302: 0x0135, - 0x004B0327: 0x0136, - 0x006B0327: 0x0137, - 0x004C0301: 0x0139, - 0x006C0301: 0x013A, - 0x004C0327: 0x013B, - 0x006C0327: 0x013C, - 0x004C030C: 0x013D, - 0x006C030C: 0x013E, - 0x004E0301: 0x0143, - 0x006E0301: 0x0144, - 0x004E0327: 0x0145, - 0x006E0327: 0x0146, - 0x004E030C: 0x0147, - 0x006E030C: 0x0148, - 0x004F0304: 0x014C, - 0x006F0304: 0x014D, - 0x004F0306: 0x014E, - 0x006F0306: 0x014F, - 0x004F030B: 0x0150, - 0x006F030B: 0x0151, - 0x00520301: 0x0154, - 0x00720301: 0x0155, - 0x00520327: 0x0156, - 0x00720327: 0x0157, - 0x0052030C: 0x0158, - 0x0072030C: 0x0159, - 0x00530301: 0x015A, - 0x00730301: 0x015B, - 0x00530302: 0x015C, - 0x00730302: 0x015D, - 0x00530327: 0x015E, - 0x00730327: 0x015F, - 0x0053030C: 0x0160, - 0x0073030C: 0x0161, - 0x00540327: 0x0162, - 0x00740327: 0x0163, - 0x0054030C: 0x0164, - 0x0074030C: 0x0165, - 0x00550303: 0x0168, - 0x00750303: 0x0169, - 0x00550304: 0x016A, - 0x00750304: 0x016B, - 0x00550306: 0x016C, - 0x00750306: 0x016D, - 0x0055030A: 0x016E, - 0x0075030A: 0x016F, - 0x0055030B: 0x0170, - 0x0075030B: 0x0171, - 0x00550328: 0x0172, - 0x00750328: 0x0173, - 0x00570302: 0x0174, - 0x00770302: 0x0175, - 0x00590302: 0x0176, - 0x00790302: 0x0177, - 0x00590308: 0x0178, - 0x005A0301: 0x0179, - 0x007A0301: 0x017A, - 0x005A0307: 0x017B, - 0x007A0307: 0x017C, - 0x005A030C: 0x017D, - 0x007A030C: 0x017E, - 0x004F031B: 0x01A0, - 0x006F031B: 0x01A1, - 0x0055031B: 0x01AF, - 0x0075031B: 0x01B0, - 0x0041030C: 0x01CD, - 0x0061030C: 0x01CE, - 0x0049030C: 0x01CF, - 0x0069030C: 0x01D0, - 0x004F030C: 0x01D1, - 0x006F030C: 0x01D2, - 0x0055030C: 0x01D3, - 0x0075030C: 0x01D4, - 0x00DC0304: 0x01D5, - 0x00FC0304: 0x01D6, - 0x00DC0301: 0x01D7, - 0x00FC0301: 0x01D8, - 0x00DC030C: 0x01D9, - 0x00FC030C: 0x01DA, - 0x00DC0300: 0x01DB, - 0x00FC0300: 0x01DC, - 0x00C40304: 0x01DE, - 0x00E40304: 0x01DF, - 0x02260304: 0x01E0, - 0x02270304: 0x01E1, - 0x00C60304: 0x01E2, - 0x00E60304: 0x01E3, - 0x0047030C: 0x01E6, - 0x0067030C: 0x01E7, - 0x004B030C: 0x01E8, - 0x006B030C: 0x01E9, - 0x004F0328: 0x01EA, - 0x006F0328: 0x01EB, - 0x01EA0304: 0x01EC, - 0x01EB0304: 0x01ED, - 0x01B7030C: 0x01EE, - 0x0292030C: 0x01EF, - 0x006A030C: 0x01F0, - 0x00470301: 0x01F4, - 0x00670301: 0x01F5, - 0x004E0300: 0x01F8, - 0x006E0300: 0x01F9, - 0x00C50301: 0x01FA, - 0x00E50301: 0x01FB, - 0x00C60301: 0x01FC, - 0x00E60301: 0x01FD, - 0x00D80301: 0x01FE, - 0x00F80301: 0x01FF, - 0x0041030F: 0x0200, - 0x0061030F: 0x0201, - 0x00410311: 0x0202, - 0x00610311: 0x0203, - 0x0045030F: 0x0204, - 0x0065030F: 0x0205, - 0x00450311: 0x0206, - 0x00650311: 0x0207, - 0x0049030F: 0x0208, - 0x0069030F: 0x0209, - 0x00490311: 0x020A, - 0x00690311: 0x020B, - 0x004F030F: 0x020C, - 0x006F030F: 0x020D, - 0x004F0311: 0x020E, - 0x006F0311: 0x020F, - 0x0052030F: 0x0210, - 0x0072030F: 0x0211, - 0x00520311: 0x0212, - 0x00720311: 0x0213, - 0x0055030F: 0x0214, - 0x0075030F: 0x0215, - 0x00550311: 0x0216, - 0x00750311: 0x0217, - 0x00530326: 0x0218, - 0x00730326: 0x0219, - 0x00540326: 0x021A, - 0x00740326: 0x021B, - 0x0048030C: 0x021E, - 0x0068030C: 0x021F, - 0x00410307: 0x0226, - 0x00610307: 0x0227, - 0x00450327: 0x0228, - 0x00650327: 0x0229, - 0x00D60304: 0x022A, - 0x00F60304: 0x022B, - 0x00D50304: 0x022C, - 0x00F50304: 0x022D, - 0x004F0307: 0x022E, - 0x006F0307: 0x022F, - 0x022E0304: 0x0230, - 0x022F0304: 0x0231, - 0x00590304: 0x0232, - 0x00790304: 0x0233, - 0x00A80301: 0x0385, - 0x03910301: 0x0386, - 0x03950301: 0x0388, - 0x03970301: 0x0389, - 0x03990301: 0x038A, - 0x039F0301: 0x038C, - 0x03A50301: 0x038E, - 0x03A90301: 0x038F, - 0x03CA0301: 0x0390, - 0x03990308: 0x03AA, - 0x03A50308: 0x03AB, - 0x03B10301: 0x03AC, - 0x03B50301: 0x03AD, - 0x03B70301: 0x03AE, - 0x03B90301: 0x03AF, - 0x03CB0301: 0x03B0, - 0x03B90308: 0x03CA, - 0x03C50308: 0x03CB, - 0x03BF0301: 0x03CC, - 0x03C50301: 0x03CD, - 0x03C90301: 0x03CE, - 0x03D20301: 0x03D3, - 0x03D20308: 0x03D4, - 0x04150300: 0x0400, - 0x04150308: 0x0401, - 0x04130301: 0x0403, - 0x04060308: 0x0407, - 0x041A0301: 0x040C, - 0x04180300: 0x040D, - 0x04230306: 0x040E, - 0x04180306: 0x0419, - 0x04380306: 0x0439, - 0x04350300: 0x0450, - 0x04350308: 0x0451, - 0x04330301: 0x0453, - 0x04560308: 0x0457, - 0x043A0301: 0x045C, - 0x04380300: 0x045D, - 0x04430306: 0x045E, - 0x0474030F: 0x0476, - 0x0475030F: 0x0477, - 0x04160306: 0x04C1, - 0x04360306: 0x04C2, - 0x04100306: 0x04D0, - 0x04300306: 0x04D1, - 0x04100308: 0x04D2, - 0x04300308: 0x04D3, - 0x04150306: 0x04D6, - 0x04350306: 0x04D7, - 0x04D80308: 0x04DA, - 0x04D90308: 0x04DB, - 0x04160308: 0x04DC, - 0x04360308: 0x04DD, - 0x04170308: 0x04DE, - 0x04370308: 0x04DF, - 0x04180304: 0x04E2, - 0x04380304: 0x04E3, - 0x04180308: 0x04E4, - 0x04380308: 0x04E5, - 0x041E0308: 0x04E6, - 0x043E0308: 0x04E7, - 0x04E80308: 0x04EA, - 0x04E90308: 0x04EB, - 0x042D0308: 0x04EC, - 0x044D0308: 0x04ED, - 0x04230304: 0x04EE, - 0x04430304: 0x04EF, - 0x04230308: 0x04F0, - 0x04430308: 0x04F1, - 0x0423030B: 0x04F2, - 0x0443030B: 0x04F3, - 0x04270308: 0x04F4, - 0x04470308: 0x04F5, - 0x042B0308: 0x04F8, - 0x044B0308: 0x04F9, - 0x06270653: 0x0622, - 0x06270654: 0x0623, - 0x06480654: 0x0624, - 0x06270655: 0x0625, - 0x064A0654: 0x0626, - 0x06D50654: 0x06C0, - 0x06C10654: 0x06C2, - 0x06D20654: 0x06D3, - 0x0928093C: 0x0929, - 0x0930093C: 0x0931, - 0x0933093C: 0x0934, - 0x09C709BE: 0x09CB, - 0x09C709D7: 0x09CC, - 0x0B470B56: 0x0B48, - 0x0B470B3E: 0x0B4B, - 0x0B470B57: 0x0B4C, - 0x0B920BD7: 0x0B94, - 0x0BC60BBE: 0x0BCA, - 0x0BC70BBE: 0x0BCB, - 0x0BC60BD7: 0x0BCC, - 0x0C460C56: 0x0C48, - 0x0CBF0CD5: 0x0CC0, - 0x0CC60CD5: 0x0CC7, - 0x0CC60CD6: 0x0CC8, - 0x0CC60CC2: 0x0CCA, - 0x0CCA0CD5: 0x0CCB, - 0x0D460D3E: 0x0D4A, - 0x0D470D3E: 0x0D4B, - 0x0D460D57: 0x0D4C, - 0x0DD90DCA: 0x0DDA, - 0x0DD90DCF: 0x0DDC, - 0x0DDC0DCA: 0x0DDD, - 0x0DD90DDF: 0x0DDE, - 0x1025102E: 0x1026, - 0x1B051B35: 0x1B06, - 0x1B071B35: 0x1B08, - 0x1B091B35: 0x1B0A, - 0x1B0B1B35: 0x1B0C, - 0x1B0D1B35: 0x1B0E, - 0x1B111B35: 0x1B12, - 0x1B3A1B35: 0x1B3B, - 0x1B3C1B35: 0x1B3D, - 0x1B3E1B35: 0x1B40, - 0x1B3F1B35: 0x1B41, - 0x1B421B35: 0x1B43, - 0x00410325: 0x1E00, - 0x00610325: 0x1E01, - 0x00420307: 0x1E02, - 0x00620307: 0x1E03, - 0x00420323: 0x1E04, - 0x00620323: 0x1E05, - 0x00420331: 0x1E06, - 0x00620331: 0x1E07, - 0x00C70301: 0x1E08, - 0x00E70301: 0x1E09, - 0x00440307: 0x1E0A, - 0x00640307: 0x1E0B, - 0x00440323: 0x1E0C, - 0x00640323: 0x1E0D, - 0x00440331: 0x1E0E, - 0x00640331: 0x1E0F, - 0x00440327: 0x1E10, - 0x00640327: 0x1E11, - 0x0044032D: 0x1E12, - 0x0064032D: 0x1E13, - 0x01120300: 0x1E14, - 0x01130300: 0x1E15, - 0x01120301: 0x1E16, - 0x01130301: 0x1E17, - 0x0045032D: 0x1E18, - 0x0065032D: 0x1E19, - 0x00450330: 0x1E1A, - 0x00650330: 0x1E1B, - 0x02280306: 0x1E1C, - 0x02290306: 0x1E1D, - 0x00460307: 0x1E1E, - 0x00660307: 0x1E1F, - 0x00470304: 0x1E20, - 0x00670304: 0x1E21, - 0x00480307: 0x1E22, - 0x00680307: 0x1E23, - 0x00480323: 0x1E24, - 0x00680323: 0x1E25, - 0x00480308: 0x1E26, - 0x00680308: 0x1E27, - 0x00480327: 0x1E28, - 0x00680327: 0x1E29, - 0x0048032E: 0x1E2A, - 0x0068032E: 0x1E2B, - 0x00490330: 0x1E2C, - 0x00690330: 0x1E2D, - 0x00CF0301: 0x1E2E, - 0x00EF0301: 0x1E2F, - 0x004B0301: 0x1E30, - 0x006B0301: 0x1E31, - 0x004B0323: 0x1E32, - 0x006B0323: 0x1E33, - 0x004B0331: 0x1E34, - 0x006B0331: 0x1E35, - 0x004C0323: 0x1E36, - 0x006C0323: 0x1E37, - 0x1E360304: 0x1E38, - 0x1E370304: 0x1E39, - 0x004C0331: 0x1E3A, - 0x006C0331: 0x1E3B, - 0x004C032D: 0x1E3C, - 0x006C032D: 0x1E3D, - 0x004D0301: 0x1E3E, - 0x006D0301: 0x1E3F, - 0x004D0307: 0x1E40, - 0x006D0307: 0x1E41, - 0x004D0323: 0x1E42, - 0x006D0323: 0x1E43, - 0x004E0307: 0x1E44, - 0x006E0307: 0x1E45, - 0x004E0323: 0x1E46, - 0x006E0323: 0x1E47, - 0x004E0331: 0x1E48, - 0x006E0331: 0x1E49, - 0x004E032D: 0x1E4A, - 0x006E032D: 0x1E4B, - 0x00D50301: 0x1E4C, - 0x00F50301: 0x1E4D, - 0x00D50308: 0x1E4E, - 0x00F50308: 0x1E4F, - 0x014C0300: 0x1E50, - 0x014D0300: 0x1E51, - 0x014C0301: 0x1E52, - 0x014D0301: 0x1E53, - 0x00500301: 0x1E54, - 0x00700301: 0x1E55, - 0x00500307: 0x1E56, - 0x00700307: 0x1E57, - 0x00520307: 0x1E58, - 0x00720307: 0x1E59, - 0x00520323: 0x1E5A, - 0x00720323: 0x1E5B, - 0x1E5A0304: 0x1E5C, - 0x1E5B0304: 0x1E5D, - 0x00520331: 0x1E5E, - 0x00720331: 0x1E5F, - 0x00530307: 0x1E60, - 0x00730307: 0x1E61, - 0x00530323: 0x1E62, - 0x00730323: 0x1E63, - 0x015A0307: 0x1E64, - 0x015B0307: 0x1E65, - 0x01600307: 0x1E66, - 0x01610307: 0x1E67, - 0x1E620307: 0x1E68, - 0x1E630307: 0x1E69, - 0x00540307: 0x1E6A, - 0x00740307: 0x1E6B, - 0x00540323: 0x1E6C, - 0x00740323: 0x1E6D, - 0x00540331: 0x1E6E, - 0x00740331: 0x1E6F, - 0x0054032D: 0x1E70, - 0x0074032D: 0x1E71, - 0x00550324: 0x1E72, - 0x00750324: 0x1E73, - 0x00550330: 0x1E74, - 0x00750330: 0x1E75, - 0x0055032D: 0x1E76, - 0x0075032D: 0x1E77, - 0x01680301: 0x1E78, - 0x01690301: 0x1E79, - 0x016A0308: 0x1E7A, - 0x016B0308: 0x1E7B, - 0x00560303: 0x1E7C, - 0x00760303: 0x1E7D, - 0x00560323: 0x1E7E, - 0x00760323: 0x1E7F, - 0x00570300: 0x1E80, - 0x00770300: 0x1E81, - 0x00570301: 0x1E82, - 0x00770301: 0x1E83, - 0x00570308: 0x1E84, - 0x00770308: 0x1E85, - 0x00570307: 0x1E86, - 0x00770307: 0x1E87, - 0x00570323: 0x1E88, - 0x00770323: 0x1E89, - 0x00580307: 0x1E8A, - 0x00780307: 0x1E8B, - 0x00580308: 0x1E8C, - 0x00780308: 0x1E8D, - 0x00590307: 0x1E8E, - 0x00790307: 0x1E8F, - 0x005A0302: 0x1E90, - 0x007A0302: 0x1E91, - 0x005A0323: 0x1E92, - 0x007A0323: 0x1E93, - 0x005A0331: 0x1E94, - 0x007A0331: 0x1E95, - 0x00680331: 0x1E96, - 0x00740308: 0x1E97, - 0x0077030A: 0x1E98, - 0x0079030A: 0x1E99, - 0x017F0307: 0x1E9B, - 0x00410323: 0x1EA0, - 0x00610323: 0x1EA1, - 0x00410309: 0x1EA2, - 0x00610309: 0x1EA3, - 0x00C20301: 0x1EA4, - 0x00E20301: 0x1EA5, - 0x00C20300: 0x1EA6, - 0x00E20300: 0x1EA7, - 0x00C20309: 0x1EA8, - 0x00E20309: 0x1EA9, - 0x00C20303: 0x1EAA, - 0x00E20303: 0x1EAB, - 0x1EA00302: 0x1EAC, - 0x1EA10302: 0x1EAD, - 0x01020301: 0x1EAE, - 0x01030301: 0x1EAF, - 0x01020300: 0x1EB0, - 0x01030300: 0x1EB1, - 0x01020309: 0x1EB2, - 0x01030309: 0x1EB3, - 0x01020303: 0x1EB4, - 0x01030303: 0x1EB5, - 0x1EA00306: 0x1EB6, - 0x1EA10306: 0x1EB7, - 0x00450323: 0x1EB8, - 0x00650323: 0x1EB9, - 0x00450309: 0x1EBA, - 0x00650309: 0x1EBB, - 0x00450303: 0x1EBC, - 0x00650303: 0x1EBD, - 0x00CA0301: 0x1EBE, - 0x00EA0301: 0x1EBF, - 0x00CA0300: 0x1EC0, - 0x00EA0300: 0x1EC1, - 0x00CA0309: 0x1EC2, - 0x00EA0309: 0x1EC3, - 0x00CA0303: 0x1EC4, - 0x00EA0303: 0x1EC5, - 0x1EB80302: 0x1EC6, - 0x1EB90302: 0x1EC7, - 0x00490309: 0x1EC8, - 0x00690309: 0x1EC9, - 0x00490323: 0x1ECA, - 0x00690323: 0x1ECB, - 0x004F0323: 0x1ECC, - 0x006F0323: 0x1ECD, - 0x004F0309: 0x1ECE, - 0x006F0309: 0x1ECF, - 0x00D40301: 0x1ED0, - 0x00F40301: 0x1ED1, - 0x00D40300: 0x1ED2, - 0x00F40300: 0x1ED3, - 0x00D40309: 0x1ED4, - 0x00F40309: 0x1ED5, - 0x00D40303: 0x1ED6, - 0x00F40303: 0x1ED7, - 0x1ECC0302: 0x1ED8, - 0x1ECD0302: 0x1ED9, - 0x01A00301: 0x1EDA, - 0x01A10301: 0x1EDB, - 0x01A00300: 0x1EDC, - 0x01A10300: 0x1EDD, - 0x01A00309: 0x1EDE, - 0x01A10309: 0x1EDF, - 0x01A00303: 0x1EE0, - 0x01A10303: 0x1EE1, - 0x01A00323: 0x1EE2, - 0x01A10323: 0x1EE3, - 0x00550323: 0x1EE4, - 0x00750323: 0x1EE5, - 0x00550309: 0x1EE6, - 0x00750309: 0x1EE7, - 0x01AF0301: 0x1EE8, - 0x01B00301: 0x1EE9, - 0x01AF0300: 0x1EEA, - 0x01B00300: 0x1EEB, - 0x01AF0309: 0x1EEC, - 0x01B00309: 0x1EED, - 0x01AF0303: 0x1EEE, - 0x01B00303: 0x1EEF, - 0x01AF0323: 0x1EF0, - 0x01B00323: 0x1EF1, - 0x00590300: 0x1EF2, - 0x00790300: 0x1EF3, - 0x00590323: 0x1EF4, - 0x00790323: 0x1EF5, - 0x00590309: 0x1EF6, - 0x00790309: 0x1EF7, - 0x00590303: 0x1EF8, - 0x00790303: 0x1EF9, - 0x03B10313: 0x1F00, - 0x03B10314: 0x1F01, - 0x1F000300: 0x1F02, - 0x1F010300: 0x1F03, - 0x1F000301: 0x1F04, - 0x1F010301: 0x1F05, - 0x1F000342: 0x1F06, - 0x1F010342: 0x1F07, - 0x03910313: 0x1F08, - 0x03910314: 0x1F09, - 0x1F080300: 0x1F0A, - 0x1F090300: 0x1F0B, - 0x1F080301: 0x1F0C, - 0x1F090301: 0x1F0D, - 0x1F080342: 0x1F0E, - 0x1F090342: 0x1F0F, - 0x03B50313: 0x1F10, - 0x03B50314: 0x1F11, - 0x1F100300: 0x1F12, - 0x1F110300: 0x1F13, - 0x1F100301: 0x1F14, - 0x1F110301: 0x1F15, - 0x03950313: 0x1F18, - 0x03950314: 0x1F19, - 0x1F180300: 0x1F1A, - 0x1F190300: 0x1F1B, - 0x1F180301: 0x1F1C, - 0x1F190301: 0x1F1D, - 0x03B70313: 0x1F20, - 0x03B70314: 0x1F21, - 0x1F200300: 0x1F22, - 0x1F210300: 0x1F23, - 0x1F200301: 0x1F24, - 0x1F210301: 0x1F25, - 0x1F200342: 0x1F26, - 0x1F210342: 0x1F27, - 0x03970313: 0x1F28, - 0x03970314: 0x1F29, - 0x1F280300: 0x1F2A, - 0x1F290300: 0x1F2B, - 0x1F280301: 0x1F2C, - 0x1F290301: 0x1F2D, - 0x1F280342: 0x1F2E, - 0x1F290342: 0x1F2F, - 0x03B90313: 0x1F30, - 0x03B90314: 0x1F31, - 0x1F300300: 0x1F32, - 0x1F310300: 0x1F33, - 0x1F300301: 0x1F34, - 0x1F310301: 0x1F35, - 0x1F300342: 0x1F36, - 0x1F310342: 0x1F37, - 0x03990313: 0x1F38, - 0x03990314: 0x1F39, - 0x1F380300: 0x1F3A, - 0x1F390300: 0x1F3B, - 0x1F380301: 0x1F3C, - 0x1F390301: 0x1F3D, - 0x1F380342: 0x1F3E, - 0x1F390342: 0x1F3F, - 0x03BF0313: 0x1F40, - 0x03BF0314: 0x1F41, - 0x1F400300: 0x1F42, - 0x1F410300: 0x1F43, - 0x1F400301: 0x1F44, - 0x1F410301: 0x1F45, - 0x039F0313: 0x1F48, - 0x039F0314: 0x1F49, - 0x1F480300: 0x1F4A, - 0x1F490300: 0x1F4B, - 0x1F480301: 0x1F4C, - 0x1F490301: 0x1F4D, - 0x03C50313: 0x1F50, - 0x03C50314: 0x1F51, - 0x1F500300: 0x1F52, - 0x1F510300: 0x1F53, - 0x1F500301: 0x1F54, - 0x1F510301: 0x1F55, - 0x1F500342: 0x1F56, - 0x1F510342: 0x1F57, - 0x03A50314: 0x1F59, - 0x1F590300: 0x1F5B, - 0x1F590301: 0x1F5D, - 0x1F590342: 0x1F5F, - 0x03C90313: 0x1F60, - 0x03C90314: 0x1F61, - 0x1F600300: 0x1F62, - 0x1F610300: 0x1F63, - 0x1F600301: 0x1F64, - 0x1F610301: 0x1F65, - 0x1F600342: 0x1F66, - 0x1F610342: 0x1F67, - 0x03A90313: 0x1F68, - 0x03A90314: 0x1F69, - 0x1F680300: 0x1F6A, - 0x1F690300: 0x1F6B, - 0x1F680301: 0x1F6C, - 0x1F690301: 0x1F6D, - 0x1F680342: 0x1F6E, - 0x1F690342: 0x1F6F, - 0x03B10300: 0x1F70, - 0x03B50300: 0x1F72, - 0x03B70300: 0x1F74, - 0x03B90300: 0x1F76, - 0x03BF0300: 0x1F78, - 0x03C50300: 0x1F7A, - 0x03C90300: 0x1F7C, - 0x1F000345: 0x1F80, - 0x1F010345: 0x1F81, - 0x1F020345: 0x1F82, - 0x1F030345: 0x1F83, - 0x1F040345: 0x1F84, - 0x1F050345: 0x1F85, - 0x1F060345: 0x1F86, - 0x1F070345: 0x1F87, - 0x1F080345: 0x1F88, - 0x1F090345: 0x1F89, - 0x1F0A0345: 0x1F8A, - 0x1F0B0345: 0x1F8B, - 0x1F0C0345: 0x1F8C, - 0x1F0D0345: 0x1F8D, - 0x1F0E0345: 0x1F8E, - 0x1F0F0345: 0x1F8F, - 0x1F200345: 0x1F90, - 0x1F210345: 0x1F91, - 0x1F220345: 0x1F92, - 0x1F230345: 0x1F93, - 0x1F240345: 0x1F94, - 0x1F250345: 0x1F95, - 0x1F260345: 0x1F96, - 0x1F270345: 0x1F97, - 0x1F280345: 0x1F98, - 0x1F290345: 0x1F99, - 0x1F2A0345: 0x1F9A, - 0x1F2B0345: 0x1F9B, - 0x1F2C0345: 0x1F9C, - 0x1F2D0345: 0x1F9D, - 0x1F2E0345: 0x1F9E, - 0x1F2F0345: 0x1F9F, - 0x1F600345: 0x1FA0, - 0x1F610345: 0x1FA1, - 0x1F620345: 0x1FA2, - 0x1F630345: 0x1FA3, - 0x1F640345: 0x1FA4, - 0x1F650345: 0x1FA5, - 0x1F660345: 0x1FA6, - 0x1F670345: 0x1FA7, - 0x1F680345: 0x1FA8, - 0x1F690345: 0x1FA9, - 0x1F6A0345: 0x1FAA, - 0x1F6B0345: 0x1FAB, - 0x1F6C0345: 0x1FAC, - 0x1F6D0345: 0x1FAD, - 0x1F6E0345: 0x1FAE, - 0x1F6F0345: 0x1FAF, - 0x03B10306: 0x1FB0, - 0x03B10304: 0x1FB1, - 0x1F700345: 0x1FB2, - 0x03B10345: 0x1FB3, - 0x03AC0345: 0x1FB4, - 0x03B10342: 0x1FB6, - 0x1FB60345: 0x1FB7, - 0x03910306: 0x1FB8, - 0x03910304: 0x1FB9, - 0x03910300: 0x1FBA, - 0x03910345: 0x1FBC, - 0x00A80342: 0x1FC1, - 0x1F740345: 0x1FC2, - 0x03B70345: 0x1FC3, - 0x03AE0345: 0x1FC4, - 0x03B70342: 0x1FC6, - 0x1FC60345: 0x1FC7, - 0x03950300: 0x1FC8, - 0x03970300: 0x1FCA, - 0x03970345: 0x1FCC, - 0x1FBF0300: 0x1FCD, - 0x1FBF0301: 0x1FCE, - 0x1FBF0342: 0x1FCF, - 0x03B90306: 0x1FD0, - 0x03B90304: 0x1FD1, - 0x03CA0300: 0x1FD2, - 0x03B90342: 0x1FD6, - 0x03CA0342: 0x1FD7, - 0x03990306: 0x1FD8, - 0x03990304: 0x1FD9, - 0x03990300: 0x1FDA, - 0x1FFE0300: 0x1FDD, - 0x1FFE0301: 0x1FDE, - 0x1FFE0342: 0x1FDF, - 0x03C50306: 0x1FE0, - 0x03C50304: 0x1FE1, - 0x03CB0300: 0x1FE2, - 0x03C10313: 0x1FE4, - 0x03C10314: 0x1FE5, - 0x03C50342: 0x1FE6, - 0x03CB0342: 0x1FE7, - 0x03A50306: 0x1FE8, - 0x03A50304: 0x1FE9, - 0x03A50300: 0x1FEA, - 0x03A10314: 0x1FEC, - 0x00A80300: 0x1FED, - 0x1F7C0345: 0x1FF2, - 0x03C90345: 0x1FF3, - 0x03CE0345: 0x1FF4, - 0x03C90342: 0x1FF6, - 0x1FF60345: 0x1FF7, - 0x039F0300: 0x1FF8, - 0x03A90300: 0x1FFA, - 0x03A90345: 0x1FFC, - 0x21900338: 0x219A, - 0x21920338: 0x219B, - 0x21940338: 0x21AE, - 0x21D00338: 0x21CD, - 0x21D40338: 0x21CE, - 0x21D20338: 0x21CF, - 0x22030338: 0x2204, - 0x22080338: 0x2209, - 0x220B0338: 0x220C, - 0x22230338: 0x2224, - 0x22250338: 0x2226, - 0x223C0338: 0x2241, - 0x22430338: 0x2244, - 0x22450338: 0x2247, - 0x22480338: 0x2249, - 0x003D0338: 0x2260, - 0x22610338: 0x2262, - 0x224D0338: 0x226D, - 0x003C0338: 0x226E, - 0x003E0338: 0x226F, - 0x22640338: 0x2270, - 0x22650338: 0x2271, - 0x22720338: 0x2274, - 0x22730338: 0x2275, - 0x22760338: 0x2278, - 0x22770338: 0x2279, - 0x227A0338: 0x2280, - 0x227B0338: 0x2281, - 0x22820338: 0x2284, - 0x22830338: 0x2285, - 0x22860338: 0x2288, - 0x22870338: 0x2289, - 0x22A20338: 0x22AC, - 0x22A80338: 0x22AD, - 0x22A90338: 0x22AE, - 0x22AB0338: 0x22AF, - 0x227C0338: 0x22E0, - 0x227D0338: 0x22E1, - 0x22910338: 0x22E2, - 0x22920338: 0x22E3, - 0x22B20338: 0x22EA, - 0x22B30338: 0x22EB, - 0x22B40338: 0x22EC, - 0x22B50338: 0x22ED, - 0x304B3099: 0x304C, - 0x304D3099: 0x304E, - 0x304F3099: 0x3050, - 0x30513099: 0x3052, - 0x30533099: 0x3054, - 0x30553099: 0x3056, - 0x30573099: 0x3058, - 0x30593099: 0x305A, - 0x305B3099: 0x305C, - 0x305D3099: 0x305E, - 0x305F3099: 0x3060, - 0x30613099: 0x3062, - 0x30643099: 0x3065, - 0x30663099: 0x3067, - 0x30683099: 0x3069, - 0x306F3099: 0x3070, - 0x306F309A: 0x3071, - 0x30723099: 0x3073, - 0x3072309A: 0x3074, - 0x30753099: 0x3076, - 0x3075309A: 0x3077, - 0x30783099: 0x3079, - 0x3078309A: 0x307A, - 0x307B3099: 0x307C, - 0x307B309A: 0x307D, - 0x30463099: 0x3094, - 0x309D3099: 0x309E, - 0x30AB3099: 0x30AC, - 0x30AD3099: 0x30AE, - 0x30AF3099: 0x30B0, - 0x30B13099: 0x30B2, - 0x30B33099: 0x30B4, - 0x30B53099: 0x30B6, - 0x30B73099: 0x30B8, - 0x30B93099: 0x30BA, - 0x30BB3099: 0x30BC, - 0x30BD3099: 0x30BE, - 0x30BF3099: 0x30C0, - 0x30C13099: 0x30C2, - 0x30C43099: 0x30C5, - 0x30C63099: 0x30C7, - 0x30C83099: 0x30C9, - 0x30CF3099: 0x30D0, - 0x30CF309A: 0x30D1, - 0x30D23099: 0x30D3, - 0x30D2309A: 0x30D4, - 0x30D53099: 0x30D6, - 0x30D5309A: 0x30D7, - 0x30D83099: 0x30D9, - 0x30D8309A: 0x30DA, - 0x30DB3099: 0x30DC, - 0x30DB309A: 0x30DD, - 0x30A63099: 0x30F4, - 0x30EF3099: 0x30F7, - 0x30F03099: 0x30F8, - 0x30F13099: 0x30F9, - 0x30F23099: 0x30FA, - 0x30FD3099: 0x30FE, - 0x109910BA: 0x1109A, - 0x109B10BA: 0x1109C, - 0x10A510BA: 0x110AB, - 0x11311127: 0x1112E, - 0x11321127: 0x1112F, - 0x1347133E: 0x1134B, - 0x13471357: 0x1134C, - 0x14B914BA: 0x114BB, - 0x14B914B0: 0x114BC, - 0x14B914BD: 0x114BE, - 0x15B815AF: 0x115BA, - 0x15B915AF: 0x115BB, -} +var recompMap map[uint32]rune +var recompMapOnce sync.Once -// Total size of tables: 53KB (54226 bytes) +const recompMapPacked = "" + + "\x00A\x03\x00\x00\x00\x00\xc0" + // 0x00410300: 0x000000C0 + "\x00A\x03\x01\x00\x00\x00\xc1" + // 0x00410301: 0x000000C1 + "\x00A\x03\x02\x00\x00\x00\xc2" + // 0x00410302: 0x000000C2 + "\x00A\x03\x03\x00\x00\x00\xc3" + // 0x00410303: 0x000000C3 + "\x00A\x03\b\x00\x00\x00\xc4" + // 0x00410308: 0x000000C4 + "\x00A\x03\n\x00\x00\x00\xc5" + // 0x0041030A: 0x000000C5 + "\x00C\x03'\x00\x00\x00\xc7" + // 0x00430327: 0x000000C7 + "\x00E\x03\x00\x00\x00\x00\xc8" + // 0x00450300: 0x000000C8 + "\x00E\x03\x01\x00\x00\x00\xc9" + // 0x00450301: 0x000000C9 + "\x00E\x03\x02\x00\x00\x00\xca" + // 0x00450302: 0x000000CA + "\x00E\x03\b\x00\x00\x00\xcb" + // 0x00450308: 0x000000CB + "\x00I\x03\x00\x00\x00\x00\xcc" + // 0x00490300: 0x000000CC + "\x00I\x03\x01\x00\x00\x00\xcd" + // 0x00490301: 0x000000CD + "\x00I\x03\x02\x00\x00\x00\xce" + // 0x00490302: 0x000000CE + "\x00I\x03\b\x00\x00\x00\xcf" + // 0x00490308: 0x000000CF + "\x00N\x03\x03\x00\x00\x00\xd1" + // 0x004E0303: 0x000000D1 + "\x00O\x03\x00\x00\x00\x00\xd2" + // 0x004F0300: 0x000000D2 + "\x00O\x03\x01\x00\x00\x00\xd3" + // 0x004F0301: 0x000000D3 + "\x00O\x03\x02\x00\x00\x00\xd4" + // 0x004F0302: 0x000000D4 + "\x00O\x03\x03\x00\x00\x00\xd5" + // 0x004F0303: 0x000000D5 + "\x00O\x03\b\x00\x00\x00\xd6" + // 0x004F0308: 0x000000D6 + "\x00U\x03\x00\x00\x00\x00\xd9" + // 0x00550300: 0x000000D9 + "\x00U\x03\x01\x00\x00\x00\xda" + // 0x00550301: 0x000000DA + "\x00U\x03\x02\x00\x00\x00\xdb" + // 0x00550302: 0x000000DB + "\x00U\x03\b\x00\x00\x00\xdc" + // 0x00550308: 0x000000DC + "\x00Y\x03\x01\x00\x00\x00\xdd" + // 0x00590301: 0x000000DD + "\x00a\x03\x00\x00\x00\x00\xe0" + // 0x00610300: 0x000000E0 + "\x00a\x03\x01\x00\x00\x00\xe1" + // 0x00610301: 0x000000E1 + "\x00a\x03\x02\x00\x00\x00\xe2" + // 0x00610302: 0x000000E2 + "\x00a\x03\x03\x00\x00\x00\xe3" + // 0x00610303: 0x000000E3 + "\x00a\x03\b\x00\x00\x00\xe4" + // 0x00610308: 0x000000E4 + "\x00a\x03\n\x00\x00\x00\xe5" + // 0x0061030A: 0x000000E5 + "\x00c\x03'\x00\x00\x00\xe7" + // 0x00630327: 0x000000E7 + "\x00e\x03\x00\x00\x00\x00\xe8" + // 0x00650300: 0x000000E8 + "\x00e\x03\x01\x00\x00\x00\xe9" + // 0x00650301: 0x000000E9 + "\x00e\x03\x02\x00\x00\x00\xea" + // 0x00650302: 0x000000EA + "\x00e\x03\b\x00\x00\x00\xeb" + // 0x00650308: 0x000000EB + "\x00i\x03\x00\x00\x00\x00\xec" + // 0x00690300: 0x000000EC + "\x00i\x03\x01\x00\x00\x00\xed" + // 0x00690301: 0x000000ED + "\x00i\x03\x02\x00\x00\x00\xee" + // 0x00690302: 0x000000EE + "\x00i\x03\b\x00\x00\x00\xef" + // 0x00690308: 0x000000EF + "\x00n\x03\x03\x00\x00\x00\xf1" + // 0x006E0303: 0x000000F1 + "\x00o\x03\x00\x00\x00\x00\xf2" + // 0x006F0300: 0x000000F2 + "\x00o\x03\x01\x00\x00\x00\xf3" + // 0x006F0301: 0x000000F3 + "\x00o\x03\x02\x00\x00\x00\xf4" + // 0x006F0302: 0x000000F4 + "\x00o\x03\x03\x00\x00\x00\xf5" + // 0x006F0303: 0x000000F5 + "\x00o\x03\b\x00\x00\x00\xf6" + // 0x006F0308: 0x000000F6 + "\x00u\x03\x00\x00\x00\x00\xf9" + // 0x00750300: 0x000000F9 + "\x00u\x03\x01\x00\x00\x00\xfa" + // 0x00750301: 0x000000FA + "\x00u\x03\x02\x00\x00\x00\xfb" + // 0x00750302: 0x000000FB + "\x00u\x03\b\x00\x00\x00\xfc" + // 0x00750308: 0x000000FC + "\x00y\x03\x01\x00\x00\x00\xfd" + // 0x00790301: 0x000000FD + "\x00y\x03\b\x00\x00\x00\xff" + // 0x00790308: 0x000000FF + "\x00A\x03\x04\x00\x00\x01\x00" + // 0x00410304: 0x00000100 + "\x00a\x03\x04\x00\x00\x01\x01" + // 0x00610304: 0x00000101 + "\x00A\x03\x06\x00\x00\x01\x02" + // 0x00410306: 0x00000102 + "\x00a\x03\x06\x00\x00\x01\x03" + // 0x00610306: 0x00000103 + "\x00A\x03(\x00\x00\x01\x04" + // 0x00410328: 0x00000104 + "\x00a\x03(\x00\x00\x01\x05" + // 0x00610328: 0x00000105 + "\x00C\x03\x01\x00\x00\x01\x06" + // 0x00430301: 0x00000106 + "\x00c\x03\x01\x00\x00\x01\a" + // 0x00630301: 0x00000107 + "\x00C\x03\x02\x00\x00\x01\b" + // 0x00430302: 0x00000108 + "\x00c\x03\x02\x00\x00\x01\t" + // 0x00630302: 0x00000109 + "\x00C\x03\a\x00\x00\x01\n" + // 0x00430307: 0x0000010A + "\x00c\x03\a\x00\x00\x01\v" + // 0x00630307: 0x0000010B + "\x00C\x03\f\x00\x00\x01\f" + // 0x0043030C: 0x0000010C + "\x00c\x03\f\x00\x00\x01\r" + // 0x0063030C: 0x0000010D + "\x00D\x03\f\x00\x00\x01\x0e" + // 0x0044030C: 0x0000010E + "\x00d\x03\f\x00\x00\x01\x0f" + // 0x0064030C: 0x0000010F + "\x00E\x03\x04\x00\x00\x01\x12" + // 0x00450304: 0x00000112 + "\x00e\x03\x04\x00\x00\x01\x13" + // 0x00650304: 0x00000113 + "\x00E\x03\x06\x00\x00\x01\x14" + // 0x00450306: 0x00000114 + "\x00e\x03\x06\x00\x00\x01\x15" + // 0x00650306: 0x00000115 + "\x00E\x03\a\x00\x00\x01\x16" + // 0x00450307: 0x00000116 + "\x00e\x03\a\x00\x00\x01\x17" + // 0x00650307: 0x00000117 + "\x00E\x03(\x00\x00\x01\x18" + // 0x00450328: 0x00000118 + "\x00e\x03(\x00\x00\x01\x19" + // 0x00650328: 0x00000119 + "\x00E\x03\f\x00\x00\x01\x1a" + // 0x0045030C: 0x0000011A + "\x00e\x03\f\x00\x00\x01\x1b" + // 0x0065030C: 0x0000011B + "\x00G\x03\x02\x00\x00\x01\x1c" + // 0x00470302: 0x0000011C + "\x00g\x03\x02\x00\x00\x01\x1d" + // 0x00670302: 0x0000011D + "\x00G\x03\x06\x00\x00\x01\x1e" + // 0x00470306: 0x0000011E + "\x00g\x03\x06\x00\x00\x01\x1f" + // 0x00670306: 0x0000011F + "\x00G\x03\a\x00\x00\x01 " + // 0x00470307: 0x00000120 + "\x00g\x03\a\x00\x00\x01!" + // 0x00670307: 0x00000121 + "\x00G\x03'\x00\x00\x01\"" + // 0x00470327: 0x00000122 + "\x00g\x03'\x00\x00\x01#" + // 0x00670327: 0x00000123 + "\x00H\x03\x02\x00\x00\x01$" + // 0x00480302: 0x00000124 + "\x00h\x03\x02\x00\x00\x01%" + // 0x00680302: 0x00000125 + "\x00I\x03\x03\x00\x00\x01(" + // 0x00490303: 0x00000128 + "\x00i\x03\x03\x00\x00\x01)" + // 0x00690303: 0x00000129 + "\x00I\x03\x04\x00\x00\x01*" + // 0x00490304: 0x0000012A + "\x00i\x03\x04\x00\x00\x01+" + // 0x00690304: 0x0000012B + "\x00I\x03\x06\x00\x00\x01," + // 0x00490306: 0x0000012C + "\x00i\x03\x06\x00\x00\x01-" + // 0x00690306: 0x0000012D + "\x00I\x03(\x00\x00\x01." + // 0x00490328: 0x0000012E + "\x00i\x03(\x00\x00\x01/" + // 0x00690328: 0x0000012F + "\x00I\x03\a\x00\x00\x010" + // 0x00490307: 0x00000130 + "\x00J\x03\x02\x00\x00\x014" + // 0x004A0302: 0x00000134 + "\x00j\x03\x02\x00\x00\x015" + // 0x006A0302: 0x00000135 + "\x00K\x03'\x00\x00\x016" + // 0x004B0327: 0x00000136 + "\x00k\x03'\x00\x00\x017" + // 0x006B0327: 0x00000137 + "\x00L\x03\x01\x00\x00\x019" + // 0x004C0301: 0x00000139 + "\x00l\x03\x01\x00\x00\x01:" + // 0x006C0301: 0x0000013A + "\x00L\x03'\x00\x00\x01;" + // 0x004C0327: 0x0000013B + "\x00l\x03'\x00\x00\x01<" + // 0x006C0327: 0x0000013C + "\x00L\x03\f\x00\x00\x01=" + // 0x004C030C: 0x0000013D + "\x00l\x03\f\x00\x00\x01>" + // 0x006C030C: 0x0000013E + "\x00N\x03\x01\x00\x00\x01C" + // 0x004E0301: 0x00000143 + "\x00n\x03\x01\x00\x00\x01D" + // 0x006E0301: 0x00000144 + "\x00N\x03'\x00\x00\x01E" + // 0x004E0327: 0x00000145 + "\x00n\x03'\x00\x00\x01F" + // 0x006E0327: 0x00000146 + "\x00N\x03\f\x00\x00\x01G" + // 0x004E030C: 0x00000147 + "\x00n\x03\f\x00\x00\x01H" + // 0x006E030C: 0x00000148 + "\x00O\x03\x04\x00\x00\x01L" + // 0x004F0304: 0x0000014C + "\x00o\x03\x04\x00\x00\x01M" + // 0x006F0304: 0x0000014D + "\x00O\x03\x06\x00\x00\x01N" + // 0x004F0306: 0x0000014E + "\x00o\x03\x06\x00\x00\x01O" + // 0x006F0306: 0x0000014F + "\x00O\x03\v\x00\x00\x01P" + // 0x004F030B: 0x00000150 + "\x00o\x03\v\x00\x00\x01Q" + // 0x006F030B: 0x00000151 + "\x00R\x03\x01\x00\x00\x01T" + // 0x00520301: 0x00000154 + "\x00r\x03\x01\x00\x00\x01U" + // 0x00720301: 0x00000155 + "\x00R\x03'\x00\x00\x01V" + // 0x00520327: 0x00000156 + "\x00r\x03'\x00\x00\x01W" + // 0x00720327: 0x00000157 + "\x00R\x03\f\x00\x00\x01X" + // 0x0052030C: 0x00000158 + "\x00r\x03\f\x00\x00\x01Y" + // 0x0072030C: 0x00000159 + "\x00S\x03\x01\x00\x00\x01Z" + // 0x00530301: 0x0000015A + "\x00s\x03\x01\x00\x00\x01[" + // 0x00730301: 0x0000015B + "\x00S\x03\x02\x00\x00\x01\\" + // 0x00530302: 0x0000015C + "\x00s\x03\x02\x00\x00\x01]" + // 0x00730302: 0x0000015D + "\x00S\x03'\x00\x00\x01^" + // 0x00530327: 0x0000015E + "\x00s\x03'\x00\x00\x01_" + // 0x00730327: 0x0000015F + "\x00S\x03\f\x00\x00\x01`" + // 0x0053030C: 0x00000160 + "\x00s\x03\f\x00\x00\x01a" + // 0x0073030C: 0x00000161 + "\x00T\x03'\x00\x00\x01b" + // 0x00540327: 0x00000162 + "\x00t\x03'\x00\x00\x01c" + // 0x00740327: 0x00000163 + "\x00T\x03\f\x00\x00\x01d" + // 0x0054030C: 0x00000164 + "\x00t\x03\f\x00\x00\x01e" + // 0x0074030C: 0x00000165 + "\x00U\x03\x03\x00\x00\x01h" + // 0x00550303: 0x00000168 + "\x00u\x03\x03\x00\x00\x01i" + // 0x00750303: 0x00000169 + "\x00U\x03\x04\x00\x00\x01j" + // 0x00550304: 0x0000016A + "\x00u\x03\x04\x00\x00\x01k" + // 0x00750304: 0x0000016B + "\x00U\x03\x06\x00\x00\x01l" + // 0x00550306: 0x0000016C + "\x00u\x03\x06\x00\x00\x01m" + // 0x00750306: 0x0000016D + "\x00U\x03\n\x00\x00\x01n" + // 0x0055030A: 0x0000016E + "\x00u\x03\n\x00\x00\x01o" + // 0x0075030A: 0x0000016F + "\x00U\x03\v\x00\x00\x01p" + // 0x0055030B: 0x00000170 + "\x00u\x03\v\x00\x00\x01q" + // 0x0075030B: 0x00000171 + "\x00U\x03(\x00\x00\x01r" + // 0x00550328: 0x00000172 + "\x00u\x03(\x00\x00\x01s" + // 0x00750328: 0x00000173 + "\x00W\x03\x02\x00\x00\x01t" + // 0x00570302: 0x00000174 + "\x00w\x03\x02\x00\x00\x01u" + // 0x00770302: 0x00000175 + "\x00Y\x03\x02\x00\x00\x01v" + // 0x00590302: 0x00000176 + "\x00y\x03\x02\x00\x00\x01w" + // 0x00790302: 0x00000177 + "\x00Y\x03\b\x00\x00\x01x" + // 0x00590308: 0x00000178 + "\x00Z\x03\x01\x00\x00\x01y" + // 0x005A0301: 0x00000179 + "\x00z\x03\x01\x00\x00\x01z" + // 0x007A0301: 0x0000017A + "\x00Z\x03\a\x00\x00\x01{" + // 0x005A0307: 0x0000017B + "\x00z\x03\a\x00\x00\x01|" + // 0x007A0307: 0x0000017C + "\x00Z\x03\f\x00\x00\x01}" + // 0x005A030C: 0x0000017D + "\x00z\x03\f\x00\x00\x01~" + // 0x007A030C: 0x0000017E + "\x00O\x03\x1b\x00\x00\x01\xa0" + // 0x004F031B: 0x000001A0 + "\x00o\x03\x1b\x00\x00\x01\xa1" + // 0x006F031B: 0x000001A1 + "\x00U\x03\x1b\x00\x00\x01\xaf" + // 0x0055031B: 0x000001AF + "\x00u\x03\x1b\x00\x00\x01\xb0" + // 0x0075031B: 0x000001B0 + "\x00A\x03\f\x00\x00\x01\xcd" + // 0x0041030C: 0x000001CD + "\x00a\x03\f\x00\x00\x01\xce" + // 0x0061030C: 0x000001CE + "\x00I\x03\f\x00\x00\x01\xcf" + // 0x0049030C: 0x000001CF + "\x00i\x03\f\x00\x00\x01\xd0" + // 0x0069030C: 0x000001D0 + "\x00O\x03\f\x00\x00\x01\xd1" + // 0x004F030C: 0x000001D1 + "\x00o\x03\f\x00\x00\x01\xd2" + // 0x006F030C: 0x000001D2 + "\x00U\x03\f\x00\x00\x01\xd3" + // 0x0055030C: 0x000001D3 + "\x00u\x03\f\x00\x00\x01\xd4" + // 0x0075030C: 0x000001D4 + "\x00\xdc\x03\x04\x00\x00\x01\xd5" + // 0x00DC0304: 0x000001D5 + "\x00\xfc\x03\x04\x00\x00\x01\xd6" + // 0x00FC0304: 0x000001D6 + "\x00\xdc\x03\x01\x00\x00\x01\xd7" + // 0x00DC0301: 0x000001D7 + "\x00\xfc\x03\x01\x00\x00\x01\xd8" + // 0x00FC0301: 0x000001D8 + "\x00\xdc\x03\f\x00\x00\x01\xd9" + // 0x00DC030C: 0x000001D9 + "\x00\xfc\x03\f\x00\x00\x01\xda" + // 0x00FC030C: 0x000001DA + "\x00\xdc\x03\x00\x00\x00\x01\xdb" + // 0x00DC0300: 0x000001DB + "\x00\xfc\x03\x00\x00\x00\x01\xdc" + // 0x00FC0300: 0x000001DC + "\x00\xc4\x03\x04\x00\x00\x01\xde" + // 0x00C40304: 0x000001DE + "\x00\xe4\x03\x04\x00\x00\x01\xdf" + // 0x00E40304: 0x000001DF + "\x02&\x03\x04\x00\x00\x01\xe0" + // 0x02260304: 0x000001E0 + "\x02'\x03\x04\x00\x00\x01\xe1" + // 0x02270304: 0x000001E1 + "\x00\xc6\x03\x04\x00\x00\x01\xe2" + // 0x00C60304: 0x000001E2 + "\x00\xe6\x03\x04\x00\x00\x01\xe3" + // 0x00E60304: 0x000001E3 + "\x00G\x03\f\x00\x00\x01\xe6" + // 0x0047030C: 0x000001E6 + "\x00g\x03\f\x00\x00\x01\xe7" + // 0x0067030C: 0x000001E7 + "\x00K\x03\f\x00\x00\x01\xe8" + // 0x004B030C: 0x000001E8 + "\x00k\x03\f\x00\x00\x01\xe9" + // 0x006B030C: 0x000001E9 + "\x00O\x03(\x00\x00\x01\xea" + // 0x004F0328: 0x000001EA + "\x00o\x03(\x00\x00\x01\xeb" + // 0x006F0328: 0x000001EB + "\x01\xea\x03\x04\x00\x00\x01\xec" + // 0x01EA0304: 0x000001EC + "\x01\xeb\x03\x04\x00\x00\x01\xed" + // 0x01EB0304: 0x000001ED + "\x01\xb7\x03\f\x00\x00\x01\xee" + // 0x01B7030C: 0x000001EE + "\x02\x92\x03\f\x00\x00\x01\xef" + // 0x0292030C: 0x000001EF + "\x00j\x03\f\x00\x00\x01\xf0" + // 0x006A030C: 0x000001F0 + "\x00G\x03\x01\x00\x00\x01\xf4" + // 0x00470301: 0x000001F4 + "\x00g\x03\x01\x00\x00\x01\xf5" + // 0x00670301: 0x000001F5 + "\x00N\x03\x00\x00\x00\x01\xf8" + // 0x004E0300: 0x000001F8 + "\x00n\x03\x00\x00\x00\x01\xf9" + // 0x006E0300: 0x000001F9 + "\x00\xc5\x03\x01\x00\x00\x01\xfa" + // 0x00C50301: 0x000001FA + "\x00\xe5\x03\x01\x00\x00\x01\xfb" + // 0x00E50301: 0x000001FB + "\x00\xc6\x03\x01\x00\x00\x01\xfc" + // 0x00C60301: 0x000001FC + "\x00\xe6\x03\x01\x00\x00\x01\xfd" + // 0x00E60301: 0x000001FD + "\x00\xd8\x03\x01\x00\x00\x01\xfe" + // 0x00D80301: 0x000001FE + "\x00\xf8\x03\x01\x00\x00\x01\xff" + // 0x00F80301: 0x000001FF + "\x00A\x03\x0f\x00\x00\x02\x00" + // 0x0041030F: 0x00000200 + "\x00a\x03\x0f\x00\x00\x02\x01" + // 0x0061030F: 0x00000201 + "\x00A\x03\x11\x00\x00\x02\x02" + // 0x00410311: 0x00000202 + "\x00a\x03\x11\x00\x00\x02\x03" + // 0x00610311: 0x00000203 + "\x00E\x03\x0f\x00\x00\x02\x04" + // 0x0045030F: 0x00000204 + "\x00e\x03\x0f\x00\x00\x02\x05" + // 0x0065030F: 0x00000205 + "\x00E\x03\x11\x00\x00\x02\x06" + // 0x00450311: 0x00000206 + "\x00e\x03\x11\x00\x00\x02\a" + // 0x00650311: 0x00000207 + "\x00I\x03\x0f\x00\x00\x02\b" + // 0x0049030F: 0x00000208 + "\x00i\x03\x0f\x00\x00\x02\t" + // 0x0069030F: 0x00000209 + "\x00I\x03\x11\x00\x00\x02\n" + // 0x00490311: 0x0000020A + "\x00i\x03\x11\x00\x00\x02\v" + // 0x00690311: 0x0000020B + "\x00O\x03\x0f\x00\x00\x02\f" + // 0x004F030F: 0x0000020C + "\x00o\x03\x0f\x00\x00\x02\r" + // 0x006F030F: 0x0000020D + "\x00O\x03\x11\x00\x00\x02\x0e" + // 0x004F0311: 0x0000020E + "\x00o\x03\x11\x00\x00\x02\x0f" + // 0x006F0311: 0x0000020F + "\x00R\x03\x0f\x00\x00\x02\x10" + // 0x0052030F: 0x00000210 + "\x00r\x03\x0f\x00\x00\x02\x11" + // 0x0072030F: 0x00000211 + "\x00R\x03\x11\x00\x00\x02\x12" + // 0x00520311: 0x00000212 + "\x00r\x03\x11\x00\x00\x02\x13" + // 0x00720311: 0x00000213 + "\x00U\x03\x0f\x00\x00\x02\x14" + // 0x0055030F: 0x00000214 + "\x00u\x03\x0f\x00\x00\x02\x15" + // 0x0075030F: 0x00000215 + "\x00U\x03\x11\x00\x00\x02\x16" + // 0x00550311: 0x00000216 + "\x00u\x03\x11\x00\x00\x02\x17" + // 0x00750311: 0x00000217 + "\x00S\x03&\x00\x00\x02\x18" + // 0x00530326: 0x00000218 + "\x00s\x03&\x00\x00\x02\x19" + // 0x00730326: 0x00000219 + "\x00T\x03&\x00\x00\x02\x1a" + // 0x00540326: 0x0000021A + "\x00t\x03&\x00\x00\x02\x1b" + // 0x00740326: 0x0000021B + "\x00H\x03\f\x00\x00\x02\x1e" + // 0x0048030C: 0x0000021E + "\x00h\x03\f\x00\x00\x02\x1f" + // 0x0068030C: 0x0000021F + "\x00A\x03\a\x00\x00\x02&" + // 0x00410307: 0x00000226 + "\x00a\x03\a\x00\x00\x02'" + // 0x00610307: 0x00000227 + "\x00E\x03'\x00\x00\x02(" + // 0x00450327: 0x00000228 + "\x00e\x03'\x00\x00\x02)" + // 0x00650327: 0x00000229 + "\x00\xd6\x03\x04\x00\x00\x02*" + // 0x00D60304: 0x0000022A + "\x00\xf6\x03\x04\x00\x00\x02+" + // 0x00F60304: 0x0000022B + "\x00\xd5\x03\x04\x00\x00\x02," + // 0x00D50304: 0x0000022C + "\x00\xf5\x03\x04\x00\x00\x02-" + // 0x00F50304: 0x0000022D + "\x00O\x03\a\x00\x00\x02." + // 0x004F0307: 0x0000022E + "\x00o\x03\a\x00\x00\x02/" + // 0x006F0307: 0x0000022F + "\x02.\x03\x04\x00\x00\x020" + // 0x022E0304: 0x00000230 + "\x02/\x03\x04\x00\x00\x021" + // 0x022F0304: 0x00000231 + "\x00Y\x03\x04\x00\x00\x022" + // 0x00590304: 0x00000232 + "\x00y\x03\x04\x00\x00\x023" + // 0x00790304: 0x00000233 + "\x00\xa8\x03\x01\x00\x00\x03\x85" + // 0x00A80301: 0x00000385 + "\x03\x91\x03\x01\x00\x00\x03\x86" + // 0x03910301: 0x00000386 + "\x03\x95\x03\x01\x00\x00\x03\x88" + // 0x03950301: 0x00000388 + "\x03\x97\x03\x01\x00\x00\x03\x89" + // 0x03970301: 0x00000389 + "\x03\x99\x03\x01\x00\x00\x03\x8a" + // 0x03990301: 0x0000038A + "\x03\x9f\x03\x01\x00\x00\x03\x8c" + // 0x039F0301: 0x0000038C + "\x03\xa5\x03\x01\x00\x00\x03\x8e" + // 0x03A50301: 0x0000038E + "\x03\xa9\x03\x01\x00\x00\x03\x8f" + // 0x03A90301: 0x0000038F + "\x03\xca\x03\x01\x00\x00\x03\x90" + // 0x03CA0301: 0x00000390 + "\x03\x99\x03\b\x00\x00\x03\xaa" + // 0x03990308: 0x000003AA + "\x03\xa5\x03\b\x00\x00\x03\xab" + // 0x03A50308: 0x000003AB + "\x03\xb1\x03\x01\x00\x00\x03\xac" + // 0x03B10301: 0x000003AC + "\x03\xb5\x03\x01\x00\x00\x03\xad" + // 0x03B50301: 0x000003AD + "\x03\xb7\x03\x01\x00\x00\x03\xae" + // 0x03B70301: 0x000003AE + "\x03\xb9\x03\x01\x00\x00\x03\xaf" + // 0x03B90301: 0x000003AF + "\x03\xcb\x03\x01\x00\x00\x03\xb0" + // 0x03CB0301: 0x000003B0 + "\x03\xb9\x03\b\x00\x00\x03\xca" + // 0x03B90308: 0x000003CA + "\x03\xc5\x03\b\x00\x00\x03\xcb" + // 0x03C50308: 0x000003CB + "\x03\xbf\x03\x01\x00\x00\x03\xcc" + // 0x03BF0301: 0x000003CC + "\x03\xc5\x03\x01\x00\x00\x03\xcd" + // 0x03C50301: 0x000003CD + "\x03\xc9\x03\x01\x00\x00\x03\xce" + // 0x03C90301: 0x000003CE + "\x03\xd2\x03\x01\x00\x00\x03\xd3" + // 0x03D20301: 0x000003D3 + "\x03\xd2\x03\b\x00\x00\x03\xd4" + // 0x03D20308: 0x000003D4 + "\x04\x15\x03\x00\x00\x00\x04\x00" + // 0x04150300: 0x00000400 + "\x04\x15\x03\b\x00\x00\x04\x01" + // 0x04150308: 0x00000401 + "\x04\x13\x03\x01\x00\x00\x04\x03" + // 0x04130301: 0x00000403 + "\x04\x06\x03\b\x00\x00\x04\a" + // 0x04060308: 0x00000407 + "\x04\x1a\x03\x01\x00\x00\x04\f" + // 0x041A0301: 0x0000040C + "\x04\x18\x03\x00\x00\x00\x04\r" + // 0x04180300: 0x0000040D + "\x04#\x03\x06\x00\x00\x04\x0e" + // 0x04230306: 0x0000040E + "\x04\x18\x03\x06\x00\x00\x04\x19" + // 0x04180306: 0x00000419 + "\x048\x03\x06\x00\x00\x049" + // 0x04380306: 0x00000439 + "\x045\x03\x00\x00\x00\x04P" + // 0x04350300: 0x00000450 + "\x045\x03\b\x00\x00\x04Q" + // 0x04350308: 0x00000451 + "\x043\x03\x01\x00\x00\x04S" + // 0x04330301: 0x00000453 + "\x04V\x03\b\x00\x00\x04W" + // 0x04560308: 0x00000457 + "\x04:\x03\x01\x00\x00\x04\\" + // 0x043A0301: 0x0000045C + "\x048\x03\x00\x00\x00\x04]" + // 0x04380300: 0x0000045D + "\x04C\x03\x06\x00\x00\x04^" + // 0x04430306: 0x0000045E + "\x04t\x03\x0f\x00\x00\x04v" + // 0x0474030F: 0x00000476 + "\x04u\x03\x0f\x00\x00\x04w" + // 0x0475030F: 0x00000477 + "\x04\x16\x03\x06\x00\x00\x04\xc1" + // 0x04160306: 0x000004C1 + "\x046\x03\x06\x00\x00\x04\xc2" + // 0x04360306: 0x000004C2 + "\x04\x10\x03\x06\x00\x00\x04\xd0" + // 0x04100306: 0x000004D0 + "\x040\x03\x06\x00\x00\x04\xd1" + // 0x04300306: 0x000004D1 + "\x04\x10\x03\b\x00\x00\x04\xd2" + // 0x04100308: 0x000004D2 + "\x040\x03\b\x00\x00\x04\xd3" + // 0x04300308: 0x000004D3 + "\x04\x15\x03\x06\x00\x00\x04\xd6" + // 0x04150306: 0x000004D6 + "\x045\x03\x06\x00\x00\x04\xd7" + // 0x04350306: 0x000004D7 + "\x04\xd8\x03\b\x00\x00\x04\xda" + // 0x04D80308: 0x000004DA + "\x04\xd9\x03\b\x00\x00\x04\xdb" + // 0x04D90308: 0x000004DB + "\x04\x16\x03\b\x00\x00\x04\xdc" + // 0x04160308: 0x000004DC + "\x046\x03\b\x00\x00\x04\xdd" + // 0x04360308: 0x000004DD + "\x04\x17\x03\b\x00\x00\x04\xde" + // 0x04170308: 0x000004DE + "\x047\x03\b\x00\x00\x04\xdf" + // 0x04370308: 0x000004DF + "\x04\x18\x03\x04\x00\x00\x04\xe2" + // 0x04180304: 0x000004E2 + "\x048\x03\x04\x00\x00\x04\xe3" + // 0x04380304: 0x000004E3 + "\x04\x18\x03\b\x00\x00\x04\xe4" + // 0x04180308: 0x000004E4 + "\x048\x03\b\x00\x00\x04\xe5" + // 0x04380308: 0x000004E5 + "\x04\x1e\x03\b\x00\x00\x04\xe6" + // 0x041E0308: 0x000004E6 + "\x04>\x03\b\x00\x00\x04\xe7" + // 0x043E0308: 0x000004E7 + "\x04\xe8\x03\b\x00\x00\x04\xea" + // 0x04E80308: 0x000004EA + "\x04\xe9\x03\b\x00\x00\x04\xeb" + // 0x04E90308: 0x000004EB + "\x04-\x03\b\x00\x00\x04\xec" + // 0x042D0308: 0x000004EC + "\x04M\x03\b\x00\x00\x04\xed" + // 0x044D0308: 0x000004ED + "\x04#\x03\x04\x00\x00\x04\xee" + // 0x04230304: 0x000004EE + "\x04C\x03\x04\x00\x00\x04\xef" + // 0x04430304: 0x000004EF + "\x04#\x03\b\x00\x00\x04\xf0" + // 0x04230308: 0x000004F0 + "\x04C\x03\b\x00\x00\x04\xf1" + // 0x04430308: 0x000004F1 + "\x04#\x03\v\x00\x00\x04\xf2" + // 0x0423030B: 0x000004F2 + "\x04C\x03\v\x00\x00\x04\xf3" + // 0x0443030B: 0x000004F3 + "\x04'\x03\b\x00\x00\x04\xf4" + // 0x04270308: 0x000004F4 + "\x04G\x03\b\x00\x00\x04\xf5" + // 0x04470308: 0x000004F5 + "\x04+\x03\b\x00\x00\x04\xf8" + // 0x042B0308: 0x000004F8 + "\x04K\x03\b\x00\x00\x04\xf9" + // 0x044B0308: 0x000004F9 + "\x06'\x06S\x00\x00\x06\"" + // 0x06270653: 0x00000622 + "\x06'\x06T\x00\x00\x06#" + // 0x06270654: 0x00000623 + "\x06H\x06T\x00\x00\x06$" + // 0x06480654: 0x00000624 + "\x06'\x06U\x00\x00\x06%" + // 0x06270655: 0x00000625 + "\x06J\x06T\x00\x00\x06&" + // 0x064A0654: 0x00000626 + "\x06\xd5\x06T\x00\x00\x06\xc0" + // 0x06D50654: 0x000006C0 + "\x06\xc1\x06T\x00\x00\x06\xc2" + // 0x06C10654: 0x000006C2 + "\x06\xd2\x06T\x00\x00\x06\xd3" + // 0x06D20654: 0x000006D3 + "\t(\t<\x00\x00\t)" + // 0x0928093C: 0x00000929 + "\t0\t<\x00\x00\t1" + // 0x0930093C: 0x00000931 + "\t3\t<\x00\x00\t4" + // 0x0933093C: 0x00000934 + "\t\xc7\t\xbe\x00\x00\t\xcb" + // 0x09C709BE: 0x000009CB + "\t\xc7\t\xd7\x00\x00\t\xcc" + // 0x09C709D7: 0x000009CC + "\vG\vV\x00\x00\vH" + // 0x0B470B56: 0x00000B48 + "\vG\v>\x00\x00\vK" + // 0x0B470B3E: 0x00000B4B + "\vG\vW\x00\x00\vL" + // 0x0B470B57: 0x00000B4C + "\v\x92\v\xd7\x00\x00\v\x94" + // 0x0B920BD7: 0x00000B94 + "\v\xc6\v\xbe\x00\x00\v\xca" + // 0x0BC60BBE: 0x00000BCA + "\v\xc7\v\xbe\x00\x00\v\xcb" + // 0x0BC70BBE: 0x00000BCB + "\v\xc6\v\xd7\x00\x00\v\xcc" + // 0x0BC60BD7: 0x00000BCC + "\fF\fV\x00\x00\fH" + // 0x0C460C56: 0x00000C48 + "\f\xbf\f\xd5\x00\x00\f\xc0" + // 0x0CBF0CD5: 0x00000CC0 + "\f\xc6\f\xd5\x00\x00\f\xc7" + // 0x0CC60CD5: 0x00000CC7 + "\f\xc6\f\xd6\x00\x00\f\xc8" + // 0x0CC60CD6: 0x00000CC8 + "\f\xc6\f\xc2\x00\x00\f\xca" + // 0x0CC60CC2: 0x00000CCA + "\f\xca\f\xd5\x00\x00\f\xcb" + // 0x0CCA0CD5: 0x00000CCB + "\rF\r>\x00\x00\rJ" + // 0x0D460D3E: 0x00000D4A + "\rG\r>\x00\x00\rK" + // 0x0D470D3E: 0x00000D4B + "\rF\rW\x00\x00\rL" + // 0x0D460D57: 0x00000D4C + "\r\xd9\r\xca\x00\x00\r\xda" + // 0x0DD90DCA: 0x00000DDA + "\r\xd9\r\xcf\x00\x00\r\xdc" + // 0x0DD90DCF: 0x00000DDC + "\r\xdc\r\xca\x00\x00\r\xdd" + // 0x0DDC0DCA: 0x00000DDD + "\r\xd9\r\xdf\x00\x00\r\xde" + // 0x0DD90DDF: 0x00000DDE + "\x10%\x10.\x00\x00\x10&" + // 0x1025102E: 0x00001026 + "\x1b\x05\x1b5\x00\x00\x1b\x06" + // 0x1B051B35: 0x00001B06 + "\x1b\a\x1b5\x00\x00\x1b\b" + // 0x1B071B35: 0x00001B08 + "\x1b\t\x1b5\x00\x00\x1b\n" + // 0x1B091B35: 0x00001B0A + "\x1b\v\x1b5\x00\x00\x1b\f" + // 0x1B0B1B35: 0x00001B0C + "\x1b\r\x1b5\x00\x00\x1b\x0e" + // 0x1B0D1B35: 0x00001B0E + "\x1b\x11\x1b5\x00\x00\x1b\x12" + // 0x1B111B35: 0x00001B12 + "\x1b:\x1b5\x00\x00\x1b;" + // 0x1B3A1B35: 0x00001B3B + "\x1b<\x1b5\x00\x00\x1b=" + // 0x1B3C1B35: 0x00001B3D + "\x1b>\x1b5\x00\x00\x1b@" + // 0x1B3E1B35: 0x00001B40 + "\x1b?\x1b5\x00\x00\x1bA" + // 0x1B3F1B35: 0x00001B41 + "\x1bB\x1b5\x00\x00\x1bC" + // 0x1B421B35: 0x00001B43 + "\x00A\x03%\x00\x00\x1e\x00" + // 0x00410325: 0x00001E00 + "\x00a\x03%\x00\x00\x1e\x01" + // 0x00610325: 0x00001E01 + "\x00B\x03\a\x00\x00\x1e\x02" + // 0x00420307: 0x00001E02 + "\x00b\x03\a\x00\x00\x1e\x03" + // 0x00620307: 0x00001E03 + "\x00B\x03#\x00\x00\x1e\x04" + // 0x00420323: 0x00001E04 + "\x00b\x03#\x00\x00\x1e\x05" + // 0x00620323: 0x00001E05 + "\x00B\x031\x00\x00\x1e\x06" + // 0x00420331: 0x00001E06 + "\x00b\x031\x00\x00\x1e\a" + // 0x00620331: 0x00001E07 + "\x00\xc7\x03\x01\x00\x00\x1e\b" + // 0x00C70301: 0x00001E08 + "\x00\xe7\x03\x01\x00\x00\x1e\t" + // 0x00E70301: 0x00001E09 + "\x00D\x03\a\x00\x00\x1e\n" + // 0x00440307: 0x00001E0A + "\x00d\x03\a\x00\x00\x1e\v" + // 0x00640307: 0x00001E0B + "\x00D\x03#\x00\x00\x1e\f" + // 0x00440323: 0x00001E0C + "\x00d\x03#\x00\x00\x1e\r" + // 0x00640323: 0x00001E0D + "\x00D\x031\x00\x00\x1e\x0e" + // 0x00440331: 0x00001E0E + "\x00d\x031\x00\x00\x1e\x0f" + // 0x00640331: 0x00001E0F + "\x00D\x03'\x00\x00\x1e\x10" + // 0x00440327: 0x00001E10 + "\x00d\x03'\x00\x00\x1e\x11" + // 0x00640327: 0x00001E11 + "\x00D\x03-\x00\x00\x1e\x12" + // 0x0044032D: 0x00001E12 + "\x00d\x03-\x00\x00\x1e\x13" + // 0x0064032D: 0x00001E13 + "\x01\x12\x03\x00\x00\x00\x1e\x14" + // 0x01120300: 0x00001E14 + "\x01\x13\x03\x00\x00\x00\x1e\x15" + // 0x01130300: 0x00001E15 + "\x01\x12\x03\x01\x00\x00\x1e\x16" + // 0x01120301: 0x00001E16 + "\x01\x13\x03\x01\x00\x00\x1e\x17" + // 0x01130301: 0x00001E17 + "\x00E\x03-\x00\x00\x1e\x18" + // 0x0045032D: 0x00001E18 + "\x00e\x03-\x00\x00\x1e\x19" + // 0x0065032D: 0x00001E19 + "\x00E\x030\x00\x00\x1e\x1a" + // 0x00450330: 0x00001E1A + "\x00e\x030\x00\x00\x1e\x1b" + // 0x00650330: 0x00001E1B + "\x02(\x03\x06\x00\x00\x1e\x1c" + // 0x02280306: 0x00001E1C + "\x02)\x03\x06\x00\x00\x1e\x1d" + // 0x02290306: 0x00001E1D + "\x00F\x03\a\x00\x00\x1e\x1e" + // 0x00460307: 0x00001E1E + "\x00f\x03\a\x00\x00\x1e\x1f" + // 0x00660307: 0x00001E1F + "\x00G\x03\x04\x00\x00\x1e " + // 0x00470304: 0x00001E20 + "\x00g\x03\x04\x00\x00\x1e!" + // 0x00670304: 0x00001E21 + "\x00H\x03\a\x00\x00\x1e\"" + // 0x00480307: 0x00001E22 + "\x00h\x03\a\x00\x00\x1e#" + // 0x00680307: 0x00001E23 + "\x00H\x03#\x00\x00\x1e$" + // 0x00480323: 0x00001E24 + "\x00h\x03#\x00\x00\x1e%" + // 0x00680323: 0x00001E25 + "\x00H\x03\b\x00\x00\x1e&" + // 0x00480308: 0x00001E26 + "\x00h\x03\b\x00\x00\x1e'" + // 0x00680308: 0x00001E27 + "\x00H\x03'\x00\x00\x1e(" + // 0x00480327: 0x00001E28 + "\x00h\x03'\x00\x00\x1e)" + // 0x00680327: 0x00001E29 + "\x00H\x03.\x00\x00\x1e*" + // 0x0048032E: 0x00001E2A + "\x00h\x03.\x00\x00\x1e+" + // 0x0068032E: 0x00001E2B + "\x00I\x030\x00\x00\x1e," + // 0x00490330: 0x00001E2C + "\x00i\x030\x00\x00\x1e-" + // 0x00690330: 0x00001E2D + "\x00\xcf\x03\x01\x00\x00\x1e." + // 0x00CF0301: 0x00001E2E + "\x00\xef\x03\x01\x00\x00\x1e/" + // 0x00EF0301: 0x00001E2F + "\x00K\x03\x01\x00\x00\x1e0" + // 0x004B0301: 0x00001E30 + "\x00k\x03\x01\x00\x00\x1e1" + // 0x006B0301: 0x00001E31 + "\x00K\x03#\x00\x00\x1e2" + // 0x004B0323: 0x00001E32 + "\x00k\x03#\x00\x00\x1e3" + // 0x006B0323: 0x00001E33 + "\x00K\x031\x00\x00\x1e4" + // 0x004B0331: 0x00001E34 + "\x00k\x031\x00\x00\x1e5" + // 0x006B0331: 0x00001E35 + "\x00L\x03#\x00\x00\x1e6" + // 0x004C0323: 0x00001E36 + "\x00l\x03#\x00\x00\x1e7" + // 0x006C0323: 0x00001E37 + "\x1e6\x03\x04\x00\x00\x1e8" + // 0x1E360304: 0x00001E38 + "\x1e7\x03\x04\x00\x00\x1e9" + // 0x1E370304: 0x00001E39 + "\x00L\x031\x00\x00\x1e:" + // 0x004C0331: 0x00001E3A + "\x00l\x031\x00\x00\x1e;" + // 0x006C0331: 0x00001E3B + "\x00L\x03-\x00\x00\x1e<" + // 0x004C032D: 0x00001E3C + "\x00l\x03-\x00\x00\x1e=" + // 0x006C032D: 0x00001E3D + "\x00M\x03\x01\x00\x00\x1e>" + // 0x004D0301: 0x00001E3E + "\x00m\x03\x01\x00\x00\x1e?" + // 0x006D0301: 0x00001E3F + "\x00M\x03\a\x00\x00\x1e@" + // 0x004D0307: 0x00001E40 + "\x00m\x03\a\x00\x00\x1eA" + // 0x006D0307: 0x00001E41 + "\x00M\x03#\x00\x00\x1eB" + // 0x004D0323: 0x00001E42 + "\x00m\x03#\x00\x00\x1eC" + // 0x006D0323: 0x00001E43 + "\x00N\x03\a\x00\x00\x1eD" + // 0x004E0307: 0x00001E44 + "\x00n\x03\a\x00\x00\x1eE" + // 0x006E0307: 0x00001E45 + "\x00N\x03#\x00\x00\x1eF" + // 0x004E0323: 0x00001E46 + "\x00n\x03#\x00\x00\x1eG" + // 0x006E0323: 0x00001E47 + "\x00N\x031\x00\x00\x1eH" + // 0x004E0331: 0x00001E48 + "\x00n\x031\x00\x00\x1eI" + // 0x006E0331: 0x00001E49 + "\x00N\x03-\x00\x00\x1eJ" + // 0x004E032D: 0x00001E4A + "\x00n\x03-\x00\x00\x1eK" + // 0x006E032D: 0x00001E4B + "\x00\xd5\x03\x01\x00\x00\x1eL" + // 0x00D50301: 0x00001E4C + "\x00\xf5\x03\x01\x00\x00\x1eM" + // 0x00F50301: 0x00001E4D + "\x00\xd5\x03\b\x00\x00\x1eN" + // 0x00D50308: 0x00001E4E + "\x00\xf5\x03\b\x00\x00\x1eO" + // 0x00F50308: 0x00001E4F + "\x01L\x03\x00\x00\x00\x1eP" + // 0x014C0300: 0x00001E50 + "\x01M\x03\x00\x00\x00\x1eQ" + // 0x014D0300: 0x00001E51 + "\x01L\x03\x01\x00\x00\x1eR" + // 0x014C0301: 0x00001E52 + "\x01M\x03\x01\x00\x00\x1eS" + // 0x014D0301: 0x00001E53 + "\x00P\x03\x01\x00\x00\x1eT" + // 0x00500301: 0x00001E54 + "\x00p\x03\x01\x00\x00\x1eU" + // 0x00700301: 0x00001E55 + "\x00P\x03\a\x00\x00\x1eV" + // 0x00500307: 0x00001E56 + "\x00p\x03\a\x00\x00\x1eW" + // 0x00700307: 0x00001E57 + "\x00R\x03\a\x00\x00\x1eX" + // 0x00520307: 0x00001E58 + "\x00r\x03\a\x00\x00\x1eY" + // 0x00720307: 0x00001E59 + "\x00R\x03#\x00\x00\x1eZ" + // 0x00520323: 0x00001E5A + "\x00r\x03#\x00\x00\x1e[" + // 0x00720323: 0x00001E5B + "\x1eZ\x03\x04\x00\x00\x1e\\" + // 0x1E5A0304: 0x00001E5C + "\x1e[\x03\x04\x00\x00\x1e]" + // 0x1E5B0304: 0x00001E5D + "\x00R\x031\x00\x00\x1e^" + // 0x00520331: 0x00001E5E + "\x00r\x031\x00\x00\x1e_" + // 0x00720331: 0x00001E5F + "\x00S\x03\a\x00\x00\x1e`" + // 0x00530307: 0x00001E60 + "\x00s\x03\a\x00\x00\x1ea" + // 0x00730307: 0x00001E61 + "\x00S\x03#\x00\x00\x1eb" + // 0x00530323: 0x00001E62 + "\x00s\x03#\x00\x00\x1ec" + // 0x00730323: 0x00001E63 + "\x01Z\x03\a\x00\x00\x1ed" + // 0x015A0307: 0x00001E64 + "\x01[\x03\a\x00\x00\x1ee" + // 0x015B0307: 0x00001E65 + "\x01`\x03\a\x00\x00\x1ef" + // 0x01600307: 0x00001E66 + "\x01a\x03\a\x00\x00\x1eg" + // 0x01610307: 0x00001E67 + "\x1eb\x03\a\x00\x00\x1eh" + // 0x1E620307: 0x00001E68 + "\x1ec\x03\a\x00\x00\x1ei" + // 0x1E630307: 0x00001E69 + "\x00T\x03\a\x00\x00\x1ej" + // 0x00540307: 0x00001E6A + "\x00t\x03\a\x00\x00\x1ek" + // 0x00740307: 0x00001E6B + "\x00T\x03#\x00\x00\x1el" + // 0x00540323: 0x00001E6C + "\x00t\x03#\x00\x00\x1em" + // 0x00740323: 0x00001E6D + "\x00T\x031\x00\x00\x1en" + // 0x00540331: 0x00001E6E + "\x00t\x031\x00\x00\x1eo" + // 0x00740331: 0x00001E6F + "\x00T\x03-\x00\x00\x1ep" + // 0x0054032D: 0x00001E70 + "\x00t\x03-\x00\x00\x1eq" + // 0x0074032D: 0x00001E71 + "\x00U\x03$\x00\x00\x1er" + // 0x00550324: 0x00001E72 + "\x00u\x03$\x00\x00\x1es" + // 0x00750324: 0x00001E73 + "\x00U\x030\x00\x00\x1et" + // 0x00550330: 0x00001E74 + "\x00u\x030\x00\x00\x1eu" + // 0x00750330: 0x00001E75 + "\x00U\x03-\x00\x00\x1ev" + // 0x0055032D: 0x00001E76 + "\x00u\x03-\x00\x00\x1ew" + // 0x0075032D: 0x00001E77 + "\x01h\x03\x01\x00\x00\x1ex" + // 0x01680301: 0x00001E78 + "\x01i\x03\x01\x00\x00\x1ey" + // 0x01690301: 0x00001E79 + "\x01j\x03\b\x00\x00\x1ez" + // 0x016A0308: 0x00001E7A + "\x01k\x03\b\x00\x00\x1e{" + // 0x016B0308: 0x00001E7B + "\x00V\x03\x03\x00\x00\x1e|" + // 0x00560303: 0x00001E7C + "\x00v\x03\x03\x00\x00\x1e}" + // 0x00760303: 0x00001E7D + "\x00V\x03#\x00\x00\x1e~" + // 0x00560323: 0x00001E7E + "\x00v\x03#\x00\x00\x1e\u007f" + // 0x00760323: 0x00001E7F + "\x00W\x03\x00\x00\x00\x1e\x80" + // 0x00570300: 0x00001E80 + "\x00w\x03\x00\x00\x00\x1e\x81" + // 0x00770300: 0x00001E81 + "\x00W\x03\x01\x00\x00\x1e\x82" + // 0x00570301: 0x00001E82 + "\x00w\x03\x01\x00\x00\x1e\x83" + // 0x00770301: 0x00001E83 + "\x00W\x03\b\x00\x00\x1e\x84" + // 0x00570308: 0x00001E84 + "\x00w\x03\b\x00\x00\x1e\x85" + // 0x00770308: 0x00001E85 + "\x00W\x03\a\x00\x00\x1e\x86" + // 0x00570307: 0x00001E86 + "\x00w\x03\a\x00\x00\x1e\x87" + // 0x00770307: 0x00001E87 + "\x00W\x03#\x00\x00\x1e\x88" + // 0x00570323: 0x00001E88 + "\x00w\x03#\x00\x00\x1e\x89" + // 0x00770323: 0x00001E89 + "\x00X\x03\a\x00\x00\x1e\x8a" + // 0x00580307: 0x00001E8A + "\x00x\x03\a\x00\x00\x1e\x8b" + // 0x00780307: 0x00001E8B + "\x00X\x03\b\x00\x00\x1e\x8c" + // 0x00580308: 0x00001E8C + "\x00x\x03\b\x00\x00\x1e\x8d" + // 0x00780308: 0x00001E8D + "\x00Y\x03\a\x00\x00\x1e\x8e" + // 0x00590307: 0x00001E8E + "\x00y\x03\a\x00\x00\x1e\x8f" + // 0x00790307: 0x00001E8F + "\x00Z\x03\x02\x00\x00\x1e\x90" + // 0x005A0302: 0x00001E90 + "\x00z\x03\x02\x00\x00\x1e\x91" + // 0x007A0302: 0x00001E91 + "\x00Z\x03#\x00\x00\x1e\x92" + // 0x005A0323: 0x00001E92 + "\x00z\x03#\x00\x00\x1e\x93" + // 0x007A0323: 0x00001E93 + "\x00Z\x031\x00\x00\x1e\x94" + // 0x005A0331: 0x00001E94 + "\x00z\x031\x00\x00\x1e\x95" + // 0x007A0331: 0x00001E95 + "\x00h\x031\x00\x00\x1e\x96" + // 0x00680331: 0x00001E96 + "\x00t\x03\b\x00\x00\x1e\x97" + // 0x00740308: 0x00001E97 + "\x00w\x03\n\x00\x00\x1e\x98" + // 0x0077030A: 0x00001E98 + "\x00y\x03\n\x00\x00\x1e\x99" + // 0x0079030A: 0x00001E99 + "\x01\u007f\x03\a\x00\x00\x1e\x9b" + // 0x017F0307: 0x00001E9B + "\x00A\x03#\x00\x00\x1e\xa0" + // 0x00410323: 0x00001EA0 + "\x00a\x03#\x00\x00\x1e\xa1" + // 0x00610323: 0x00001EA1 + "\x00A\x03\t\x00\x00\x1e\xa2" + // 0x00410309: 0x00001EA2 + "\x00a\x03\t\x00\x00\x1e\xa3" + // 0x00610309: 0x00001EA3 + "\x00\xc2\x03\x01\x00\x00\x1e\xa4" + // 0x00C20301: 0x00001EA4 + "\x00\xe2\x03\x01\x00\x00\x1e\xa5" + // 0x00E20301: 0x00001EA5 + "\x00\xc2\x03\x00\x00\x00\x1e\xa6" + // 0x00C20300: 0x00001EA6 + "\x00\xe2\x03\x00\x00\x00\x1e\xa7" + // 0x00E20300: 0x00001EA7 + "\x00\xc2\x03\t\x00\x00\x1e\xa8" + // 0x00C20309: 0x00001EA8 + "\x00\xe2\x03\t\x00\x00\x1e\xa9" + // 0x00E20309: 0x00001EA9 + "\x00\xc2\x03\x03\x00\x00\x1e\xaa" + // 0x00C20303: 0x00001EAA + "\x00\xe2\x03\x03\x00\x00\x1e\xab" + // 0x00E20303: 0x00001EAB + "\x1e\xa0\x03\x02\x00\x00\x1e\xac" + // 0x1EA00302: 0x00001EAC + "\x1e\xa1\x03\x02\x00\x00\x1e\xad" + // 0x1EA10302: 0x00001EAD + "\x01\x02\x03\x01\x00\x00\x1e\xae" + // 0x01020301: 0x00001EAE + "\x01\x03\x03\x01\x00\x00\x1e\xaf" + // 0x01030301: 0x00001EAF + "\x01\x02\x03\x00\x00\x00\x1e\xb0" + // 0x01020300: 0x00001EB0 + "\x01\x03\x03\x00\x00\x00\x1e\xb1" + // 0x01030300: 0x00001EB1 + "\x01\x02\x03\t\x00\x00\x1e\xb2" + // 0x01020309: 0x00001EB2 + "\x01\x03\x03\t\x00\x00\x1e\xb3" + // 0x01030309: 0x00001EB3 + "\x01\x02\x03\x03\x00\x00\x1e\xb4" + // 0x01020303: 0x00001EB4 + "\x01\x03\x03\x03\x00\x00\x1e\xb5" + // 0x01030303: 0x00001EB5 + "\x1e\xa0\x03\x06\x00\x00\x1e\xb6" + // 0x1EA00306: 0x00001EB6 + "\x1e\xa1\x03\x06\x00\x00\x1e\xb7" + // 0x1EA10306: 0x00001EB7 + "\x00E\x03#\x00\x00\x1e\xb8" + // 0x00450323: 0x00001EB8 + "\x00e\x03#\x00\x00\x1e\xb9" + // 0x00650323: 0x00001EB9 + "\x00E\x03\t\x00\x00\x1e\xba" + // 0x00450309: 0x00001EBA + "\x00e\x03\t\x00\x00\x1e\xbb" + // 0x00650309: 0x00001EBB + "\x00E\x03\x03\x00\x00\x1e\xbc" + // 0x00450303: 0x00001EBC + "\x00e\x03\x03\x00\x00\x1e\xbd" + // 0x00650303: 0x00001EBD + "\x00\xca\x03\x01\x00\x00\x1e\xbe" + // 0x00CA0301: 0x00001EBE + "\x00\xea\x03\x01\x00\x00\x1e\xbf" + // 0x00EA0301: 0x00001EBF + "\x00\xca\x03\x00\x00\x00\x1e\xc0" + // 0x00CA0300: 0x00001EC0 + "\x00\xea\x03\x00\x00\x00\x1e\xc1" + // 0x00EA0300: 0x00001EC1 + "\x00\xca\x03\t\x00\x00\x1e\xc2" + // 0x00CA0309: 0x00001EC2 + "\x00\xea\x03\t\x00\x00\x1e\xc3" + // 0x00EA0309: 0x00001EC3 + "\x00\xca\x03\x03\x00\x00\x1e\xc4" + // 0x00CA0303: 0x00001EC4 + "\x00\xea\x03\x03\x00\x00\x1e\xc5" + // 0x00EA0303: 0x00001EC5 + "\x1e\xb8\x03\x02\x00\x00\x1e\xc6" + // 0x1EB80302: 0x00001EC6 + "\x1e\xb9\x03\x02\x00\x00\x1e\xc7" + // 0x1EB90302: 0x00001EC7 + "\x00I\x03\t\x00\x00\x1e\xc8" + // 0x00490309: 0x00001EC8 + "\x00i\x03\t\x00\x00\x1e\xc9" + // 0x00690309: 0x00001EC9 + "\x00I\x03#\x00\x00\x1e\xca" + // 0x00490323: 0x00001ECA + "\x00i\x03#\x00\x00\x1e\xcb" + // 0x00690323: 0x00001ECB + "\x00O\x03#\x00\x00\x1e\xcc" + // 0x004F0323: 0x00001ECC + "\x00o\x03#\x00\x00\x1e\xcd" + // 0x006F0323: 0x00001ECD + "\x00O\x03\t\x00\x00\x1e\xce" + // 0x004F0309: 0x00001ECE + "\x00o\x03\t\x00\x00\x1e\xcf" + // 0x006F0309: 0x00001ECF + "\x00\xd4\x03\x01\x00\x00\x1e\xd0" + // 0x00D40301: 0x00001ED0 + "\x00\xf4\x03\x01\x00\x00\x1e\xd1" + // 0x00F40301: 0x00001ED1 + "\x00\xd4\x03\x00\x00\x00\x1e\xd2" + // 0x00D40300: 0x00001ED2 + "\x00\xf4\x03\x00\x00\x00\x1e\xd3" + // 0x00F40300: 0x00001ED3 + "\x00\xd4\x03\t\x00\x00\x1e\xd4" + // 0x00D40309: 0x00001ED4 + "\x00\xf4\x03\t\x00\x00\x1e\xd5" + // 0x00F40309: 0x00001ED5 + "\x00\xd4\x03\x03\x00\x00\x1e\xd6" + // 0x00D40303: 0x00001ED6 + "\x00\xf4\x03\x03\x00\x00\x1e\xd7" + // 0x00F40303: 0x00001ED7 + "\x1e\xcc\x03\x02\x00\x00\x1e\xd8" + // 0x1ECC0302: 0x00001ED8 + "\x1e\xcd\x03\x02\x00\x00\x1e\xd9" + // 0x1ECD0302: 0x00001ED9 + "\x01\xa0\x03\x01\x00\x00\x1e\xda" + // 0x01A00301: 0x00001EDA + "\x01\xa1\x03\x01\x00\x00\x1e\xdb" + // 0x01A10301: 0x00001EDB + "\x01\xa0\x03\x00\x00\x00\x1e\xdc" + // 0x01A00300: 0x00001EDC + "\x01\xa1\x03\x00\x00\x00\x1e\xdd" + // 0x01A10300: 0x00001EDD + "\x01\xa0\x03\t\x00\x00\x1e\xde" + // 0x01A00309: 0x00001EDE + "\x01\xa1\x03\t\x00\x00\x1e\xdf" + // 0x01A10309: 0x00001EDF + "\x01\xa0\x03\x03\x00\x00\x1e\xe0" + // 0x01A00303: 0x00001EE0 + "\x01\xa1\x03\x03\x00\x00\x1e\xe1" + // 0x01A10303: 0x00001EE1 + "\x01\xa0\x03#\x00\x00\x1e\xe2" + // 0x01A00323: 0x00001EE2 + "\x01\xa1\x03#\x00\x00\x1e\xe3" + // 0x01A10323: 0x00001EE3 + "\x00U\x03#\x00\x00\x1e\xe4" + // 0x00550323: 0x00001EE4 + "\x00u\x03#\x00\x00\x1e\xe5" + // 0x00750323: 0x00001EE5 + "\x00U\x03\t\x00\x00\x1e\xe6" + // 0x00550309: 0x00001EE6 + "\x00u\x03\t\x00\x00\x1e\xe7" + // 0x00750309: 0x00001EE7 + "\x01\xaf\x03\x01\x00\x00\x1e\xe8" + // 0x01AF0301: 0x00001EE8 + "\x01\xb0\x03\x01\x00\x00\x1e\xe9" + // 0x01B00301: 0x00001EE9 + "\x01\xaf\x03\x00\x00\x00\x1e\xea" + // 0x01AF0300: 0x00001EEA + "\x01\xb0\x03\x00\x00\x00\x1e\xeb" + // 0x01B00300: 0x00001EEB + "\x01\xaf\x03\t\x00\x00\x1e\xec" + // 0x01AF0309: 0x00001EEC + "\x01\xb0\x03\t\x00\x00\x1e\xed" + // 0x01B00309: 0x00001EED + "\x01\xaf\x03\x03\x00\x00\x1e\xee" + // 0x01AF0303: 0x00001EEE + "\x01\xb0\x03\x03\x00\x00\x1e\xef" + // 0x01B00303: 0x00001EEF + "\x01\xaf\x03#\x00\x00\x1e\xf0" + // 0x01AF0323: 0x00001EF0 + "\x01\xb0\x03#\x00\x00\x1e\xf1" + // 0x01B00323: 0x00001EF1 + "\x00Y\x03\x00\x00\x00\x1e\xf2" + // 0x00590300: 0x00001EF2 + "\x00y\x03\x00\x00\x00\x1e\xf3" + // 0x00790300: 0x00001EF3 + "\x00Y\x03#\x00\x00\x1e\xf4" + // 0x00590323: 0x00001EF4 + "\x00y\x03#\x00\x00\x1e\xf5" + // 0x00790323: 0x00001EF5 + "\x00Y\x03\t\x00\x00\x1e\xf6" + // 0x00590309: 0x00001EF6 + "\x00y\x03\t\x00\x00\x1e\xf7" + // 0x00790309: 0x00001EF7 + "\x00Y\x03\x03\x00\x00\x1e\xf8" + // 0x00590303: 0x00001EF8 + "\x00y\x03\x03\x00\x00\x1e\xf9" + // 0x00790303: 0x00001EF9 + "\x03\xb1\x03\x13\x00\x00\x1f\x00" + // 0x03B10313: 0x00001F00 + "\x03\xb1\x03\x14\x00\x00\x1f\x01" + // 0x03B10314: 0x00001F01 + "\x1f\x00\x03\x00\x00\x00\x1f\x02" + // 0x1F000300: 0x00001F02 + "\x1f\x01\x03\x00\x00\x00\x1f\x03" + // 0x1F010300: 0x00001F03 + "\x1f\x00\x03\x01\x00\x00\x1f\x04" + // 0x1F000301: 0x00001F04 + "\x1f\x01\x03\x01\x00\x00\x1f\x05" + // 0x1F010301: 0x00001F05 + "\x1f\x00\x03B\x00\x00\x1f\x06" + // 0x1F000342: 0x00001F06 + "\x1f\x01\x03B\x00\x00\x1f\a" + // 0x1F010342: 0x00001F07 + "\x03\x91\x03\x13\x00\x00\x1f\b" + // 0x03910313: 0x00001F08 + "\x03\x91\x03\x14\x00\x00\x1f\t" + // 0x03910314: 0x00001F09 + "\x1f\b\x03\x00\x00\x00\x1f\n" + // 0x1F080300: 0x00001F0A + "\x1f\t\x03\x00\x00\x00\x1f\v" + // 0x1F090300: 0x00001F0B + "\x1f\b\x03\x01\x00\x00\x1f\f" + // 0x1F080301: 0x00001F0C + "\x1f\t\x03\x01\x00\x00\x1f\r" + // 0x1F090301: 0x00001F0D + "\x1f\b\x03B\x00\x00\x1f\x0e" + // 0x1F080342: 0x00001F0E + "\x1f\t\x03B\x00\x00\x1f\x0f" + // 0x1F090342: 0x00001F0F + "\x03\xb5\x03\x13\x00\x00\x1f\x10" + // 0x03B50313: 0x00001F10 + "\x03\xb5\x03\x14\x00\x00\x1f\x11" + // 0x03B50314: 0x00001F11 + "\x1f\x10\x03\x00\x00\x00\x1f\x12" + // 0x1F100300: 0x00001F12 + "\x1f\x11\x03\x00\x00\x00\x1f\x13" + // 0x1F110300: 0x00001F13 + "\x1f\x10\x03\x01\x00\x00\x1f\x14" + // 0x1F100301: 0x00001F14 + "\x1f\x11\x03\x01\x00\x00\x1f\x15" + // 0x1F110301: 0x00001F15 + "\x03\x95\x03\x13\x00\x00\x1f\x18" + // 0x03950313: 0x00001F18 + "\x03\x95\x03\x14\x00\x00\x1f\x19" + // 0x03950314: 0x00001F19 + "\x1f\x18\x03\x00\x00\x00\x1f\x1a" + // 0x1F180300: 0x00001F1A + "\x1f\x19\x03\x00\x00\x00\x1f\x1b" + // 0x1F190300: 0x00001F1B + "\x1f\x18\x03\x01\x00\x00\x1f\x1c" + // 0x1F180301: 0x00001F1C + "\x1f\x19\x03\x01\x00\x00\x1f\x1d" + // 0x1F190301: 0x00001F1D + "\x03\xb7\x03\x13\x00\x00\x1f " + // 0x03B70313: 0x00001F20 + "\x03\xb7\x03\x14\x00\x00\x1f!" + // 0x03B70314: 0x00001F21 + "\x1f \x03\x00\x00\x00\x1f\"" + // 0x1F200300: 0x00001F22 + "\x1f!\x03\x00\x00\x00\x1f#" + // 0x1F210300: 0x00001F23 + "\x1f \x03\x01\x00\x00\x1f$" + // 0x1F200301: 0x00001F24 + "\x1f!\x03\x01\x00\x00\x1f%" + // 0x1F210301: 0x00001F25 + "\x1f \x03B\x00\x00\x1f&" + // 0x1F200342: 0x00001F26 + "\x1f!\x03B\x00\x00\x1f'" + // 0x1F210342: 0x00001F27 + "\x03\x97\x03\x13\x00\x00\x1f(" + // 0x03970313: 0x00001F28 + "\x03\x97\x03\x14\x00\x00\x1f)" + // 0x03970314: 0x00001F29 + "\x1f(\x03\x00\x00\x00\x1f*" + // 0x1F280300: 0x00001F2A + "\x1f)\x03\x00\x00\x00\x1f+" + // 0x1F290300: 0x00001F2B + "\x1f(\x03\x01\x00\x00\x1f," + // 0x1F280301: 0x00001F2C + "\x1f)\x03\x01\x00\x00\x1f-" + // 0x1F290301: 0x00001F2D + "\x1f(\x03B\x00\x00\x1f." + // 0x1F280342: 0x00001F2E + "\x1f)\x03B\x00\x00\x1f/" + // 0x1F290342: 0x00001F2F + "\x03\xb9\x03\x13\x00\x00\x1f0" + // 0x03B90313: 0x00001F30 + "\x03\xb9\x03\x14\x00\x00\x1f1" + // 0x03B90314: 0x00001F31 + "\x1f0\x03\x00\x00\x00\x1f2" + // 0x1F300300: 0x00001F32 + "\x1f1\x03\x00\x00\x00\x1f3" + // 0x1F310300: 0x00001F33 + "\x1f0\x03\x01\x00\x00\x1f4" + // 0x1F300301: 0x00001F34 + "\x1f1\x03\x01\x00\x00\x1f5" + // 0x1F310301: 0x00001F35 + "\x1f0\x03B\x00\x00\x1f6" + // 0x1F300342: 0x00001F36 + "\x1f1\x03B\x00\x00\x1f7" + // 0x1F310342: 0x00001F37 + "\x03\x99\x03\x13\x00\x00\x1f8" + // 0x03990313: 0x00001F38 + "\x03\x99\x03\x14\x00\x00\x1f9" + // 0x03990314: 0x00001F39 + "\x1f8\x03\x00\x00\x00\x1f:" + // 0x1F380300: 0x00001F3A + "\x1f9\x03\x00\x00\x00\x1f;" + // 0x1F390300: 0x00001F3B + "\x1f8\x03\x01\x00\x00\x1f<" + // 0x1F380301: 0x00001F3C + "\x1f9\x03\x01\x00\x00\x1f=" + // 0x1F390301: 0x00001F3D + "\x1f8\x03B\x00\x00\x1f>" + // 0x1F380342: 0x00001F3E + "\x1f9\x03B\x00\x00\x1f?" + // 0x1F390342: 0x00001F3F + "\x03\xbf\x03\x13\x00\x00\x1f@" + // 0x03BF0313: 0x00001F40 + "\x03\xbf\x03\x14\x00\x00\x1fA" + // 0x03BF0314: 0x00001F41 + "\x1f@\x03\x00\x00\x00\x1fB" + // 0x1F400300: 0x00001F42 + "\x1fA\x03\x00\x00\x00\x1fC" + // 0x1F410300: 0x00001F43 + "\x1f@\x03\x01\x00\x00\x1fD" + // 0x1F400301: 0x00001F44 + "\x1fA\x03\x01\x00\x00\x1fE" + // 0x1F410301: 0x00001F45 + "\x03\x9f\x03\x13\x00\x00\x1fH" + // 0x039F0313: 0x00001F48 + "\x03\x9f\x03\x14\x00\x00\x1fI" + // 0x039F0314: 0x00001F49 + "\x1fH\x03\x00\x00\x00\x1fJ" + // 0x1F480300: 0x00001F4A + "\x1fI\x03\x00\x00\x00\x1fK" + // 0x1F490300: 0x00001F4B + "\x1fH\x03\x01\x00\x00\x1fL" + // 0x1F480301: 0x00001F4C + "\x1fI\x03\x01\x00\x00\x1fM" + // 0x1F490301: 0x00001F4D + "\x03\xc5\x03\x13\x00\x00\x1fP" + // 0x03C50313: 0x00001F50 + "\x03\xc5\x03\x14\x00\x00\x1fQ" + // 0x03C50314: 0x00001F51 + "\x1fP\x03\x00\x00\x00\x1fR" + // 0x1F500300: 0x00001F52 + "\x1fQ\x03\x00\x00\x00\x1fS" + // 0x1F510300: 0x00001F53 + "\x1fP\x03\x01\x00\x00\x1fT" + // 0x1F500301: 0x00001F54 + "\x1fQ\x03\x01\x00\x00\x1fU" + // 0x1F510301: 0x00001F55 + "\x1fP\x03B\x00\x00\x1fV" + // 0x1F500342: 0x00001F56 + "\x1fQ\x03B\x00\x00\x1fW" + // 0x1F510342: 0x00001F57 + "\x03\xa5\x03\x14\x00\x00\x1fY" + // 0x03A50314: 0x00001F59 + "\x1fY\x03\x00\x00\x00\x1f[" + // 0x1F590300: 0x00001F5B + "\x1fY\x03\x01\x00\x00\x1f]" + // 0x1F590301: 0x00001F5D + "\x1fY\x03B\x00\x00\x1f_" + // 0x1F590342: 0x00001F5F + "\x03\xc9\x03\x13\x00\x00\x1f`" + // 0x03C90313: 0x00001F60 + "\x03\xc9\x03\x14\x00\x00\x1fa" + // 0x03C90314: 0x00001F61 + "\x1f`\x03\x00\x00\x00\x1fb" + // 0x1F600300: 0x00001F62 + "\x1fa\x03\x00\x00\x00\x1fc" + // 0x1F610300: 0x00001F63 + "\x1f`\x03\x01\x00\x00\x1fd" + // 0x1F600301: 0x00001F64 + "\x1fa\x03\x01\x00\x00\x1fe" + // 0x1F610301: 0x00001F65 + "\x1f`\x03B\x00\x00\x1ff" + // 0x1F600342: 0x00001F66 + "\x1fa\x03B\x00\x00\x1fg" + // 0x1F610342: 0x00001F67 + "\x03\xa9\x03\x13\x00\x00\x1fh" + // 0x03A90313: 0x00001F68 + "\x03\xa9\x03\x14\x00\x00\x1fi" + // 0x03A90314: 0x00001F69 + "\x1fh\x03\x00\x00\x00\x1fj" + // 0x1F680300: 0x00001F6A + "\x1fi\x03\x00\x00\x00\x1fk" + // 0x1F690300: 0x00001F6B + "\x1fh\x03\x01\x00\x00\x1fl" + // 0x1F680301: 0x00001F6C + "\x1fi\x03\x01\x00\x00\x1fm" + // 0x1F690301: 0x00001F6D + "\x1fh\x03B\x00\x00\x1fn" + // 0x1F680342: 0x00001F6E + "\x1fi\x03B\x00\x00\x1fo" + // 0x1F690342: 0x00001F6F + "\x03\xb1\x03\x00\x00\x00\x1fp" + // 0x03B10300: 0x00001F70 + "\x03\xb5\x03\x00\x00\x00\x1fr" + // 0x03B50300: 0x00001F72 + "\x03\xb7\x03\x00\x00\x00\x1ft" + // 0x03B70300: 0x00001F74 + "\x03\xb9\x03\x00\x00\x00\x1fv" + // 0x03B90300: 0x00001F76 + "\x03\xbf\x03\x00\x00\x00\x1fx" + // 0x03BF0300: 0x00001F78 + "\x03\xc5\x03\x00\x00\x00\x1fz" + // 0x03C50300: 0x00001F7A + "\x03\xc9\x03\x00\x00\x00\x1f|" + // 0x03C90300: 0x00001F7C + "\x1f\x00\x03E\x00\x00\x1f\x80" + // 0x1F000345: 0x00001F80 + "\x1f\x01\x03E\x00\x00\x1f\x81" + // 0x1F010345: 0x00001F81 + "\x1f\x02\x03E\x00\x00\x1f\x82" + // 0x1F020345: 0x00001F82 + "\x1f\x03\x03E\x00\x00\x1f\x83" + // 0x1F030345: 0x00001F83 + "\x1f\x04\x03E\x00\x00\x1f\x84" + // 0x1F040345: 0x00001F84 + "\x1f\x05\x03E\x00\x00\x1f\x85" + // 0x1F050345: 0x00001F85 + "\x1f\x06\x03E\x00\x00\x1f\x86" + // 0x1F060345: 0x00001F86 + "\x1f\a\x03E\x00\x00\x1f\x87" + // 0x1F070345: 0x00001F87 + "\x1f\b\x03E\x00\x00\x1f\x88" + // 0x1F080345: 0x00001F88 + "\x1f\t\x03E\x00\x00\x1f\x89" + // 0x1F090345: 0x00001F89 + "\x1f\n\x03E\x00\x00\x1f\x8a" + // 0x1F0A0345: 0x00001F8A + "\x1f\v\x03E\x00\x00\x1f\x8b" + // 0x1F0B0345: 0x00001F8B + "\x1f\f\x03E\x00\x00\x1f\x8c" + // 0x1F0C0345: 0x00001F8C + "\x1f\r\x03E\x00\x00\x1f\x8d" + // 0x1F0D0345: 0x00001F8D + "\x1f\x0e\x03E\x00\x00\x1f\x8e" + // 0x1F0E0345: 0x00001F8E + "\x1f\x0f\x03E\x00\x00\x1f\x8f" + // 0x1F0F0345: 0x00001F8F + "\x1f \x03E\x00\x00\x1f\x90" + // 0x1F200345: 0x00001F90 + "\x1f!\x03E\x00\x00\x1f\x91" + // 0x1F210345: 0x00001F91 + "\x1f\"\x03E\x00\x00\x1f\x92" + // 0x1F220345: 0x00001F92 + "\x1f#\x03E\x00\x00\x1f\x93" + // 0x1F230345: 0x00001F93 + "\x1f$\x03E\x00\x00\x1f\x94" + // 0x1F240345: 0x00001F94 + "\x1f%\x03E\x00\x00\x1f\x95" + // 0x1F250345: 0x00001F95 + "\x1f&\x03E\x00\x00\x1f\x96" + // 0x1F260345: 0x00001F96 + "\x1f'\x03E\x00\x00\x1f\x97" + // 0x1F270345: 0x00001F97 + "\x1f(\x03E\x00\x00\x1f\x98" + // 0x1F280345: 0x00001F98 + "\x1f)\x03E\x00\x00\x1f\x99" + // 0x1F290345: 0x00001F99 + "\x1f*\x03E\x00\x00\x1f\x9a" + // 0x1F2A0345: 0x00001F9A + "\x1f+\x03E\x00\x00\x1f\x9b" + // 0x1F2B0345: 0x00001F9B + "\x1f,\x03E\x00\x00\x1f\x9c" + // 0x1F2C0345: 0x00001F9C + "\x1f-\x03E\x00\x00\x1f\x9d" + // 0x1F2D0345: 0x00001F9D + "\x1f.\x03E\x00\x00\x1f\x9e" + // 0x1F2E0345: 0x00001F9E + "\x1f/\x03E\x00\x00\x1f\x9f" + // 0x1F2F0345: 0x00001F9F + "\x1f`\x03E\x00\x00\x1f\xa0" + // 0x1F600345: 0x00001FA0 + "\x1fa\x03E\x00\x00\x1f\xa1" + // 0x1F610345: 0x00001FA1 + "\x1fb\x03E\x00\x00\x1f\xa2" + // 0x1F620345: 0x00001FA2 + "\x1fc\x03E\x00\x00\x1f\xa3" + // 0x1F630345: 0x00001FA3 + "\x1fd\x03E\x00\x00\x1f\xa4" + // 0x1F640345: 0x00001FA4 + "\x1fe\x03E\x00\x00\x1f\xa5" + // 0x1F650345: 0x00001FA5 + "\x1ff\x03E\x00\x00\x1f\xa6" + // 0x1F660345: 0x00001FA6 + "\x1fg\x03E\x00\x00\x1f\xa7" + // 0x1F670345: 0x00001FA7 + "\x1fh\x03E\x00\x00\x1f\xa8" + // 0x1F680345: 0x00001FA8 + "\x1fi\x03E\x00\x00\x1f\xa9" + // 0x1F690345: 0x00001FA9 + "\x1fj\x03E\x00\x00\x1f\xaa" + // 0x1F6A0345: 0x00001FAA + "\x1fk\x03E\x00\x00\x1f\xab" + // 0x1F6B0345: 0x00001FAB + "\x1fl\x03E\x00\x00\x1f\xac" + // 0x1F6C0345: 0x00001FAC + "\x1fm\x03E\x00\x00\x1f\xad" + // 0x1F6D0345: 0x00001FAD + "\x1fn\x03E\x00\x00\x1f\xae" + // 0x1F6E0345: 0x00001FAE + "\x1fo\x03E\x00\x00\x1f\xaf" + // 0x1F6F0345: 0x00001FAF + "\x03\xb1\x03\x06\x00\x00\x1f\xb0" + // 0x03B10306: 0x00001FB0 + "\x03\xb1\x03\x04\x00\x00\x1f\xb1" + // 0x03B10304: 0x00001FB1 + "\x1fp\x03E\x00\x00\x1f\xb2" + // 0x1F700345: 0x00001FB2 + "\x03\xb1\x03E\x00\x00\x1f\xb3" + // 0x03B10345: 0x00001FB3 + "\x03\xac\x03E\x00\x00\x1f\xb4" + // 0x03AC0345: 0x00001FB4 + "\x03\xb1\x03B\x00\x00\x1f\xb6" + // 0x03B10342: 0x00001FB6 + "\x1f\xb6\x03E\x00\x00\x1f\xb7" + // 0x1FB60345: 0x00001FB7 + "\x03\x91\x03\x06\x00\x00\x1f\xb8" + // 0x03910306: 0x00001FB8 + "\x03\x91\x03\x04\x00\x00\x1f\xb9" + // 0x03910304: 0x00001FB9 + "\x03\x91\x03\x00\x00\x00\x1f\xba" + // 0x03910300: 0x00001FBA + "\x03\x91\x03E\x00\x00\x1f\xbc" + // 0x03910345: 0x00001FBC + "\x00\xa8\x03B\x00\x00\x1f\xc1" + // 0x00A80342: 0x00001FC1 + "\x1ft\x03E\x00\x00\x1f\xc2" + // 0x1F740345: 0x00001FC2 + "\x03\xb7\x03E\x00\x00\x1f\xc3" + // 0x03B70345: 0x00001FC3 + "\x03\xae\x03E\x00\x00\x1f\xc4" + // 0x03AE0345: 0x00001FC4 + "\x03\xb7\x03B\x00\x00\x1f\xc6" + // 0x03B70342: 0x00001FC6 + "\x1f\xc6\x03E\x00\x00\x1f\xc7" + // 0x1FC60345: 0x00001FC7 + "\x03\x95\x03\x00\x00\x00\x1f\xc8" + // 0x03950300: 0x00001FC8 + "\x03\x97\x03\x00\x00\x00\x1f\xca" + // 0x03970300: 0x00001FCA + "\x03\x97\x03E\x00\x00\x1f\xcc" + // 0x03970345: 0x00001FCC + "\x1f\xbf\x03\x00\x00\x00\x1f\xcd" + // 0x1FBF0300: 0x00001FCD + "\x1f\xbf\x03\x01\x00\x00\x1f\xce" + // 0x1FBF0301: 0x00001FCE + "\x1f\xbf\x03B\x00\x00\x1f\xcf" + // 0x1FBF0342: 0x00001FCF + "\x03\xb9\x03\x06\x00\x00\x1f\xd0" + // 0x03B90306: 0x00001FD0 + "\x03\xb9\x03\x04\x00\x00\x1f\xd1" + // 0x03B90304: 0x00001FD1 + "\x03\xca\x03\x00\x00\x00\x1f\xd2" + // 0x03CA0300: 0x00001FD2 + "\x03\xb9\x03B\x00\x00\x1f\xd6" + // 0x03B90342: 0x00001FD6 + "\x03\xca\x03B\x00\x00\x1f\xd7" + // 0x03CA0342: 0x00001FD7 + "\x03\x99\x03\x06\x00\x00\x1f\xd8" + // 0x03990306: 0x00001FD8 + "\x03\x99\x03\x04\x00\x00\x1f\xd9" + // 0x03990304: 0x00001FD9 + "\x03\x99\x03\x00\x00\x00\x1f\xda" + // 0x03990300: 0x00001FDA + "\x1f\xfe\x03\x00\x00\x00\x1f\xdd" + // 0x1FFE0300: 0x00001FDD + "\x1f\xfe\x03\x01\x00\x00\x1f\xde" + // 0x1FFE0301: 0x00001FDE + "\x1f\xfe\x03B\x00\x00\x1f\xdf" + // 0x1FFE0342: 0x00001FDF + "\x03\xc5\x03\x06\x00\x00\x1f\xe0" + // 0x03C50306: 0x00001FE0 + "\x03\xc5\x03\x04\x00\x00\x1f\xe1" + // 0x03C50304: 0x00001FE1 + "\x03\xcb\x03\x00\x00\x00\x1f\xe2" + // 0x03CB0300: 0x00001FE2 + "\x03\xc1\x03\x13\x00\x00\x1f\xe4" + // 0x03C10313: 0x00001FE4 + "\x03\xc1\x03\x14\x00\x00\x1f\xe5" + // 0x03C10314: 0x00001FE5 + "\x03\xc5\x03B\x00\x00\x1f\xe6" + // 0x03C50342: 0x00001FE6 + "\x03\xcb\x03B\x00\x00\x1f\xe7" + // 0x03CB0342: 0x00001FE7 + "\x03\xa5\x03\x06\x00\x00\x1f\xe8" + // 0x03A50306: 0x00001FE8 + "\x03\xa5\x03\x04\x00\x00\x1f\xe9" + // 0x03A50304: 0x00001FE9 + "\x03\xa5\x03\x00\x00\x00\x1f\xea" + // 0x03A50300: 0x00001FEA + "\x03\xa1\x03\x14\x00\x00\x1f\xec" + // 0x03A10314: 0x00001FEC + "\x00\xa8\x03\x00\x00\x00\x1f\xed" + // 0x00A80300: 0x00001FED + "\x1f|\x03E\x00\x00\x1f\xf2" + // 0x1F7C0345: 0x00001FF2 + "\x03\xc9\x03E\x00\x00\x1f\xf3" + // 0x03C90345: 0x00001FF3 + "\x03\xce\x03E\x00\x00\x1f\xf4" + // 0x03CE0345: 0x00001FF4 + "\x03\xc9\x03B\x00\x00\x1f\xf6" + // 0x03C90342: 0x00001FF6 + "\x1f\xf6\x03E\x00\x00\x1f\xf7" + // 0x1FF60345: 0x00001FF7 + "\x03\x9f\x03\x00\x00\x00\x1f\xf8" + // 0x039F0300: 0x00001FF8 + "\x03\xa9\x03\x00\x00\x00\x1f\xfa" + // 0x03A90300: 0x00001FFA + "\x03\xa9\x03E\x00\x00\x1f\xfc" + // 0x03A90345: 0x00001FFC + "!\x90\x038\x00\x00!\x9a" + // 0x21900338: 0x0000219A + "!\x92\x038\x00\x00!\x9b" + // 0x21920338: 0x0000219B + "!\x94\x038\x00\x00!\xae" + // 0x21940338: 0x000021AE + "!\xd0\x038\x00\x00!\xcd" + // 0x21D00338: 0x000021CD + "!\xd4\x038\x00\x00!\xce" + // 0x21D40338: 0x000021CE + "!\xd2\x038\x00\x00!\xcf" + // 0x21D20338: 0x000021CF + "\"\x03\x038\x00\x00\"\x04" + // 0x22030338: 0x00002204 + "\"\b\x038\x00\x00\"\t" + // 0x22080338: 0x00002209 + "\"\v\x038\x00\x00\"\f" + // 0x220B0338: 0x0000220C + "\"#\x038\x00\x00\"$" + // 0x22230338: 0x00002224 + "\"%\x038\x00\x00\"&" + // 0x22250338: 0x00002226 + "\"<\x038\x00\x00\"A" + // 0x223C0338: 0x00002241 + "\"C\x038\x00\x00\"D" + // 0x22430338: 0x00002244 + "\"E\x038\x00\x00\"G" + // 0x22450338: 0x00002247 + "\"H\x038\x00\x00\"I" + // 0x22480338: 0x00002249 + "\x00=\x038\x00\x00\"`" + // 0x003D0338: 0x00002260 + "\"a\x038\x00\x00\"b" + // 0x22610338: 0x00002262 + "\"M\x038\x00\x00\"m" + // 0x224D0338: 0x0000226D + "\x00<\x038\x00\x00\"n" + // 0x003C0338: 0x0000226E + "\x00>\x038\x00\x00\"o" + // 0x003E0338: 0x0000226F + "\"d\x038\x00\x00\"p" + // 0x22640338: 0x00002270 + "\"e\x038\x00\x00\"q" + // 0x22650338: 0x00002271 + "\"r\x038\x00\x00\"t" + // 0x22720338: 0x00002274 + "\"s\x038\x00\x00\"u" + // 0x22730338: 0x00002275 + "\"v\x038\x00\x00\"x" + // 0x22760338: 0x00002278 + "\"w\x038\x00\x00\"y" + // 0x22770338: 0x00002279 + "\"z\x038\x00\x00\"\x80" + // 0x227A0338: 0x00002280 + "\"{\x038\x00\x00\"\x81" + // 0x227B0338: 0x00002281 + "\"\x82\x038\x00\x00\"\x84" + // 0x22820338: 0x00002284 + "\"\x83\x038\x00\x00\"\x85" + // 0x22830338: 0x00002285 + "\"\x86\x038\x00\x00\"\x88" + // 0x22860338: 0x00002288 + "\"\x87\x038\x00\x00\"\x89" + // 0x22870338: 0x00002289 + "\"\xa2\x038\x00\x00\"\xac" + // 0x22A20338: 0x000022AC + "\"\xa8\x038\x00\x00\"\xad" + // 0x22A80338: 0x000022AD + "\"\xa9\x038\x00\x00\"\xae" + // 0x22A90338: 0x000022AE + "\"\xab\x038\x00\x00\"\xaf" + // 0x22AB0338: 0x000022AF + "\"|\x038\x00\x00\"\xe0" + // 0x227C0338: 0x000022E0 + "\"}\x038\x00\x00\"\xe1" + // 0x227D0338: 0x000022E1 + "\"\x91\x038\x00\x00\"\xe2" + // 0x22910338: 0x000022E2 + "\"\x92\x038\x00\x00\"\xe3" + // 0x22920338: 0x000022E3 + "\"\xb2\x038\x00\x00\"\xea" + // 0x22B20338: 0x000022EA + "\"\xb3\x038\x00\x00\"\xeb" + // 0x22B30338: 0x000022EB + "\"\xb4\x038\x00\x00\"\xec" + // 0x22B40338: 0x000022EC + "\"\xb5\x038\x00\x00\"\xed" + // 0x22B50338: 0x000022ED + "0K0\x99\x00\x000L" + // 0x304B3099: 0x0000304C + "0M0\x99\x00\x000N" + // 0x304D3099: 0x0000304E + "0O0\x99\x00\x000P" + // 0x304F3099: 0x00003050 + "0Q0\x99\x00\x000R" + // 0x30513099: 0x00003052 + "0S0\x99\x00\x000T" + // 0x30533099: 0x00003054 + "0U0\x99\x00\x000V" + // 0x30553099: 0x00003056 + "0W0\x99\x00\x000X" + // 0x30573099: 0x00003058 + "0Y0\x99\x00\x000Z" + // 0x30593099: 0x0000305A + "0[0\x99\x00\x000\\" + // 0x305B3099: 0x0000305C + "0]0\x99\x00\x000^" + // 0x305D3099: 0x0000305E + "0_0\x99\x00\x000`" + // 0x305F3099: 0x00003060 + "0a0\x99\x00\x000b" + // 0x30613099: 0x00003062 + "0d0\x99\x00\x000e" + // 0x30643099: 0x00003065 + "0f0\x99\x00\x000g" + // 0x30663099: 0x00003067 + "0h0\x99\x00\x000i" + // 0x30683099: 0x00003069 + "0o0\x99\x00\x000p" + // 0x306F3099: 0x00003070 + "0o0\x9a\x00\x000q" + // 0x306F309A: 0x00003071 + "0r0\x99\x00\x000s" + // 0x30723099: 0x00003073 + "0r0\x9a\x00\x000t" + // 0x3072309A: 0x00003074 + "0u0\x99\x00\x000v" + // 0x30753099: 0x00003076 + "0u0\x9a\x00\x000w" + // 0x3075309A: 0x00003077 + "0x0\x99\x00\x000y" + // 0x30783099: 0x00003079 + "0x0\x9a\x00\x000z" + // 0x3078309A: 0x0000307A + "0{0\x99\x00\x000|" + // 0x307B3099: 0x0000307C + "0{0\x9a\x00\x000}" + // 0x307B309A: 0x0000307D + "0F0\x99\x00\x000\x94" + // 0x30463099: 0x00003094 + "0\x9d0\x99\x00\x000\x9e" + // 0x309D3099: 0x0000309E + "0\xab0\x99\x00\x000\xac" + // 0x30AB3099: 0x000030AC + "0\xad0\x99\x00\x000\xae" + // 0x30AD3099: 0x000030AE + "0\xaf0\x99\x00\x000\xb0" + // 0x30AF3099: 0x000030B0 + "0\xb10\x99\x00\x000\xb2" + // 0x30B13099: 0x000030B2 + "0\xb30\x99\x00\x000\xb4" + // 0x30B33099: 0x000030B4 + "0\xb50\x99\x00\x000\xb6" + // 0x30B53099: 0x000030B6 + "0\xb70\x99\x00\x000\xb8" + // 0x30B73099: 0x000030B8 + "0\xb90\x99\x00\x000\xba" + // 0x30B93099: 0x000030BA + "0\xbb0\x99\x00\x000\xbc" + // 0x30BB3099: 0x000030BC + "0\xbd0\x99\x00\x000\xbe" + // 0x30BD3099: 0x000030BE + "0\xbf0\x99\x00\x000\xc0" + // 0x30BF3099: 0x000030C0 + "0\xc10\x99\x00\x000\xc2" + // 0x30C13099: 0x000030C2 + "0\xc40\x99\x00\x000\xc5" + // 0x30C43099: 0x000030C5 + "0\xc60\x99\x00\x000\xc7" + // 0x30C63099: 0x000030C7 + "0\xc80\x99\x00\x000\xc9" + // 0x30C83099: 0x000030C9 + "0\xcf0\x99\x00\x000\xd0" + // 0x30CF3099: 0x000030D0 + "0\xcf0\x9a\x00\x000\xd1" + // 0x30CF309A: 0x000030D1 + "0\xd20\x99\x00\x000\xd3" + // 0x30D23099: 0x000030D3 + "0\xd20\x9a\x00\x000\xd4" + // 0x30D2309A: 0x000030D4 + "0\xd50\x99\x00\x000\xd6" + // 0x30D53099: 0x000030D6 + "0\xd50\x9a\x00\x000\xd7" + // 0x30D5309A: 0x000030D7 + "0\xd80\x99\x00\x000\xd9" + // 0x30D83099: 0x000030D9 + "0\xd80\x9a\x00\x000\xda" + // 0x30D8309A: 0x000030DA + "0\xdb0\x99\x00\x000\xdc" + // 0x30DB3099: 0x000030DC + "0\xdb0\x9a\x00\x000\xdd" + // 0x30DB309A: 0x000030DD + "0\xa60\x99\x00\x000\xf4" + // 0x30A63099: 0x000030F4 + "0\xef0\x99\x00\x000\xf7" + // 0x30EF3099: 0x000030F7 + "0\xf00\x99\x00\x000\xf8" + // 0x30F03099: 0x000030F8 + "0\xf10\x99\x00\x000\xf9" + // 0x30F13099: 0x000030F9 + "0\xf20\x99\x00\x000\xfa" + // 0x30F23099: 0x000030FA + "0\xfd0\x99\x00\x000\xfe" + // 0x30FD3099: 0x000030FE + "\x10\x99\x10\xba\x00\x01\x10\x9a" + // 0x109910BA: 0x0001109A + "\x10\x9b\x10\xba\x00\x01\x10\x9c" + // 0x109B10BA: 0x0001109C + "\x10\xa5\x10\xba\x00\x01\x10\xab" + // 0x10A510BA: 0x000110AB + "\x111\x11'\x00\x01\x11." + // 0x11311127: 0x0001112E + "\x112\x11'\x00\x01\x11/" + // 0x11321127: 0x0001112F + "\x13G\x13>\x00\x01\x13K" + // 0x1347133E: 0x0001134B + "\x13G\x13W\x00\x01\x13L" + // 0x13471357: 0x0001134C + "\x14\xb9\x14\xba\x00\x01\x14\xbb" + // 0x14B914BA: 0x000114BB + "\x14\xb9\x14\xb0\x00\x01\x14\xbc" + // 0x14B914B0: 0x000114BC + "\x14\xb9\x14\xbd\x00\x01\x14\xbe" + // 0x14B914BD: 0x000114BE + "\x15\xb8\x15\xaf\x00\x01\x15\xba" + // 0x15B815AF: 0x000115BA + "\x15\xb9\x15\xaf\x00\x01\x15\xbb" + // 0x15B915AF: 0x000115BB + "" + // Total size of tables: 53KB (54226 bytes) diff --git a/vendor/golang.org/x/text/unicode/norm/tables11.0.0.go b/vendor/golang.org/x/text/unicode/norm/tables11.0.0.go new file mode 100644 index 00000000..7297cce3 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/norm/tables11.0.0.go @@ -0,0 +1,7693 @@ +// Code generated by running "go generate" in golang.org/x/text. DO NOT EDIT. + +// +build go1.13 + +package norm + +import "sync" + +const ( + // Version is the Unicode edition from which the tables are derived. + Version = "11.0.0" + + // MaxTransformChunkSize indicates the maximum number of bytes that Transform + // may need to write atomically for any Form. Making a destination buffer at + // least this size ensures that Transform can always make progress and that + // the user does not need to grow the buffer on an ErrShortDst. + MaxTransformChunkSize = 35 + maxNonStarters*4 +) + +var ccc = [55]uint8{ + 0, 1, 7, 8, 9, 10, 11, 12, + 13, 14, 15, 16, 17, 18, 19, 20, + 21, 22, 23, 24, 25, 26, 27, 28, + 29, 30, 31, 32, 33, 34, 35, 36, + 84, 91, 103, 107, 118, 122, 129, 130, + 132, 202, 214, 216, 218, 220, 222, 224, + 226, 228, 230, 232, 233, 234, 240, +} + +const ( + firstMulti = 0x186D + firstCCC = 0x2C9E + endMulti = 0x2F60 + firstLeadingCCC = 0x49AE + firstCCCZeroExcept = 0x4A78 + firstStarterWithNLead = 0x4A9F + lastDecomp = 0x4AA1 + maxDecomp = 0x8000 +) + +// decomps: 19105 bytes +var decomps = [...]byte{ + // Bytes 0 - 3f + 0x00, 0x41, 0x20, 0x41, 0x21, 0x41, 0x22, 0x41, + 0x23, 0x41, 0x24, 0x41, 0x25, 0x41, 0x26, 0x41, + 0x27, 0x41, 0x28, 0x41, 0x29, 0x41, 0x2A, 0x41, + 0x2B, 0x41, 0x2C, 0x41, 0x2D, 0x41, 0x2E, 0x41, + 0x2F, 0x41, 0x30, 0x41, 0x31, 0x41, 0x32, 0x41, + 0x33, 0x41, 0x34, 0x41, 0x35, 0x41, 0x36, 0x41, + 0x37, 0x41, 0x38, 0x41, 0x39, 0x41, 0x3A, 0x41, + 0x3B, 0x41, 0x3C, 0x41, 0x3D, 0x41, 0x3E, 0x41, + // Bytes 40 - 7f + 0x3F, 0x41, 0x40, 0x41, 0x41, 0x41, 0x42, 0x41, + 0x43, 0x41, 0x44, 0x41, 0x45, 0x41, 0x46, 0x41, + 0x47, 0x41, 0x48, 0x41, 0x49, 0x41, 0x4A, 0x41, + 0x4B, 0x41, 0x4C, 0x41, 0x4D, 0x41, 0x4E, 0x41, + 0x4F, 0x41, 0x50, 0x41, 0x51, 0x41, 0x52, 0x41, + 0x53, 0x41, 0x54, 0x41, 0x55, 0x41, 0x56, 0x41, + 0x57, 0x41, 0x58, 0x41, 0x59, 0x41, 0x5A, 0x41, + 0x5B, 0x41, 0x5C, 0x41, 0x5D, 0x41, 0x5E, 0x41, + // Bytes 80 - bf + 0x5F, 0x41, 0x60, 0x41, 0x61, 0x41, 0x62, 0x41, + 0x63, 0x41, 0x64, 0x41, 0x65, 0x41, 0x66, 0x41, + 0x67, 0x41, 0x68, 0x41, 0x69, 0x41, 0x6A, 0x41, + 0x6B, 0x41, 0x6C, 0x41, 0x6D, 0x41, 0x6E, 0x41, + 0x6F, 0x41, 0x70, 0x41, 0x71, 0x41, 0x72, 0x41, + 0x73, 0x41, 0x74, 0x41, 0x75, 0x41, 0x76, 0x41, + 0x77, 0x41, 0x78, 0x41, 0x79, 0x41, 0x7A, 0x41, + 0x7B, 0x41, 0x7C, 0x41, 0x7D, 0x41, 0x7E, 0x42, + // Bytes c0 - ff + 0xC2, 0xA2, 0x42, 0xC2, 0xA3, 0x42, 0xC2, 0xA5, + 0x42, 0xC2, 0xA6, 0x42, 0xC2, 0xAC, 0x42, 0xC2, + 0xB7, 0x42, 0xC3, 0x86, 0x42, 0xC3, 0xB0, 0x42, + 0xC4, 0xA6, 0x42, 0xC4, 0xA7, 0x42, 0xC4, 0xB1, + 0x42, 0xC5, 0x8B, 0x42, 0xC5, 0x93, 0x42, 0xC6, + 0x8E, 0x42, 0xC6, 0x90, 0x42, 0xC6, 0xAB, 0x42, + 0xC8, 0xA2, 0x42, 0xC8, 0xB7, 0x42, 0xC9, 0x90, + 0x42, 0xC9, 0x91, 0x42, 0xC9, 0x92, 0x42, 0xC9, + // Bytes 100 - 13f + 0x94, 0x42, 0xC9, 0x95, 0x42, 0xC9, 0x99, 0x42, + 0xC9, 0x9B, 0x42, 0xC9, 0x9C, 0x42, 0xC9, 0x9F, + 0x42, 0xC9, 0xA1, 0x42, 0xC9, 0xA3, 0x42, 0xC9, + 0xA5, 0x42, 0xC9, 0xA6, 0x42, 0xC9, 0xA8, 0x42, + 0xC9, 0xA9, 0x42, 0xC9, 0xAA, 0x42, 0xC9, 0xAB, + 0x42, 0xC9, 0xAD, 0x42, 0xC9, 0xAF, 0x42, 0xC9, + 0xB0, 0x42, 0xC9, 0xB1, 0x42, 0xC9, 0xB2, 0x42, + 0xC9, 0xB3, 0x42, 0xC9, 0xB4, 0x42, 0xC9, 0xB5, + // Bytes 140 - 17f + 0x42, 0xC9, 0xB8, 0x42, 0xC9, 0xB9, 0x42, 0xC9, + 0xBB, 0x42, 0xCA, 0x81, 0x42, 0xCA, 0x82, 0x42, + 0xCA, 0x83, 0x42, 0xCA, 0x89, 0x42, 0xCA, 0x8A, + 0x42, 0xCA, 0x8B, 0x42, 0xCA, 0x8C, 0x42, 0xCA, + 0x90, 0x42, 0xCA, 0x91, 0x42, 0xCA, 0x92, 0x42, + 0xCA, 0x95, 0x42, 0xCA, 0x9D, 0x42, 0xCA, 0x9F, + 0x42, 0xCA, 0xB9, 0x42, 0xCE, 0x91, 0x42, 0xCE, + 0x92, 0x42, 0xCE, 0x93, 0x42, 0xCE, 0x94, 0x42, + // Bytes 180 - 1bf + 0xCE, 0x95, 0x42, 0xCE, 0x96, 0x42, 0xCE, 0x97, + 0x42, 0xCE, 0x98, 0x42, 0xCE, 0x99, 0x42, 0xCE, + 0x9A, 0x42, 0xCE, 0x9B, 0x42, 0xCE, 0x9C, 0x42, + 0xCE, 0x9D, 0x42, 0xCE, 0x9E, 0x42, 0xCE, 0x9F, + 0x42, 0xCE, 0xA0, 0x42, 0xCE, 0xA1, 0x42, 0xCE, + 0xA3, 0x42, 0xCE, 0xA4, 0x42, 0xCE, 0xA5, 0x42, + 0xCE, 0xA6, 0x42, 0xCE, 0xA7, 0x42, 0xCE, 0xA8, + 0x42, 0xCE, 0xA9, 0x42, 0xCE, 0xB1, 0x42, 0xCE, + // Bytes 1c0 - 1ff + 0xB2, 0x42, 0xCE, 0xB3, 0x42, 0xCE, 0xB4, 0x42, + 0xCE, 0xB5, 0x42, 0xCE, 0xB6, 0x42, 0xCE, 0xB7, + 0x42, 0xCE, 0xB8, 0x42, 0xCE, 0xB9, 0x42, 0xCE, + 0xBA, 0x42, 0xCE, 0xBB, 0x42, 0xCE, 0xBC, 0x42, + 0xCE, 0xBD, 0x42, 0xCE, 0xBE, 0x42, 0xCE, 0xBF, + 0x42, 0xCF, 0x80, 0x42, 0xCF, 0x81, 0x42, 0xCF, + 0x82, 0x42, 0xCF, 0x83, 0x42, 0xCF, 0x84, 0x42, + 0xCF, 0x85, 0x42, 0xCF, 0x86, 0x42, 0xCF, 0x87, + // Bytes 200 - 23f + 0x42, 0xCF, 0x88, 0x42, 0xCF, 0x89, 0x42, 0xCF, + 0x9C, 0x42, 0xCF, 0x9D, 0x42, 0xD0, 0xBD, 0x42, + 0xD1, 0x8A, 0x42, 0xD1, 0x8C, 0x42, 0xD7, 0x90, + 0x42, 0xD7, 0x91, 0x42, 0xD7, 0x92, 0x42, 0xD7, + 0x93, 0x42, 0xD7, 0x94, 0x42, 0xD7, 0x9B, 0x42, + 0xD7, 0x9C, 0x42, 0xD7, 0x9D, 0x42, 0xD7, 0xA2, + 0x42, 0xD7, 0xA8, 0x42, 0xD7, 0xAA, 0x42, 0xD8, + 0xA1, 0x42, 0xD8, 0xA7, 0x42, 0xD8, 0xA8, 0x42, + // Bytes 240 - 27f + 0xD8, 0xA9, 0x42, 0xD8, 0xAA, 0x42, 0xD8, 0xAB, + 0x42, 0xD8, 0xAC, 0x42, 0xD8, 0xAD, 0x42, 0xD8, + 0xAE, 0x42, 0xD8, 0xAF, 0x42, 0xD8, 0xB0, 0x42, + 0xD8, 0xB1, 0x42, 0xD8, 0xB2, 0x42, 0xD8, 0xB3, + 0x42, 0xD8, 0xB4, 0x42, 0xD8, 0xB5, 0x42, 0xD8, + 0xB6, 0x42, 0xD8, 0xB7, 0x42, 0xD8, 0xB8, 0x42, + 0xD8, 0xB9, 0x42, 0xD8, 0xBA, 0x42, 0xD9, 0x81, + 0x42, 0xD9, 0x82, 0x42, 0xD9, 0x83, 0x42, 0xD9, + // Bytes 280 - 2bf + 0x84, 0x42, 0xD9, 0x85, 0x42, 0xD9, 0x86, 0x42, + 0xD9, 0x87, 0x42, 0xD9, 0x88, 0x42, 0xD9, 0x89, + 0x42, 0xD9, 0x8A, 0x42, 0xD9, 0xAE, 0x42, 0xD9, + 0xAF, 0x42, 0xD9, 0xB1, 0x42, 0xD9, 0xB9, 0x42, + 0xD9, 0xBA, 0x42, 0xD9, 0xBB, 0x42, 0xD9, 0xBE, + 0x42, 0xD9, 0xBF, 0x42, 0xDA, 0x80, 0x42, 0xDA, + 0x83, 0x42, 0xDA, 0x84, 0x42, 0xDA, 0x86, 0x42, + 0xDA, 0x87, 0x42, 0xDA, 0x88, 0x42, 0xDA, 0x8C, + // Bytes 2c0 - 2ff + 0x42, 0xDA, 0x8D, 0x42, 0xDA, 0x8E, 0x42, 0xDA, + 0x91, 0x42, 0xDA, 0x98, 0x42, 0xDA, 0xA1, 0x42, + 0xDA, 0xA4, 0x42, 0xDA, 0xA6, 0x42, 0xDA, 0xA9, + 0x42, 0xDA, 0xAD, 0x42, 0xDA, 0xAF, 0x42, 0xDA, + 0xB1, 0x42, 0xDA, 0xB3, 0x42, 0xDA, 0xBA, 0x42, + 0xDA, 0xBB, 0x42, 0xDA, 0xBE, 0x42, 0xDB, 0x81, + 0x42, 0xDB, 0x85, 0x42, 0xDB, 0x86, 0x42, 0xDB, + 0x87, 0x42, 0xDB, 0x88, 0x42, 0xDB, 0x89, 0x42, + // Bytes 300 - 33f + 0xDB, 0x8B, 0x42, 0xDB, 0x8C, 0x42, 0xDB, 0x90, + 0x42, 0xDB, 0x92, 0x43, 0xE0, 0xBC, 0x8B, 0x43, + 0xE1, 0x83, 0x9C, 0x43, 0xE1, 0x84, 0x80, 0x43, + 0xE1, 0x84, 0x81, 0x43, 0xE1, 0x84, 0x82, 0x43, + 0xE1, 0x84, 0x83, 0x43, 0xE1, 0x84, 0x84, 0x43, + 0xE1, 0x84, 0x85, 0x43, 0xE1, 0x84, 0x86, 0x43, + 0xE1, 0x84, 0x87, 0x43, 0xE1, 0x84, 0x88, 0x43, + 0xE1, 0x84, 0x89, 0x43, 0xE1, 0x84, 0x8A, 0x43, + // Bytes 340 - 37f + 0xE1, 0x84, 0x8B, 0x43, 0xE1, 0x84, 0x8C, 0x43, + 0xE1, 0x84, 0x8D, 0x43, 0xE1, 0x84, 0x8E, 0x43, + 0xE1, 0x84, 0x8F, 0x43, 0xE1, 0x84, 0x90, 0x43, + 0xE1, 0x84, 0x91, 0x43, 0xE1, 0x84, 0x92, 0x43, + 0xE1, 0x84, 0x94, 0x43, 0xE1, 0x84, 0x95, 0x43, + 0xE1, 0x84, 0x9A, 0x43, 0xE1, 0x84, 0x9C, 0x43, + 0xE1, 0x84, 0x9D, 0x43, 0xE1, 0x84, 0x9E, 0x43, + 0xE1, 0x84, 0xA0, 0x43, 0xE1, 0x84, 0xA1, 0x43, + // Bytes 380 - 3bf + 0xE1, 0x84, 0xA2, 0x43, 0xE1, 0x84, 0xA3, 0x43, + 0xE1, 0x84, 0xA7, 0x43, 0xE1, 0x84, 0xA9, 0x43, + 0xE1, 0x84, 0xAB, 0x43, 0xE1, 0x84, 0xAC, 0x43, + 0xE1, 0x84, 0xAD, 0x43, 0xE1, 0x84, 0xAE, 0x43, + 0xE1, 0x84, 0xAF, 0x43, 0xE1, 0x84, 0xB2, 0x43, + 0xE1, 0x84, 0xB6, 0x43, 0xE1, 0x85, 0x80, 0x43, + 0xE1, 0x85, 0x87, 0x43, 0xE1, 0x85, 0x8C, 0x43, + 0xE1, 0x85, 0x97, 0x43, 0xE1, 0x85, 0x98, 0x43, + // Bytes 3c0 - 3ff + 0xE1, 0x85, 0x99, 0x43, 0xE1, 0x85, 0xA0, 0x43, + 0xE1, 0x86, 0x84, 0x43, 0xE1, 0x86, 0x85, 0x43, + 0xE1, 0x86, 0x88, 0x43, 0xE1, 0x86, 0x91, 0x43, + 0xE1, 0x86, 0x92, 0x43, 0xE1, 0x86, 0x94, 0x43, + 0xE1, 0x86, 0x9E, 0x43, 0xE1, 0x86, 0xA1, 0x43, + 0xE1, 0x87, 0x87, 0x43, 0xE1, 0x87, 0x88, 0x43, + 0xE1, 0x87, 0x8C, 0x43, 0xE1, 0x87, 0x8E, 0x43, + 0xE1, 0x87, 0x93, 0x43, 0xE1, 0x87, 0x97, 0x43, + // Bytes 400 - 43f + 0xE1, 0x87, 0x99, 0x43, 0xE1, 0x87, 0x9D, 0x43, + 0xE1, 0x87, 0x9F, 0x43, 0xE1, 0x87, 0xB1, 0x43, + 0xE1, 0x87, 0xB2, 0x43, 0xE1, 0xB4, 0x82, 0x43, + 0xE1, 0xB4, 0x96, 0x43, 0xE1, 0xB4, 0x97, 0x43, + 0xE1, 0xB4, 0x9C, 0x43, 0xE1, 0xB4, 0x9D, 0x43, + 0xE1, 0xB4, 0xA5, 0x43, 0xE1, 0xB5, 0xBB, 0x43, + 0xE1, 0xB6, 0x85, 0x43, 0xE2, 0x80, 0x82, 0x43, + 0xE2, 0x80, 0x83, 0x43, 0xE2, 0x80, 0x90, 0x43, + // Bytes 440 - 47f + 0xE2, 0x80, 0x93, 0x43, 0xE2, 0x80, 0x94, 0x43, + 0xE2, 0x82, 0xA9, 0x43, 0xE2, 0x86, 0x90, 0x43, + 0xE2, 0x86, 0x91, 0x43, 0xE2, 0x86, 0x92, 0x43, + 0xE2, 0x86, 0x93, 0x43, 0xE2, 0x88, 0x82, 0x43, + 0xE2, 0x88, 0x87, 0x43, 0xE2, 0x88, 0x91, 0x43, + 0xE2, 0x88, 0x92, 0x43, 0xE2, 0x94, 0x82, 0x43, + 0xE2, 0x96, 0xA0, 0x43, 0xE2, 0x97, 0x8B, 0x43, + 0xE2, 0xA6, 0x85, 0x43, 0xE2, 0xA6, 0x86, 0x43, + // Bytes 480 - 4bf + 0xE2, 0xB5, 0xA1, 0x43, 0xE3, 0x80, 0x81, 0x43, + 0xE3, 0x80, 0x82, 0x43, 0xE3, 0x80, 0x88, 0x43, + 0xE3, 0x80, 0x89, 0x43, 0xE3, 0x80, 0x8A, 0x43, + 0xE3, 0x80, 0x8B, 0x43, 0xE3, 0x80, 0x8C, 0x43, + 0xE3, 0x80, 0x8D, 0x43, 0xE3, 0x80, 0x8E, 0x43, + 0xE3, 0x80, 0x8F, 0x43, 0xE3, 0x80, 0x90, 0x43, + 0xE3, 0x80, 0x91, 0x43, 0xE3, 0x80, 0x92, 0x43, + 0xE3, 0x80, 0x94, 0x43, 0xE3, 0x80, 0x95, 0x43, + // Bytes 4c0 - 4ff + 0xE3, 0x80, 0x96, 0x43, 0xE3, 0x80, 0x97, 0x43, + 0xE3, 0x82, 0xA1, 0x43, 0xE3, 0x82, 0xA2, 0x43, + 0xE3, 0x82, 0xA3, 0x43, 0xE3, 0x82, 0xA4, 0x43, + 0xE3, 0x82, 0xA5, 0x43, 0xE3, 0x82, 0xA6, 0x43, + 0xE3, 0x82, 0xA7, 0x43, 0xE3, 0x82, 0xA8, 0x43, + 0xE3, 0x82, 0xA9, 0x43, 0xE3, 0x82, 0xAA, 0x43, + 0xE3, 0x82, 0xAB, 0x43, 0xE3, 0x82, 0xAD, 0x43, + 0xE3, 0x82, 0xAF, 0x43, 0xE3, 0x82, 0xB1, 0x43, + // Bytes 500 - 53f + 0xE3, 0x82, 0xB3, 0x43, 0xE3, 0x82, 0xB5, 0x43, + 0xE3, 0x82, 0xB7, 0x43, 0xE3, 0x82, 0xB9, 0x43, + 0xE3, 0x82, 0xBB, 0x43, 0xE3, 0x82, 0xBD, 0x43, + 0xE3, 0x82, 0xBF, 0x43, 0xE3, 0x83, 0x81, 0x43, + 0xE3, 0x83, 0x83, 0x43, 0xE3, 0x83, 0x84, 0x43, + 0xE3, 0x83, 0x86, 0x43, 0xE3, 0x83, 0x88, 0x43, + 0xE3, 0x83, 0x8A, 0x43, 0xE3, 0x83, 0x8B, 0x43, + 0xE3, 0x83, 0x8C, 0x43, 0xE3, 0x83, 0x8D, 0x43, + // Bytes 540 - 57f + 0xE3, 0x83, 0x8E, 0x43, 0xE3, 0x83, 0x8F, 0x43, + 0xE3, 0x83, 0x92, 0x43, 0xE3, 0x83, 0x95, 0x43, + 0xE3, 0x83, 0x98, 0x43, 0xE3, 0x83, 0x9B, 0x43, + 0xE3, 0x83, 0x9E, 0x43, 0xE3, 0x83, 0x9F, 0x43, + 0xE3, 0x83, 0xA0, 0x43, 0xE3, 0x83, 0xA1, 0x43, + 0xE3, 0x83, 0xA2, 0x43, 0xE3, 0x83, 0xA3, 0x43, + 0xE3, 0x83, 0xA4, 0x43, 0xE3, 0x83, 0xA5, 0x43, + 0xE3, 0x83, 0xA6, 0x43, 0xE3, 0x83, 0xA7, 0x43, + // Bytes 580 - 5bf + 0xE3, 0x83, 0xA8, 0x43, 0xE3, 0x83, 0xA9, 0x43, + 0xE3, 0x83, 0xAA, 0x43, 0xE3, 0x83, 0xAB, 0x43, + 0xE3, 0x83, 0xAC, 0x43, 0xE3, 0x83, 0xAD, 0x43, + 0xE3, 0x83, 0xAF, 0x43, 0xE3, 0x83, 0xB0, 0x43, + 0xE3, 0x83, 0xB1, 0x43, 0xE3, 0x83, 0xB2, 0x43, + 0xE3, 0x83, 0xB3, 0x43, 0xE3, 0x83, 0xBB, 0x43, + 0xE3, 0x83, 0xBC, 0x43, 0xE3, 0x92, 0x9E, 0x43, + 0xE3, 0x92, 0xB9, 0x43, 0xE3, 0x92, 0xBB, 0x43, + // Bytes 5c0 - 5ff + 0xE3, 0x93, 0x9F, 0x43, 0xE3, 0x94, 0x95, 0x43, + 0xE3, 0x9B, 0xAE, 0x43, 0xE3, 0x9B, 0xBC, 0x43, + 0xE3, 0x9E, 0x81, 0x43, 0xE3, 0xA0, 0xAF, 0x43, + 0xE3, 0xA1, 0xA2, 0x43, 0xE3, 0xA1, 0xBC, 0x43, + 0xE3, 0xA3, 0x87, 0x43, 0xE3, 0xA3, 0xA3, 0x43, + 0xE3, 0xA4, 0x9C, 0x43, 0xE3, 0xA4, 0xBA, 0x43, + 0xE3, 0xA8, 0xAE, 0x43, 0xE3, 0xA9, 0xAC, 0x43, + 0xE3, 0xAB, 0xA4, 0x43, 0xE3, 0xAC, 0x88, 0x43, + // Bytes 600 - 63f + 0xE3, 0xAC, 0x99, 0x43, 0xE3, 0xAD, 0x89, 0x43, + 0xE3, 0xAE, 0x9D, 0x43, 0xE3, 0xB0, 0x98, 0x43, + 0xE3, 0xB1, 0x8E, 0x43, 0xE3, 0xB4, 0xB3, 0x43, + 0xE3, 0xB6, 0x96, 0x43, 0xE3, 0xBA, 0xAC, 0x43, + 0xE3, 0xBA, 0xB8, 0x43, 0xE3, 0xBC, 0x9B, 0x43, + 0xE3, 0xBF, 0xBC, 0x43, 0xE4, 0x80, 0x88, 0x43, + 0xE4, 0x80, 0x98, 0x43, 0xE4, 0x80, 0xB9, 0x43, + 0xE4, 0x81, 0x86, 0x43, 0xE4, 0x82, 0x96, 0x43, + // Bytes 640 - 67f + 0xE4, 0x83, 0xA3, 0x43, 0xE4, 0x84, 0xAF, 0x43, + 0xE4, 0x88, 0x82, 0x43, 0xE4, 0x88, 0xA7, 0x43, + 0xE4, 0x8A, 0xA0, 0x43, 0xE4, 0x8C, 0x81, 0x43, + 0xE4, 0x8C, 0xB4, 0x43, 0xE4, 0x8D, 0x99, 0x43, + 0xE4, 0x8F, 0x95, 0x43, 0xE4, 0x8F, 0x99, 0x43, + 0xE4, 0x90, 0x8B, 0x43, 0xE4, 0x91, 0xAB, 0x43, + 0xE4, 0x94, 0xAB, 0x43, 0xE4, 0x95, 0x9D, 0x43, + 0xE4, 0x95, 0xA1, 0x43, 0xE4, 0x95, 0xAB, 0x43, + // Bytes 680 - 6bf + 0xE4, 0x97, 0x97, 0x43, 0xE4, 0x97, 0xB9, 0x43, + 0xE4, 0x98, 0xB5, 0x43, 0xE4, 0x9A, 0xBE, 0x43, + 0xE4, 0x9B, 0x87, 0x43, 0xE4, 0xA6, 0x95, 0x43, + 0xE4, 0xA7, 0xA6, 0x43, 0xE4, 0xA9, 0xAE, 0x43, + 0xE4, 0xA9, 0xB6, 0x43, 0xE4, 0xAA, 0xB2, 0x43, + 0xE4, 0xAC, 0xB3, 0x43, 0xE4, 0xAF, 0x8E, 0x43, + 0xE4, 0xB3, 0x8E, 0x43, 0xE4, 0xB3, 0xAD, 0x43, + 0xE4, 0xB3, 0xB8, 0x43, 0xE4, 0xB5, 0x96, 0x43, + // Bytes 6c0 - 6ff + 0xE4, 0xB8, 0x80, 0x43, 0xE4, 0xB8, 0x81, 0x43, + 0xE4, 0xB8, 0x83, 0x43, 0xE4, 0xB8, 0x89, 0x43, + 0xE4, 0xB8, 0x8A, 0x43, 0xE4, 0xB8, 0x8B, 0x43, + 0xE4, 0xB8, 0x8D, 0x43, 0xE4, 0xB8, 0x99, 0x43, + 0xE4, 0xB8, 0xA6, 0x43, 0xE4, 0xB8, 0xA8, 0x43, + 0xE4, 0xB8, 0xAD, 0x43, 0xE4, 0xB8, 0xB2, 0x43, + 0xE4, 0xB8, 0xB6, 0x43, 0xE4, 0xB8, 0xB8, 0x43, + 0xE4, 0xB8, 0xB9, 0x43, 0xE4, 0xB8, 0xBD, 0x43, + // Bytes 700 - 73f + 0xE4, 0xB8, 0xBF, 0x43, 0xE4, 0xB9, 0x81, 0x43, + 0xE4, 0xB9, 0x99, 0x43, 0xE4, 0xB9, 0x9D, 0x43, + 0xE4, 0xBA, 0x82, 0x43, 0xE4, 0xBA, 0x85, 0x43, + 0xE4, 0xBA, 0x86, 0x43, 0xE4, 0xBA, 0x8C, 0x43, + 0xE4, 0xBA, 0x94, 0x43, 0xE4, 0xBA, 0xA0, 0x43, + 0xE4, 0xBA, 0xA4, 0x43, 0xE4, 0xBA, 0xAE, 0x43, + 0xE4, 0xBA, 0xBA, 0x43, 0xE4, 0xBB, 0x80, 0x43, + 0xE4, 0xBB, 0x8C, 0x43, 0xE4, 0xBB, 0xA4, 0x43, + // Bytes 740 - 77f + 0xE4, 0xBC, 0x81, 0x43, 0xE4, 0xBC, 0x91, 0x43, + 0xE4, 0xBD, 0xA0, 0x43, 0xE4, 0xBE, 0x80, 0x43, + 0xE4, 0xBE, 0x86, 0x43, 0xE4, 0xBE, 0x8B, 0x43, + 0xE4, 0xBE, 0xAE, 0x43, 0xE4, 0xBE, 0xBB, 0x43, + 0xE4, 0xBE, 0xBF, 0x43, 0xE5, 0x80, 0x82, 0x43, + 0xE5, 0x80, 0xAB, 0x43, 0xE5, 0x81, 0xBA, 0x43, + 0xE5, 0x82, 0x99, 0x43, 0xE5, 0x83, 0x8F, 0x43, + 0xE5, 0x83, 0x9A, 0x43, 0xE5, 0x83, 0xA7, 0x43, + // Bytes 780 - 7bf + 0xE5, 0x84, 0xAA, 0x43, 0xE5, 0x84, 0xBF, 0x43, + 0xE5, 0x85, 0x80, 0x43, 0xE5, 0x85, 0x85, 0x43, + 0xE5, 0x85, 0x8D, 0x43, 0xE5, 0x85, 0x94, 0x43, + 0xE5, 0x85, 0xA4, 0x43, 0xE5, 0x85, 0xA5, 0x43, + 0xE5, 0x85, 0xA7, 0x43, 0xE5, 0x85, 0xA8, 0x43, + 0xE5, 0x85, 0xA9, 0x43, 0xE5, 0x85, 0xAB, 0x43, + 0xE5, 0x85, 0xAD, 0x43, 0xE5, 0x85, 0xB7, 0x43, + 0xE5, 0x86, 0x80, 0x43, 0xE5, 0x86, 0x82, 0x43, + // Bytes 7c0 - 7ff + 0xE5, 0x86, 0x8D, 0x43, 0xE5, 0x86, 0x92, 0x43, + 0xE5, 0x86, 0x95, 0x43, 0xE5, 0x86, 0x96, 0x43, + 0xE5, 0x86, 0x97, 0x43, 0xE5, 0x86, 0x99, 0x43, + 0xE5, 0x86, 0xA4, 0x43, 0xE5, 0x86, 0xAB, 0x43, + 0xE5, 0x86, 0xAC, 0x43, 0xE5, 0x86, 0xB5, 0x43, + 0xE5, 0x86, 0xB7, 0x43, 0xE5, 0x87, 0x89, 0x43, + 0xE5, 0x87, 0x8C, 0x43, 0xE5, 0x87, 0x9C, 0x43, + 0xE5, 0x87, 0x9E, 0x43, 0xE5, 0x87, 0xA0, 0x43, + // Bytes 800 - 83f + 0xE5, 0x87, 0xB5, 0x43, 0xE5, 0x88, 0x80, 0x43, + 0xE5, 0x88, 0x83, 0x43, 0xE5, 0x88, 0x87, 0x43, + 0xE5, 0x88, 0x97, 0x43, 0xE5, 0x88, 0x9D, 0x43, + 0xE5, 0x88, 0xA9, 0x43, 0xE5, 0x88, 0xBA, 0x43, + 0xE5, 0x88, 0xBB, 0x43, 0xE5, 0x89, 0x86, 0x43, + 0xE5, 0x89, 0x8D, 0x43, 0xE5, 0x89, 0xB2, 0x43, + 0xE5, 0x89, 0xB7, 0x43, 0xE5, 0x8A, 0x89, 0x43, + 0xE5, 0x8A, 0x9B, 0x43, 0xE5, 0x8A, 0xA3, 0x43, + // Bytes 840 - 87f + 0xE5, 0x8A, 0xB3, 0x43, 0xE5, 0x8A, 0xB4, 0x43, + 0xE5, 0x8B, 0x87, 0x43, 0xE5, 0x8B, 0x89, 0x43, + 0xE5, 0x8B, 0x92, 0x43, 0xE5, 0x8B, 0x9E, 0x43, + 0xE5, 0x8B, 0xA4, 0x43, 0xE5, 0x8B, 0xB5, 0x43, + 0xE5, 0x8B, 0xB9, 0x43, 0xE5, 0x8B, 0xBA, 0x43, + 0xE5, 0x8C, 0x85, 0x43, 0xE5, 0x8C, 0x86, 0x43, + 0xE5, 0x8C, 0x95, 0x43, 0xE5, 0x8C, 0x97, 0x43, + 0xE5, 0x8C, 0x9A, 0x43, 0xE5, 0x8C, 0xB8, 0x43, + // Bytes 880 - 8bf + 0xE5, 0x8C, 0xBB, 0x43, 0xE5, 0x8C, 0xBF, 0x43, + 0xE5, 0x8D, 0x81, 0x43, 0xE5, 0x8D, 0x84, 0x43, + 0xE5, 0x8D, 0x85, 0x43, 0xE5, 0x8D, 0x89, 0x43, + 0xE5, 0x8D, 0x91, 0x43, 0xE5, 0x8D, 0x94, 0x43, + 0xE5, 0x8D, 0x9A, 0x43, 0xE5, 0x8D, 0x9C, 0x43, + 0xE5, 0x8D, 0xA9, 0x43, 0xE5, 0x8D, 0xB0, 0x43, + 0xE5, 0x8D, 0xB3, 0x43, 0xE5, 0x8D, 0xB5, 0x43, + 0xE5, 0x8D, 0xBD, 0x43, 0xE5, 0x8D, 0xBF, 0x43, + // Bytes 8c0 - 8ff + 0xE5, 0x8E, 0x82, 0x43, 0xE5, 0x8E, 0xB6, 0x43, + 0xE5, 0x8F, 0x83, 0x43, 0xE5, 0x8F, 0x88, 0x43, + 0xE5, 0x8F, 0x8A, 0x43, 0xE5, 0x8F, 0x8C, 0x43, + 0xE5, 0x8F, 0x9F, 0x43, 0xE5, 0x8F, 0xA3, 0x43, + 0xE5, 0x8F, 0xA5, 0x43, 0xE5, 0x8F, 0xAB, 0x43, + 0xE5, 0x8F, 0xAF, 0x43, 0xE5, 0x8F, 0xB1, 0x43, + 0xE5, 0x8F, 0xB3, 0x43, 0xE5, 0x90, 0x86, 0x43, + 0xE5, 0x90, 0x88, 0x43, 0xE5, 0x90, 0x8D, 0x43, + // Bytes 900 - 93f + 0xE5, 0x90, 0x8F, 0x43, 0xE5, 0x90, 0x9D, 0x43, + 0xE5, 0x90, 0xB8, 0x43, 0xE5, 0x90, 0xB9, 0x43, + 0xE5, 0x91, 0x82, 0x43, 0xE5, 0x91, 0x88, 0x43, + 0xE5, 0x91, 0xA8, 0x43, 0xE5, 0x92, 0x9E, 0x43, + 0xE5, 0x92, 0xA2, 0x43, 0xE5, 0x92, 0xBD, 0x43, + 0xE5, 0x93, 0xB6, 0x43, 0xE5, 0x94, 0x90, 0x43, + 0xE5, 0x95, 0x8F, 0x43, 0xE5, 0x95, 0x93, 0x43, + 0xE5, 0x95, 0x95, 0x43, 0xE5, 0x95, 0xA3, 0x43, + // Bytes 940 - 97f + 0xE5, 0x96, 0x84, 0x43, 0xE5, 0x96, 0x87, 0x43, + 0xE5, 0x96, 0x99, 0x43, 0xE5, 0x96, 0x9D, 0x43, + 0xE5, 0x96, 0xAB, 0x43, 0xE5, 0x96, 0xB3, 0x43, + 0xE5, 0x96, 0xB6, 0x43, 0xE5, 0x97, 0x80, 0x43, + 0xE5, 0x97, 0x82, 0x43, 0xE5, 0x97, 0xA2, 0x43, + 0xE5, 0x98, 0x86, 0x43, 0xE5, 0x99, 0x91, 0x43, + 0xE5, 0x99, 0xA8, 0x43, 0xE5, 0x99, 0xB4, 0x43, + 0xE5, 0x9B, 0x97, 0x43, 0xE5, 0x9B, 0x9B, 0x43, + // Bytes 980 - 9bf + 0xE5, 0x9B, 0xB9, 0x43, 0xE5, 0x9C, 0x96, 0x43, + 0xE5, 0x9C, 0x97, 0x43, 0xE5, 0x9C, 0x9F, 0x43, + 0xE5, 0x9C, 0xB0, 0x43, 0xE5, 0x9E, 0x8B, 0x43, + 0xE5, 0x9F, 0x8E, 0x43, 0xE5, 0x9F, 0xB4, 0x43, + 0xE5, 0xA0, 0x8D, 0x43, 0xE5, 0xA0, 0xB1, 0x43, + 0xE5, 0xA0, 0xB2, 0x43, 0xE5, 0xA1, 0x80, 0x43, + 0xE5, 0xA1, 0x9A, 0x43, 0xE5, 0xA1, 0x9E, 0x43, + 0xE5, 0xA2, 0xA8, 0x43, 0xE5, 0xA2, 0xAC, 0x43, + // Bytes 9c0 - 9ff + 0xE5, 0xA2, 0xB3, 0x43, 0xE5, 0xA3, 0x98, 0x43, + 0xE5, 0xA3, 0x9F, 0x43, 0xE5, 0xA3, 0xAB, 0x43, + 0xE5, 0xA3, 0xAE, 0x43, 0xE5, 0xA3, 0xB0, 0x43, + 0xE5, 0xA3, 0xB2, 0x43, 0xE5, 0xA3, 0xB7, 0x43, + 0xE5, 0xA4, 0x82, 0x43, 0xE5, 0xA4, 0x86, 0x43, + 0xE5, 0xA4, 0x8A, 0x43, 0xE5, 0xA4, 0x95, 0x43, + 0xE5, 0xA4, 0x9A, 0x43, 0xE5, 0xA4, 0x9C, 0x43, + 0xE5, 0xA4, 0xA2, 0x43, 0xE5, 0xA4, 0xA7, 0x43, + // Bytes a00 - a3f + 0xE5, 0xA4, 0xA9, 0x43, 0xE5, 0xA5, 0x84, 0x43, + 0xE5, 0xA5, 0x88, 0x43, 0xE5, 0xA5, 0x91, 0x43, + 0xE5, 0xA5, 0x94, 0x43, 0xE5, 0xA5, 0xA2, 0x43, + 0xE5, 0xA5, 0xB3, 0x43, 0xE5, 0xA7, 0x98, 0x43, + 0xE5, 0xA7, 0xAC, 0x43, 0xE5, 0xA8, 0x9B, 0x43, + 0xE5, 0xA8, 0xA7, 0x43, 0xE5, 0xA9, 0xA2, 0x43, + 0xE5, 0xA9, 0xA6, 0x43, 0xE5, 0xAA, 0xB5, 0x43, + 0xE5, 0xAC, 0x88, 0x43, 0xE5, 0xAC, 0xA8, 0x43, + // Bytes a40 - a7f + 0xE5, 0xAC, 0xBE, 0x43, 0xE5, 0xAD, 0x90, 0x43, + 0xE5, 0xAD, 0x97, 0x43, 0xE5, 0xAD, 0xA6, 0x43, + 0xE5, 0xAE, 0x80, 0x43, 0xE5, 0xAE, 0x85, 0x43, + 0xE5, 0xAE, 0x97, 0x43, 0xE5, 0xAF, 0x83, 0x43, + 0xE5, 0xAF, 0x98, 0x43, 0xE5, 0xAF, 0xA7, 0x43, + 0xE5, 0xAF, 0xAE, 0x43, 0xE5, 0xAF, 0xB3, 0x43, + 0xE5, 0xAF, 0xB8, 0x43, 0xE5, 0xAF, 0xBF, 0x43, + 0xE5, 0xB0, 0x86, 0x43, 0xE5, 0xB0, 0x8F, 0x43, + // Bytes a80 - abf + 0xE5, 0xB0, 0xA2, 0x43, 0xE5, 0xB0, 0xB8, 0x43, + 0xE5, 0xB0, 0xBF, 0x43, 0xE5, 0xB1, 0xA0, 0x43, + 0xE5, 0xB1, 0xA2, 0x43, 0xE5, 0xB1, 0xA4, 0x43, + 0xE5, 0xB1, 0xA5, 0x43, 0xE5, 0xB1, 0xAE, 0x43, + 0xE5, 0xB1, 0xB1, 0x43, 0xE5, 0xB2, 0x8D, 0x43, + 0xE5, 0xB3, 0x80, 0x43, 0xE5, 0xB4, 0x99, 0x43, + 0xE5, 0xB5, 0x83, 0x43, 0xE5, 0xB5, 0x90, 0x43, + 0xE5, 0xB5, 0xAB, 0x43, 0xE5, 0xB5, 0xAE, 0x43, + // Bytes ac0 - aff + 0xE5, 0xB5, 0xBC, 0x43, 0xE5, 0xB6, 0xB2, 0x43, + 0xE5, 0xB6, 0xBA, 0x43, 0xE5, 0xB7, 0x9B, 0x43, + 0xE5, 0xB7, 0xA1, 0x43, 0xE5, 0xB7, 0xA2, 0x43, + 0xE5, 0xB7, 0xA5, 0x43, 0xE5, 0xB7, 0xA6, 0x43, + 0xE5, 0xB7, 0xB1, 0x43, 0xE5, 0xB7, 0xBD, 0x43, + 0xE5, 0xB7, 0xBE, 0x43, 0xE5, 0xB8, 0xA8, 0x43, + 0xE5, 0xB8, 0xBD, 0x43, 0xE5, 0xB9, 0xA9, 0x43, + 0xE5, 0xB9, 0xB2, 0x43, 0xE5, 0xB9, 0xB4, 0x43, + // Bytes b00 - b3f + 0xE5, 0xB9, 0xBA, 0x43, 0xE5, 0xB9, 0xBC, 0x43, + 0xE5, 0xB9, 0xBF, 0x43, 0xE5, 0xBA, 0xA6, 0x43, + 0xE5, 0xBA, 0xB0, 0x43, 0xE5, 0xBA, 0xB3, 0x43, + 0xE5, 0xBA, 0xB6, 0x43, 0xE5, 0xBB, 0x89, 0x43, + 0xE5, 0xBB, 0x8A, 0x43, 0xE5, 0xBB, 0x92, 0x43, + 0xE5, 0xBB, 0x93, 0x43, 0xE5, 0xBB, 0x99, 0x43, + 0xE5, 0xBB, 0xAC, 0x43, 0xE5, 0xBB, 0xB4, 0x43, + 0xE5, 0xBB, 0xBE, 0x43, 0xE5, 0xBC, 0x84, 0x43, + // Bytes b40 - b7f + 0xE5, 0xBC, 0x8B, 0x43, 0xE5, 0xBC, 0x93, 0x43, + 0xE5, 0xBC, 0xA2, 0x43, 0xE5, 0xBD, 0x90, 0x43, + 0xE5, 0xBD, 0x93, 0x43, 0xE5, 0xBD, 0xA1, 0x43, + 0xE5, 0xBD, 0xA2, 0x43, 0xE5, 0xBD, 0xA9, 0x43, + 0xE5, 0xBD, 0xAB, 0x43, 0xE5, 0xBD, 0xB3, 0x43, + 0xE5, 0xBE, 0x8B, 0x43, 0xE5, 0xBE, 0x8C, 0x43, + 0xE5, 0xBE, 0x97, 0x43, 0xE5, 0xBE, 0x9A, 0x43, + 0xE5, 0xBE, 0xA9, 0x43, 0xE5, 0xBE, 0xAD, 0x43, + // Bytes b80 - bbf + 0xE5, 0xBF, 0x83, 0x43, 0xE5, 0xBF, 0x8D, 0x43, + 0xE5, 0xBF, 0x97, 0x43, 0xE5, 0xBF, 0xB5, 0x43, + 0xE5, 0xBF, 0xB9, 0x43, 0xE6, 0x80, 0x92, 0x43, + 0xE6, 0x80, 0x9C, 0x43, 0xE6, 0x81, 0xB5, 0x43, + 0xE6, 0x82, 0x81, 0x43, 0xE6, 0x82, 0x94, 0x43, + 0xE6, 0x83, 0x87, 0x43, 0xE6, 0x83, 0x98, 0x43, + 0xE6, 0x83, 0xA1, 0x43, 0xE6, 0x84, 0x88, 0x43, + 0xE6, 0x85, 0x84, 0x43, 0xE6, 0x85, 0x88, 0x43, + // Bytes bc0 - bff + 0xE6, 0x85, 0x8C, 0x43, 0xE6, 0x85, 0x8E, 0x43, + 0xE6, 0x85, 0xA0, 0x43, 0xE6, 0x85, 0xA8, 0x43, + 0xE6, 0x85, 0xBA, 0x43, 0xE6, 0x86, 0x8E, 0x43, + 0xE6, 0x86, 0x90, 0x43, 0xE6, 0x86, 0xA4, 0x43, + 0xE6, 0x86, 0xAF, 0x43, 0xE6, 0x86, 0xB2, 0x43, + 0xE6, 0x87, 0x9E, 0x43, 0xE6, 0x87, 0xB2, 0x43, + 0xE6, 0x87, 0xB6, 0x43, 0xE6, 0x88, 0x80, 0x43, + 0xE6, 0x88, 0x88, 0x43, 0xE6, 0x88, 0x90, 0x43, + // Bytes c00 - c3f + 0xE6, 0x88, 0x9B, 0x43, 0xE6, 0x88, 0xAE, 0x43, + 0xE6, 0x88, 0xB4, 0x43, 0xE6, 0x88, 0xB6, 0x43, + 0xE6, 0x89, 0x8B, 0x43, 0xE6, 0x89, 0x93, 0x43, + 0xE6, 0x89, 0x9D, 0x43, 0xE6, 0x8A, 0x95, 0x43, + 0xE6, 0x8A, 0xB1, 0x43, 0xE6, 0x8B, 0x89, 0x43, + 0xE6, 0x8B, 0x8F, 0x43, 0xE6, 0x8B, 0x93, 0x43, + 0xE6, 0x8B, 0x94, 0x43, 0xE6, 0x8B, 0xBC, 0x43, + 0xE6, 0x8B, 0xBE, 0x43, 0xE6, 0x8C, 0x87, 0x43, + // Bytes c40 - c7f + 0xE6, 0x8C, 0xBD, 0x43, 0xE6, 0x8D, 0x90, 0x43, + 0xE6, 0x8D, 0x95, 0x43, 0xE6, 0x8D, 0xA8, 0x43, + 0xE6, 0x8D, 0xBB, 0x43, 0xE6, 0x8E, 0x83, 0x43, + 0xE6, 0x8E, 0xA0, 0x43, 0xE6, 0x8E, 0xA9, 0x43, + 0xE6, 0x8F, 0x84, 0x43, 0xE6, 0x8F, 0x85, 0x43, + 0xE6, 0x8F, 0xA4, 0x43, 0xE6, 0x90, 0x9C, 0x43, + 0xE6, 0x90, 0xA2, 0x43, 0xE6, 0x91, 0x92, 0x43, + 0xE6, 0x91, 0xA9, 0x43, 0xE6, 0x91, 0xB7, 0x43, + // Bytes c80 - cbf + 0xE6, 0x91, 0xBE, 0x43, 0xE6, 0x92, 0x9A, 0x43, + 0xE6, 0x92, 0x9D, 0x43, 0xE6, 0x93, 0x84, 0x43, + 0xE6, 0x94, 0xAF, 0x43, 0xE6, 0x94, 0xB4, 0x43, + 0xE6, 0x95, 0x8F, 0x43, 0xE6, 0x95, 0x96, 0x43, + 0xE6, 0x95, 0xAC, 0x43, 0xE6, 0x95, 0xB8, 0x43, + 0xE6, 0x96, 0x87, 0x43, 0xE6, 0x96, 0x97, 0x43, + 0xE6, 0x96, 0x99, 0x43, 0xE6, 0x96, 0xA4, 0x43, + 0xE6, 0x96, 0xB0, 0x43, 0xE6, 0x96, 0xB9, 0x43, + // Bytes cc0 - cff + 0xE6, 0x97, 0x85, 0x43, 0xE6, 0x97, 0xA0, 0x43, + 0xE6, 0x97, 0xA2, 0x43, 0xE6, 0x97, 0xA3, 0x43, + 0xE6, 0x97, 0xA5, 0x43, 0xE6, 0x98, 0x93, 0x43, + 0xE6, 0x98, 0xA0, 0x43, 0xE6, 0x99, 0x89, 0x43, + 0xE6, 0x99, 0xB4, 0x43, 0xE6, 0x9A, 0x88, 0x43, + 0xE6, 0x9A, 0x91, 0x43, 0xE6, 0x9A, 0x9C, 0x43, + 0xE6, 0x9A, 0xB4, 0x43, 0xE6, 0x9B, 0x86, 0x43, + 0xE6, 0x9B, 0xB0, 0x43, 0xE6, 0x9B, 0xB4, 0x43, + // Bytes d00 - d3f + 0xE6, 0x9B, 0xB8, 0x43, 0xE6, 0x9C, 0x80, 0x43, + 0xE6, 0x9C, 0x88, 0x43, 0xE6, 0x9C, 0x89, 0x43, + 0xE6, 0x9C, 0x97, 0x43, 0xE6, 0x9C, 0x9B, 0x43, + 0xE6, 0x9C, 0xA1, 0x43, 0xE6, 0x9C, 0xA8, 0x43, + 0xE6, 0x9D, 0x8E, 0x43, 0xE6, 0x9D, 0x93, 0x43, + 0xE6, 0x9D, 0x96, 0x43, 0xE6, 0x9D, 0x9E, 0x43, + 0xE6, 0x9D, 0xBB, 0x43, 0xE6, 0x9E, 0x85, 0x43, + 0xE6, 0x9E, 0x97, 0x43, 0xE6, 0x9F, 0xB3, 0x43, + // Bytes d40 - d7f + 0xE6, 0x9F, 0xBA, 0x43, 0xE6, 0xA0, 0x97, 0x43, + 0xE6, 0xA0, 0x9F, 0x43, 0xE6, 0xA0, 0xAA, 0x43, + 0xE6, 0xA1, 0x92, 0x43, 0xE6, 0xA2, 0x81, 0x43, + 0xE6, 0xA2, 0x85, 0x43, 0xE6, 0xA2, 0x8E, 0x43, + 0xE6, 0xA2, 0xA8, 0x43, 0xE6, 0xA4, 0x94, 0x43, + 0xE6, 0xA5, 0x82, 0x43, 0xE6, 0xA6, 0xA3, 0x43, + 0xE6, 0xA7, 0xAA, 0x43, 0xE6, 0xA8, 0x82, 0x43, + 0xE6, 0xA8, 0x93, 0x43, 0xE6, 0xAA, 0xA8, 0x43, + // Bytes d80 - dbf + 0xE6, 0xAB, 0x93, 0x43, 0xE6, 0xAB, 0x9B, 0x43, + 0xE6, 0xAC, 0x84, 0x43, 0xE6, 0xAC, 0xA0, 0x43, + 0xE6, 0xAC, 0xA1, 0x43, 0xE6, 0xAD, 0x94, 0x43, + 0xE6, 0xAD, 0xA2, 0x43, 0xE6, 0xAD, 0xA3, 0x43, + 0xE6, 0xAD, 0xB2, 0x43, 0xE6, 0xAD, 0xB7, 0x43, + 0xE6, 0xAD, 0xB9, 0x43, 0xE6, 0xAE, 0x9F, 0x43, + 0xE6, 0xAE, 0xAE, 0x43, 0xE6, 0xAE, 0xB3, 0x43, + 0xE6, 0xAE, 0xBA, 0x43, 0xE6, 0xAE, 0xBB, 0x43, + // Bytes dc0 - dff + 0xE6, 0xAF, 0x8B, 0x43, 0xE6, 0xAF, 0x8D, 0x43, + 0xE6, 0xAF, 0x94, 0x43, 0xE6, 0xAF, 0x9B, 0x43, + 0xE6, 0xB0, 0x8F, 0x43, 0xE6, 0xB0, 0x94, 0x43, + 0xE6, 0xB0, 0xB4, 0x43, 0xE6, 0xB1, 0x8E, 0x43, + 0xE6, 0xB1, 0xA7, 0x43, 0xE6, 0xB2, 0x88, 0x43, + 0xE6, 0xB2, 0xBF, 0x43, 0xE6, 0xB3, 0x8C, 0x43, + 0xE6, 0xB3, 0x8D, 0x43, 0xE6, 0xB3, 0xA5, 0x43, + 0xE6, 0xB3, 0xA8, 0x43, 0xE6, 0xB4, 0x96, 0x43, + // Bytes e00 - e3f + 0xE6, 0xB4, 0x9B, 0x43, 0xE6, 0xB4, 0x9E, 0x43, + 0xE6, 0xB4, 0xB4, 0x43, 0xE6, 0xB4, 0xBE, 0x43, + 0xE6, 0xB5, 0x81, 0x43, 0xE6, 0xB5, 0xA9, 0x43, + 0xE6, 0xB5, 0xAA, 0x43, 0xE6, 0xB5, 0xB7, 0x43, + 0xE6, 0xB5, 0xB8, 0x43, 0xE6, 0xB6, 0x85, 0x43, + 0xE6, 0xB7, 0x8B, 0x43, 0xE6, 0xB7, 0x9A, 0x43, + 0xE6, 0xB7, 0xAA, 0x43, 0xE6, 0xB7, 0xB9, 0x43, + 0xE6, 0xB8, 0x9A, 0x43, 0xE6, 0xB8, 0xAF, 0x43, + // Bytes e40 - e7f + 0xE6, 0xB9, 0xAE, 0x43, 0xE6, 0xBA, 0x80, 0x43, + 0xE6, 0xBA, 0x9C, 0x43, 0xE6, 0xBA, 0xBA, 0x43, + 0xE6, 0xBB, 0x87, 0x43, 0xE6, 0xBB, 0x8B, 0x43, + 0xE6, 0xBB, 0x91, 0x43, 0xE6, 0xBB, 0x9B, 0x43, + 0xE6, 0xBC, 0x8F, 0x43, 0xE6, 0xBC, 0x94, 0x43, + 0xE6, 0xBC, 0xA2, 0x43, 0xE6, 0xBC, 0xA3, 0x43, + 0xE6, 0xBD, 0xAE, 0x43, 0xE6, 0xBF, 0x86, 0x43, + 0xE6, 0xBF, 0xAB, 0x43, 0xE6, 0xBF, 0xBE, 0x43, + // Bytes e80 - ebf + 0xE7, 0x80, 0x9B, 0x43, 0xE7, 0x80, 0x9E, 0x43, + 0xE7, 0x80, 0xB9, 0x43, 0xE7, 0x81, 0x8A, 0x43, + 0xE7, 0x81, 0xAB, 0x43, 0xE7, 0x81, 0xB0, 0x43, + 0xE7, 0x81, 0xB7, 0x43, 0xE7, 0x81, 0xBD, 0x43, + 0xE7, 0x82, 0x99, 0x43, 0xE7, 0x82, 0xAD, 0x43, + 0xE7, 0x83, 0x88, 0x43, 0xE7, 0x83, 0x99, 0x43, + 0xE7, 0x84, 0xA1, 0x43, 0xE7, 0x85, 0x85, 0x43, + 0xE7, 0x85, 0x89, 0x43, 0xE7, 0x85, 0xAE, 0x43, + // Bytes ec0 - eff + 0xE7, 0x86, 0x9C, 0x43, 0xE7, 0x87, 0x8E, 0x43, + 0xE7, 0x87, 0x90, 0x43, 0xE7, 0x88, 0x90, 0x43, + 0xE7, 0x88, 0x9B, 0x43, 0xE7, 0x88, 0xA8, 0x43, + 0xE7, 0x88, 0xAA, 0x43, 0xE7, 0x88, 0xAB, 0x43, + 0xE7, 0x88, 0xB5, 0x43, 0xE7, 0x88, 0xB6, 0x43, + 0xE7, 0x88, 0xBB, 0x43, 0xE7, 0x88, 0xBF, 0x43, + 0xE7, 0x89, 0x87, 0x43, 0xE7, 0x89, 0x90, 0x43, + 0xE7, 0x89, 0x99, 0x43, 0xE7, 0x89, 0x9B, 0x43, + // Bytes f00 - f3f + 0xE7, 0x89, 0xA2, 0x43, 0xE7, 0x89, 0xB9, 0x43, + 0xE7, 0x8A, 0x80, 0x43, 0xE7, 0x8A, 0x95, 0x43, + 0xE7, 0x8A, 0xAC, 0x43, 0xE7, 0x8A, 0xAF, 0x43, + 0xE7, 0x8B, 0x80, 0x43, 0xE7, 0x8B, 0xBC, 0x43, + 0xE7, 0x8C, 0xAA, 0x43, 0xE7, 0x8D, 0xB5, 0x43, + 0xE7, 0x8D, 0xBA, 0x43, 0xE7, 0x8E, 0x84, 0x43, + 0xE7, 0x8E, 0x87, 0x43, 0xE7, 0x8E, 0x89, 0x43, + 0xE7, 0x8E, 0x8B, 0x43, 0xE7, 0x8E, 0xA5, 0x43, + // Bytes f40 - f7f + 0xE7, 0x8E, 0xB2, 0x43, 0xE7, 0x8F, 0x9E, 0x43, + 0xE7, 0x90, 0x86, 0x43, 0xE7, 0x90, 0x89, 0x43, + 0xE7, 0x90, 0xA2, 0x43, 0xE7, 0x91, 0x87, 0x43, + 0xE7, 0x91, 0x9C, 0x43, 0xE7, 0x91, 0xA9, 0x43, + 0xE7, 0x91, 0xB1, 0x43, 0xE7, 0x92, 0x85, 0x43, + 0xE7, 0x92, 0x89, 0x43, 0xE7, 0x92, 0x98, 0x43, + 0xE7, 0x93, 0x8A, 0x43, 0xE7, 0x93, 0x9C, 0x43, + 0xE7, 0x93, 0xA6, 0x43, 0xE7, 0x94, 0x86, 0x43, + // Bytes f80 - fbf + 0xE7, 0x94, 0x98, 0x43, 0xE7, 0x94, 0x9F, 0x43, + 0xE7, 0x94, 0xA4, 0x43, 0xE7, 0x94, 0xA8, 0x43, + 0xE7, 0x94, 0xB0, 0x43, 0xE7, 0x94, 0xB2, 0x43, + 0xE7, 0x94, 0xB3, 0x43, 0xE7, 0x94, 0xB7, 0x43, + 0xE7, 0x94, 0xBB, 0x43, 0xE7, 0x94, 0xBE, 0x43, + 0xE7, 0x95, 0x99, 0x43, 0xE7, 0x95, 0xA5, 0x43, + 0xE7, 0x95, 0xB0, 0x43, 0xE7, 0x96, 0x8B, 0x43, + 0xE7, 0x96, 0x92, 0x43, 0xE7, 0x97, 0xA2, 0x43, + // Bytes fc0 - fff + 0xE7, 0x98, 0x90, 0x43, 0xE7, 0x98, 0x9D, 0x43, + 0xE7, 0x98, 0x9F, 0x43, 0xE7, 0x99, 0x82, 0x43, + 0xE7, 0x99, 0xA9, 0x43, 0xE7, 0x99, 0xB6, 0x43, + 0xE7, 0x99, 0xBD, 0x43, 0xE7, 0x9A, 0xAE, 0x43, + 0xE7, 0x9A, 0xBF, 0x43, 0xE7, 0x9B, 0x8A, 0x43, + 0xE7, 0x9B, 0x9B, 0x43, 0xE7, 0x9B, 0xA3, 0x43, + 0xE7, 0x9B, 0xA7, 0x43, 0xE7, 0x9B, 0xAE, 0x43, + 0xE7, 0x9B, 0xB4, 0x43, 0xE7, 0x9C, 0x81, 0x43, + // Bytes 1000 - 103f + 0xE7, 0x9C, 0x9E, 0x43, 0xE7, 0x9C, 0x9F, 0x43, + 0xE7, 0x9D, 0x80, 0x43, 0xE7, 0x9D, 0x8A, 0x43, + 0xE7, 0x9E, 0x8B, 0x43, 0xE7, 0x9E, 0xA7, 0x43, + 0xE7, 0x9F, 0x9B, 0x43, 0xE7, 0x9F, 0xA2, 0x43, + 0xE7, 0x9F, 0xB3, 0x43, 0xE7, 0xA1, 0x8E, 0x43, + 0xE7, 0xA1, 0xAB, 0x43, 0xE7, 0xA2, 0x8C, 0x43, + 0xE7, 0xA2, 0x91, 0x43, 0xE7, 0xA3, 0x8A, 0x43, + 0xE7, 0xA3, 0x8C, 0x43, 0xE7, 0xA3, 0xBB, 0x43, + // Bytes 1040 - 107f + 0xE7, 0xA4, 0xAA, 0x43, 0xE7, 0xA4, 0xBA, 0x43, + 0xE7, 0xA4, 0xBC, 0x43, 0xE7, 0xA4, 0xBE, 0x43, + 0xE7, 0xA5, 0x88, 0x43, 0xE7, 0xA5, 0x89, 0x43, + 0xE7, 0xA5, 0x90, 0x43, 0xE7, 0xA5, 0x96, 0x43, + 0xE7, 0xA5, 0x9D, 0x43, 0xE7, 0xA5, 0x9E, 0x43, + 0xE7, 0xA5, 0xA5, 0x43, 0xE7, 0xA5, 0xBF, 0x43, + 0xE7, 0xA6, 0x81, 0x43, 0xE7, 0xA6, 0x8D, 0x43, + 0xE7, 0xA6, 0x8E, 0x43, 0xE7, 0xA6, 0x8F, 0x43, + // Bytes 1080 - 10bf + 0xE7, 0xA6, 0xAE, 0x43, 0xE7, 0xA6, 0xB8, 0x43, + 0xE7, 0xA6, 0xBE, 0x43, 0xE7, 0xA7, 0x8A, 0x43, + 0xE7, 0xA7, 0x98, 0x43, 0xE7, 0xA7, 0xAB, 0x43, + 0xE7, 0xA8, 0x9C, 0x43, 0xE7, 0xA9, 0x80, 0x43, + 0xE7, 0xA9, 0x8A, 0x43, 0xE7, 0xA9, 0x8F, 0x43, + 0xE7, 0xA9, 0xB4, 0x43, 0xE7, 0xA9, 0xBA, 0x43, + 0xE7, 0xAA, 0x81, 0x43, 0xE7, 0xAA, 0xB1, 0x43, + 0xE7, 0xAB, 0x8B, 0x43, 0xE7, 0xAB, 0xAE, 0x43, + // Bytes 10c0 - 10ff + 0xE7, 0xAB, 0xB9, 0x43, 0xE7, 0xAC, 0xA0, 0x43, + 0xE7, 0xAE, 0x8F, 0x43, 0xE7, 0xAF, 0x80, 0x43, + 0xE7, 0xAF, 0x86, 0x43, 0xE7, 0xAF, 0x89, 0x43, + 0xE7, 0xB0, 0xBE, 0x43, 0xE7, 0xB1, 0xA0, 0x43, + 0xE7, 0xB1, 0xB3, 0x43, 0xE7, 0xB1, 0xBB, 0x43, + 0xE7, 0xB2, 0x92, 0x43, 0xE7, 0xB2, 0xBE, 0x43, + 0xE7, 0xB3, 0x92, 0x43, 0xE7, 0xB3, 0x96, 0x43, + 0xE7, 0xB3, 0xA3, 0x43, 0xE7, 0xB3, 0xA7, 0x43, + // Bytes 1100 - 113f + 0xE7, 0xB3, 0xA8, 0x43, 0xE7, 0xB3, 0xB8, 0x43, + 0xE7, 0xB4, 0x80, 0x43, 0xE7, 0xB4, 0x90, 0x43, + 0xE7, 0xB4, 0xA2, 0x43, 0xE7, 0xB4, 0xAF, 0x43, + 0xE7, 0xB5, 0x82, 0x43, 0xE7, 0xB5, 0x9B, 0x43, + 0xE7, 0xB5, 0xA3, 0x43, 0xE7, 0xB6, 0xA0, 0x43, + 0xE7, 0xB6, 0xBE, 0x43, 0xE7, 0xB7, 0x87, 0x43, + 0xE7, 0xB7, 0xB4, 0x43, 0xE7, 0xB8, 0x82, 0x43, + 0xE7, 0xB8, 0x89, 0x43, 0xE7, 0xB8, 0xB7, 0x43, + // Bytes 1140 - 117f + 0xE7, 0xB9, 0x81, 0x43, 0xE7, 0xB9, 0x85, 0x43, + 0xE7, 0xBC, 0xB6, 0x43, 0xE7, 0xBC, 0xBE, 0x43, + 0xE7, 0xBD, 0x91, 0x43, 0xE7, 0xBD, 0xB2, 0x43, + 0xE7, 0xBD, 0xB9, 0x43, 0xE7, 0xBD, 0xBA, 0x43, + 0xE7, 0xBE, 0x85, 0x43, 0xE7, 0xBE, 0x8A, 0x43, + 0xE7, 0xBE, 0x95, 0x43, 0xE7, 0xBE, 0x9A, 0x43, + 0xE7, 0xBE, 0xBD, 0x43, 0xE7, 0xBF, 0xBA, 0x43, + 0xE8, 0x80, 0x81, 0x43, 0xE8, 0x80, 0x85, 0x43, + // Bytes 1180 - 11bf + 0xE8, 0x80, 0x8C, 0x43, 0xE8, 0x80, 0x92, 0x43, + 0xE8, 0x80, 0xB3, 0x43, 0xE8, 0x81, 0x86, 0x43, + 0xE8, 0x81, 0xA0, 0x43, 0xE8, 0x81, 0xAF, 0x43, + 0xE8, 0x81, 0xB0, 0x43, 0xE8, 0x81, 0xBE, 0x43, + 0xE8, 0x81, 0xBF, 0x43, 0xE8, 0x82, 0x89, 0x43, + 0xE8, 0x82, 0x8B, 0x43, 0xE8, 0x82, 0xAD, 0x43, + 0xE8, 0x82, 0xB2, 0x43, 0xE8, 0x84, 0x83, 0x43, + 0xE8, 0x84, 0xBE, 0x43, 0xE8, 0x87, 0x98, 0x43, + // Bytes 11c0 - 11ff + 0xE8, 0x87, 0xA3, 0x43, 0xE8, 0x87, 0xA8, 0x43, + 0xE8, 0x87, 0xAA, 0x43, 0xE8, 0x87, 0xAD, 0x43, + 0xE8, 0x87, 0xB3, 0x43, 0xE8, 0x87, 0xBC, 0x43, + 0xE8, 0x88, 0x81, 0x43, 0xE8, 0x88, 0x84, 0x43, + 0xE8, 0x88, 0x8C, 0x43, 0xE8, 0x88, 0x98, 0x43, + 0xE8, 0x88, 0x9B, 0x43, 0xE8, 0x88, 0x9F, 0x43, + 0xE8, 0x89, 0xAE, 0x43, 0xE8, 0x89, 0xAF, 0x43, + 0xE8, 0x89, 0xB2, 0x43, 0xE8, 0x89, 0xB8, 0x43, + // Bytes 1200 - 123f + 0xE8, 0x89, 0xB9, 0x43, 0xE8, 0x8A, 0x8B, 0x43, + 0xE8, 0x8A, 0x91, 0x43, 0xE8, 0x8A, 0x9D, 0x43, + 0xE8, 0x8A, 0xB1, 0x43, 0xE8, 0x8A, 0xB3, 0x43, + 0xE8, 0x8A, 0xBD, 0x43, 0xE8, 0x8B, 0xA5, 0x43, + 0xE8, 0x8B, 0xA6, 0x43, 0xE8, 0x8C, 0x9D, 0x43, + 0xE8, 0x8C, 0xA3, 0x43, 0xE8, 0x8C, 0xB6, 0x43, + 0xE8, 0x8D, 0x92, 0x43, 0xE8, 0x8D, 0x93, 0x43, + 0xE8, 0x8D, 0xA3, 0x43, 0xE8, 0x8E, 0xAD, 0x43, + // Bytes 1240 - 127f + 0xE8, 0x8E, 0xBD, 0x43, 0xE8, 0x8F, 0x89, 0x43, + 0xE8, 0x8F, 0x8A, 0x43, 0xE8, 0x8F, 0x8C, 0x43, + 0xE8, 0x8F, 0x9C, 0x43, 0xE8, 0x8F, 0xA7, 0x43, + 0xE8, 0x8F, 0xAF, 0x43, 0xE8, 0x8F, 0xB1, 0x43, + 0xE8, 0x90, 0xBD, 0x43, 0xE8, 0x91, 0x89, 0x43, + 0xE8, 0x91, 0x97, 0x43, 0xE8, 0x93, 0xAE, 0x43, + 0xE8, 0x93, 0xB1, 0x43, 0xE8, 0x93, 0xB3, 0x43, + 0xE8, 0x93, 0xBC, 0x43, 0xE8, 0x94, 0x96, 0x43, + // Bytes 1280 - 12bf + 0xE8, 0x95, 0xA4, 0x43, 0xE8, 0x97, 0x8D, 0x43, + 0xE8, 0x97, 0xBA, 0x43, 0xE8, 0x98, 0x86, 0x43, + 0xE8, 0x98, 0x92, 0x43, 0xE8, 0x98, 0xAD, 0x43, + 0xE8, 0x98, 0xBF, 0x43, 0xE8, 0x99, 0x8D, 0x43, + 0xE8, 0x99, 0x90, 0x43, 0xE8, 0x99, 0x9C, 0x43, + 0xE8, 0x99, 0xA7, 0x43, 0xE8, 0x99, 0xA9, 0x43, + 0xE8, 0x99, 0xAB, 0x43, 0xE8, 0x9A, 0x88, 0x43, + 0xE8, 0x9A, 0xA9, 0x43, 0xE8, 0x9B, 0xA2, 0x43, + // Bytes 12c0 - 12ff + 0xE8, 0x9C, 0x8E, 0x43, 0xE8, 0x9C, 0xA8, 0x43, + 0xE8, 0x9D, 0xAB, 0x43, 0xE8, 0x9D, 0xB9, 0x43, + 0xE8, 0x9E, 0x86, 0x43, 0xE8, 0x9E, 0xBA, 0x43, + 0xE8, 0x9F, 0xA1, 0x43, 0xE8, 0xA0, 0x81, 0x43, + 0xE8, 0xA0, 0x9F, 0x43, 0xE8, 0xA1, 0x80, 0x43, + 0xE8, 0xA1, 0x8C, 0x43, 0xE8, 0xA1, 0xA0, 0x43, + 0xE8, 0xA1, 0xA3, 0x43, 0xE8, 0xA3, 0x82, 0x43, + 0xE8, 0xA3, 0x8F, 0x43, 0xE8, 0xA3, 0x97, 0x43, + // Bytes 1300 - 133f + 0xE8, 0xA3, 0x9E, 0x43, 0xE8, 0xA3, 0xA1, 0x43, + 0xE8, 0xA3, 0xB8, 0x43, 0xE8, 0xA3, 0xBA, 0x43, + 0xE8, 0xA4, 0x90, 0x43, 0xE8, 0xA5, 0x81, 0x43, + 0xE8, 0xA5, 0xA4, 0x43, 0xE8, 0xA5, 0xBE, 0x43, + 0xE8, 0xA6, 0x86, 0x43, 0xE8, 0xA6, 0x8B, 0x43, + 0xE8, 0xA6, 0x96, 0x43, 0xE8, 0xA7, 0x92, 0x43, + 0xE8, 0xA7, 0xA3, 0x43, 0xE8, 0xA8, 0x80, 0x43, + 0xE8, 0xAA, 0xA0, 0x43, 0xE8, 0xAA, 0xAA, 0x43, + // Bytes 1340 - 137f + 0xE8, 0xAA, 0xBF, 0x43, 0xE8, 0xAB, 0x8B, 0x43, + 0xE8, 0xAB, 0x92, 0x43, 0xE8, 0xAB, 0x96, 0x43, + 0xE8, 0xAB, 0xAD, 0x43, 0xE8, 0xAB, 0xB8, 0x43, + 0xE8, 0xAB, 0xBE, 0x43, 0xE8, 0xAC, 0x81, 0x43, + 0xE8, 0xAC, 0xB9, 0x43, 0xE8, 0xAD, 0x98, 0x43, + 0xE8, 0xAE, 0x80, 0x43, 0xE8, 0xAE, 0x8A, 0x43, + 0xE8, 0xB0, 0xB7, 0x43, 0xE8, 0xB1, 0x86, 0x43, + 0xE8, 0xB1, 0x88, 0x43, 0xE8, 0xB1, 0x95, 0x43, + // Bytes 1380 - 13bf + 0xE8, 0xB1, 0xB8, 0x43, 0xE8, 0xB2, 0x9D, 0x43, + 0xE8, 0xB2, 0xA1, 0x43, 0xE8, 0xB2, 0xA9, 0x43, + 0xE8, 0xB2, 0xAB, 0x43, 0xE8, 0xB3, 0x81, 0x43, + 0xE8, 0xB3, 0x82, 0x43, 0xE8, 0xB3, 0x87, 0x43, + 0xE8, 0xB3, 0x88, 0x43, 0xE8, 0xB3, 0x93, 0x43, + 0xE8, 0xB4, 0x88, 0x43, 0xE8, 0xB4, 0x9B, 0x43, + 0xE8, 0xB5, 0xA4, 0x43, 0xE8, 0xB5, 0xB0, 0x43, + 0xE8, 0xB5, 0xB7, 0x43, 0xE8, 0xB6, 0xB3, 0x43, + // Bytes 13c0 - 13ff + 0xE8, 0xB6, 0xBC, 0x43, 0xE8, 0xB7, 0x8B, 0x43, + 0xE8, 0xB7, 0xAF, 0x43, 0xE8, 0xB7, 0xB0, 0x43, + 0xE8, 0xBA, 0xAB, 0x43, 0xE8, 0xBB, 0x8A, 0x43, + 0xE8, 0xBB, 0x94, 0x43, 0xE8, 0xBC, 0xA6, 0x43, + 0xE8, 0xBC, 0xAA, 0x43, 0xE8, 0xBC, 0xB8, 0x43, + 0xE8, 0xBC, 0xBB, 0x43, 0xE8, 0xBD, 0xA2, 0x43, + 0xE8, 0xBE, 0x9B, 0x43, 0xE8, 0xBE, 0x9E, 0x43, + 0xE8, 0xBE, 0xB0, 0x43, 0xE8, 0xBE, 0xB5, 0x43, + // Bytes 1400 - 143f + 0xE8, 0xBE, 0xB6, 0x43, 0xE9, 0x80, 0xA3, 0x43, + 0xE9, 0x80, 0xB8, 0x43, 0xE9, 0x81, 0x8A, 0x43, + 0xE9, 0x81, 0xA9, 0x43, 0xE9, 0x81, 0xB2, 0x43, + 0xE9, 0x81, 0xBC, 0x43, 0xE9, 0x82, 0x8F, 0x43, + 0xE9, 0x82, 0x91, 0x43, 0xE9, 0x82, 0x94, 0x43, + 0xE9, 0x83, 0x8E, 0x43, 0xE9, 0x83, 0x9E, 0x43, + 0xE9, 0x83, 0xB1, 0x43, 0xE9, 0x83, 0xBD, 0x43, + 0xE9, 0x84, 0x91, 0x43, 0xE9, 0x84, 0x9B, 0x43, + // Bytes 1440 - 147f + 0xE9, 0x85, 0x89, 0x43, 0xE9, 0x85, 0x8D, 0x43, + 0xE9, 0x85, 0xAA, 0x43, 0xE9, 0x86, 0x99, 0x43, + 0xE9, 0x86, 0xB4, 0x43, 0xE9, 0x87, 0x86, 0x43, + 0xE9, 0x87, 0x8C, 0x43, 0xE9, 0x87, 0x8F, 0x43, + 0xE9, 0x87, 0x91, 0x43, 0xE9, 0x88, 0xB4, 0x43, + 0xE9, 0x88, 0xB8, 0x43, 0xE9, 0x89, 0xB6, 0x43, + 0xE9, 0x89, 0xBC, 0x43, 0xE9, 0x8B, 0x97, 0x43, + 0xE9, 0x8B, 0x98, 0x43, 0xE9, 0x8C, 0x84, 0x43, + // Bytes 1480 - 14bf + 0xE9, 0x8D, 0x8A, 0x43, 0xE9, 0x8F, 0xB9, 0x43, + 0xE9, 0x90, 0x95, 0x43, 0xE9, 0x95, 0xB7, 0x43, + 0xE9, 0x96, 0x80, 0x43, 0xE9, 0x96, 0x8B, 0x43, + 0xE9, 0x96, 0xAD, 0x43, 0xE9, 0x96, 0xB7, 0x43, + 0xE9, 0x98, 0x9C, 0x43, 0xE9, 0x98, 0xAE, 0x43, + 0xE9, 0x99, 0x8B, 0x43, 0xE9, 0x99, 0x8D, 0x43, + 0xE9, 0x99, 0xB5, 0x43, 0xE9, 0x99, 0xB8, 0x43, + 0xE9, 0x99, 0xBC, 0x43, 0xE9, 0x9A, 0x86, 0x43, + // Bytes 14c0 - 14ff + 0xE9, 0x9A, 0xA3, 0x43, 0xE9, 0x9A, 0xB6, 0x43, + 0xE9, 0x9A, 0xB7, 0x43, 0xE9, 0x9A, 0xB8, 0x43, + 0xE9, 0x9A, 0xB9, 0x43, 0xE9, 0x9B, 0x83, 0x43, + 0xE9, 0x9B, 0xA2, 0x43, 0xE9, 0x9B, 0xA3, 0x43, + 0xE9, 0x9B, 0xA8, 0x43, 0xE9, 0x9B, 0xB6, 0x43, + 0xE9, 0x9B, 0xB7, 0x43, 0xE9, 0x9C, 0xA3, 0x43, + 0xE9, 0x9C, 0xB2, 0x43, 0xE9, 0x9D, 0x88, 0x43, + 0xE9, 0x9D, 0x91, 0x43, 0xE9, 0x9D, 0x96, 0x43, + // Bytes 1500 - 153f + 0xE9, 0x9D, 0x9E, 0x43, 0xE9, 0x9D, 0xA2, 0x43, + 0xE9, 0x9D, 0xA9, 0x43, 0xE9, 0x9F, 0x8B, 0x43, + 0xE9, 0x9F, 0x9B, 0x43, 0xE9, 0x9F, 0xA0, 0x43, + 0xE9, 0x9F, 0xAD, 0x43, 0xE9, 0x9F, 0xB3, 0x43, + 0xE9, 0x9F, 0xBF, 0x43, 0xE9, 0xA0, 0x81, 0x43, + 0xE9, 0xA0, 0x85, 0x43, 0xE9, 0xA0, 0x8B, 0x43, + 0xE9, 0xA0, 0x98, 0x43, 0xE9, 0xA0, 0xA9, 0x43, + 0xE9, 0xA0, 0xBB, 0x43, 0xE9, 0xA1, 0x9E, 0x43, + // Bytes 1540 - 157f + 0xE9, 0xA2, 0xA8, 0x43, 0xE9, 0xA3, 0x9B, 0x43, + 0xE9, 0xA3, 0x9F, 0x43, 0xE9, 0xA3, 0xA2, 0x43, + 0xE9, 0xA3, 0xAF, 0x43, 0xE9, 0xA3, 0xBC, 0x43, + 0xE9, 0xA4, 0xA8, 0x43, 0xE9, 0xA4, 0xA9, 0x43, + 0xE9, 0xA6, 0x96, 0x43, 0xE9, 0xA6, 0x99, 0x43, + 0xE9, 0xA6, 0xA7, 0x43, 0xE9, 0xA6, 0xAC, 0x43, + 0xE9, 0xA7, 0x82, 0x43, 0xE9, 0xA7, 0xB1, 0x43, + 0xE9, 0xA7, 0xBE, 0x43, 0xE9, 0xA9, 0xAA, 0x43, + // Bytes 1580 - 15bf + 0xE9, 0xAA, 0xA8, 0x43, 0xE9, 0xAB, 0x98, 0x43, + 0xE9, 0xAB, 0x9F, 0x43, 0xE9, 0xAC, 0x92, 0x43, + 0xE9, 0xAC, 0xA5, 0x43, 0xE9, 0xAC, 0xAF, 0x43, + 0xE9, 0xAC, 0xB2, 0x43, 0xE9, 0xAC, 0xBC, 0x43, + 0xE9, 0xAD, 0x9A, 0x43, 0xE9, 0xAD, 0xAF, 0x43, + 0xE9, 0xB1, 0x80, 0x43, 0xE9, 0xB1, 0x97, 0x43, + 0xE9, 0xB3, 0xA5, 0x43, 0xE9, 0xB3, 0xBD, 0x43, + 0xE9, 0xB5, 0xA7, 0x43, 0xE9, 0xB6, 0xB4, 0x43, + // Bytes 15c0 - 15ff + 0xE9, 0xB7, 0xBA, 0x43, 0xE9, 0xB8, 0x9E, 0x43, + 0xE9, 0xB9, 0xB5, 0x43, 0xE9, 0xB9, 0xBF, 0x43, + 0xE9, 0xBA, 0x97, 0x43, 0xE9, 0xBA, 0x9F, 0x43, + 0xE9, 0xBA, 0xA5, 0x43, 0xE9, 0xBA, 0xBB, 0x43, + 0xE9, 0xBB, 0x83, 0x43, 0xE9, 0xBB, 0x8D, 0x43, + 0xE9, 0xBB, 0x8E, 0x43, 0xE9, 0xBB, 0x91, 0x43, + 0xE9, 0xBB, 0xB9, 0x43, 0xE9, 0xBB, 0xBD, 0x43, + 0xE9, 0xBB, 0xBE, 0x43, 0xE9, 0xBC, 0x85, 0x43, + // Bytes 1600 - 163f + 0xE9, 0xBC, 0x8E, 0x43, 0xE9, 0xBC, 0x8F, 0x43, + 0xE9, 0xBC, 0x93, 0x43, 0xE9, 0xBC, 0x96, 0x43, + 0xE9, 0xBC, 0xA0, 0x43, 0xE9, 0xBC, 0xBB, 0x43, + 0xE9, 0xBD, 0x83, 0x43, 0xE9, 0xBD, 0x8A, 0x43, + 0xE9, 0xBD, 0x92, 0x43, 0xE9, 0xBE, 0x8D, 0x43, + 0xE9, 0xBE, 0x8E, 0x43, 0xE9, 0xBE, 0x9C, 0x43, + 0xE9, 0xBE, 0x9F, 0x43, 0xE9, 0xBE, 0xA0, 0x43, + 0xEA, 0x9C, 0xA7, 0x43, 0xEA, 0x9D, 0xAF, 0x43, + // Bytes 1640 - 167f + 0xEA, 0xAC, 0xB7, 0x43, 0xEA, 0xAD, 0x92, 0x44, + 0xF0, 0xA0, 0x84, 0xA2, 0x44, 0xF0, 0xA0, 0x94, + 0x9C, 0x44, 0xF0, 0xA0, 0x94, 0xA5, 0x44, 0xF0, + 0xA0, 0x95, 0x8B, 0x44, 0xF0, 0xA0, 0x98, 0xBA, + 0x44, 0xF0, 0xA0, 0xA0, 0x84, 0x44, 0xF0, 0xA0, + 0xA3, 0x9E, 0x44, 0xF0, 0xA0, 0xA8, 0xAC, 0x44, + 0xF0, 0xA0, 0xAD, 0xA3, 0x44, 0xF0, 0xA1, 0x93, + 0xA4, 0x44, 0xF0, 0xA1, 0x9A, 0xA8, 0x44, 0xF0, + // Bytes 1680 - 16bf + 0xA1, 0x9B, 0xAA, 0x44, 0xF0, 0xA1, 0xA7, 0x88, + 0x44, 0xF0, 0xA1, 0xAC, 0x98, 0x44, 0xF0, 0xA1, + 0xB4, 0x8B, 0x44, 0xF0, 0xA1, 0xB7, 0xA4, 0x44, + 0xF0, 0xA1, 0xB7, 0xA6, 0x44, 0xF0, 0xA2, 0x86, + 0x83, 0x44, 0xF0, 0xA2, 0x86, 0x9F, 0x44, 0xF0, + 0xA2, 0x8C, 0xB1, 0x44, 0xF0, 0xA2, 0x9B, 0x94, + 0x44, 0xF0, 0xA2, 0xA1, 0x84, 0x44, 0xF0, 0xA2, + 0xA1, 0x8A, 0x44, 0xF0, 0xA2, 0xAC, 0x8C, 0x44, + // Bytes 16c0 - 16ff + 0xF0, 0xA2, 0xAF, 0xB1, 0x44, 0xF0, 0xA3, 0x80, + 0x8A, 0x44, 0xF0, 0xA3, 0x8A, 0xB8, 0x44, 0xF0, + 0xA3, 0x8D, 0x9F, 0x44, 0xF0, 0xA3, 0x8E, 0x93, + 0x44, 0xF0, 0xA3, 0x8E, 0x9C, 0x44, 0xF0, 0xA3, + 0x8F, 0x83, 0x44, 0xF0, 0xA3, 0x8F, 0x95, 0x44, + 0xF0, 0xA3, 0x91, 0xAD, 0x44, 0xF0, 0xA3, 0x9A, + 0xA3, 0x44, 0xF0, 0xA3, 0xA2, 0xA7, 0x44, 0xF0, + 0xA3, 0xAA, 0x8D, 0x44, 0xF0, 0xA3, 0xAB, 0xBA, + // Bytes 1700 - 173f + 0x44, 0xF0, 0xA3, 0xB2, 0xBC, 0x44, 0xF0, 0xA3, + 0xB4, 0x9E, 0x44, 0xF0, 0xA3, 0xBB, 0x91, 0x44, + 0xF0, 0xA3, 0xBD, 0x9E, 0x44, 0xF0, 0xA3, 0xBE, + 0x8E, 0x44, 0xF0, 0xA4, 0x89, 0xA3, 0x44, 0xF0, + 0xA4, 0x8B, 0xAE, 0x44, 0xF0, 0xA4, 0x8E, 0xAB, + 0x44, 0xF0, 0xA4, 0x98, 0x88, 0x44, 0xF0, 0xA4, + 0x9C, 0xB5, 0x44, 0xF0, 0xA4, 0xA0, 0x94, 0x44, + 0xF0, 0xA4, 0xB0, 0xB6, 0x44, 0xF0, 0xA4, 0xB2, + // Bytes 1740 - 177f + 0x92, 0x44, 0xF0, 0xA4, 0xBE, 0xA1, 0x44, 0xF0, + 0xA4, 0xBE, 0xB8, 0x44, 0xF0, 0xA5, 0x81, 0x84, + 0x44, 0xF0, 0xA5, 0x83, 0xB2, 0x44, 0xF0, 0xA5, + 0x83, 0xB3, 0x44, 0xF0, 0xA5, 0x84, 0x99, 0x44, + 0xF0, 0xA5, 0x84, 0xB3, 0x44, 0xF0, 0xA5, 0x89, + 0x89, 0x44, 0xF0, 0xA5, 0x90, 0x9D, 0x44, 0xF0, + 0xA5, 0x98, 0xA6, 0x44, 0xF0, 0xA5, 0x9A, 0x9A, + 0x44, 0xF0, 0xA5, 0x9B, 0x85, 0x44, 0xF0, 0xA5, + // Bytes 1780 - 17bf + 0xA5, 0xBC, 0x44, 0xF0, 0xA5, 0xAA, 0xA7, 0x44, + 0xF0, 0xA5, 0xAE, 0xAB, 0x44, 0xF0, 0xA5, 0xB2, + 0x80, 0x44, 0xF0, 0xA5, 0xB3, 0x90, 0x44, 0xF0, + 0xA5, 0xBE, 0x86, 0x44, 0xF0, 0xA6, 0x87, 0x9A, + 0x44, 0xF0, 0xA6, 0x88, 0xA8, 0x44, 0xF0, 0xA6, + 0x89, 0x87, 0x44, 0xF0, 0xA6, 0x8B, 0x99, 0x44, + 0xF0, 0xA6, 0x8C, 0xBE, 0x44, 0xF0, 0xA6, 0x93, + 0x9A, 0x44, 0xF0, 0xA6, 0x94, 0xA3, 0x44, 0xF0, + // Bytes 17c0 - 17ff + 0xA6, 0x96, 0xA8, 0x44, 0xF0, 0xA6, 0x9E, 0xA7, + 0x44, 0xF0, 0xA6, 0x9E, 0xB5, 0x44, 0xF0, 0xA6, + 0xAC, 0xBC, 0x44, 0xF0, 0xA6, 0xB0, 0xB6, 0x44, + 0xF0, 0xA6, 0xB3, 0x95, 0x44, 0xF0, 0xA6, 0xB5, + 0xAB, 0x44, 0xF0, 0xA6, 0xBC, 0xAC, 0x44, 0xF0, + 0xA6, 0xBE, 0xB1, 0x44, 0xF0, 0xA7, 0x83, 0x92, + 0x44, 0xF0, 0xA7, 0x8F, 0x8A, 0x44, 0xF0, 0xA7, + 0x99, 0xA7, 0x44, 0xF0, 0xA7, 0xA2, 0xAE, 0x44, + // Bytes 1800 - 183f + 0xF0, 0xA7, 0xA5, 0xA6, 0x44, 0xF0, 0xA7, 0xB2, + 0xA8, 0x44, 0xF0, 0xA7, 0xBB, 0x93, 0x44, 0xF0, + 0xA7, 0xBC, 0xAF, 0x44, 0xF0, 0xA8, 0x97, 0x92, + 0x44, 0xF0, 0xA8, 0x97, 0xAD, 0x44, 0xF0, 0xA8, + 0x9C, 0xAE, 0x44, 0xF0, 0xA8, 0xAF, 0xBA, 0x44, + 0xF0, 0xA8, 0xB5, 0xB7, 0x44, 0xF0, 0xA9, 0x85, + 0x85, 0x44, 0xF0, 0xA9, 0x87, 0x9F, 0x44, 0xF0, + 0xA9, 0x88, 0x9A, 0x44, 0xF0, 0xA9, 0x90, 0x8A, + // Bytes 1840 - 187f + 0x44, 0xF0, 0xA9, 0x92, 0x96, 0x44, 0xF0, 0xA9, + 0x96, 0xB6, 0x44, 0xF0, 0xA9, 0xAC, 0xB0, 0x44, + 0xF0, 0xAA, 0x83, 0x8E, 0x44, 0xF0, 0xAA, 0x84, + 0x85, 0x44, 0xF0, 0xAA, 0x88, 0x8E, 0x44, 0xF0, + 0xAA, 0x8A, 0x91, 0x44, 0xF0, 0xAA, 0x8E, 0x92, + 0x44, 0xF0, 0xAA, 0x98, 0x80, 0x42, 0x21, 0x21, + 0x42, 0x21, 0x3F, 0x42, 0x2E, 0x2E, 0x42, 0x30, + 0x2C, 0x42, 0x30, 0x2E, 0x42, 0x31, 0x2C, 0x42, + // Bytes 1880 - 18bf + 0x31, 0x2E, 0x42, 0x31, 0x30, 0x42, 0x31, 0x31, + 0x42, 0x31, 0x32, 0x42, 0x31, 0x33, 0x42, 0x31, + 0x34, 0x42, 0x31, 0x35, 0x42, 0x31, 0x36, 0x42, + 0x31, 0x37, 0x42, 0x31, 0x38, 0x42, 0x31, 0x39, + 0x42, 0x32, 0x2C, 0x42, 0x32, 0x2E, 0x42, 0x32, + 0x30, 0x42, 0x32, 0x31, 0x42, 0x32, 0x32, 0x42, + 0x32, 0x33, 0x42, 0x32, 0x34, 0x42, 0x32, 0x35, + 0x42, 0x32, 0x36, 0x42, 0x32, 0x37, 0x42, 0x32, + // Bytes 18c0 - 18ff + 0x38, 0x42, 0x32, 0x39, 0x42, 0x33, 0x2C, 0x42, + 0x33, 0x2E, 0x42, 0x33, 0x30, 0x42, 0x33, 0x31, + 0x42, 0x33, 0x32, 0x42, 0x33, 0x33, 0x42, 0x33, + 0x34, 0x42, 0x33, 0x35, 0x42, 0x33, 0x36, 0x42, + 0x33, 0x37, 0x42, 0x33, 0x38, 0x42, 0x33, 0x39, + 0x42, 0x34, 0x2C, 0x42, 0x34, 0x2E, 0x42, 0x34, + 0x30, 0x42, 0x34, 0x31, 0x42, 0x34, 0x32, 0x42, + 0x34, 0x33, 0x42, 0x34, 0x34, 0x42, 0x34, 0x35, + // Bytes 1900 - 193f + 0x42, 0x34, 0x36, 0x42, 0x34, 0x37, 0x42, 0x34, + 0x38, 0x42, 0x34, 0x39, 0x42, 0x35, 0x2C, 0x42, + 0x35, 0x2E, 0x42, 0x35, 0x30, 0x42, 0x36, 0x2C, + 0x42, 0x36, 0x2E, 0x42, 0x37, 0x2C, 0x42, 0x37, + 0x2E, 0x42, 0x38, 0x2C, 0x42, 0x38, 0x2E, 0x42, + 0x39, 0x2C, 0x42, 0x39, 0x2E, 0x42, 0x3D, 0x3D, + 0x42, 0x3F, 0x21, 0x42, 0x3F, 0x3F, 0x42, 0x41, + 0x55, 0x42, 0x42, 0x71, 0x42, 0x43, 0x44, 0x42, + // Bytes 1940 - 197f + 0x44, 0x4A, 0x42, 0x44, 0x5A, 0x42, 0x44, 0x7A, + 0x42, 0x47, 0x42, 0x42, 0x47, 0x79, 0x42, 0x48, + 0x50, 0x42, 0x48, 0x56, 0x42, 0x48, 0x67, 0x42, + 0x48, 0x7A, 0x42, 0x49, 0x49, 0x42, 0x49, 0x4A, + 0x42, 0x49, 0x55, 0x42, 0x49, 0x56, 0x42, 0x49, + 0x58, 0x42, 0x4B, 0x42, 0x42, 0x4B, 0x4B, 0x42, + 0x4B, 0x4D, 0x42, 0x4C, 0x4A, 0x42, 0x4C, 0x6A, + 0x42, 0x4D, 0x42, 0x42, 0x4D, 0x43, 0x42, 0x4D, + // Bytes 1980 - 19bf + 0x44, 0x42, 0x4D, 0x56, 0x42, 0x4D, 0x57, 0x42, + 0x4E, 0x4A, 0x42, 0x4E, 0x6A, 0x42, 0x4E, 0x6F, + 0x42, 0x50, 0x48, 0x42, 0x50, 0x52, 0x42, 0x50, + 0x61, 0x42, 0x52, 0x73, 0x42, 0x53, 0x44, 0x42, + 0x53, 0x4D, 0x42, 0x53, 0x53, 0x42, 0x53, 0x76, + 0x42, 0x54, 0x4D, 0x42, 0x56, 0x49, 0x42, 0x57, + 0x43, 0x42, 0x57, 0x5A, 0x42, 0x57, 0x62, 0x42, + 0x58, 0x49, 0x42, 0x63, 0x63, 0x42, 0x63, 0x64, + // Bytes 19c0 - 19ff + 0x42, 0x63, 0x6D, 0x42, 0x64, 0x42, 0x42, 0x64, + 0x61, 0x42, 0x64, 0x6C, 0x42, 0x64, 0x6D, 0x42, + 0x64, 0x7A, 0x42, 0x65, 0x56, 0x42, 0x66, 0x66, + 0x42, 0x66, 0x69, 0x42, 0x66, 0x6C, 0x42, 0x66, + 0x6D, 0x42, 0x68, 0x61, 0x42, 0x69, 0x69, 0x42, + 0x69, 0x6A, 0x42, 0x69, 0x6E, 0x42, 0x69, 0x76, + 0x42, 0x69, 0x78, 0x42, 0x6B, 0x41, 0x42, 0x6B, + 0x56, 0x42, 0x6B, 0x57, 0x42, 0x6B, 0x67, 0x42, + // Bytes 1a00 - 1a3f + 0x6B, 0x6C, 0x42, 0x6B, 0x6D, 0x42, 0x6B, 0x74, + 0x42, 0x6C, 0x6A, 0x42, 0x6C, 0x6D, 0x42, 0x6C, + 0x6E, 0x42, 0x6C, 0x78, 0x42, 0x6D, 0x32, 0x42, + 0x6D, 0x33, 0x42, 0x6D, 0x41, 0x42, 0x6D, 0x56, + 0x42, 0x6D, 0x57, 0x42, 0x6D, 0x62, 0x42, 0x6D, + 0x67, 0x42, 0x6D, 0x6C, 0x42, 0x6D, 0x6D, 0x42, + 0x6D, 0x73, 0x42, 0x6E, 0x41, 0x42, 0x6E, 0x46, + 0x42, 0x6E, 0x56, 0x42, 0x6E, 0x57, 0x42, 0x6E, + // Bytes 1a40 - 1a7f + 0x6A, 0x42, 0x6E, 0x6D, 0x42, 0x6E, 0x73, 0x42, + 0x6F, 0x56, 0x42, 0x70, 0x41, 0x42, 0x70, 0x46, + 0x42, 0x70, 0x56, 0x42, 0x70, 0x57, 0x42, 0x70, + 0x63, 0x42, 0x70, 0x73, 0x42, 0x73, 0x72, 0x42, + 0x73, 0x74, 0x42, 0x76, 0x69, 0x42, 0x78, 0x69, + 0x43, 0x28, 0x31, 0x29, 0x43, 0x28, 0x32, 0x29, + 0x43, 0x28, 0x33, 0x29, 0x43, 0x28, 0x34, 0x29, + 0x43, 0x28, 0x35, 0x29, 0x43, 0x28, 0x36, 0x29, + // Bytes 1a80 - 1abf + 0x43, 0x28, 0x37, 0x29, 0x43, 0x28, 0x38, 0x29, + 0x43, 0x28, 0x39, 0x29, 0x43, 0x28, 0x41, 0x29, + 0x43, 0x28, 0x42, 0x29, 0x43, 0x28, 0x43, 0x29, + 0x43, 0x28, 0x44, 0x29, 0x43, 0x28, 0x45, 0x29, + 0x43, 0x28, 0x46, 0x29, 0x43, 0x28, 0x47, 0x29, + 0x43, 0x28, 0x48, 0x29, 0x43, 0x28, 0x49, 0x29, + 0x43, 0x28, 0x4A, 0x29, 0x43, 0x28, 0x4B, 0x29, + 0x43, 0x28, 0x4C, 0x29, 0x43, 0x28, 0x4D, 0x29, + // Bytes 1ac0 - 1aff + 0x43, 0x28, 0x4E, 0x29, 0x43, 0x28, 0x4F, 0x29, + 0x43, 0x28, 0x50, 0x29, 0x43, 0x28, 0x51, 0x29, + 0x43, 0x28, 0x52, 0x29, 0x43, 0x28, 0x53, 0x29, + 0x43, 0x28, 0x54, 0x29, 0x43, 0x28, 0x55, 0x29, + 0x43, 0x28, 0x56, 0x29, 0x43, 0x28, 0x57, 0x29, + 0x43, 0x28, 0x58, 0x29, 0x43, 0x28, 0x59, 0x29, + 0x43, 0x28, 0x5A, 0x29, 0x43, 0x28, 0x61, 0x29, + 0x43, 0x28, 0x62, 0x29, 0x43, 0x28, 0x63, 0x29, + // Bytes 1b00 - 1b3f + 0x43, 0x28, 0x64, 0x29, 0x43, 0x28, 0x65, 0x29, + 0x43, 0x28, 0x66, 0x29, 0x43, 0x28, 0x67, 0x29, + 0x43, 0x28, 0x68, 0x29, 0x43, 0x28, 0x69, 0x29, + 0x43, 0x28, 0x6A, 0x29, 0x43, 0x28, 0x6B, 0x29, + 0x43, 0x28, 0x6C, 0x29, 0x43, 0x28, 0x6D, 0x29, + 0x43, 0x28, 0x6E, 0x29, 0x43, 0x28, 0x6F, 0x29, + 0x43, 0x28, 0x70, 0x29, 0x43, 0x28, 0x71, 0x29, + 0x43, 0x28, 0x72, 0x29, 0x43, 0x28, 0x73, 0x29, + // Bytes 1b40 - 1b7f + 0x43, 0x28, 0x74, 0x29, 0x43, 0x28, 0x75, 0x29, + 0x43, 0x28, 0x76, 0x29, 0x43, 0x28, 0x77, 0x29, + 0x43, 0x28, 0x78, 0x29, 0x43, 0x28, 0x79, 0x29, + 0x43, 0x28, 0x7A, 0x29, 0x43, 0x2E, 0x2E, 0x2E, + 0x43, 0x31, 0x30, 0x2E, 0x43, 0x31, 0x31, 0x2E, + 0x43, 0x31, 0x32, 0x2E, 0x43, 0x31, 0x33, 0x2E, + 0x43, 0x31, 0x34, 0x2E, 0x43, 0x31, 0x35, 0x2E, + 0x43, 0x31, 0x36, 0x2E, 0x43, 0x31, 0x37, 0x2E, + // Bytes 1b80 - 1bbf + 0x43, 0x31, 0x38, 0x2E, 0x43, 0x31, 0x39, 0x2E, + 0x43, 0x32, 0x30, 0x2E, 0x43, 0x3A, 0x3A, 0x3D, + 0x43, 0x3D, 0x3D, 0x3D, 0x43, 0x43, 0x6F, 0x2E, + 0x43, 0x46, 0x41, 0x58, 0x43, 0x47, 0x48, 0x7A, + 0x43, 0x47, 0x50, 0x61, 0x43, 0x49, 0x49, 0x49, + 0x43, 0x4C, 0x54, 0x44, 0x43, 0x4C, 0xC2, 0xB7, + 0x43, 0x4D, 0x48, 0x7A, 0x43, 0x4D, 0x50, 0x61, + 0x43, 0x4D, 0xCE, 0xA9, 0x43, 0x50, 0x50, 0x4D, + // Bytes 1bc0 - 1bff + 0x43, 0x50, 0x50, 0x56, 0x43, 0x50, 0x54, 0x45, + 0x43, 0x54, 0x45, 0x4C, 0x43, 0x54, 0x48, 0x7A, + 0x43, 0x56, 0x49, 0x49, 0x43, 0x58, 0x49, 0x49, + 0x43, 0x61, 0x2F, 0x63, 0x43, 0x61, 0x2F, 0x73, + 0x43, 0x61, 0xCA, 0xBE, 0x43, 0x62, 0x61, 0x72, + 0x43, 0x63, 0x2F, 0x6F, 0x43, 0x63, 0x2F, 0x75, + 0x43, 0x63, 0x61, 0x6C, 0x43, 0x63, 0x6D, 0x32, + 0x43, 0x63, 0x6D, 0x33, 0x43, 0x64, 0x6D, 0x32, + // Bytes 1c00 - 1c3f + 0x43, 0x64, 0x6D, 0x33, 0x43, 0x65, 0x72, 0x67, + 0x43, 0x66, 0x66, 0x69, 0x43, 0x66, 0x66, 0x6C, + 0x43, 0x67, 0x61, 0x6C, 0x43, 0x68, 0x50, 0x61, + 0x43, 0x69, 0x69, 0x69, 0x43, 0x6B, 0x48, 0x7A, + 0x43, 0x6B, 0x50, 0x61, 0x43, 0x6B, 0x6D, 0x32, + 0x43, 0x6B, 0x6D, 0x33, 0x43, 0x6B, 0xCE, 0xA9, + 0x43, 0x6C, 0x6F, 0x67, 0x43, 0x6C, 0xC2, 0xB7, + 0x43, 0x6D, 0x69, 0x6C, 0x43, 0x6D, 0x6D, 0x32, + // Bytes 1c40 - 1c7f + 0x43, 0x6D, 0x6D, 0x33, 0x43, 0x6D, 0x6F, 0x6C, + 0x43, 0x72, 0x61, 0x64, 0x43, 0x76, 0x69, 0x69, + 0x43, 0x78, 0x69, 0x69, 0x43, 0xC2, 0xB0, 0x43, + 0x43, 0xC2, 0xB0, 0x46, 0x43, 0xCA, 0xBC, 0x6E, + 0x43, 0xCE, 0xBC, 0x41, 0x43, 0xCE, 0xBC, 0x46, + 0x43, 0xCE, 0xBC, 0x56, 0x43, 0xCE, 0xBC, 0x57, + 0x43, 0xCE, 0xBC, 0x67, 0x43, 0xCE, 0xBC, 0x6C, + 0x43, 0xCE, 0xBC, 0x6D, 0x43, 0xCE, 0xBC, 0x73, + // Bytes 1c80 - 1cbf + 0x44, 0x28, 0x31, 0x30, 0x29, 0x44, 0x28, 0x31, + 0x31, 0x29, 0x44, 0x28, 0x31, 0x32, 0x29, 0x44, + 0x28, 0x31, 0x33, 0x29, 0x44, 0x28, 0x31, 0x34, + 0x29, 0x44, 0x28, 0x31, 0x35, 0x29, 0x44, 0x28, + 0x31, 0x36, 0x29, 0x44, 0x28, 0x31, 0x37, 0x29, + 0x44, 0x28, 0x31, 0x38, 0x29, 0x44, 0x28, 0x31, + 0x39, 0x29, 0x44, 0x28, 0x32, 0x30, 0x29, 0x44, + 0x30, 0xE7, 0x82, 0xB9, 0x44, 0x31, 0xE2, 0x81, + // Bytes 1cc0 - 1cff + 0x84, 0x44, 0x31, 0xE6, 0x97, 0xA5, 0x44, 0x31, + 0xE6, 0x9C, 0x88, 0x44, 0x31, 0xE7, 0x82, 0xB9, + 0x44, 0x32, 0xE6, 0x97, 0xA5, 0x44, 0x32, 0xE6, + 0x9C, 0x88, 0x44, 0x32, 0xE7, 0x82, 0xB9, 0x44, + 0x33, 0xE6, 0x97, 0xA5, 0x44, 0x33, 0xE6, 0x9C, + 0x88, 0x44, 0x33, 0xE7, 0x82, 0xB9, 0x44, 0x34, + 0xE6, 0x97, 0xA5, 0x44, 0x34, 0xE6, 0x9C, 0x88, + 0x44, 0x34, 0xE7, 0x82, 0xB9, 0x44, 0x35, 0xE6, + // Bytes 1d00 - 1d3f + 0x97, 0xA5, 0x44, 0x35, 0xE6, 0x9C, 0x88, 0x44, + 0x35, 0xE7, 0x82, 0xB9, 0x44, 0x36, 0xE6, 0x97, + 0xA5, 0x44, 0x36, 0xE6, 0x9C, 0x88, 0x44, 0x36, + 0xE7, 0x82, 0xB9, 0x44, 0x37, 0xE6, 0x97, 0xA5, + 0x44, 0x37, 0xE6, 0x9C, 0x88, 0x44, 0x37, 0xE7, + 0x82, 0xB9, 0x44, 0x38, 0xE6, 0x97, 0xA5, 0x44, + 0x38, 0xE6, 0x9C, 0x88, 0x44, 0x38, 0xE7, 0x82, + 0xB9, 0x44, 0x39, 0xE6, 0x97, 0xA5, 0x44, 0x39, + // Bytes 1d40 - 1d7f + 0xE6, 0x9C, 0x88, 0x44, 0x39, 0xE7, 0x82, 0xB9, + 0x44, 0x56, 0x49, 0x49, 0x49, 0x44, 0x61, 0x2E, + 0x6D, 0x2E, 0x44, 0x6B, 0x63, 0x61, 0x6C, 0x44, + 0x70, 0x2E, 0x6D, 0x2E, 0x44, 0x76, 0x69, 0x69, + 0x69, 0x44, 0xD5, 0xA5, 0xD6, 0x82, 0x44, 0xD5, + 0xB4, 0xD5, 0xA5, 0x44, 0xD5, 0xB4, 0xD5, 0xAB, + 0x44, 0xD5, 0xB4, 0xD5, 0xAD, 0x44, 0xD5, 0xB4, + 0xD5, 0xB6, 0x44, 0xD5, 0xBE, 0xD5, 0xB6, 0x44, + // Bytes 1d80 - 1dbf + 0xD7, 0x90, 0xD7, 0x9C, 0x44, 0xD8, 0xA7, 0xD9, + 0xB4, 0x44, 0xD8, 0xA8, 0xD8, 0xAC, 0x44, 0xD8, + 0xA8, 0xD8, 0xAD, 0x44, 0xD8, 0xA8, 0xD8, 0xAE, + 0x44, 0xD8, 0xA8, 0xD8, 0xB1, 0x44, 0xD8, 0xA8, + 0xD8, 0xB2, 0x44, 0xD8, 0xA8, 0xD9, 0x85, 0x44, + 0xD8, 0xA8, 0xD9, 0x86, 0x44, 0xD8, 0xA8, 0xD9, + 0x87, 0x44, 0xD8, 0xA8, 0xD9, 0x89, 0x44, 0xD8, + 0xA8, 0xD9, 0x8A, 0x44, 0xD8, 0xAA, 0xD8, 0xAC, + // Bytes 1dc0 - 1dff + 0x44, 0xD8, 0xAA, 0xD8, 0xAD, 0x44, 0xD8, 0xAA, + 0xD8, 0xAE, 0x44, 0xD8, 0xAA, 0xD8, 0xB1, 0x44, + 0xD8, 0xAA, 0xD8, 0xB2, 0x44, 0xD8, 0xAA, 0xD9, + 0x85, 0x44, 0xD8, 0xAA, 0xD9, 0x86, 0x44, 0xD8, + 0xAA, 0xD9, 0x87, 0x44, 0xD8, 0xAA, 0xD9, 0x89, + 0x44, 0xD8, 0xAA, 0xD9, 0x8A, 0x44, 0xD8, 0xAB, + 0xD8, 0xAC, 0x44, 0xD8, 0xAB, 0xD8, 0xB1, 0x44, + 0xD8, 0xAB, 0xD8, 0xB2, 0x44, 0xD8, 0xAB, 0xD9, + // Bytes 1e00 - 1e3f + 0x85, 0x44, 0xD8, 0xAB, 0xD9, 0x86, 0x44, 0xD8, + 0xAB, 0xD9, 0x87, 0x44, 0xD8, 0xAB, 0xD9, 0x89, + 0x44, 0xD8, 0xAB, 0xD9, 0x8A, 0x44, 0xD8, 0xAC, + 0xD8, 0xAD, 0x44, 0xD8, 0xAC, 0xD9, 0x85, 0x44, + 0xD8, 0xAC, 0xD9, 0x89, 0x44, 0xD8, 0xAC, 0xD9, + 0x8A, 0x44, 0xD8, 0xAD, 0xD8, 0xAC, 0x44, 0xD8, + 0xAD, 0xD9, 0x85, 0x44, 0xD8, 0xAD, 0xD9, 0x89, + 0x44, 0xD8, 0xAD, 0xD9, 0x8A, 0x44, 0xD8, 0xAE, + // Bytes 1e40 - 1e7f + 0xD8, 0xAC, 0x44, 0xD8, 0xAE, 0xD8, 0xAD, 0x44, + 0xD8, 0xAE, 0xD9, 0x85, 0x44, 0xD8, 0xAE, 0xD9, + 0x89, 0x44, 0xD8, 0xAE, 0xD9, 0x8A, 0x44, 0xD8, + 0xB3, 0xD8, 0xAC, 0x44, 0xD8, 0xB3, 0xD8, 0xAD, + 0x44, 0xD8, 0xB3, 0xD8, 0xAE, 0x44, 0xD8, 0xB3, + 0xD8, 0xB1, 0x44, 0xD8, 0xB3, 0xD9, 0x85, 0x44, + 0xD8, 0xB3, 0xD9, 0x87, 0x44, 0xD8, 0xB3, 0xD9, + 0x89, 0x44, 0xD8, 0xB3, 0xD9, 0x8A, 0x44, 0xD8, + // Bytes 1e80 - 1ebf + 0xB4, 0xD8, 0xAC, 0x44, 0xD8, 0xB4, 0xD8, 0xAD, + 0x44, 0xD8, 0xB4, 0xD8, 0xAE, 0x44, 0xD8, 0xB4, + 0xD8, 0xB1, 0x44, 0xD8, 0xB4, 0xD9, 0x85, 0x44, + 0xD8, 0xB4, 0xD9, 0x87, 0x44, 0xD8, 0xB4, 0xD9, + 0x89, 0x44, 0xD8, 0xB4, 0xD9, 0x8A, 0x44, 0xD8, + 0xB5, 0xD8, 0xAD, 0x44, 0xD8, 0xB5, 0xD8, 0xAE, + 0x44, 0xD8, 0xB5, 0xD8, 0xB1, 0x44, 0xD8, 0xB5, + 0xD9, 0x85, 0x44, 0xD8, 0xB5, 0xD9, 0x89, 0x44, + // Bytes 1ec0 - 1eff + 0xD8, 0xB5, 0xD9, 0x8A, 0x44, 0xD8, 0xB6, 0xD8, + 0xAC, 0x44, 0xD8, 0xB6, 0xD8, 0xAD, 0x44, 0xD8, + 0xB6, 0xD8, 0xAE, 0x44, 0xD8, 0xB6, 0xD8, 0xB1, + 0x44, 0xD8, 0xB6, 0xD9, 0x85, 0x44, 0xD8, 0xB6, + 0xD9, 0x89, 0x44, 0xD8, 0xB6, 0xD9, 0x8A, 0x44, + 0xD8, 0xB7, 0xD8, 0xAD, 0x44, 0xD8, 0xB7, 0xD9, + 0x85, 0x44, 0xD8, 0xB7, 0xD9, 0x89, 0x44, 0xD8, + 0xB7, 0xD9, 0x8A, 0x44, 0xD8, 0xB8, 0xD9, 0x85, + // Bytes 1f00 - 1f3f + 0x44, 0xD8, 0xB9, 0xD8, 0xAC, 0x44, 0xD8, 0xB9, + 0xD9, 0x85, 0x44, 0xD8, 0xB9, 0xD9, 0x89, 0x44, + 0xD8, 0xB9, 0xD9, 0x8A, 0x44, 0xD8, 0xBA, 0xD8, + 0xAC, 0x44, 0xD8, 0xBA, 0xD9, 0x85, 0x44, 0xD8, + 0xBA, 0xD9, 0x89, 0x44, 0xD8, 0xBA, 0xD9, 0x8A, + 0x44, 0xD9, 0x81, 0xD8, 0xAC, 0x44, 0xD9, 0x81, + 0xD8, 0xAD, 0x44, 0xD9, 0x81, 0xD8, 0xAE, 0x44, + 0xD9, 0x81, 0xD9, 0x85, 0x44, 0xD9, 0x81, 0xD9, + // Bytes 1f40 - 1f7f + 0x89, 0x44, 0xD9, 0x81, 0xD9, 0x8A, 0x44, 0xD9, + 0x82, 0xD8, 0xAD, 0x44, 0xD9, 0x82, 0xD9, 0x85, + 0x44, 0xD9, 0x82, 0xD9, 0x89, 0x44, 0xD9, 0x82, + 0xD9, 0x8A, 0x44, 0xD9, 0x83, 0xD8, 0xA7, 0x44, + 0xD9, 0x83, 0xD8, 0xAC, 0x44, 0xD9, 0x83, 0xD8, + 0xAD, 0x44, 0xD9, 0x83, 0xD8, 0xAE, 0x44, 0xD9, + 0x83, 0xD9, 0x84, 0x44, 0xD9, 0x83, 0xD9, 0x85, + 0x44, 0xD9, 0x83, 0xD9, 0x89, 0x44, 0xD9, 0x83, + // Bytes 1f80 - 1fbf + 0xD9, 0x8A, 0x44, 0xD9, 0x84, 0xD8, 0xA7, 0x44, + 0xD9, 0x84, 0xD8, 0xAC, 0x44, 0xD9, 0x84, 0xD8, + 0xAD, 0x44, 0xD9, 0x84, 0xD8, 0xAE, 0x44, 0xD9, + 0x84, 0xD9, 0x85, 0x44, 0xD9, 0x84, 0xD9, 0x87, + 0x44, 0xD9, 0x84, 0xD9, 0x89, 0x44, 0xD9, 0x84, + 0xD9, 0x8A, 0x44, 0xD9, 0x85, 0xD8, 0xA7, 0x44, + 0xD9, 0x85, 0xD8, 0xAC, 0x44, 0xD9, 0x85, 0xD8, + 0xAD, 0x44, 0xD9, 0x85, 0xD8, 0xAE, 0x44, 0xD9, + // Bytes 1fc0 - 1fff + 0x85, 0xD9, 0x85, 0x44, 0xD9, 0x85, 0xD9, 0x89, + 0x44, 0xD9, 0x85, 0xD9, 0x8A, 0x44, 0xD9, 0x86, + 0xD8, 0xAC, 0x44, 0xD9, 0x86, 0xD8, 0xAD, 0x44, + 0xD9, 0x86, 0xD8, 0xAE, 0x44, 0xD9, 0x86, 0xD8, + 0xB1, 0x44, 0xD9, 0x86, 0xD8, 0xB2, 0x44, 0xD9, + 0x86, 0xD9, 0x85, 0x44, 0xD9, 0x86, 0xD9, 0x86, + 0x44, 0xD9, 0x86, 0xD9, 0x87, 0x44, 0xD9, 0x86, + 0xD9, 0x89, 0x44, 0xD9, 0x86, 0xD9, 0x8A, 0x44, + // Bytes 2000 - 203f + 0xD9, 0x87, 0xD8, 0xAC, 0x44, 0xD9, 0x87, 0xD9, + 0x85, 0x44, 0xD9, 0x87, 0xD9, 0x89, 0x44, 0xD9, + 0x87, 0xD9, 0x8A, 0x44, 0xD9, 0x88, 0xD9, 0xB4, + 0x44, 0xD9, 0x8A, 0xD8, 0xAC, 0x44, 0xD9, 0x8A, + 0xD8, 0xAD, 0x44, 0xD9, 0x8A, 0xD8, 0xAE, 0x44, + 0xD9, 0x8A, 0xD8, 0xB1, 0x44, 0xD9, 0x8A, 0xD8, + 0xB2, 0x44, 0xD9, 0x8A, 0xD9, 0x85, 0x44, 0xD9, + 0x8A, 0xD9, 0x86, 0x44, 0xD9, 0x8A, 0xD9, 0x87, + // Bytes 2040 - 207f + 0x44, 0xD9, 0x8A, 0xD9, 0x89, 0x44, 0xD9, 0x8A, + 0xD9, 0x8A, 0x44, 0xD9, 0x8A, 0xD9, 0xB4, 0x44, + 0xDB, 0x87, 0xD9, 0xB4, 0x45, 0x28, 0xE1, 0x84, + 0x80, 0x29, 0x45, 0x28, 0xE1, 0x84, 0x82, 0x29, + 0x45, 0x28, 0xE1, 0x84, 0x83, 0x29, 0x45, 0x28, + 0xE1, 0x84, 0x85, 0x29, 0x45, 0x28, 0xE1, 0x84, + 0x86, 0x29, 0x45, 0x28, 0xE1, 0x84, 0x87, 0x29, + 0x45, 0x28, 0xE1, 0x84, 0x89, 0x29, 0x45, 0x28, + // Bytes 2080 - 20bf + 0xE1, 0x84, 0x8B, 0x29, 0x45, 0x28, 0xE1, 0x84, + 0x8C, 0x29, 0x45, 0x28, 0xE1, 0x84, 0x8E, 0x29, + 0x45, 0x28, 0xE1, 0x84, 0x8F, 0x29, 0x45, 0x28, + 0xE1, 0x84, 0x90, 0x29, 0x45, 0x28, 0xE1, 0x84, + 0x91, 0x29, 0x45, 0x28, 0xE1, 0x84, 0x92, 0x29, + 0x45, 0x28, 0xE4, 0xB8, 0x80, 0x29, 0x45, 0x28, + 0xE4, 0xB8, 0x83, 0x29, 0x45, 0x28, 0xE4, 0xB8, + 0x89, 0x29, 0x45, 0x28, 0xE4, 0xB9, 0x9D, 0x29, + // Bytes 20c0 - 20ff + 0x45, 0x28, 0xE4, 0xBA, 0x8C, 0x29, 0x45, 0x28, + 0xE4, 0xBA, 0x94, 0x29, 0x45, 0x28, 0xE4, 0xBB, + 0xA3, 0x29, 0x45, 0x28, 0xE4, 0xBC, 0x81, 0x29, + 0x45, 0x28, 0xE4, 0xBC, 0x91, 0x29, 0x45, 0x28, + 0xE5, 0x85, 0xAB, 0x29, 0x45, 0x28, 0xE5, 0x85, + 0xAD, 0x29, 0x45, 0x28, 0xE5, 0x8A, 0xB4, 0x29, + 0x45, 0x28, 0xE5, 0x8D, 0x81, 0x29, 0x45, 0x28, + 0xE5, 0x8D, 0x94, 0x29, 0x45, 0x28, 0xE5, 0x90, + // Bytes 2100 - 213f + 0x8D, 0x29, 0x45, 0x28, 0xE5, 0x91, 0xBC, 0x29, + 0x45, 0x28, 0xE5, 0x9B, 0x9B, 0x29, 0x45, 0x28, + 0xE5, 0x9C, 0x9F, 0x29, 0x45, 0x28, 0xE5, 0xAD, + 0xA6, 0x29, 0x45, 0x28, 0xE6, 0x97, 0xA5, 0x29, + 0x45, 0x28, 0xE6, 0x9C, 0x88, 0x29, 0x45, 0x28, + 0xE6, 0x9C, 0x89, 0x29, 0x45, 0x28, 0xE6, 0x9C, + 0xA8, 0x29, 0x45, 0x28, 0xE6, 0xA0, 0xAA, 0x29, + 0x45, 0x28, 0xE6, 0xB0, 0xB4, 0x29, 0x45, 0x28, + // Bytes 2140 - 217f + 0xE7, 0x81, 0xAB, 0x29, 0x45, 0x28, 0xE7, 0x89, + 0xB9, 0x29, 0x45, 0x28, 0xE7, 0x9B, 0xA3, 0x29, + 0x45, 0x28, 0xE7, 0xA4, 0xBE, 0x29, 0x45, 0x28, + 0xE7, 0xA5, 0x9D, 0x29, 0x45, 0x28, 0xE7, 0xA5, + 0xAD, 0x29, 0x45, 0x28, 0xE8, 0x87, 0xAA, 0x29, + 0x45, 0x28, 0xE8, 0x87, 0xB3, 0x29, 0x45, 0x28, + 0xE8, 0xB2, 0xA1, 0x29, 0x45, 0x28, 0xE8, 0xB3, + 0x87, 0x29, 0x45, 0x28, 0xE9, 0x87, 0x91, 0x29, + // Bytes 2180 - 21bf + 0x45, 0x30, 0xE2, 0x81, 0x84, 0x33, 0x45, 0x31, + 0x30, 0xE6, 0x97, 0xA5, 0x45, 0x31, 0x30, 0xE6, + 0x9C, 0x88, 0x45, 0x31, 0x30, 0xE7, 0x82, 0xB9, + 0x45, 0x31, 0x31, 0xE6, 0x97, 0xA5, 0x45, 0x31, + 0x31, 0xE6, 0x9C, 0x88, 0x45, 0x31, 0x31, 0xE7, + 0x82, 0xB9, 0x45, 0x31, 0x32, 0xE6, 0x97, 0xA5, + 0x45, 0x31, 0x32, 0xE6, 0x9C, 0x88, 0x45, 0x31, + 0x32, 0xE7, 0x82, 0xB9, 0x45, 0x31, 0x33, 0xE6, + // Bytes 21c0 - 21ff + 0x97, 0xA5, 0x45, 0x31, 0x33, 0xE7, 0x82, 0xB9, + 0x45, 0x31, 0x34, 0xE6, 0x97, 0xA5, 0x45, 0x31, + 0x34, 0xE7, 0x82, 0xB9, 0x45, 0x31, 0x35, 0xE6, + 0x97, 0xA5, 0x45, 0x31, 0x35, 0xE7, 0x82, 0xB9, + 0x45, 0x31, 0x36, 0xE6, 0x97, 0xA5, 0x45, 0x31, + 0x36, 0xE7, 0x82, 0xB9, 0x45, 0x31, 0x37, 0xE6, + 0x97, 0xA5, 0x45, 0x31, 0x37, 0xE7, 0x82, 0xB9, + 0x45, 0x31, 0x38, 0xE6, 0x97, 0xA5, 0x45, 0x31, + // Bytes 2200 - 223f + 0x38, 0xE7, 0x82, 0xB9, 0x45, 0x31, 0x39, 0xE6, + 0x97, 0xA5, 0x45, 0x31, 0x39, 0xE7, 0x82, 0xB9, + 0x45, 0x31, 0xE2, 0x81, 0x84, 0x32, 0x45, 0x31, + 0xE2, 0x81, 0x84, 0x33, 0x45, 0x31, 0xE2, 0x81, + 0x84, 0x34, 0x45, 0x31, 0xE2, 0x81, 0x84, 0x35, + 0x45, 0x31, 0xE2, 0x81, 0x84, 0x36, 0x45, 0x31, + 0xE2, 0x81, 0x84, 0x37, 0x45, 0x31, 0xE2, 0x81, + 0x84, 0x38, 0x45, 0x31, 0xE2, 0x81, 0x84, 0x39, + // Bytes 2240 - 227f + 0x45, 0x32, 0x30, 0xE6, 0x97, 0xA5, 0x45, 0x32, + 0x30, 0xE7, 0x82, 0xB9, 0x45, 0x32, 0x31, 0xE6, + 0x97, 0xA5, 0x45, 0x32, 0x31, 0xE7, 0x82, 0xB9, + 0x45, 0x32, 0x32, 0xE6, 0x97, 0xA5, 0x45, 0x32, + 0x32, 0xE7, 0x82, 0xB9, 0x45, 0x32, 0x33, 0xE6, + 0x97, 0xA5, 0x45, 0x32, 0x33, 0xE7, 0x82, 0xB9, + 0x45, 0x32, 0x34, 0xE6, 0x97, 0xA5, 0x45, 0x32, + 0x34, 0xE7, 0x82, 0xB9, 0x45, 0x32, 0x35, 0xE6, + // Bytes 2280 - 22bf + 0x97, 0xA5, 0x45, 0x32, 0x36, 0xE6, 0x97, 0xA5, + 0x45, 0x32, 0x37, 0xE6, 0x97, 0xA5, 0x45, 0x32, + 0x38, 0xE6, 0x97, 0xA5, 0x45, 0x32, 0x39, 0xE6, + 0x97, 0xA5, 0x45, 0x32, 0xE2, 0x81, 0x84, 0x33, + 0x45, 0x32, 0xE2, 0x81, 0x84, 0x35, 0x45, 0x33, + 0x30, 0xE6, 0x97, 0xA5, 0x45, 0x33, 0x31, 0xE6, + 0x97, 0xA5, 0x45, 0x33, 0xE2, 0x81, 0x84, 0x34, + 0x45, 0x33, 0xE2, 0x81, 0x84, 0x35, 0x45, 0x33, + // Bytes 22c0 - 22ff + 0xE2, 0x81, 0x84, 0x38, 0x45, 0x34, 0xE2, 0x81, + 0x84, 0x35, 0x45, 0x35, 0xE2, 0x81, 0x84, 0x36, + 0x45, 0x35, 0xE2, 0x81, 0x84, 0x38, 0x45, 0x37, + 0xE2, 0x81, 0x84, 0x38, 0x45, 0x41, 0xE2, 0x88, + 0x95, 0x6D, 0x45, 0x56, 0xE2, 0x88, 0x95, 0x6D, + 0x45, 0x6D, 0xE2, 0x88, 0x95, 0x73, 0x46, 0x31, + 0xE2, 0x81, 0x84, 0x31, 0x30, 0x46, 0x43, 0xE2, + 0x88, 0x95, 0x6B, 0x67, 0x46, 0x6D, 0xE2, 0x88, + // Bytes 2300 - 233f + 0x95, 0x73, 0x32, 0x46, 0xD8, 0xA8, 0xD8, 0xAD, + 0xD9, 0x8A, 0x46, 0xD8, 0xA8, 0xD8, 0xAE, 0xD9, + 0x8A, 0x46, 0xD8, 0xAA, 0xD8, 0xAC, 0xD9, 0x85, + 0x46, 0xD8, 0xAA, 0xD8, 0xAC, 0xD9, 0x89, 0x46, + 0xD8, 0xAA, 0xD8, 0xAC, 0xD9, 0x8A, 0x46, 0xD8, + 0xAA, 0xD8, 0xAD, 0xD8, 0xAC, 0x46, 0xD8, 0xAA, + 0xD8, 0xAD, 0xD9, 0x85, 0x46, 0xD8, 0xAA, 0xD8, + 0xAE, 0xD9, 0x85, 0x46, 0xD8, 0xAA, 0xD8, 0xAE, + // Bytes 2340 - 237f + 0xD9, 0x89, 0x46, 0xD8, 0xAA, 0xD8, 0xAE, 0xD9, + 0x8A, 0x46, 0xD8, 0xAA, 0xD9, 0x85, 0xD8, 0xAC, + 0x46, 0xD8, 0xAA, 0xD9, 0x85, 0xD8, 0xAD, 0x46, + 0xD8, 0xAA, 0xD9, 0x85, 0xD8, 0xAE, 0x46, 0xD8, + 0xAA, 0xD9, 0x85, 0xD9, 0x89, 0x46, 0xD8, 0xAA, + 0xD9, 0x85, 0xD9, 0x8A, 0x46, 0xD8, 0xAC, 0xD8, + 0xAD, 0xD9, 0x89, 0x46, 0xD8, 0xAC, 0xD8, 0xAD, + 0xD9, 0x8A, 0x46, 0xD8, 0xAC, 0xD9, 0x85, 0xD8, + // Bytes 2380 - 23bf + 0xAD, 0x46, 0xD8, 0xAC, 0xD9, 0x85, 0xD9, 0x89, + 0x46, 0xD8, 0xAC, 0xD9, 0x85, 0xD9, 0x8A, 0x46, + 0xD8, 0xAD, 0xD8, 0xAC, 0xD9, 0x8A, 0x46, 0xD8, + 0xAD, 0xD9, 0x85, 0xD9, 0x89, 0x46, 0xD8, 0xAD, + 0xD9, 0x85, 0xD9, 0x8A, 0x46, 0xD8, 0xB3, 0xD8, + 0xAC, 0xD8, 0xAD, 0x46, 0xD8, 0xB3, 0xD8, 0xAC, + 0xD9, 0x89, 0x46, 0xD8, 0xB3, 0xD8, 0xAD, 0xD8, + 0xAC, 0x46, 0xD8, 0xB3, 0xD8, 0xAE, 0xD9, 0x89, + // Bytes 23c0 - 23ff + 0x46, 0xD8, 0xB3, 0xD8, 0xAE, 0xD9, 0x8A, 0x46, + 0xD8, 0xB3, 0xD9, 0x85, 0xD8, 0xAC, 0x46, 0xD8, + 0xB3, 0xD9, 0x85, 0xD8, 0xAD, 0x46, 0xD8, 0xB3, + 0xD9, 0x85, 0xD9, 0x85, 0x46, 0xD8, 0xB4, 0xD8, + 0xAC, 0xD9, 0x8A, 0x46, 0xD8, 0xB4, 0xD8, 0xAD, + 0xD9, 0x85, 0x46, 0xD8, 0xB4, 0xD8, 0xAD, 0xD9, + 0x8A, 0x46, 0xD8, 0xB4, 0xD9, 0x85, 0xD8, 0xAE, + 0x46, 0xD8, 0xB4, 0xD9, 0x85, 0xD9, 0x85, 0x46, + // Bytes 2400 - 243f + 0xD8, 0xB5, 0xD8, 0xAD, 0xD8, 0xAD, 0x46, 0xD8, + 0xB5, 0xD8, 0xAD, 0xD9, 0x8A, 0x46, 0xD8, 0xB5, + 0xD9, 0x84, 0xD9, 0x89, 0x46, 0xD8, 0xB5, 0xD9, + 0x84, 0xDB, 0x92, 0x46, 0xD8, 0xB5, 0xD9, 0x85, + 0xD9, 0x85, 0x46, 0xD8, 0xB6, 0xD8, 0xAD, 0xD9, + 0x89, 0x46, 0xD8, 0xB6, 0xD8, 0xAD, 0xD9, 0x8A, + 0x46, 0xD8, 0xB6, 0xD8, 0xAE, 0xD9, 0x85, 0x46, + 0xD8, 0xB7, 0xD9, 0x85, 0xD8, 0xAD, 0x46, 0xD8, + // Bytes 2440 - 247f + 0xB7, 0xD9, 0x85, 0xD9, 0x85, 0x46, 0xD8, 0xB7, + 0xD9, 0x85, 0xD9, 0x8A, 0x46, 0xD8, 0xB9, 0xD8, + 0xAC, 0xD9, 0x85, 0x46, 0xD8, 0xB9, 0xD9, 0x85, + 0xD9, 0x85, 0x46, 0xD8, 0xB9, 0xD9, 0x85, 0xD9, + 0x89, 0x46, 0xD8, 0xB9, 0xD9, 0x85, 0xD9, 0x8A, + 0x46, 0xD8, 0xBA, 0xD9, 0x85, 0xD9, 0x85, 0x46, + 0xD8, 0xBA, 0xD9, 0x85, 0xD9, 0x89, 0x46, 0xD8, + 0xBA, 0xD9, 0x85, 0xD9, 0x8A, 0x46, 0xD9, 0x81, + // Bytes 2480 - 24bf + 0xD8, 0xAE, 0xD9, 0x85, 0x46, 0xD9, 0x81, 0xD9, + 0x85, 0xD9, 0x8A, 0x46, 0xD9, 0x82, 0xD9, 0x84, + 0xDB, 0x92, 0x46, 0xD9, 0x82, 0xD9, 0x85, 0xD8, + 0xAD, 0x46, 0xD9, 0x82, 0xD9, 0x85, 0xD9, 0x85, + 0x46, 0xD9, 0x82, 0xD9, 0x85, 0xD9, 0x8A, 0x46, + 0xD9, 0x83, 0xD9, 0x85, 0xD9, 0x85, 0x46, 0xD9, + 0x83, 0xD9, 0x85, 0xD9, 0x8A, 0x46, 0xD9, 0x84, + 0xD8, 0xAC, 0xD8, 0xAC, 0x46, 0xD9, 0x84, 0xD8, + // Bytes 24c0 - 24ff + 0xAC, 0xD9, 0x85, 0x46, 0xD9, 0x84, 0xD8, 0xAC, + 0xD9, 0x8A, 0x46, 0xD9, 0x84, 0xD8, 0xAD, 0xD9, + 0x85, 0x46, 0xD9, 0x84, 0xD8, 0xAD, 0xD9, 0x89, + 0x46, 0xD9, 0x84, 0xD8, 0xAD, 0xD9, 0x8A, 0x46, + 0xD9, 0x84, 0xD8, 0xAE, 0xD9, 0x85, 0x46, 0xD9, + 0x84, 0xD9, 0x85, 0xD8, 0xAD, 0x46, 0xD9, 0x84, + 0xD9, 0x85, 0xD9, 0x8A, 0x46, 0xD9, 0x85, 0xD8, + 0xAC, 0xD8, 0xAD, 0x46, 0xD9, 0x85, 0xD8, 0xAC, + // Bytes 2500 - 253f + 0xD8, 0xAE, 0x46, 0xD9, 0x85, 0xD8, 0xAC, 0xD9, + 0x85, 0x46, 0xD9, 0x85, 0xD8, 0xAC, 0xD9, 0x8A, + 0x46, 0xD9, 0x85, 0xD8, 0xAD, 0xD8, 0xAC, 0x46, + 0xD9, 0x85, 0xD8, 0xAD, 0xD9, 0x85, 0x46, 0xD9, + 0x85, 0xD8, 0xAD, 0xD9, 0x8A, 0x46, 0xD9, 0x85, + 0xD8, 0xAE, 0xD8, 0xAC, 0x46, 0xD9, 0x85, 0xD8, + 0xAE, 0xD9, 0x85, 0x46, 0xD9, 0x85, 0xD8, 0xAE, + 0xD9, 0x8A, 0x46, 0xD9, 0x85, 0xD9, 0x85, 0xD9, + // Bytes 2540 - 257f + 0x8A, 0x46, 0xD9, 0x86, 0xD8, 0xAC, 0xD8, 0xAD, + 0x46, 0xD9, 0x86, 0xD8, 0xAC, 0xD9, 0x85, 0x46, + 0xD9, 0x86, 0xD8, 0xAC, 0xD9, 0x89, 0x46, 0xD9, + 0x86, 0xD8, 0xAC, 0xD9, 0x8A, 0x46, 0xD9, 0x86, + 0xD8, 0xAD, 0xD9, 0x85, 0x46, 0xD9, 0x86, 0xD8, + 0xAD, 0xD9, 0x89, 0x46, 0xD9, 0x86, 0xD8, 0xAD, + 0xD9, 0x8A, 0x46, 0xD9, 0x86, 0xD9, 0x85, 0xD9, + 0x89, 0x46, 0xD9, 0x86, 0xD9, 0x85, 0xD9, 0x8A, + // Bytes 2580 - 25bf + 0x46, 0xD9, 0x87, 0xD9, 0x85, 0xD8, 0xAC, 0x46, + 0xD9, 0x87, 0xD9, 0x85, 0xD9, 0x85, 0x46, 0xD9, + 0x8A, 0xD8, 0xAC, 0xD9, 0x8A, 0x46, 0xD9, 0x8A, + 0xD8, 0xAD, 0xD9, 0x8A, 0x46, 0xD9, 0x8A, 0xD9, + 0x85, 0xD9, 0x85, 0x46, 0xD9, 0x8A, 0xD9, 0x85, + 0xD9, 0x8A, 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xD8, + 0xA7, 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xD8, 0xAC, + 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xD8, 0xAD, 0x46, + // Bytes 25c0 - 25ff + 0xD9, 0x8A, 0xD9, 0x94, 0xD8, 0xAE, 0x46, 0xD9, + 0x8A, 0xD9, 0x94, 0xD8, 0xB1, 0x46, 0xD9, 0x8A, + 0xD9, 0x94, 0xD8, 0xB2, 0x46, 0xD9, 0x8A, 0xD9, + 0x94, 0xD9, 0x85, 0x46, 0xD9, 0x8A, 0xD9, 0x94, + 0xD9, 0x86, 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xD9, + 0x87, 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xD9, 0x88, + 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xD9, 0x89, 0x46, + 0xD9, 0x8A, 0xD9, 0x94, 0xD9, 0x8A, 0x46, 0xD9, + // Bytes 2600 - 263f + 0x8A, 0xD9, 0x94, 0xDB, 0x86, 0x46, 0xD9, 0x8A, + 0xD9, 0x94, 0xDB, 0x87, 0x46, 0xD9, 0x8A, 0xD9, + 0x94, 0xDB, 0x88, 0x46, 0xD9, 0x8A, 0xD9, 0x94, + 0xDB, 0x90, 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xDB, + 0x95, 0x46, 0xE0, 0xB9, 0x8D, 0xE0, 0xB8, 0xB2, + 0x46, 0xE0, 0xBA, 0xAB, 0xE0, 0xBA, 0x99, 0x46, + 0xE0, 0xBA, 0xAB, 0xE0, 0xBA, 0xA1, 0x46, 0xE0, + 0xBB, 0x8D, 0xE0, 0xBA, 0xB2, 0x46, 0xE0, 0xBD, + // Bytes 2640 - 267f + 0x80, 0xE0, 0xBE, 0xB5, 0x46, 0xE0, 0xBD, 0x82, + 0xE0, 0xBE, 0xB7, 0x46, 0xE0, 0xBD, 0x8C, 0xE0, + 0xBE, 0xB7, 0x46, 0xE0, 0xBD, 0x91, 0xE0, 0xBE, + 0xB7, 0x46, 0xE0, 0xBD, 0x96, 0xE0, 0xBE, 0xB7, + 0x46, 0xE0, 0xBD, 0x9B, 0xE0, 0xBE, 0xB7, 0x46, + 0xE0, 0xBE, 0x90, 0xE0, 0xBE, 0xB5, 0x46, 0xE0, + 0xBE, 0x92, 0xE0, 0xBE, 0xB7, 0x46, 0xE0, 0xBE, + 0x9C, 0xE0, 0xBE, 0xB7, 0x46, 0xE0, 0xBE, 0xA1, + // Bytes 2680 - 26bf + 0xE0, 0xBE, 0xB7, 0x46, 0xE0, 0xBE, 0xA6, 0xE0, + 0xBE, 0xB7, 0x46, 0xE0, 0xBE, 0xAB, 0xE0, 0xBE, + 0xB7, 0x46, 0xE2, 0x80, 0xB2, 0xE2, 0x80, 0xB2, + 0x46, 0xE2, 0x80, 0xB5, 0xE2, 0x80, 0xB5, 0x46, + 0xE2, 0x88, 0xAB, 0xE2, 0x88, 0xAB, 0x46, 0xE2, + 0x88, 0xAE, 0xE2, 0x88, 0xAE, 0x46, 0xE3, 0x81, + 0xBB, 0xE3, 0x81, 0x8B, 0x46, 0xE3, 0x82, 0x88, + 0xE3, 0x82, 0x8A, 0x46, 0xE3, 0x82, 0xAD, 0xE3, + // Bytes 26c0 - 26ff + 0x83, 0xAD, 0x46, 0xE3, 0x82, 0xB3, 0xE3, 0x82, + 0xB3, 0x46, 0xE3, 0x82, 0xB3, 0xE3, 0x83, 0x88, + 0x46, 0xE3, 0x83, 0x88, 0xE3, 0x83, 0xB3, 0x46, + 0xE3, 0x83, 0x8A, 0xE3, 0x83, 0x8E, 0x46, 0xE3, + 0x83, 0x9B, 0xE3, 0x83, 0xB3, 0x46, 0xE3, 0x83, + 0x9F, 0xE3, 0x83, 0xAA, 0x46, 0xE3, 0x83, 0xAA, + 0xE3, 0x83, 0xA9, 0x46, 0xE3, 0x83, 0xAC, 0xE3, + 0x83, 0xA0, 0x46, 0xE5, 0xA4, 0xA7, 0xE6, 0xAD, + // Bytes 2700 - 273f + 0xA3, 0x46, 0xE5, 0xB9, 0xB3, 0xE6, 0x88, 0x90, + 0x46, 0xE6, 0x98, 0x8E, 0xE6, 0xB2, 0xBB, 0x46, + 0xE6, 0x98, 0xAD, 0xE5, 0x92, 0x8C, 0x47, 0x72, + 0x61, 0x64, 0xE2, 0x88, 0x95, 0x73, 0x47, 0xE3, + 0x80, 0x94, 0x53, 0xE3, 0x80, 0x95, 0x48, 0x28, + 0xE1, 0x84, 0x80, 0xE1, 0x85, 0xA1, 0x29, 0x48, + 0x28, 0xE1, 0x84, 0x82, 0xE1, 0x85, 0xA1, 0x29, + 0x48, 0x28, 0xE1, 0x84, 0x83, 0xE1, 0x85, 0xA1, + // Bytes 2740 - 277f + 0x29, 0x48, 0x28, 0xE1, 0x84, 0x85, 0xE1, 0x85, + 0xA1, 0x29, 0x48, 0x28, 0xE1, 0x84, 0x86, 0xE1, + 0x85, 0xA1, 0x29, 0x48, 0x28, 0xE1, 0x84, 0x87, + 0xE1, 0x85, 0xA1, 0x29, 0x48, 0x28, 0xE1, 0x84, + 0x89, 0xE1, 0x85, 0xA1, 0x29, 0x48, 0x28, 0xE1, + 0x84, 0x8B, 0xE1, 0x85, 0xA1, 0x29, 0x48, 0x28, + 0xE1, 0x84, 0x8C, 0xE1, 0x85, 0xA1, 0x29, 0x48, + 0x28, 0xE1, 0x84, 0x8C, 0xE1, 0x85, 0xAE, 0x29, + // Bytes 2780 - 27bf + 0x48, 0x28, 0xE1, 0x84, 0x8E, 0xE1, 0x85, 0xA1, + 0x29, 0x48, 0x28, 0xE1, 0x84, 0x8F, 0xE1, 0x85, + 0xA1, 0x29, 0x48, 0x28, 0xE1, 0x84, 0x90, 0xE1, + 0x85, 0xA1, 0x29, 0x48, 0x28, 0xE1, 0x84, 0x91, + 0xE1, 0x85, 0xA1, 0x29, 0x48, 0x28, 0xE1, 0x84, + 0x92, 0xE1, 0x85, 0xA1, 0x29, 0x48, 0x72, 0x61, + 0x64, 0xE2, 0x88, 0x95, 0x73, 0x32, 0x48, 0xD8, + 0xA7, 0xD9, 0x83, 0xD8, 0xA8, 0xD8, 0xB1, 0x48, + // Bytes 27c0 - 27ff + 0xD8, 0xA7, 0xD9, 0x84, 0xD9, 0x84, 0xD9, 0x87, + 0x48, 0xD8, 0xB1, 0xD8, 0xB3, 0xD9, 0x88, 0xD9, + 0x84, 0x48, 0xD8, 0xB1, 0xDB, 0x8C, 0xD8, 0xA7, + 0xD9, 0x84, 0x48, 0xD8, 0xB5, 0xD9, 0x84, 0xD8, + 0xB9, 0xD9, 0x85, 0x48, 0xD8, 0xB9, 0xD9, 0x84, + 0xD9, 0x8A, 0xD9, 0x87, 0x48, 0xD9, 0x85, 0xD8, + 0xAD, 0xD9, 0x85, 0xD8, 0xAF, 0x48, 0xD9, 0x88, + 0xD8, 0xB3, 0xD9, 0x84, 0xD9, 0x85, 0x49, 0xE2, + // Bytes 2800 - 283f + 0x80, 0xB2, 0xE2, 0x80, 0xB2, 0xE2, 0x80, 0xB2, + 0x49, 0xE2, 0x80, 0xB5, 0xE2, 0x80, 0xB5, 0xE2, + 0x80, 0xB5, 0x49, 0xE2, 0x88, 0xAB, 0xE2, 0x88, + 0xAB, 0xE2, 0x88, 0xAB, 0x49, 0xE2, 0x88, 0xAE, + 0xE2, 0x88, 0xAE, 0xE2, 0x88, 0xAE, 0x49, 0xE3, + 0x80, 0x94, 0xE4, 0xB8, 0x89, 0xE3, 0x80, 0x95, + 0x49, 0xE3, 0x80, 0x94, 0xE4, 0xBA, 0x8C, 0xE3, + 0x80, 0x95, 0x49, 0xE3, 0x80, 0x94, 0xE5, 0x8B, + // Bytes 2840 - 287f + 0x9D, 0xE3, 0x80, 0x95, 0x49, 0xE3, 0x80, 0x94, + 0xE5, 0xAE, 0x89, 0xE3, 0x80, 0x95, 0x49, 0xE3, + 0x80, 0x94, 0xE6, 0x89, 0x93, 0xE3, 0x80, 0x95, + 0x49, 0xE3, 0x80, 0x94, 0xE6, 0x95, 0x97, 0xE3, + 0x80, 0x95, 0x49, 0xE3, 0x80, 0x94, 0xE6, 0x9C, + 0xAC, 0xE3, 0x80, 0x95, 0x49, 0xE3, 0x80, 0x94, + 0xE7, 0x82, 0xB9, 0xE3, 0x80, 0x95, 0x49, 0xE3, + 0x80, 0x94, 0xE7, 0x9B, 0x97, 0xE3, 0x80, 0x95, + // Bytes 2880 - 28bf + 0x49, 0xE3, 0x82, 0xA2, 0xE3, 0x83, 0xBC, 0xE3, + 0x83, 0xAB, 0x49, 0xE3, 0x82, 0xA4, 0xE3, 0x83, + 0xB3, 0xE3, 0x83, 0x81, 0x49, 0xE3, 0x82, 0xA6, + 0xE3, 0x82, 0xA9, 0xE3, 0x83, 0xB3, 0x49, 0xE3, + 0x82, 0xAA, 0xE3, 0x83, 0xB3, 0xE3, 0x82, 0xB9, + 0x49, 0xE3, 0x82, 0xAA, 0xE3, 0x83, 0xBC, 0xE3, + 0x83, 0xA0, 0x49, 0xE3, 0x82, 0xAB, 0xE3, 0x82, + 0xA4, 0xE3, 0x83, 0xAA, 0x49, 0xE3, 0x82, 0xB1, + // Bytes 28c0 - 28ff + 0xE3, 0x83, 0xBC, 0xE3, 0x82, 0xB9, 0x49, 0xE3, + 0x82, 0xB3, 0xE3, 0x83, 0xAB, 0xE3, 0x83, 0x8A, + 0x49, 0xE3, 0x82, 0xBB, 0xE3, 0x83, 0xB3, 0xE3, + 0x83, 0x81, 0x49, 0xE3, 0x82, 0xBB, 0xE3, 0x83, + 0xB3, 0xE3, 0x83, 0x88, 0x49, 0xE3, 0x83, 0x86, + 0xE3, 0x82, 0x99, 0xE3, 0x82, 0xB7, 0x49, 0xE3, + 0x83, 0x88, 0xE3, 0x82, 0x99, 0xE3, 0x83, 0xAB, + 0x49, 0xE3, 0x83, 0x8E, 0xE3, 0x83, 0x83, 0xE3, + // Bytes 2900 - 293f + 0x83, 0x88, 0x49, 0xE3, 0x83, 0x8F, 0xE3, 0x82, + 0xA4, 0xE3, 0x83, 0x84, 0x49, 0xE3, 0x83, 0x92, + 0xE3, 0x82, 0x99, 0xE3, 0x83, 0xAB, 0x49, 0xE3, + 0x83, 0x92, 0xE3, 0x82, 0x9A, 0xE3, 0x82, 0xB3, + 0x49, 0xE3, 0x83, 0x95, 0xE3, 0x83, 0xA9, 0xE3, + 0x83, 0xB3, 0x49, 0xE3, 0x83, 0x98, 0xE3, 0x82, + 0x9A, 0xE3, 0x82, 0xBD, 0x49, 0xE3, 0x83, 0x98, + 0xE3, 0x83, 0xAB, 0xE3, 0x83, 0x84, 0x49, 0xE3, + // Bytes 2940 - 297f + 0x83, 0x9B, 0xE3, 0x83, 0xBC, 0xE3, 0x83, 0xAB, + 0x49, 0xE3, 0x83, 0x9B, 0xE3, 0x83, 0xBC, 0xE3, + 0x83, 0xB3, 0x49, 0xE3, 0x83, 0x9E, 0xE3, 0x82, + 0xA4, 0xE3, 0x83, 0xAB, 0x49, 0xE3, 0x83, 0x9E, + 0xE3, 0x83, 0x83, 0xE3, 0x83, 0x8F, 0x49, 0xE3, + 0x83, 0x9E, 0xE3, 0x83, 0xAB, 0xE3, 0x82, 0xAF, + 0x49, 0xE3, 0x83, 0xA4, 0xE3, 0x83, 0xBC, 0xE3, + 0x83, 0xAB, 0x49, 0xE3, 0x83, 0xA6, 0xE3, 0x82, + // Bytes 2980 - 29bf + 0xA2, 0xE3, 0x83, 0xB3, 0x49, 0xE3, 0x83, 0xAF, + 0xE3, 0x83, 0x83, 0xE3, 0x83, 0x88, 0x4C, 0xE2, + 0x80, 0xB2, 0xE2, 0x80, 0xB2, 0xE2, 0x80, 0xB2, + 0xE2, 0x80, 0xB2, 0x4C, 0xE2, 0x88, 0xAB, 0xE2, + 0x88, 0xAB, 0xE2, 0x88, 0xAB, 0xE2, 0x88, 0xAB, + 0x4C, 0xE3, 0x82, 0xA2, 0xE3, 0x83, 0xAB, 0xE3, + 0x83, 0x95, 0xE3, 0x82, 0xA1, 0x4C, 0xE3, 0x82, + 0xA8, 0xE3, 0x83, 0xBC, 0xE3, 0x82, 0xAB, 0xE3, + // Bytes 29c0 - 29ff + 0x83, 0xBC, 0x4C, 0xE3, 0x82, 0xAB, 0xE3, 0x82, + 0x99, 0xE3, 0x83, 0xAD, 0xE3, 0x83, 0xB3, 0x4C, + 0xE3, 0x82, 0xAB, 0xE3, 0x82, 0x99, 0xE3, 0x83, + 0xB3, 0xE3, 0x83, 0x9E, 0x4C, 0xE3, 0x82, 0xAB, + 0xE3, 0x83, 0xA9, 0xE3, 0x83, 0x83, 0xE3, 0x83, + 0x88, 0x4C, 0xE3, 0x82, 0xAB, 0xE3, 0x83, 0xAD, + 0xE3, 0x83, 0xAA, 0xE3, 0x83, 0xBC, 0x4C, 0xE3, + 0x82, 0xAD, 0xE3, 0x82, 0x99, 0xE3, 0x83, 0x8B, + // Bytes 2a00 - 2a3f + 0xE3, 0x83, 0xBC, 0x4C, 0xE3, 0x82, 0xAD, 0xE3, + 0x83, 0xA5, 0xE3, 0x83, 0xAA, 0xE3, 0x83, 0xBC, + 0x4C, 0xE3, 0x82, 0xAF, 0xE3, 0x82, 0x99, 0xE3, + 0x83, 0xA9, 0xE3, 0x83, 0xA0, 0x4C, 0xE3, 0x82, + 0xAF, 0xE3, 0x83, 0xAD, 0xE3, 0x83, 0xBC, 0xE3, + 0x83, 0x8D, 0x4C, 0xE3, 0x82, 0xB5, 0xE3, 0x82, + 0xA4, 0xE3, 0x82, 0xAF, 0xE3, 0x83, 0xAB, 0x4C, + 0xE3, 0x82, 0xBF, 0xE3, 0x82, 0x99, 0xE3, 0x83, + // Bytes 2a40 - 2a7f + 0xBC, 0xE3, 0x82, 0xB9, 0x4C, 0xE3, 0x83, 0x8F, + 0xE3, 0x82, 0x9A, 0xE3, 0x83, 0xBC, 0xE3, 0x83, + 0x84, 0x4C, 0xE3, 0x83, 0x92, 0xE3, 0x82, 0x9A, + 0xE3, 0x82, 0xAF, 0xE3, 0x83, 0xAB, 0x4C, 0xE3, + 0x83, 0x95, 0xE3, 0x82, 0xA3, 0xE3, 0x83, 0xBC, + 0xE3, 0x83, 0x88, 0x4C, 0xE3, 0x83, 0x98, 0xE3, + 0x82, 0x99, 0xE3, 0x83, 0xBC, 0xE3, 0x82, 0xBF, + 0x4C, 0xE3, 0x83, 0x98, 0xE3, 0x82, 0x9A, 0xE3, + // Bytes 2a80 - 2abf + 0x83, 0x8B, 0xE3, 0x83, 0x92, 0x4C, 0xE3, 0x83, + 0x98, 0xE3, 0x82, 0x9A, 0xE3, 0x83, 0xB3, 0xE3, + 0x82, 0xB9, 0x4C, 0xE3, 0x83, 0x9B, 0xE3, 0x82, + 0x99, 0xE3, 0x83, 0xAB, 0xE3, 0x83, 0x88, 0x4C, + 0xE3, 0x83, 0x9E, 0xE3, 0x82, 0xA4, 0xE3, 0x82, + 0xAF, 0xE3, 0x83, 0xAD, 0x4C, 0xE3, 0x83, 0x9F, + 0xE3, 0x82, 0xAF, 0xE3, 0x83, 0xAD, 0xE3, 0x83, + 0xB3, 0x4C, 0xE3, 0x83, 0xA1, 0xE3, 0x83, 0xBC, + // Bytes 2ac0 - 2aff + 0xE3, 0x83, 0x88, 0xE3, 0x83, 0xAB, 0x4C, 0xE3, + 0x83, 0xAA, 0xE3, 0x83, 0x83, 0xE3, 0x83, 0x88, + 0xE3, 0x83, 0xAB, 0x4C, 0xE3, 0x83, 0xAB, 0xE3, + 0x83, 0x92, 0xE3, 0x82, 0x9A, 0xE3, 0x83, 0xBC, + 0x4C, 0xE6, 0xA0, 0xAA, 0xE5, 0xBC, 0x8F, 0xE4, + 0xBC, 0x9A, 0xE7, 0xA4, 0xBE, 0x4E, 0x28, 0xE1, + 0x84, 0x8B, 0xE1, 0x85, 0xA9, 0xE1, 0x84, 0x92, + 0xE1, 0x85, 0xAE, 0x29, 0x4F, 0xD8, 0xAC, 0xD9, + // Bytes 2b00 - 2b3f + 0x84, 0x20, 0xD8, 0xAC, 0xD9, 0x84, 0xD8, 0xA7, + 0xD9, 0x84, 0xD9, 0x87, 0x4F, 0xE3, 0x82, 0xA2, + 0xE3, 0x83, 0x8F, 0xE3, 0x82, 0x9A, 0xE3, 0x83, + 0xBC, 0xE3, 0x83, 0x88, 0x4F, 0xE3, 0x82, 0xA2, + 0xE3, 0x83, 0xB3, 0xE3, 0x83, 0x98, 0xE3, 0x82, + 0x9A, 0xE3, 0x82, 0xA2, 0x4F, 0xE3, 0x82, 0xAD, + 0xE3, 0x83, 0xAD, 0xE3, 0x83, 0xAF, 0xE3, 0x83, + 0x83, 0xE3, 0x83, 0x88, 0x4F, 0xE3, 0x82, 0xB5, + // Bytes 2b40 - 2b7f + 0xE3, 0x83, 0xB3, 0xE3, 0x83, 0x81, 0xE3, 0x83, + 0xBC, 0xE3, 0x83, 0xA0, 0x4F, 0xE3, 0x83, 0x8F, + 0xE3, 0x82, 0x99, 0xE3, 0x83, 0xBC, 0xE3, 0x83, + 0xAC, 0xE3, 0x83, 0xAB, 0x4F, 0xE3, 0x83, 0x98, + 0xE3, 0x82, 0xAF, 0xE3, 0x82, 0xBF, 0xE3, 0x83, + 0xBC, 0xE3, 0x83, 0xAB, 0x4F, 0xE3, 0x83, 0x9B, + 0xE3, 0x82, 0x9A, 0xE3, 0x82, 0xA4, 0xE3, 0x83, + 0xB3, 0xE3, 0x83, 0x88, 0x4F, 0xE3, 0x83, 0x9E, + // Bytes 2b80 - 2bbf + 0xE3, 0x83, 0xB3, 0xE3, 0x82, 0xB7, 0xE3, 0x83, + 0xA7, 0xE3, 0x83, 0xB3, 0x4F, 0xE3, 0x83, 0xA1, + 0xE3, 0x82, 0xAB, 0xE3, 0x82, 0x99, 0xE3, 0x83, + 0x88, 0xE3, 0x83, 0xB3, 0x4F, 0xE3, 0x83, 0xAB, + 0xE3, 0x83, 0xBC, 0xE3, 0x83, 0x95, 0xE3, 0x82, + 0x99, 0xE3, 0x83, 0xAB, 0x51, 0x28, 0xE1, 0x84, + 0x8B, 0xE1, 0x85, 0xA9, 0xE1, 0x84, 0x8C, 0xE1, + 0x85, 0xA5, 0xE1, 0x86, 0xAB, 0x29, 0x52, 0xE3, + // Bytes 2bc0 - 2bff + 0x82, 0xAD, 0xE3, 0x82, 0x99, 0xE3, 0x83, 0xAB, + 0xE3, 0x82, 0xBF, 0xE3, 0x82, 0x99, 0xE3, 0x83, + 0xBC, 0x52, 0xE3, 0x82, 0xAD, 0xE3, 0x83, 0xAD, + 0xE3, 0x82, 0xAF, 0xE3, 0x82, 0x99, 0xE3, 0x83, + 0xA9, 0xE3, 0x83, 0xA0, 0x52, 0xE3, 0x82, 0xAD, + 0xE3, 0x83, 0xAD, 0xE3, 0x83, 0xA1, 0xE3, 0x83, + 0xBC, 0xE3, 0x83, 0x88, 0xE3, 0x83, 0xAB, 0x52, + 0xE3, 0x82, 0xAF, 0xE3, 0x82, 0x99, 0xE3, 0x83, + // Bytes 2c00 - 2c3f + 0xA9, 0xE3, 0x83, 0xA0, 0xE3, 0x83, 0x88, 0xE3, + 0x83, 0xB3, 0x52, 0xE3, 0x82, 0xAF, 0xE3, 0x83, + 0xAB, 0xE3, 0x82, 0xBB, 0xE3, 0x82, 0x99, 0xE3, + 0x82, 0xA4, 0xE3, 0x83, 0xAD, 0x52, 0xE3, 0x83, + 0x8F, 0xE3, 0x82, 0x9A, 0xE3, 0x83, 0xBC, 0xE3, + 0x82, 0xBB, 0xE3, 0x83, 0xB3, 0xE3, 0x83, 0x88, + 0x52, 0xE3, 0x83, 0x92, 0xE3, 0x82, 0x9A, 0xE3, + 0x82, 0xA2, 0xE3, 0x82, 0xB9, 0xE3, 0x83, 0x88, + // Bytes 2c40 - 2c7f + 0xE3, 0x83, 0xAB, 0x52, 0xE3, 0x83, 0x95, 0xE3, + 0x82, 0x99, 0xE3, 0x83, 0x83, 0xE3, 0x82, 0xB7, + 0xE3, 0x82, 0xA7, 0xE3, 0x83, 0xAB, 0x52, 0xE3, + 0x83, 0x9F, 0xE3, 0x83, 0xAA, 0xE3, 0x83, 0x8F, + 0xE3, 0x82, 0x99, 0xE3, 0x83, 0xBC, 0xE3, 0x83, + 0xAB, 0x52, 0xE3, 0x83, 0xAC, 0xE3, 0x83, 0xB3, + 0xE3, 0x83, 0x88, 0xE3, 0x82, 0xB1, 0xE3, 0x82, + 0x99, 0xE3, 0x83, 0xB3, 0x61, 0xD8, 0xB5, 0xD9, + // Bytes 2c80 - 2cbf + 0x84, 0xD9, 0x89, 0x20, 0xD8, 0xA7, 0xD9, 0x84, + 0xD9, 0x84, 0xD9, 0x87, 0x20, 0xD8, 0xB9, 0xD9, + 0x84, 0xD9, 0x8A, 0xD9, 0x87, 0x20, 0xD9, 0x88, + 0xD8, 0xB3, 0xD9, 0x84, 0xD9, 0x85, 0x06, 0xE0, + 0xA7, 0x87, 0xE0, 0xA6, 0xBE, 0x01, 0x06, 0xE0, + 0xA7, 0x87, 0xE0, 0xA7, 0x97, 0x01, 0x06, 0xE0, + 0xAD, 0x87, 0xE0, 0xAC, 0xBE, 0x01, 0x06, 0xE0, + 0xAD, 0x87, 0xE0, 0xAD, 0x96, 0x01, 0x06, 0xE0, + // Bytes 2cc0 - 2cff + 0xAD, 0x87, 0xE0, 0xAD, 0x97, 0x01, 0x06, 0xE0, + 0xAE, 0x92, 0xE0, 0xAF, 0x97, 0x01, 0x06, 0xE0, + 0xAF, 0x86, 0xE0, 0xAE, 0xBE, 0x01, 0x06, 0xE0, + 0xAF, 0x86, 0xE0, 0xAF, 0x97, 0x01, 0x06, 0xE0, + 0xAF, 0x87, 0xE0, 0xAE, 0xBE, 0x01, 0x06, 0xE0, + 0xB2, 0xBF, 0xE0, 0xB3, 0x95, 0x01, 0x06, 0xE0, + 0xB3, 0x86, 0xE0, 0xB3, 0x95, 0x01, 0x06, 0xE0, + 0xB3, 0x86, 0xE0, 0xB3, 0x96, 0x01, 0x06, 0xE0, + // Bytes 2d00 - 2d3f + 0xB5, 0x86, 0xE0, 0xB4, 0xBE, 0x01, 0x06, 0xE0, + 0xB5, 0x86, 0xE0, 0xB5, 0x97, 0x01, 0x06, 0xE0, + 0xB5, 0x87, 0xE0, 0xB4, 0xBE, 0x01, 0x06, 0xE0, + 0xB7, 0x99, 0xE0, 0xB7, 0x9F, 0x01, 0x06, 0xE1, + 0x80, 0xA5, 0xE1, 0x80, 0xAE, 0x01, 0x06, 0xE1, + 0xAC, 0x85, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0x87, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0x89, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + // Bytes 2d40 - 2d7f + 0xAC, 0x8B, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0x8D, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0x91, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0xBA, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0xBC, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0xBE, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0xBF, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAD, 0x82, 0xE1, 0xAC, 0xB5, 0x01, 0x08, 0xF0, + // Bytes 2d80 - 2dbf + 0x91, 0x84, 0xB1, 0xF0, 0x91, 0x84, 0xA7, 0x01, + 0x08, 0xF0, 0x91, 0x84, 0xB2, 0xF0, 0x91, 0x84, + 0xA7, 0x01, 0x08, 0xF0, 0x91, 0x8D, 0x87, 0xF0, + 0x91, 0x8C, 0xBE, 0x01, 0x08, 0xF0, 0x91, 0x8D, + 0x87, 0xF0, 0x91, 0x8D, 0x97, 0x01, 0x08, 0xF0, + 0x91, 0x92, 0xB9, 0xF0, 0x91, 0x92, 0xB0, 0x01, + 0x08, 0xF0, 0x91, 0x92, 0xB9, 0xF0, 0x91, 0x92, + 0xBA, 0x01, 0x08, 0xF0, 0x91, 0x92, 0xB9, 0xF0, + // Bytes 2dc0 - 2dff + 0x91, 0x92, 0xBD, 0x01, 0x08, 0xF0, 0x91, 0x96, + 0xB8, 0xF0, 0x91, 0x96, 0xAF, 0x01, 0x08, 0xF0, + 0x91, 0x96, 0xB9, 0xF0, 0x91, 0x96, 0xAF, 0x01, + 0x09, 0xE0, 0xB3, 0x86, 0xE0, 0xB3, 0x82, 0xE0, + 0xB3, 0x95, 0x02, 0x09, 0xE0, 0xB7, 0x99, 0xE0, + 0xB7, 0x8F, 0xE0, 0xB7, 0x8A, 0x12, 0x44, 0x44, + 0x5A, 0xCC, 0x8C, 0xC9, 0x44, 0x44, 0x7A, 0xCC, + 0x8C, 0xC9, 0x44, 0x64, 0x7A, 0xCC, 0x8C, 0xC9, + // Bytes 2e00 - 2e3f + 0x46, 0xD9, 0x84, 0xD8, 0xA7, 0xD9, 0x93, 0xC9, + 0x46, 0xD9, 0x84, 0xD8, 0xA7, 0xD9, 0x94, 0xC9, + 0x46, 0xD9, 0x84, 0xD8, 0xA7, 0xD9, 0x95, 0xB5, + 0x46, 0xE1, 0x84, 0x80, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x82, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x83, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x85, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x86, 0xE1, 0x85, 0xA1, 0x01, + // Bytes 2e40 - 2e7f + 0x46, 0xE1, 0x84, 0x87, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x89, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x8B, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x8B, 0xE1, 0x85, 0xAE, 0x01, + 0x46, 0xE1, 0x84, 0x8C, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x8E, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x8F, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x90, 0xE1, 0x85, 0xA1, 0x01, + // Bytes 2e80 - 2ebf + 0x46, 0xE1, 0x84, 0x91, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x92, 0xE1, 0x85, 0xA1, 0x01, + 0x49, 0xE3, 0x83, 0xA1, 0xE3, 0x82, 0xAB, 0xE3, + 0x82, 0x99, 0x0D, 0x4C, 0xE1, 0x84, 0x8C, 0xE1, + 0x85, 0xAE, 0xE1, 0x84, 0x8B, 0xE1, 0x85, 0xB4, + 0x01, 0x4C, 0xE3, 0x82, 0xAD, 0xE3, 0x82, 0x99, + 0xE3, 0x82, 0xAB, 0xE3, 0x82, 0x99, 0x0D, 0x4C, + 0xE3, 0x82, 0xB3, 0xE3, 0x83, 0xBC, 0xE3, 0x83, + // Bytes 2ec0 - 2eff + 0x9B, 0xE3, 0x82, 0x9A, 0x0D, 0x4C, 0xE3, 0x83, + 0xA4, 0xE3, 0x83, 0xBC, 0xE3, 0x83, 0x88, 0xE3, + 0x82, 0x99, 0x0D, 0x4F, 0xE1, 0x84, 0x8E, 0xE1, + 0x85, 0xA1, 0xE1, 0x86, 0xB7, 0xE1, 0x84, 0x80, + 0xE1, 0x85, 0xA9, 0x01, 0x4F, 0xE3, 0x82, 0xA4, + 0xE3, 0x83, 0x8B, 0xE3, 0x83, 0xB3, 0xE3, 0x82, + 0xAF, 0xE3, 0x82, 0x99, 0x0D, 0x4F, 0xE3, 0x82, + 0xB7, 0xE3, 0x83, 0xAA, 0xE3, 0x83, 0xB3, 0xE3, + // Bytes 2f00 - 2f3f + 0x82, 0xAF, 0xE3, 0x82, 0x99, 0x0D, 0x4F, 0xE3, + 0x83, 0x98, 0xE3, 0x82, 0x9A, 0xE3, 0x83, 0xBC, + 0xE3, 0x82, 0xB7, 0xE3, 0x82, 0x99, 0x0D, 0x4F, + 0xE3, 0x83, 0x9B, 0xE3, 0x82, 0x9A, 0xE3, 0x83, + 0xB3, 0xE3, 0x83, 0x88, 0xE3, 0x82, 0x99, 0x0D, + 0x52, 0xE3, 0x82, 0xA8, 0xE3, 0x82, 0xB9, 0xE3, + 0x82, 0xAF, 0xE3, 0x83, 0xBC, 0xE3, 0x83, 0x88, + 0xE3, 0x82, 0x99, 0x0D, 0x52, 0xE3, 0x83, 0x95, + // Bytes 2f40 - 2f7f + 0xE3, 0x82, 0xA1, 0xE3, 0x83, 0xA9, 0xE3, 0x83, + 0x83, 0xE3, 0x83, 0x88, 0xE3, 0x82, 0x99, 0x0D, + 0x86, 0xE0, 0xB3, 0x86, 0xE0, 0xB3, 0x82, 0x01, + 0x86, 0xE0, 0xB7, 0x99, 0xE0, 0xB7, 0x8F, 0x01, + 0x03, 0x3C, 0xCC, 0xB8, 0x05, 0x03, 0x3D, 0xCC, + 0xB8, 0x05, 0x03, 0x3E, 0xCC, 0xB8, 0x05, 0x03, + 0x41, 0xCC, 0x80, 0xC9, 0x03, 0x41, 0xCC, 0x81, + 0xC9, 0x03, 0x41, 0xCC, 0x83, 0xC9, 0x03, 0x41, + // Bytes 2f80 - 2fbf + 0xCC, 0x84, 0xC9, 0x03, 0x41, 0xCC, 0x89, 0xC9, + 0x03, 0x41, 0xCC, 0x8C, 0xC9, 0x03, 0x41, 0xCC, + 0x8F, 0xC9, 0x03, 0x41, 0xCC, 0x91, 0xC9, 0x03, + 0x41, 0xCC, 0xA5, 0xB5, 0x03, 0x41, 0xCC, 0xA8, + 0xA5, 0x03, 0x42, 0xCC, 0x87, 0xC9, 0x03, 0x42, + 0xCC, 0xA3, 0xB5, 0x03, 0x42, 0xCC, 0xB1, 0xB5, + 0x03, 0x43, 0xCC, 0x81, 0xC9, 0x03, 0x43, 0xCC, + 0x82, 0xC9, 0x03, 0x43, 0xCC, 0x87, 0xC9, 0x03, + // Bytes 2fc0 - 2fff + 0x43, 0xCC, 0x8C, 0xC9, 0x03, 0x44, 0xCC, 0x87, + 0xC9, 0x03, 0x44, 0xCC, 0x8C, 0xC9, 0x03, 0x44, + 0xCC, 0xA3, 0xB5, 0x03, 0x44, 0xCC, 0xA7, 0xA5, + 0x03, 0x44, 0xCC, 0xAD, 0xB5, 0x03, 0x44, 0xCC, + 0xB1, 0xB5, 0x03, 0x45, 0xCC, 0x80, 0xC9, 0x03, + 0x45, 0xCC, 0x81, 0xC9, 0x03, 0x45, 0xCC, 0x83, + 0xC9, 0x03, 0x45, 0xCC, 0x86, 0xC9, 0x03, 0x45, + 0xCC, 0x87, 0xC9, 0x03, 0x45, 0xCC, 0x88, 0xC9, + // Bytes 3000 - 303f + 0x03, 0x45, 0xCC, 0x89, 0xC9, 0x03, 0x45, 0xCC, + 0x8C, 0xC9, 0x03, 0x45, 0xCC, 0x8F, 0xC9, 0x03, + 0x45, 0xCC, 0x91, 0xC9, 0x03, 0x45, 0xCC, 0xA8, + 0xA5, 0x03, 0x45, 0xCC, 0xAD, 0xB5, 0x03, 0x45, + 0xCC, 0xB0, 0xB5, 0x03, 0x46, 0xCC, 0x87, 0xC9, + 0x03, 0x47, 0xCC, 0x81, 0xC9, 0x03, 0x47, 0xCC, + 0x82, 0xC9, 0x03, 0x47, 0xCC, 0x84, 0xC9, 0x03, + 0x47, 0xCC, 0x86, 0xC9, 0x03, 0x47, 0xCC, 0x87, + // Bytes 3040 - 307f + 0xC9, 0x03, 0x47, 0xCC, 0x8C, 0xC9, 0x03, 0x47, + 0xCC, 0xA7, 0xA5, 0x03, 0x48, 0xCC, 0x82, 0xC9, + 0x03, 0x48, 0xCC, 0x87, 0xC9, 0x03, 0x48, 0xCC, + 0x88, 0xC9, 0x03, 0x48, 0xCC, 0x8C, 0xC9, 0x03, + 0x48, 0xCC, 0xA3, 0xB5, 0x03, 0x48, 0xCC, 0xA7, + 0xA5, 0x03, 0x48, 0xCC, 0xAE, 0xB5, 0x03, 0x49, + 0xCC, 0x80, 0xC9, 0x03, 0x49, 0xCC, 0x81, 0xC9, + 0x03, 0x49, 0xCC, 0x82, 0xC9, 0x03, 0x49, 0xCC, + // Bytes 3080 - 30bf + 0x83, 0xC9, 0x03, 0x49, 0xCC, 0x84, 0xC9, 0x03, + 0x49, 0xCC, 0x86, 0xC9, 0x03, 0x49, 0xCC, 0x87, + 0xC9, 0x03, 0x49, 0xCC, 0x89, 0xC9, 0x03, 0x49, + 0xCC, 0x8C, 0xC9, 0x03, 0x49, 0xCC, 0x8F, 0xC9, + 0x03, 0x49, 0xCC, 0x91, 0xC9, 0x03, 0x49, 0xCC, + 0xA3, 0xB5, 0x03, 0x49, 0xCC, 0xA8, 0xA5, 0x03, + 0x49, 0xCC, 0xB0, 0xB5, 0x03, 0x4A, 0xCC, 0x82, + 0xC9, 0x03, 0x4B, 0xCC, 0x81, 0xC9, 0x03, 0x4B, + // Bytes 30c0 - 30ff + 0xCC, 0x8C, 0xC9, 0x03, 0x4B, 0xCC, 0xA3, 0xB5, + 0x03, 0x4B, 0xCC, 0xA7, 0xA5, 0x03, 0x4B, 0xCC, + 0xB1, 0xB5, 0x03, 0x4C, 0xCC, 0x81, 0xC9, 0x03, + 0x4C, 0xCC, 0x8C, 0xC9, 0x03, 0x4C, 0xCC, 0xA7, + 0xA5, 0x03, 0x4C, 0xCC, 0xAD, 0xB5, 0x03, 0x4C, + 0xCC, 0xB1, 0xB5, 0x03, 0x4D, 0xCC, 0x81, 0xC9, + 0x03, 0x4D, 0xCC, 0x87, 0xC9, 0x03, 0x4D, 0xCC, + 0xA3, 0xB5, 0x03, 0x4E, 0xCC, 0x80, 0xC9, 0x03, + // Bytes 3100 - 313f + 0x4E, 0xCC, 0x81, 0xC9, 0x03, 0x4E, 0xCC, 0x83, + 0xC9, 0x03, 0x4E, 0xCC, 0x87, 0xC9, 0x03, 0x4E, + 0xCC, 0x8C, 0xC9, 0x03, 0x4E, 0xCC, 0xA3, 0xB5, + 0x03, 0x4E, 0xCC, 0xA7, 0xA5, 0x03, 0x4E, 0xCC, + 0xAD, 0xB5, 0x03, 0x4E, 0xCC, 0xB1, 0xB5, 0x03, + 0x4F, 0xCC, 0x80, 0xC9, 0x03, 0x4F, 0xCC, 0x81, + 0xC9, 0x03, 0x4F, 0xCC, 0x86, 0xC9, 0x03, 0x4F, + 0xCC, 0x89, 0xC9, 0x03, 0x4F, 0xCC, 0x8B, 0xC9, + // Bytes 3140 - 317f + 0x03, 0x4F, 0xCC, 0x8C, 0xC9, 0x03, 0x4F, 0xCC, + 0x8F, 0xC9, 0x03, 0x4F, 0xCC, 0x91, 0xC9, 0x03, + 0x50, 0xCC, 0x81, 0xC9, 0x03, 0x50, 0xCC, 0x87, + 0xC9, 0x03, 0x52, 0xCC, 0x81, 0xC9, 0x03, 0x52, + 0xCC, 0x87, 0xC9, 0x03, 0x52, 0xCC, 0x8C, 0xC9, + 0x03, 0x52, 0xCC, 0x8F, 0xC9, 0x03, 0x52, 0xCC, + 0x91, 0xC9, 0x03, 0x52, 0xCC, 0xA7, 0xA5, 0x03, + 0x52, 0xCC, 0xB1, 0xB5, 0x03, 0x53, 0xCC, 0x82, + // Bytes 3180 - 31bf + 0xC9, 0x03, 0x53, 0xCC, 0x87, 0xC9, 0x03, 0x53, + 0xCC, 0xA6, 0xB5, 0x03, 0x53, 0xCC, 0xA7, 0xA5, + 0x03, 0x54, 0xCC, 0x87, 0xC9, 0x03, 0x54, 0xCC, + 0x8C, 0xC9, 0x03, 0x54, 0xCC, 0xA3, 0xB5, 0x03, + 0x54, 0xCC, 0xA6, 0xB5, 0x03, 0x54, 0xCC, 0xA7, + 0xA5, 0x03, 0x54, 0xCC, 0xAD, 0xB5, 0x03, 0x54, + 0xCC, 0xB1, 0xB5, 0x03, 0x55, 0xCC, 0x80, 0xC9, + 0x03, 0x55, 0xCC, 0x81, 0xC9, 0x03, 0x55, 0xCC, + // Bytes 31c0 - 31ff + 0x82, 0xC9, 0x03, 0x55, 0xCC, 0x86, 0xC9, 0x03, + 0x55, 0xCC, 0x89, 0xC9, 0x03, 0x55, 0xCC, 0x8A, + 0xC9, 0x03, 0x55, 0xCC, 0x8B, 0xC9, 0x03, 0x55, + 0xCC, 0x8C, 0xC9, 0x03, 0x55, 0xCC, 0x8F, 0xC9, + 0x03, 0x55, 0xCC, 0x91, 0xC9, 0x03, 0x55, 0xCC, + 0xA3, 0xB5, 0x03, 0x55, 0xCC, 0xA4, 0xB5, 0x03, + 0x55, 0xCC, 0xA8, 0xA5, 0x03, 0x55, 0xCC, 0xAD, + 0xB5, 0x03, 0x55, 0xCC, 0xB0, 0xB5, 0x03, 0x56, + // Bytes 3200 - 323f + 0xCC, 0x83, 0xC9, 0x03, 0x56, 0xCC, 0xA3, 0xB5, + 0x03, 0x57, 0xCC, 0x80, 0xC9, 0x03, 0x57, 0xCC, + 0x81, 0xC9, 0x03, 0x57, 0xCC, 0x82, 0xC9, 0x03, + 0x57, 0xCC, 0x87, 0xC9, 0x03, 0x57, 0xCC, 0x88, + 0xC9, 0x03, 0x57, 0xCC, 0xA3, 0xB5, 0x03, 0x58, + 0xCC, 0x87, 0xC9, 0x03, 0x58, 0xCC, 0x88, 0xC9, + 0x03, 0x59, 0xCC, 0x80, 0xC9, 0x03, 0x59, 0xCC, + 0x81, 0xC9, 0x03, 0x59, 0xCC, 0x82, 0xC9, 0x03, + // Bytes 3240 - 327f + 0x59, 0xCC, 0x83, 0xC9, 0x03, 0x59, 0xCC, 0x84, + 0xC9, 0x03, 0x59, 0xCC, 0x87, 0xC9, 0x03, 0x59, + 0xCC, 0x88, 0xC9, 0x03, 0x59, 0xCC, 0x89, 0xC9, + 0x03, 0x59, 0xCC, 0xA3, 0xB5, 0x03, 0x5A, 0xCC, + 0x81, 0xC9, 0x03, 0x5A, 0xCC, 0x82, 0xC9, 0x03, + 0x5A, 0xCC, 0x87, 0xC9, 0x03, 0x5A, 0xCC, 0x8C, + 0xC9, 0x03, 0x5A, 0xCC, 0xA3, 0xB5, 0x03, 0x5A, + 0xCC, 0xB1, 0xB5, 0x03, 0x61, 0xCC, 0x80, 0xC9, + // Bytes 3280 - 32bf + 0x03, 0x61, 0xCC, 0x81, 0xC9, 0x03, 0x61, 0xCC, + 0x83, 0xC9, 0x03, 0x61, 0xCC, 0x84, 0xC9, 0x03, + 0x61, 0xCC, 0x89, 0xC9, 0x03, 0x61, 0xCC, 0x8C, + 0xC9, 0x03, 0x61, 0xCC, 0x8F, 0xC9, 0x03, 0x61, + 0xCC, 0x91, 0xC9, 0x03, 0x61, 0xCC, 0xA5, 0xB5, + 0x03, 0x61, 0xCC, 0xA8, 0xA5, 0x03, 0x62, 0xCC, + 0x87, 0xC9, 0x03, 0x62, 0xCC, 0xA3, 0xB5, 0x03, + 0x62, 0xCC, 0xB1, 0xB5, 0x03, 0x63, 0xCC, 0x81, + // Bytes 32c0 - 32ff + 0xC9, 0x03, 0x63, 0xCC, 0x82, 0xC9, 0x03, 0x63, + 0xCC, 0x87, 0xC9, 0x03, 0x63, 0xCC, 0x8C, 0xC9, + 0x03, 0x64, 0xCC, 0x87, 0xC9, 0x03, 0x64, 0xCC, + 0x8C, 0xC9, 0x03, 0x64, 0xCC, 0xA3, 0xB5, 0x03, + 0x64, 0xCC, 0xA7, 0xA5, 0x03, 0x64, 0xCC, 0xAD, + 0xB5, 0x03, 0x64, 0xCC, 0xB1, 0xB5, 0x03, 0x65, + 0xCC, 0x80, 0xC9, 0x03, 0x65, 0xCC, 0x81, 0xC9, + 0x03, 0x65, 0xCC, 0x83, 0xC9, 0x03, 0x65, 0xCC, + // Bytes 3300 - 333f + 0x86, 0xC9, 0x03, 0x65, 0xCC, 0x87, 0xC9, 0x03, + 0x65, 0xCC, 0x88, 0xC9, 0x03, 0x65, 0xCC, 0x89, + 0xC9, 0x03, 0x65, 0xCC, 0x8C, 0xC9, 0x03, 0x65, + 0xCC, 0x8F, 0xC9, 0x03, 0x65, 0xCC, 0x91, 0xC9, + 0x03, 0x65, 0xCC, 0xA8, 0xA5, 0x03, 0x65, 0xCC, + 0xAD, 0xB5, 0x03, 0x65, 0xCC, 0xB0, 0xB5, 0x03, + 0x66, 0xCC, 0x87, 0xC9, 0x03, 0x67, 0xCC, 0x81, + 0xC9, 0x03, 0x67, 0xCC, 0x82, 0xC9, 0x03, 0x67, + // Bytes 3340 - 337f + 0xCC, 0x84, 0xC9, 0x03, 0x67, 0xCC, 0x86, 0xC9, + 0x03, 0x67, 0xCC, 0x87, 0xC9, 0x03, 0x67, 0xCC, + 0x8C, 0xC9, 0x03, 0x67, 0xCC, 0xA7, 0xA5, 0x03, + 0x68, 0xCC, 0x82, 0xC9, 0x03, 0x68, 0xCC, 0x87, + 0xC9, 0x03, 0x68, 0xCC, 0x88, 0xC9, 0x03, 0x68, + 0xCC, 0x8C, 0xC9, 0x03, 0x68, 0xCC, 0xA3, 0xB5, + 0x03, 0x68, 0xCC, 0xA7, 0xA5, 0x03, 0x68, 0xCC, + 0xAE, 0xB5, 0x03, 0x68, 0xCC, 0xB1, 0xB5, 0x03, + // Bytes 3380 - 33bf + 0x69, 0xCC, 0x80, 0xC9, 0x03, 0x69, 0xCC, 0x81, + 0xC9, 0x03, 0x69, 0xCC, 0x82, 0xC9, 0x03, 0x69, + 0xCC, 0x83, 0xC9, 0x03, 0x69, 0xCC, 0x84, 0xC9, + 0x03, 0x69, 0xCC, 0x86, 0xC9, 0x03, 0x69, 0xCC, + 0x89, 0xC9, 0x03, 0x69, 0xCC, 0x8C, 0xC9, 0x03, + 0x69, 0xCC, 0x8F, 0xC9, 0x03, 0x69, 0xCC, 0x91, + 0xC9, 0x03, 0x69, 0xCC, 0xA3, 0xB5, 0x03, 0x69, + 0xCC, 0xA8, 0xA5, 0x03, 0x69, 0xCC, 0xB0, 0xB5, + // Bytes 33c0 - 33ff + 0x03, 0x6A, 0xCC, 0x82, 0xC9, 0x03, 0x6A, 0xCC, + 0x8C, 0xC9, 0x03, 0x6B, 0xCC, 0x81, 0xC9, 0x03, + 0x6B, 0xCC, 0x8C, 0xC9, 0x03, 0x6B, 0xCC, 0xA3, + 0xB5, 0x03, 0x6B, 0xCC, 0xA7, 0xA5, 0x03, 0x6B, + 0xCC, 0xB1, 0xB5, 0x03, 0x6C, 0xCC, 0x81, 0xC9, + 0x03, 0x6C, 0xCC, 0x8C, 0xC9, 0x03, 0x6C, 0xCC, + 0xA7, 0xA5, 0x03, 0x6C, 0xCC, 0xAD, 0xB5, 0x03, + 0x6C, 0xCC, 0xB1, 0xB5, 0x03, 0x6D, 0xCC, 0x81, + // Bytes 3400 - 343f + 0xC9, 0x03, 0x6D, 0xCC, 0x87, 0xC9, 0x03, 0x6D, + 0xCC, 0xA3, 0xB5, 0x03, 0x6E, 0xCC, 0x80, 0xC9, + 0x03, 0x6E, 0xCC, 0x81, 0xC9, 0x03, 0x6E, 0xCC, + 0x83, 0xC9, 0x03, 0x6E, 0xCC, 0x87, 0xC9, 0x03, + 0x6E, 0xCC, 0x8C, 0xC9, 0x03, 0x6E, 0xCC, 0xA3, + 0xB5, 0x03, 0x6E, 0xCC, 0xA7, 0xA5, 0x03, 0x6E, + 0xCC, 0xAD, 0xB5, 0x03, 0x6E, 0xCC, 0xB1, 0xB5, + 0x03, 0x6F, 0xCC, 0x80, 0xC9, 0x03, 0x6F, 0xCC, + // Bytes 3440 - 347f + 0x81, 0xC9, 0x03, 0x6F, 0xCC, 0x86, 0xC9, 0x03, + 0x6F, 0xCC, 0x89, 0xC9, 0x03, 0x6F, 0xCC, 0x8B, + 0xC9, 0x03, 0x6F, 0xCC, 0x8C, 0xC9, 0x03, 0x6F, + 0xCC, 0x8F, 0xC9, 0x03, 0x6F, 0xCC, 0x91, 0xC9, + 0x03, 0x70, 0xCC, 0x81, 0xC9, 0x03, 0x70, 0xCC, + 0x87, 0xC9, 0x03, 0x72, 0xCC, 0x81, 0xC9, 0x03, + 0x72, 0xCC, 0x87, 0xC9, 0x03, 0x72, 0xCC, 0x8C, + 0xC9, 0x03, 0x72, 0xCC, 0x8F, 0xC9, 0x03, 0x72, + // Bytes 3480 - 34bf + 0xCC, 0x91, 0xC9, 0x03, 0x72, 0xCC, 0xA7, 0xA5, + 0x03, 0x72, 0xCC, 0xB1, 0xB5, 0x03, 0x73, 0xCC, + 0x82, 0xC9, 0x03, 0x73, 0xCC, 0x87, 0xC9, 0x03, + 0x73, 0xCC, 0xA6, 0xB5, 0x03, 0x73, 0xCC, 0xA7, + 0xA5, 0x03, 0x74, 0xCC, 0x87, 0xC9, 0x03, 0x74, + 0xCC, 0x88, 0xC9, 0x03, 0x74, 0xCC, 0x8C, 0xC9, + 0x03, 0x74, 0xCC, 0xA3, 0xB5, 0x03, 0x74, 0xCC, + 0xA6, 0xB5, 0x03, 0x74, 0xCC, 0xA7, 0xA5, 0x03, + // Bytes 34c0 - 34ff + 0x74, 0xCC, 0xAD, 0xB5, 0x03, 0x74, 0xCC, 0xB1, + 0xB5, 0x03, 0x75, 0xCC, 0x80, 0xC9, 0x03, 0x75, + 0xCC, 0x81, 0xC9, 0x03, 0x75, 0xCC, 0x82, 0xC9, + 0x03, 0x75, 0xCC, 0x86, 0xC9, 0x03, 0x75, 0xCC, + 0x89, 0xC9, 0x03, 0x75, 0xCC, 0x8A, 0xC9, 0x03, + 0x75, 0xCC, 0x8B, 0xC9, 0x03, 0x75, 0xCC, 0x8C, + 0xC9, 0x03, 0x75, 0xCC, 0x8F, 0xC9, 0x03, 0x75, + 0xCC, 0x91, 0xC9, 0x03, 0x75, 0xCC, 0xA3, 0xB5, + // Bytes 3500 - 353f + 0x03, 0x75, 0xCC, 0xA4, 0xB5, 0x03, 0x75, 0xCC, + 0xA8, 0xA5, 0x03, 0x75, 0xCC, 0xAD, 0xB5, 0x03, + 0x75, 0xCC, 0xB0, 0xB5, 0x03, 0x76, 0xCC, 0x83, + 0xC9, 0x03, 0x76, 0xCC, 0xA3, 0xB5, 0x03, 0x77, + 0xCC, 0x80, 0xC9, 0x03, 0x77, 0xCC, 0x81, 0xC9, + 0x03, 0x77, 0xCC, 0x82, 0xC9, 0x03, 0x77, 0xCC, + 0x87, 0xC9, 0x03, 0x77, 0xCC, 0x88, 0xC9, 0x03, + 0x77, 0xCC, 0x8A, 0xC9, 0x03, 0x77, 0xCC, 0xA3, + // Bytes 3540 - 357f + 0xB5, 0x03, 0x78, 0xCC, 0x87, 0xC9, 0x03, 0x78, + 0xCC, 0x88, 0xC9, 0x03, 0x79, 0xCC, 0x80, 0xC9, + 0x03, 0x79, 0xCC, 0x81, 0xC9, 0x03, 0x79, 0xCC, + 0x82, 0xC9, 0x03, 0x79, 0xCC, 0x83, 0xC9, 0x03, + 0x79, 0xCC, 0x84, 0xC9, 0x03, 0x79, 0xCC, 0x87, + 0xC9, 0x03, 0x79, 0xCC, 0x88, 0xC9, 0x03, 0x79, + 0xCC, 0x89, 0xC9, 0x03, 0x79, 0xCC, 0x8A, 0xC9, + 0x03, 0x79, 0xCC, 0xA3, 0xB5, 0x03, 0x7A, 0xCC, + // Bytes 3580 - 35bf + 0x81, 0xC9, 0x03, 0x7A, 0xCC, 0x82, 0xC9, 0x03, + 0x7A, 0xCC, 0x87, 0xC9, 0x03, 0x7A, 0xCC, 0x8C, + 0xC9, 0x03, 0x7A, 0xCC, 0xA3, 0xB5, 0x03, 0x7A, + 0xCC, 0xB1, 0xB5, 0x04, 0xC2, 0xA8, 0xCC, 0x80, + 0xCA, 0x04, 0xC2, 0xA8, 0xCC, 0x81, 0xCA, 0x04, + 0xC2, 0xA8, 0xCD, 0x82, 0xCA, 0x04, 0xC3, 0x86, + 0xCC, 0x81, 0xC9, 0x04, 0xC3, 0x86, 0xCC, 0x84, + 0xC9, 0x04, 0xC3, 0x98, 0xCC, 0x81, 0xC9, 0x04, + // Bytes 35c0 - 35ff + 0xC3, 0xA6, 0xCC, 0x81, 0xC9, 0x04, 0xC3, 0xA6, + 0xCC, 0x84, 0xC9, 0x04, 0xC3, 0xB8, 0xCC, 0x81, + 0xC9, 0x04, 0xC5, 0xBF, 0xCC, 0x87, 0xC9, 0x04, + 0xC6, 0xB7, 0xCC, 0x8C, 0xC9, 0x04, 0xCA, 0x92, + 0xCC, 0x8C, 0xC9, 0x04, 0xCE, 0x91, 0xCC, 0x80, + 0xC9, 0x04, 0xCE, 0x91, 0xCC, 0x81, 0xC9, 0x04, + 0xCE, 0x91, 0xCC, 0x84, 0xC9, 0x04, 0xCE, 0x91, + 0xCC, 0x86, 0xC9, 0x04, 0xCE, 0x91, 0xCD, 0x85, + // Bytes 3600 - 363f + 0xD9, 0x04, 0xCE, 0x95, 0xCC, 0x80, 0xC9, 0x04, + 0xCE, 0x95, 0xCC, 0x81, 0xC9, 0x04, 0xCE, 0x97, + 0xCC, 0x80, 0xC9, 0x04, 0xCE, 0x97, 0xCC, 0x81, + 0xC9, 0x04, 0xCE, 0x97, 0xCD, 0x85, 0xD9, 0x04, + 0xCE, 0x99, 0xCC, 0x80, 0xC9, 0x04, 0xCE, 0x99, + 0xCC, 0x81, 0xC9, 0x04, 0xCE, 0x99, 0xCC, 0x84, + 0xC9, 0x04, 0xCE, 0x99, 0xCC, 0x86, 0xC9, 0x04, + 0xCE, 0x99, 0xCC, 0x88, 0xC9, 0x04, 0xCE, 0x9F, + // Bytes 3640 - 367f + 0xCC, 0x80, 0xC9, 0x04, 0xCE, 0x9F, 0xCC, 0x81, + 0xC9, 0x04, 0xCE, 0xA1, 0xCC, 0x94, 0xC9, 0x04, + 0xCE, 0xA5, 0xCC, 0x80, 0xC9, 0x04, 0xCE, 0xA5, + 0xCC, 0x81, 0xC9, 0x04, 0xCE, 0xA5, 0xCC, 0x84, + 0xC9, 0x04, 0xCE, 0xA5, 0xCC, 0x86, 0xC9, 0x04, + 0xCE, 0xA5, 0xCC, 0x88, 0xC9, 0x04, 0xCE, 0xA9, + 0xCC, 0x80, 0xC9, 0x04, 0xCE, 0xA9, 0xCC, 0x81, + 0xC9, 0x04, 0xCE, 0xA9, 0xCD, 0x85, 0xD9, 0x04, + // Bytes 3680 - 36bf + 0xCE, 0xB1, 0xCC, 0x84, 0xC9, 0x04, 0xCE, 0xB1, + 0xCC, 0x86, 0xC9, 0x04, 0xCE, 0xB1, 0xCD, 0x85, + 0xD9, 0x04, 0xCE, 0xB5, 0xCC, 0x80, 0xC9, 0x04, + 0xCE, 0xB5, 0xCC, 0x81, 0xC9, 0x04, 0xCE, 0xB7, + 0xCD, 0x85, 0xD9, 0x04, 0xCE, 0xB9, 0xCC, 0x80, + 0xC9, 0x04, 0xCE, 0xB9, 0xCC, 0x81, 0xC9, 0x04, + 0xCE, 0xB9, 0xCC, 0x84, 0xC9, 0x04, 0xCE, 0xB9, + 0xCC, 0x86, 0xC9, 0x04, 0xCE, 0xB9, 0xCD, 0x82, + // Bytes 36c0 - 36ff + 0xC9, 0x04, 0xCE, 0xBF, 0xCC, 0x80, 0xC9, 0x04, + 0xCE, 0xBF, 0xCC, 0x81, 0xC9, 0x04, 0xCF, 0x81, + 0xCC, 0x93, 0xC9, 0x04, 0xCF, 0x81, 0xCC, 0x94, + 0xC9, 0x04, 0xCF, 0x85, 0xCC, 0x80, 0xC9, 0x04, + 0xCF, 0x85, 0xCC, 0x81, 0xC9, 0x04, 0xCF, 0x85, + 0xCC, 0x84, 0xC9, 0x04, 0xCF, 0x85, 0xCC, 0x86, + 0xC9, 0x04, 0xCF, 0x85, 0xCD, 0x82, 0xC9, 0x04, + 0xCF, 0x89, 0xCD, 0x85, 0xD9, 0x04, 0xCF, 0x92, + // Bytes 3700 - 373f + 0xCC, 0x81, 0xC9, 0x04, 0xCF, 0x92, 0xCC, 0x88, + 0xC9, 0x04, 0xD0, 0x86, 0xCC, 0x88, 0xC9, 0x04, + 0xD0, 0x90, 0xCC, 0x86, 0xC9, 0x04, 0xD0, 0x90, + 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0x93, 0xCC, 0x81, + 0xC9, 0x04, 0xD0, 0x95, 0xCC, 0x80, 0xC9, 0x04, + 0xD0, 0x95, 0xCC, 0x86, 0xC9, 0x04, 0xD0, 0x95, + 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0x96, 0xCC, 0x86, + 0xC9, 0x04, 0xD0, 0x96, 0xCC, 0x88, 0xC9, 0x04, + // Bytes 3740 - 377f + 0xD0, 0x97, 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0x98, + 0xCC, 0x80, 0xC9, 0x04, 0xD0, 0x98, 0xCC, 0x84, + 0xC9, 0x04, 0xD0, 0x98, 0xCC, 0x86, 0xC9, 0x04, + 0xD0, 0x98, 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0x9A, + 0xCC, 0x81, 0xC9, 0x04, 0xD0, 0x9E, 0xCC, 0x88, + 0xC9, 0x04, 0xD0, 0xA3, 0xCC, 0x84, 0xC9, 0x04, + 0xD0, 0xA3, 0xCC, 0x86, 0xC9, 0x04, 0xD0, 0xA3, + 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0xA3, 0xCC, 0x8B, + // Bytes 3780 - 37bf + 0xC9, 0x04, 0xD0, 0xA7, 0xCC, 0x88, 0xC9, 0x04, + 0xD0, 0xAB, 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0xAD, + 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0xB0, 0xCC, 0x86, + 0xC9, 0x04, 0xD0, 0xB0, 0xCC, 0x88, 0xC9, 0x04, + 0xD0, 0xB3, 0xCC, 0x81, 0xC9, 0x04, 0xD0, 0xB5, + 0xCC, 0x80, 0xC9, 0x04, 0xD0, 0xB5, 0xCC, 0x86, + 0xC9, 0x04, 0xD0, 0xB5, 0xCC, 0x88, 0xC9, 0x04, + 0xD0, 0xB6, 0xCC, 0x86, 0xC9, 0x04, 0xD0, 0xB6, + // Bytes 37c0 - 37ff + 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0xB7, 0xCC, 0x88, + 0xC9, 0x04, 0xD0, 0xB8, 0xCC, 0x80, 0xC9, 0x04, + 0xD0, 0xB8, 0xCC, 0x84, 0xC9, 0x04, 0xD0, 0xB8, + 0xCC, 0x86, 0xC9, 0x04, 0xD0, 0xB8, 0xCC, 0x88, + 0xC9, 0x04, 0xD0, 0xBA, 0xCC, 0x81, 0xC9, 0x04, + 0xD0, 0xBE, 0xCC, 0x88, 0xC9, 0x04, 0xD1, 0x83, + 0xCC, 0x84, 0xC9, 0x04, 0xD1, 0x83, 0xCC, 0x86, + 0xC9, 0x04, 0xD1, 0x83, 0xCC, 0x88, 0xC9, 0x04, + // Bytes 3800 - 383f + 0xD1, 0x83, 0xCC, 0x8B, 0xC9, 0x04, 0xD1, 0x87, + 0xCC, 0x88, 0xC9, 0x04, 0xD1, 0x8B, 0xCC, 0x88, + 0xC9, 0x04, 0xD1, 0x8D, 0xCC, 0x88, 0xC9, 0x04, + 0xD1, 0x96, 0xCC, 0x88, 0xC9, 0x04, 0xD1, 0xB4, + 0xCC, 0x8F, 0xC9, 0x04, 0xD1, 0xB5, 0xCC, 0x8F, + 0xC9, 0x04, 0xD3, 0x98, 0xCC, 0x88, 0xC9, 0x04, + 0xD3, 0x99, 0xCC, 0x88, 0xC9, 0x04, 0xD3, 0xA8, + 0xCC, 0x88, 0xC9, 0x04, 0xD3, 0xA9, 0xCC, 0x88, + // Bytes 3840 - 387f + 0xC9, 0x04, 0xD8, 0xA7, 0xD9, 0x93, 0xC9, 0x04, + 0xD8, 0xA7, 0xD9, 0x94, 0xC9, 0x04, 0xD8, 0xA7, + 0xD9, 0x95, 0xB5, 0x04, 0xD9, 0x88, 0xD9, 0x94, + 0xC9, 0x04, 0xD9, 0x8A, 0xD9, 0x94, 0xC9, 0x04, + 0xDB, 0x81, 0xD9, 0x94, 0xC9, 0x04, 0xDB, 0x92, + 0xD9, 0x94, 0xC9, 0x04, 0xDB, 0x95, 0xD9, 0x94, + 0xC9, 0x05, 0x41, 0xCC, 0x82, 0xCC, 0x80, 0xCA, + 0x05, 0x41, 0xCC, 0x82, 0xCC, 0x81, 0xCA, 0x05, + // Bytes 3880 - 38bf + 0x41, 0xCC, 0x82, 0xCC, 0x83, 0xCA, 0x05, 0x41, + 0xCC, 0x82, 0xCC, 0x89, 0xCA, 0x05, 0x41, 0xCC, + 0x86, 0xCC, 0x80, 0xCA, 0x05, 0x41, 0xCC, 0x86, + 0xCC, 0x81, 0xCA, 0x05, 0x41, 0xCC, 0x86, 0xCC, + 0x83, 0xCA, 0x05, 0x41, 0xCC, 0x86, 0xCC, 0x89, + 0xCA, 0x05, 0x41, 0xCC, 0x87, 0xCC, 0x84, 0xCA, + 0x05, 0x41, 0xCC, 0x88, 0xCC, 0x84, 0xCA, 0x05, + 0x41, 0xCC, 0x8A, 0xCC, 0x81, 0xCA, 0x05, 0x41, + // Bytes 38c0 - 38ff + 0xCC, 0xA3, 0xCC, 0x82, 0xCA, 0x05, 0x41, 0xCC, + 0xA3, 0xCC, 0x86, 0xCA, 0x05, 0x43, 0xCC, 0xA7, + 0xCC, 0x81, 0xCA, 0x05, 0x45, 0xCC, 0x82, 0xCC, + 0x80, 0xCA, 0x05, 0x45, 0xCC, 0x82, 0xCC, 0x81, + 0xCA, 0x05, 0x45, 0xCC, 0x82, 0xCC, 0x83, 0xCA, + 0x05, 0x45, 0xCC, 0x82, 0xCC, 0x89, 0xCA, 0x05, + 0x45, 0xCC, 0x84, 0xCC, 0x80, 0xCA, 0x05, 0x45, + 0xCC, 0x84, 0xCC, 0x81, 0xCA, 0x05, 0x45, 0xCC, + // Bytes 3900 - 393f + 0xA3, 0xCC, 0x82, 0xCA, 0x05, 0x45, 0xCC, 0xA7, + 0xCC, 0x86, 0xCA, 0x05, 0x49, 0xCC, 0x88, 0xCC, + 0x81, 0xCA, 0x05, 0x4C, 0xCC, 0xA3, 0xCC, 0x84, + 0xCA, 0x05, 0x4F, 0xCC, 0x82, 0xCC, 0x80, 0xCA, + 0x05, 0x4F, 0xCC, 0x82, 0xCC, 0x81, 0xCA, 0x05, + 0x4F, 0xCC, 0x82, 0xCC, 0x83, 0xCA, 0x05, 0x4F, + 0xCC, 0x82, 0xCC, 0x89, 0xCA, 0x05, 0x4F, 0xCC, + 0x83, 0xCC, 0x81, 0xCA, 0x05, 0x4F, 0xCC, 0x83, + // Bytes 3940 - 397f + 0xCC, 0x84, 0xCA, 0x05, 0x4F, 0xCC, 0x83, 0xCC, + 0x88, 0xCA, 0x05, 0x4F, 0xCC, 0x84, 0xCC, 0x80, + 0xCA, 0x05, 0x4F, 0xCC, 0x84, 0xCC, 0x81, 0xCA, + 0x05, 0x4F, 0xCC, 0x87, 0xCC, 0x84, 0xCA, 0x05, + 0x4F, 0xCC, 0x88, 0xCC, 0x84, 0xCA, 0x05, 0x4F, + 0xCC, 0x9B, 0xCC, 0x80, 0xCA, 0x05, 0x4F, 0xCC, + 0x9B, 0xCC, 0x81, 0xCA, 0x05, 0x4F, 0xCC, 0x9B, + 0xCC, 0x83, 0xCA, 0x05, 0x4F, 0xCC, 0x9B, 0xCC, + // Bytes 3980 - 39bf + 0x89, 0xCA, 0x05, 0x4F, 0xCC, 0x9B, 0xCC, 0xA3, + 0xB6, 0x05, 0x4F, 0xCC, 0xA3, 0xCC, 0x82, 0xCA, + 0x05, 0x4F, 0xCC, 0xA8, 0xCC, 0x84, 0xCA, 0x05, + 0x52, 0xCC, 0xA3, 0xCC, 0x84, 0xCA, 0x05, 0x53, + 0xCC, 0x81, 0xCC, 0x87, 0xCA, 0x05, 0x53, 0xCC, + 0x8C, 0xCC, 0x87, 0xCA, 0x05, 0x53, 0xCC, 0xA3, + 0xCC, 0x87, 0xCA, 0x05, 0x55, 0xCC, 0x83, 0xCC, + 0x81, 0xCA, 0x05, 0x55, 0xCC, 0x84, 0xCC, 0x88, + // Bytes 39c0 - 39ff + 0xCA, 0x05, 0x55, 0xCC, 0x88, 0xCC, 0x80, 0xCA, + 0x05, 0x55, 0xCC, 0x88, 0xCC, 0x81, 0xCA, 0x05, + 0x55, 0xCC, 0x88, 0xCC, 0x84, 0xCA, 0x05, 0x55, + 0xCC, 0x88, 0xCC, 0x8C, 0xCA, 0x05, 0x55, 0xCC, + 0x9B, 0xCC, 0x80, 0xCA, 0x05, 0x55, 0xCC, 0x9B, + 0xCC, 0x81, 0xCA, 0x05, 0x55, 0xCC, 0x9B, 0xCC, + 0x83, 0xCA, 0x05, 0x55, 0xCC, 0x9B, 0xCC, 0x89, + 0xCA, 0x05, 0x55, 0xCC, 0x9B, 0xCC, 0xA3, 0xB6, + // Bytes 3a00 - 3a3f + 0x05, 0x61, 0xCC, 0x82, 0xCC, 0x80, 0xCA, 0x05, + 0x61, 0xCC, 0x82, 0xCC, 0x81, 0xCA, 0x05, 0x61, + 0xCC, 0x82, 0xCC, 0x83, 0xCA, 0x05, 0x61, 0xCC, + 0x82, 0xCC, 0x89, 0xCA, 0x05, 0x61, 0xCC, 0x86, + 0xCC, 0x80, 0xCA, 0x05, 0x61, 0xCC, 0x86, 0xCC, + 0x81, 0xCA, 0x05, 0x61, 0xCC, 0x86, 0xCC, 0x83, + 0xCA, 0x05, 0x61, 0xCC, 0x86, 0xCC, 0x89, 0xCA, + 0x05, 0x61, 0xCC, 0x87, 0xCC, 0x84, 0xCA, 0x05, + // Bytes 3a40 - 3a7f + 0x61, 0xCC, 0x88, 0xCC, 0x84, 0xCA, 0x05, 0x61, + 0xCC, 0x8A, 0xCC, 0x81, 0xCA, 0x05, 0x61, 0xCC, + 0xA3, 0xCC, 0x82, 0xCA, 0x05, 0x61, 0xCC, 0xA3, + 0xCC, 0x86, 0xCA, 0x05, 0x63, 0xCC, 0xA7, 0xCC, + 0x81, 0xCA, 0x05, 0x65, 0xCC, 0x82, 0xCC, 0x80, + 0xCA, 0x05, 0x65, 0xCC, 0x82, 0xCC, 0x81, 0xCA, + 0x05, 0x65, 0xCC, 0x82, 0xCC, 0x83, 0xCA, 0x05, + 0x65, 0xCC, 0x82, 0xCC, 0x89, 0xCA, 0x05, 0x65, + // Bytes 3a80 - 3abf + 0xCC, 0x84, 0xCC, 0x80, 0xCA, 0x05, 0x65, 0xCC, + 0x84, 0xCC, 0x81, 0xCA, 0x05, 0x65, 0xCC, 0xA3, + 0xCC, 0x82, 0xCA, 0x05, 0x65, 0xCC, 0xA7, 0xCC, + 0x86, 0xCA, 0x05, 0x69, 0xCC, 0x88, 0xCC, 0x81, + 0xCA, 0x05, 0x6C, 0xCC, 0xA3, 0xCC, 0x84, 0xCA, + 0x05, 0x6F, 0xCC, 0x82, 0xCC, 0x80, 0xCA, 0x05, + 0x6F, 0xCC, 0x82, 0xCC, 0x81, 0xCA, 0x05, 0x6F, + 0xCC, 0x82, 0xCC, 0x83, 0xCA, 0x05, 0x6F, 0xCC, + // Bytes 3ac0 - 3aff + 0x82, 0xCC, 0x89, 0xCA, 0x05, 0x6F, 0xCC, 0x83, + 0xCC, 0x81, 0xCA, 0x05, 0x6F, 0xCC, 0x83, 0xCC, + 0x84, 0xCA, 0x05, 0x6F, 0xCC, 0x83, 0xCC, 0x88, + 0xCA, 0x05, 0x6F, 0xCC, 0x84, 0xCC, 0x80, 0xCA, + 0x05, 0x6F, 0xCC, 0x84, 0xCC, 0x81, 0xCA, 0x05, + 0x6F, 0xCC, 0x87, 0xCC, 0x84, 0xCA, 0x05, 0x6F, + 0xCC, 0x88, 0xCC, 0x84, 0xCA, 0x05, 0x6F, 0xCC, + 0x9B, 0xCC, 0x80, 0xCA, 0x05, 0x6F, 0xCC, 0x9B, + // Bytes 3b00 - 3b3f + 0xCC, 0x81, 0xCA, 0x05, 0x6F, 0xCC, 0x9B, 0xCC, + 0x83, 0xCA, 0x05, 0x6F, 0xCC, 0x9B, 0xCC, 0x89, + 0xCA, 0x05, 0x6F, 0xCC, 0x9B, 0xCC, 0xA3, 0xB6, + 0x05, 0x6F, 0xCC, 0xA3, 0xCC, 0x82, 0xCA, 0x05, + 0x6F, 0xCC, 0xA8, 0xCC, 0x84, 0xCA, 0x05, 0x72, + 0xCC, 0xA3, 0xCC, 0x84, 0xCA, 0x05, 0x73, 0xCC, + 0x81, 0xCC, 0x87, 0xCA, 0x05, 0x73, 0xCC, 0x8C, + 0xCC, 0x87, 0xCA, 0x05, 0x73, 0xCC, 0xA3, 0xCC, + // Bytes 3b40 - 3b7f + 0x87, 0xCA, 0x05, 0x75, 0xCC, 0x83, 0xCC, 0x81, + 0xCA, 0x05, 0x75, 0xCC, 0x84, 0xCC, 0x88, 0xCA, + 0x05, 0x75, 0xCC, 0x88, 0xCC, 0x80, 0xCA, 0x05, + 0x75, 0xCC, 0x88, 0xCC, 0x81, 0xCA, 0x05, 0x75, + 0xCC, 0x88, 0xCC, 0x84, 0xCA, 0x05, 0x75, 0xCC, + 0x88, 0xCC, 0x8C, 0xCA, 0x05, 0x75, 0xCC, 0x9B, + 0xCC, 0x80, 0xCA, 0x05, 0x75, 0xCC, 0x9B, 0xCC, + 0x81, 0xCA, 0x05, 0x75, 0xCC, 0x9B, 0xCC, 0x83, + // Bytes 3b80 - 3bbf + 0xCA, 0x05, 0x75, 0xCC, 0x9B, 0xCC, 0x89, 0xCA, + 0x05, 0x75, 0xCC, 0x9B, 0xCC, 0xA3, 0xB6, 0x05, + 0xE1, 0xBE, 0xBF, 0xCC, 0x80, 0xCA, 0x05, 0xE1, + 0xBE, 0xBF, 0xCC, 0x81, 0xCA, 0x05, 0xE1, 0xBE, + 0xBF, 0xCD, 0x82, 0xCA, 0x05, 0xE1, 0xBF, 0xBE, + 0xCC, 0x80, 0xCA, 0x05, 0xE1, 0xBF, 0xBE, 0xCC, + 0x81, 0xCA, 0x05, 0xE1, 0xBF, 0xBE, 0xCD, 0x82, + 0xCA, 0x05, 0xE2, 0x86, 0x90, 0xCC, 0xB8, 0x05, + // Bytes 3bc0 - 3bff + 0x05, 0xE2, 0x86, 0x92, 0xCC, 0xB8, 0x05, 0x05, + 0xE2, 0x86, 0x94, 0xCC, 0xB8, 0x05, 0x05, 0xE2, + 0x87, 0x90, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x87, + 0x92, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x87, 0x94, + 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x88, 0x83, 0xCC, + 0xB8, 0x05, 0x05, 0xE2, 0x88, 0x88, 0xCC, 0xB8, + 0x05, 0x05, 0xE2, 0x88, 0x8B, 0xCC, 0xB8, 0x05, + 0x05, 0xE2, 0x88, 0xA3, 0xCC, 0xB8, 0x05, 0x05, + // Bytes 3c00 - 3c3f + 0xE2, 0x88, 0xA5, 0xCC, 0xB8, 0x05, 0x05, 0xE2, + 0x88, 0xBC, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x89, + 0x83, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x89, 0x85, + 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x89, 0x88, 0xCC, + 0xB8, 0x05, 0x05, 0xE2, 0x89, 0x8D, 0xCC, 0xB8, + 0x05, 0x05, 0xE2, 0x89, 0xA1, 0xCC, 0xB8, 0x05, + 0x05, 0xE2, 0x89, 0xA4, 0xCC, 0xB8, 0x05, 0x05, + 0xE2, 0x89, 0xA5, 0xCC, 0xB8, 0x05, 0x05, 0xE2, + // Bytes 3c40 - 3c7f + 0x89, 0xB2, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x89, + 0xB3, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x89, 0xB6, + 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x89, 0xB7, 0xCC, + 0xB8, 0x05, 0x05, 0xE2, 0x89, 0xBA, 0xCC, 0xB8, + 0x05, 0x05, 0xE2, 0x89, 0xBB, 0xCC, 0xB8, 0x05, + 0x05, 0xE2, 0x89, 0xBC, 0xCC, 0xB8, 0x05, 0x05, + 0xE2, 0x89, 0xBD, 0xCC, 0xB8, 0x05, 0x05, 0xE2, + 0x8A, 0x82, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x8A, + // Bytes 3c80 - 3cbf + 0x83, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x8A, 0x86, + 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x8A, 0x87, 0xCC, + 0xB8, 0x05, 0x05, 0xE2, 0x8A, 0x91, 0xCC, 0xB8, + 0x05, 0x05, 0xE2, 0x8A, 0x92, 0xCC, 0xB8, 0x05, + 0x05, 0xE2, 0x8A, 0xA2, 0xCC, 0xB8, 0x05, 0x05, + 0xE2, 0x8A, 0xA8, 0xCC, 0xB8, 0x05, 0x05, 0xE2, + 0x8A, 0xA9, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x8A, + 0xAB, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x8A, 0xB2, + // Bytes 3cc0 - 3cff + 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x8A, 0xB3, 0xCC, + 0xB8, 0x05, 0x05, 0xE2, 0x8A, 0xB4, 0xCC, 0xB8, + 0x05, 0x05, 0xE2, 0x8A, 0xB5, 0xCC, 0xB8, 0x05, + 0x06, 0xCE, 0x91, 0xCC, 0x93, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0x91, 0xCC, 0x94, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0x95, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0x95, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0x95, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + // Bytes 3d00 - 3d3f + 0x06, 0xCE, 0x95, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0x97, 0xCC, 0x93, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0x97, 0xCC, 0x94, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0x99, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0x99, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0x99, 0xCC, 0x93, 0xCD, 0x82, 0xCA, + 0x06, 0xCE, 0x99, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0x99, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + // Bytes 3d40 - 3d7f + 0x06, 0xCE, 0x99, 0xCC, 0x94, 0xCD, 0x82, 0xCA, + 0x06, 0xCE, 0x9F, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0x9F, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0x9F, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0x9F, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xA5, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xA5, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xA5, 0xCC, 0x94, 0xCD, 0x82, 0xCA, + // Bytes 3d80 - 3dbf + 0x06, 0xCE, 0xA9, 0xCC, 0x93, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xA9, 0xCC, 0x94, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB1, 0xCC, 0x80, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB1, 0xCC, 0x81, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB1, 0xCC, 0x93, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB1, 0xCC, 0x94, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB1, 0xCD, 0x82, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB5, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + // Bytes 3dc0 - 3dff + 0x06, 0xCE, 0xB5, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xB5, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xB5, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xB7, 0xCC, 0x80, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB7, 0xCC, 0x81, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB7, 0xCC, 0x93, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB7, 0xCC, 0x94, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB7, 0xCD, 0x82, 0xCD, 0x85, 0xDA, + // Bytes 3e00 - 3e3f + 0x06, 0xCE, 0xB9, 0xCC, 0x88, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x88, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x88, 0xCD, 0x82, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x93, 0xCD, 0x82, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + // Bytes 3e40 - 3e7f + 0x06, 0xCE, 0xB9, 0xCC, 0x94, 0xCD, 0x82, 0xCA, + 0x06, 0xCE, 0xBF, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xBF, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xBF, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xBF, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x88, 0xCC, 0x80, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x88, 0xCC, 0x81, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x88, 0xCD, 0x82, 0xCA, + // Bytes 3e80 - 3ebf + 0x06, 0xCF, 0x85, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x93, 0xCD, 0x82, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x94, 0xCD, 0x82, 0xCA, + 0x06, 0xCF, 0x89, 0xCC, 0x80, 0xCD, 0x85, 0xDA, + 0x06, 0xCF, 0x89, 0xCC, 0x81, 0xCD, 0x85, 0xDA, + // Bytes 3ec0 - 3eff + 0x06, 0xCF, 0x89, 0xCC, 0x93, 0xCD, 0x85, 0xDA, + 0x06, 0xCF, 0x89, 0xCC, 0x94, 0xCD, 0x85, 0xDA, + 0x06, 0xCF, 0x89, 0xCD, 0x82, 0xCD, 0x85, 0xDA, + 0x06, 0xE0, 0xA4, 0xA8, 0xE0, 0xA4, 0xBC, 0x09, + 0x06, 0xE0, 0xA4, 0xB0, 0xE0, 0xA4, 0xBC, 0x09, + 0x06, 0xE0, 0xA4, 0xB3, 0xE0, 0xA4, 0xBC, 0x09, + 0x06, 0xE0, 0xB1, 0x86, 0xE0, 0xB1, 0x96, 0x85, + 0x06, 0xE0, 0xB7, 0x99, 0xE0, 0xB7, 0x8A, 0x11, + // Bytes 3f00 - 3f3f + 0x06, 0xE3, 0x81, 0x86, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x8B, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x8D, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x8F, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x91, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x93, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x95, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x97, 0xE3, 0x82, 0x99, 0x0D, + // Bytes 3f40 - 3f7f + 0x06, 0xE3, 0x81, 0x99, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x9B, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x9D, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x9F, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xA1, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xA4, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xA6, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xA8, 0xE3, 0x82, 0x99, 0x0D, + // Bytes 3f80 - 3fbf + 0x06, 0xE3, 0x81, 0xAF, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xAF, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x81, 0xB2, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xB2, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x81, 0xB5, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xB5, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x81, 0xB8, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xB8, 0xE3, 0x82, 0x9A, 0x0D, + // Bytes 3fc0 - 3fff + 0x06, 0xE3, 0x81, 0xBB, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xBB, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x82, 0x9D, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xA6, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xAB, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xAD, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xAF, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xB1, 0xE3, 0x82, 0x99, 0x0D, + // Bytes 4000 - 403f + 0x06, 0xE3, 0x82, 0xB3, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xB5, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xB7, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xB9, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xBB, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xBD, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xBF, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x81, 0xE3, 0x82, 0x99, 0x0D, + // Bytes 4040 - 407f + 0x06, 0xE3, 0x83, 0x84, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x86, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x88, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x8F, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x8F, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x83, 0x92, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x92, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x83, 0x95, 0xE3, 0x82, 0x99, 0x0D, + // Bytes 4080 - 40bf + 0x06, 0xE3, 0x83, 0x95, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x83, 0x98, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x98, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x83, 0x9B, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x9B, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x83, 0xAF, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0xB0, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0xB1, 0xE3, 0x82, 0x99, 0x0D, + // Bytes 40c0 - 40ff + 0x06, 0xE3, 0x83, 0xB2, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0xBD, 0xE3, 0x82, 0x99, 0x0D, + 0x08, 0xCE, 0x91, 0xCC, 0x93, 0xCC, 0x80, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0x91, 0xCC, 0x93, 0xCC, + 0x81, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0x91, 0xCC, + 0x93, 0xCD, 0x82, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + 0x91, 0xCC, 0x94, 0xCC, 0x80, 0xCD, 0x85, 0xDB, + 0x08, 0xCE, 0x91, 0xCC, 0x94, 0xCC, 0x81, 0xCD, + // Bytes 4100 - 413f + 0x85, 0xDB, 0x08, 0xCE, 0x91, 0xCC, 0x94, 0xCD, + 0x82, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0x97, 0xCC, + 0x93, 0xCC, 0x80, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + 0x97, 0xCC, 0x93, 0xCC, 0x81, 0xCD, 0x85, 0xDB, + 0x08, 0xCE, 0x97, 0xCC, 0x93, 0xCD, 0x82, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0x97, 0xCC, 0x94, 0xCC, + 0x80, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0x97, 0xCC, + 0x94, 0xCC, 0x81, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + // Bytes 4140 - 417f + 0x97, 0xCC, 0x94, 0xCD, 0x82, 0xCD, 0x85, 0xDB, + 0x08, 0xCE, 0xA9, 0xCC, 0x93, 0xCC, 0x80, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0xA9, 0xCC, 0x93, 0xCC, + 0x81, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0xA9, 0xCC, + 0x93, 0xCD, 0x82, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + 0xA9, 0xCC, 0x94, 0xCC, 0x80, 0xCD, 0x85, 0xDB, + 0x08, 0xCE, 0xA9, 0xCC, 0x94, 0xCC, 0x81, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0xA9, 0xCC, 0x94, 0xCD, + // Bytes 4180 - 41bf + 0x82, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0xB1, 0xCC, + 0x93, 0xCC, 0x80, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + 0xB1, 0xCC, 0x93, 0xCC, 0x81, 0xCD, 0x85, 0xDB, + 0x08, 0xCE, 0xB1, 0xCC, 0x93, 0xCD, 0x82, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0xB1, 0xCC, 0x94, 0xCC, + 0x80, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0xB1, 0xCC, + 0x94, 0xCC, 0x81, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + 0xB1, 0xCC, 0x94, 0xCD, 0x82, 0xCD, 0x85, 0xDB, + // Bytes 41c0 - 41ff + 0x08, 0xCE, 0xB7, 0xCC, 0x93, 0xCC, 0x80, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0xB7, 0xCC, 0x93, 0xCC, + 0x81, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0xB7, 0xCC, + 0x93, 0xCD, 0x82, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + 0xB7, 0xCC, 0x94, 0xCC, 0x80, 0xCD, 0x85, 0xDB, + 0x08, 0xCE, 0xB7, 0xCC, 0x94, 0xCC, 0x81, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0xB7, 0xCC, 0x94, 0xCD, + 0x82, 0xCD, 0x85, 0xDB, 0x08, 0xCF, 0x89, 0xCC, + // Bytes 4200 - 423f + 0x93, 0xCC, 0x80, 0xCD, 0x85, 0xDB, 0x08, 0xCF, + 0x89, 0xCC, 0x93, 0xCC, 0x81, 0xCD, 0x85, 0xDB, + 0x08, 0xCF, 0x89, 0xCC, 0x93, 0xCD, 0x82, 0xCD, + 0x85, 0xDB, 0x08, 0xCF, 0x89, 0xCC, 0x94, 0xCC, + 0x80, 0xCD, 0x85, 0xDB, 0x08, 0xCF, 0x89, 0xCC, + 0x94, 0xCC, 0x81, 0xCD, 0x85, 0xDB, 0x08, 0xCF, + 0x89, 0xCC, 0x94, 0xCD, 0x82, 0xCD, 0x85, 0xDB, + 0x08, 0xF0, 0x91, 0x82, 0x99, 0xF0, 0x91, 0x82, + // Bytes 4240 - 427f + 0xBA, 0x09, 0x08, 0xF0, 0x91, 0x82, 0x9B, 0xF0, + 0x91, 0x82, 0xBA, 0x09, 0x08, 0xF0, 0x91, 0x82, + 0xA5, 0xF0, 0x91, 0x82, 0xBA, 0x09, 0x42, 0xC2, + 0xB4, 0x01, 0x43, 0x20, 0xCC, 0x81, 0xC9, 0x43, + 0x20, 0xCC, 0x83, 0xC9, 0x43, 0x20, 0xCC, 0x84, + 0xC9, 0x43, 0x20, 0xCC, 0x85, 0xC9, 0x43, 0x20, + 0xCC, 0x86, 0xC9, 0x43, 0x20, 0xCC, 0x87, 0xC9, + 0x43, 0x20, 0xCC, 0x88, 0xC9, 0x43, 0x20, 0xCC, + // Bytes 4280 - 42bf + 0x8A, 0xC9, 0x43, 0x20, 0xCC, 0x8B, 0xC9, 0x43, + 0x20, 0xCC, 0x93, 0xC9, 0x43, 0x20, 0xCC, 0x94, + 0xC9, 0x43, 0x20, 0xCC, 0xA7, 0xA5, 0x43, 0x20, + 0xCC, 0xA8, 0xA5, 0x43, 0x20, 0xCC, 0xB3, 0xB5, + 0x43, 0x20, 0xCD, 0x82, 0xC9, 0x43, 0x20, 0xCD, + 0x85, 0xD9, 0x43, 0x20, 0xD9, 0x8B, 0x59, 0x43, + 0x20, 0xD9, 0x8C, 0x5D, 0x43, 0x20, 0xD9, 0x8D, + 0x61, 0x43, 0x20, 0xD9, 0x8E, 0x65, 0x43, 0x20, + // Bytes 42c0 - 42ff + 0xD9, 0x8F, 0x69, 0x43, 0x20, 0xD9, 0x90, 0x6D, + 0x43, 0x20, 0xD9, 0x91, 0x71, 0x43, 0x20, 0xD9, + 0x92, 0x75, 0x43, 0x41, 0xCC, 0x8A, 0xC9, 0x43, + 0x73, 0xCC, 0x87, 0xC9, 0x44, 0x20, 0xE3, 0x82, + 0x99, 0x0D, 0x44, 0x20, 0xE3, 0x82, 0x9A, 0x0D, + 0x44, 0xC2, 0xA8, 0xCC, 0x81, 0xCA, 0x44, 0xCE, + 0x91, 0xCC, 0x81, 0xC9, 0x44, 0xCE, 0x95, 0xCC, + 0x81, 0xC9, 0x44, 0xCE, 0x97, 0xCC, 0x81, 0xC9, + // Bytes 4300 - 433f + 0x44, 0xCE, 0x99, 0xCC, 0x81, 0xC9, 0x44, 0xCE, + 0x9F, 0xCC, 0x81, 0xC9, 0x44, 0xCE, 0xA5, 0xCC, + 0x81, 0xC9, 0x44, 0xCE, 0xA5, 0xCC, 0x88, 0xC9, + 0x44, 0xCE, 0xA9, 0xCC, 0x81, 0xC9, 0x44, 0xCE, + 0xB1, 0xCC, 0x81, 0xC9, 0x44, 0xCE, 0xB5, 0xCC, + 0x81, 0xC9, 0x44, 0xCE, 0xB7, 0xCC, 0x81, 0xC9, + 0x44, 0xCE, 0xB9, 0xCC, 0x81, 0xC9, 0x44, 0xCE, + 0xBF, 0xCC, 0x81, 0xC9, 0x44, 0xCF, 0x85, 0xCC, + // Bytes 4340 - 437f + 0x81, 0xC9, 0x44, 0xCF, 0x89, 0xCC, 0x81, 0xC9, + 0x44, 0xD7, 0x90, 0xD6, 0xB7, 0x31, 0x44, 0xD7, + 0x90, 0xD6, 0xB8, 0x35, 0x44, 0xD7, 0x90, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0x91, 0xD6, 0xBC, 0x41, + 0x44, 0xD7, 0x91, 0xD6, 0xBF, 0x49, 0x44, 0xD7, + 0x92, 0xD6, 0xBC, 0x41, 0x44, 0xD7, 0x93, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0x94, 0xD6, 0xBC, 0x41, + 0x44, 0xD7, 0x95, 0xD6, 0xB9, 0x39, 0x44, 0xD7, + // Bytes 4380 - 43bf + 0x95, 0xD6, 0xBC, 0x41, 0x44, 0xD7, 0x96, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0x98, 0xD6, 0xBC, 0x41, + 0x44, 0xD7, 0x99, 0xD6, 0xB4, 0x25, 0x44, 0xD7, + 0x99, 0xD6, 0xBC, 0x41, 0x44, 0xD7, 0x9A, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0x9B, 0xD6, 0xBC, 0x41, + 0x44, 0xD7, 0x9B, 0xD6, 0xBF, 0x49, 0x44, 0xD7, + 0x9C, 0xD6, 0xBC, 0x41, 0x44, 0xD7, 0x9E, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0xA0, 0xD6, 0xBC, 0x41, + // Bytes 43c0 - 43ff + 0x44, 0xD7, 0xA1, 0xD6, 0xBC, 0x41, 0x44, 0xD7, + 0xA3, 0xD6, 0xBC, 0x41, 0x44, 0xD7, 0xA4, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0xA4, 0xD6, 0xBF, 0x49, + 0x44, 0xD7, 0xA6, 0xD6, 0xBC, 0x41, 0x44, 0xD7, + 0xA7, 0xD6, 0xBC, 0x41, 0x44, 0xD7, 0xA8, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0xA9, 0xD6, 0xBC, 0x41, + 0x44, 0xD7, 0xA9, 0xD7, 0x81, 0x4D, 0x44, 0xD7, + 0xA9, 0xD7, 0x82, 0x51, 0x44, 0xD7, 0xAA, 0xD6, + // Bytes 4400 - 443f + 0xBC, 0x41, 0x44, 0xD7, 0xB2, 0xD6, 0xB7, 0x31, + 0x44, 0xD8, 0xA7, 0xD9, 0x8B, 0x59, 0x44, 0xD8, + 0xA7, 0xD9, 0x93, 0xC9, 0x44, 0xD8, 0xA7, 0xD9, + 0x94, 0xC9, 0x44, 0xD8, 0xA7, 0xD9, 0x95, 0xB5, + 0x44, 0xD8, 0xB0, 0xD9, 0xB0, 0x79, 0x44, 0xD8, + 0xB1, 0xD9, 0xB0, 0x79, 0x44, 0xD9, 0x80, 0xD9, + 0x8B, 0x59, 0x44, 0xD9, 0x80, 0xD9, 0x8E, 0x65, + 0x44, 0xD9, 0x80, 0xD9, 0x8F, 0x69, 0x44, 0xD9, + // Bytes 4440 - 447f + 0x80, 0xD9, 0x90, 0x6D, 0x44, 0xD9, 0x80, 0xD9, + 0x91, 0x71, 0x44, 0xD9, 0x80, 0xD9, 0x92, 0x75, + 0x44, 0xD9, 0x87, 0xD9, 0xB0, 0x79, 0x44, 0xD9, + 0x88, 0xD9, 0x94, 0xC9, 0x44, 0xD9, 0x89, 0xD9, + 0xB0, 0x79, 0x44, 0xD9, 0x8A, 0xD9, 0x94, 0xC9, + 0x44, 0xDB, 0x92, 0xD9, 0x94, 0xC9, 0x44, 0xDB, + 0x95, 0xD9, 0x94, 0xC9, 0x45, 0x20, 0xCC, 0x88, + 0xCC, 0x80, 0xCA, 0x45, 0x20, 0xCC, 0x88, 0xCC, + // Bytes 4480 - 44bf + 0x81, 0xCA, 0x45, 0x20, 0xCC, 0x88, 0xCD, 0x82, + 0xCA, 0x45, 0x20, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x45, 0x20, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x45, + 0x20, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x45, 0x20, + 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x45, 0x20, 0xCC, + 0x94, 0xCC, 0x81, 0xCA, 0x45, 0x20, 0xCC, 0x94, + 0xCD, 0x82, 0xCA, 0x45, 0x20, 0xD9, 0x8C, 0xD9, + 0x91, 0x72, 0x45, 0x20, 0xD9, 0x8D, 0xD9, 0x91, + // Bytes 44c0 - 44ff + 0x72, 0x45, 0x20, 0xD9, 0x8E, 0xD9, 0x91, 0x72, + 0x45, 0x20, 0xD9, 0x8F, 0xD9, 0x91, 0x72, 0x45, + 0x20, 0xD9, 0x90, 0xD9, 0x91, 0x72, 0x45, 0x20, + 0xD9, 0x91, 0xD9, 0xB0, 0x7A, 0x45, 0xE2, 0xAB, + 0x9D, 0xCC, 0xB8, 0x05, 0x46, 0xCE, 0xB9, 0xCC, + 0x88, 0xCC, 0x81, 0xCA, 0x46, 0xCF, 0x85, 0xCC, + 0x88, 0xCC, 0x81, 0xCA, 0x46, 0xD7, 0xA9, 0xD6, + 0xBC, 0xD7, 0x81, 0x4E, 0x46, 0xD7, 0xA9, 0xD6, + // Bytes 4500 - 453f + 0xBC, 0xD7, 0x82, 0x52, 0x46, 0xD9, 0x80, 0xD9, + 0x8E, 0xD9, 0x91, 0x72, 0x46, 0xD9, 0x80, 0xD9, + 0x8F, 0xD9, 0x91, 0x72, 0x46, 0xD9, 0x80, 0xD9, + 0x90, 0xD9, 0x91, 0x72, 0x46, 0xE0, 0xA4, 0x95, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0x96, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0x97, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0x9C, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0xA1, + // Bytes 4540 - 457f + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0xA2, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0xAB, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0xAF, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA6, 0xA1, + 0xE0, 0xA6, 0xBC, 0x09, 0x46, 0xE0, 0xA6, 0xA2, + 0xE0, 0xA6, 0xBC, 0x09, 0x46, 0xE0, 0xA6, 0xAF, + 0xE0, 0xA6, 0xBC, 0x09, 0x46, 0xE0, 0xA8, 0x96, + 0xE0, 0xA8, 0xBC, 0x09, 0x46, 0xE0, 0xA8, 0x97, + // Bytes 4580 - 45bf + 0xE0, 0xA8, 0xBC, 0x09, 0x46, 0xE0, 0xA8, 0x9C, + 0xE0, 0xA8, 0xBC, 0x09, 0x46, 0xE0, 0xA8, 0xAB, + 0xE0, 0xA8, 0xBC, 0x09, 0x46, 0xE0, 0xA8, 0xB2, + 0xE0, 0xA8, 0xBC, 0x09, 0x46, 0xE0, 0xA8, 0xB8, + 0xE0, 0xA8, 0xBC, 0x09, 0x46, 0xE0, 0xAC, 0xA1, + 0xE0, 0xAC, 0xBC, 0x09, 0x46, 0xE0, 0xAC, 0xA2, + 0xE0, 0xAC, 0xBC, 0x09, 0x46, 0xE0, 0xBE, 0xB2, + 0xE0, 0xBE, 0x80, 0x9D, 0x46, 0xE0, 0xBE, 0xB3, + // Bytes 45c0 - 45ff + 0xE0, 0xBE, 0x80, 0x9D, 0x46, 0xE3, 0x83, 0x86, + 0xE3, 0x82, 0x99, 0x0D, 0x48, 0xF0, 0x9D, 0x85, + 0x97, 0xF0, 0x9D, 0x85, 0xA5, 0xAD, 0x48, 0xF0, + 0x9D, 0x85, 0x98, 0xF0, 0x9D, 0x85, 0xA5, 0xAD, + 0x48, 0xF0, 0x9D, 0x86, 0xB9, 0xF0, 0x9D, 0x85, + 0xA5, 0xAD, 0x48, 0xF0, 0x9D, 0x86, 0xBA, 0xF0, + 0x9D, 0x85, 0xA5, 0xAD, 0x49, 0xE0, 0xBE, 0xB2, + 0xE0, 0xBD, 0xB1, 0xE0, 0xBE, 0x80, 0x9E, 0x49, + // Bytes 4600 - 463f + 0xE0, 0xBE, 0xB3, 0xE0, 0xBD, 0xB1, 0xE0, 0xBE, + 0x80, 0x9E, 0x4C, 0xF0, 0x9D, 0x85, 0x98, 0xF0, + 0x9D, 0x85, 0xA5, 0xF0, 0x9D, 0x85, 0xAE, 0xAE, + 0x4C, 0xF0, 0x9D, 0x85, 0x98, 0xF0, 0x9D, 0x85, + 0xA5, 0xF0, 0x9D, 0x85, 0xAF, 0xAE, 0x4C, 0xF0, + 0x9D, 0x85, 0x98, 0xF0, 0x9D, 0x85, 0xA5, 0xF0, + 0x9D, 0x85, 0xB0, 0xAE, 0x4C, 0xF0, 0x9D, 0x85, + 0x98, 0xF0, 0x9D, 0x85, 0xA5, 0xF0, 0x9D, 0x85, + // Bytes 4640 - 467f + 0xB1, 0xAE, 0x4C, 0xF0, 0x9D, 0x85, 0x98, 0xF0, + 0x9D, 0x85, 0xA5, 0xF0, 0x9D, 0x85, 0xB2, 0xAE, + 0x4C, 0xF0, 0x9D, 0x86, 0xB9, 0xF0, 0x9D, 0x85, + 0xA5, 0xF0, 0x9D, 0x85, 0xAE, 0xAE, 0x4C, 0xF0, + 0x9D, 0x86, 0xB9, 0xF0, 0x9D, 0x85, 0xA5, 0xF0, + 0x9D, 0x85, 0xAF, 0xAE, 0x4C, 0xF0, 0x9D, 0x86, + 0xBA, 0xF0, 0x9D, 0x85, 0xA5, 0xF0, 0x9D, 0x85, + 0xAE, 0xAE, 0x4C, 0xF0, 0x9D, 0x86, 0xBA, 0xF0, + // Bytes 4680 - 46bf + 0x9D, 0x85, 0xA5, 0xF0, 0x9D, 0x85, 0xAF, 0xAE, + 0x83, 0x41, 0xCC, 0x82, 0xC9, 0x83, 0x41, 0xCC, + 0x86, 0xC9, 0x83, 0x41, 0xCC, 0x87, 0xC9, 0x83, + 0x41, 0xCC, 0x88, 0xC9, 0x83, 0x41, 0xCC, 0x8A, + 0xC9, 0x83, 0x41, 0xCC, 0xA3, 0xB5, 0x83, 0x43, + 0xCC, 0xA7, 0xA5, 0x83, 0x45, 0xCC, 0x82, 0xC9, + 0x83, 0x45, 0xCC, 0x84, 0xC9, 0x83, 0x45, 0xCC, + 0xA3, 0xB5, 0x83, 0x45, 0xCC, 0xA7, 0xA5, 0x83, + // Bytes 46c0 - 46ff + 0x49, 0xCC, 0x88, 0xC9, 0x83, 0x4C, 0xCC, 0xA3, + 0xB5, 0x83, 0x4F, 0xCC, 0x82, 0xC9, 0x83, 0x4F, + 0xCC, 0x83, 0xC9, 0x83, 0x4F, 0xCC, 0x84, 0xC9, + 0x83, 0x4F, 0xCC, 0x87, 0xC9, 0x83, 0x4F, 0xCC, + 0x88, 0xC9, 0x83, 0x4F, 0xCC, 0x9B, 0xAD, 0x83, + 0x4F, 0xCC, 0xA3, 0xB5, 0x83, 0x4F, 0xCC, 0xA8, + 0xA5, 0x83, 0x52, 0xCC, 0xA3, 0xB5, 0x83, 0x53, + 0xCC, 0x81, 0xC9, 0x83, 0x53, 0xCC, 0x8C, 0xC9, + // Bytes 4700 - 473f + 0x83, 0x53, 0xCC, 0xA3, 0xB5, 0x83, 0x55, 0xCC, + 0x83, 0xC9, 0x83, 0x55, 0xCC, 0x84, 0xC9, 0x83, + 0x55, 0xCC, 0x88, 0xC9, 0x83, 0x55, 0xCC, 0x9B, + 0xAD, 0x83, 0x61, 0xCC, 0x82, 0xC9, 0x83, 0x61, + 0xCC, 0x86, 0xC9, 0x83, 0x61, 0xCC, 0x87, 0xC9, + 0x83, 0x61, 0xCC, 0x88, 0xC9, 0x83, 0x61, 0xCC, + 0x8A, 0xC9, 0x83, 0x61, 0xCC, 0xA3, 0xB5, 0x83, + 0x63, 0xCC, 0xA7, 0xA5, 0x83, 0x65, 0xCC, 0x82, + // Bytes 4740 - 477f + 0xC9, 0x83, 0x65, 0xCC, 0x84, 0xC9, 0x83, 0x65, + 0xCC, 0xA3, 0xB5, 0x83, 0x65, 0xCC, 0xA7, 0xA5, + 0x83, 0x69, 0xCC, 0x88, 0xC9, 0x83, 0x6C, 0xCC, + 0xA3, 0xB5, 0x83, 0x6F, 0xCC, 0x82, 0xC9, 0x83, + 0x6F, 0xCC, 0x83, 0xC9, 0x83, 0x6F, 0xCC, 0x84, + 0xC9, 0x83, 0x6F, 0xCC, 0x87, 0xC9, 0x83, 0x6F, + 0xCC, 0x88, 0xC9, 0x83, 0x6F, 0xCC, 0x9B, 0xAD, + 0x83, 0x6F, 0xCC, 0xA3, 0xB5, 0x83, 0x6F, 0xCC, + // Bytes 4780 - 47bf + 0xA8, 0xA5, 0x83, 0x72, 0xCC, 0xA3, 0xB5, 0x83, + 0x73, 0xCC, 0x81, 0xC9, 0x83, 0x73, 0xCC, 0x8C, + 0xC9, 0x83, 0x73, 0xCC, 0xA3, 0xB5, 0x83, 0x75, + 0xCC, 0x83, 0xC9, 0x83, 0x75, 0xCC, 0x84, 0xC9, + 0x83, 0x75, 0xCC, 0x88, 0xC9, 0x83, 0x75, 0xCC, + 0x9B, 0xAD, 0x84, 0xCE, 0x91, 0xCC, 0x93, 0xC9, + 0x84, 0xCE, 0x91, 0xCC, 0x94, 0xC9, 0x84, 0xCE, + 0x95, 0xCC, 0x93, 0xC9, 0x84, 0xCE, 0x95, 0xCC, + // Bytes 47c0 - 47ff + 0x94, 0xC9, 0x84, 0xCE, 0x97, 0xCC, 0x93, 0xC9, + 0x84, 0xCE, 0x97, 0xCC, 0x94, 0xC9, 0x84, 0xCE, + 0x99, 0xCC, 0x93, 0xC9, 0x84, 0xCE, 0x99, 0xCC, + 0x94, 0xC9, 0x84, 0xCE, 0x9F, 0xCC, 0x93, 0xC9, + 0x84, 0xCE, 0x9F, 0xCC, 0x94, 0xC9, 0x84, 0xCE, + 0xA5, 0xCC, 0x94, 0xC9, 0x84, 0xCE, 0xA9, 0xCC, + 0x93, 0xC9, 0x84, 0xCE, 0xA9, 0xCC, 0x94, 0xC9, + 0x84, 0xCE, 0xB1, 0xCC, 0x80, 0xC9, 0x84, 0xCE, + // Bytes 4800 - 483f + 0xB1, 0xCC, 0x81, 0xC9, 0x84, 0xCE, 0xB1, 0xCC, + 0x93, 0xC9, 0x84, 0xCE, 0xB1, 0xCC, 0x94, 0xC9, + 0x84, 0xCE, 0xB1, 0xCD, 0x82, 0xC9, 0x84, 0xCE, + 0xB5, 0xCC, 0x93, 0xC9, 0x84, 0xCE, 0xB5, 0xCC, + 0x94, 0xC9, 0x84, 0xCE, 0xB7, 0xCC, 0x80, 0xC9, + 0x84, 0xCE, 0xB7, 0xCC, 0x81, 0xC9, 0x84, 0xCE, + 0xB7, 0xCC, 0x93, 0xC9, 0x84, 0xCE, 0xB7, 0xCC, + 0x94, 0xC9, 0x84, 0xCE, 0xB7, 0xCD, 0x82, 0xC9, + // Bytes 4840 - 487f + 0x84, 0xCE, 0xB9, 0xCC, 0x88, 0xC9, 0x84, 0xCE, + 0xB9, 0xCC, 0x93, 0xC9, 0x84, 0xCE, 0xB9, 0xCC, + 0x94, 0xC9, 0x84, 0xCE, 0xBF, 0xCC, 0x93, 0xC9, + 0x84, 0xCE, 0xBF, 0xCC, 0x94, 0xC9, 0x84, 0xCF, + 0x85, 0xCC, 0x88, 0xC9, 0x84, 0xCF, 0x85, 0xCC, + 0x93, 0xC9, 0x84, 0xCF, 0x85, 0xCC, 0x94, 0xC9, + 0x84, 0xCF, 0x89, 0xCC, 0x80, 0xC9, 0x84, 0xCF, + 0x89, 0xCC, 0x81, 0xC9, 0x84, 0xCF, 0x89, 0xCC, + // Bytes 4880 - 48bf + 0x93, 0xC9, 0x84, 0xCF, 0x89, 0xCC, 0x94, 0xC9, + 0x84, 0xCF, 0x89, 0xCD, 0x82, 0xC9, 0x86, 0xCE, + 0x91, 0xCC, 0x93, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0x91, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0x91, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0x91, 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0x91, 0xCC, 0x94, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0x91, 0xCC, 0x94, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + // Bytes 48c0 - 48ff + 0x97, 0xCC, 0x93, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0x97, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0x97, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0x97, 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0x97, 0xCC, 0x94, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0x97, 0xCC, 0x94, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0xA9, 0xCC, 0x93, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0xA9, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + // Bytes 4900 - 493f + 0xA9, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0xA9, 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0xA9, 0xCC, 0x94, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0xA9, 0xCC, 0x94, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0xB1, 0xCC, 0x93, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0xB1, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0xB1, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0xB1, 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + // Bytes 4940 - 497f + 0xB1, 0xCC, 0x94, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0xB1, 0xCC, 0x94, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0xB7, 0xCC, 0x93, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0xB7, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0xB7, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0xB7, 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0xB7, 0xCC, 0x94, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0xB7, 0xCC, 0x94, 0xCD, 0x82, 0xCA, 0x86, 0xCF, + // Bytes 4980 - 49bf + 0x89, 0xCC, 0x93, 0xCC, 0x80, 0xCA, 0x86, 0xCF, + 0x89, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x86, 0xCF, + 0x89, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x86, 0xCF, + 0x89, 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x86, 0xCF, + 0x89, 0xCC, 0x94, 0xCC, 0x81, 0xCA, 0x86, 0xCF, + 0x89, 0xCC, 0x94, 0xCD, 0x82, 0xCA, 0x42, 0xCC, + 0x80, 0xC9, 0x32, 0x42, 0xCC, 0x81, 0xC9, 0x32, + 0x42, 0xCC, 0x93, 0xC9, 0x32, 0x43, 0xE1, 0x85, + // Bytes 49c0 - 49ff + 0xA1, 0x01, 0x00, 0x43, 0xE1, 0x85, 0xA2, 0x01, + 0x00, 0x43, 0xE1, 0x85, 0xA3, 0x01, 0x00, 0x43, + 0xE1, 0x85, 0xA4, 0x01, 0x00, 0x43, 0xE1, 0x85, + 0xA5, 0x01, 0x00, 0x43, 0xE1, 0x85, 0xA6, 0x01, + 0x00, 0x43, 0xE1, 0x85, 0xA7, 0x01, 0x00, 0x43, + 0xE1, 0x85, 0xA8, 0x01, 0x00, 0x43, 0xE1, 0x85, + 0xA9, 0x01, 0x00, 0x43, 0xE1, 0x85, 0xAA, 0x01, + 0x00, 0x43, 0xE1, 0x85, 0xAB, 0x01, 0x00, 0x43, + // Bytes 4a00 - 4a3f + 0xE1, 0x85, 0xAC, 0x01, 0x00, 0x43, 0xE1, 0x85, + 0xAD, 0x01, 0x00, 0x43, 0xE1, 0x85, 0xAE, 0x01, + 0x00, 0x43, 0xE1, 0x85, 0xAF, 0x01, 0x00, 0x43, + 0xE1, 0x85, 0xB0, 0x01, 0x00, 0x43, 0xE1, 0x85, + 0xB1, 0x01, 0x00, 0x43, 0xE1, 0x85, 0xB2, 0x01, + 0x00, 0x43, 0xE1, 0x85, 0xB3, 0x01, 0x00, 0x43, + 0xE1, 0x85, 0xB4, 0x01, 0x00, 0x43, 0xE1, 0x85, + 0xB5, 0x01, 0x00, 0x43, 0xE1, 0x86, 0xAA, 0x01, + // Bytes 4a40 - 4a7f + 0x00, 0x43, 0xE1, 0x86, 0xAC, 0x01, 0x00, 0x43, + 0xE1, 0x86, 0xAD, 0x01, 0x00, 0x43, 0xE1, 0x86, + 0xB0, 0x01, 0x00, 0x43, 0xE1, 0x86, 0xB1, 0x01, + 0x00, 0x43, 0xE1, 0x86, 0xB2, 0x01, 0x00, 0x43, + 0xE1, 0x86, 0xB3, 0x01, 0x00, 0x43, 0xE1, 0x86, + 0xB4, 0x01, 0x00, 0x43, 0xE1, 0x86, 0xB5, 0x01, + 0x00, 0x44, 0xCC, 0x88, 0xCC, 0x81, 0xCA, 0x32, + 0x43, 0xE3, 0x82, 0x99, 0x0D, 0x03, 0x43, 0xE3, + // Bytes 4a80 - 4abf + 0x82, 0x9A, 0x0D, 0x03, 0x46, 0xE0, 0xBD, 0xB1, + 0xE0, 0xBD, 0xB2, 0x9E, 0x26, 0x46, 0xE0, 0xBD, + 0xB1, 0xE0, 0xBD, 0xB4, 0xA2, 0x26, 0x46, 0xE0, + 0xBD, 0xB1, 0xE0, 0xBE, 0x80, 0x9E, 0x26, 0x00, + 0x01, +} + +// lookup returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *nfcTrie) lookup(s []byte) (v uint16, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return nfcValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := nfcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := nfcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := nfcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = nfcIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *nfcTrie) lookupUnsafe(s []byte) uint16 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return nfcValues[c0] + } + i := nfcIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = nfcIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = nfcIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// lookupString returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *nfcTrie) lookupString(s string) (v uint16, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return nfcValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := nfcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := nfcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := nfcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = nfcIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupStringUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *nfcTrie) lookupStringUnsafe(s string) uint16 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return nfcValues[c0] + } + i := nfcIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = nfcIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = nfcIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// nfcTrie. Total size: 10586 bytes (10.34 KiB). Checksum: dd926e82067bee11. +type nfcTrie struct{} + +func newNfcTrie(i int) *nfcTrie { + return &nfcTrie{} +} + +// lookupValue determines the type of block n and looks up the value for b. +func (t *nfcTrie) lookupValue(n uint32, b byte) uint16 { + switch { + case n < 46: + return uint16(nfcValues[n<<6+uint32(b)]) + default: + n -= 46 + return uint16(nfcSparse.lookup(n, b)) + } +} + +// nfcValues: 48 blocks, 3072 entries, 6144 bytes +// The third block is the zero block. +var nfcValues = [3072]uint16{ + // Block 0x0, offset 0x0 + 0x3c: 0xa000, 0x3d: 0xa000, 0x3e: 0xa000, + // Block 0x1, offset 0x40 + 0x41: 0xa000, 0x42: 0xa000, 0x43: 0xa000, 0x44: 0xa000, 0x45: 0xa000, + 0x46: 0xa000, 0x47: 0xa000, 0x48: 0xa000, 0x49: 0xa000, 0x4a: 0xa000, 0x4b: 0xa000, + 0x4c: 0xa000, 0x4d: 0xa000, 0x4e: 0xa000, 0x4f: 0xa000, 0x50: 0xa000, + 0x52: 0xa000, 0x53: 0xa000, 0x54: 0xa000, 0x55: 0xa000, 0x56: 0xa000, 0x57: 0xa000, + 0x58: 0xa000, 0x59: 0xa000, 0x5a: 0xa000, + 0x61: 0xa000, 0x62: 0xa000, 0x63: 0xa000, + 0x64: 0xa000, 0x65: 0xa000, 0x66: 0xa000, 0x67: 0xa000, 0x68: 0xa000, 0x69: 0xa000, + 0x6a: 0xa000, 0x6b: 0xa000, 0x6c: 0xa000, 0x6d: 0xa000, 0x6e: 0xa000, 0x6f: 0xa000, + 0x70: 0xa000, 0x72: 0xa000, 0x73: 0xa000, 0x74: 0xa000, 0x75: 0xa000, + 0x76: 0xa000, 0x77: 0xa000, 0x78: 0xa000, 0x79: 0xa000, 0x7a: 0xa000, + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc0: 0x2f6f, 0xc1: 0x2f74, 0xc2: 0x4688, 0xc3: 0x2f79, 0xc4: 0x4697, 0xc5: 0x469c, + 0xc6: 0xa000, 0xc7: 0x46a6, 0xc8: 0x2fe2, 0xc9: 0x2fe7, 0xca: 0x46ab, 0xcb: 0x2ffb, + 0xcc: 0x306e, 0xcd: 0x3073, 0xce: 0x3078, 0xcf: 0x46bf, 0xd1: 0x3104, + 0xd2: 0x3127, 0xd3: 0x312c, 0xd4: 0x46c9, 0xd5: 0x46ce, 0xd6: 0x46dd, + 0xd8: 0xa000, 0xd9: 0x31b3, 0xda: 0x31b8, 0xdb: 0x31bd, 0xdc: 0x470f, 0xdd: 0x3235, + 0xe0: 0x327b, 0xe1: 0x3280, 0xe2: 0x4719, 0xe3: 0x3285, + 0xe4: 0x4728, 0xe5: 0x472d, 0xe6: 0xa000, 0xe7: 0x4737, 0xe8: 0x32ee, 0xe9: 0x32f3, + 0xea: 0x473c, 0xeb: 0x3307, 0xec: 0x337f, 0xed: 0x3384, 0xee: 0x3389, 0xef: 0x4750, + 0xf1: 0x3415, 0xf2: 0x3438, 0xf3: 0x343d, 0xf4: 0x475a, 0xf5: 0x475f, + 0xf6: 0x476e, 0xf8: 0xa000, 0xf9: 0x34c9, 0xfa: 0x34ce, 0xfb: 0x34d3, + 0xfc: 0x47a0, 0xfd: 0x3550, 0xff: 0x3569, + // Block 0x4, offset 0x100 + 0x100: 0x2f7e, 0x101: 0x328a, 0x102: 0x468d, 0x103: 0x471e, 0x104: 0x2f9c, 0x105: 0x32a8, + 0x106: 0x2fb0, 0x107: 0x32bc, 0x108: 0x2fb5, 0x109: 0x32c1, 0x10a: 0x2fba, 0x10b: 0x32c6, + 0x10c: 0x2fbf, 0x10d: 0x32cb, 0x10e: 0x2fc9, 0x10f: 0x32d5, + 0x112: 0x46b0, 0x113: 0x4741, 0x114: 0x2ff1, 0x115: 0x32fd, 0x116: 0x2ff6, 0x117: 0x3302, + 0x118: 0x3014, 0x119: 0x3320, 0x11a: 0x3005, 0x11b: 0x3311, 0x11c: 0x302d, 0x11d: 0x3339, + 0x11e: 0x3037, 0x11f: 0x3343, 0x120: 0x303c, 0x121: 0x3348, 0x122: 0x3046, 0x123: 0x3352, + 0x124: 0x304b, 0x125: 0x3357, 0x128: 0x307d, 0x129: 0x338e, + 0x12a: 0x3082, 0x12b: 0x3393, 0x12c: 0x3087, 0x12d: 0x3398, 0x12e: 0x30aa, 0x12f: 0x33b6, + 0x130: 0x308c, 0x134: 0x30b4, 0x135: 0x33c0, + 0x136: 0x30c8, 0x137: 0x33d9, 0x139: 0x30d2, 0x13a: 0x33e3, 0x13b: 0x30dc, + 0x13c: 0x33ed, 0x13d: 0x30d7, 0x13e: 0x33e8, + // Block 0x5, offset 0x140 + 0x143: 0x30ff, 0x144: 0x3410, 0x145: 0x3118, + 0x146: 0x3429, 0x147: 0x310e, 0x148: 0x341f, + 0x14c: 0x46d3, 0x14d: 0x4764, 0x14e: 0x3131, 0x14f: 0x3442, 0x150: 0x313b, 0x151: 0x344c, + 0x154: 0x3159, 0x155: 0x346a, 0x156: 0x3172, 0x157: 0x3483, + 0x158: 0x3163, 0x159: 0x3474, 0x15a: 0x46f6, 0x15b: 0x4787, 0x15c: 0x317c, 0x15d: 0x348d, + 0x15e: 0x318b, 0x15f: 0x349c, 0x160: 0x46fb, 0x161: 0x478c, 0x162: 0x31a4, 0x163: 0x34ba, + 0x164: 0x3195, 0x165: 0x34ab, 0x168: 0x4705, 0x169: 0x4796, + 0x16a: 0x470a, 0x16b: 0x479b, 0x16c: 0x31c2, 0x16d: 0x34d8, 0x16e: 0x31cc, 0x16f: 0x34e2, + 0x170: 0x31d1, 0x171: 0x34e7, 0x172: 0x31ef, 0x173: 0x3505, 0x174: 0x3212, 0x175: 0x3528, + 0x176: 0x323a, 0x177: 0x3555, 0x178: 0x324e, 0x179: 0x325d, 0x17a: 0x357d, 0x17b: 0x3267, + 0x17c: 0x3587, 0x17d: 0x326c, 0x17e: 0x358c, 0x17f: 0xa000, + // Block 0x6, offset 0x180 + 0x184: 0x8100, 0x185: 0x8100, + 0x186: 0x8100, + 0x18d: 0x2f88, 0x18e: 0x3294, 0x18f: 0x3096, 0x190: 0x33a2, 0x191: 0x3140, + 0x192: 0x3451, 0x193: 0x31d6, 0x194: 0x34ec, 0x195: 0x39cf, 0x196: 0x3b5e, 0x197: 0x39c8, + 0x198: 0x3b57, 0x199: 0x39d6, 0x19a: 0x3b65, 0x19b: 0x39c1, 0x19c: 0x3b50, + 0x19e: 0x38b0, 0x19f: 0x3a3f, 0x1a0: 0x38a9, 0x1a1: 0x3a38, 0x1a2: 0x35b3, 0x1a3: 0x35c5, + 0x1a6: 0x3041, 0x1a7: 0x334d, 0x1a8: 0x30be, 0x1a9: 0x33cf, + 0x1aa: 0x46ec, 0x1ab: 0x477d, 0x1ac: 0x3990, 0x1ad: 0x3b1f, 0x1ae: 0x35d7, 0x1af: 0x35dd, + 0x1b0: 0x33c5, 0x1b4: 0x3028, 0x1b5: 0x3334, + 0x1b8: 0x30fa, 0x1b9: 0x340b, 0x1ba: 0x38b7, 0x1bb: 0x3a46, + 0x1bc: 0x35ad, 0x1bd: 0x35bf, 0x1be: 0x35b9, 0x1bf: 0x35cb, + // Block 0x7, offset 0x1c0 + 0x1c0: 0x2f8d, 0x1c1: 0x3299, 0x1c2: 0x2f92, 0x1c3: 0x329e, 0x1c4: 0x300a, 0x1c5: 0x3316, + 0x1c6: 0x300f, 0x1c7: 0x331b, 0x1c8: 0x309b, 0x1c9: 0x33a7, 0x1ca: 0x30a0, 0x1cb: 0x33ac, + 0x1cc: 0x3145, 0x1cd: 0x3456, 0x1ce: 0x314a, 0x1cf: 0x345b, 0x1d0: 0x3168, 0x1d1: 0x3479, + 0x1d2: 0x316d, 0x1d3: 0x347e, 0x1d4: 0x31db, 0x1d5: 0x34f1, 0x1d6: 0x31e0, 0x1d7: 0x34f6, + 0x1d8: 0x3186, 0x1d9: 0x3497, 0x1da: 0x319f, 0x1db: 0x34b5, + 0x1de: 0x305a, 0x1df: 0x3366, + 0x1e6: 0x4692, 0x1e7: 0x4723, 0x1e8: 0x46ba, 0x1e9: 0x474b, + 0x1ea: 0x395f, 0x1eb: 0x3aee, 0x1ec: 0x393c, 0x1ed: 0x3acb, 0x1ee: 0x46d8, 0x1ef: 0x4769, + 0x1f0: 0x3958, 0x1f1: 0x3ae7, 0x1f2: 0x3244, 0x1f3: 0x355f, + // Block 0x8, offset 0x200 + 0x200: 0x9932, 0x201: 0x9932, 0x202: 0x9932, 0x203: 0x9932, 0x204: 0x9932, 0x205: 0x8132, + 0x206: 0x9932, 0x207: 0x9932, 0x208: 0x9932, 0x209: 0x9932, 0x20a: 0x9932, 0x20b: 0x9932, + 0x20c: 0x9932, 0x20d: 0x8132, 0x20e: 0x8132, 0x20f: 0x9932, 0x210: 0x8132, 0x211: 0x9932, + 0x212: 0x8132, 0x213: 0x9932, 0x214: 0x9932, 0x215: 0x8133, 0x216: 0x812d, 0x217: 0x812d, + 0x218: 0x812d, 0x219: 0x812d, 0x21a: 0x8133, 0x21b: 0x992b, 0x21c: 0x812d, 0x21d: 0x812d, + 0x21e: 0x812d, 0x21f: 0x812d, 0x220: 0x812d, 0x221: 0x8129, 0x222: 0x8129, 0x223: 0x992d, + 0x224: 0x992d, 0x225: 0x992d, 0x226: 0x992d, 0x227: 0x9929, 0x228: 0x9929, 0x229: 0x812d, + 0x22a: 0x812d, 0x22b: 0x812d, 0x22c: 0x812d, 0x22d: 0x992d, 0x22e: 0x992d, 0x22f: 0x812d, + 0x230: 0x992d, 0x231: 0x992d, 0x232: 0x812d, 0x233: 0x812d, 0x234: 0x8101, 0x235: 0x8101, + 0x236: 0x8101, 0x237: 0x8101, 0x238: 0x9901, 0x239: 0x812d, 0x23a: 0x812d, 0x23b: 0x812d, + 0x23c: 0x812d, 0x23d: 0x8132, 0x23e: 0x8132, 0x23f: 0x8132, + // Block 0x9, offset 0x240 + 0x240: 0x49ae, 0x241: 0x49b3, 0x242: 0x9932, 0x243: 0x49b8, 0x244: 0x4a71, 0x245: 0x9936, + 0x246: 0x8132, 0x247: 0x812d, 0x248: 0x812d, 0x249: 0x812d, 0x24a: 0x8132, 0x24b: 0x8132, + 0x24c: 0x8132, 0x24d: 0x812d, 0x24e: 0x812d, 0x250: 0x8132, 0x251: 0x8132, + 0x252: 0x8132, 0x253: 0x812d, 0x254: 0x812d, 0x255: 0x812d, 0x256: 0x812d, 0x257: 0x8132, + 0x258: 0x8133, 0x259: 0x812d, 0x25a: 0x812d, 0x25b: 0x8132, 0x25c: 0x8134, 0x25d: 0x8135, + 0x25e: 0x8135, 0x25f: 0x8134, 0x260: 0x8135, 0x261: 0x8135, 0x262: 0x8134, 0x263: 0x8132, + 0x264: 0x8132, 0x265: 0x8132, 0x266: 0x8132, 0x267: 0x8132, 0x268: 0x8132, 0x269: 0x8132, + 0x26a: 0x8132, 0x26b: 0x8132, 0x26c: 0x8132, 0x26d: 0x8132, 0x26e: 0x8132, 0x26f: 0x8132, + 0x274: 0x0170, + 0x27a: 0x8100, + 0x27e: 0x0037, + // Block 0xa, offset 0x280 + 0x284: 0x8100, 0x285: 0x35a1, + 0x286: 0x35e9, 0x287: 0x00ce, 0x288: 0x3607, 0x289: 0x3613, 0x28a: 0x3625, + 0x28c: 0x3643, 0x28e: 0x3655, 0x28f: 0x3673, 0x290: 0x3e08, 0x291: 0xa000, + 0x295: 0xa000, 0x297: 0xa000, + 0x299: 0xa000, + 0x29f: 0xa000, 0x2a1: 0xa000, + 0x2a5: 0xa000, 0x2a9: 0xa000, + 0x2aa: 0x3637, 0x2ab: 0x3667, 0x2ac: 0x47fe, 0x2ad: 0x3697, 0x2ae: 0x4828, 0x2af: 0x36a9, + 0x2b0: 0x3e70, 0x2b1: 0xa000, 0x2b5: 0xa000, + 0x2b7: 0xa000, 0x2b9: 0xa000, + 0x2bf: 0xa000, + // Block 0xb, offset 0x2c0 + 0x2c0: 0x3721, 0x2c1: 0x372d, 0x2c3: 0x371b, + 0x2c6: 0xa000, 0x2c7: 0x3709, + 0x2cc: 0x375d, 0x2cd: 0x3745, 0x2ce: 0x376f, 0x2d0: 0xa000, + 0x2d3: 0xa000, 0x2d5: 0xa000, 0x2d6: 0xa000, 0x2d7: 0xa000, + 0x2d8: 0xa000, 0x2d9: 0x3751, 0x2da: 0xa000, + 0x2de: 0xa000, 0x2e3: 0xa000, + 0x2e7: 0xa000, + 0x2eb: 0xa000, 0x2ed: 0xa000, + 0x2f0: 0xa000, 0x2f3: 0xa000, 0x2f5: 0xa000, + 0x2f6: 0xa000, 0x2f7: 0xa000, 0x2f8: 0xa000, 0x2f9: 0x37d5, 0x2fa: 0xa000, + 0x2fe: 0xa000, + // Block 0xc, offset 0x300 + 0x301: 0x3733, 0x302: 0x37b7, + 0x310: 0x370f, 0x311: 0x3793, + 0x312: 0x3715, 0x313: 0x3799, 0x316: 0x3727, 0x317: 0x37ab, + 0x318: 0xa000, 0x319: 0xa000, 0x31a: 0x3829, 0x31b: 0x382f, 0x31c: 0x3739, 0x31d: 0x37bd, + 0x31e: 0x373f, 0x31f: 0x37c3, 0x322: 0x374b, 0x323: 0x37cf, + 0x324: 0x3757, 0x325: 0x37db, 0x326: 0x3763, 0x327: 0x37e7, 0x328: 0xa000, 0x329: 0xa000, + 0x32a: 0x3835, 0x32b: 0x383b, 0x32c: 0x378d, 0x32d: 0x3811, 0x32e: 0x3769, 0x32f: 0x37ed, + 0x330: 0x3775, 0x331: 0x37f9, 0x332: 0x377b, 0x333: 0x37ff, 0x334: 0x3781, 0x335: 0x3805, + 0x338: 0x3787, 0x339: 0x380b, + // Block 0xd, offset 0x340 + 0x351: 0x812d, + 0x352: 0x8132, 0x353: 0x8132, 0x354: 0x8132, 0x355: 0x8132, 0x356: 0x812d, 0x357: 0x8132, + 0x358: 0x8132, 0x359: 0x8132, 0x35a: 0x812e, 0x35b: 0x812d, 0x35c: 0x8132, 0x35d: 0x8132, + 0x35e: 0x8132, 0x35f: 0x8132, 0x360: 0x8132, 0x361: 0x8132, 0x362: 0x812d, 0x363: 0x812d, + 0x364: 0x812d, 0x365: 0x812d, 0x366: 0x812d, 0x367: 0x812d, 0x368: 0x8132, 0x369: 0x8132, + 0x36a: 0x812d, 0x36b: 0x8132, 0x36c: 0x8132, 0x36d: 0x812e, 0x36e: 0x8131, 0x36f: 0x8132, + 0x370: 0x8105, 0x371: 0x8106, 0x372: 0x8107, 0x373: 0x8108, 0x374: 0x8109, 0x375: 0x810a, + 0x376: 0x810b, 0x377: 0x810c, 0x378: 0x810d, 0x379: 0x810e, 0x37a: 0x810e, 0x37b: 0x810f, + 0x37c: 0x8110, 0x37d: 0x8111, 0x37f: 0x8112, + // Block 0xe, offset 0x380 + 0x388: 0xa000, 0x38a: 0xa000, 0x38b: 0x8116, + 0x38c: 0x8117, 0x38d: 0x8118, 0x38e: 0x8119, 0x38f: 0x811a, 0x390: 0x811b, 0x391: 0x811c, + 0x392: 0x811d, 0x393: 0x9932, 0x394: 0x9932, 0x395: 0x992d, 0x396: 0x812d, 0x397: 0x8132, + 0x398: 0x8132, 0x399: 0x8132, 0x39a: 0x8132, 0x39b: 0x8132, 0x39c: 0x812d, 0x39d: 0x8132, + 0x39e: 0x8132, 0x39f: 0x812d, + 0x3b0: 0x811e, + // Block 0xf, offset 0x3c0 + 0x3d3: 0x812d, 0x3d4: 0x8132, 0x3d5: 0x8132, 0x3d6: 0x8132, 0x3d7: 0x8132, + 0x3d8: 0x8132, 0x3d9: 0x8132, 0x3da: 0x8132, 0x3db: 0x8132, 0x3dc: 0x8132, 0x3dd: 0x8132, + 0x3de: 0x8132, 0x3df: 0x8132, 0x3e0: 0x8132, 0x3e1: 0x8132, 0x3e3: 0x812d, + 0x3e4: 0x8132, 0x3e5: 0x8132, 0x3e6: 0x812d, 0x3e7: 0x8132, 0x3e8: 0x8132, 0x3e9: 0x812d, + 0x3ea: 0x8132, 0x3eb: 0x8132, 0x3ec: 0x8132, 0x3ed: 0x812d, 0x3ee: 0x812d, 0x3ef: 0x812d, + 0x3f0: 0x8116, 0x3f1: 0x8117, 0x3f2: 0x8118, 0x3f3: 0x8132, 0x3f4: 0x8132, 0x3f5: 0x8132, + 0x3f6: 0x812d, 0x3f7: 0x8132, 0x3f8: 0x8132, 0x3f9: 0x812d, 0x3fa: 0x812d, 0x3fb: 0x8132, + 0x3fc: 0x8132, 0x3fd: 0x8132, 0x3fe: 0x8132, 0x3ff: 0x8132, + // Block 0x10, offset 0x400 + 0x405: 0xa000, + 0x406: 0x2d26, 0x407: 0xa000, 0x408: 0x2d2e, 0x409: 0xa000, 0x40a: 0x2d36, 0x40b: 0xa000, + 0x40c: 0x2d3e, 0x40d: 0xa000, 0x40e: 0x2d46, 0x411: 0xa000, + 0x412: 0x2d4e, + 0x434: 0x8102, 0x435: 0x9900, + 0x43a: 0xa000, 0x43b: 0x2d56, + 0x43c: 0xa000, 0x43d: 0x2d5e, 0x43e: 0xa000, 0x43f: 0xa000, + // Block 0x11, offset 0x440 + 0x440: 0x8132, 0x441: 0x8132, 0x442: 0x812d, 0x443: 0x8132, 0x444: 0x8132, 0x445: 0x8132, + 0x446: 0x8132, 0x447: 0x8132, 0x448: 0x8132, 0x449: 0x8132, 0x44a: 0x812d, 0x44b: 0x8132, + 0x44c: 0x8132, 0x44d: 0x8135, 0x44e: 0x812a, 0x44f: 0x812d, 0x450: 0x8129, 0x451: 0x8132, + 0x452: 0x8132, 0x453: 0x8132, 0x454: 0x8132, 0x455: 0x8132, 0x456: 0x8132, 0x457: 0x8132, + 0x458: 0x8132, 0x459: 0x8132, 0x45a: 0x8132, 0x45b: 0x8132, 0x45c: 0x8132, 0x45d: 0x8132, + 0x45e: 0x8132, 0x45f: 0x8132, 0x460: 0x8132, 0x461: 0x8132, 0x462: 0x8132, 0x463: 0x8132, + 0x464: 0x8132, 0x465: 0x8132, 0x466: 0x8132, 0x467: 0x8132, 0x468: 0x8132, 0x469: 0x8132, + 0x46a: 0x8132, 0x46b: 0x8132, 0x46c: 0x8132, 0x46d: 0x8132, 0x46e: 0x8132, 0x46f: 0x8132, + 0x470: 0x8132, 0x471: 0x8132, 0x472: 0x8132, 0x473: 0x8132, 0x474: 0x8132, 0x475: 0x8132, + 0x476: 0x8133, 0x477: 0x8131, 0x478: 0x8131, 0x479: 0x812d, 0x47b: 0x8132, + 0x47c: 0x8134, 0x47d: 0x812d, 0x47e: 0x8132, 0x47f: 0x812d, + // Block 0x12, offset 0x480 + 0x480: 0x2f97, 0x481: 0x32a3, 0x482: 0x2fa1, 0x483: 0x32ad, 0x484: 0x2fa6, 0x485: 0x32b2, + 0x486: 0x2fab, 0x487: 0x32b7, 0x488: 0x38cc, 0x489: 0x3a5b, 0x48a: 0x2fc4, 0x48b: 0x32d0, + 0x48c: 0x2fce, 0x48d: 0x32da, 0x48e: 0x2fdd, 0x48f: 0x32e9, 0x490: 0x2fd3, 0x491: 0x32df, + 0x492: 0x2fd8, 0x493: 0x32e4, 0x494: 0x38ef, 0x495: 0x3a7e, 0x496: 0x38f6, 0x497: 0x3a85, + 0x498: 0x3019, 0x499: 0x3325, 0x49a: 0x301e, 0x49b: 0x332a, 0x49c: 0x3904, 0x49d: 0x3a93, + 0x49e: 0x3023, 0x49f: 0x332f, 0x4a0: 0x3032, 0x4a1: 0x333e, 0x4a2: 0x3050, 0x4a3: 0x335c, + 0x4a4: 0x305f, 0x4a5: 0x336b, 0x4a6: 0x3055, 0x4a7: 0x3361, 0x4a8: 0x3064, 0x4a9: 0x3370, + 0x4aa: 0x3069, 0x4ab: 0x3375, 0x4ac: 0x30af, 0x4ad: 0x33bb, 0x4ae: 0x390b, 0x4af: 0x3a9a, + 0x4b0: 0x30b9, 0x4b1: 0x33ca, 0x4b2: 0x30c3, 0x4b3: 0x33d4, 0x4b4: 0x30cd, 0x4b5: 0x33de, + 0x4b6: 0x46c4, 0x4b7: 0x4755, 0x4b8: 0x3912, 0x4b9: 0x3aa1, 0x4ba: 0x30e6, 0x4bb: 0x33f7, + 0x4bc: 0x30e1, 0x4bd: 0x33f2, 0x4be: 0x30eb, 0x4bf: 0x33fc, + // Block 0x13, offset 0x4c0 + 0x4c0: 0x30f0, 0x4c1: 0x3401, 0x4c2: 0x30f5, 0x4c3: 0x3406, 0x4c4: 0x3109, 0x4c5: 0x341a, + 0x4c6: 0x3113, 0x4c7: 0x3424, 0x4c8: 0x3122, 0x4c9: 0x3433, 0x4ca: 0x311d, 0x4cb: 0x342e, + 0x4cc: 0x3935, 0x4cd: 0x3ac4, 0x4ce: 0x3943, 0x4cf: 0x3ad2, 0x4d0: 0x394a, 0x4d1: 0x3ad9, + 0x4d2: 0x3951, 0x4d3: 0x3ae0, 0x4d4: 0x314f, 0x4d5: 0x3460, 0x4d6: 0x3154, 0x4d7: 0x3465, + 0x4d8: 0x315e, 0x4d9: 0x346f, 0x4da: 0x46f1, 0x4db: 0x4782, 0x4dc: 0x3997, 0x4dd: 0x3b26, + 0x4de: 0x3177, 0x4df: 0x3488, 0x4e0: 0x3181, 0x4e1: 0x3492, 0x4e2: 0x4700, 0x4e3: 0x4791, + 0x4e4: 0x399e, 0x4e5: 0x3b2d, 0x4e6: 0x39a5, 0x4e7: 0x3b34, 0x4e8: 0x39ac, 0x4e9: 0x3b3b, + 0x4ea: 0x3190, 0x4eb: 0x34a1, 0x4ec: 0x319a, 0x4ed: 0x34b0, 0x4ee: 0x31ae, 0x4ef: 0x34c4, + 0x4f0: 0x31a9, 0x4f1: 0x34bf, 0x4f2: 0x31ea, 0x4f3: 0x3500, 0x4f4: 0x31f9, 0x4f5: 0x350f, + 0x4f6: 0x31f4, 0x4f7: 0x350a, 0x4f8: 0x39b3, 0x4f9: 0x3b42, 0x4fa: 0x39ba, 0x4fb: 0x3b49, + 0x4fc: 0x31fe, 0x4fd: 0x3514, 0x4fe: 0x3203, 0x4ff: 0x3519, + // Block 0x14, offset 0x500 + 0x500: 0x3208, 0x501: 0x351e, 0x502: 0x320d, 0x503: 0x3523, 0x504: 0x321c, 0x505: 0x3532, + 0x506: 0x3217, 0x507: 0x352d, 0x508: 0x3221, 0x509: 0x353c, 0x50a: 0x3226, 0x50b: 0x3541, + 0x50c: 0x322b, 0x50d: 0x3546, 0x50e: 0x3249, 0x50f: 0x3564, 0x510: 0x3262, 0x511: 0x3582, + 0x512: 0x3271, 0x513: 0x3591, 0x514: 0x3276, 0x515: 0x3596, 0x516: 0x337a, 0x517: 0x34a6, + 0x518: 0x3537, 0x519: 0x3573, 0x51b: 0x35d1, + 0x520: 0x46a1, 0x521: 0x4732, 0x522: 0x2f83, 0x523: 0x328f, + 0x524: 0x3878, 0x525: 0x3a07, 0x526: 0x3871, 0x527: 0x3a00, 0x528: 0x3886, 0x529: 0x3a15, + 0x52a: 0x387f, 0x52b: 0x3a0e, 0x52c: 0x38be, 0x52d: 0x3a4d, 0x52e: 0x3894, 0x52f: 0x3a23, + 0x530: 0x388d, 0x531: 0x3a1c, 0x532: 0x38a2, 0x533: 0x3a31, 0x534: 0x389b, 0x535: 0x3a2a, + 0x536: 0x38c5, 0x537: 0x3a54, 0x538: 0x46b5, 0x539: 0x4746, 0x53a: 0x3000, 0x53b: 0x330c, + 0x53c: 0x2fec, 0x53d: 0x32f8, 0x53e: 0x38da, 0x53f: 0x3a69, + // Block 0x15, offset 0x540 + 0x540: 0x38d3, 0x541: 0x3a62, 0x542: 0x38e8, 0x543: 0x3a77, 0x544: 0x38e1, 0x545: 0x3a70, + 0x546: 0x38fd, 0x547: 0x3a8c, 0x548: 0x3091, 0x549: 0x339d, 0x54a: 0x30a5, 0x54b: 0x33b1, + 0x54c: 0x46e7, 0x54d: 0x4778, 0x54e: 0x3136, 0x54f: 0x3447, 0x550: 0x3920, 0x551: 0x3aaf, + 0x552: 0x3919, 0x553: 0x3aa8, 0x554: 0x392e, 0x555: 0x3abd, 0x556: 0x3927, 0x557: 0x3ab6, + 0x558: 0x3989, 0x559: 0x3b18, 0x55a: 0x396d, 0x55b: 0x3afc, 0x55c: 0x3966, 0x55d: 0x3af5, + 0x55e: 0x397b, 0x55f: 0x3b0a, 0x560: 0x3974, 0x561: 0x3b03, 0x562: 0x3982, 0x563: 0x3b11, + 0x564: 0x31e5, 0x565: 0x34fb, 0x566: 0x31c7, 0x567: 0x34dd, 0x568: 0x39e4, 0x569: 0x3b73, + 0x56a: 0x39dd, 0x56b: 0x3b6c, 0x56c: 0x39f2, 0x56d: 0x3b81, 0x56e: 0x39eb, 0x56f: 0x3b7a, + 0x570: 0x39f9, 0x571: 0x3b88, 0x572: 0x3230, 0x573: 0x354b, 0x574: 0x3258, 0x575: 0x3578, + 0x576: 0x3253, 0x577: 0x356e, 0x578: 0x323f, 0x579: 0x355a, + // Block 0x16, offset 0x580 + 0x580: 0x4804, 0x581: 0x480a, 0x582: 0x491e, 0x583: 0x4936, 0x584: 0x4926, 0x585: 0x493e, + 0x586: 0x492e, 0x587: 0x4946, 0x588: 0x47aa, 0x589: 0x47b0, 0x58a: 0x488e, 0x58b: 0x48a6, + 0x58c: 0x4896, 0x58d: 0x48ae, 0x58e: 0x489e, 0x58f: 0x48b6, 0x590: 0x4816, 0x591: 0x481c, + 0x592: 0x3db8, 0x593: 0x3dc8, 0x594: 0x3dc0, 0x595: 0x3dd0, + 0x598: 0x47b6, 0x599: 0x47bc, 0x59a: 0x3ce8, 0x59b: 0x3cf8, 0x59c: 0x3cf0, 0x59d: 0x3d00, + 0x5a0: 0x482e, 0x5a1: 0x4834, 0x5a2: 0x494e, 0x5a3: 0x4966, + 0x5a4: 0x4956, 0x5a5: 0x496e, 0x5a6: 0x495e, 0x5a7: 0x4976, 0x5a8: 0x47c2, 0x5a9: 0x47c8, + 0x5aa: 0x48be, 0x5ab: 0x48d6, 0x5ac: 0x48c6, 0x5ad: 0x48de, 0x5ae: 0x48ce, 0x5af: 0x48e6, + 0x5b0: 0x4846, 0x5b1: 0x484c, 0x5b2: 0x3e18, 0x5b3: 0x3e30, 0x5b4: 0x3e20, 0x5b5: 0x3e38, + 0x5b6: 0x3e28, 0x5b7: 0x3e40, 0x5b8: 0x47ce, 0x5b9: 0x47d4, 0x5ba: 0x3d18, 0x5bb: 0x3d30, + 0x5bc: 0x3d20, 0x5bd: 0x3d38, 0x5be: 0x3d28, 0x5bf: 0x3d40, + // Block 0x17, offset 0x5c0 + 0x5c0: 0x4852, 0x5c1: 0x4858, 0x5c2: 0x3e48, 0x5c3: 0x3e58, 0x5c4: 0x3e50, 0x5c5: 0x3e60, + 0x5c8: 0x47da, 0x5c9: 0x47e0, 0x5ca: 0x3d48, 0x5cb: 0x3d58, + 0x5cc: 0x3d50, 0x5cd: 0x3d60, 0x5d0: 0x4864, 0x5d1: 0x486a, + 0x5d2: 0x3e80, 0x5d3: 0x3e98, 0x5d4: 0x3e88, 0x5d5: 0x3ea0, 0x5d6: 0x3e90, 0x5d7: 0x3ea8, + 0x5d9: 0x47e6, 0x5db: 0x3d68, 0x5dd: 0x3d70, + 0x5df: 0x3d78, 0x5e0: 0x487c, 0x5e1: 0x4882, 0x5e2: 0x497e, 0x5e3: 0x4996, + 0x5e4: 0x4986, 0x5e5: 0x499e, 0x5e6: 0x498e, 0x5e7: 0x49a6, 0x5e8: 0x47ec, 0x5e9: 0x47f2, + 0x5ea: 0x48ee, 0x5eb: 0x4906, 0x5ec: 0x48f6, 0x5ed: 0x490e, 0x5ee: 0x48fe, 0x5ef: 0x4916, + 0x5f0: 0x47f8, 0x5f1: 0x431e, 0x5f2: 0x3691, 0x5f3: 0x4324, 0x5f4: 0x4822, 0x5f5: 0x432a, + 0x5f6: 0x36a3, 0x5f7: 0x4330, 0x5f8: 0x36c1, 0x5f9: 0x4336, 0x5fa: 0x36d9, 0x5fb: 0x433c, + 0x5fc: 0x4870, 0x5fd: 0x4342, + // Block 0x18, offset 0x600 + 0x600: 0x3da0, 0x601: 0x3da8, 0x602: 0x4184, 0x603: 0x41a2, 0x604: 0x418e, 0x605: 0x41ac, + 0x606: 0x4198, 0x607: 0x41b6, 0x608: 0x3cd8, 0x609: 0x3ce0, 0x60a: 0x40d0, 0x60b: 0x40ee, + 0x60c: 0x40da, 0x60d: 0x40f8, 0x60e: 0x40e4, 0x60f: 0x4102, 0x610: 0x3de8, 0x611: 0x3df0, + 0x612: 0x41c0, 0x613: 0x41de, 0x614: 0x41ca, 0x615: 0x41e8, 0x616: 0x41d4, 0x617: 0x41f2, + 0x618: 0x3d08, 0x619: 0x3d10, 0x61a: 0x410c, 0x61b: 0x412a, 0x61c: 0x4116, 0x61d: 0x4134, + 0x61e: 0x4120, 0x61f: 0x413e, 0x620: 0x3ec0, 0x621: 0x3ec8, 0x622: 0x41fc, 0x623: 0x421a, + 0x624: 0x4206, 0x625: 0x4224, 0x626: 0x4210, 0x627: 0x422e, 0x628: 0x3d80, 0x629: 0x3d88, + 0x62a: 0x4148, 0x62b: 0x4166, 0x62c: 0x4152, 0x62d: 0x4170, 0x62e: 0x415c, 0x62f: 0x417a, + 0x630: 0x3685, 0x631: 0x367f, 0x632: 0x3d90, 0x633: 0x368b, 0x634: 0x3d98, + 0x636: 0x4810, 0x637: 0x3db0, 0x638: 0x35f5, 0x639: 0x35ef, 0x63a: 0x35e3, 0x63b: 0x42ee, + 0x63c: 0x35fb, 0x63d: 0x8100, 0x63e: 0x01d3, 0x63f: 0xa100, + // Block 0x19, offset 0x640 + 0x640: 0x8100, 0x641: 0x35a7, 0x642: 0x3dd8, 0x643: 0x369d, 0x644: 0x3de0, + 0x646: 0x483a, 0x647: 0x3df8, 0x648: 0x3601, 0x649: 0x42f4, 0x64a: 0x360d, 0x64b: 0x42fa, + 0x64c: 0x3619, 0x64d: 0x3b8f, 0x64e: 0x3b96, 0x64f: 0x3b9d, 0x650: 0x36b5, 0x651: 0x36af, + 0x652: 0x3e00, 0x653: 0x44e4, 0x656: 0x36bb, 0x657: 0x3e10, + 0x658: 0x3631, 0x659: 0x362b, 0x65a: 0x361f, 0x65b: 0x4300, 0x65d: 0x3ba4, + 0x65e: 0x3bab, 0x65f: 0x3bb2, 0x660: 0x36eb, 0x661: 0x36e5, 0x662: 0x3e68, 0x663: 0x44ec, + 0x664: 0x36cd, 0x665: 0x36d3, 0x666: 0x36f1, 0x667: 0x3e78, 0x668: 0x3661, 0x669: 0x365b, + 0x66a: 0x364f, 0x66b: 0x430c, 0x66c: 0x3649, 0x66d: 0x359b, 0x66e: 0x42e8, 0x66f: 0x0081, + 0x672: 0x3eb0, 0x673: 0x36f7, 0x674: 0x3eb8, + 0x676: 0x4888, 0x677: 0x3ed0, 0x678: 0x363d, 0x679: 0x4306, 0x67a: 0x366d, 0x67b: 0x4318, + 0x67c: 0x3679, 0x67d: 0x4256, 0x67e: 0xa100, + // Block 0x1a, offset 0x680 + 0x681: 0x3c06, 0x683: 0xa000, 0x684: 0x3c0d, 0x685: 0xa000, + 0x687: 0x3c14, 0x688: 0xa000, 0x689: 0x3c1b, + 0x68d: 0xa000, + 0x6a0: 0x2f65, 0x6a1: 0xa000, 0x6a2: 0x3c29, + 0x6a4: 0xa000, 0x6a5: 0xa000, + 0x6ad: 0x3c22, 0x6ae: 0x2f60, 0x6af: 0x2f6a, + 0x6b0: 0x3c30, 0x6b1: 0x3c37, 0x6b2: 0xa000, 0x6b3: 0xa000, 0x6b4: 0x3c3e, 0x6b5: 0x3c45, + 0x6b6: 0xa000, 0x6b7: 0xa000, 0x6b8: 0x3c4c, 0x6b9: 0x3c53, 0x6ba: 0xa000, 0x6bb: 0xa000, + 0x6bc: 0xa000, 0x6bd: 0xa000, + // Block 0x1b, offset 0x6c0 + 0x6c0: 0x3c5a, 0x6c1: 0x3c61, 0x6c2: 0xa000, 0x6c3: 0xa000, 0x6c4: 0x3c76, 0x6c5: 0x3c7d, + 0x6c6: 0xa000, 0x6c7: 0xa000, 0x6c8: 0x3c84, 0x6c9: 0x3c8b, + 0x6d1: 0xa000, + 0x6d2: 0xa000, + 0x6e2: 0xa000, + 0x6e8: 0xa000, 0x6e9: 0xa000, + 0x6eb: 0xa000, 0x6ec: 0x3ca0, 0x6ed: 0x3ca7, 0x6ee: 0x3cae, 0x6ef: 0x3cb5, + 0x6f2: 0xa000, 0x6f3: 0xa000, 0x6f4: 0xa000, 0x6f5: 0xa000, + // Block 0x1c, offset 0x700 + 0x706: 0xa000, 0x70b: 0xa000, + 0x70c: 0x3f08, 0x70d: 0xa000, 0x70e: 0x3f10, 0x70f: 0xa000, 0x710: 0x3f18, 0x711: 0xa000, + 0x712: 0x3f20, 0x713: 0xa000, 0x714: 0x3f28, 0x715: 0xa000, 0x716: 0x3f30, 0x717: 0xa000, + 0x718: 0x3f38, 0x719: 0xa000, 0x71a: 0x3f40, 0x71b: 0xa000, 0x71c: 0x3f48, 0x71d: 0xa000, + 0x71e: 0x3f50, 0x71f: 0xa000, 0x720: 0x3f58, 0x721: 0xa000, 0x722: 0x3f60, + 0x724: 0xa000, 0x725: 0x3f68, 0x726: 0xa000, 0x727: 0x3f70, 0x728: 0xa000, 0x729: 0x3f78, + 0x72f: 0xa000, + 0x730: 0x3f80, 0x731: 0x3f88, 0x732: 0xa000, 0x733: 0x3f90, 0x734: 0x3f98, 0x735: 0xa000, + 0x736: 0x3fa0, 0x737: 0x3fa8, 0x738: 0xa000, 0x739: 0x3fb0, 0x73a: 0x3fb8, 0x73b: 0xa000, + 0x73c: 0x3fc0, 0x73d: 0x3fc8, + // Block 0x1d, offset 0x740 + 0x754: 0x3f00, + 0x759: 0x9903, 0x75a: 0x9903, 0x75b: 0x8100, 0x75c: 0x8100, 0x75d: 0xa000, + 0x75e: 0x3fd0, + 0x766: 0xa000, + 0x76b: 0xa000, 0x76c: 0x3fe0, 0x76d: 0xa000, 0x76e: 0x3fe8, 0x76f: 0xa000, + 0x770: 0x3ff0, 0x771: 0xa000, 0x772: 0x3ff8, 0x773: 0xa000, 0x774: 0x4000, 0x775: 0xa000, + 0x776: 0x4008, 0x777: 0xa000, 0x778: 0x4010, 0x779: 0xa000, 0x77a: 0x4018, 0x77b: 0xa000, + 0x77c: 0x4020, 0x77d: 0xa000, 0x77e: 0x4028, 0x77f: 0xa000, + // Block 0x1e, offset 0x780 + 0x780: 0x4030, 0x781: 0xa000, 0x782: 0x4038, 0x784: 0xa000, 0x785: 0x4040, + 0x786: 0xa000, 0x787: 0x4048, 0x788: 0xa000, 0x789: 0x4050, + 0x78f: 0xa000, 0x790: 0x4058, 0x791: 0x4060, + 0x792: 0xa000, 0x793: 0x4068, 0x794: 0x4070, 0x795: 0xa000, 0x796: 0x4078, 0x797: 0x4080, + 0x798: 0xa000, 0x799: 0x4088, 0x79a: 0x4090, 0x79b: 0xa000, 0x79c: 0x4098, 0x79d: 0x40a0, + 0x7af: 0xa000, + 0x7b0: 0xa000, 0x7b1: 0xa000, 0x7b2: 0xa000, 0x7b4: 0x3fd8, + 0x7b7: 0x40a8, 0x7b8: 0x40b0, 0x7b9: 0x40b8, 0x7ba: 0x40c0, + 0x7bd: 0xa000, 0x7be: 0x40c8, + // Block 0x1f, offset 0x7c0 + 0x7c0: 0x1377, 0x7c1: 0x0cfb, 0x7c2: 0x13d3, 0x7c3: 0x139f, 0x7c4: 0x0e57, 0x7c5: 0x06eb, + 0x7c6: 0x08df, 0x7c7: 0x162b, 0x7c8: 0x162b, 0x7c9: 0x0a0b, 0x7ca: 0x145f, 0x7cb: 0x0943, + 0x7cc: 0x0a07, 0x7cd: 0x0bef, 0x7ce: 0x0fcf, 0x7cf: 0x115f, 0x7d0: 0x1297, 0x7d1: 0x12d3, + 0x7d2: 0x1307, 0x7d3: 0x141b, 0x7d4: 0x0d73, 0x7d5: 0x0dff, 0x7d6: 0x0eab, 0x7d7: 0x0f43, + 0x7d8: 0x125f, 0x7d9: 0x1447, 0x7da: 0x1573, 0x7db: 0x070f, 0x7dc: 0x08b3, 0x7dd: 0x0d87, + 0x7de: 0x0ecf, 0x7df: 0x1293, 0x7e0: 0x15c3, 0x7e1: 0x0ab3, 0x7e2: 0x0e77, 0x7e3: 0x1283, + 0x7e4: 0x1317, 0x7e5: 0x0c23, 0x7e6: 0x11bb, 0x7e7: 0x12df, 0x7e8: 0x0b1f, 0x7e9: 0x0d0f, + 0x7ea: 0x0e17, 0x7eb: 0x0f1b, 0x7ec: 0x1427, 0x7ed: 0x074f, 0x7ee: 0x07e7, 0x7ef: 0x0853, + 0x7f0: 0x0c8b, 0x7f1: 0x0d7f, 0x7f2: 0x0ecb, 0x7f3: 0x0fef, 0x7f4: 0x1177, 0x7f5: 0x128b, + 0x7f6: 0x12a3, 0x7f7: 0x13c7, 0x7f8: 0x14ef, 0x7f9: 0x15a3, 0x7fa: 0x15bf, 0x7fb: 0x102b, + 0x7fc: 0x106b, 0x7fd: 0x1123, 0x7fe: 0x1243, 0x7ff: 0x147b, + // Block 0x20, offset 0x800 + 0x800: 0x15cb, 0x801: 0x134b, 0x802: 0x09c7, 0x803: 0x0b3b, 0x804: 0x10db, 0x805: 0x119b, + 0x806: 0x0eff, 0x807: 0x1033, 0x808: 0x1397, 0x809: 0x14e7, 0x80a: 0x09c3, 0x80b: 0x0a8f, + 0x80c: 0x0d77, 0x80d: 0x0e2b, 0x80e: 0x0e5f, 0x80f: 0x1113, 0x810: 0x113b, 0x811: 0x14a7, + 0x812: 0x084f, 0x813: 0x11a7, 0x814: 0x07f3, 0x815: 0x07ef, 0x816: 0x1097, 0x817: 0x1127, + 0x818: 0x125b, 0x819: 0x14af, 0x81a: 0x1367, 0x81b: 0x0c27, 0x81c: 0x0d73, 0x81d: 0x1357, + 0x81e: 0x06f7, 0x81f: 0x0a63, 0x820: 0x0b93, 0x821: 0x0f2f, 0x822: 0x0faf, 0x823: 0x0873, + 0x824: 0x103b, 0x825: 0x075f, 0x826: 0x0b77, 0x827: 0x06d7, 0x828: 0x0deb, 0x829: 0x0ca3, + 0x82a: 0x110f, 0x82b: 0x08c7, 0x82c: 0x09b3, 0x82d: 0x0ffb, 0x82e: 0x1263, 0x82f: 0x133b, + 0x830: 0x0db7, 0x831: 0x13f7, 0x832: 0x0de3, 0x833: 0x0c37, 0x834: 0x121b, 0x835: 0x0c57, + 0x836: 0x0fab, 0x837: 0x072b, 0x838: 0x07a7, 0x839: 0x07eb, 0x83a: 0x0d53, 0x83b: 0x10fb, + 0x83c: 0x11f3, 0x83d: 0x1347, 0x83e: 0x145b, 0x83f: 0x085b, + // Block 0x21, offset 0x840 + 0x840: 0x090f, 0x841: 0x0a17, 0x842: 0x0b2f, 0x843: 0x0cbf, 0x844: 0x0e7b, 0x845: 0x103f, + 0x846: 0x1497, 0x847: 0x157b, 0x848: 0x15cf, 0x849: 0x15e7, 0x84a: 0x0837, 0x84b: 0x0cf3, + 0x84c: 0x0da3, 0x84d: 0x13eb, 0x84e: 0x0afb, 0x84f: 0x0bd7, 0x850: 0x0bf3, 0x851: 0x0c83, + 0x852: 0x0e6b, 0x853: 0x0eb7, 0x854: 0x0f67, 0x855: 0x108b, 0x856: 0x112f, 0x857: 0x1193, + 0x858: 0x13db, 0x859: 0x126b, 0x85a: 0x1403, 0x85b: 0x147f, 0x85c: 0x080f, 0x85d: 0x083b, + 0x85e: 0x0923, 0x85f: 0x0ea7, 0x860: 0x12f3, 0x861: 0x133b, 0x862: 0x0b1b, 0x863: 0x0b8b, + 0x864: 0x0c4f, 0x865: 0x0daf, 0x866: 0x10d7, 0x867: 0x0f23, 0x868: 0x073b, 0x869: 0x097f, + 0x86a: 0x0a63, 0x86b: 0x0ac7, 0x86c: 0x0b97, 0x86d: 0x0f3f, 0x86e: 0x0f5b, 0x86f: 0x116b, + 0x870: 0x118b, 0x871: 0x1463, 0x872: 0x14e3, 0x873: 0x14f3, 0x874: 0x152f, 0x875: 0x0753, + 0x876: 0x107f, 0x877: 0x144f, 0x878: 0x14cb, 0x879: 0x0baf, 0x87a: 0x0717, 0x87b: 0x0777, + 0x87c: 0x0a67, 0x87d: 0x0a87, 0x87e: 0x0caf, 0x87f: 0x0d73, + // Block 0x22, offset 0x880 + 0x880: 0x0ec3, 0x881: 0x0fcb, 0x882: 0x1277, 0x883: 0x1417, 0x884: 0x1623, 0x885: 0x0ce3, + 0x886: 0x14a3, 0x887: 0x0833, 0x888: 0x0d2f, 0x889: 0x0d3b, 0x88a: 0x0e0f, 0x88b: 0x0e47, + 0x88c: 0x0f4b, 0x88d: 0x0fa7, 0x88e: 0x1027, 0x88f: 0x110b, 0x890: 0x153b, 0x891: 0x07af, + 0x892: 0x0c03, 0x893: 0x14b3, 0x894: 0x0767, 0x895: 0x0aab, 0x896: 0x0e2f, 0x897: 0x13df, + 0x898: 0x0b67, 0x899: 0x0bb7, 0x89a: 0x0d43, 0x89b: 0x0f2f, 0x89c: 0x14bb, 0x89d: 0x0817, + 0x89e: 0x08ff, 0x89f: 0x0a97, 0x8a0: 0x0cd3, 0x8a1: 0x0d1f, 0x8a2: 0x0d5f, 0x8a3: 0x0df3, + 0x8a4: 0x0f47, 0x8a5: 0x0fbb, 0x8a6: 0x1157, 0x8a7: 0x12f7, 0x8a8: 0x1303, 0x8a9: 0x1457, + 0x8aa: 0x14d7, 0x8ab: 0x0883, 0x8ac: 0x0e4b, 0x8ad: 0x0903, 0x8ae: 0x0ec7, 0x8af: 0x0f6b, + 0x8b0: 0x1287, 0x8b1: 0x14bf, 0x8b2: 0x15ab, 0x8b3: 0x15d3, 0x8b4: 0x0d37, 0x8b5: 0x0e27, + 0x8b6: 0x11c3, 0x8b7: 0x10b7, 0x8b8: 0x10c3, 0x8b9: 0x10e7, 0x8ba: 0x0f17, 0x8bb: 0x0e9f, + 0x8bc: 0x1363, 0x8bd: 0x0733, 0x8be: 0x122b, 0x8bf: 0x081b, + // Block 0x23, offset 0x8c0 + 0x8c0: 0x080b, 0x8c1: 0x0b0b, 0x8c2: 0x0c2b, 0x8c3: 0x10f3, 0x8c4: 0x0a53, 0x8c5: 0x0e03, + 0x8c6: 0x0cef, 0x8c7: 0x13e7, 0x8c8: 0x12e7, 0x8c9: 0x14ab, 0x8ca: 0x1323, 0x8cb: 0x0b27, + 0x8cc: 0x0787, 0x8cd: 0x095b, 0x8d0: 0x09af, + 0x8d2: 0x0cdf, 0x8d5: 0x07f7, 0x8d6: 0x0f1f, 0x8d7: 0x0fe3, + 0x8d8: 0x1047, 0x8d9: 0x1063, 0x8da: 0x1067, 0x8db: 0x107b, 0x8dc: 0x14fb, 0x8dd: 0x10eb, + 0x8de: 0x116f, 0x8e0: 0x128f, 0x8e2: 0x1353, + 0x8e5: 0x1407, 0x8e6: 0x1433, + 0x8ea: 0x154f, 0x8eb: 0x1553, 0x8ec: 0x1557, 0x8ed: 0x15bb, 0x8ee: 0x142b, 0x8ef: 0x14c7, + 0x8f0: 0x0757, 0x8f1: 0x077b, 0x8f2: 0x078f, 0x8f3: 0x084b, 0x8f4: 0x0857, 0x8f5: 0x0897, + 0x8f6: 0x094b, 0x8f7: 0x0967, 0x8f8: 0x096f, 0x8f9: 0x09ab, 0x8fa: 0x09b7, 0x8fb: 0x0a93, + 0x8fc: 0x0a9b, 0x8fd: 0x0ba3, 0x8fe: 0x0bcb, 0x8ff: 0x0bd3, + // Block 0x24, offset 0x900 + 0x900: 0x0beb, 0x901: 0x0c97, 0x902: 0x0cc7, 0x903: 0x0ce7, 0x904: 0x0d57, 0x905: 0x0e1b, + 0x906: 0x0e37, 0x907: 0x0e67, 0x908: 0x0ebb, 0x909: 0x0edb, 0x90a: 0x0f4f, 0x90b: 0x102f, + 0x90c: 0x104b, 0x90d: 0x1053, 0x90e: 0x104f, 0x90f: 0x1057, 0x910: 0x105b, 0x911: 0x105f, + 0x912: 0x1073, 0x913: 0x1077, 0x914: 0x109b, 0x915: 0x10af, 0x916: 0x10cb, 0x917: 0x112f, + 0x918: 0x1137, 0x919: 0x113f, 0x91a: 0x1153, 0x91b: 0x117b, 0x91c: 0x11cb, 0x91d: 0x11ff, + 0x91e: 0x11ff, 0x91f: 0x1267, 0x920: 0x130f, 0x921: 0x1327, 0x922: 0x135b, 0x923: 0x135f, + 0x924: 0x13a3, 0x925: 0x13a7, 0x926: 0x13ff, 0x927: 0x1407, 0x928: 0x14db, 0x929: 0x151f, + 0x92a: 0x1537, 0x92b: 0x0b9b, 0x92c: 0x171e, 0x92d: 0x11e3, + 0x930: 0x06df, 0x931: 0x07e3, 0x932: 0x07a3, 0x933: 0x074b, 0x934: 0x078b, 0x935: 0x07b7, + 0x936: 0x0847, 0x937: 0x0863, 0x938: 0x094b, 0x939: 0x0937, 0x93a: 0x0947, 0x93b: 0x0963, + 0x93c: 0x09af, 0x93d: 0x09bf, 0x93e: 0x0a03, 0x93f: 0x0a0f, + // Block 0x25, offset 0x940 + 0x940: 0x0a2b, 0x941: 0x0a3b, 0x942: 0x0b23, 0x943: 0x0b2b, 0x944: 0x0b5b, 0x945: 0x0b7b, + 0x946: 0x0bab, 0x947: 0x0bc3, 0x948: 0x0bb3, 0x949: 0x0bd3, 0x94a: 0x0bc7, 0x94b: 0x0beb, + 0x94c: 0x0c07, 0x94d: 0x0c5f, 0x94e: 0x0c6b, 0x94f: 0x0c73, 0x950: 0x0c9b, 0x951: 0x0cdf, + 0x952: 0x0d0f, 0x953: 0x0d13, 0x954: 0x0d27, 0x955: 0x0da7, 0x956: 0x0db7, 0x957: 0x0e0f, + 0x958: 0x0e5b, 0x959: 0x0e53, 0x95a: 0x0e67, 0x95b: 0x0e83, 0x95c: 0x0ebb, 0x95d: 0x1013, + 0x95e: 0x0edf, 0x95f: 0x0f13, 0x960: 0x0f1f, 0x961: 0x0f5f, 0x962: 0x0f7b, 0x963: 0x0f9f, + 0x964: 0x0fc3, 0x965: 0x0fc7, 0x966: 0x0fe3, 0x967: 0x0fe7, 0x968: 0x0ff7, 0x969: 0x100b, + 0x96a: 0x1007, 0x96b: 0x1037, 0x96c: 0x10b3, 0x96d: 0x10cb, 0x96e: 0x10e3, 0x96f: 0x111b, + 0x970: 0x112f, 0x971: 0x114b, 0x972: 0x117b, 0x973: 0x122f, 0x974: 0x1257, 0x975: 0x12cb, + 0x976: 0x1313, 0x977: 0x131f, 0x978: 0x1327, 0x979: 0x133f, 0x97a: 0x1353, 0x97b: 0x1343, + 0x97c: 0x135b, 0x97d: 0x1357, 0x97e: 0x134f, 0x97f: 0x135f, + // Block 0x26, offset 0x980 + 0x980: 0x136b, 0x981: 0x13a7, 0x982: 0x13e3, 0x983: 0x1413, 0x984: 0x144b, 0x985: 0x146b, + 0x986: 0x14b7, 0x987: 0x14db, 0x988: 0x14fb, 0x989: 0x150f, 0x98a: 0x151f, 0x98b: 0x152b, + 0x98c: 0x1537, 0x98d: 0x158b, 0x98e: 0x162b, 0x98f: 0x16b5, 0x990: 0x16b0, 0x991: 0x16e2, + 0x992: 0x0607, 0x993: 0x062f, 0x994: 0x0633, 0x995: 0x1764, 0x996: 0x1791, 0x997: 0x1809, + 0x998: 0x1617, 0x999: 0x1627, + // Block 0x27, offset 0x9c0 + 0x9c0: 0x06fb, 0x9c1: 0x06f3, 0x9c2: 0x0703, 0x9c3: 0x1647, 0x9c4: 0x0747, 0x9c5: 0x0757, + 0x9c6: 0x075b, 0x9c7: 0x0763, 0x9c8: 0x076b, 0x9c9: 0x076f, 0x9ca: 0x077b, 0x9cb: 0x0773, + 0x9cc: 0x05b3, 0x9cd: 0x165b, 0x9ce: 0x078f, 0x9cf: 0x0793, 0x9d0: 0x0797, 0x9d1: 0x07b3, + 0x9d2: 0x164c, 0x9d3: 0x05b7, 0x9d4: 0x079f, 0x9d5: 0x07bf, 0x9d6: 0x1656, 0x9d7: 0x07cf, + 0x9d8: 0x07d7, 0x9d9: 0x0737, 0x9da: 0x07df, 0x9db: 0x07e3, 0x9dc: 0x1831, 0x9dd: 0x07ff, + 0x9de: 0x0807, 0x9df: 0x05bf, 0x9e0: 0x081f, 0x9e1: 0x0823, 0x9e2: 0x082b, 0x9e3: 0x082f, + 0x9e4: 0x05c3, 0x9e5: 0x0847, 0x9e6: 0x084b, 0x9e7: 0x0857, 0x9e8: 0x0863, 0x9e9: 0x0867, + 0x9ea: 0x086b, 0x9eb: 0x0873, 0x9ec: 0x0893, 0x9ed: 0x0897, 0x9ee: 0x089f, 0x9ef: 0x08af, + 0x9f0: 0x08b7, 0x9f1: 0x08bb, 0x9f2: 0x08bb, 0x9f3: 0x08bb, 0x9f4: 0x166a, 0x9f5: 0x0e93, + 0x9f6: 0x08cf, 0x9f7: 0x08d7, 0x9f8: 0x166f, 0x9f9: 0x08e3, 0x9fa: 0x08eb, 0x9fb: 0x08f3, + 0x9fc: 0x091b, 0x9fd: 0x0907, 0x9fe: 0x0913, 0x9ff: 0x0917, + // Block 0x28, offset 0xa00 + 0xa00: 0x091f, 0xa01: 0x0927, 0xa02: 0x092b, 0xa03: 0x0933, 0xa04: 0x093b, 0xa05: 0x093f, + 0xa06: 0x093f, 0xa07: 0x0947, 0xa08: 0x094f, 0xa09: 0x0953, 0xa0a: 0x095f, 0xa0b: 0x0983, + 0xa0c: 0x0967, 0xa0d: 0x0987, 0xa0e: 0x096b, 0xa0f: 0x0973, 0xa10: 0x080b, 0xa11: 0x09cf, + 0xa12: 0x0997, 0xa13: 0x099b, 0xa14: 0x099f, 0xa15: 0x0993, 0xa16: 0x09a7, 0xa17: 0x09a3, + 0xa18: 0x09bb, 0xa19: 0x1674, 0xa1a: 0x09d7, 0xa1b: 0x09db, 0xa1c: 0x09e3, 0xa1d: 0x09ef, + 0xa1e: 0x09f7, 0xa1f: 0x0a13, 0xa20: 0x1679, 0xa21: 0x167e, 0xa22: 0x0a1f, 0xa23: 0x0a23, + 0xa24: 0x0a27, 0xa25: 0x0a1b, 0xa26: 0x0a2f, 0xa27: 0x05c7, 0xa28: 0x05cb, 0xa29: 0x0a37, + 0xa2a: 0x0a3f, 0xa2b: 0x0a3f, 0xa2c: 0x1683, 0xa2d: 0x0a5b, 0xa2e: 0x0a5f, 0xa2f: 0x0a63, + 0xa30: 0x0a6b, 0xa31: 0x1688, 0xa32: 0x0a73, 0xa33: 0x0a77, 0xa34: 0x0b4f, 0xa35: 0x0a7f, + 0xa36: 0x05cf, 0xa37: 0x0a8b, 0xa38: 0x0a9b, 0xa39: 0x0aa7, 0xa3a: 0x0aa3, 0xa3b: 0x1692, + 0xa3c: 0x0aaf, 0xa3d: 0x1697, 0xa3e: 0x0abb, 0xa3f: 0x0ab7, + // Block 0x29, offset 0xa40 + 0xa40: 0x0abf, 0xa41: 0x0acf, 0xa42: 0x0ad3, 0xa43: 0x05d3, 0xa44: 0x0ae3, 0xa45: 0x0aeb, + 0xa46: 0x0aef, 0xa47: 0x0af3, 0xa48: 0x05d7, 0xa49: 0x169c, 0xa4a: 0x05db, 0xa4b: 0x0b0f, + 0xa4c: 0x0b13, 0xa4d: 0x0b17, 0xa4e: 0x0b1f, 0xa4f: 0x1863, 0xa50: 0x0b37, 0xa51: 0x16a6, + 0xa52: 0x16a6, 0xa53: 0x11d7, 0xa54: 0x0b47, 0xa55: 0x0b47, 0xa56: 0x05df, 0xa57: 0x16c9, + 0xa58: 0x179b, 0xa59: 0x0b57, 0xa5a: 0x0b5f, 0xa5b: 0x05e3, 0xa5c: 0x0b73, 0xa5d: 0x0b83, + 0xa5e: 0x0b87, 0xa5f: 0x0b8f, 0xa60: 0x0b9f, 0xa61: 0x05eb, 0xa62: 0x05e7, 0xa63: 0x0ba3, + 0xa64: 0x16ab, 0xa65: 0x0ba7, 0xa66: 0x0bbb, 0xa67: 0x0bbf, 0xa68: 0x0bc3, 0xa69: 0x0bbf, + 0xa6a: 0x0bcf, 0xa6b: 0x0bd3, 0xa6c: 0x0be3, 0xa6d: 0x0bdb, 0xa6e: 0x0bdf, 0xa6f: 0x0be7, + 0xa70: 0x0beb, 0xa71: 0x0bef, 0xa72: 0x0bfb, 0xa73: 0x0bff, 0xa74: 0x0c17, 0xa75: 0x0c1f, + 0xa76: 0x0c2f, 0xa77: 0x0c43, 0xa78: 0x16ba, 0xa79: 0x0c3f, 0xa7a: 0x0c33, 0xa7b: 0x0c4b, + 0xa7c: 0x0c53, 0xa7d: 0x0c67, 0xa7e: 0x16bf, 0xa7f: 0x0c6f, + // Block 0x2a, offset 0xa80 + 0xa80: 0x0c63, 0xa81: 0x0c5b, 0xa82: 0x05ef, 0xa83: 0x0c77, 0xa84: 0x0c7f, 0xa85: 0x0c87, + 0xa86: 0x0c7b, 0xa87: 0x05f3, 0xa88: 0x0c97, 0xa89: 0x0c9f, 0xa8a: 0x16c4, 0xa8b: 0x0ccb, + 0xa8c: 0x0cff, 0xa8d: 0x0cdb, 0xa8e: 0x05ff, 0xa8f: 0x0ce7, 0xa90: 0x05fb, 0xa91: 0x05f7, + 0xa92: 0x07c3, 0xa93: 0x07c7, 0xa94: 0x0d03, 0xa95: 0x0ceb, 0xa96: 0x11ab, 0xa97: 0x0663, + 0xa98: 0x0d0f, 0xa99: 0x0d13, 0xa9a: 0x0d17, 0xa9b: 0x0d2b, 0xa9c: 0x0d23, 0xa9d: 0x16dd, + 0xa9e: 0x0603, 0xa9f: 0x0d3f, 0xaa0: 0x0d33, 0xaa1: 0x0d4f, 0xaa2: 0x0d57, 0xaa3: 0x16e7, + 0xaa4: 0x0d5b, 0xaa5: 0x0d47, 0xaa6: 0x0d63, 0xaa7: 0x0607, 0xaa8: 0x0d67, 0xaa9: 0x0d6b, + 0xaaa: 0x0d6f, 0xaab: 0x0d7b, 0xaac: 0x16ec, 0xaad: 0x0d83, 0xaae: 0x060b, 0xaaf: 0x0d8f, + 0xab0: 0x16f1, 0xab1: 0x0d93, 0xab2: 0x060f, 0xab3: 0x0d9f, 0xab4: 0x0dab, 0xab5: 0x0db7, + 0xab6: 0x0dbb, 0xab7: 0x16f6, 0xab8: 0x168d, 0xab9: 0x16fb, 0xaba: 0x0ddb, 0xabb: 0x1700, + 0xabc: 0x0de7, 0xabd: 0x0def, 0xabe: 0x0ddf, 0xabf: 0x0dfb, + // Block 0x2b, offset 0xac0 + 0xac0: 0x0e0b, 0xac1: 0x0e1b, 0xac2: 0x0e0f, 0xac3: 0x0e13, 0xac4: 0x0e1f, 0xac5: 0x0e23, + 0xac6: 0x1705, 0xac7: 0x0e07, 0xac8: 0x0e3b, 0xac9: 0x0e3f, 0xaca: 0x0613, 0xacb: 0x0e53, + 0xacc: 0x0e4f, 0xacd: 0x170a, 0xace: 0x0e33, 0xacf: 0x0e6f, 0xad0: 0x170f, 0xad1: 0x1714, + 0xad2: 0x0e73, 0xad3: 0x0e87, 0xad4: 0x0e83, 0xad5: 0x0e7f, 0xad6: 0x0617, 0xad7: 0x0e8b, + 0xad8: 0x0e9b, 0xad9: 0x0e97, 0xada: 0x0ea3, 0xadb: 0x1651, 0xadc: 0x0eb3, 0xadd: 0x1719, + 0xade: 0x0ebf, 0xadf: 0x1723, 0xae0: 0x0ed3, 0xae1: 0x0edf, 0xae2: 0x0ef3, 0xae3: 0x1728, + 0xae4: 0x0f07, 0xae5: 0x0f0b, 0xae6: 0x172d, 0xae7: 0x1732, 0xae8: 0x0f27, 0xae9: 0x0f37, + 0xaea: 0x061b, 0xaeb: 0x0f3b, 0xaec: 0x061f, 0xaed: 0x061f, 0xaee: 0x0f53, 0xaef: 0x0f57, + 0xaf0: 0x0f5f, 0xaf1: 0x0f63, 0xaf2: 0x0f6f, 0xaf3: 0x0623, 0xaf4: 0x0f87, 0xaf5: 0x1737, + 0xaf6: 0x0fa3, 0xaf7: 0x173c, 0xaf8: 0x0faf, 0xaf9: 0x16a1, 0xafa: 0x0fbf, 0xafb: 0x1741, + 0xafc: 0x1746, 0xafd: 0x174b, 0xafe: 0x0627, 0xaff: 0x062b, + // Block 0x2c, offset 0xb00 + 0xb00: 0x0ff7, 0xb01: 0x1755, 0xb02: 0x1750, 0xb03: 0x175a, 0xb04: 0x175f, 0xb05: 0x0fff, + 0xb06: 0x1003, 0xb07: 0x1003, 0xb08: 0x100b, 0xb09: 0x0633, 0xb0a: 0x100f, 0xb0b: 0x0637, + 0xb0c: 0x063b, 0xb0d: 0x1769, 0xb0e: 0x1023, 0xb0f: 0x102b, 0xb10: 0x1037, 0xb11: 0x063f, + 0xb12: 0x176e, 0xb13: 0x105b, 0xb14: 0x1773, 0xb15: 0x1778, 0xb16: 0x107b, 0xb17: 0x1093, + 0xb18: 0x0643, 0xb19: 0x109b, 0xb1a: 0x109f, 0xb1b: 0x10a3, 0xb1c: 0x177d, 0xb1d: 0x1782, + 0xb1e: 0x1782, 0xb1f: 0x10bb, 0xb20: 0x0647, 0xb21: 0x1787, 0xb22: 0x10cf, 0xb23: 0x10d3, + 0xb24: 0x064b, 0xb25: 0x178c, 0xb26: 0x10ef, 0xb27: 0x064f, 0xb28: 0x10ff, 0xb29: 0x10f7, + 0xb2a: 0x1107, 0xb2b: 0x1796, 0xb2c: 0x111f, 0xb2d: 0x0653, 0xb2e: 0x112b, 0xb2f: 0x1133, + 0xb30: 0x1143, 0xb31: 0x0657, 0xb32: 0x17a0, 0xb33: 0x17a5, 0xb34: 0x065b, 0xb35: 0x17aa, + 0xb36: 0x115b, 0xb37: 0x17af, 0xb38: 0x1167, 0xb39: 0x1173, 0xb3a: 0x117b, 0xb3b: 0x17b4, + 0xb3c: 0x17b9, 0xb3d: 0x118f, 0xb3e: 0x17be, 0xb3f: 0x1197, + // Block 0x2d, offset 0xb40 + 0xb40: 0x16ce, 0xb41: 0x065f, 0xb42: 0x11af, 0xb43: 0x11b3, 0xb44: 0x0667, 0xb45: 0x11b7, + 0xb46: 0x0a33, 0xb47: 0x17c3, 0xb48: 0x17c8, 0xb49: 0x16d3, 0xb4a: 0x16d8, 0xb4b: 0x11d7, + 0xb4c: 0x11db, 0xb4d: 0x13f3, 0xb4e: 0x066b, 0xb4f: 0x1207, 0xb50: 0x1203, 0xb51: 0x120b, + 0xb52: 0x083f, 0xb53: 0x120f, 0xb54: 0x1213, 0xb55: 0x1217, 0xb56: 0x121f, 0xb57: 0x17cd, + 0xb58: 0x121b, 0xb59: 0x1223, 0xb5a: 0x1237, 0xb5b: 0x123b, 0xb5c: 0x1227, 0xb5d: 0x123f, + 0xb5e: 0x1253, 0xb5f: 0x1267, 0xb60: 0x1233, 0xb61: 0x1247, 0xb62: 0x124b, 0xb63: 0x124f, + 0xb64: 0x17d2, 0xb65: 0x17dc, 0xb66: 0x17d7, 0xb67: 0x066f, 0xb68: 0x126f, 0xb69: 0x1273, + 0xb6a: 0x127b, 0xb6b: 0x17f0, 0xb6c: 0x127f, 0xb6d: 0x17e1, 0xb6e: 0x0673, 0xb6f: 0x0677, + 0xb70: 0x17e6, 0xb71: 0x17eb, 0xb72: 0x067b, 0xb73: 0x129f, 0xb74: 0x12a3, 0xb75: 0x12a7, + 0xb76: 0x12ab, 0xb77: 0x12b7, 0xb78: 0x12b3, 0xb79: 0x12bf, 0xb7a: 0x12bb, 0xb7b: 0x12cb, + 0xb7c: 0x12c3, 0xb7d: 0x12c7, 0xb7e: 0x12cf, 0xb7f: 0x067f, + // Block 0x2e, offset 0xb80 + 0xb80: 0x12d7, 0xb81: 0x12db, 0xb82: 0x0683, 0xb83: 0x12eb, 0xb84: 0x12ef, 0xb85: 0x17f5, + 0xb86: 0x12fb, 0xb87: 0x12ff, 0xb88: 0x0687, 0xb89: 0x130b, 0xb8a: 0x05bb, 0xb8b: 0x17fa, + 0xb8c: 0x17ff, 0xb8d: 0x068b, 0xb8e: 0x068f, 0xb8f: 0x1337, 0xb90: 0x134f, 0xb91: 0x136b, + 0xb92: 0x137b, 0xb93: 0x1804, 0xb94: 0x138f, 0xb95: 0x1393, 0xb96: 0x13ab, 0xb97: 0x13b7, + 0xb98: 0x180e, 0xb99: 0x1660, 0xb9a: 0x13c3, 0xb9b: 0x13bf, 0xb9c: 0x13cb, 0xb9d: 0x1665, + 0xb9e: 0x13d7, 0xb9f: 0x13e3, 0xba0: 0x1813, 0xba1: 0x1818, 0xba2: 0x1423, 0xba3: 0x142f, + 0xba4: 0x1437, 0xba5: 0x181d, 0xba6: 0x143b, 0xba7: 0x1467, 0xba8: 0x1473, 0xba9: 0x1477, + 0xbaa: 0x146f, 0xbab: 0x1483, 0xbac: 0x1487, 0xbad: 0x1822, 0xbae: 0x1493, 0xbaf: 0x0693, + 0xbb0: 0x149b, 0xbb1: 0x1827, 0xbb2: 0x0697, 0xbb3: 0x14d3, 0xbb4: 0x0ac3, 0xbb5: 0x14eb, + 0xbb6: 0x182c, 0xbb7: 0x1836, 0xbb8: 0x069b, 0xbb9: 0x069f, 0xbba: 0x1513, 0xbbb: 0x183b, + 0xbbc: 0x06a3, 0xbbd: 0x1840, 0xbbe: 0x152b, 0xbbf: 0x152b, + // Block 0x2f, offset 0xbc0 + 0xbc0: 0x1533, 0xbc1: 0x1845, 0xbc2: 0x154b, 0xbc3: 0x06a7, 0xbc4: 0x155b, 0xbc5: 0x1567, + 0xbc6: 0x156f, 0xbc7: 0x1577, 0xbc8: 0x06ab, 0xbc9: 0x184a, 0xbca: 0x158b, 0xbcb: 0x15a7, + 0xbcc: 0x15b3, 0xbcd: 0x06af, 0xbce: 0x06b3, 0xbcf: 0x15b7, 0xbd0: 0x184f, 0xbd1: 0x06b7, + 0xbd2: 0x1854, 0xbd3: 0x1859, 0xbd4: 0x185e, 0xbd5: 0x15db, 0xbd6: 0x06bb, 0xbd7: 0x15ef, + 0xbd8: 0x15f7, 0xbd9: 0x15fb, 0xbda: 0x1603, 0xbdb: 0x160b, 0xbdc: 0x1613, 0xbdd: 0x1868, +} + +// nfcIndex: 22 blocks, 1408 entries, 1408 bytes +// Block 0 is the zero block. +var nfcIndex = [1408]uint8{ + // Block 0x0, offset 0x0 + // Block 0x1, offset 0x40 + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc2: 0x2e, 0xc3: 0x01, 0xc4: 0x02, 0xc5: 0x03, 0xc6: 0x2f, 0xc7: 0x04, + 0xc8: 0x05, 0xca: 0x30, 0xcb: 0x31, 0xcc: 0x06, 0xcd: 0x07, 0xce: 0x08, 0xcf: 0x32, + 0xd0: 0x09, 0xd1: 0x33, 0xd2: 0x34, 0xd3: 0x0a, 0xd6: 0x0b, 0xd7: 0x35, + 0xd8: 0x36, 0xd9: 0x0c, 0xdb: 0x37, 0xdc: 0x38, 0xdd: 0x39, 0xdf: 0x3a, + 0xe0: 0x02, 0xe1: 0x03, 0xe2: 0x04, 0xe3: 0x05, + 0xea: 0x06, 0xeb: 0x07, 0xec: 0x08, 0xed: 0x09, 0xef: 0x0a, + 0xf0: 0x13, + // Block 0x4, offset 0x100 + 0x120: 0x3b, 0x121: 0x3c, 0x123: 0x0d, 0x124: 0x3d, 0x125: 0x3e, 0x126: 0x3f, 0x127: 0x40, + 0x128: 0x41, 0x129: 0x42, 0x12a: 0x43, 0x12b: 0x44, 0x12c: 0x3f, 0x12d: 0x45, 0x12e: 0x46, 0x12f: 0x47, + 0x131: 0x48, 0x132: 0x49, 0x133: 0x4a, 0x134: 0x4b, 0x135: 0x4c, 0x137: 0x4d, + 0x138: 0x4e, 0x139: 0x4f, 0x13a: 0x50, 0x13b: 0x51, 0x13c: 0x52, 0x13d: 0x53, 0x13e: 0x54, 0x13f: 0x55, + // Block 0x5, offset 0x140 + 0x140: 0x56, 0x142: 0x57, 0x144: 0x58, 0x145: 0x59, 0x146: 0x5a, 0x147: 0x5b, + 0x14d: 0x5c, + 0x15c: 0x5d, 0x15f: 0x5e, + 0x162: 0x5f, 0x164: 0x60, + 0x168: 0x61, 0x169: 0x62, 0x16a: 0x63, 0x16c: 0x0e, 0x16d: 0x64, 0x16e: 0x65, 0x16f: 0x66, + 0x170: 0x67, 0x173: 0x68, 0x177: 0x0f, + 0x178: 0x10, 0x179: 0x11, 0x17a: 0x12, 0x17b: 0x13, 0x17c: 0x14, 0x17d: 0x15, 0x17e: 0x16, 0x17f: 0x17, + // Block 0x6, offset 0x180 + 0x180: 0x69, 0x183: 0x6a, 0x184: 0x6b, 0x186: 0x6c, 0x187: 0x6d, + 0x188: 0x6e, 0x189: 0x18, 0x18a: 0x19, 0x18b: 0x6f, 0x18c: 0x70, + 0x1ab: 0x71, + 0x1b3: 0x72, 0x1b5: 0x73, 0x1b7: 0x74, + // Block 0x7, offset 0x1c0 + 0x1c0: 0x75, 0x1c1: 0x1a, 0x1c2: 0x1b, 0x1c3: 0x1c, 0x1c4: 0x76, 0x1c5: 0x77, + 0x1c9: 0x78, 0x1cc: 0x79, 0x1cd: 0x7a, + // Block 0x8, offset 0x200 + 0x219: 0x7b, 0x21a: 0x7c, 0x21b: 0x7d, + 0x220: 0x7e, 0x223: 0x7f, 0x224: 0x80, 0x225: 0x81, 0x226: 0x82, 0x227: 0x83, + 0x22a: 0x84, 0x22b: 0x85, 0x22f: 0x86, + 0x230: 0x87, 0x231: 0x88, 0x232: 0x89, 0x233: 0x8a, 0x234: 0x8b, 0x235: 0x8c, 0x236: 0x8d, 0x237: 0x87, + 0x238: 0x88, 0x239: 0x89, 0x23a: 0x8a, 0x23b: 0x8b, 0x23c: 0x8c, 0x23d: 0x8d, 0x23e: 0x87, 0x23f: 0x88, + // Block 0x9, offset 0x240 + 0x240: 0x89, 0x241: 0x8a, 0x242: 0x8b, 0x243: 0x8c, 0x244: 0x8d, 0x245: 0x87, 0x246: 0x88, 0x247: 0x89, + 0x248: 0x8a, 0x249: 0x8b, 0x24a: 0x8c, 0x24b: 0x8d, 0x24c: 0x87, 0x24d: 0x88, 0x24e: 0x89, 0x24f: 0x8a, + 0x250: 0x8b, 0x251: 0x8c, 0x252: 0x8d, 0x253: 0x87, 0x254: 0x88, 0x255: 0x89, 0x256: 0x8a, 0x257: 0x8b, + 0x258: 0x8c, 0x259: 0x8d, 0x25a: 0x87, 0x25b: 0x88, 0x25c: 0x89, 0x25d: 0x8a, 0x25e: 0x8b, 0x25f: 0x8c, + 0x260: 0x8d, 0x261: 0x87, 0x262: 0x88, 0x263: 0x89, 0x264: 0x8a, 0x265: 0x8b, 0x266: 0x8c, 0x267: 0x8d, + 0x268: 0x87, 0x269: 0x88, 0x26a: 0x89, 0x26b: 0x8a, 0x26c: 0x8b, 0x26d: 0x8c, 0x26e: 0x8d, 0x26f: 0x87, + 0x270: 0x88, 0x271: 0x89, 0x272: 0x8a, 0x273: 0x8b, 0x274: 0x8c, 0x275: 0x8d, 0x276: 0x87, 0x277: 0x88, + 0x278: 0x89, 0x279: 0x8a, 0x27a: 0x8b, 0x27b: 0x8c, 0x27c: 0x8d, 0x27d: 0x87, 0x27e: 0x88, 0x27f: 0x89, + // Block 0xa, offset 0x280 + 0x280: 0x8a, 0x281: 0x8b, 0x282: 0x8c, 0x283: 0x8d, 0x284: 0x87, 0x285: 0x88, 0x286: 0x89, 0x287: 0x8a, + 0x288: 0x8b, 0x289: 0x8c, 0x28a: 0x8d, 0x28b: 0x87, 0x28c: 0x88, 0x28d: 0x89, 0x28e: 0x8a, 0x28f: 0x8b, + 0x290: 0x8c, 0x291: 0x8d, 0x292: 0x87, 0x293: 0x88, 0x294: 0x89, 0x295: 0x8a, 0x296: 0x8b, 0x297: 0x8c, + 0x298: 0x8d, 0x299: 0x87, 0x29a: 0x88, 0x29b: 0x89, 0x29c: 0x8a, 0x29d: 0x8b, 0x29e: 0x8c, 0x29f: 0x8d, + 0x2a0: 0x87, 0x2a1: 0x88, 0x2a2: 0x89, 0x2a3: 0x8a, 0x2a4: 0x8b, 0x2a5: 0x8c, 0x2a6: 0x8d, 0x2a7: 0x87, + 0x2a8: 0x88, 0x2a9: 0x89, 0x2aa: 0x8a, 0x2ab: 0x8b, 0x2ac: 0x8c, 0x2ad: 0x8d, 0x2ae: 0x87, 0x2af: 0x88, + 0x2b0: 0x89, 0x2b1: 0x8a, 0x2b2: 0x8b, 0x2b3: 0x8c, 0x2b4: 0x8d, 0x2b5: 0x87, 0x2b6: 0x88, 0x2b7: 0x89, + 0x2b8: 0x8a, 0x2b9: 0x8b, 0x2ba: 0x8c, 0x2bb: 0x8d, 0x2bc: 0x87, 0x2bd: 0x88, 0x2be: 0x89, 0x2bf: 0x8a, + // Block 0xb, offset 0x2c0 + 0x2c0: 0x8b, 0x2c1: 0x8c, 0x2c2: 0x8d, 0x2c3: 0x87, 0x2c4: 0x88, 0x2c5: 0x89, 0x2c6: 0x8a, 0x2c7: 0x8b, + 0x2c8: 0x8c, 0x2c9: 0x8d, 0x2ca: 0x87, 0x2cb: 0x88, 0x2cc: 0x89, 0x2cd: 0x8a, 0x2ce: 0x8b, 0x2cf: 0x8c, + 0x2d0: 0x8d, 0x2d1: 0x87, 0x2d2: 0x88, 0x2d3: 0x89, 0x2d4: 0x8a, 0x2d5: 0x8b, 0x2d6: 0x8c, 0x2d7: 0x8d, + 0x2d8: 0x87, 0x2d9: 0x88, 0x2da: 0x89, 0x2db: 0x8a, 0x2dc: 0x8b, 0x2dd: 0x8c, 0x2de: 0x8e, + // Block 0xc, offset 0x300 + 0x324: 0x1d, 0x325: 0x1e, 0x326: 0x1f, 0x327: 0x20, + 0x328: 0x21, 0x329: 0x22, 0x32a: 0x23, 0x32b: 0x24, 0x32c: 0x8f, 0x32d: 0x90, 0x32e: 0x91, + 0x331: 0x92, 0x332: 0x93, 0x333: 0x94, 0x334: 0x95, + 0x338: 0x96, 0x339: 0x97, 0x33a: 0x98, 0x33b: 0x99, 0x33e: 0x9a, 0x33f: 0x9b, + // Block 0xd, offset 0x340 + 0x347: 0x9c, + 0x34b: 0x9d, 0x34d: 0x9e, + 0x368: 0x9f, 0x36b: 0xa0, + 0x374: 0xa1, + 0x37d: 0xa2, + // Block 0xe, offset 0x380 + 0x381: 0xa3, 0x382: 0xa4, 0x384: 0xa5, 0x385: 0x82, 0x387: 0xa6, + 0x388: 0xa7, 0x38b: 0xa8, 0x38c: 0xa9, 0x38d: 0xaa, + 0x391: 0xab, 0x392: 0xac, 0x393: 0xad, 0x396: 0xae, 0x397: 0xaf, + 0x398: 0x73, 0x39a: 0xb0, 0x39c: 0xb1, + 0x3a0: 0xb2, + 0x3a8: 0xb3, 0x3a9: 0xb4, 0x3aa: 0xb5, + 0x3b0: 0x73, 0x3b5: 0xb6, 0x3b6: 0xb7, + // Block 0xf, offset 0x3c0 + 0x3eb: 0xb8, 0x3ec: 0xb9, + // Block 0x10, offset 0x400 + 0x432: 0xba, + // Block 0x11, offset 0x440 + 0x445: 0xbb, 0x446: 0xbc, 0x447: 0xbd, + 0x449: 0xbe, + // Block 0x12, offset 0x480 + 0x480: 0xbf, + 0x4a3: 0xc0, 0x4a5: 0xc1, + // Block 0x13, offset 0x4c0 + 0x4c8: 0xc2, + // Block 0x14, offset 0x500 + 0x520: 0x25, 0x521: 0x26, 0x522: 0x27, 0x523: 0x28, 0x524: 0x29, 0x525: 0x2a, 0x526: 0x2b, 0x527: 0x2c, + 0x528: 0x2d, + // Block 0x15, offset 0x540 + 0x550: 0x0b, 0x551: 0x0c, 0x556: 0x0d, + 0x55b: 0x0e, 0x55d: 0x0f, 0x55e: 0x10, 0x55f: 0x11, + 0x56f: 0x12, +} + +// nfcSparseOffset: 149 entries, 298 bytes +var nfcSparseOffset = []uint16{0x0, 0x5, 0x9, 0xb, 0xd, 0x18, 0x28, 0x2a, 0x2f, 0x3a, 0x49, 0x56, 0x5e, 0x63, 0x68, 0x6a, 0x72, 0x79, 0x7c, 0x84, 0x88, 0x8c, 0x8e, 0x90, 0x99, 0x9d, 0xa4, 0xa9, 0xac, 0xb6, 0xb9, 0xc0, 0xc8, 0xcb, 0xcd, 0xcf, 0xd1, 0xd6, 0xe7, 0xf3, 0xf5, 0xfb, 0xfd, 0xff, 0x101, 0x103, 0x105, 0x107, 0x10a, 0x10d, 0x10f, 0x112, 0x115, 0x119, 0x11e, 0x127, 0x129, 0x12c, 0x12e, 0x139, 0x13d, 0x14b, 0x14e, 0x154, 0x15a, 0x165, 0x169, 0x16b, 0x16d, 0x16f, 0x171, 0x173, 0x179, 0x17d, 0x17f, 0x181, 0x189, 0x18d, 0x190, 0x192, 0x194, 0x196, 0x199, 0x19b, 0x19d, 0x19f, 0x1a1, 0x1a7, 0x1aa, 0x1ac, 0x1b3, 0x1b9, 0x1bf, 0x1c7, 0x1cd, 0x1d3, 0x1d9, 0x1dd, 0x1eb, 0x1f4, 0x1f7, 0x1fa, 0x1fc, 0x1ff, 0x201, 0x205, 0x20a, 0x20c, 0x20e, 0x213, 0x219, 0x21b, 0x21d, 0x21f, 0x225, 0x228, 0x22a, 0x230, 0x233, 0x23b, 0x242, 0x245, 0x248, 0x24a, 0x24d, 0x255, 0x259, 0x260, 0x263, 0x269, 0x26b, 0x26e, 0x270, 0x273, 0x275, 0x277, 0x279, 0x27c, 0x27e, 0x280, 0x282, 0x284, 0x291, 0x29b, 0x29d, 0x29f, 0x2a5, 0x2a7, 0x2aa} + +// nfcSparseValues: 684 entries, 2736 bytes +var nfcSparseValues = [684]valueRange{ + // Block 0x0, offset 0x0 + {value: 0x0000, lo: 0x04}, + {value: 0xa100, lo: 0xa8, hi: 0xa8}, + {value: 0x8100, lo: 0xaf, hi: 0xaf}, + {value: 0x8100, lo: 0xb4, hi: 0xb4}, + {value: 0x8100, lo: 0xb8, hi: 0xb8}, + // Block 0x1, offset 0x5 + {value: 0x0091, lo: 0x03}, + {value: 0x46e2, lo: 0xa0, hi: 0xa1}, + {value: 0x4714, lo: 0xaf, hi: 0xb0}, + {value: 0xa000, lo: 0xb7, hi: 0xb7}, + // Block 0x2, offset 0x9 + {value: 0x0000, lo: 0x01}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + // Block 0x3, offset 0xb + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0x98, hi: 0x9d}, + // Block 0x4, offset 0xd + {value: 0x0006, lo: 0x0a}, + {value: 0xa000, lo: 0x81, hi: 0x81}, + {value: 0xa000, lo: 0x85, hi: 0x85}, + {value: 0xa000, lo: 0x89, hi: 0x89}, + {value: 0x4840, lo: 0x8a, hi: 0x8a}, + {value: 0x485e, lo: 0x8b, hi: 0x8b}, + {value: 0x36c7, lo: 0x8c, hi: 0x8c}, + {value: 0x36df, lo: 0x8d, hi: 0x8d}, + {value: 0x4876, lo: 0x8e, hi: 0x8e}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0x36fd, lo: 0x93, hi: 0x94}, + // Block 0x5, offset 0x18 + {value: 0x0000, lo: 0x0f}, + {value: 0xa000, lo: 0x83, hi: 0x83}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0xa000, lo: 0x8b, hi: 0x8b}, + {value: 0xa000, lo: 0x8d, hi: 0x8d}, + {value: 0x37a5, lo: 0x90, hi: 0x90}, + {value: 0x37b1, lo: 0x91, hi: 0x91}, + {value: 0x379f, lo: 0x93, hi: 0x93}, + {value: 0xa000, lo: 0x96, hi: 0x96}, + {value: 0x3817, lo: 0x97, hi: 0x97}, + {value: 0x37e1, lo: 0x9c, hi: 0x9c}, + {value: 0x37c9, lo: 0x9d, hi: 0x9d}, + {value: 0x37f3, lo: 0x9e, hi: 0x9e}, + {value: 0xa000, lo: 0xb4, hi: 0xb5}, + {value: 0x381d, lo: 0xb6, hi: 0xb6}, + {value: 0x3823, lo: 0xb7, hi: 0xb7}, + // Block 0x6, offset 0x28 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x83, hi: 0x87}, + // Block 0x7, offset 0x2a + {value: 0x0001, lo: 0x04}, + {value: 0x8113, lo: 0x81, hi: 0x82}, + {value: 0x8132, lo: 0x84, hi: 0x84}, + {value: 0x812d, lo: 0x85, hi: 0x85}, + {value: 0x810d, lo: 0x87, hi: 0x87}, + // Block 0x8, offset 0x2f + {value: 0x0000, lo: 0x0a}, + {value: 0x8132, lo: 0x90, hi: 0x97}, + {value: 0x8119, lo: 0x98, hi: 0x98}, + {value: 0x811a, lo: 0x99, hi: 0x99}, + {value: 0x811b, lo: 0x9a, hi: 0x9a}, + {value: 0x3841, lo: 0xa2, hi: 0xa2}, + {value: 0x3847, lo: 0xa3, hi: 0xa3}, + {value: 0x3853, lo: 0xa4, hi: 0xa4}, + {value: 0x384d, lo: 0xa5, hi: 0xa5}, + {value: 0x3859, lo: 0xa6, hi: 0xa6}, + {value: 0xa000, lo: 0xa7, hi: 0xa7}, + // Block 0x9, offset 0x3a + {value: 0x0000, lo: 0x0e}, + {value: 0x386b, lo: 0x80, hi: 0x80}, + {value: 0xa000, lo: 0x81, hi: 0x81}, + {value: 0x385f, lo: 0x82, hi: 0x82}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0x3865, lo: 0x93, hi: 0x93}, + {value: 0xa000, lo: 0x95, hi: 0x95}, + {value: 0x8132, lo: 0x96, hi: 0x9c}, + {value: 0x8132, lo: 0x9f, hi: 0xa2}, + {value: 0x812d, lo: 0xa3, hi: 0xa3}, + {value: 0x8132, lo: 0xa4, hi: 0xa4}, + {value: 0x8132, lo: 0xa7, hi: 0xa8}, + {value: 0x812d, lo: 0xaa, hi: 0xaa}, + {value: 0x8132, lo: 0xab, hi: 0xac}, + {value: 0x812d, lo: 0xad, hi: 0xad}, + // Block 0xa, offset 0x49 + {value: 0x0000, lo: 0x0c}, + {value: 0x811f, lo: 0x91, hi: 0x91}, + {value: 0x8132, lo: 0xb0, hi: 0xb0}, + {value: 0x812d, lo: 0xb1, hi: 0xb1}, + {value: 0x8132, lo: 0xb2, hi: 0xb3}, + {value: 0x812d, lo: 0xb4, hi: 0xb4}, + {value: 0x8132, lo: 0xb5, hi: 0xb6}, + {value: 0x812d, lo: 0xb7, hi: 0xb9}, + {value: 0x8132, lo: 0xba, hi: 0xba}, + {value: 0x812d, lo: 0xbb, hi: 0xbc}, + {value: 0x8132, lo: 0xbd, hi: 0xbd}, + {value: 0x812d, lo: 0xbe, hi: 0xbe}, + {value: 0x8132, lo: 0xbf, hi: 0xbf}, + // Block 0xb, offset 0x56 + {value: 0x0005, lo: 0x07}, + {value: 0x8132, lo: 0x80, hi: 0x80}, + {value: 0x8132, lo: 0x81, hi: 0x81}, + {value: 0x812d, lo: 0x82, hi: 0x83}, + {value: 0x812d, lo: 0x84, hi: 0x85}, + {value: 0x812d, lo: 0x86, hi: 0x87}, + {value: 0x812d, lo: 0x88, hi: 0x89}, + {value: 0x8132, lo: 0x8a, hi: 0x8a}, + // Block 0xc, offset 0x5e + {value: 0x0000, lo: 0x04}, + {value: 0x8132, lo: 0xab, hi: 0xb1}, + {value: 0x812d, lo: 0xb2, hi: 0xb2}, + {value: 0x8132, lo: 0xb3, hi: 0xb3}, + {value: 0x812d, lo: 0xbd, hi: 0xbd}, + // Block 0xd, offset 0x63 + {value: 0x0000, lo: 0x04}, + {value: 0x8132, lo: 0x96, hi: 0x99}, + {value: 0x8132, lo: 0x9b, hi: 0xa3}, + {value: 0x8132, lo: 0xa5, hi: 0xa7}, + {value: 0x8132, lo: 0xa9, hi: 0xad}, + // Block 0xe, offset 0x68 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x99, hi: 0x9b}, + // Block 0xf, offset 0x6a + {value: 0x0000, lo: 0x07}, + {value: 0xa000, lo: 0xa8, hi: 0xa8}, + {value: 0x3ed8, lo: 0xa9, hi: 0xa9}, + {value: 0xa000, lo: 0xb0, hi: 0xb0}, + {value: 0x3ee0, lo: 0xb1, hi: 0xb1}, + {value: 0xa000, lo: 0xb3, hi: 0xb3}, + {value: 0x3ee8, lo: 0xb4, hi: 0xb4}, + {value: 0x9902, lo: 0xbc, hi: 0xbc}, + // Block 0x10, offset 0x72 + {value: 0x0008, lo: 0x06}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x8132, lo: 0x91, hi: 0x91}, + {value: 0x812d, lo: 0x92, hi: 0x92}, + {value: 0x8132, lo: 0x93, hi: 0x93}, + {value: 0x8132, lo: 0x94, hi: 0x94}, + {value: 0x451c, lo: 0x98, hi: 0x9f}, + // Block 0x11, offset 0x79 + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x12, offset 0x7c + {value: 0x0008, lo: 0x07}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0x2c9e, lo: 0x8b, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + {value: 0x455c, lo: 0x9c, hi: 0x9d}, + {value: 0x456c, lo: 0x9f, hi: 0x9f}, + {value: 0x8132, lo: 0xbe, hi: 0xbe}, + // Block 0x13, offset 0x84 + {value: 0x0000, lo: 0x03}, + {value: 0x4594, lo: 0xb3, hi: 0xb3}, + {value: 0x459c, lo: 0xb6, hi: 0xb6}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + // Block 0x14, offset 0x88 + {value: 0x0008, lo: 0x03}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x4574, lo: 0x99, hi: 0x9b}, + {value: 0x458c, lo: 0x9e, hi: 0x9e}, + // Block 0x15, offset 0x8c + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + // Block 0x16, offset 0x8e + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + // Block 0x17, offset 0x90 + {value: 0x0000, lo: 0x08}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0x2cb6, lo: 0x88, hi: 0x88}, + {value: 0x2cae, lo: 0x8b, hi: 0x8b}, + {value: 0x2cbe, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x96, hi: 0x97}, + {value: 0x45a4, lo: 0x9c, hi: 0x9c}, + {value: 0x45ac, lo: 0x9d, hi: 0x9d}, + // Block 0x18, offset 0x99 + {value: 0x0000, lo: 0x03}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0x2cc6, lo: 0x94, hi: 0x94}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x19, offset 0x9d + {value: 0x0000, lo: 0x06}, + {value: 0xa000, lo: 0x86, hi: 0x87}, + {value: 0x2cce, lo: 0x8a, hi: 0x8a}, + {value: 0x2cde, lo: 0x8b, hi: 0x8b}, + {value: 0x2cd6, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + // Block 0x1a, offset 0xa4 + {value: 0x1801, lo: 0x04}, + {value: 0xa000, lo: 0x86, hi: 0x86}, + {value: 0x3ef0, lo: 0x88, hi: 0x88}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x8120, lo: 0x95, hi: 0x96}, + // Block 0x1b, offset 0xa9 + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + {value: 0xa000, lo: 0xbf, hi: 0xbf}, + // Block 0x1c, offset 0xac + {value: 0x0000, lo: 0x09}, + {value: 0x2ce6, lo: 0x80, hi: 0x80}, + {value: 0x9900, lo: 0x82, hi: 0x82}, + {value: 0xa000, lo: 0x86, hi: 0x86}, + {value: 0x2cee, lo: 0x87, hi: 0x87}, + {value: 0x2cf6, lo: 0x88, hi: 0x88}, + {value: 0x2f50, lo: 0x8a, hi: 0x8a}, + {value: 0x2dd8, lo: 0x8b, hi: 0x8b}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x95, hi: 0x96}, + // Block 0x1d, offset 0xb6 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0xbb, hi: 0xbc}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x1e, offset 0xb9 + {value: 0x0000, lo: 0x06}, + {value: 0xa000, lo: 0x86, hi: 0x87}, + {value: 0x2cfe, lo: 0x8a, hi: 0x8a}, + {value: 0x2d0e, lo: 0x8b, hi: 0x8b}, + {value: 0x2d06, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + // Block 0x1f, offset 0xc0 + {value: 0x6bea, lo: 0x07}, + {value: 0x9904, lo: 0x8a, hi: 0x8a}, + {value: 0x9900, lo: 0x8f, hi: 0x8f}, + {value: 0xa000, lo: 0x99, hi: 0x99}, + {value: 0x3ef8, lo: 0x9a, hi: 0x9a}, + {value: 0x2f58, lo: 0x9c, hi: 0x9c}, + {value: 0x2de3, lo: 0x9d, hi: 0x9d}, + {value: 0x2d16, lo: 0x9e, hi: 0x9f}, + // Block 0x20, offset 0xc8 + {value: 0x0000, lo: 0x02}, + {value: 0x8122, lo: 0xb8, hi: 0xb9}, + {value: 0x8104, lo: 0xba, hi: 0xba}, + // Block 0x21, offset 0xcb + {value: 0x0000, lo: 0x01}, + {value: 0x8123, lo: 0x88, hi: 0x8b}, + // Block 0x22, offset 0xcd + {value: 0x0000, lo: 0x01}, + {value: 0x8124, lo: 0xb8, hi: 0xb9}, + // Block 0x23, offset 0xcf + {value: 0x0000, lo: 0x01}, + {value: 0x8125, lo: 0x88, hi: 0x8b}, + // Block 0x24, offset 0xd1 + {value: 0x0000, lo: 0x04}, + {value: 0x812d, lo: 0x98, hi: 0x99}, + {value: 0x812d, lo: 0xb5, hi: 0xb5}, + {value: 0x812d, lo: 0xb7, hi: 0xb7}, + {value: 0x812b, lo: 0xb9, hi: 0xb9}, + // Block 0x25, offset 0xd6 + {value: 0x0000, lo: 0x10}, + {value: 0x2644, lo: 0x83, hi: 0x83}, + {value: 0x264b, lo: 0x8d, hi: 0x8d}, + {value: 0x2652, lo: 0x92, hi: 0x92}, + {value: 0x2659, lo: 0x97, hi: 0x97}, + {value: 0x2660, lo: 0x9c, hi: 0x9c}, + {value: 0x263d, lo: 0xa9, hi: 0xa9}, + {value: 0x8126, lo: 0xb1, hi: 0xb1}, + {value: 0x8127, lo: 0xb2, hi: 0xb2}, + {value: 0x4a84, lo: 0xb3, hi: 0xb3}, + {value: 0x8128, lo: 0xb4, hi: 0xb4}, + {value: 0x4a8d, lo: 0xb5, hi: 0xb5}, + {value: 0x45b4, lo: 0xb6, hi: 0xb6}, + {value: 0x8200, lo: 0xb7, hi: 0xb7}, + {value: 0x45bc, lo: 0xb8, hi: 0xb8}, + {value: 0x8200, lo: 0xb9, hi: 0xb9}, + {value: 0x8127, lo: 0xba, hi: 0xbd}, + // Block 0x26, offset 0xe7 + {value: 0x0000, lo: 0x0b}, + {value: 0x8127, lo: 0x80, hi: 0x80}, + {value: 0x4a96, lo: 0x81, hi: 0x81}, + {value: 0x8132, lo: 0x82, hi: 0x83}, + {value: 0x8104, lo: 0x84, hi: 0x84}, + {value: 0x8132, lo: 0x86, hi: 0x87}, + {value: 0x266e, lo: 0x93, hi: 0x93}, + {value: 0x2675, lo: 0x9d, hi: 0x9d}, + {value: 0x267c, lo: 0xa2, hi: 0xa2}, + {value: 0x2683, lo: 0xa7, hi: 0xa7}, + {value: 0x268a, lo: 0xac, hi: 0xac}, + {value: 0x2667, lo: 0xb9, hi: 0xb9}, + // Block 0x27, offset 0xf3 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x86, hi: 0x86}, + // Block 0x28, offset 0xf5 + {value: 0x0000, lo: 0x05}, + {value: 0xa000, lo: 0xa5, hi: 0xa5}, + {value: 0x2d1e, lo: 0xa6, hi: 0xa6}, + {value: 0x9900, lo: 0xae, hi: 0xae}, + {value: 0x8102, lo: 0xb7, hi: 0xb7}, + {value: 0x8104, lo: 0xb9, hi: 0xba}, + // Block 0x29, offset 0xfb + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x8d, hi: 0x8d}, + // Block 0x2a, offset 0xfd + {value: 0x0000, lo: 0x01}, + {value: 0xa000, lo: 0x80, hi: 0x92}, + // Block 0x2b, offset 0xff + {value: 0x0000, lo: 0x01}, + {value: 0xb900, lo: 0xa1, hi: 0xb5}, + // Block 0x2c, offset 0x101 + {value: 0x0000, lo: 0x01}, + {value: 0x9900, lo: 0xa8, hi: 0xbf}, + // Block 0x2d, offset 0x103 + {value: 0x0000, lo: 0x01}, + {value: 0x9900, lo: 0x80, hi: 0x82}, + // Block 0x2e, offset 0x105 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x9d, hi: 0x9f}, + // Block 0x2f, offset 0x107 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x94, hi: 0x94}, + {value: 0x8104, lo: 0xb4, hi: 0xb4}, + // Block 0x30, offset 0x10a + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x92, hi: 0x92}, + {value: 0x8132, lo: 0x9d, hi: 0x9d}, + // Block 0x31, offset 0x10d + {value: 0x0000, lo: 0x01}, + {value: 0x8131, lo: 0xa9, hi: 0xa9}, + // Block 0x32, offset 0x10f + {value: 0x0004, lo: 0x02}, + {value: 0x812e, lo: 0xb9, hi: 0xba}, + {value: 0x812d, lo: 0xbb, hi: 0xbb}, + // Block 0x33, offset 0x112 + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0x97, hi: 0x97}, + {value: 0x812d, lo: 0x98, hi: 0x98}, + // Block 0x34, offset 0x115 + {value: 0x0000, lo: 0x03}, + {value: 0x8104, lo: 0xa0, hi: 0xa0}, + {value: 0x8132, lo: 0xb5, hi: 0xbc}, + {value: 0x812d, lo: 0xbf, hi: 0xbf}, + // Block 0x35, offset 0x119 + {value: 0x0000, lo: 0x04}, + {value: 0x8132, lo: 0xb0, hi: 0xb4}, + {value: 0x812d, lo: 0xb5, hi: 0xba}, + {value: 0x8132, lo: 0xbb, hi: 0xbc}, + {value: 0x812d, lo: 0xbd, hi: 0xbd}, + // Block 0x36, offset 0x11e + {value: 0x0000, lo: 0x08}, + {value: 0x2d66, lo: 0x80, hi: 0x80}, + {value: 0x2d6e, lo: 0x81, hi: 0x81}, + {value: 0xa000, lo: 0x82, hi: 0x82}, + {value: 0x2d76, lo: 0x83, hi: 0x83}, + {value: 0x8104, lo: 0x84, hi: 0x84}, + {value: 0x8132, lo: 0xab, hi: 0xab}, + {value: 0x812d, lo: 0xac, hi: 0xac}, + {value: 0x8132, lo: 0xad, hi: 0xb3}, + // Block 0x37, offset 0x127 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xaa, hi: 0xab}, + // Block 0x38, offset 0x129 + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xa6, hi: 0xa6}, + {value: 0x8104, lo: 0xb2, hi: 0xb3}, + // Block 0x39, offset 0x12c + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0xb7, hi: 0xb7}, + // Block 0x3a, offset 0x12e + {value: 0x0000, lo: 0x0a}, + {value: 0x8132, lo: 0x90, hi: 0x92}, + {value: 0x8101, lo: 0x94, hi: 0x94}, + {value: 0x812d, lo: 0x95, hi: 0x99}, + {value: 0x8132, lo: 0x9a, hi: 0x9b}, + {value: 0x812d, lo: 0x9c, hi: 0x9f}, + {value: 0x8132, lo: 0xa0, hi: 0xa0}, + {value: 0x8101, lo: 0xa2, hi: 0xa8}, + {value: 0x812d, lo: 0xad, hi: 0xad}, + {value: 0x8132, lo: 0xb4, hi: 0xb4}, + {value: 0x8132, lo: 0xb8, hi: 0xb9}, + // Block 0x3b, offset 0x139 + {value: 0x0004, lo: 0x03}, + {value: 0x0433, lo: 0x80, hi: 0x81}, + {value: 0x8100, lo: 0x97, hi: 0x97}, + {value: 0x8100, lo: 0xbe, hi: 0xbe}, + // Block 0x3c, offset 0x13d + {value: 0x0000, lo: 0x0d}, + {value: 0x8132, lo: 0x90, hi: 0x91}, + {value: 0x8101, lo: 0x92, hi: 0x93}, + {value: 0x8132, lo: 0x94, hi: 0x97}, + {value: 0x8101, lo: 0x98, hi: 0x9a}, + {value: 0x8132, lo: 0x9b, hi: 0x9c}, + {value: 0x8132, lo: 0xa1, hi: 0xa1}, + {value: 0x8101, lo: 0xa5, hi: 0xa6}, + {value: 0x8132, lo: 0xa7, hi: 0xa7}, + {value: 0x812d, lo: 0xa8, hi: 0xa8}, + {value: 0x8132, lo: 0xa9, hi: 0xa9}, + {value: 0x8101, lo: 0xaa, hi: 0xab}, + {value: 0x812d, lo: 0xac, hi: 0xaf}, + {value: 0x8132, lo: 0xb0, hi: 0xb0}, + // Block 0x3d, offset 0x14b + {value: 0x427b, lo: 0x02}, + {value: 0x01b8, lo: 0xa6, hi: 0xa6}, + {value: 0x0057, lo: 0xaa, hi: 0xab}, + // Block 0x3e, offset 0x14e + {value: 0x0007, lo: 0x05}, + {value: 0xa000, lo: 0x90, hi: 0x90}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0xa000, lo: 0x94, hi: 0x94}, + {value: 0x3bb9, lo: 0x9a, hi: 0x9b}, + {value: 0x3bc7, lo: 0xae, hi: 0xae}, + // Block 0x3f, offset 0x154 + {value: 0x000e, lo: 0x05}, + {value: 0x3bce, lo: 0x8d, hi: 0x8e}, + {value: 0x3bd5, lo: 0x8f, hi: 0x8f}, + {value: 0xa000, lo: 0x90, hi: 0x90}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0xa000, lo: 0x94, hi: 0x94}, + // Block 0x40, offset 0x15a + {value: 0x6408, lo: 0x0a}, + {value: 0xa000, lo: 0x83, hi: 0x83}, + {value: 0x3be3, lo: 0x84, hi: 0x84}, + {value: 0xa000, lo: 0x88, hi: 0x88}, + {value: 0x3bea, lo: 0x89, hi: 0x89}, + {value: 0xa000, lo: 0x8b, hi: 0x8b}, + {value: 0x3bf1, lo: 0x8c, hi: 0x8c}, + {value: 0xa000, lo: 0xa3, hi: 0xa3}, + {value: 0x3bf8, lo: 0xa4, hi: 0xa5}, + {value: 0x3bff, lo: 0xa6, hi: 0xa6}, + {value: 0xa000, lo: 0xbc, hi: 0xbc}, + // Block 0x41, offset 0x165 + {value: 0x0007, lo: 0x03}, + {value: 0x3c68, lo: 0xa0, hi: 0xa1}, + {value: 0x3c92, lo: 0xa2, hi: 0xa3}, + {value: 0x3cbc, lo: 0xaa, hi: 0xad}, + // Block 0x42, offset 0x169 + {value: 0x0004, lo: 0x01}, + {value: 0x048b, lo: 0xa9, hi: 0xaa}, + // Block 0x43, offset 0x16b + {value: 0x0000, lo: 0x01}, + {value: 0x44dd, lo: 0x9c, hi: 0x9c}, + // Block 0x44, offset 0x16d + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xaf, hi: 0xb1}, + // Block 0x45, offset 0x16f + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x46, offset 0x171 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xa0, hi: 0xbf}, + // Block 0x47, offset 0x173 + {value: 0x0000, lo: 0x05}, + {value: 0x812c, lo: 0xaa, hi: 0xaa}, + {value: 0x8131, lo: 0xab, hi: 0xab}, + {value: 0x8133, lo: 0xac, hi: 0xac}, + {value: 0x812e, lo: 0xad, hi: 0xad}, + {value: 0x812f, lo: 0xae, hi: 0xaf}, + // Block 0x48, offset 0x179 + {value: 0x0000, lo: 0x03}, + {value: 0x4a9f, lo: 0xb3, hi: 0xb3}, + {value: 0x4a9f, lo: 0xb5, hi: 0xb6}, + {value: 0x4a9f, lo: 0xba, hi: 0xbf}, + // Block 0x49, offset 0x17d + {value: 0x0000, lo: 0x01}, + {value: 0x4a9f, lo: 0x8f, hi: 0xa3}, + // Block 0x4a, offset 0x17f + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0xae, hi: 0xbe}, + // Block 0x4b, offset 0x181 + {value: 0x0000, lo: 0x07}, + {value: 0x8100, lo: 0x84, hi: 0x84}, + {value: 0x8100, lo: 0x87, hi: 0x87}, + {value: 0x8100, lo: 0x90, hi: 0x90}, + {value: 0x8100, lo: 0x9e, hi: 0x9e}, + {value: 0x8100, lo: 0xa1, hi: 0xa1}, + {value: 0x8100, lo: 0xb2, hi: 0xb2}, + {value: 0x8100, lo: 0xbb, hi: 0xbb}, + // Block 0x4c, offset 0x189 + {value: 0x0000, lo: 0x03}, + {value: 0x8100, lo: 0x80, hi: 0x80}, + {value: 0x8100, lo: 0x8b, hi: 0x8b}, + {value: 0x8100, lo: 0x8e, hi: 0x8e}, + // Block 0x4d, offset 0x18d + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0xaf, hi: 0xaf}, + {value: 0x8132, lo: 0xb4, hi: 0xbd}, + // Block 0x4e, offset 0x190 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x9e, hi: 0x9f}, + // Block 0x4f, offset 0x192 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xb0, hi: 0xb1}, + // Block 0x50, offset 0x194 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x86, hi: 0x86}, + // Block 0x51, offset 0x196 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x84, hi: 0x84}, + {value: 0x8132, lo: 0xa0, hi: 0xb1}, + // Block 0x52, offset 0x199 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0xab, hi: 0xad}, + // Block 0x53, offset 0x19b + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x93, hi: 0x93}, + // Block 0x54, offset 0x19d + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0xb3, hi: 0xb3}, + // Block 0x55, offset 0x19f + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x80, hi: 0x80}, + // Block 0x56, offset 0x1a1 + {value: 0x0000, lo: 0x05}, + {value: 0x8132, lo: 0xb0, hi: 0xb0}, + {value: 0x8132, lo: 0xb2, hi: 0xb3}, + {value: 0x812d, lo: 0xb4, hi: 0xb4}, + {value: 0x8132, lo: 0xb7, hi: 0xb8}, + {value: 0x8132, lo: 0xbe, hi: 0xbf}, + // Block 0x57, offset 0x1a7 + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0x81, hi: 0x81}, + {value: 0x8104, lo: 0xb6, hi: 0xb6}, + // Block 0x58, offset 0x1aa + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xad, hi: 0xad}, + // Block 0x59, offset 0x1ac + {value: 0x0000, lo: 0x06}, + {value: 0xe500, lo: 0x80, hi: 0x80}, + {value: 0xc600, lo: 0x81, hi: 0x9b}, + {value: 0xe500, lo: 0x9c, hi: 0x9c}, + {value: 0xc600, lo: 0x9d, hi: 0xb7}, + {value: 0xe500, lo: 0xb8, hi: 0xb8}, + {value: 0xc600, lo: 0xb9, hi: 0xbf}, + // Block 0x5a, offset 0x1b3 + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x93}, + {value: 0xe500, lo: 0x94, hi: 0x94}, + {value: 0xc600, lo: 0x95, hi: 0xaf}, + {value: 0xe500, lo: 0xb0, hi: 0xb0}, + {value: 0xc600, lo: 0xb1, hi: 0xbf}, + // Block 0x5b, offset 0x1b9 + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x8b}, + {value: 0xe500, lo: 0x8c, hi: 0x8c}, + {value: 0xc600, lo: 0x8d, hi: 0xa7}, + {value: 0xe500, lo: 0xa8, hi: 0xa8}, + {value: 0xc600, lo: 0xa9, hi: 0xbf}, + // Block 0x5c, offset 0x1bf + {value: 0x0000, lo: 0x07}, + {value: 0xc600, lo: 0x80, hi: 0x83}, + {value: 0xe500, lo: 0x84, hi: 0x84}, + {value: 0xc600, lo: 0x85, hi: 0x9f}, + {value: 0xe500, lo: 0xa0, hi: 0xa0}, + {value: 0xc600, lo: 0xa1, hi: 0xbb}, + {value: 0xe500, lo: 0xbc, hi: 0xbc}, + {value: 0xc600, lo: 0xbd, hi: 0xbf}, + // Block 0x5d, offset 0x1c7 + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x97}, + {value: 0xe500, lo: 0x98, hi: 0x98}, + {value: 0xc600, lo: 0x99, hi: 0xb3}, + {value: 0xe500, lo: 0xb4, hi: 0xb4}, + {value: 0xc600, lo: 0xb5, hi: 0xbf}, + // Block 0x5e, offset 0x1cd + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x8f}, + {value: 0xe500, lo: 0x90, hi: 0x90}, + {value: 0xc600, lo: 0x91, hi: 0xab}, + {value: 0xe500, lo: 0xac, hi: 0xac}, + {value: 0xc600, lo: 0xad, hi: 0xbf}, + // Block 0x5f, offset 0x1d3 + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x87}, + {value: 0xe500, lo: 0x88, hi: 0x88}, + {value: 0xc600, lo: 0x89, hi: 0xa3}, + {value: 0xe500, lo: 0xa4, hi: 0xa4}, + {value: 0xc600, lo: 0xa5, hi: 0xbf}, + // Block 0x60, offset 0x1d9 + {value: 0x0000, lo: 0x03}, + {value: 0xc600, lo: 0x80, hi: 0x87}, + {value: 0xe500, lo: 0x88, hi: 0x88}, + {value: 0xc600, lo: 0x89, hi: 0xa3}, + // Block 0x61, offset 0x1dd + {value: 0x0006, lo: 0x0d}, + {value: 0x4390, lo: 0x9d, hi: 0x9d}, + {value: 0x8115, lo: 0x9e, hi: 0x9e}, + {value: 0x4402, lo: 0x9f, hi: 0x9f}, + {value: 0x43f0, lo: 0xaa, hi: 0xab}, + {value: 0x44f4, lo: 0xac, hi: 0xac}, + {value: 0x44fc, lo: 0xad, hi: 0xad}, + {value: 0x4348, lo: 0xae, hi: 0xb1}, + {value: 0x4366, lo: 0xb2, hi: 0xb4}, + {value: 0x437e, lo: 0xb5, hi: 0xb6}, + {value: 0x438a, lo: 0xb8, hi: 0xb8}, + {value: 0x4396, lo: 0xb9, hi: 0xbb}, + {value: 0x43ae, lo: 0xbc, hi: 0xbc}, + {value: 0x43b4, lo: 0xbe, hi: 0xbe}, + // Block 0x62, offset 0x1eb + {value: 0x0006, lo: 0x08}, + {value: 0x43ba, lo: 0x80, hi: 0x81}, + {value: 0x43c6, lo: 0x83, hi: 0x84}, + {value: 0x43d8, lo: 0x86, hi: 0x89}, + {value: 0x43fc, lo: 0x8a, hi: 0x8a}, + {value: 0x4378, lo: 0x8b, hi: 0x8b}, + {value: 0x4360, lo: 0x8c, hi: 0x8c}, + {value: 0x43a8, lo: 0x8d, hi: 0x8d}, + {value: 0x43d2, lo: 0x8e, hi: 0x8e}, + // Block 0x63, offset 0x1f4 + {value: 0x0000, lo: 0x02}, + {value: 0x8100, lo: 0xa4, hi: 0xa5}, + {value: 0x8100, lo: 0xb0, hi: 0xb1}, + // Block 0x64, offset 0x1f7 + {value: 0x0000, lo: 0x02}, + {value: 0x8100, lo: 0x9b, hi: 0x9d}, + {value: 0x8200, lo: 0x9e, hi: 0xa3}, + // Block 0x65, offset 0x1fa + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0x90, hi: 0x90}, + // Block 0x66, offset 0x1fc + {value: 0x0000, lo: 0x02}, + {value: 0x8100, lo: 0x99, hi: 0x99}, + {value: 0x8200, lo: 0xb2, hi: 0xb4}, + // Block 0x67, offset 0x1ff + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0xbc, hi: 0xbd}, + // Block 0x68, offset 0x201 + {value: 0x0000, lo: 0x03}, + {value: 0x8132, lo: 0xa0, hi: 0xa6}, + {value: 0x812d, lo: 0xa7, hi: 0xad}, + {value: 0x8132, lo: 0xae, hi: 0xaf}, + // Block 0x69, offset 0x205 + {value: 0x0000, lo: 0x04}, + {value: 0x8100, lo: 0x89, hi: 0x8c}, + {value: 0x8100, lo: 0xb0, hi: 0xb2}, + {value: 0x8100, lo: 0xb4, hi: 0xb4}, + {value: 0x8100, lo: 0xb6, hi: 0xbf}, + // Block 0x6a, offset 0x20a + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0x81, hi: 0x8c}, + // Block 0x6b, offset 0x20c + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0xb5, hi: 0xba}, + // Block 0x6c, offset 0x20e + {value: 0x0000, lo: 0x04}, + {value: 0x4a9f, lo: 0x9e, hi: 0x9f}, + {value: 0x4a9f, lo: 0xa3, hi: 0xa3}, + {value: 0x4a9f, lo: 0xa5, hi: 0xa6}, + {value: 0x4a9f, lo: 0xaa, hi: 0xaf}, + // Block 0x6d, offset 0x213 + {value: 0x0000, lo: 0x05}, + {value: 0x4a9f, lo: 0x82, hi: 0x87}, + {value: 0x4a9f, lo: 0x8a, hi: 0x8f}, + {value: 0x4a9f, lo: 0x92, hi: 0x97}, + {value: 0x4a9f, lo: 0x9a, hi: 0x9c}, + {value: 0x8100, lo: 0xa3, hi: 0xa3}, + // Block 0x6e, offset 0x219 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0xbd, hi: 0xbd}, + // Block 0x6f, offset 0x21b + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0xa0, hi: 0xa0}, + // Block 0x70, offset 0x21d + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xb6, hi: 0xba}, + // Block 0x71, offset 0x21f + {value: 0x002c, lo: 0x05}, + {value: 0x812d, lo: 0x8d, hi: 0x8d}, + {value: 0x8132, lo: 0x8f, hi: 0x8f}, + {value: 0x8132, lo: 0xb8, hi: 0xb8}, + {value: 0x8101, lo: 0xb9, hi: 0xba}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x72, offset 0x225 + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0xa5, hi: 0xa5}, + {value: 0x812d, lo: 0xa6, hi: 0xa6}, + // Block 0x73, offset 0x228 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xa4, hi: 0xa7}, + // Block 0x74, offset 0x22a + {value: 0x0000, lo: 0x05}, + {value: 0x812d, lo: 0x86, hi: 0x87}, + {value: 0x8132, lo: 0x88, hi: 0x8a}, + {value: 0x812d, lo: 0x8b, hi: 0x8b}, + {value: 0x8132, lo: 0x8c, hi: 0x8c}, + {value: 0x812d, lo: 0x8d, hi: 0x90}, + // Block 0x75, offset 0x230 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x86, hi: 0x86}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x76, offset 0x233 + {value: 0x17fe, lo: 0x07}, + {value: 0xa000, lo: 0x99, hi: 0x99}, + {value: 0x4238, lo: 0x9a, hi: 0x9a}, + {value: 0xa000, lo: 0x9b, hi: 0x9b}, + {value: 0x4242, lo: 0x9c, hi: 0x9c}, + {value: 0xa000, lo: 0xa5, hi: 0xa5}, + {value: 0x424c, lo: 0xab, hi: 0xab}, + {value: 0x8104, lo: 0xb9, hi: 0xba}, + // Block 0x77, offset 0x23b + {value: 0x0000, lo: 0x06}, + {value: 0x8132, lo: 0x80, hi: 0x82}, + {value: 0x9900, lo: 0xa7, hi: 0xa7}, + {value: 0x2d7e, lo: 0xae, hi: 0xae}, + {value: 0x2d88, lo: 0xaf, hi: 0xaf}, + {value: 0xa000, lo: 0xb1, hi: 0xb2}, + {value: 0x8104, lo: 0xb3, hi: 0xb4}, + // Block 0x78, offset 0x242 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x80, hi: 0x80}, + {value: 0x8102, lo: 0x8a, hi: 0x8a}, + // Block 0x79, offset 0x245 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0xb5, hi: 0xb5}, + {value: 0x8102, lo: 0xb6, hi: 0xb6}, + // Block 0x7a, offset 0x248 + {value: 0x0002, lo: 0x01}, + {value: 0x8102, lo: 0xa9, hi: 0xaa}, + // Block 0x7b, offset 0x24a + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xbb, hi: 0xbc}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x7c, offset 0x24d + {value: 0x0000, lo: 0x07}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0x2d92, lo: 0x8b, hi: 0x8b}, + {value: 0x2d9c, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + {value: 0x8132, lo: 0xa6, hi: 0xac}, + {value: 0x8132, lo: 0xb0, hi: 0xb4}, + // Block 0x7d, offset 0x255 + {value: 0x0000, lo: 0x03}, + {value: 0x8104, lo: 0x82, hi: 0x82}, + {value: 0x8102, lo: 0x86, hi: 0x86}, + {value: 0x8132, lo: 0x9e, hi: 0x9e}, + // Block 0x7e, offset 0x259 + {value: 0x6b5a, lo: 0x06}, + {value: 0x9900, lo: 0xb0, hi: 0xb0}, + {value: 0xa000, lo: 0xb9, hi: 0xb9}, + {value: 0x9900, lo: 0xba, hi: 0xba}, + {value: 0x2db0, lo: 0xbb, hi: 0xbb}, + {value: 0x2da6, lo: 0xbc, hi: 0xbd}, + {value: 0x2dba, lo: 0xbe, hi: 0xbe}, + // Block 0x7f, offset 0x260 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x82, hi: 0x82}, + {value: 0x8102, lo: 0x83, hi: 0x83}, + // Block 0x80, offset 0x263 + {value: 0x0000, lo: 0x05}, + {value: 0x9900, lo: 0xaf, hi: 0xaf}, + {value: 0xa000, lo: 0xb8, hi: 0xb9}, + {value: 0x2dc4, lo: 0xba, hi: 0xba}, + {value: 0x2dce, lo: 0xbb, hi: 0xbb}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x81, offset 0x269 + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0x80, hi: 0x80}, + // Block 0x82, offset 0x26b + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0xb6, hi: 0xb6}, + {value: 0x8102, lo: 0xb7, hi: 0xb7}, + // Block 0x83, offset 0x26e + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xab, hi: 0xab}, + // Block 0x84, offset 0x270 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0xb9, hi: 0xb9}, + {value: 0x8102, lo: 0xba, hi: 0xba}, + // Block 0x85, offset 0x273 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xb4, hi: 0xb4}, + // Block 0x86, offset 0x275 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x87, hi: 0x87}, + // Block 0x87, offset 0x277 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x99, hi: 0x99}, + // Block 0x88, offset 0x279 + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0x82, hi: 0x82}, + {value: 0x8104, lo: 0x84, hi: 0x85}, + // Block 0x89, offset 0x27c + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x97, hi: 0x97}, + // Block 0x8a, offset 0x27e + {value: 0x0000, lo: 0x01}, + {value: 0x8101, lo: 0xb0, hi: 0xb4}, + // Block 0x8b, offset 0x280 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xb0, hi: 0xb6}, + // Block 0x8c, offset 0x282 + {value: 0x0000, lo: 0x01}, + {value: 0x8101, lo: 0x9e, hi: 0x9e}, + // Block 0x8d, offset 0x284 + {value: 0x0000, lo: 0x0c}, + {value: 0x45cc, lo: 0x9e, hi: 0x9e}, + {value: 0x45d6, lo: 0x9f, hi: 0x9f}, + {value: 0x460a, lo: 0xa0, hi: 0xa0}, + {value: 0x4618, lo: 0xa1, hi: 0xa1}, + {value: 0x4626, lo: 0xa2, hi: 0xa2}, + {value: 0x4634, lo: 0xa3, hi: 0xa3}, + {value: 0x4642, lo: 0xa4, hi: 0xa4}, + {value: 0x812b, lo: 0xa5, hi: 0xa6}, + {value: 0x8101, lo: 0xa7, hi: 0xa9}, + {value: 0x8130, lo: 0xad, hi: 0xad}, + {value: 0x812b, lo: 0xae, hi: 0xb2}, + {value: 0x812d, lo: 0xbb, hi: 0xbf}, + // Block 0x8e, offset 0x291 + {value: 0x0000, lo: 0x09}, + {value: 0x812d, lo: 0x80, hi: 0x82}, + {value: 0x8132, lo: 0x85, hi: 0x89}, + {value: 0x812d, lo: 0x8a, hi: 0x8b}, + {value: 0x8132, lo: 0xaa, hi: 0xad}, + {value: 0x45e0, lo: 0xbb, hi: 0xbb}, + {value: 0x45ea, lo: 0xbc, hi: 0xbc}, + {value: 0x4650, lo: 0xbd, hi: 0xbd}, + {value: 0x466c, lo: 0xbe, hi: 0xbe}, + {value: 0x465e, lo: 0xbf, hi: 0xbf}, + // Block 0x8f, offset 0x29b + {value: 0x0000, lo: 0x01}, + {value: 0x467a, lo: 0x80, hi: 0x80}, + // Block 0x90, offset 0x29d + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x82, hi: 0x84}, + // Block 0x91, offset 0x29f + {value: 0x0000, lo: 0x05}, + {value: 0x8132, lo: 0x80, hi: 0x86}, + {value: 0x8132, lo: 0x88, hi: 0x98}, + {value: 0x8132, lo: 0x9b, hi: 0xa1}, + {value: 0x8132, lo: 0xa3, hi: 0xa4}, + {value: 0x8132, lo: 0xa6, hi: 0xaa}, + // Block 0x92, offset 0x2a5 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x90, hi: 0x96}, + // Block 0x93, offset 0x2a7 + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0x84, hi: 0x89}, + {value: 0x8102, lo: 0x8a, hi: 0x8a}, + // Block 0x94, offset 0x2aa + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0x93, hi: 0x93}, +} + +// lookup returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *nfkcTrie) lookup(s []byte) (v uint16, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return nfkcValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := nfkcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := nfkcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfkcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := nfkcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfkcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = nfkcIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *nfkcTrie) lookupUnsafe(s []byte) uint16 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return nfkcValues[c0] + } + i := nfkcIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = nfkcIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = nfkcIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// lookupString returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *nfkcTrie) lookupString(s string) (v uint16, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return nfkcValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := nfkcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := nfkcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfkcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := nfkcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfkcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = nfkcIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupStringUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *nfkcTrie) lookupStringUnsafe(s string) uint16 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return nfkcValues[c0] + } + i := nfkcIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = nfkcIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = nfkcIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// nfkcTrie. Total size: 17248 bytes (16.84 KiB). Checksum: 4fb368372b6b1b27. +type nfkcTrie struct{} + +func newNfkcTrie(i int) *nfkcTrie { + return &nfkcTrie{} +} + +// lookupValue determines the type of block n and looks up the value for b. +func (t *nfkcTrie) lookupValue(n uint32, b byte) uint16 { + switch { + case n < 92: + return uint16(nfkcValues[n<<6+uint32(b)]) + default: + n -= 92 + return uint16(nfkcSparse.lookup(n, b)) + } +} + +// nfkcValues: 94 blocks, 6016 entries, 12032 bytes +// The third block is the zero block. +var nfkcValues = [6016]uint16{ + // Block 0x0, offset 0x0 + 0x3c: 0xa000, 0x3d: 0xa000, 0x3e: 0xa000, + // Block 0x1, offset 0x40 + 0x41: 0xa000, 0x42: 0xa000, 0x43: 0xa000, 0x44: 0xa000, 0x45: 0xa000, + 0x46: 0xa000, 0x47: 0xa000, 0x48: 0xa000, 0x49: 0xa000, 0x4a: 0xa000, 0x4b: 0xa000, + 0x4c: 0xa000, 0x4d: 0xa000, 0x4e: 0xa000, 0x4f: 0xa000, 0x50: 0xa000, + 0x52: 0xa000, 0x53: 0xa000, 0x54: 0xa000, 0x55: 0xa000, 0x56: 0xa000, 0x57: 0xa000, + 0x58: 0xa000, 0x59: 0xa000, 0x5a: 0xa000, + 0x61: 0xa000, 0x62: 0xa000, 0x63: 0xa000, + 0x64: 0xa000, 0x65: 0xa000, 0x66: 0xa000, 0x67: 0xa000, 0x68: 0xa000, 0x69: 0xa000, + 0x6a: 0xa000, 0x6b: 0xa000, 0x6c: 0xa000, 0x6d: 0xa000, 0x6e: 0xa000, 0x6f: 0xa000, + 0x70: 0xa000, 0x72: 0xa000, 0x73: 0xa000, 0x74: 0xa000, 0x75: 0xa000, + 0x76: 0xa000, 0x77: 0xa000, 0x78: 0xa000, 0x79: 0xa000, 0x7a: 0xa000, + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc0: 0x2f6f, 0xc1: 0x2f74, 0xc2: 0x4688, 0xc3: 0x2f79, 0xc4: 0x4697, 0xc5: 0x469c, + 0xc6: 0xa000, 0xc7: 0x46a6, 0xc8: 0x2fe2, 0xc9: 0x2fe7, 0xca: 0x46ab, 0xcb: 0x2ffb, + 0xcc: 0x306e, 0xcd: 0x3073, 0xce: 0x3078, 0xcf: 0x46bf, 0xd1: 0x3104, + 0xd2: 0x3127, 0xd3: 0x312c, 0xd4: 0x46c9, 0xd5: 0x46ce, 0xd6: 0x46dd, + 0xd8: 0xa000, 0xd9: 0x31b3, 0xda: 0x31b8, 0xdb: 0x31bd, 0xdc: 0x470f, 0xdd: 0x3235, + 0xe0: 0x327b, 0xe1: 0x3280, 0xe2: 0x4719, 0xe3: 0x3285, + 0xe4: 0x4728, 0xe5: 0x472d, 0xe6: 0xa000, 0xe7: 0x4737, 0xe8: 0x32ee, 0xe9: 0x32f3, + 0xea: 0x473c, 0xeb: 0x3307, 0xec: 0x337f, 0xed: 0x3384, 0xee: 0x3389, 0xef: 0x4750, + 0xf1: 0x3415, 0xf2: 0x3438, 0xf3: 0x343d, 0xf4: 0x475a, 0xf5: 0x475f, + 0xf6: 0x476e, 0xf8: 0xa000, 0xf9: 0x34c9, 0xfa: 0x34ce, 0xfb: 0x34d3, + 0xfc: 0x47a0, 0xfd: 0x3550, 0xff: 0x3569, + // Block 0x4, offset 0x100 + 0x100: 0x2f7e, 0x101: 0x328a, 0x102: 0x468d, 0x103: 0x471e, 0x104: 0x2f9c, 0x105: 0x32a8, + 0x106: 0x2fb0, 0x107: 0x32bc, 0x108: 0x2fb5, 0x109: 0x32c1, 0x10a: 0x2fba, 0x10b: 0x32c6, + 0x10c: 0x2fbf, 0x10d: 0x32cb, 0x10e: 0x2fc9, 0x10f: 0x32d5, + 0x112: 0x46b0, 0x113: 0x4741, 0x114: 0x2ff1, 0x115: 0x32fd, 0x116: 0x2ff6, 0x117: 0x3302, + 0x118: 0x3014, 0x119: 0x3320, 0x11a: 0x3005, 0x11b: 0x3311, 0x11c: 0x302d, 0x11d: 0x3339, + 0x11e: 0x3037, 0x11f: 0x3343, 0x120: 0x303c, 0x121: 0x3348, 0x122: 0x3046, 0x123: 0x3352, + 0x124: 0x304b, 0x125: 0x3357, 0x128: 0x307d, 0x129: 0x338e, + 0x12a: 0x3082, 0x12b: 0x3393, 0x12c: 0x3087, 0x12d: 0x3398, 0x12e: 0x30aa, 0x12f: 0x33b6, + 0x130: 0x308c, 0x132: 0x195d, 0x133: 0x19e7, 0x134: 0x30b4, 0x135: 0x33c0, + 0x136: 0x30c8, 0x137: 0x33d9, 0x139: 0x30d2, 0x13a: 0x33e3, 0x13b: 0x30dc, + 0x13c: 0x33ed, 0x13d: 0x30d7, 0x13e: 0x33e8, 0x13f: 0x1bac, + // Block 0x5, offset 0x140 + 0x140: 0x1c34, 0x143: 0x30ff, 0x144: 0x3410, 0x145: 0x3118, + 0x146: 0x3429, 0x147: 0x310e, 0x148: 0x341f, 0x149: 0x1c5c, + 0x14c: 0x46d3, 0x14d: 0x4764, 0x14e: 0x3131, 0x14f: 0x3442, 0x150: 0x313b, 0x151: 0x344c, + 0x154: 0x3159, 0x155: 0x346a, 0x156: 0x3172, 0x157: 0x3483, + 0x158: 0x3163, 0x159: 0x3474, 0x15a: 0x46f6, 0x15b: 0x4787, 0x15c: 0x317c, 0x15d: 0x348d, + 0x15e: 0x318b, 0x15f: 0x349c, 0x160: 0x46fb, 0x161: 0x478c, 0x162: 0x31a4, 0x163: 0x34ba, + 0x164: 0x3195, 0x165: 0x34ab, 0x168: 0x4705, 0x169: 0x4796, + 0x16a: 0x470a, 0x16b: 0x479b, 0x16c: 0x31c2, 0x16d: 0x34d8, 0x16e: 0x31cc, 0x16f: 0x34e2, + 0x170: 0x31d1, 0x171: 0x34e7, 0x172: 0x31ef, 0x173: 0x3505, 0x174: 0x3212, 0x175: 0x3528, + 0x176: 0x323a, 0x177: 0x3555, 0x178: 0x324e, 0x179: 0x325d, 0x17a: 0x357d, 0x17b: 0x3267, + 0x17c: 0x3587, 0x17d: 0x326c, 0x17e: 0x358c, 0x17f: 0x00a7, + // Block 0x6, offset 0x180 + 0x184: 0x2dee, 0x185: 0x2df4, + 0x186: 0x2dfa, 0x187: 0x1972, 0x188: 0x1975, 0x189: 0x1a08, 0x18a: 0x1987, 0x18b: 0x198a, + 0x18c: 0x1a3e, 0x18d: 0x2f88, 0x18e: 0x3294, 0x18f: 0x3096, 0x190: 0x33a2, 0x191: 0x3140, + 0x192: 0x3451, 0x193: 0x31d6, 0x194: 0x34ec, 0x195: 0x39cf, 0x196: 0x3b5e, 0x197: 0x39c8, + 0x198: 0x3b57, 0x199: 0x39d6, 0x19a: 0x3b65, 0x19b: 0x39c1, 0x19c: 0x3b50, + 0x19e: 0x38b0, 0x19f: 0x3a3f, 0x1a0: 0x38a9, 0x1a1: 0x3a38, 0x1a2: 0x35b3, 0x1a3: 0x35c5, + 0x1a6: 0x3041, 0x1a7: 0x334d, 0x1a8: 0x30be, 0x1a9: 0x33cf, + 0x1aa: 0x46ec, 0x1ab: 0x477d, 0x1ac: 0x3990, 0x1ad: 0x3b1f, 0x1ae: 0x35d7, 0x1af: 0x35dd, + 0x1b0: 0x33c5, 0x1b1: 0x1942, 0x1b2: 0x1945, 0x1b3: 0x19cf, 0x1b4: 0x3028, 0x1b5: 0x3334, + 0x1b8: 0x30fa, 0x1b9: 0x340b, 0x1ba: 0x38b7, 0x1bb: 0x3a46, + 0x1bc: 0x35ad, 0x1bd: 0x35bf, 0x1be: 0x35b9, 0x1bf: 0x35cb, + // Block 0x7, offset 0x1c0 + 0x1c0: 0x2f8d, 0x1c1: 0x3299, 0x1c2: 0x2f92, 0x1c3: 0x329e, 0x1c4: 0x300a, 0x1c5: 0x3316, + 0x1c6: 0x300f, 0x1c7: 0x331b, 0x1c8: 0x309b, 0x1c9: 0x33a7, 0x1ca: 0x30a0, 0x1cb: 0x33ac, + 0x1cc: 0x3145, 0x1cd: 0x3456, 0x1ce: 0x314a, 0x1cf: 0x345b, 0x1d0: 0x3168, 0x1d1: 0x3479, + 0x1d2: 0x316d, 0x1d3: 0x347e, 0x1d4: 0x31db, 0x1d5: 0x34f1, 0x1d6: 0x31e0, 0x1d7: 0x34f6, + 0x1d8: 0x3186, 0x1d9: 0x3497, 0x1da: 0x319f, 0x1db: 0x34b5, + 0x1de: 0x305a, 0x1df: 0x3366, + 0x1e6: 0x4692, 0x1e7: 0x4723, 0x1e8: 0x46ba, 0x1e9: 0x474b, + 0x1ea: 0x395f, 0x1eb: 0x3aee, 0x1ec: 0x393c, 0x1ed: 0x3acb, 0x1ee: 0x46d8, 0x1ef: 0x4769, + 0x1f0: 0x3958, 0x1f1: 0x3ae7, 0x1f2: 0x3244, 0x1f3: 0x355f, + // Block 0x8, offset 0x200 + 0x200: 0x9932, 0x201: 0x9932, 0x202: 0x9932, 0x203: 0x9932, 0x204: 0x9932, 0x205: 0x8132, + 0x206: 0x9932, 0x207: 0x9932, 0x208: 0x9932, 0x209: 0x9932, 0x20a: 0x9932, 0x20b: 0x9932, + 0x20c: 0x9932, 0x20d: 0x8132, 0x20e: 0x8132, 0x20f: 0x9932, 0x210: 0x8132, 0x211: 0x9932, + 0x212: 0x8132, 0x213: 0x9932, 0x214: 0x9932, 0x215: 0x8133, 0x216: 0x812d, 0x217: 0x812d, + 0x218: 0x812d, 0x219: 0x812d, 0x21a: 0x8133, 0x21b: 0x992b, 0x21c: 0x812d, 0x21d: 0x812d, + 0x21e: 0x812d, 0x21f: 0x812d, 0x220: 0x812d, 0x221: 0x8129, 0x222: 0x8129, 0x223: 0x992d, + 0x224: 0x992d, 0x225: 0x992d, 0x226: 0x992d, 0x227: 0x9929, 0x228: 0x9929, 0x229: 0x812d, + 0x22a: 0x812d, 0x22b: 0x812d, 0x22c: 0x812d, 0x22d: 0x992d, 0x22e: 0x992d, 0x22f: 0x812d, + 0x230: 0x992d, 0x231: 0x992d, 0x232: 0x812d, 0x233: 0x812d, 0x234: 0x8101, 0x235: 0x8101, + 0x236: 0x8101, 0x237: 0x8101, 0x238: 0x9901, 0x239: 0x812d, 0x23a: 0x812d, 0x23b: 0x812d, + 0x23c: 0x812d, 0x23d: 0x8132, 0x23e: 0x8132, 0x23f: 0x8132, + // Block 0x9, offset 0x240 + 0x240: 0x49ae, 0x241: 0x49b3, 0x242: 0x9932, 0x243: 0x49b8, 0x244: 0x4a71, 0x245: 0x9936, + 0x246: 0x8132, 0x247: 0x812d, 0x248: 0x812d, 0x249: 0x812d, 0x24a: 0x8132, 0x24b: 0x8132, + 0x24c: 0x8132, 0x24d: 0x812d, 0x24e: 0x812d, 0x250: 0x8132, 0x251: 0x8132, + 0x252: 0x8132, 0x253: 0x812d, 0x254: 0x812d, 0x255: 0x812d, 0x256: 0x812d, 0x257: 0x8132, + 0x258: 0x8133, 0x259: 0x812d, 0x25a: 0x812d, 0x25b: 0x8132, 0x25c: 0x8134, 0x25d: 0x8135, + 0x25e: 0x8135, 0x25f: 0x8134, 0x260: 0x8135, 0x261: 0x8135, 0x262: 0x8134, 0x263: 0x8132, + 0x264: 0x8132, 0x265: 0x8132, 0x266: 0x8132, 0x267: 0x8132, 0x268: 0x8132, 0x269: 0x8132, + 0x26a: 0x8132, 0x26b: 0x8132, 0x26c: 0x8132, 0x26d: 0x8132, 0x26e: 0x8132, 0x26f: 0x8132, + 0x274: 0x0170, + 0x27a: 0x42a5, + 0x27e: 0x0037, + // Block 0xa, offset 0x280 + 0x284: 0x425a, 0x285: 0x447b, + 0x286: 0x35e9, 0x287: 0x00ce, 0x288: 0x3607, 0x289: 0x3613, 0x28a: 0x3625, + 0x28c: 0x3643, 0x28e: 0x3655, 0x28f: 0x3673, 0x290: 0x3e08, 0x291: 0xa000, + 0x295: 0xa000, 0x297: 0xa000, + 0x299: 0xa000, + 0x29f: 0xa000, 0x2a1: 0xa000, + 0x2a5: 0xa000, 0x2a9: 0xa000, + 0x2aa: 0x3637, 0x2ab: 0x3667, 0x2ac: 0x47fe, 0x2ad: 0x3697, 0x2ae: 0x4828, 0x2af: 0x36a9, + 0x2b0: 0x3e70, 0x2b1: 0xa000, 0x2b5: 0xa000, + 0x2b7: 0xa000, 0x2b9: 0xa000, + 0x2bf: 0xa000, + // Block 0xb, offset 0x2c0 + 0x2c1: 0xa000, 0x2c5: 0xa000, + 0x2c9: 0xa000, 0x2ca: 0x4840, 0x2cb: 0x485e, + 0x2cc: 0x36c7, 0x2cd: 0x36df, 0x2ce: 0x4876, 0x2d0: 0x01be, 0x2d1: 0x01d0, + 0x2d2: 0x01ac, 0x2d3: 0x430c, 0x2d4: 0x4312, 0x2d5: 0x01fa, 0x2d6: 0x01e8, + 0x2f0: 0x01d6, 0x2f1: 0x01eb, 0x2f2: 0x01ee, 0x2f4: 0x0188, 0x2f5: 0x01c7, + 0x2f9: 0x01a6, + // Block 0xc, offset 0x300 + 0x300: 0x3721, 0x301: 0x372d, 0x303: 0x371b, + 0x306: 0xa000, 0x307: 0x3709, + 0x30c: 0x375d, 0x30d: 0x3745, 0x30e: 0x376f, 0x310: 0xa000, + 0x313: 0xa000, 0x315: 0xa000, 0x316: 0xa000, 0x317: 0xa000, + 0x318: 0xa000, 0x319: 0x3751, 0x31a: 0xa000, + 0x31e: 0xa000, 0x323: 0xa000, + 0x327: 0xa000, + 0x32b: 0xa000, 0x32d: 0xa000, + 0x330: 0xa000, 0x333: 0xa000, 0x335: 0xa000, + 0x336: 0xa000, 0x337: 0xa000, 0x338: 0xa000, 0x339: 0x37d5, 0x33a: 0xa000, + 0x33e: 0xa000, + // Block 0xd, offset 0x340 + 0x341: 0x3733, 0x342: 0x37b7, + 0x350: 0x370f, 0x351: 0x3793, + 0x352: 0x3715, 0x353: 0x3799, 0x356: 0x3727, 0x357: 0x37ab, + 0x358: 0xa000, 0x359: 0xa000, 0x35a: 0x3829, 0x35b: 0x382f, 0x35c: 0x3739, 0x35d: 0x37bd, + 0x35e: 0x373f, 0x35f: 0x37c3, 0x362: 0x374b, 0x363: 0x37cf, + 0x364: 0x3757, 0x365: 0x37db, 0x366: 0x3763, 0x367: 0x37e7, 0x368: 0xa000, 0x369: 0xa000, + 0x36a: 0x3835, 0x36b: 0x383b, 0x36c: 0x378d, 0x36d: 0x3811, 0x36e: 0x3769, 0x36f: 0x37ed, + 0x370: 0x3775, 0x371: 0x37f9, 0x372: 0x377b, 0x373: 0x37ff, 0x374: 0x3781, 0x375: 0x3805, + 0x378: 0x3787, 0x379: 0x380b, + // Block 0xe, offset 0x380 + 0x387: 0x1d61, + 0x391: 0x812d, + 0x392: 0x8132, 0x393: 0x8132, 0x394: 0x8132, 0x395: 0x8132, 0x396: 0x812d, 0x397: 0x8132, + 0x398: 0x8132, 0x399: 0x8132, 0x39a: 0x812e, 0x39b: 0x812d, 0x39c: 0x8132, 0x39d: 0x8132, + 0x39e: 0x8132, 0x39f: 0x8132, 0x3a0: 0x8132, 0x3a1: 0x8132, 0x3a2: 0x812d, 0x3a3: 0x812d, + 0x3a4: 0x812d, 0x3a5: 0x812d, 0x3a6: 0x812d, 0x3a7: 0x812d, 0x3a8: 0x8132, 0x3a9: 0x8132, + 0x3aa: 0x812d, 0x3ab: 0x8132, 0x3ac: 0x8132, 0x3ad: 0x812e, 0x3ae: 0x8131, 0x3af: 0x8132, + 0x3b0: 0x8105, 0x3b1: 0x8106, 0x3b2: 0x8107, 0x3b3: 0x8108, 0x3b4: 0x8109, 0x3b5: 0x810a, + 0x3b6: 0x810b, 0x3b7: 0x810c, 0x3b8: 0x810d, 0x3b9: 0x810e, 0x3ba: 0x810e, 0x3bb: 0x810f, + 0x3bc: 0x8110, 0x3bd: 0x8111, 0x3bf: 0x8112, + // Block 0xf, offset 0x3c0 + 0x3c8: 0xa000, 0x3ca: 0xa000, 0x3cb: 0x8116, + 0x3cc: 0x8117, 0x3cd: 0x8118, 0x3ce: 0x8119, 0x3cf: 0x811a, 0x3d0: 0x811b, 0x3d1: 0x811c, + 0x3d2: 0x811d, 0x3d3: 0x9932, 0x3d4: 0x9932, 0x3d5: 0x992d, 0x3d6: 0x812d, 0x3d7: 0x8132, + 0x3d8: 0x8132, 0x3d9: 0x8132, 0x3da: 0x8132, 0x3db: 0x8132, 0x3dc: 0x812d, 0x3dd: 0x8132, + 0x3de: 0x8132, 0x3df: 0x812d, + 0x3f0: 0x811e, 0x3f5: 0x1d84, + 0x3f6: 0x2013, 0x3f7: 0x204f, 0x3f8: 0x204a, + // Block 0x10, offset 0x400 + 0x413: 0x812d, 0x414: 0x8132, 0x415: 0x8132, 0x416: 0x8132, 0x417: 0x8132, + 0x418: 0x8132, 0x419: 0x8132, 0x41a: 0x8132, 0x41b: 0x8132, 0x41c: 0x8132, 0x41d: 0x8132, + 0x41e: 0x8132, 0x41f: 0x8132, 0x420: 0x8132, 0x421: 0x8132, 0x423: 0x812d, + 0x424: 0x8132, 0x425: 0x8132, 0x426: 0x812d, 0x427: 0x8132, 0x428: 0x8132, 0x429: 0x812d, + 0x42a: 0x8132, 0x42b: 0x8132, 0x42c: 0x8132, 0x42d: 0x812d, 0x42e: 0x812d, 0x42f: 0x812d, + 0x430: 0x8116, 0x431: 0x8117, 0x432: 0x8118, 0x433: 0x8132, 0x434: 0x8132, 0x435: 0x8132, + 0x436: 0x812d, 0x437: 0x8132, 0x438: 0x8132, 0x439: 0x812d, 0x43a: 0x812d, 0x43b: 0x8132, + 0x43c: 0x8132, 0x43d: 0x8132, 0x43e: 0x8132, 0x43f: 0x8132, + // Block 0x11, offset 0x440 + 0x445: 0xa000, + 0x446: 0x2d26, 0x447: 0xa000, 0x448: 0x2d2e, 0x449: 0xa000, 0x44a: 0x2d36, 0x44b: 0xa000, + 0x44c: 0x2d3e, 0x44d: 0xa000, 0x44e: 0x2d46, 0x451: 0xa000, + 0x452: 0x2d4e, + 0x474: 0x8102, 0x475: 0x9900, + 0x47a: 0xa000, 0x47b: 0x2d56, + 0x47c: 0xa000, 0x47d: 0x2d5e, 0x47e: 0xa000, 0x47f: 0xa000, + // Block 0x12, offset 0x480 + 0x480: 0x0069, 0x481: 0x006b, 0x482: 0x006f, 0x483: 0x0083, 0x484: 0x00f5, 0x485: 0x00f8, + 0x486: 0x0413, 0x487: 0x0085, 0x488: 0x0089, 0x489: 0x008b, 0x48a: 0x0104, 0x48b: 0x0107, + 0x48c: 0x010a, 0x48d: 0x008f, 0x48f: 0x0097, 0x490: 0x009b, 0x491: 0x00e0, + 0x492: 0x009f, 0x493: 0x00fe, 0x494: 0x0417, 0x495: 0x041b, 0x496: 0x00a1, 0x497: 0x00a9, + 0x498: 0x00ab, 0x499: 0x0423, 0x49a: 0x012b, 0x49b: 0x00ad, 0x49c: 0x0427, 0x49d: 0x01be, + 0x49e: 0x01c1, 0x49f: 0x01c4, 0x4a0: 0x01fa, 0x4a1: 0x01fd, 0x4a2: 0x0093, 0x4a3: 0x00a5, + 0x4a4: 0x00ab, 0x4a5: 0x00ad, 0x4a6: 0x01be, 0x4a7: 0x01c1, 0x4a8: 0x01eb, 0x4a9: 0x01fa, + 0x4aa: 0x01fd, + 0x4b8: 0x020c, + // Block 0x13, offset 0x4c0 + 0x4db: 0x00fb, 0x4dc: 0x0087, 0x4dd: 0x0101, + 0x4de: 0x00d4, 0x4df: 0x010a, 0x4e0: 0x008d, 0x4e1: 0x010d, 0x4e2: 0x0110, 0x4e3: 0x0116, + 0x4e4: 0x011c, 0x4e5: 0x011f, 0x4e6: 0x0122, 0x4e7: 0x042b, 0x4e8: 0x016a, 0x4e9: 0x0128, + 0x4ea: 0x042f, 0x4eb: 0x016d, 0x4ec: 0x0131, 0x4ed: 0x012e, 0x4ee: 0x0134, 0x4ef: 0x0137, + 0x4f0: 0x013a, 0x4f1: 0x013d, 0x4f2: 0x0140, 0x4f3: 0x014c, 0x4f4: 0x014f, 0x4f5: 0x00ec, + 0x4f6: 0x0152, 0x4f7: 0x0155, 0x4f8: 0x041f, 0x4f9: 0x0158, 0x4fa: 0x015b, 0x4fb: 0x00b5, + 0x4fc: 0x015e, 0x4fd: 0x0161, 0x4fe: 0x0164, 0x4ff: 0x01d0, + // Block 0x14, offset 0x500 + 0x500: 0x8132, 0x501: 0x8132, 0x502: 0x812d, 0x503: 0x8132, 0x504: 0x8132, 0x505: 0x8132, + 0x506: 0x8132, 0x507: 0x8132, 0x508: 0x8132, 0x509: 0x8132, 0x50a: 0x812d, 0x50b: 0x8132, + 0x50c: 0x8132, 0x50d: 0x8135, 0x50e: 0x812a, 0x50f: 0x812d, 0x510: 0x8129, 0x511: 0x8132, + 0x512: 0x8132, 0x513: 0x8132, 0x514: 0x8132, 0x515: 0x8132, 0x516: 0x8132, 0x517: 0x8132, + 0x518: 0x8132, 0x519: 0x8132, 0x51a: 0x8132, 0x51b: 0x8132, 0x51c: 0x8132, 0x51d: 0x8132, + 0x51e: 0x8132, 0x51f: 0x8132, 0x520: 0x8132, 0x521: 0x8132, 0x522: 0x8132, 0x523: 0x8132, + 0x524: 0x8132, 0x525: 0x8132, 0x526: 0x8132, 0x527: 0x8132, 0x528: 0x8132, 0x529: 0x8132, + 0x52a: 0x8132, 0x52b: 0x8132, 0x52c: 0x8132, 0x52d: 0x8132, 0x52e: 0x8132, 0x52f: 0x8132, + 0x530: 0x8132, 0x531: 0x8132, 0x532: 0x8132, 0x533: 0x8132, 0x534: 0x8132, 0x535: 0x8132, + 0x536: 0x8133, 0x537: 0x8131, 0x538: 0x8131, 0x539: 0x812d, 0x53b: 0x8132, + 0x53c: 0x8134, 0x53d: 0x812d, 0x53e: 0x8132, 0x53f: 0x812d, + // Block 0x15, offset 0x540 + 0x540: 0x2f97, 0x541: 0x32a3, 0x542: 0x2fa1, 0x543: 0x32ad, 0x544: 0x2fa6, 0x545: 0x32b2, + 0x546: 0x2fab, 0x547: 0x32b7, 0x548: 0x38cc, 0x549: 0x3a5b, 0x54a: 0x2fc4, 0x54b: 0x32d0, + 0x54c: 0x2fce, 0x54d: 0x32da, 0x54e: 0x2fdd, 0x54f: 0x32e9, 0x550: 0x2fd3, 0x551: 0x32df, + 0x552: 0x2fd8, 0x553: 0x32e4, 0x554: 0x38ef, 0x555: 0x3a7e, 0x556: 0x38f6, 0x557: 0x3a85, + 0x558: 0x3019, 0x559: 0x3325, 0x55a: 0x301e, 0x55b: 0x332a, 0x55c: 0x3904, 0x55d: 0x3a93, + 0x55e: 0x3023, 0x55f: 0x332f, 0x560: 0x3032, 0x561: 0x333e, 0x562: 0x3050, 0x563: 0x335c, + 0x564: 0x305f, 0x565: 0x336b, 0x566: 0x3055, 0x567: 0x3361, 0x568: 0x3064, 0x569: 0x3370, + 0x56a: 0x3069, 0x56b: 0x3375, 0x56c: 0x30af, 0x56d: 0x33bb, 0x56e: 0x390b, 0x56f: 0x3a9a, + 0x570: 0x30b9, 0x571: 0x33ca, 0x572: 0x30c3, 0x573: 0x33d4, 0x574: 0x30cd, 0x575: 0x33de, + 0x576: 0x46c4, 0x577: 0x4755, 0x578: 0x3912, 0x579: 0x3aa1, 0x57a: 0x30e6, 0x57b: 0x33f7, + 0x57c: 0x30e1, 0x57d: 0x33f2, 0x57e: 0x30eb, 0x57f: 0x33fc, + // Block 0x16, offset 0x580 + 0x580: 0x30f0, 0x581: 0x3401, 0x582: 0x30f5, 0x583: 0x3406, 0x584: 0x3109, 0x585: 0x341a, + 0x586: 0x3113, 0x587: 0x3424, 0x588: 0x3122, 0x589: 0x3433, 0x58a: 0x311d, 0x58b: 0x342e, + 0x58c: 0x3935, 0x58d: 0x3ac4, 0x58e: 0x3943, 0x58f: 0x3ad2, 0x590: 0x394a, 0x591: 0x3ad9, + 0x592: 0x3951, 0x593: 0x3ae0, 0x594: 0x314f, 0x595: 0x3460, 0x596: 0x3154, 0x597: 0x3465, + 0x598: 0x315e, 0x599: 0x346f, 0x59a: 0x46f1, 0x59b: 0x4782, 0x59c: 0x3997, 0x59d: 0x3b26, + 0x59e: 0x3177, 0x59f: 0x3488, 0x5a0: 0x3181, 0x5a1: 0x3492, 0x5a2: 0x4700, 0x5a3: 0x4791, + 0x5a4: 0x399e, 0x5a5: 0x3b2d, 0x5a6: 0x39a5, 0x5a7: 0x3b34, 0x5a8: 0x39ac, 0x5a9: 0x3b3b, + 0x5aa: 0x3190, 0x5ab: 0x34a1, 0x5ac: 0x319a, 0x5ad: 0x34b0, 0x5ae: 0x31ae, 0x5af: 0x34c4, + 0x5b0: 0x31a9, 0x5b1: 0x34bf, 0x5b2: 0x31ea, 0x5b3: 0x3500, 0x5b4: 0x31f9, 0x5b5: 0x350f, + 0x5b6: 0x31f4, 0x5b7: 0x350a, 0x5b8: 0x39b3, 0x5b9: 0x3b42, 0x5ba: 0x39ba, 0x5bb: 0x3b49, + 0x5bc: 0x31fe, 0x5bd: 0x3514, 0x5be: 0x3203, 0x5bf: 0x3519, + // Block 0x17, offset 0x5c0 + 0x5c0: 0x3208, 0x5c1: 0x351e, 0x5c2: 0x320d, 0x5c3: 0x3523, 0x5c4: 0x321c, 0x5c5: 0x3532, + 0x5c6: 0x3217, 0x5c7: 0x352d, 0x5c8: 0x3221, 0x5c9: 0x353c, 0x5ca: 0x3226, 0x5cb: 0x3541, + 0x5cc: 0x322b, 0x5cd: 0x3546, 0x5ce: 0x3249, 0x5cf: 0x3564, 0x5d0: 0x3262, 0x5d1: 0x3582, + 0x5d2: 0x3271, 0x5d3: 0x3591, 0x5d4: 0x3276, 0x5d5: 0x3596, 0x5d6: 0x337a, 0x5d7: 0x34a6, + 0x5d8: 0x3537, 0x5d9: 0x3573, 0x5da: 0x1be0, 0x5db: 0x42d7, + 0x5e0: 0x46a1, 0x5e1: 0x4732, 0x5e2: 0x2f83, 0x5e3: 0x328f, + 0x5e4: 0x3878, 0x5e5: 0x3a07, 0x5e6: 0x3871, 0x5e7: 0x3a00, 0x5e8: 0x3886, 0x5e9: 0x3a15, + 0x5ea: 0x387f, 0x5eb: 0x3a0e, 0x5ec: 0x38be, 0x5ed: 0x3a4d, 0x5ee: 0x3894, 0x5ef: 0x3a23, + 0x5f0: 0x388d, 0x5f1: 0x3a1c, 0x5f2: 0x38a2, 0x5f3: 0x3a31, 0x5f4: 0x389b, 0x5f5: 0x3a2a, + 0x5f6: 0x38c5, 0x5f7: 0x3a54, 0x5f8: 0x46b5, 0x5f9: 0x4746, 0x5fa: 0x3000, 0x5fb: 0x330c, + 0x5fc: 0x2fec, 0x5fd: 0x32f8, 0x5fe: 0x38da, 0x5ff: 0x3a69, + // Block 0x18, offset 0x600 + 0x600: 0x38d3, 0x601: 0x3a62, 0x602: 0x38e8, 0x603: 0x3a77, 0x604: 0x38e1, 0x605: 0x3a70, + 0x606: 0x38fd, 0x607: 0x3a8c, 0x608: 0x3091, 0x609: 0x339d, 0x60a: 0x30a5, 0x60b: 0x33b1, + 0x60c: 0x46e7, 0x60d: 0x4778, 0x60e: 0x3136, 0x60f: 0x3447, 0x610: 0x3920, 0x611: 0x3aaf, + 0x612: 0x3919, 0x613: 0x3aa8, 0x614: 0x392e, 0x615: 0x3abd, 0x616: 0x3927, 0x617: 0x3ab6, + 0x618: 0x3989, 0x619: 0x3b18, 0x61a: 0x396d, 0x61b: 0x3afc, 0x61c: 0x3966, 0x61d: 0x3af5, + 0x61e: 0x397b, 0x61f: 0x3b0a, 0x620: 0x3974, 0x621: 0x3b03, 0x622: 0x3982, 0x623: 0x3b11, + 0x624: 0x31e5, 0x625: 0x34fb, 0x626: 0x31c7, 0x627: 0x34dd, 0x628: 0x39e4, 0x629: 0x3b73, + 0x62a: 0x39dd, 0x62b: 0x3b6c, 0x62c: 0x39f2, 0x62d: 0x3b81, 0x62e: 0x39eb, 0x62f: 0x3b7a, + 0x630: 0x39f9, 0x631: 0x3b88, 0x632: 0x3230, 0x633: 0x354b, 0x634: 0x3258, 0x635: 0x3578, + 0x636: 0x3253, 0x637: 0x356e, 0x638: 0x323f, 0x639: 0x355a, + // Block 0x19, offset 0x640 + 0x640: 0x4804, 0x641: 0x480a, 0x642: 0x491e, 0x643: 0x4936, 0x644: 0x4926, 0x645: 0x493e, + 0x646: 0x492e, 0x647: 0x4946, 0x648: 0x47aa, 0x649: 0x47b0, 0x64a: 0x488e, 0x64b: 0x48a6, + 0x64c: 0x4896, 0x64d: 0x48ae, 0x64e: 0x489e, 0x64f: 0x48b6, 0x650: 0x4816, 0x651: 0x481c, + 0x652: 0x3db8, 0x653: 0x3dc8, 0x654: 0x3dc0, 0x655: 0x3dd0, + 0x658: 0x47b6, 0x659: 0x47bc, 0x65a: 0x3ce8, 0x65b: 0x3cf8, 0x65c: 0x3cf0, 0x65d: 0x3d00, + 0x660: 0x482e, 0x661: 0x4834, 0x662: 0x494e, 0x663: 0x4966, + 0x664: 0x4956, 0x665: 0x496e, 0x666: 0x495e, 0x667: 0x4976, 0x668: 0x47c2, 0x669: 0x47c8, + 0x66a: 0x48be, 0x66b: 0x48d6, 0x66c: 0x48c6, 0x66d: 0x48de, 0x66e: 0x48ce, 0x66f: 0x48e6, + 0x670: 0x4846, 0x671: 0x484c, 0x672: 0x3e18, 0x673: 0x3e30, 0x674: 0x3e20, 0x675: 0x3e38, + 0x676: 0x3e28, 0x677: 0x3e40, 0x678: 0x47ce, 0x679: 0x47d4, 0x67a: 0x3d18, 0x67b: 0x3d30, + 0x67c: 0x3d20, 0x67d: 0x3d38, 0x67e: 0x3d28, 0x67f: 0x3d40, + // Block 0x1a, offset 0x680 + 0x680: 0x4852, 0x681: 0x4858, 0x682: 0x3e48, 0x683: 0x3e58, 0x684: 0x3e50, 0x685: 0x3e60, + 0x688: 0x47da, 0x689: 0x47e0, 0x68a: 0x3d48, 0x68b: 0x3d58, + 0x68c: 0x3d50, 0x68d: 0x3d60, 0x690: 0x4864, 0x691: 0x486a, + 0x692: 0x3e80, 0x693: 0x3e98, 0x694: 0x3e88, 0x695: 0x3ea0, 0x696: 0x3e90, 0x697: 0x3ea8, + 0x699: 0x47e6, 0x69b: 0x3d68, 0x69d: 0x3d70, + 0x69f: 0x3d78, 0x6a0: 0x487c, 0x6a1: 0x4882, 0x6a2: 0x497e, 0x6a3: 0x4996, + 0x6a4: 0x4986, 0x6a5: 0x499e, 0x6a6: 0x498e, 0x6a7: 0x49a6, 0x6a8: 0x47ec, 0x6a9: 0x47f2, + 0x6aa: 0x48ee, 0x6ab: 0x4906, 0x6ac: 0x48f6, 0x6ad: 0x490e, 0x6ae: 0x48fe, 0x6af: 0x4916, + 0x6b0: 0x47f8, 0x6b1: 0x431e, 0x6b2: 0x3691, 0x6b3: 0x4324, 0x6b4: 0x4822, 0x6b5: 0x432a, + 0x6b6: 0x36a3, 0x6b7: 0x4330, 0x6b8: 0x36c1, 0x6b9: 0x4336, 0x6ba: 0x36d9, 0x6bb: 0x433c, + 0x6bc: 0x4870, 0x6bd: 0x4342, + // Block 0x1b, offset 0x6c0 + 0x6c0: 0x3da0, 0x6c1: 0x3da8, 0x6c2: 0x4184, 0x6c3: 0x41a2, 0x6c4: 0x418e, 0x6c5: 0x41ac, + 0x6c6: 0x4198, 0x6c7: 0x41b6, 0x6c8: 0x3cd8, 0x6c9: 0x3ce0, 0x6ca: 0x40d0, 0x6cb: 0x40ee, + 0x6cc: 0x40da, 0x6cd: 0x40f8, 0x6ce: 0x40e4, 0x6cf: 0x4102, 0x6d0: 0x3de8, 0x6d1: 0x3df0, + 0x6d2: 0x41c0, 0x6d3: 0x41de, 0x6d4: 0x41ca, 0x6d5: 0x41e8, 0x6d6: 0x41d4, 0x6d7: 0x41f2, + 0x6d8: 0x3d08, 0x6d9: 0x3d10, 0x6da: 0x410c, 0x6db: 0x412a, 0x6dc: 0x4116, 0x6dd: 0x4134, + 0x6de: 0x4120, 0x6df: 0x413e, 0x6e0: 0x3ec0, 0x6e1: 0x3ec8, 0x6e2: 0x41fc, 0x6e3: 0x421a, + 0x6e4: 0x4206, 0x6e5: 0x4224, 0x6e6: 0x4210, 0x6e7: 0x422e, 0x6e8: 0x3d80, 0x6e9: 0x3d88, + 0x6ea: 0x4148, 0x6eb: 0x4166, 0x6ec: 0x4152, 0x6ed: 0x4170, 0x6ee: 0x415c, 0x6ef: 0x417a, + 0x6f0: 0x3685, 0x6f1: 0x367f, 0x6f2: 0x3d90, 0x6f3: 0x368b, 0x6f4: 0x3d98, + 0x6f6: 0x4810, 0x6f7: 0x3db0, 0x6f8: 0x35f5, 0x6f9: 0x35ef, 0x6fa: 0x35e3, 0x6fb: 0x42ee, + 0x6fc: 0x35fb, 0x6fd: 0x4287, 0x6fe: 0x01d3, 0x6ff: 0x4287, + // Block 0x1c, offset 0x700 + 0x700: 0x42a0, 0x701: 0x4482, 0x702: 0x3dd8, 0x703: 0x369d, 0x704: 0x3de0, + 0x706: 0x483a, 0x707: 0x3df8, 0x708: 0x3601, 0x709: 0x42f4, 0x70a: 0x360d, 0x70b: 0x42fa, + 0x70c: 0x3619, 0x70d: 0x4489, 0x70e: 0x4490, 0x70f: 0x4497, 0x710: 0x36b5, 0x711: 0x36af, + 0x712: 0x3e00, 0x713: 0x44e4, 0x716: 0x36bb, 0x717: 0x3e10, + 0x718: 0x3631, 0x719: 0x362b, 0x71a: 0x361f, 0x71b: 0x4300, 0x71d: 0x449e, + 0x71e: 0x44a5, 0x71f: 0x44ac, 0x720: 0x36eb, 0x721: 0x36e5, 0x722: 0x3e68, 0x723: 0x44ec, + 0x724: 0x36cd, 0x725: 0x36d3, 0x726: 0x36f1, 0x727: 0x3e78, 0x728: 0x3661, 0x729: 0x365b, + 0x72a: 0x364f, 0x72b: 0x430c, 0x72c: 0x3649, 0x72d: 0x4474, 0x72e: 0x447b, 0x72f: 0x0081, + 0x732: 0x3eb0, 0x733: 0x36f7, 0x734: 0x3eb8, + 0x736: 0x4888, 0x737: 0x3ed0, 0x738: 0x363d, 0x739: 0x4306, 0x73a: 0x366d, 0x73b: 0x4318, + 0x73c: 0x3679, 0x73d: 0x425a, 0x73e: 0x428c, + // Block 0x1d, offset 0x740 + 0x740: 0x1bd8, 0x741: 0x1bdc, 0x742: 0x0047, 0x743: 0x1c54, 0x745: 0x1be8, + 0x746: 0x1bec, 0x747: 0x00e9, 0x749: 0x1c58, 0x74a: 0x008f, 0x74b: 0x0051, + 0x74c: 0x0051, 0x74d: 0x0051, 0x74e: 0x0091, 0x74f: 0x00da, 0x750: 0x0053, 0x751: 0x0053, + 0x752: 0x0059, 0x753: 0x0099, 0x755: 0x005d, 0x756: 0x198d, + 0x759: 0x0061, 0x75a: 0x0063, 0x75b: 0x0065, 0x75c: 0x0065, 0x75d: 0x0065, + 0x760: 0x199f, 0x761: 0x1bc8, 0x762: 0x19a8, + 0x764: 0x0075, 0x766: 0x01b8, 0x768: 0x0075, + 0x76a: 0x0057, 0x76b: 0x42d2, 0x76c: 0x0045, 0x76d: 0x0047, 0x76f: 0x008b, + 0x770: 0x004b, 0x771: 0x004d, 0x773: 0x005b, 0x774: 0x009f, 0x775: 0x0215, + 0x776: 0x0218, 0x777: 0x021b, 0x778: 0x021e, 0x779: 0x0093, 0x77b: 0x1b98, + 0x77c: 0x01e8, 0x77d: 0x01c1, 0x77e: 0x0179, 0x77f: 0x01a0, + // Block 0x1e, offset 0x780 + 0x780: 0x0463, 0x785: 0x0049, + 0x786: 0x0089, 0x787: 0x008b, 0x788: 0x0093, 0x789: 0x0095, + 0x790: 0x222e, 0x791: 0x223a, + 0x792: 0x22ee, 0x793: 0x2216, 0x794: 0x229a, 0x795: 0x2222, 0x796: 0x22a0, 0x797: 0x22b8, + 0x798: 0x22c4, 0x799: 0x2228, 0x79a: 0x22ca, 0x79b: 0x2234, 0x79c: 0x22be, 0x79d: 0x22d0, + 0x79e: 0x22d6, 0x79f: 0x1cbc, 0x7a0: 0x0053, 0x7a1: 0x195a, 0x7a2: 0x1ba4, 0x7a3: 0x1963, + 0x7a4: 0x006d, 0x7a5: 0x19ab, 0x7a6: 0x1bd0, 0x7a7: 0x1d48, 0x7a8: 0x1966, 0x7a9: 0x0071, + 0x7aa: 0x19b7, 0x7ab: 0x1bd4, 0x7ac: 0x0059, 0x7ad: 0x0047, 0x7ae: 0x0049, 0x7af: 0x005b, + 0x7b0: 0x0093, 0x7b1: 0x19e4, 0x7b2: 0x1c18, 0x7b3: 0x19ed, 0x7b4: 0x00ad, 0x7b5: 0x1a62, + 0x7b6: 0x1c4c, 0x7b7: 0x1d5c, 0x7b8: 0x19f0, 0x7b9: 0x00b1, 0x7ba: 0x1a65, 0x7bb: 0x1c50, + 0x7bc: 0x0099, 0x7bd: 0x0087, 0x7be: 0x0089, 0x7bf: 0x009b, + // Block 0x1f, offset 0x7c0 + 0x7c1: 0x3c06, 0x7c3: 0xa000, 0x7c4: 0x3c0d, 0x7c5: 0xa000, + 0x7c7: 0x3c14, 0x7c8: 0xa000, 0x7c9: 0x3c1b, + 0x7cd: 0xa000, + 0x7e0: 0x2f65, 0x7e1: 0xa000, 0x7e2: 0x3c29, + 0x7e4: 0xa000, 0x7e5: 0xa000, + 0x7ed: 0x3c22, 0x7ee: 0x2f60, 0x7ef: 0x2f6a, + 0x7f0: 0x3c30, 0x7f1: 0x3c37, 0x7f2: 0xa000, 0x7f3: 0xa000, 0x7f4: 0x3c3e, 0x7f5: 0x3c45, + 0x7f6: 0xa000, 0x7f7: 0xa000, 0x7f8: 0x3c4c, 0x7f9: 0x3c53, 0x7fa: 0xa000, 0x7fb: 0xa000, + 0x7fc: 0xa000, 0x7fd: 0xa000, + // Block 0x20, offset 0x800 + 0x800: 0x3c5a, 0x801: 0x3c61, 0x802: 0xa000, 0x803: 0xa000, 0x804: 0x3c76, 0x805: 0x3c7d, + 0x806: 0xa000, 0x807: 0xa000, 0x808: 0x3c84, 0x809: 0x3c8b, + 0x811: 0xa000, + 0x812: 0xa000, + 0x822: 0xa000, + 0x828: 0xa000, 0x829: 0xa000, + 0x82b: 0xa000, 0x82c: 0x3ca0, 0x82d: 0x3ca7, 0x82e: 0x3cae, 0x82f: 0x3cb5, + 0x832: 0xa000, 0x833: 0xa000, 0x834: 0xa000, 0x835: 0xa000, + // Block 0x21, offset 0x840 + 0x860: 0x0023, 0x861: 0x0025, 0x862: 0x0027, 0x863: 0x0029, + 0x864: 0x002b, 0x865: 0x002d, 0x866: 0x002f, 0x867: 0x0031, 0x868: 0x0033, 0x869: 0x1882, + 0x86a: 0x1885, 0x86b: 0x1888, 0x86c: 0x188b, 0x86d: 0x188e, 0x86e: 0x1891, 0x86f: 0x1894, + 0x870: 0x1897, 0x871: 0x189a, 0x872: 0x189d, 0x873: 0x18a6, 0x874: 0x1a68, 0x875: 0x1a6c, + 0x876: 0x1a70, 0x877: 0x1a74, 0x878: 0x1a78, 0x879: 0x1a7c, 0x87a: 0x1a80, 0x87b: 0x1a84, + 0x87c: 0x1a88, 0x87d: 0x1c80, 0x87e: 0x1c85, 0x87f: 0x1c8a, + // Block 0x22, offset 0x880 + 0x880: 0x1c8f, 0x881: 0x1c94, 0x882: 0x1c99, 0x883: 0x1c9e, 0x884: 0x1ca3, 0x885: 0x1ca8, + 0x886: 0x1cad, 0x887: 0x1cb2, 0x888: 0x187f, 0x889: 0x18a3, 0x88a: 0x18c7, 0x88b: 0x18eb, + 0x88c: 0x190f, 0x88d: 0x1918, 0x88e: 0x191e, 0x88f: 0x1924, 0x890: 0x192a, 0x891: 0x1b60, + 0x892: 0x1b64, 0x893: 0x1b68, 0x894: 0x1b6c, 0x895: 0x1b70, 0x896: 0x1b74, 0x897: 0x1b78, + 0x898: 0x1b7c, 0x899: 0x1b80, 0x89a: 0x1b84, 0x89b: 0x1b88, 0x89c: 0x1af4, 0x89d: 0x1af8, + 0x89e: 0x1afc, 0x89f: 0x1b00, 0x8a0: 0x1b04, 0x8a1: 0x1b08, 0x8a2: 0x1b0c, 0x8a3: 0x1b10, + 0x8a4: 0x1b14, 0x8a5: 0x1b18, 0x8a6: 0x1b1c, 0x8a7: 0x1b20, 0x8a8: 0x1b24, 0x8a9: 0x1b28, + 0x8aa: 0x1b2c, 0x8ab: 0x1b30, 0x8ac: 0x1b34, 0x8ad: 0x1b38, 0x8ae: 0x1b3c, 0x8af: 0x1b40, + 0x8b0: 0x1b44, 0x8b1: 0x1b48, 0x8b2: 0x1b4c, 0x8b3: 0x1b50, 0x8b4: 0x1b54, 0x8b5: 0x1b58, + 0x8b6: 0x0043, 0x8b7: 0x0045, 0x8b8: 0x0047, 0x8b9: 0x0049, 0x8ba: 0x004b, 0x8bb: 0x004d, + 0x8bc: 0x004f, 0x8bd: 0x0051, 0x8be: 0x0053, 0x8bf: 0x0055, + // Block 0x23, offset 0x8c0 + 0x8c0: 0x06bf, 0x8c1: 0x06e3, 0x8c2: 0x06ef, 0x8c3: 0x06ff, 0x8c4: 0x0707, 0x8c5: 0x0713, + 0x8c6: 0x071b, 0x8c7: 0x0723, 0x8c8: 0x072f, 0x8c9: 0x0783, 0x8ca: 0x079b, 0x8cb: 0x07ab, + 0x8cc: 0x07bb, 0x8cd: 0x07cb, 0x8ce: 0x07db, 0x8cf: 0x07fb, 0x8d0: 0x07ff, 0x8d1: 0x0803, + 0x8d2: 0x0837, 0x8d3: 0x085f, 0x8d4: 0x086f, 0x8d5: 0x0877, 0x8d6: 0x087b, 0x8d7: 0x0887, + 0x8d8: 0x08a3, 0x8d9: 0x08a7, 0x8da: 0x08bf, 0x8db: 0x08c3, 0x8dc: 0x08cb, 0x8dd: 0x08db, + 0x8de: 0x0977, 0x8df: 0x098b, 0x8e0: 0x09cb, 0x8e1: 0x09df, 0x8e2: 0x09e7, 0x8e3: 0x09eb, + 0x8e4: 0x09fb, 0x8e5: 0x0a17, 0x8e6: 0x0a43, 0x8e7: 0x0a4f, 0x8e8: 0x0a6f, 0x8e9: 0x0a7b, + 0x8ea: 0x0a7f, 0x8eb: 0x0a83, 0x8ec: 0x0a9b, 0x8ed: 0x0a9f, 0x8ee: 0x0acb, 0x8ef: 0x0ad7, + 0x8f0: 0x0adf, 0x8f1: 0x0ae7, 0x8f2: 0x0af7, 0x8f3: 0x0aff, 0x8f4: 0x0b07, 0x8f5: 0x0b33, + 0x8f6: 0x0b37, 0x8f7: 0x0b3f, 0x8f8: 0x0b43, 0x8f9: 0x0b4b, 0x8fa: 0x0b53, 0x8fb: 0x0b63, + 0x8fc: 0x0b7f, 0x8fd: 0x0bf7, 0x8fe: 0x0c0b, 0x8ff: 0x0c0f, + // Block 0x24, offset 0x900 + 0x900: 0x0c8f, 0x901: 0x0c93, 0x902: 0x0ca7, 0x903: 0x0cab, 0x904: 0x0cb3, 0x905: 0x0cbb, + 0x906: 0x0cc3, 0x907: 0x0ccf, 0x908: 0x0cf7, 0x909: 0x0d07, 0x90a: 0x0d1b, 0x90b: 0x0d8b, + 0x90c: 0x0d97, 0x90d: 0x0da7, 0x90e: 0x0db3, 0x90f: 0x0dbf, 0x910: 0x0dc7, 0x911: 0x0dcb, + 0x912: 0x0dcf, 0x913: 0x0dd3, 0x914: 0x0dd7, 0x915: 0x0e8f, 0x916: 0x0ed7, 0x917: 0x0ee3, + 0x918: 0x0ee7, 0x919: 0x0eeb, 0x91a: 0x0eef, 0x91b: 0x0ef7, 0x91c: 0x0efb, 0x91d: 0x0f0f, + 0x91e: 0x0f2b, 0x91f: 0x0f33, 0x920: 0x0f73, 0x921: 0x0f77, 0x922: 0x0f7f, 0x923: 0x0f83, + 0x924: 0x0f8b, 0x925: 0x0f8f, 0x926: 0x0fb3, 0x927: 0x0fb7, 0x928: 0x0fd3, 0x929: 0x0fd7, + 0x92a: 0x0fdb, 0x92b: 0x0fdf, 0x92c: 0x0ff3, 0x92d: 0x1017, 0x92e: 0x101b, 0x92f: 0x101f, + 0x930: 0x1043, 0x931: 0x1083, 0x932: 0x1087, 0x933: 0x10a7, 0x934: 0x10b7, 0x935: 0x10bf, + 0x936: 0x10df, 0x937: 0x1103, 0x938: 0x1147, 0x939: 0x114f, 0x93a: 0x1163, 0x93b: 0x116f, + 0x93c: 0x1177, 0x93d: 0x117f, 0x93e: 0x1183, 0x93f: 0x1187, + // Block 0x25, offset 0x940 + 0x940: 0x119f, 0x941: 0x11a3, 0x942: 0x11bf, 0x943: 0x11c7, 0x944: 0x11cf, 0x945: 0x11d3, + 0x946: 0x11df, 0x947: 0x11e7, 0x948: 0x11eb, 0x949: 0x11ef, 0x94a: 0x11f7, 0x94b: 0x11fb, + 0x94c: 0x129b, 0x94d: 0x12af, 0x94e: 0x12e3, 0x94f: 0x12e7, 0x950: 0x12ef, 0x951: 0x131b, + 0x952: 0x1323, 0x953: 0x132b, 0x954: 0x1333, 0x955: 0x136f, 0x956: 0x1373, 0x957: 0x137b, + 0x958: 0x137f, 0x959: 0x1383, 0x95a: 0x13af, 0x95b: 0x13b3, 0x95c: 0x13bb, 0x95d: 0x13cf, + 0x95e: 0x13d3, 0x95f: 0x13ef, 0x960: 0x13f7, 0x961: 0x13fb, 0x962: 0x141f, 0x963: 0x143f, + 0x964: 0x1453, 0x965: 0x1457, 0x966: 0x145f, 0x967: 0x148b, 0x968: 0x148f, 0x969: 0x149f, + 0x96a: 0x14c3, 0x96b: 0x14cf, 0x96c: 0x14df, 0x96d: 0x14f7, 0x96e: 0x14ff, 0x96f: 0x1503, + 0x970: 0x1507, 0x971: 0x150b, 0x972: 0x1517, 0x973: 0x151b, 0x974: 0x1523, 0x975: 0x153f, + 0x976: 0x1543, 0x977: 0x1547, 0x978: 0x155f, 0x979: 0x1563, 0x97a: 0x156b, 0x97b: 0x157f, + 0x97c: 0x1583, 0x97d: 0x1587, 0x97e: 0x158f, 0x97f: 0x1593, + // Block 0x26, offset 0x980 + 0x986: 0xa000, 0x98b: 0xa000, + 0x98c: 0x3f08, 0x98d: 0xa000, 0x98e: 0x3f10, 0x98f: 0xa000, 0x990: 0x3f18, 0x991: 0xa000, + 0x992: 0x3f20, 0x993: 0xa000, 0x994: 0x3f28, 0x995: 0xa000, 0x996: 0x3f30, 0x997: 0xa000, + 0x998: 0x3f38, 0x999: 0xa000, 0x99a: 0x3f40, 0x99b: 0xa000, 0x99c: 0x3f48, 0x99d: 0xa000, + 0x99e: 0x3f50, 0x99f: 0xa000, 0x9a0: 0x3f58, 0x9a1: 0xa000, 0x9a2: 0x3f60, + 0x9a4: 0xa000, 0x9a5: 0x3f68, 0x9a6: 0xa000, 0x9a7: 0x3f70, 0x9a8: 0xa000, 0x9a9: 0x3f78, + 0x9af: 0xa000, + 0x9b0: 0x3f80, 0x9b1: 0x3f88, 0x9b2: 0xa000, 0x9b3: 0x3f90, 0x9b4: 0x3f98, 0x9b5: 0xa000, + 0x9b6: 0x3fa0, 0x9b7: 0x3fa8, 0x9b8: 0xa000, 0x9b9: 0x3fb0, 0x9ba: 0x3fb8, 0x9bb: 0xa000, + 0x9bc: 0x3fc0, 0x9bd: 0x3fc8, + // Block 0x27, offset 0x9c0 + 0x9d4: 0x3f00, + 0x9d9: 0x9903, 0x9da: 0x9903, 0x9db: 0x42dc, 0x9dc: 0x42e2, 0x9dd: 0xa000, + 0x9de: 0x3fd0, 0x9df: 0x26b4, + 0x9e6: 0xa000, + 0x9eb: 0xa000, 0x9ec: 0x3fe0, 0x9ed: 0xa000, 0x9ee: 0x3fe8, 0x9ef: 0xa000, + 0x9f0: 0x3ff0, 0x9f1: 0xa000, 0x9f2: 0x3ff8, 0x9f3: 0xa000, 0x9f4: 0x4000, 0x9f5: 0xa000, + 0x9f6: 0x4008, 0x9f7: 0xa000, 0x9f8: 0x4010, 0x9f9: 0xa000, 0x9fa: 0x4018, 0x9fb: 0xa000, + 0x9fc: 0x4020, 0x9fd: 0xa000, 0x9fe: 0x4028, 0x9ff: 0xa000, + // Block 0x28, offset 0xa00 + 0xa00: 0x4030, 0xa01: 0xa000, 0xa02: 0x4038, 0xa04: 0xa000, 0xa05: 0x4040, + 0xa06: 0xa000, 0xa07: 0x4048, 0xa08: 0xa000, 0xa09: 0x4050, + 0xa0f: 0xa000, 0xa10: 0x4058, 0xa11: 0x4060, + 0xa12: 0xa000, 0xa13: 0x4068, 0xa14: 0x4070, 0xa15: 0xa000, 0xa16: 0x4078, 0xa17: 0x4080, + 0xa18: 0xa000, 0xa19: 0x4088, 0xa1a: 0x4090, 0xa1b: 0xa000, 0xa1c: 0x4098, 0xa1d: 0x40a0, + 0xa2f: 0xa000, + 0xa30: 0xa000, 0xa31: 0xa000, 0xa32: 0xa000, 0xa34: 0x3fd8, + 0xa37: 0x40a8, 0xa38: 0x40b0, 0xa39: 0x40b8, 0xa3a: 0x40c0, + 0xa3d: 0xa000, 0xa3e: 0x40c8, 0xa3f: 0x26c9, + // Block 0x29, offset 0xa40 + 0xa40: 0x0367, 0xa41: 0x032b, 0xa42: 0x032f, 0xa43: 0x0333, 0xa44: 0x037b, 0xa45: 0x0337, + 0xa46: 0x033b, 0xa47: 0x033f, 0xa48: 0x0343, 0xa49: 0x0347, 0xa4a: 0x034b, 0xa4b: 0x034f, + 0xa4c: 0x0353, 0xa4d: 0x0357, 0xa4e: 0x035b, 0xa4f: 0x49bd, 0xa50: 0x49c3, 0xa51: 0x49c9, + 0xa52: 0x49cf, 0xa53: 0x49d5, 0xa54: 0x49db, 0xa55: 0x49e1, 0xa56: 0x49e7, 0xa57: 0x49ed, + 0xa58: 0x49f3, 0xa59: 0x49f9, 0xa5a: 0x49ff, 0xa5b: 0x4a05, 0xa5c: 0x4a0b, 0xa5d: 0x4a11, + 0xa5e: 0x4a17, 0xa5f: 0x4a1d, 0xa60: 0x4a23, 0xa61: 0x4a29, 0xa62: 0x4a2f, 0xa63: 0x4a35, + 0xa64: 0x03c3, 0xa65: 0x035f, 0xa66: 0x0363, 0xa67: 0x03e7, 0xa68: 0x03eb, 0xa69: 0x03ef, + 0xa6a: 0x03f3, 0xa6b: 0x03f7, 0xa6c: 0x03fb, 0xa6d: 0x03ff, 0xa6e: 0x036b, 0xa6f: 0x0403, + 0xa70: 0x0407, 0xa71: 0x036f, 0xa72: 0x0373, 0xa73: 0x0377, 0xa74: 0x037f, 0xa75: 0x0383, + 0xa76: 0x0387, 0xa77: 0x038b, 0xa78: 0x038f, 0xa79: 0x0393, 0xa7a: 0x0397, 0xa7b: 0x039b, + 0xa7c: 0x039f, 0xa7d: 0x03a3, 0xa7e: 0x03a7, 0xa7f: 0x03ab, + // Block 0x2a, offset 0xa80 + 0xa80: 0x03af, 0xa81: 0x03b3, 0xa82: 0x040b, 0xa83: 0x040f, 0xa84: 0x03b7, 0xa85: 0x03bb, + 0xa86: 0x03bf, 0xa87: 0x03c7, 0xa88: 0x03cb, 0xa89: 0x03cf, 0xa8a: 0x03d3, 0xa8b: 0x03d7, + 0xa8c: 0x03db, 0xa8d: 0x03df, 0xa8e: 0x03e3, + 0xa92: 0x06bf, 0xa93: 0x071b, 0xa94: 0x06cb, 0xa95: 0x097b, 0xa96: 0x06cf, 0xa97: 0x06e7, + 0xa98: 0x06d3, 0xa99: 0x0f93, 0xa9a: 0x0707, 0xa9b: 0x06db, 0xa9c: 0x06c3, 0xa9d: 0x09ff, + 0xa9e: 0x098f, 0xa9f: 0x072f, + // Block 0x2b, offset 0xac0 + 0xac0: 0x2054, 0xac1: 0x205a, 0xac2: 0x2060, 0xac3: 0x2066, 0xac4: 0x206c, 0xac5: 0x2072, + 0xac6: 0x2078, 0xac7: 0x207e, 0xac8: 0x2084, 0xac9: 0x208a, 0xaca: 0x2090, 0xacb: 0x2096, + 0xacc: 0x209c, 0xacd: 0x20a2, 0xace: 0x2726, 0xacf: 0x272f, 0xad0: 0x2738, 0xad1: 0x2741, + 0xad2: 0x274a, 0xad3: 0x2753, 0xad4: 0x275c, 0xad5: 0x2765, 0xad6: 0x276e, 0xad7: 0x2780, + 0xad8: 0x2789, 0xad9: 0x2792, 0xada: 0x279b, 0xadb: 0x27a4, 0xadc: 0x2777, 0xadd: 0x2bac, + 0xade: 0x2aed, 0xae0: 0x20a8, 0xae1: 0x20c0, 0xae2: 0x20b4, 0xae3: 0x2108, + 0xae4: 0x20c6, 0xae5: 0x20e4, 0xae6: 0x20ae, 0xae7: 0x20de, 0xae8: 0x20ba, 0xae9: 0x20f0, + 0xaea: 0x2120, 0xaeb: 0x213e, 0xaec: 0x2138, 0xaed: 0x212c, 0xaee: 0x217a, 0xaef: 0x210e, + 0xaf0: 0x211a, 0xaf1: 0x2132, 0xaf2: 0x2126, 0xaf3: 0x2150, 0xaf4: 0x20fc, 0xaf5: 0x2144, + 0xaf6: 0x216e, 0xaf7: 0x2156, 0xaf8: 0x20ea, 0xaf9: 0x20cc, 0xafa: 0x2102, 0xafb: 0x2114, + 0xafc: 0x214a, 0xafd: 0x20d2, 0xafe: 0x2174, 0xaff: 0x20f6, + // Block 0x2c, offset 0xb00 + 0xb00: 0x215c, 0xb01: 0x20d8, 0xb02: 0x2162, 0xb03: 0x2168, 0xb04: 0x092f, 0xb05: 0x0b03, + 0xb06: 0x0ca7, 0xb07: 0x10c7, + 0xb10: 0x1bc4, 0xb11: 0x18a9, + 0xb12: 0x18ac, 0xb13: 0x18af, 0xb14: 0x18b2, 0xb15: 0x18b5, 0xb16: 0x18b8, 0xb17: 0x18bb, + 0xb18: 0x18be, 0xb19: 0x18c1, 0xb1a: 0x18ca, 0xb1b: 0x18cd, 0xb1c: 0x18d0, 0xb1d: 0x18d3, + 0xb1e: 0x18d6, 0xb1f: 0x18d9, 0xb20: 0x0313, 0xb21: 0x031b, 0xb22: 0x031f, 0xb23: 0x0327, + 0xb24: 0x032b, 0xb25: 0x032f, 0xb26: 0x0337, 0xb27: 0x033f, 0xb28: 0x0343, 0xb29: 0x034b, + 0xb2a: 0x034f, 0xb2b: 0x0353, 0xb2c: 0x0357, 0xb2d: 0x035b, 0xb2e: 0x2e18, 0xb2f: 0x2e20, + 0xb30: 0x2e28, 0xb31: 0x2e30, 0xb32: 0x2e38, 0xb33: 0x2e40, 0xb34: 0x2e48, 0xb35: 0x2e50, + 0xb36: 0x2e60, 0xb37: 0x2e68, 0xb38: 0x2e70, 0xb39: 0x2e78, 0xb3a: 0x2e80, 0xb3b: 0x2e88, + 0xb3c: 0x2ed3, 0xb3d: 0x2e9b, 0xb3e: 0x2e58, + // Block 0x2d, offset 0xb40 + 0xb40: 0x06bf, 0xb41: 0x071b, 0xb42: 0x06cb, 0xb43: 0x097b, 0xb44: 0x071f, 0xb45: 0x07af, + 0xb46: 0x06c7, 0xb47: 0x07ab, 0xb48: 0x070b, 0xb49: 0x0887, 0xb4a: 0x0d07, 0xb4b: 0x0e8f, + 0xb4c: 0x0dd7, 0xb4d: 0x0d1b, 0xb4e: 0x145f, 0xb4f: 0x098b, 0xb50: 0x0ccf, 0xb51: 0x0d4b, + 0xb52: 0x0d0b, 0xb53: 0x104b, 0xb54: 0x08fb, 0xb55: 0x0f03, 0xb56: 0x1387, 0xb57: 0x105f, + 0xb58: 0x0843, 0xb59: 0x108f, 0xb5a: 0x0f9b, 0xb5b: 0x0a17, 0xb5c: 0x140f, 0xb5d: 0x077f, + 0xb5e: 0x08ab, 0xb5f: 0x0df7, 0xb60: 0x1527, 0xb61: 0x0743, 0xb62: 0x07d3, 0xb63: 0x0d9b, + 0xb64: 0x06cf, 0xb65: 0x06e7, 0xb66: 0x06d3, 0xb67: 0x0adb, 0xb68: 0x08ef, 0xb69: 0x087f, + 0xb6a: 0x0a57, 0xb6b: 0x0a4b, 0xb6c: 0x0feb, 0xb6d: 0x073f, 0xb6e: 0x139b, 0xb6f: 0x089b, + 0xb70: 0x09f3, 0xb71: 0x18dc, 0xb72: 0x18df, 0xb73: 0x18e2, 0xb74: 0x18e5, 0xb75: 0x18ee, + 0xb76: 0x18f1, 0xb77: 0x18f4, 0xb78: 0x18f7, 0xb79: 0x18fa, 0xb7a: 0x18fd, 0xb7b: 0x1900, + 0xb7c: 0x1903, 0xb7d: 0x1906, 0xb7e: 0x1909, 0xb7f: 0x1912, + // Block 0x2e, offset 0xb80 + 0xb80: 0x1cc6, 0xb81: 0x1cd5, 0xb82: 0x1ce4, 0xb83: 0x1cf3, 0xb84: 0x1d02, 0xb85: 0x1d11, + 0xb86: 0x1d20, 0xb87: 0x1d2f, 0xb88: 0x1d3e, 0xb89: 0x218c, 0xb8a: 0x219e, 0xb8b: 0x21b0, + 0xb8c: 0x1954, 0xb8d: 0x1c04, 0xb8e: 0x19d2, 0xb8f: 0x1ba8, 0xb90: 0x04cb, 0xb91: 0x04d3, + 0xb92: 0x04db, 0xb93: 0x04e3, 0xb94: 0x04eb, 0xb95: 0x04ef, 0xb96: 0x04f3, 0xb97: 0x04f7, + 0xb98: 0x04fb, 0xb99: 0x04ff, 0xb9a: 0x0503, 0xb9b: 0x0507, 0xb9c: 0x050b, 0xb9d: 0x050f, + 0xb9e: 0x0513, 0xb9f: 0x0517, 0xba0: 0x051b, 0xba1: 0x0523, 0xba2: 0x0527, 0xba3: 0x052b, + 0xba4: 0x052f, 0xba5: 0x0533, 0xba6: 0x0537, 0xba7: 0x053b, 0xba8: 0x053f, 0xba9: 0x0543, + 0xbaa: 0x0547, 0xbab: 0x054b, 0xbac: 0x054f, 0xbad: 0x0553, 0xbae: 0x0557, 0xbaf: 0x055b, + 0xbb0: 0x055f, 0xbb1: 0x0563, 0xbb2: 0x0567, 0xbb3: 0x056f, 0xbb4: 0x0577, 0xbb5: 0x057f, + 0xbb6: 0x0583, 0xbb7: 0x0587, 0xbb8: 0x058b, 0xbb9: 0x058f, 0xbba: 0x0593, 0xbbb: 0x0597, + 0xbbc: 0x059b, 0xbbd: 0x059f, 0xbbe: 0x05a3, + // Block 0x2f, offset 0xbc0 + 0xbc0: 0x2b0c, 0xbc1: 0x29a8, 0xbc2: 0x2b1c, 0xbc3: 0x2880, 0xbc4: 0x2ee4, 0xbc5: 0x288a, + 0xbc6: 0x2894, 0xbc7: 0x2f28, 0xbc8: 0x29b5, 0xbc9: 0x289e, 0xbca: 0x28a8, 0xbcb: 0x28b2, + 0xbcc: 0x29dc, 0xbcd: 0x29e9, 0xbce: 0x29c2, 0xbcf: 0x29cf, 0xbd0: 0x2ea9, 0xbd1: 0x29f6, + 0xbd2: 0x2a03, 0xbd3: 0x2bbe, 0xbd4: 0x26bb, 0xbd5: 0x2bd1, 0xbd6: 0x2be4, 0xbd7: 0x2b2c, + 0xbd8: 0x2a10, 0xbd9: 0x2bf7, 0xbda: 0x2c0a, 0xbdb: 0x2a1d, 0xbdc: 0x28bc, 0xbdd: 0x28c6, + 0xbde: 0x2eb7, 0xbdf: 0x2a2a, 0xbe0: 0x2b3c, 0xbe1: 0x2ef5, 0xbe2: 0x28d0, 0xbe3: 0x28da, + 0xbe4: 0x2a37, 0xbe5: 0x28e4, 0xbe6: 0x28ee, 0xbe7: 0x26d0, 0xbe8: 0x26d7, 0xbe9: 0x28f8, + 0xbea: 0x2902, 0xbeb: 0x2c1d, 0xbec: 0x2a44, 0xbed: 0x2b4c, 0xbee: 0x2c30, 0xbef: 0x2a51, + 0xbf0: 0x2916, 0xbf1: 0x290c, 0xbf2: 0x2f3c, 0xbf3: 0x2a5e, 0xbf4: 0x2c43, 0xbf5: 0x2920, + 0xbf6: 0x2b5c, 0xbf7: 0x292a, 0xbf8: 0x2a78, 0xbf9: 0x2934, 0xbfa: 0x2a85, 0xbfb: 0x2f06, + 0xbfc: 0x2a6b, 0xbfd: 0x2b6c, 0xbfe: 0x2a92, 0xbff: 0x26de, + // Block 0x30, offset 0xc00 + 0xc00: 0x2f17, 0xc01: 0x293e, 0xc02: 0x2948, 0xc03: 0x2a9f, 0xc04: 0x2952, 0xc05: 0x295c, + 0xc06: 0x2966, 0xc07: 0x2b7c, 0xc08: 0x2aac, 0xc09: 0x26e5, 0xc0a: 0x2c56, 0xc0b: 0x2e90, + 0xc0c: 0x2b8c, 0xc0d: 0x2ab9, 0xc0e: 0x2ec5, 0xc0f: 0x2970, 0xc10: 0x297a, 0xc11: 0x2ac6, + 0xc12: 0x26ec, 0xc13: 0x2ad3, 0xc14: 0x2b9c, 0xc15: 0x26f3, 0xc16: 0x2c69, 0xc17: 0x2984, + 0xc18: 0x1cb7, 0xc19: 0x1ccb, 0xc1a: 0x1cda, 0xc1b: 0x1ce9, 0xc1c: 0x1cf8, 0xc1d: 0x1d07, + 0xc1e: 0x1d16, 0xc1f: 0x1d25, 0xc20: 0x1d34, 0xc21: 0x1d43, 0xc22: 0x2192, 0xc23: 0x21a4, + 0xc24: 0x21b6, 0xc25: 0x21c2, 0xc26: 0x21ce, 0xc27: 0x21da, 0xc28: 0x21e6, 0xc29: 0x21f2, + 0xc2a: 0x21fe, 0xc2b: 0x220a, 0xc2c: 0x2246, 0xc2d: 0x2252, 0xc2e: 0x225e, 0xc2f: 0x226a, + 0xc30: 0x2276, 0xc31: 0x1c14, 0xc32: 0x19c6, 0xc33: 0x1936, 0xc34: 0x1be4, 0xc35: 0x1a47, + 0xc36: 0x1a56, 0xc37: 0x19cc, 0xc38: 0x1bfc, 0xc39: 0x1c00, 0xc3a: 0x1960, 0xc3b: 0x2701, + 0xc3c: 0x270f, 0xc3d: 0x26fa, 0xc3e: 0x2708, 0xc3f: 0x2ae0, + // Block 0x31, offset 0xc40 + 0xc40: 0x1a4a, 0xc41: 0x1a32, 0xc42: 0x1c60, 0xc43: 0x1a1a, 0xc44: 0x19f3, 0xc45: 0x1969, + 0xc46: 0x1978, 0xc47: 0x1948, 0xc48: 0x1bf0, 0xc49: 0x1d52, 0xc4a: 0x1a4d, 0xc4b: 0x1a35, + 0xc4c: 0x1c64, 0xc4d: 0x1c70, 0xc4e: 0x1a26, 0xc4f: 0x19fc, 0xc50: 0x1957, 0xc51: 0x1c1c, + 0xc52: 0x1bb0, 0xc53: 0x1b9c, 0xc54: 0x1bcc, 0xc55: 0x1c74, 0xc56: 0x1a29, 0xc57: 0x19c9, + 0xc58: 0x19ff, 0xc59: 0x19de, 0xc5a: 0x1a41, 0xc5b: 0x1c78, 0xc5c: 0x1a2c, 0xc5d: 0x19c0, + 0xc5e: 0x1a02, 0xc5f: 0x1c3c, 0xc60: 0x1bf4, 0xc61: 0x1a14, 0xc62: 0x1c24, 0xc63: 0x1c40, + 0xc64: 0x1bf8, 0xc65: 0x1a17, 0xc66: 0x1c28, 0xc67: 0x22e8, 0xc68: 0x22fc, 0xc69: 0x1996, + 0xc6a: 0x1c20, 0xc6b: 0x1bb4, 0xc6c: 0x1ba0, 0xc6d: 0x1c48, 0xc6e: 0x2716, 0xc6f: 0x27ad, + 0xc70: 0x1a59, 0xc71: 0x1a44, 0xc72: 0x1c7c, 0xc73: 0x1a2f, 0xc74: 0x1a50, 0xc75: 0x1a38, + 0xc76: 0x1c68, 0xc77: 0x1a1d, 0xc78: 0x19f6, 0xc79: 0x1981, 0xc7a: 0x1a53, 0xc7b: 0x1a3b, + 0xc7c: 0x1c6c, 0xc7d: 0x1a20, 0xc7e: 0x19f9, 0xc7f: 0x1984, + // Block 0x32, offset 0xc80 + 0xc80: 0x1c2c, 0xc81: 0x1bb8, 0xc82: 0x1d4d, 0xc83: 0x1939, 0xc84: 0x19ba, 0xc85: 0x19bd, + 0xc86: 0x22f5, 0xc87: 0x1b94, 0xc88: 0x19c3, 0xc89: 0x194b, 0xc8a: 0x19e1, 0xc8b: 0x194e, + 0xc8c: 0x19ea, 0xc8d: 0x196c, 0xc8e: 0x196f, 0xc8f: 0x1a05, 0xc90: 0x1a0b, 0xc91: 0x1a0e, + 0xc92: 0x1c30, 0xc93: 0x1a11, 0xc94: 0x1a23, 0xc95: 0x1c38, 0xc96: 0x1c44, 0xc97: 0x1990, + 0xc98: 0x1d57, 0xc99: 0x1bbc, 0xc9a: 0x1993, 0xc9b: 0x1a5c, 0xc9c: 0x19a5, 0xc9d: 0x19b4, + 0xc9e: 0x22e2, 0xc9f: 0x22dc, 0xca0: 0x1cc1, 0xca1: 0x1cd0, 0xca2: 0x1cdf, 0xca3: 0x1cee, + 0xca4: 0x1cfd, 0xca5: 0x1d0c, 0xca6: 0x1d1b, 0xca7: 0x1d2a, 0xca8: 0x1d39, 0xca9: 0x2186, + 0xcaa: 0x2198, 0xcab: 0x21aa, 0xcac: 0x21bc, 0xcad: 0x21c8, 0xcae: 0x21d4, 0xcaf: 0x21e0, + 0xcb0: 0x21ec, 0xcb1: 0x21f8, 0xcb2: 0x2204, 0xcb3: 0x2240, 0xcb4: 0x224c, 0xcb5: 0x2258, + 0xcb6: 0x2264, 0xcb7: 0x2270, 0xcb8: 0x227c, 0xcb9: 0x2282, 0xcba: 0x2288, 0xcbb: 0x228e, + 0xcbc: 0x2294, 0xcbd: 0x22a6, 0xcbe: 0x22ac, 0xcbf: 0x1c10, + // Block 0x33, offset 0xcc0 + 0xcc0: 0x1377, 0xcc1: 0x0cfb, 0xcc2: 0x13d3, 0xcc3: 0x139f, 0xcc4: 0x0e57, 0xcc5: 0x06eb, + 0xcc6: 0x08df, 0xcc7: 0x162b, 0xcc8: 0x162b, 0xcc9: 0x0a0b, 0xcca: 0x145f, 0xccb: 0x0943, + 0xccc: 0x0a07, 0xccd: 0x0bef, 0xcce: 0x0fcf, 0xccf: 0x115f, 0xcd0: 0x1297, 0xcd1: 0x12d3, + 0xcd2: 0x1307, 0xcd3: 0x141b, 0xcd4: 0x0d73, 0xcd5: 0x0dff, 0xcd6: 0x0eab, 0xcd7: 0x0f43, + 0xcd8: 0x125f, 0xcd9: 0x1447, 0xcda: 0x1573, 0xcdb: 0x070f, 0xcdc: 0x08b3, 0xcdd: 0x0d87, + 0xcde: 0x0ecf, 0xcdf: 0x1293, 0xce0: 0x15c3, 0xce1: 0x0ab3, 0xce2: 0x0e77, 0xce3: 0x1283, + 0xce4: 0x1317, 0xce5: 0x0c23, 0xce6: 0x11bb, 0xce7: 0x12df, 0xce8: 0x0b1f, 0xce9: 0x0d0f, + 0xcea: 0x0e17, 0xceb: 0x0f1b, 0xcec: 0x1427, 0xced: 0x074f, 0xcee: 0x07e7, 0xcef: 0x0853, + 0xcf0: 0x0c8b, 0xcf1: 0x0d7f, 0xcf2: 0x0ecb, 0xcf3: 0x0fef, 0xcf4: 0x1177, 0xcf5: 0x128b, + 0xcf6: 0x12a3, 0xcf7: 0x13c7, 0xcf8: 0x14ef, 0xcf9: 0x15a3, 0xcfa: 0x15bf, 0xcfb: 0x102b, + 0xcfc: 0x106b, 0xcfd: 0x1123, 0xcfe: 0x1243, 0xcff: 0x147b, + // Block 0x34, offset 0xd00 + 0xd00: 0x15cb, 0xd01: 0x134b, 0xd02: 0x09c7, 0xd03: 0x0b3b, 0xd04: 0x10db, 0xd05: 0x119b, + 0xd06: 0x0eff, 0xd07: 0x1033, 0xd08: 0x1397, 0xd09: 0x14e7, 0xd0a: 0x09c3, 0xd0b: 0x0a8f, + 0xd0c: 0x0d77, 0xd0d: 0x0e2b, 0xd0e: 0x0e5f, 0xd0f: 0x1113, 0xd10: 0x113b, 0xd11: 0x14a7, + 0xd12: 0x084f, 0xd13: 0x11a7, 0xd14: 0x07f3, 0xd15: 0x07ef, 0xd16: 0x1097, 0xd17: 0x1127, + 0xd18: 0x125b, 0xd19: 0x14af, 0xd1a: 0x1367, 0xd1b: 0x0c27, 0xd1c: 0x0d73, 0xd1d: 0x1357, + 0xd1e: 0x06f7, 0xd1f: 0x0a63, 0xd20: 0x0b93, 0xd21: 0x0f2f, 0xd22: 0x0faf, 0xd23: 0x0873, + 0xd24: 0x103b, 0xd25: 0x075f, 0xd26: 0x0b77, 0xd27: 0x06d7, 0xd28: 0x0deb, 0xd29: 0x0ca3, + 0xd2a: 0x110f, 0xd2b: 0x08c7, 0xd2c: 0x09b3, 0xd2d: 0x0ffb, 0xd2e: 0x1263, 0xd2f: 0x133b, + 0xd30: 0x0db7, 0xd31: 0x13f7, 0xd32: 0x0de3, 0xd33: 0x0c37, 0xd34: 0x121b, 0xd35: 0x0c57, + 0xd36: 0x0fab, 0xd37: 0x072b, 0xd38: 0x07a7, 0xd39: 0x07eb, 0xd3a: 0x0d53, 0xd3b: 0x10fb, + 0xd3c: 0x11f3, 0xd3d: 0x1347, 0xd3e: 0x145b, 0xd3f: 0x085b, + // Block 0x35, offset 0xd40 + 0xd40: 0x090f, 0xd41: 0x0a17, 0xd42: 0x0b2f, 0xd43: 0x0cbf, 0xd44: 0x0e7b, 0xd45: 0x103f, + 0xd46: 0x1497, 0xd47: 0x157b, 0xd48: 0x15cf, 0xd49: 0x15e7, 0xd4a: 0x0837, 0xd4b: 0x0cf3, + 0xd4c: 0x0da3, 0xd4d: 0x13eb, 0xd4e: 0x0afb, 0xd4f: 0x0bd7, 0xd50: 0x0bf3, 0xd51: 0x0c83, + 0xd52: 0x0e6b, 0xd53: 0x0eb7, 0xd54: 0x0f67, 0xd55: 0x108b, 0xd56: 0x112f, 0xd57: 0x1193, + 0xd58: 0x13db, 0xd59: 0x126b, 0xd5a: 0x1403, 0xd5b: 0x147f, 0xd5c: 0x080f, 0xd5d: 0x083b, + 0xd5e: 0x0923, 0xd5f: 0x0ea7, 0xd60: 0x12f3, 0xd61: 0x133b, 0xd62: 0x0b1b, 0xd63: 0x0b8b, + 0xd64: 0x0c4f, 0xd65: 0x0daf, 0xd66: 0x10d7, 0xd67: 0x0f23, 0xd68: 0x073b, 0xd69: 0x097f, + 0xd6a: 0x0a63, 0xd6b: 0x0ac7, 0xd6c: 0x0b97, 0xd6d: 0x0f3f, 0xd6e: 0x0f5b, 0xd6f: 0x116b, + 0xd70: 0x118b, 0xd71: 0x1463, 0xd72: 0x14e3, 0xd73: 0x14f3, 0xd74: 0x152f, 0xd75: 0x0753, + 0xd76: 0x107f, 0xd77: 0x144f, 0xd78: 0x14cb, 0xd79: 0x0baf, 0xd7a: 0x0717, 0xd7b: 0x0777, + 0xd7c: 0x0a67, 0xd7d: 0x0a87, 0xd7e: 0x0caf, 0xd7f: 0x0d73, + // Block 0x36, offset 0xd80 + 0xd80: 0x0ec3, 0xd81: 0x0fcb, 0xd82: 0x1277, 0xd83: 0x1417, 0xd84: 0x1623, 0xd85: 0x0ce3, + 0xd86: 0x14a3, 0xd87: 0x0833, 0xd88: 0x0d2f, 0xd89: 0x0d3b, 0xd8a: 0x0e0f, 0xd8b: 0x0e47, + 0xd8c: 0x0f4b, 0xd8d: 0x0fa7, 0xd8e: 0x1027, 0xd8f: 0x110b, 0xd90: 0x153b, 0xd91: 0x07af, + 0xd92: 0x0c03, 0xd93: 0x14b3, 0xd94: 0x0767, 0xd95: 0x0aab, 0xd96: 0x0e2f, 0xd97: 0x13df, + 0xd98: 0x0b67, 0xd99: 0x0bb7, 0xd9a: 0x0d43, 0xd9b: 0x0f2f, 0xd9c: 0x14bb, 0xd9d: 0x0817, + 0xd9e: 0x08ff, 0xd9f: 0x0a97, 0xda0: 0x0cd3, 0xda1: 0x0d1f, 0xda2: 0x0d5f, 0xda3: 0x0df3, + 0xda4: 0x0f47, 0xda5: 0x0fbb, 0xda6: 0x1157, 0xda7: 0x12f7, 0xda8: 0x1303, 0xda9: 0x1457, + 0xdaa: 0x14d7, 0xdab: 0x0883, 0xdac: 0x0e4b, 0xdad: 0x0903, 0xdae: 0x0ec7, 0xdaf: 0x0f6b, + 0xdb0: 0x1287, 0xdb1: 0x14bf, 0xdb2: 0x15ab, 0xdb3: 0x15d3, 0xdb4: 0x0d37, 0xdb5: 0x0e27, + 0xdb6: 0x11c3, 0xdb7: 0x10b7, 0xdb8: 0x10c3, 0xdb9: 0x10e7, 0xdba: 0x0f17, 0xdbb: 0x0e9f, + 0xdbc: 0x1363, 0xdbd: 0x0733, 0xdbe: 0x122b, 0xdbf: 0x081b, + // Block 0x37, offset 0xdc0 + 0xdc0: 0x080b, 0xdc1: 0x0b0b, 0xdc2: 0x0c2b, 0xdc3: 0x10f3, 0xdc4: 0x0a53, 0xdc5: 0x0e03, + 0xdc6: 0x0cef, 0xdc7: 0x13e7, 0xdc8: 0x12e7, 0xdc9: 0x14ab, 0xdca: 0x1323, 0xdcb: 0x0b27, + 0xdcc: 0x0787, 0xdcd: 0x095b, 0xdd0: 0x09af, + 0xdd2: 0x0cdf, 0xdd5: 0x07f7, 0xdd6: 0x0f1f, 0xdd7: 0x0fe3, + 0xdd8: 0x1047, 0xdd9: 0x1063, 0xdda: 0x1067, 0xddb: 0x107b, 0xddc: 0x14fb, 0xddd: 0x10eb, + 0xdde: 0x116f, 0xde0: 0x128f, 0xde2: 0x1353, + 0xde5: 0x1407, 0xde6: 0x1433, + 0xdea: 0x154f, 0xdeb: 0x1553, 0xdec: 0x1557, 0xded: 0x15bb, 0xdee: 0x142b, 0xdef: 0x14c7, + 0xdf0: 0x0757, 0xdf1: 0x077b, 0xdf2: 0x078f, 0xdf3: 0x084b, 0xdf4: 0x0857, 0xdf5: 0x0897, + 0xdf6: 0x094b, 0xdf7: 0x0967, 0xdf8: 0x096f, 0xdf9: 0x09ab, 0xdfa: 0x09b7, 0xdfb: 0x0a93, + 0xdfc: 0x0a9b, 0xdfd: 0x0ba3, 0xdfe: 0x0bcb, 0xdff: 0x0bd3, + // Block 0x38, offset 0xe00 + 0xe00: 0x0beb, 0xe01: 0x0c97, 0xe02: 0x0cc7, 0xe03: 0x0ce7, 0xe04: 0x0d57, 0xe05: 0x0e1b, + 0xe06: 0x0e37, 0xe07: 0x0e67, 0xe08: 0x0ebb, 0xe09: 0x0edb, 0xe0a: 0x0f4f, 0xe0b: 0x102f, + 0xe0c: 0x104b, 0xe0d: 0x1053, 0xe0e: 0x104f, 0xe0f: 0x1057, 0xe10: 0x105b, 0xe11: 0x105f, + 0xe12: 0x1073, 0xe13: 0x1077, 0xe14: 0x109b, 0xe15: 0x10af, 0xe16: 0x10cb, 0xe17: 0x112f, + 0xe18: 0x1137, 0xe19: 0x113f, 0xe1a: 0x1153, 0xe1b: 0x117b, 0xe1c: 0x11cb, 0xe1d: 0x11ff, + 0xe1e: 0x11ff, 0xe1f: 0x1267, 0xe20: 0x130f, 0xe21: 0x1327, 0xe22: 0x135b, 0xe23: 0x135f, + 0xe24: 0x13a3, 0xe25: 0x13a7, 0xe26: 0x13ff, 0xe27: 0x1407, 0xe28: 0x14db, 0xe29: 0x151f, + 0xe2a: 0x1537, 0xe2b: 0x0b9b, 0xe2c: 0x171e, 0xe2d: 0x11e3, + 0xe30: 0x06df, 0xe31: 0x07e3, 0xe32: 0x07a3, 0xe33: 0x074b, 0xe34: 0x078b, 0xe35: 0x07b7, + 0xe36: 0x0847, 0xe37: 0x0863, 0xe38: 0x094b, 0xe39: 0x0937, 0xe3a: 0x0947, 0xe3b: 0x0963, + 0xe3c: 0x09af, 0xe3d: 0x09bf, 0xe3e: 0x0a03, 0xe3f: 0x0a0f, + // Block 0x39, offset 0xe40 + 0xe40: 0x0a2b, 0xe41: 0x0a3b, 0xe42: 0x0b23, 0xe43: 0x0b2b, 0xe44: 0x0b5b, 0xe45: 0x0b7b, + 0xe46: 0x0bab, 0xe47: 0x0bc3, 0xe48: 0x0bb3, 0xe49: 0x0bd3, 0xe4a: 0x0bc7, 0xe4b: 0x0beb, + 0xe4c: 0x0c07, 0xe4d: 0x0c5f, 0xe4e: 0x0c6b, 0xe4f: 0x0c73, 0xe50: 0x0c9b, 0xe51: 0x0cdf, + 0xe52: 0x0d0f, 0xe53: 0x0d13, 0xe54: 0x0d27, 0xe55: 0x0da7, 0xe56: 0x0db7, 0xe57: 0x0e0f, + 0xe58: 0x0e5b, 0xe59: 0x0e53, 0xe5a: 0x0e67, 0xe5b: 0x0e83, 0xe5c: 0x0ebb, 0xe5d: 0x1013, + 0xe5e: 0x0edf, 0xe5f: 0x0f13, 0xe60: 0x0f1f, 0xe61: 0x0f5f, 0xe62: 0x0f7b, 0xe63: 0x0f9f, + 0xe64: 0x0fc3, 0xe65: 0x0fc7, 0xe66: 0x0fe3, 0xe67: 0x0fe7, 0xe68: 0x0ff7, 0xe69: 0x100b, + 0xe6a: 0x1007, 0xe6b: 0x1037, 0xe6c: 0x10b3, 0xe6d: 0x10cb, 0xe6e: 0x10e3, 0xe6f: 0x111b, + 0xe70: 0x112f, 0xe71: 0x114b, 0xe72: 0x117b, 0xe73: 0x122f, 0xe74: 0x1257, 0xe75: 0x12cb, + 0xe76: 0x1313, 0xe77: 0x131f, 0xe78: 0x1327, 0xe79: 0x133f, 0xe7a: 0x1353, 0xe7b: 0x1343, + 0xe7c: 0x135b, 0xe7d: 0x1357, 0xe7e: 0x134f, 0xe7f: 0x135f, + // Block 0x3a, offset 0xe80 + 0xe80: 0x136b, 0xe81: 0x13a7, 0xe82: 0x13e3, 0xe83: 0x1413, 0xe84: 0x144b, 0xe85: 0x146b, + 0xe86: 0x14b7, 0xe87: 0x14db, 0xe88: 0x14fb, 0xe89: 0x150f, 0xe8a: 0x151f, 0xe8b: 0x152b, + 0xe8c: 0x1537, 0xe8d: 0x158b, 0xe8e: 0x162b, 0xe8f: 0x16b5, 0xe90: 0x16b0, 0xe91: 0x16e2, + 0xe92: 0x0607, 0xe93: 0x062f, 0xe94: 0x0633, 0xe95: 0x1764, 0xe96: 0x1791, 0xe97: 0x1809, + 0xe98: 0x1617, 0xe99: 0x1627, + // Block 0x3b, offset 0xec0 + 0xec0: 0x19d5, 0xec1: 0x19d8, 0xec2: 0x19db, 0xec3: 0x1c08, 0xec4: 0x1c0c, 0xec5: 0x1a5f, + 0xec6: 0x1a5f, + 0xed3: 0x1d75, 0xed4: 0x1d66, 0xed5: 0x1d6b, 0xed6: 0x1d7a, 0xed7: 0x1d70, + 0xedd: 0x4390, + 0xede: 0x8115, 0xedf: 0x4402, 0xee0: 0x022d, 0xee1: 0x0215, 0xee2: 0x021e, 0xee3: 0x0221, + 0xee4: 0x0224, 0xee5: 0x0227, 0xee6: 0x022a, 0xee7: 0x0230, 0xee8: 0x0233, 0xee9: 0x0017, + 0xeea: 0x43f0, 0xeeb: 0x43f6, 0xeec: 0x44f4, 0xeed: 0x44fc, 0xeee: 0x4348, 0xeef: 0x434e, + 0xef0: 0x4354, 0xef1: 0x435a, 0xef2: 0x4366, 0xef3: 0x436c, 0xef4: 0x4372, 0xef5: 0x437e, + 0xef6: 0x4384, 0xef8: 0x438a, 0xef9: 0x4396, 0xefa: 0x439c, 0xefb: 0x43a2, + 0xefc: 0x43ae, 0xefe: 0x43b4, + // Block 0x3c, offset 0xf00 + 0xf00: 0x43ba, 0xf01: 0x43c0, 0xf03: 0x43c6, 0xf04: 0x43cc, + 0xf06: 0x43d8, 0xf07: 0x43de, 0xf08: 0x43e4, 0xf09: 0x43ea, 0xf0a: 0x43fc, 0xf0b: 0x4378, + 0xf0c: 0x4360, 0xf0d: 0x43a8, 0xf0e: 0x43d2, 0xf0f: 0x1d7f, 0xf10: 0x0299, 0xf11: 0x0299, + 0xf12: 0x02a2, 0xf13: 0x02a2, 0xf14: 0x02a2, 0xf15: 0x02a2, 0xf16: 0x02a5, 0xf17: 0x02a5, + 0xf18: 0x02a5, 0xf19: 0x02a5, 0xf1a: 0x02ab, 0xf1b: 0x02ab, 0xf1c: 0x02ab, 0xf1d: 0x02ab, + 0xf1e: 0x029f, 0xf1f: 0x029f, 0xf20: 0x029f, 0xf21: 0x029f, 0xf22: 0x02a8, 0xf23: 0x02a8, + 0xf24: 0x02a8, 0xf25: 0x02a8, 0xf26: 0x029c, 0xf27: 0x029c, 0xf28: 0x029c, 0xf29: 0x029c, + 0xf2a: 0x02cf, 0xf2b: 0x02cf, 0xf2c: 0x02cf, 0xf2d: 0x02cf, 0xf2e: 0x02d2, 0xf2f: 0x02d2, + 0xf30: 0x02d2, 0xf31: 0x02d2, 0xf32: 0x02b1, 0xf33: 0x02b1, 0xf34: 0x02b1, 0xf35: 0x02b1, + 0xf36: 0x02ae, 0xf37: 0x02ae, 0xf38: 0x02ae, 0xf39: 0x02ae, 0xf3a: 0x02b4, 0xf3b: 0x02b4, + 0xf3c: 0x02b4, 0xf3d: 0x02b4, 0xf3e: 0x02b7, 0xf3f: 0x02b7, + // Block 0x3d, offset 0xf40 + 0xf40: 0x02b7, 0xf41: 0x02b7, 0xf42: 0x02c0, 0xf43: 0x02c0, 0xf44: 0x02bd, 0xf45: 0x02bd, + 0xf46: 0x02c3, 0xf47: 0x02c3, 0xf48: 0x02ba, 0xf49: 0x02ba, 0xf4a: 0x02c9, 0xf4b: 0x02c9, + 0xf4c: 0x02c6, 0xf4d: 0x02c6, 0xf4e: 0x02d5, 0xf4f: 0x02d5, 0xf50: 0x02d5, 0xf51: 0x02d5, + 0xf52: 0x02db, 0xf53: 0x02db, 0xf54: 0x02db, 0xf55: 0x02db, 0xf56: 0x02e1, 0xf57: 0x02e1, + 0xf58: 0x02e1, 0xf59: 0x02e1, 0xf5a: 0x02de, 0xf5b: 0x02de, 0xf5c: 0x02de, 0xf5d: 0x02de, + 0xf5e: 0x02e4, 0xf5f: 0x02e4, 0xf60: 0x02e7, 0xf61: 0x02e7, 0xf62: 0x02e7, 0xf63: 0x02e7, + 0xf64: 0x446e, 0xf65: 0x446e, 0xf66: 0x02ed, 0xf67: 0x02ed, 0xf68: 0x02ed, 0xf69: 0x02ed, + 0xf6a: 0x02ea, 0xf6b: 0x02ea, 0xf6c: 0x02ea, 0xf6d: 0x02ea, 0xf6e: 0x0308, 0xf6f: 0x0308, + 0xf70: 0x4468, 0xf71: 0x4468, + // Block 0x3e, offset 0xf80 + 0xf93: 0x02d8, 0xf94: 0x02d8, 0xf95: 0x02d8, 0xf96: 0x02d8, 0xf97: 0x02f6, + 0xf98: 0x02f6, 0xf99: 0x02f3, 0xf9a: 0x02f3, 0xf9b: 0x02f9, 0xf9c: 0x02f9, 0xf9d: 0x204f, + 0xf9e: 0x02ff, 0xf9f: 0x02ff, 0xfa0: 0x02f0, 0xfa1: 0x02f0, 0xfa2: 0x02fc, 0xfa3: 0x02fc, + 0xfa4: 0x0305, 0xfa5: 0x0305, 0xfa6: 0x0305, 0xfa7: 0x0305, 0xfa8: 0x028d, 0xfa9: 0x028d, + 0xfaa: 0x25aa, 0xfab: 0x25aa, 0xfac: 0x261a, 0xfad: 0x261a, 0xfae: 0x25e9, 0xfaf: 0x25e9, + 0xfb0: 0x2605, 0xfb1: 0x2605, 0xfb2: 0x25fe, 0xfb3: 0x25fe, 0xfb4: 0x260c, 0xfb5: 0x260c, + 0xfb6: 0x2613, 0xfb7: 0x2613, 0xfb8: 0x2613, 0xfb9: 0x25f0, 0xfba: 0x25f0, 0xfbb: 0x25f0, + 0xfbc: 0x0302, 0xfbd: 0x0302, 0xfbe: 0x0302, 0xfbf: 0x0302, + // Block 0x3f, offset 0xfc0 + 0xfc0: 0x25b1, 0xfc1: 0x25b8, 0xfc2: 0x25d4, 0xfc3: 0x25f0, 0xfc4: 0x25f7, 0xfc5: 0x1d89, + 0xfc6: 0x1d8e, 0xfc7: 0x1d93, 0xfc8: 0x1da2, 0xfc9: 0x1db1, 0xfca: 0x1db6, 0xfcb: 0x1dbb, + 0xfcc: 0x1dc0, 0xfcd: 0x1dc5, 0xfce: 0x1dd4, 0xfcf: 0x1de3, 0xfd0: 0x1de8, 0xfd1: 0x1ded, + 0xfd2: 0x1dfc, 0xfd3: 0x1e0b, 0xfd4: 0x1e10, 0xfd5: 0x1e15, 0xfd6: 0x1e1a, 0xfd7: 0x1e29, + 0xfd8: 0x1e2e, 0xfd9: 0x1e3d, 0xfda: 0x1e42, 0xfdb: 0x1e47, 0xfdc: 0x1e56, 0xfdd: 0x1e5b, + 0xfde: 0x1e60, 0xfdf: 0x1e6a, 0xfe0: 0x1ea6, 0xfe1: 0x1eb5, 0xfe2: 0x1ec4, 0xfe3: 0x1ec9, + 0xfe4: 0x1ece, 0xfe5: 0x1ed8, 0xfe6: 0x1ee7, 0xfe7: 0x1eec, 0xfe8: 0x1efb, 0xfe9: 0x1f00, + 0xfea: 0x1f05, 0xfeb: 0x1f14, 0xfec: 0x1f19, 0xfed: 0x1f28, 0xfee: 0x1f2d, 0xfef: 0x1f32, + 0xff0: 0x1f37, 0xff1: 0x1f3c, 0xff2: 0x1f41, 0xff3: 0x1f46, 0xff4: 0x1f4b, 0xff5: 0x1f50, + 0xff6: 0x1f55, 0xff7: 0x1f5a, 0xff8: 0x1f5f, 0xff9: 0x1f64, 0xffa: 0x1f69, 0xffb: 0x1f6e, + 0xffc: 0x1f73, 0xffd: 0x1f78, 0xffe: 0x1f7d, 0xfff: 0x1f87, + // Block 0x40, offset 0x1000 + 0x1000: 0x1f8c, 0x1001: 0x1f91, 0x1002: 0x1f96, 0x1003: 0x1fa0, 0x1004: 0x1fa5, 0x1005: 0x1faf, + 0x1006: 0x1fb4, 0x1007: 0x1fb9, 0x1008: 0x1fbe, 0x1009: 0x1fc3, 0x100a: 0x1fc8, 0x100b: 0x1fcd, + 0x100c: 0x1fd2, 0x100d: 0x1fd7, 0x100e: 0x1fe6, 0x100f: 0x1ff5, 0x1010: 0x1ffa, 0x1011: 0x1fff, + 0x1012: 0x2004, 0x1013: 0x2009, 0x1014: 0x200e, 0x1015: 0x2018, 0x1016: 0x201d, 0x1017: 0x2022, + 0x1018: 0x2031, 0x1019: 0x2040, 0x101a: 0x2045, 0x101b: 0x4420, 0x101c: 0x4426, 0x101d: 0x445c, + 0x101e: 0x44b3, 0x101f: 0x44ba, 0x1020: 0x44c1, 0x1021: 0x44c8, 0x1022: 0x44cf, 0x1023: 0x44d6, + 0x1024: 0x25c6, 0x1025: 0x25cd, 0x1026: 0x25d4, 0x1027: 0x25db, 0x1028: 0x25f0, 0x1029: 0x25f7, + 0x102a: 0x1d98, 0x102b: 0x1d9d, 0x102c: 0x1da2, 0x102d: 0x1da7, 0x102e: 0x1db1, 0x102f: 0x1db6, + 0x1030: 0x1dca, 0x1031: 0x1dcf, 0x1032: 0x1dd4, 0x1033: 0x1dd9, 0x1034: 0x1de3, 0x1035: 0x1de8, + 0x1036: 0x1df2, 0x1037: 0x1df7, 0x1038: 0x1dfc, 0x1039: 0x1e01, 0x103a: 0x1e0b, 0x103b: 0x1e10, + 0x103c: 0x1f3c, 0x103d: 0x1f41, 0x103e: 0x1f50, 0x103f: 0x1f55, + // Block 0x41, offset 0x1040 + 0x1040: 0x1f5a, 0x1041: 0x1f6e, 0x1042: 0x1f73, 0x1043: 0x1f78, 0x1044: 0x1f7d, 0x1045: 0x1f96, + 0x1046: 0x1fa0, 0x1047: 0x1fa5, 0x1048: 0x1faa, 0x1049: 0x1fbe, 0x104a: 0x1fdc, 0x104b: 0x1fe1, + 0x104c: 0x1fe6, 0x104d: 0x1feb, 0x104e: 0x1ff5, 0x104f: 0x1ffa, 0x1050: 0x445c, 0x1051: 0x2027, + 0x1052: 0x202c, 0x1053: 0x2031, 0x1054: 0x2036, 0x1055: 0x2040, 0x1056: 0x2045, 0x1057: 0x25b1, + 0x1058: 0x25b8, 0x1059: 0x25bf, 0x105a: 0x25d4, 0x105b: 0x25e2, 0x105c: 0x1d89, 0x105d: 0x1d8e, + 0x105e: 0x1d93, 0x105f: 0x1da2, 0x1060: 0x1dac, 0x1061: 0x1dbb, 0x1062: 0x1dc0, 0x1063: 0x1dc5, + 0x1064: 0x1dd4, 0x1065: 0x1dde, 0x1066: 0x1dfc, 0x1067: 0x1e15, 0x1068: 0x1e1a, 0x1069: 0x1e29, + 0x106a: 0x1e2e, 0x106b: 0x1e3d, 0x106c: 0x1e47, 0x106d: 0x1e56, 0x106e: 0x1e5b, 0x106f: 0x1e60, + 0x1070: 0x1e6a, 0x1071: 0x1ea6, 0x1072: 0x1eab, 0x1073: 0x1eb5, 0x1074: 0x1ec4, 0x1075: 0x1ec9, + 0x1076: 0x1ece, 0x1077: 0x1ed8, 0x1078: 0x1ee7, 0x1079: 0x1efb, 0x107a: 0x1f00, 0x107b: 0x1f05, + 0x107c: 0x1f14, 0x107d: 0x1f19, 0x107e: 0x1f28, 0x107f: 0x1f2d, + // Block 0x42, offset 0x1080 + 0x1080: 0x1f32, 0x1081: 0x1f37, 0x1082: 0x1f46, 0x1083: 0x1f4b, 0x1084: 0x1f5f, 0x1085: 0x1f64, + 0x1086: 0x1f69, 0x1087: 0x1f6e, 0x1088: 0x1f73, 0x1089: 0x1f87, 0x108a: 0x1f8c, 0x108b: 0x1f91, + 0x108c: 0x1f96, 0x108d: 0x1f9b, 0x108e: 0x1faf, 0x108f: 0x1fb4, 0x1090: 0x1fb9, 0x1091: 0x1fbe, + 0x1092: 0x1fcd, 0x1093: 0x1fd2, 0x1094: 0x1fd7, 0x1095: 0x1fe6, 0x1096: 0x1ff0, 0x1097: 0x1fff, + 0x1098: 0x2004, 0x1099: 0x4450, 0x109a: 0x2018, 0x109b: 0x201d, 0x109c: 0x2022, 0x109d: 0x2031, + 0x109e: 0x203b, 0x109f: 0x25d4, 0x10a0: 0x25e2, 0x10a1: 0x1da2, 0x10a2: 0x1dac, 0x10a3: 0x1dd4, + 0x10a4: 0x1dde, 0x10a5: 0x1dfc, 0x10a6: 0x1e06, 0x10a7: 0x1e6a, 0x10a8: 0x1e6f, 0x10a9: 0x1e92, + 0x10aa: 0x1e97, 0x10ab: 0x1f6e, 0x10ac: 0x1f73, 0x10ad: 0x1f96, 0x10ae: 0x1fe6, 0x10af: 0x1ff0, + 0x10b0: 0x2031, 0x10b1: 0x203b, 0x10b2: 0x4504, 0x10b3: 0x450c, 0x10b4: 0x4514, 0x10b5: 0x1ef1, + 0x10b6: 0x1ef6, 0x10b7: 0x1f0a, 0x10b8: 0x1f0f, 0x10b9: 0x1f1e, 0x10ba: 0x1f23, 0x10bb: 0x1e74, + 0x10bc: 0x1e79, 0x10bd: 0x1e9c, 0x10be: 0x1ea1, 0x10bf: 0x1e33, + // Block 0x43, offset 0x10c0 + 0x10c0: 0x1e38, 0x10c1: 0x1e1f, 0x10c2: 0x1e24, 0x10c3: 0x1e4c, 0x10c4: 0x1e51, 0x10c5: 0x1eba, + 0x10c6: 0x1ebf, 0x10c7: 0x1edd, 0x10c8: 0x1ee2, 0x10c9: 0x1e7e, 0x10ca: 0x1e83, 0x10cb: 0x1e88, + 0x10cc: 0x1e92, 0x10cd: 0x1e8d, 0x10ce: 0x1e65, 0x10cf: 0x1eb0, 0x10d0: 0x1ed3, 0x10d1: 0x1ef1, + 0x10d2: 0x1ef6, 0x10d3: 0x1f0a, 0x10d4: 0x1f0f, 0x10d5: 0x1f1e, 0x10d6: 0x1f23, 0x10d7: 0x1e74, + 0x10d8: 0x1e79, 0x10d9: 0x1e9c, 0x10da: 0x1ea1, 0x10db: 0x1e33, 0x10dc: 0x1e38, 0x10dd: 0x1e1f, + 0x10de: 0x1e24, 0x10df: 0x1e4c, 0x10e0: 0x1e51, 0x10e1: 0x1eba, 0x10e2: 0x1ebf, 0x10e3: 0x1edd, + 0x10e4: 0x1ee2, 0x10e5: 0x1e7e, 0x10e6: 0x1e83, 0x10e7: 0x1e88, 0x10e8: 0x1e92, 0x10e9: 0x1e8d, + 0x10ea: 0x1e65, 0x10eb: 0x1eb0, 0x10ec: 0x1ed3, 0x10ed: 0x1e7e, 0x10ee: 0x1e83, 0x10ef: 0x1e88, + 0x10f0: 0x1e92, 0x10f1: 0x1e6f, 0x10f2: 0x1e97, 0x10f3: 0x1eec, 0x10f4: 0x1e56, 0x10f5: 0x1e5b, + 0x10f6: 0x1e60, 0x10f7: 0x1e7e, 0x10f8: 0x1e83, 0x10f9: 0x1e88, 0x10fa: 0x1eec, 0x10fb: 0x1efb, + 0x10fc: 0x4408, 0x10fd: 0x4408, + // Block 0x44, offset 0x1100 + 0x1110: 0x2311, 0x1111: 0x2326, + 0x1112: 0x2326, 0x1113: 0x232d, 0x1114: 0x2334, 0x1115: 0x2349, 0x1116: 0x2350, 0x1117: 0x2357, + 0x1118: 0x237a, 0x1119: 0x237a, 0x111a: 0x239d, 0x111b: 0x2396, 0x111c: 0x23b2, 0x111d: 0x23a4, + 0x111e: 0x23ab, 0x111f: 0x23ce, 0x1120: 0x23ce, 0x1121: 0x23c7, 0x1122: 0x23d5, 0x1123: 0x23d5, + 0x1124: 0x23ff, 0x1125: 0x23ff, 0x1126: 0x241b, 0x1127: 0x23e3, 0x1128: 0x23e3, 0x1129: 0x23dc, + 0x112a: 0x23f1, 0x112b: 0x23f1, 0x112c: 0x23f8, 0x112d: 0x23f8, 0x112e: 0x2422, 0x112f: 0x2430, + 0x1130: 0x2430, 0x1131: 0x2437, 0x1132: 0x2437, 0x1133: 0x243e, 0x1134: 0x2445, 0x1135: 0x244c, + 0x1136: 0x2453, 0x1137: 0x2453, 0x1138: 0x245a, 0x1139: 0x2468, 0x113a: 0x2476, 0x113b: 0x246f, + 0x113c: 0x247d, 0x113d: 0x247d, 0x113e: 0x2492, 0x113f: 0x2499, + // Block 0x45, offset 0x1140 + 0x1140: 0x24ca, 0x1141: 0x24d8, 0x1142: 0x24d1, 0x1143: 0x24b5, 0x1144: 0x24b5, 0x1145: 0x24df, + 0x1146: 0x24df, 0x1147: 0x24e6, 0x1148: 0x24e6, 0x1149: 0x2510, 0x114a: 0x2517, 0x114b: 0x251e, + 0x114c: 0x24f4, 0x114d: 0x2502, 0x114e: 0x2525, 0x114f: 0x252c, + 0x1152: 0x24fb, 0x1153: 0x2580, 0x1154: 0x2587, 0x1155: 0x255d, 0x1156: 0x2564, 0x1157: 0x2548, + 0x1158: 0x2548, 0x1159: 0x254f, 0x115a: 0x2579, 0x115b: 0x2572, 0x115c: 0x259c, 0x115d: 0x259c, + 0x115e: 0x230a, 0x115f: 0x231f, 0x1160: 0x2318, 0x1161: 0x2342, 0x1162: 0x233b, 0x1163: 0x2365, + 0x1164: 0x235e, 0x1165: 0x2388, 0x1166: 0x236c, 0x1167: 0x2381, 0x1168: 0x23b9, 0x1169: 0x2406, + 0x116a: 0x23ea, 0x116b: 0x2429, 0x116c: 0x24c3, 0x116d: 0x24ed, 0x116e: 0x2595, 0x116f: 0x258e, + 0x1170: 0x25a3, 0x1171: 0x253a, 0x1172: 0x24a0, 0x1173: 0x256b, 0x1174: 0x2492, 0x1175: 0x24ca, + 0x1176: 0x2461, 0x1177: 0x24ae, 0x1178: 0x2541, 0x1179: 0x2533, 0x117a: 0x24bc, 0x117b: 0x24a7, + 0x117c: 0x24bc, 0x117d: 0x2541, 0x117e: 0x2373, 0x117f: 0x238f, + // Block 0x46, offset 0x1180 + 0x1180: 0x2509, 0x1181: 0x2484, 0x1182: 0x2303, 0x1183: 0x24a7, 0x1184: 0x244c, 0x1185: 0x241b, + 0x1186: 0x23c0, 0x1187: 0x2556, + 0x11b0: 0x2414, 0x11b1: 0x248b, 0x11b2: 0x27bf, 0x11b3: 0x27b6, 0x11b4: 0x27ec, 0x11b5: 0x27da, + 0x11b6: 0x27c8, 0x11b7: 0x27e3, 0x11b8: 0x27f5, 0x11b9: 0x240d, 0x11ba: 0x2c7c, 0x11bb: 0x2afc, + 0x11bc: 0x27d1, + // Block 0x47, offset 0x11c0 + 0x11d0: 0x0019, 0x11d1: 0x0483, + 0x11d2: 0x0487, 0x11d3: 0x0035, 0x11d4: 0x0037, 0x11d5: 0x0003, 0x11d6: 0x003f, 0x11d7: 0x04bf, + 0x11d8: 0x04c3, 0x11d9: 0x1b5c, + 0x11e0: 0x8132, 0x11e1: 0x8132, 0x11e2: 0x8132, 0x11e3: 0x8132, + 0x11e4: 0x8132, 0x11e5: 0x8132, 0x11e6: 0x8132, 0x11e7: 0x812d, 0x11e8: 0x812d, 0x11e9: 0x812d, + 0x11ea: 0x812d, 0x11eb: 0x812d, 0x11ec: 0x812d, 0x11ed: 0x812d, 0x11ee: 0x8132, 0x11ef: 0x8132, + 0x11f0: 0x1873, 0x11f1: 0x0443, 0x11f2: 0x043f, 0x11f3: 0x007f, 0x11f4: 0x007f, 0x11f5: 0x0011, + 0x11f6: 0x0013, 0x11f7: 0x00b7, 0x11f8: 0x00bb, 0x11f9: 0x04b7, 0x11fa: 0x04bb, 0x11fb: 0x04ab, + 0x11fc: 0x04af, 0x11fd: 0x0493, 0x11fe: 0x0497, 0x11ff: 0x048b, + // Block 0x48, offset 0x1200 + 0x1200: 0x048f, 0x1201: 0x049b, 0x1202: 0x049f, 0x1203: 0x04a3, 0x1204: 0x04a7, + 0x1207: 0x0077, 0x1208: 0x007b, 0x1209: 0x4269, 0x120a: 0x4269, 0x120b: 0x4269, + 0x120c: 0x4269, 0x120d: 0x007f, 0x120e: 0x007f, 0x120f: 0x007f, 0x1210: 0x0019, 0x1211: 0x0483, + 0x1212: 0x001d, 0x1214: 0x0037, 0x1215: 0x0035, 0x1216: 0x003f, 0x1217: 0x0003, + 0x1218: 0x0443, 0x1219: 0x0011, 0x121a: 0x0013, 0x121b: 0x00b7, 0x121c: 0x00bb, 0x121d: 0x04b7, + 0x121e: 0x04bb, 0x121f: 0x0007, 0x1220: 0x000d, 0x1221: 0x0015, 0x1222: 0x0017, 0x1223: 0x001b, + 0x1224: 0x0039, 0x1225: 0x003d, 0x1226: 0x003b, 0x1228: 0x0079, 0x1229: 0x0009, + 0x122a: 0x000b, 0x122b: 0x0041, + 0x1230: 0x42aa, 0x1231: 0x442c, 0x1232: 0x42af, 0x1234: 0x42b4, + 0x1236: 0x42b9, 0x1237: 0x4432, 0x1238: 0x42be, 0x1239: 0x4438, 0x123a: 0x42c3, 0x123b: 0x443e, + 0x123c: 0x42c8, 0x123d: 0x4444, 0x123e: 0x42cd, 0x123f: 0x444a, + // Block 0x49, offset 0x1240 + 0x1240: 0x0236, 0x1241: 0x440e, 0x1242: 0x440e, 0x1243: 0x4414, 0x1244: 0x4414, 0x1245: 0x4456, + 0x1246: 0x4456, 0x1247: 0x441a, 0x1248: 0x441a, 0x1249: 0x4462, 0x124a: 0x4462, 0x124b: 0x4462, + 0x124c: 0x4462, 0x124d: 0x0239, 0x124e: 0x0239, 0x124f: 0x023c, 0x1250: 0x023c, 0x1251: 0x023c, + 0x1252: 0x023c, 0x1253: 0x023f, 0x1254: 0x023f, 0x1255: 0x0242, 0x1256: 0x0242, 0x1257: 0x0242, + 0x1258: 0x0242, 0x1259: 0x0245, 0x125a: 0x0245, 0x125b: 0x0245, 0x125c: 0x0245, 0x125d: 0x0248, + 0x125e: 0x0248, 0x125f: 0x0248, 0x1260: 0x0248, 0x1261: 0x024b, 0x1262: 0x024b, 0x1263: 0x024b, + 0x1264: 0x024b, 0x1265: 0x024e, 0x1266: 0x024e, 0x1267: 0x024e, 0x1268: 0x024e, 0x1269: 0x0251, + 0x126a: 0x0251, 0x126b: 0x0254, 0x126c: 0x0254, 0x126d: 0x0257, 0x126e: 0x0257, 0x126f: 0x025a, + 0x1270: 0x025a, 0x1271: 0x025d, 0x1272: 0x025d, 0x1273: 0x025d, 0x1274: 0x025d, 0x1275: 0x0260, + 0x1276: 0x0260, 0x1277: 0x0260, 0x1278: 0x0260, 0x1279: 0x0263, 0x127a: 0x0263, 0x127b: 0x0263, + 0x127c: 0x0263, 0x127d: 0x0266, 0x127e: 0x0266, 0x127f: 0x0266, + // Block 0x4a, offset 0x1280 + 0x1280: 0x0266, 0x1281: 0x0269, 0x1282: 0x0269, 0x1283: 0x0269, 0x1284: 0x0269, 0x1285: 0x026c, + 0x1286: 0x026c, 0x1287: 0x026c, 0x1288: 0x026c, 0x1289: 0x026f, 0x128a: 0x026f, 0x128b: 0x026f, + 0x128c: 0x026f, 0x128d: 0x0272, 0x128e: 0x0272, 0x128f: 0x0272, 0x1290: 0x0272, 0x1291: 0x0275, + 0x1292: 0x0275, 0x1293: 0x0275, 0x1294: 0x0275, 0x1295: 0x0278, 0x1296: 0x0278, 0x1297: 0x0278, + 0x1298: 0x0278, 0x1299: 0x027b, 0x129a: 0x027b, 0x129b: 0x027b, 0x129c: 0x027b, 0x129d: 0x027e, + 0x129e: 0x027e, 0x129f: 0x027e, 0x12a0: 0x027e, 0x12a1: 0x0281, 0x12a2: 0x0281, 0x12a3: 0x0281, + 0x12a4: 0x0281, 0x12a5: 0x0284, 0x12a6: 0x0284, 0x12a7: 0x0284, 0x12a8: 0x0284, 0x12a9: 0x0287, + 0x12aa: 0x0287, 0x12ab: 0x0287, 0x12ac: 0x0287, 0x12ad: 0x028a, 0x12ae: 0x028a, 0x12af: 0x028d, + 0x12b0: 0x028d, 0x12b1: 0x0290, 0x12b2: 0x0290, 0x12b3: 0x0290, 0x12b4: 0x0290, 0x12b5: 0x2e00, + 0x12b6: 0x2e00, 0x12b7: 0x2e08, 0x12b8: 0x2e08, 0x12b9: 0x2e10, 0x12ba: 0x2e10, 0x12bb: 0x1f82, + 0x12bc: 0x1f82, + // Block 0x4b, offset 0x12c0 + 0x12c0: 0x0081, 0x12c1: 0x0083, 0x12c2: 0x0085, 0x12c3: 0x0087, 0x12c4: 0x0089, 0x12c5: 0x008b, + 0x12c6: 0x008d, 0x12c7: 0x008f, 0x12c8: 0x0091, 0x12c9: 0x0093, 0x12ca: 0x0095, 0x12cb: 0x0097, + 0x12cc: 0x0099, 0x12cd: 0x009b, 0x12ce: 0x009d, 0x12cf: 0x009f, 0x12d0: 0x00a1, 0x12d1: 0x00a3, + 0x12d2: 0x00a5, 0x12d3: 0x00a7, 0x12d4: 0x00a9, 0x12d5: 0x00ab, 0x12d6: 0x00ad, 0x12d7: 0x00af, + 0x12d8: 0x00b1, 0x12d9: 0x00b3, 0x12da: 0x00b5, 0x12db: 0x00b7, 0x12dc: 0x00b9, 0x12dd: 0x00bb, + 0x12de: 0x00bd, 0x12df: 0x0477, 0x12e0: 0x047b, 0x12e1: 0x0487, 0x12e2: 0x049b, 0x12e3: 0x049f, + 0x12e4: 0x0483, 0x12e5: 0x05ab, 0x12e6: 0x05a3, 0x12e7: 0x04c7, 0x12e8: 0x04cf, 0x12e9: 0x04d7, + 0x12ea: 0x04df, 0x12eb: 0x04e7, 0x12ec: 0x056b, 0x12ed: 0x0573, 0x12ee: 0x057b, 0x12ef: 0x051f, + 0x12f0: 0x05af, 0x12f1: 0x04cb, 0x12f2: 0x04d3, 0x12f3: 0x04db, 0x12f4: 0x04e3, 0x12f5: 0x04eb, + 0x12f6: 0x04ef, 0x12f7: 0x04f3, 0x12f8: 0x04f7, 0x12f9: 0x04fb, 0x12fa: 0x04ff, 0x12fb: 0x0503, + 0x12fc: 0x0507, 0x12fd: 0x050b, 0x12fe: 0x050f, 0x12ff: 0x0513, + // Block 0x4c, offset 0x1300 + 0x1300: 0x0517, 0x1301: 0x051b, 0x1302: 0x0523, 0x1303: 0x0527, 0x1304: 0x052b, 0x1305: 0x052f, + 0x1306: 0x0533, 0x1307: 0x0537, 0x1308: 0x053b, 0x1309: 0x053f, 0x130a: 0x0543, 0x130b: 0x0547, + 0x130c: 0x054b, 0x130d: 0x054f, 0x130e: 0x0553, 0x130f: 0x0557, 0x1310: 0x055b, 0x1311: 0x055f, + 0x1312: 0x0563, 0x1313: 0x0567, 0x1314: 0x056f, 0x1315: 0x0577, 0x1316: 0x057f, 0x1317: 0x0583, + 0x1318: 0x0587, 0x1319: 0x058b, 0x131a: 0x058f, 0x131b: 0x0593, 0x131c: 0x0597, 0x131d: 0x05a7, + 0x131e: 0x4a78, 0x131f: 0x4a7e, 0x1320: 0x03c3, 0x1321: 0x0313, 0x1322: 0x0317, 0x1323: 0x4a3b, + 0x1324: 0x031b, 0x1325: 0x4a41, 0x1326: 0x4a47, 0x1327: 0x031f, 0x1328: 0x0323, 0x1329: 0x0327, + 0x132a: 0x4a4d, 0x132b: 0x4a53, 0x132c: 0x4a59, 0x132d: 0x4a5f, 0x132e: 0x4a65, 0x132f: 0x4a6b, + 0x1330: 0x0367, 0x1331: 0x032b, 0x1332: 0x032f, 0x1333: 0x0333, 0x1334: 0x037b, 0x1335: 0x0337, + 0x1336: 0x033b, 0x1337: 0x033f, 0x1338: 0x0343, 0x1339: 0x0347, 0x133a: 0x034b, 0x133b: 0x034f, + 0x133c: 0x0353, 0x133d: 0x0357, 0x133e: 0x035b, + // Block 0x4d, offset 0x1340 + 0x1342: 0x49bd, 0x1343: 0x49c3, 0x1344: 0x49c9, 0x1345: 0x49cf, + 0x1346: 0x49d5, 0x1347: 0x49db, 0x134a: 0x49e1, 0x134b: 0x49e7, + 0x134c: 0x49ed, 0x134d: 0x49f3, 0x134e: 0x49f9, 0x134f: 0x49ff, + 0x1352: 0x4a05, 0x1353: 0x4a0b, 0x1354: 0x4a11, 0x1355: 0x4a17, 0x1356: 0x4a1d, 0x1357: 0x4a23, + 0x135a: 0x4a29, 0x135b: 0x4a2f, 0x135c: 0x4a35, + 0x1360: 0x00bf, 0x1361: 0x00c2, 0x1362: 0x00cb, 0x1363: 0x4264, + 0x1364: 0x00c8, 0x1365: 0x00c5, 0x1366: 0x0447, 0x1368: 0x046b, 0x1369: 0x044b, + 0x136a: 0x044f, 0x136b: 0x0453, 0x136c: 0x0457, 0x136d: 0x046f, 0x136e: 0x0473, + // Block 0x4e, offset 0x1380 + 0x1380: 0x0063, 0x1381: 0x0065, 0x1382: 0x0067, 0x1383: 0x0069, 0x1384: 0x006b, 0x1385: 0x006d, + 0x1386: 0x006f, 0x1387: 0x0071, 0x1388: 0x0073, 0x1389: 0x0075, 0x138a: 0x0083, 0x138b: 0x0085, + 0x138c: 0x0087, 0x138d: 0x0089, 0x138e: 0x008b, 0x138f: 0x008d, 0x1390: 0x008f, 0x1391: 0x0091, + 0x1392: 0x0093, 0x1393: 0x0095, 0x1394: 0x0097, 0x1395: 0x0099, 0x1396: 0x009b, 0x1397: 0x009d, + 0x1398: 0x009f, 0x1399: 0x00a1, 0x139a: 0x00a3, 0x139b: 0x00a5, 0x139c: 0x00a7, 0x139d: 0x00a9, + 0x139e: 0x00ab, 0x139f: 0x00ad, 0x13a0: 0x00af, 0x13a1: 0x00b1, 0x13a2: 0x00b3, 0x13a3: 0x00b5, + 0x13a4: 0x00dd, 0x13a5: 0x00f2, 0x13a8: 0x0173, 0x13a9: 0x0176, + 0x13aa: 0x0179, 0x13ab: 0x017c, 0x13ac: 0x017f, 0x13ad: 0x0182, 0x13ae: 0x0185, 0x13af: 0x0188, + 0x13b0: 0x018b, 0x13b1: 0x018e, 0x13b2: 0x0191, 0x13b3: 0x0194, 0x13b4: 0x0197, 0x13b5: 0x019a, + 0x13b6: 0x019d, 0x13b7: 0x01a0, 0x13b8: 0x01a3, 0x13b9: 0x0188, 0x13ba: 0x01a6, 0x13bb: 0x01a9, + 0x13bc: 0x01ac, 0x13bd: 0x01af, 0x13be: 0x01b2, 0x13bf: 0x01b5, + // Block 0x4f, offset 0x13c0 + 0x13c0: 0x01fd, 0x13c1: 0x0200, 0x13c2: 0x0203, 0x13c3: 0x045b, 0x13c4: 0x01c7, 0x13c5: 0x01d0, + 0x13c6: 0x01d6, 0x13c7: 0x01fa, 0x13c8: 0x01eb, 0x13c9: 0x01e8, 0x13ca: 0x0206, 0x13cb: 0x0209, + 0x13ce: 0x0021, 0x13cf: 0x0023, 0x13d0: 0x0025, 0x13d1: 0x0027, + 0x13d2: 0x0029, 0x13d3: 0x002b, 0x13d4: 0x002d, 0x13d5: 0x002f, 0x13d6: 0x0031, 0x13d7: 0x0033, + 0x13d8: 0x0021, 0x13d9: 0x0023, 0x13da: 0x0025, 0x13db: 0x0027, 0x13dc: 0x0029, 0x13dd: 0x002b, + 0x13de: 0x002d, 0x13df: 0x002f, 0x13e0: 0x0031, 0x13e1: 0x0033, 0x13e2: 0x0021, 0x13e3: 0x0023, + 0x13e4: 0x0025, 0x13e5: 0x0027, 0x13e6: 0x0029, 0x13e7: 0x002b, 0x13e8: 0x002d, 0x13e9: 0x002f, + 0x13ea: 0x0031, 0x13eb: 0x0033, 0x13ec: 0x0021, 0x13ed: 0x0023, 0x13ee: 0x0025, 0x13ef: 0x0027, + 0x13f0: 0x0029, 0x13f1: 0x002b, 0x13f2: 0x002d, 0x13f3: 0x002f, 0x13f4: 0x0031, 0x13f5: 0x0033, + 0x13f6: 0x0021, 0x13f7: 0x0023, 0x13f8: 0x0025, 0x13f9: 0x0027, 0x13fa: 0x0029, 0x13fb: 0x002b, + 0x13fc: 0x002d, 0x13fd: 0x002f, 0x13fe: 0x0031, 0x13ff: 0x0033, + // Block 0x50, offset 0x1400 + 0x1400: 0x0239, 0x1401: 0x023c, 0x1402: 0x0248, 0x1403: 0x0251, 0x1405: 0x028a, + 0x1406: 0x025a, 0x1407: 0x024b, 0x1408: 0x0269, 0x1409: 0x0290, 0x140a: 0x027b, 0x140b: 0x027e, + 0x140c: 0x0281, 0x140d: 0x0284, 0x140e: 0x025d, 0x140f: 0x026f, 0x1410: 0x0275, 0x1411: 0x0263, + 0x1412: 0x0278, 0x1413: 0x0257, 0x1414: 0x0260, 0x1415: 0x0242, 0x1416: 0x0245, 0x1417: 0x024e, + 0x1418: 0x0254, 0x1419: 0x0266, 0x141a: 0x026c, 0x141b: 0x0272, 0x141c: 0x0293, 0x141d: 0x02e4, + 0x141e: 0x02cc, 0x141f: 0x0296, 0x1421: 0x023c, 0x1422: 0x0248, + 0x1424: 0x0287, 0x1427: 0x024b, 0x1429: 0x0290, + 0x142a: 0x027b, 0x142b: 0x027e, 0x142c: 0x0281, 0x142d: 0x0284, 0x142e: 0x025d, 0x142f: 0x026f, + 0x1430: 0x0275, 0x1431: 0x0263, 0x1432: 0x0278, 0x1434: 0x0260, 0x1435: 0x0242, + 0x1436: 0x0245, 0x1437: 0x024e, 0x1439: 0x0266, 0x143b: 0x0272, + // Block 0x51, offset 0x1440 + 0x1442: 0x0248, + 0x1447: 0x024b, 0x1449: 0x0290, 0x144b: 0x027e, + 0x144d: 0x0284, 0x144e: 0x025d, 0x144f: 0x026f, 0x1451: 0x0263, + 0x1452: 0x0278, 0x1454: 0x0260, 0x1457: 0x024e, + 0x1459: 0x0266, 0x145b: 0x0272, 0x145d: 0x02e4, + 0x145f: 0x0296, 0x1461: 0x023c, 0x1462: 0x0248, + 0x1464: 0x0287, 0x1467: 0x024b, 0x1468: 0x0269, 0x1469: 0x0290, + 0x146a: 0x027b, 0x146c: 0x0281, 0x146d: 0x0284, 0x146e: 0x025d, 0x146f: 0x026f, + 0x1470: 0x0275, 0x1471: 0x0263, 0x1472: 0x0278, 0x1474: 0x0260, 0x1475: 0x0242, + 0x1476: 0x0245, 0x1477: 0x024e, 0x1479: 0x0266, 0x147a: 0x026c, 0x147b: 0x0272, + 0x147c: 0x0293, 0x147e: 0x02cc, + // Block 0x52, offset 0x1480 + 0x1480: 0x0239, 0x1481: 0x023c, 0x1482: 0x0248, 0x1483: 0x0251, 0x1484: 0x0287, 0x1485: 0x028a, + 0x1486: 0x025a, 0x1487: 0x024b, 0x1488: 0x0269, 0x1489: 0x0290, 0x148b: 0x027e, + 0x148c: 0x0281, 0x148d: 0x0284, 0x148e: 0x025d, 0x148f: 0x026f, 0x1490: 0x0275, 0x1491: 0x0263, + 0x1492: 0x0278, 0x1493: 0x0257, 0x1494: 0x0260, 0x1495: 0x0242, 0x1496: 0x0245, 0x1497: 0x024e, + 0x1498: 0x0254, 0x1499: 0x0266, 0x149a: 0x026c, 0x149b: 0x0272, + 0x14a1: 0x023c, 0x14a2: 0x0248, 0x14a3: 0x0251, + 0x14a5: 0x028a, 0x14a6: 0x025a, 0x14a7: 0x024b, 0x14a8: 0x0269, 0x14a9: 0x0290, + 0x14ab: 0x027e, 0x14ac: 0x0281, 0x14ad: 0x0284, 0x14ae: 0x025d, 0x14af: 0x026f, + 0x14b0: 0x0275, 0x14b1: 0x0263, 0x14b2: 0x0278, 0x14b3: 0x0257, 0x14b4: 0x0260, 0x14b5: 0x0242, + 0x14b6: 0x0245, 0x14b7: 0x024e, 0x14b8: 0x0254, 0x14b9: 0x0266, 0x14ba: 0x026c, 0x14bb: 0x0272, + // Block 0x53, offset 0x14c0 + 0x14c0: 0x1879, 0x14c1: 0x1876, 0x14c2: 0x187c, 0x14c3: 0x18a0, 0x14c4: 0x18c4, 0x14c5: 0x18e8, + 0x14c6: 0x190c, 0x14c7: 0x1915, 0x14c8: 0x191b, 0x14c9: 0x1921, 0x14ca: 0x1927, + 0x14d0: 0x1a8c, 0x14d1: 0x1a90, + 0x14d2: 0x1a94, 0x14d3: 0x1a98, 0x14d4: 0x1a9c, 0x14d5: 0x1aa0, 0x14d6: 0x1aa4, 0x14d7: 0x1aa8, + 0x14d8: 0x1aac, 0x14d9: 0x1ab0, 0x14da: 0x1ab4, 0x14db: 0x1ab8, 0x14dc: 0x1abc, 0x14dd: 0x1ac0, + 0x14de: 0x1ac4, 0x14df: 0x1ac8, 0x14e0: 0x1acc, 0x14e1: 0x1ad0, 0x14e2: 0x1ad4, 0x14e3: 0x1ad8, + 0x14e4: 0x1adc, 0x14e5: 0x1ae0, 0x14e6: 0x1ae4, 0x14e7: 0x1ae8, 0x14e8: 0x1aec, 0x14e9: 0x1af0, + 0x14ea: 0x271e, 0x14eb: 0x0047, 0x14ec: 0x0065, 0x14ed: 0x193c, 0x14ee: 0x19b1, + 0x14f0: 0x0043, 0x14f1: 0x0045, 0x14f2: 0x0047, 0x14f3: 0x0049, 0x14f4: 0x004b, 0x14f5: 0x004d, + 0x14f6: 0x004f, 0x14f7: 0x0051, 0x14f8: 0x0053, 0x14f9: 0x0055, 0x14fa: 0x0057, 0x14fb: 0x0059, + 0x14fc: 0x005b, 0x14fd: 0x005d, 0x14fe: 0x005f, 0x14ff: 0x0061, + // Block 0x54, offset 0x1500 + 0x1500: 0x26ad, 0x1501: 0x26c2, 0x1502: 0x0503, + 0x1510: 0x0c0f, 0x1511: 0x0a47, + 0x1512: 0x08d3, 0x1513: 0x45c4, 0x1514: 0x071b, 0x1515: 0x09ef, 0x1516: 0x132f, 0x1517: 0x09ff, + 0x1518: 0x0727, 0x1519: 0x0cd7, 0x151a: 0x0eaf, 0x151b: 0x0caf, 0x151c: 0x0827, 0x151d: 0x0b6b, + 0x151e: 0x07bf, 0x151f: 0x0cb7, 0x1520: 0x0813, 0x1521: 0x1117, 0x1522: 0x0f83, 0x1523: 0x138b, + 0x1524: 0x09d3, 0x1525: 0x090b, 0x1526: 0x0e63, 0x1527: 0x0c1b, 0x1528: 0x0c47, 0x1529: 0x06bf, + 0x152a: 0x06cb, 0x152b: 0x140b, 0x152c: 0x0adb, 0x152d: 0x06e7, 0x152e: 0x08ef, 0x152f: 0x0c3b, + 0x1530: 0x13b3, 0x1531: 0x0c13, 0x1532: 0x106f, 0x1533: 0x10ab, 0x1534: 0x08f7, 0x1535: 0x0e43, + 0x1536: 0x0d0b, 0x1537: 0x0d07, 0x1538: 0x0f97, 0x1539: 0x082b, 0x153a: 0x0957, 0x153b: 0x1443, + // Block 0x55, offset 0x1540 + 0x1540: 0x06fb, 0x1541: 0x06f3, 0x1542: 0x0703, 0x1543: 0x1647, 0x1544: 0x0747, 0x1545: 0x0757, + 0x1546: 0x075b, 0x1547: 0x0763, 0x1548: 0x076b, 0x1549: 0x076f, 0x154a: 0x077b, 0x154b: 0x0773, + 0x154c: 0x05b3, 0x154d: 0x165b, 0x154e: 0x078f, 0x154f: 0x0793, 0x1550: 0x0797, 0x1551: 0x07b3, + 0x1552: 0x164c, 0x1553: 0x05b7, 0x1554: 0x079f, 0x1555: 0x07bf, 0x1556: 0x1656, 0x1557: 0x07cf, + 0x1558: 0x07d7, 0x1559: 0x0737, 0x155a: 0x07df, 0x155b: 0x07e3, 0x155c: 0x1831, 0x155d: 0x07ff, + 0x155e: 0x0807, 0x155f: 0x05bf, 0x1560: 0x081f, 0x1561: 0x0823, 0x1562: 0x082b, 0x1563: 0x082f, + 0x1564: 0x05c3, 0x1565: 0x0847, 0x1566: 0x084b, 0x1567: 0x0857, 0x1568: 0x0863, 0x1569: 0x0867, + 0x156a: 0x086b, 0x156b: 0x0873, 0x156c: 0x0893, 0x156d: 0x0897, 0x156e: 0x089f, 0x156f: 0x08af, + 0x1570: 0x08b7, 0x1571: 0x08bb, 0x1572: 0x08bb, 0x1573: 0x08bb, 0x1574: 0x166a, 0x1575: 0x0e93, + 0x1576: 0x08cf, 0x1577: 0x08d7, 0x1578: 0x166f, 0x1579: 0x08e3, 0x157a: 0x08eb, 0x157b: 0x08f3, + 0x157c: 0x091b, 0x157d: 0x0907, 0x157e: 0x0913, 0x157f: 0x0917, + // Block 0x56, offset 0x1580 + 0x1580: 0x091f, 0x1581: 0x0927, 0x1582: 0x092b, 0x1583: 0x0933, 0x1584: 0x093b, 0x1585: 0x093f, + 0x1586: 0x093f, 0x1587: 0x0947, 0x1588: 0x094f, 0x1589: 0x0953, 0x158a: 0x095f, 0x158b: 0x0983, + 0x158c: 0x0967, 0x158d: 0x0987, 0x158e: 0x096b, 0x158f: 0x0973, 0x1590: 0x080b, 0x1591: 0x09cf, + 0x1592: 0x0997, 0x1593: 0x099b, 0x1594: 0x099f, 0x1595: 0x0993, 0x1596: 0x09a7, 0x1597: 0x09a3, + 0x1598: 0x09bb, 0x1599: 0x1674, 0x159a: 0x09d7, 0x159b: 0x09db, 0x159c: 0x09e3, 0x159d: 0x09ef, + 0x159e: 0x09f7, 0x159f: 0x0a13, 0x15a0: 0x1679, 0x15a1: 0x167e, 0x15a2: 0x0a1f, 0x15a3: 0x0a23, + 0x15a4: 0x0a27, 0x15a5: 0x0a1b, 0x15a6: 0x0a2f, 0x15a7: 0x05c7, 0x15a8: 0x05cb, 0x15a9: 0x0a37, + 0x15aa: 0x0a3f, 0x15ab: 0x0a3f, 0x15ac: 0x1683, 0x15ad: 0x0a5b, 0x15ae: 0x0a5f, 0x15af: 0x0a63, + 0x15b0: 0x0a6b, 0x15b1: 0x1688, 0x15b2: 0x0a73, 0x15b3: 0x0a77, 0x15b4: 0x0b4f, 0x15b5: 0x0a7f, + 0x15b6: 0x05cf, 0x15b7: 0x0a8b, 0x15b8: 0x0a9b, 0x15b9: 0x0aa7, 0x15ba: 0x0aa3, 0x15bb: 0x1692, + 0x15bc: 0x0aaf, 0x15bd: 0x1697, 0x15be: 0x0abb, 0x15bf: 0x0ab7, + // Block 0x57, offset 0x15c0 + 0x15c0: 0x0abf, 0x15c1: 0x0acf, 0x15c2: 0x0ad3, 0x15c3: 0x05d3, 0x15c4: 0x0ae3, 0x15c5: 0x0aeb, + 0x15c6: 0x0aef, 0x15c7: 0x0af3, 0x15c8: 0x05d7, 0x15c9: 0x169c, 0x15ca: 0x05db, 0x15cb: 0x0b0f, + 0x15cc: 0x0b13, 0x15cd: 0x0b17, 0x15ce: 0x0b1f, 0x15cf: 0x1863, 0x15d0: 0x0b37, 0x15d1: 0x16a6, + 0x15d2: 0x16a6, 0x15d3: 0x11d7, 0x15d4: 0x0b47, 0x15d5: 0x0b47, 0x15d6: 0x05df, 0x15d7: 0x16c9, + 0x15d8: 0x179b, 0x15d9: 0x0b57, 0x15da: 0x0b5f, 0x15db: 0x05e3, 0x15dc: 0x0b73, 0x15dd: 0x0b83, + 0x15de: 0x0b87, 0x15df: 0x0b8f, 0x15e0: 0x0b9f, 0x15e1: 0x05eb, 0x15e2: 0x05e7, 0x15e3: 0x0ba3, + 0x15e4: 0x16ab, 0x15e5: 0x0ba7, 0x15e6: 0x0bbb, 0x15e7: 0x0bbf, 0x15e8: 0x0bc3, 0x15e9: 0x0bbf, + 0x15ea: 0x0bcf, 0x15eb: 0x0bd3, 0x15ec: 0x0be3, 0x15ed: 0x0bdb, 0x15ee: 0x0bdf, 0x15ef: 0x0be7, + 0x15f0: 0x0beb, 0x15f1: 0x0bef, 0x15f2: 0x0bfb, 0x15f3: 0x0bff, 0x15f4: 0x0c17, 0x15f5: 0x0c1f, + 0x15f6: 0x0c2f, 0x15f7: 0x0c43, 0x15f8: 0x16ba, 0x15f9: 0x0c3f, 0x15fa: 0x0c33, 0x15fb: 0x0c4b, + 0x15fc: 0x0c53, 0x15fd: 0x0c67, 0x15fe: 0x16bf, 0x15ff: 0x0c6f, + // Block 0x58, offset 0x1600 + 0x1600: 0x0c63, 0x1601: 0x0c5b, 0x1602: 0x05ef, 0x1603: 0x0c77, 0x1604: 0x0c7f, 0x1605: 0x0c87, + 0x1606: 0x0c7b, 0x1607: 0x05f3, 0x1608: 0x0c97, 0x1609: 0x0c9f, 0x160a: 0x16c4, 0x160b: 0x0ccb, + 0x160c: 0x0cff, 0x160d: 0x0cdb, 0x160e: 0x05ff, 0x160f: 0x0ce7, 0x1610: 0x05fb, 0x1611: 0x05f7, + 0x1612: 0x07c3, 0x1613: 0x07c7, 0x1614: 0x0d03, 0x1615: 0x0ceb, 0x1616: 0x11ab, 0x1617: 0x0663, + 0x1618: 0x0d0f, 0x1619: 0x0d13, 0x161a: 0x0d17, 0x161b: 0x0d2b, 0x161c: 0x0d23, 0x161d: 0x16dd, + 0x161e: 0x0603, 0x161f: 0x0d3f, 0x1620: 0x0d33, 0x1621: 0x0d4f, 0x1622: 0x0d57, 0x1623: 0x16e7, + 0x1624: 0x0d5b, 0x1625: 0x0d47, 0x1626: 0x0d63, 0x1627: 0x0607, 0x1628: 0x0d67, 0x1629: 0x0d6b, + 0x162a: 0x0d6f, 0x162b: 0x0d7b, 0x162c: 0x16ec, 0x162d: 0x0d83, 0x162e: 0x060b, 0x162f: 0x0d8f, + 0x1630: 0x16f1, 0x1631: 0x0d93, 0x1632: 0x060f, 0x1633: 0x0d9f, 0x1634: 0x0dab, 0x1635: 0x0db7, + 0x1636: 0x0dbb, 0x1637: 0x16f6, 0x1638: 0x168d, 0x1639: 0x16fb, 0x163a: 0x0ddb, 0x163b: 0x1700, + 0x163c: 0x0de7, 0x163d: 0x0def, 0x163e: 0x0ddf, 0x163f: 0x0dfb, + // Block 0x59, offset 0x1640 + 0x1640: 0x0e0b, 0x1641: 0x0e1b, 0x1642: 0x0e0f, 0x1643: 0x0e13, 0x1644: 0x0e1f, 0x1645: 0x0e23, + 0x1646: 0x1705, 0x1647: 0x0e07, 0x1648: 0x0e3b, 0x1649: 0x0e3f, 0x164a: 0x0613, 0x164b: 0x0e53, + 0x164c: 0x0e4f, 0x164d: 0x170a, 0x164e: 0x0e33, 0x164f: 0x0e6f, 0x1650: 0x170f, 0x1651: 0x1714, + 0x1652: 0x0e73, 0x1653: 0x0e87, 0x1654: 0x0e83, 0x1655: 0x0e7f, 0x1656: 0x0617, 0x1657: 0x0e8b, + 0x1658: 0x0e9b, 0x1659: 0x0e97, 0x165a: 0x0ea3, 0x165b: 0x1651, 0x165c: 0x0eb3, 0x165d: 0x1719, + 0x165e: 0x0ebf, 0x165f: 0x1723, 0x1660: 0x0ed3, 0x1661: 0x0edf, 0x1662: 0x0ef3, 0x1663: 0x1728, + 0x1664: 0x0f07, 0x1665: 0x0f0b, 0x1666: 0x172d, 0x1667: 0x1732, 0x1668: 0x0f27, 0x1669: 0x0f37, + 0x166a: 0x061b, 0x166b: 0x0f3b, 0x166c: 0x061f, 0x166d: 0x061f, 0x166e: 0x0f53, 0x166f: 0x0f57, + 0x1670: 0x0f5f, 0x1671: 0x0f63, 0x1672: 0x0f6f, 0x1673: 0x0623, 0x1674: 0x0f87, 0x1675: 0x1737, + 0x1676: 0x0fa3, 0x1677: 0x173c, 0x1678: 0x0faf, 0x1679: 0x16a1, 0x167a: 0x0fbf, 0x167b: 0x1741, + 0x167c: 0x1746, 0x167d: 0x174b, 0x167e: 0x0627, 0x167f: 0x062b, + // Block 0x5a, offset 0x1680 + 0x1680: 0x0ff7, 0x1681: 0x1755, 0x1682: 0x1750, 0x1683: 0x175a, 0x1684: 0x175f, 0x1685: 0x0fff, + 0x1686: 0x1003, 0x1687: 0x1003, 0x1688: 0x100b, 0x1689: 0x0633, 0x168a: 0x100f, 0x168b: 0x0637, + 0x168c: 0x063b, 0x168d: 0x1769, 0x168e: 0x1023, 0x168f: 0x102b, 0x1690: 0x1037, 0x1691: 0x063f, + 0x1692: 0x176e, 0x1693: 0x105b, 0x1694: 0x1773, 0x1695: 0x1778, 0x1696: 0x107b, 0x1697: 0x1093, + 0x1698: 0x0643, 0x1699: 0x109b, 0x169a: 0x109f, 0x169b: 0x10a3, 0x169c: 0x177d, 0x169d: 0x1782, + 0x169e: 0x1782, 0x169f: 0x10bb, 0x16a0: 0x0647, 0x16a1: 0x1787, 0x16a2: 0x10cf, 0x16a3: 0x10d3, + 0x16a4: 0x064b, 0x16a5: 0x178c, 0x16a6: 0x10ef, 0x16a7: 0x064f, 0x16a8: 0x10ff, 0x16a9: 0x10f7, + 0x16aa: 0x1107, 0x16ab: 0x1796, 0x16ac: 0x111f, 0x16ad: 0x0653, 0x16ae: 0x112b, 0x16af: 0x1133, + 0x16b0: 0x1143, 0x16b1: 0x0657, 0x16b2: 0x17a0, 0x16b3: 0x17a5, 0x16b4: 0x065b, 0x16b5: 0x17aa, + 0x16b6: 0x115b, 0x16b7: 0x17af, 0x16b8: 0x1167, 0x16b9: 0x1173, 0x16ba: 0x117b, 0x16bb: 0x17b4, + 0x16bc: 0x17b9, 0x16bd: 0x118f, 0x16be: 0x17be, 0x16bf: 0x1197, + // Block 0x5b, offset 0x16c0 + 0x16c0: 0x16ce, 0x16c1: 0x065f, 0x16c2: 0x11af, 0x16c3: 0x11b3, 0x16c4: 0x0667, 0x16c5: 0x11b7, + 0x16c6: 0x0a33, 0x16c7: 0x17c3, 0x16c8: 0x17c8, 0x16c9: 0x16d3, 0x16ca: 0x16d8, 0x16cb: 0x11d7, + 0x16cc: 0x11db, 0x16cd: 0x13f3, 0x16ce: 0x066b, 0x16cf: 0x1207, 0x16d0: 0x1203, 0x16d1: 0x120b, + 0x16d2: 0x083f, 0x16d3: 0x120f, 0x16d4: 0x1213, 0x16d5: 0x1217, 0x16d6: 0x121f, 0x16d7: 0x17cd, + 0x16d8: 0x121b, 0x16d9: 0x1223, 0x16da: 0x1237, 0x16db: 0x123b, 0x16dc: 0x1227, 0x16dd: 0x123f, + 0x16de: 0x1253, 0x16df: 0x1267, 0x16e0: 0x1233, 0x16e1: 0x1247, 0x16e2: 0x124b, 0x16e3: 0x124f, + 0x16e4: 0x17d2, 0x16e5: 0x17dc, 0x16e6: 0x17d7, 0x16e7: 0x066f, 0x16e8: 0x126f, 0x16e9: 0x1273, + 0x16ea: 0x127b, 0x16eb: 0x17f0, 0x16ec: 0x127f, 0x16ed: 0x17e1, 0x16ee: 0x0673, 0x16ef: 0x0677, + 0x16f0: 0x17e6, 0x16f1: 0x17eb, 0x16f2: 0x067b, 0x16f3: 0x129f, 0x16f4: 0x12a3, 0x16f5: 0x12a7, + 0x16f6: 0x12ab, 0x16f7: 0x12b7, 0x16f8: 0x12b3, 0x16f9: 0x12bf, 0x16fa: 0x12bb, 0x16fb: 0x12cb, + 0x16fc: 0x12c3, 0x16fd: 0x12c7, 0x16fe: 0x12cf, 0x16ff: 0x067f, + // Block 0x5c, offset 0x1700 + 0x1700: 0x12d7, 0x1701: 0x12db, 0x1702: 0x0683, 0x1703: 0x12eb, 0x1704: 0x12ef, 0x1705: 0x17f5, + 0x1706: 0x12fb, 0x1707: 0x12ff, 0x1708: 0x0687, 0x1709: 0x130b, 0x170a: 0x05bb, 0x170b: 0x17fa, + 0x170c: 0x17ff, 0x170d: 0x068b, 0x170e: 0x068f, 0x170f: 0x1337, 0x1710: 0x134f, 0x1711: 0x136b, + 0x1712: 0x137b, 0x1713: 0x1804, 0x1714: 0x138f, 0x1715: 0x1393, 0x1716: 0x13ab, 0x1717: 0x13b7, + 0x1718: 0x180e, 0x1719: 0x1660, 0x171a: 0x13c3, 0x171b: 0x13bf, 0x171c: 0x13cb, 0x171d: 0x1665, + 0x171e: 0x13d7, 0x171f: 0x13e3, 0x1720: 0x1813, 0x1721: 0x1818, 0x1722: 0x1423, 0x1723: 0x142f, + 0x1724: 0x1437, 0x1725: 0x181d, 0x1726: 0x143b, 0x1727: 0x1467, 0x1728: 0x1473, 0x1729: 0x1477, + 0x172a: 0x146f, 0x172b: 0x1483, 0x172c: 0x1487, 0x172d: 0x1822, 0x172e: 0x1493, 0x172f: 0x0693, + 0x1730: 0x149b, 0x1731: 0x1827, 0x1732: 0x0697, 0x1733: 0x14d3, 0x1734: 0x0ac3, 0x1735: 0x14eb, + 0x1736: 0x182c, 0x1737: 0x1836, 0x1738: 0x069b, 0x1739: 0x069f, 0x173a: 0x1513, 0x173b: 0x183b, + 0x173c: 0x06a3, 0x173d: 0x1840, 0x173e: 0x152b, 0x173f: 0x152b, + // Block 0x5d, offset 0x1740 + 0x1740: 0x1533, 0x1741: 0x1845, 0x1742: 0x154b, 0x1743: 0x06a7, 0x1744: 0x155b, 0x1745: 0x1567, + 0x1746: 0x156f, 0x1747: 0x1577, 0x1748: 0x06ab, 0x1749: 0x184a, 0x174a: 0x158b, 0x174b: 0x15a7, + 0x174c: 0x15b3, 0x174d: 0x06af, 0x174e: 0x06b3, 0x174f: 0x15b7, 0x1750: 0x184f, 0x1751: 0x06b7, + 0x1752: 0x1854, 0x1753: 0x1859, 0x1754: 0x185e, 0x1755: 0x15db, 0x1756: 0x06bb, 0x1757: 0x15ef, + 0x1758: 0x15f7, 0x1759: 0x15fb, 0x175a: 0x1603, 0x175b: 0x160b, 0x175c: 0x1613, 0x175d: 0x1868, +} + +// nfkcIndex: 22 blocks, 1408 entries, 1408 bytes +// Block 0 is the zero block. +var nfkcIndex = [1408]uint8{ + // Block 0x0, offset 0x0 + // Block 0x1, offset 0x40 + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc2: 0x5c, 0xc3: 0x01, 0xc4: 0x02, 0xc5: 0x03, 0xc6: 0x5d, 0xc7: 0x04, + 0xc8: 0x05, 0xca: 0x5e, 0xcb: 0x5f, 0xcc: 0x06, 0xcd: 0x07, 0xce: 0x08, 0xcf: 0x09, + 0xd0: 0x0a, 0xd1: 0x60, 0xd2: 0x61, 0xd3: 0x0b, 0xd6: 0x0c, 0xd7: 0x62, + 0xd8: 0x63, 0xd9: 0x0d, 0xdb: 0x64, 0xdc: 0x65, 0xdd: 0x66, 0xdf: 0x67, + 0xe0: 0x02, 0xe1: 0x03, 0xe2: 0x04, 0xe3: 0x05, + 0xea: 0x06, 0xeb: 0x07, 0xec: 0x08, 0xed: 0x09, 0xef: 0x0a, + 0xf0: 0x13, + // Block 0x4, offset 0x100 + 0x120: 0x68, 0x121: 0x69, 0x123: 0x0e, 0x124: 0x6a, 0x125: 0x6b, 0x126: 0x6c, 0x127: 0x6d, + 0x128: 0x6e, 0x129: 0x6f, 0x12a: 0x70, 0x12b: 0x71, 0x12c: 0x6c, 0x12d: 0x72, 0x12e: 0x73, 0x12f: 0x74, + 0x131: 0x75, 0x132: 0x76, 0x133: 0x77, 0x134: 0x78, 0x135: 0x79, 0x137: 0x7a, + 0x138: 0x7b, 0x139: 0x7c, 0x13a: 0x7d, 0x13b: 0x7e, 0x13c: 0x7f, 0x13d: 0x80, 0x13e: 0x81, 0x13f: 0x82, + // Block 0x5, offset 0x140 + 0x140: 0x83, 0x142: 0x84, 0x143: 0x85, 0x144: 0x86, 0x145: 0x87, 0x146: 0x88, 0x147: 0x89, + 0x14d: 0x8a, + 0x15c: 0x8b, 0x15f: 0x8c, + 0x162: 0x8d, 0x164: 0x8e, + 0x168: 0x8f, 0x169: 0x90, 0x16a: 0x91, 0x16c: 0x0f, 0x16d: 0x92, 0x16e: 0x93, 0x16f: 0x94, + 0x170: 0x95, 0x173: 0x96, 0x174: 0x97, 0x175: 0x10, 0x176: 0x11, 0x177: 0x12, + 0x178: 0x13, 0x179: 0x14, 0x17a: 0x15, 0x17b: 0x16, 0x17c: 0x17, 0x17d: 0x18, 0x17e: 0x19, 0x17f: 0x1a, + // Block 0x6, offset 0x180 + 0x180: 0x98, 0x181: 0x99, 0x182: 0x9a, 0x183: 0x9b, 0x184: 0x1b, 0x185: 0x1c, 0x186: 0x9c, 0x187: 0x9d, + 0x188: 0x9e, 0x189: 0x1d, 0x18a: 0x1e, 0x18b: 0x9f, 0x18c: 0xa0, + 0x191: 0x1f, 0x192: 0x20, 0x193: 0xa1, + 0x1a8: 0xa2, 0x1a9: 0xa3, 0x1ab: 0xa4, + 0x1b1: 0xa5, 0x1b3: 0xa6, 0x1b5: 0xa7, 0x1b7: 0xa8, + 0x1ba: 0xa9, 0x1bb: 0xaa, 0x1bc: 0x21, 0x1bd: 0x22, 0x1be: 0x23, 0x1bf: 0xab, + // Block 0x7, offset 0x1c0 + 0x1c0: 0xac, 0x1c1: 0x24, 0x1c2: 0x25, 0x1c3: 0x26, 0x1c4: 0xad, 0x1c5: 0x27, 0x1c6: 0x28, + 0x1c8: 0x29, 0x1c9: 0x2a, 0x1ca: 0x2b, 0x1cb: 0x2c, 0x1cc: 0x2d, 0x1cd: 0x2e, 0x1ce: 0x2f, 0x1cf: 0x30, + // Block 0x8, offset 0x200 + 0x219: 0xae, 0x21a: 0xaf, 0x21b: 0xb0, 0x21d: 0xb1, 0x21f: 0xb2, + 0x220: 0xb3, 0x223: 0xb4, 0x224: 0xb5, 0x225: 0xb6, 0x226: 0xb7, 0x227: 0xb8, + 0x22a: 0xb9, 0x22b: 0xba, 0x22d: 0xbb, 0x22f: 0xbc, + 0x230: 0xbd, 0x231: 0xbe, 0x232: 0xbf, 0x233: 0xc0, 0x234: 0xc1, 0x235: 0xc2, 0x236: 0xc3, 0x237: 0xbd, + 0x238: 0xbe, 0x239: 0xbf, 0x23a: 0xc0, 0x23b: 0xc1, 0x23c: 0xc2, 0x23d: 0xc3, 0x23e: 0xbd, 0x23f: 0xbe, + // Block 0x9, offset 0x240 + 0x240: 0xbf, 0x241: 0xc0, 0x242: 0xc1, 0x243: 0xc2, 0x244: 0xc3, 0x245: 0xbd, 0x246: 0xbe, 0x247: 0xbf, + 0x248: 0xc0, 0x249: 0xc1, 0x24a: 0xc2, 0x24b: 0xc3, 0x24c: 0xbd, 0x24d: 0xbe, 0x24e: 0xbf, 0x24f: 0xc0, + 0x250: 0xc1, 0x251: 0xc2, 0x252: 0xc3, 0x253: 0xbd, 0x254: 0xbe, 0x255: 0xbf, 0x256: 0xc0, 0x257: 0xc1, + 0x258: 0xc2, 0x259: 0xc3, 0x25a: 0xbd, 0x25b: 0xbe, 0x25c: 0xbf, 0x25d: 0xc0, 0x25e: 0xc1, 0x25f: 0xc2, + 0x260: 0xc3, 0x261: 0xbd, 0x262: 0xbe, 0x263: 0xbf, 0x264: 0xc0, 0x265: 0xc1, 0x266: 0xc2, 0x267: 0xc3, + 0x268: 0xbd, 0x269: 0xbe, 0x26a: 0xbf, 0x26b: 0xc0, 0x26c: 0xc1, 0x26d: 0xc2, 0x26e: 0xc3, 0x26f: 0xbd, + 0x270: 0xbe, 0x271: 0xbf, 0x272: 0xc0, 0x273: 0xc1, 0x274: 0xc2, 0x275: 0xc3, 0x276: 0xbd, 0x277: 0xbe, + 0x278: 0xbf, 0x279: 0xc0, 0x27a: 0xc1, 0x27b: 0xc2, 0x27c: 0xc3, 0x27d: 0xbd, 0x27e: 0xbe, 0x27f: 0xbf, + // Block 0xa, offset 0x280 + 0x280: 0xc0, 0x281: 0xc1, 0x282: 0xc2, 0x283: 0xc3, 0x284: 0xbd, 0x285: 0xbe, 0x286: 0xbf, 0x287: 0xc0, + 0x288: 0xc1, 0x289: 0xc2, 0x28a: 0xc3, 0x28b: 0xbd, 0x28c: 0xbe, 0x28d: 0xbf, 0x28e: 0xc0, 0x28f: 0xc1, + 0x290: 0xc2, 0x291: 0xc3, 0x292: 0xbd, 0x293: 0xbe, 0x294: 0xbf, 0x295: 0xc0, 0x296: 0xc1, 0x297: 0xc2, + 0x298: 0xc3, 0x299: 0xbd, 0x29a: 0xbe, 0x29b: 0xbf, 0x29c: 0xc0, 0x29d: 0xc1, 0x29e: 0xc2, 0x29f: 0xc3, + 0x2a0: 0xbd, 0x2a1: 0xbe, 0x2a2: 0xbf, 0x2a3: 0xc0, 0x2a4: 0xc1, 0x2a5: 0xc2, 0x2a6: 0xc3, 0x2a7: 0xbd, + 0x2a8: 0xbe, 0x2a9: 0xbf, 0x2aa: 0xc0, 0x2ab: 0xc1, 0x2ac: 0xc2, 0x2ad: 0xc3, 0x2ae: 0xbd, 0x2af: 0xbe, + 0x2b0: 0xbf, 0x2b1: 0xc0, 0x2b2: 0xc1, 0x2b3: 0xc2, 0x2b4: 0xc3, 0x2b5: 0xbd, 0x2b6: 0xbe, 0x2b7: 0xbf, + 0x2b8: 0xc0, 0x2b9: 0xc1, 0x2ba: 0xc2, 0x2bb: 0xc3, 0x2bc: 0xbd, 0x2bd: 0xbe, 0x2be: 0xbf, 0x2bf: 0xc0, + // Block 0xb, offset 0x2c0 + 0x2c0: 0xc1, 0x2c1: 0xc2, 0x2c2: 0xc3, 0x2c3: 0xbd, 0x2c4: 0xbe, 0x2c5: 0xbf, 0x2c6: 0xc0, 0x2c7: 0xc1, + 0x2c8: 0xc2, 0x2c9: 0xc3, 0x2ca: 0xbd, 0x2cb: 0xbe, 0x2cc: 0xbf, 0x2cd: 0xc0, 0x2ce: 0xc1, 0x2cf: 0xc2, + 0x2d0: 0xc3, 0x2d1: 0xbd, 0x2d2: 0xbe, 0x2d3: 0xbf, 0x2d4: 0xc0, 0x2d5: 0xc1, 0x2d6: 0xc2, 0x2d7: 0xc3, + 0x2d8: 0xbd, 0x2d9: 0xbe, 0x2da: 0xbf, 0x2db: 0xc0, 0x2dc: 0xc1, 0x2dd: 0xc2, 0x2de: 0xc4, + // Block 0xc, offset 0x300 + 0x324: 0x31, 0x325: 0x32, 0x326: 0x33, 0x327: 0x34, + 0x328: 0x35, 0x329: 0x36, 0x32a: 0x37, 0x32b: 0x38, 0x32c: 0x39, 0x32d: 0x3a, 0x32e: 0x3b, 0x32f: 0x3c, + 0x330: 0x3d, 0x331: 0x3e, 0x332: 0x3f, 0x333: 0x40, 0x334: 0x41, 0x335: 0x42, 0x336: 0x43, 0x337: 0x44, + 0x338: 0x45, 0x339: 0x46, 0x33a: 0x47, 0x33b: 0x48, 0x33c: 0xc5, 0x33d: 0x49, 0x33e: 0x4a, 0x33f: 0x4b, + // Block 0xd, offset 0x340 + 0x347: 0xc6, + 0x34b: 0xc7, 0x34d: 0xc8, + 0x368: 0xc9, 0x36b: 0xca, + 0x374: 0xcb, + 0x37d: 0xcc, + // Block 0xe, offset 0x380 + 0x381: 0xcd, 0x382: 0xce, 0x384: 0xcf, 0x385: 0xb7, 0x387: 0xd0, + 0x388: 0xd1, 0x38b: 0xd2, 0x38c: 0xd3, 0x38d: 0xd4, + 0x391: 0xd5, 0x392: 0xd6, 0x393: 0xd7, 0x396: 0xd8, 0x397: 0xd9, + 0x398: 0xda, 0x39a: 0xdb, 0x39c: 0xdc, + 0x3a0: 0xdd, + 0x3a8: 0xde, 0x3a9: 0xdf, 0x3aa: 0xe0, + 0x3b0: 0xda, 0x3b5: 0xe1, 0x3b6: 0xe2, + // Block 0xf, offset 0x3c0 + 0x3eb: 0xe3, 0x3ec: 0xe4, + // Block 0x10, offset 0x400 + 0x432: 0xe5, + // Block 0x11, offset 0x440 + 0x445: 0xe6, 0x446: 0xe7, 0x447: 0xe8, + 0x449: 0xe9, + 0x450: 0xea, 0x451: 0xeb, 0x452: 0xec, 0x453: 0xed, 0x454: 0xee, 0x455: 0xef, 0x456: 0xf0, 0x457: 0xf1, + 0x458: 0xf2, 0x459: 0xf3, 0x45a: 0x4c, 0x45b: 0xf4, 0x45c: 0xf5, 0x45d: 0xf6, 0x45e: 0xf7, 0x45f: 0x4d, + // Block 0x12, offset 0x480 + 0x480: 0xf8, + 0x4a3: 0xf9, 0x4a5: 0xfa, + 0x4b8: 0x4e, 0x4b9: 0x4f, 0x4ba: 0x50, + // Block 0x13, offset 0x4c0 + 0x4c4: 0x51, 0x4c5: 0xfb, 0x4c6: 0xfc, + 0x4c8: 0x52, 0x4c9: 0xfd, + // Block 0x14, offset 0x500 + 0x520: 0x53, 0x521: 0x54, 0x522: 0x55, 0x523: 0x56, 0x524: 0x57, 0x525: 0x58, 0x526: 0x59, 0x527: 0x5a, + 0x528: 0x5b, + // Block 0x15, offset 0x540 + 0x550: 0x0b, 0x551: 0x0c, 0x556: 0x0d, + 0x55b: 0x0e, 0x55d: 0x0f, 0x55e: 0x10, 0x55f: 0x11, + 0x56f: 0x12, +} + +// nfkcSparseOffset: 162 entries, 324 bytes +var nfkcSparseOffset = []uint16{0x0, 0xe, 0x12, 0x1b, 0x25, 0x35, 0x37, 0x3c, 0x47, 0x56, 0x63, 0x6b, 0x70, 0x75, 0x77, 0x7f, 0x86, 0x89, 0x91, 0x95, 0x99, 0x9b, 0x9d, 0xa6, 0xaa, 0xb1, 0xb6, 0xb9, 0xc3, 0xc6, 0xcd, 0xd5, 0xd9, 0xdb, 0xde, 0xe2, 0xe8, 0xf9, 0x105, 0x107, 0x10d, 0x10f, 0x111, 0x113, 0x115, 0x117, 0x119, 0x11b, 0x11e, 0x121, 0x123, 0x126, 0x129, 0x12d, 0x132, 0x13b, 0x13d, 0x140, 0x142, 0x14d, 0x158, 0x166, 0x174, 0x184, 0x192, 0x199, 0x19f, 0x1ae, 0x1b2, 0x1b4, 0x1b8, 0x1ba, 0x1bd, 0x1bf, 0x1c2, 0x1c4, 0x1c7, 0x1c9, 0x1cb, 0x1cd, 0x1d9, 0x1e3, 0x1ed, 0x1f0, 0x1f4, 0x1f6, 0x1f8, 0x1fa, 0x1fc, 0x1ff, 0x201, 0x203, 0x205, 0x207, 0x20d, 0x210, 0x214, 0x216, 0x21d, 0x223, 0x229, 0x231, 0x237, 0x23d, 0x243, 0x247, 0x249, 0x24b, 0x24d, 0x24f, 0x255, 0x258, 0x25a, 0x260, 0x263, 0x26b, 0x272, 0x275, 0x278, 0x27a, 0x27d, 0x285, 0x289, 0x290, 0x293, 0x299, 0x29b, 0x29d, 0x2a0, 0x2a2, 0x2a5, 0x2a7, 0x2a9, 0x2ab, 0x2ae, 0x2b0, 0x2b2, 0x2b4, 0x2b6, 0x2c3, 0x2cd, 0x2cf, 0x2d1, 0x2d5, 0x2da, 0x2e6, 0x2eb, 0x2f4, 0x2fa, 0x2ff, 0x303, 0x308, 0x30c, 0x31c, 0x32a, 0x338, 0x346, 0x34c, 0x34e, 0x351, 0x35b, 0x35d} + +// nfkcSparseValues: 871 entries, 3484 bytes +var nfkcSparseValues = [871]valueRange{ + // Block 0x0, offset 0x0 + {value: 0x0002, lo: 0x0d}, + {value: 0x0001, lo: 0xa0, hi: 0xa0}, + {value: 0x4278, lo: 0xa8, hi: 0xa8}, + {value: 0x0083, lo: 0xaa, hi: 0xaa}, + {value: 0x4264, lo: 0xaf, hi: 0xaf}, + {value: 0x0025, lo: 0xb2, hi: 0xb3}, + {value: 0x425a, lo: 0xb4, hi: 0xb4}, + {value: 0x01dc, lo: 0xb5, hi: 0xb5}, + {value: 0x4291, lo: 0xb8, hi: 0xb8}, + {value: 0x0023, lo: 0xb9, hi: 0xb9}, + {value: 0x009f, lo: 0xba, hi: 0xba}, + {value: 0x221c, lo: 0xbc, hi: 0xbc}, + {value: 0x2210, lo: 0xbd, hi: 0xbd}, + {value: 0x22b2, lo: 0xbe, hi: 0xbe}, + // Block 0x1, offset 0xe + {value: 0x0091, lo: 0x03}, + {value: 0x46e2, lo: 0xa0, hi: 0xa1}, + {value: 0x4714, lo: 0xaf, hi: 0xb0}, + {value: 0xa000, lo: 0xb7, hi: 0xb7}, + // Block 0x2, offset 0x12 + {value: 0x0003, lo: 0x08}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0x0091, lo: 0xb0, hi: 0xb0}, + {value: 0x0119, lo: 0xb1, hi: 0xb1}, + {value: 0x0095, lo: 0xb2, hi: 0xb2}, + {value: 0x00a5, lo: 0xb3, hi: 0xb3}, + {value: 0x0143, lo: 0xb4, hi: 0xb6}, + {value: 0x00af, lo: 0xb7, hi: 0xb7}, + {value: 0x00b3, lo: 0xb8, hi: 0xb8}, + // Block 0x3, offset 0x1b + {value: 0x000a, lo: 0x09}, + {value: 0x426e, lo: 0x98, hi: 0x98}, + {value: 0x4273, lo: 0x99, hi: 0x9a}, + {value: 0x4296, lo: 0x9b, hi: 0x9b}, + {value: 0x425f, lo: 0x9c, hi: 0x9c}, + {value: 0x4282, lo: 0x9d, hi: 0x9d}, + {value: 0x0113, lo: 0xa0, hi: 0xa0}, + {value: 0x0099, lo: 0xa1, hi: 0xa1}, + {value: 0x00a7, lo: 0xa2, hi: 0xa3}, + {value: 0x0167, lo: 0xa4, hi: 0xa4}, + // Block 0x4, offset 0x25 + {value: 0x0000, lo: 0x0f}, + {value: 0xa000, lo: 0x83, hi: 0x83}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0xa000, lo: 0x8b, hi: 0x8b}, + {value: 0xa000, lo: 0x8d, hi: 0x8d}, + {value: 0x37a5, lo: 0x90, hi: 0x90}, + {value: 0x37b1, lo: 0x91, hi: 0x91}, + {value: 0x379f, lo: 0x93, hi: 0x93}, + {value: 0xa000, lo: 0x96, hi: 0x96}, + {value: 0x3817, lo: 0x97, hi: 0x97}, + {value: 0x37e1, lo: 0x9c, hi: 0x9c}, + {value: 0x37c9, lo: 0x9d, hi: 0x9d}, + {value: 0x37f3, lo: 0x9e, hi: 0x9e}, + {value: 0xa000, lo: 0xb4, hi: 0xb5}, + {value: 0x381d, lo: 0xb6, hi: 0xb6}, + {value: 0x3823, lo: 0xb7, hi: 0xb7}, + // Block 0x5, offset 0x35 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x83, hi: 0x87}, + // Block 0x6, offset 0x37 + {value: 0x0001, lo: 0x04}, + {value: 0x8113, lo: 0x81, hi: 0x82}, + {value: 0x8132, lo: 0x84, hi: 0x84}, + {value: 0x812d, lo: 0x85, hi: 0x85}, + {value: 0x810d, lo: 0x87, hi: 0x87}, + // Block 0x7, offset 0x3c + {value: 0x0000, lo: 0x0a}, + {value: 0x8132, lo: 0x90, hi: 0x97}, + {value: 0x8119, lo: 0x98, hi: 0x98}, + {value: 0x811a, lo: 0x99, hi: 0x99}, + {value: 0x811b, lo: 0x9a, hi: 0x9a}, + {value: 0x3841, lo: 0xa2, hi: 0xa2}, + {value: 0x3847, lo: 0xa3, hi: 0xa3}, + {value: 0x3853, lo: 0xa4, hi: 0xa4}, + {value: 0x384d, lo: 0xa5, hi: 0xa5}, + {value: 0x3859, lo: 0xa6, hi: 0xa6}, + {value: 0xa000, lo: 0xa7, hi: 0xa7}, + // Block 0x8, offset 0x47 + {value: 0x0000, lo: 0x0e}, + {value: 0x386b, lo: 0x80, hi: 0x80}, + {value: 0xa000, lo: 0x81, hi: 0x81}, + {value: 0x385f, lo: 0x82, hi: 0x82}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0x3865, lo: 0x93, hi: 0x93}, + {value: 0xa000, lo: 0x95, hi: 0x95}, + {value: 0x8132, lo: 0x96, hi: 0x9c}, + {value: 0x8132, lo: 0x9f, hi: 0xa2}, + {value: 0x812d, lo: 0xa3, hi: 0xa3}, + {value: 0x8132, lo: 0xa4, hi: 0xa4}, + {value: 0x8132, lo: 0xa7, hi: 0xa8}, + {value: 0x812d, lo: 0xaa, hi: 0xaa}, + {value: 0x8132, lo: 0xab, hi: 0xac}, + {value: 0x812d, lo: 0xad, hi: 0xad}, + // Block 0x9, offset 0x56 + {value: 0x0000, lo: 0x0c}, + {value: 0x811f, lo: 0x91, hi: 0x91}, + {value: 0x8132, lo: 0xb0, hi: 0xb0}, + {value: 0x812d, lo: 0xb1, hi: 0xb1}, + {value: 0x8132, lo: 0xb2, hi: 0xb3}, + {value: 0x812d, lo: 0xb4, hi: 0xb4}, + {value: 0x8132, lo: 0xb5, hi: 0xb6}, + {value: 0x812d, lo: 0xb7, hi: 0xb9}, + {value: 0x8132, lo: 0xba, hi: 0xba}, + {value: 0x812d, lo: 0xbb, hi: 0xbc}, + {value: 0x8132, lo: 0xbd, hi: 0xbd}, + {value: 0x812d, lo: 0xbe, hi: 0xbe}, + {value: 0x8132, lo: 0xbf, hi: 0xbf}, + // Block 0xa, offset 0x63 + {value: 0x0005, lo: 0x07}, + {value: 0x8132, lo: 0x80, hi: 0x80}, + {value: 0x8132, lo: 0x81, hi: 0x81}, + {value: 0x812d, lo: 0x82, hi: 0x83}, + {value: 0x812d, lo: 0x84, hi: 0x85}, + {value: 0x812d, lo: 0x86, hi: 0x87}, + {value: 0x812d, lo: 0x88, hi: 0x89}, + {value: 0x8132, lo: 0x8a, hi: 0x8a}, + // Block 0xb, offset 0x6b + {value: 0x0000, lo: 0x04}, + {value: 0x8132, lo: 0xab, hi: 0xb1}, + {value: 0x812d, lo: 0xb2, hi: 0xb2}, + {value: 0x8132, lo: 0xb3, hi: 0xb3}, + {value: 0x812d, lo: 0xbd, hi: 0xbd}, + // Block 0xc, offset 0x70 + {value: 0x0000, lo: 0x04}, + {value: 0x8132, lo: 0x96, hi: 0x99}, + {value: 0x8132, lo: 0x9b, hi: 0xa3}, + {value: 0x8132, lo: 0xa5, hi: 0xa7}, + {value: 0x8132, lo: 0xa9, hi: 0xad}, + // Block 0xd, offset 0x75 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x99, hi: 0x9b}, + // Block 0xe, offset 0x77 + {value: 0x0000, lo: 0x07}, + {value: 0xa000, lo: 0xa8, hi: 0xa8}, + {value: 0x3ed8, lo: 0xa9, hi: 0xa9}, + {value: 0xa000, lo: 0xb0, hi: 0xb0}, + {value: 0x3ee0, lo: 0xb1, hi: 0xb1}, + {value: 0xa000, lo: 0xb3, hi: 0xb3}, + {value: 0x3ee8, lo: 0xb4, hi: 0xb4}, + {value: 0x9902, lo: 0xbc, hi: 0xbc}, + // Block 0xf, offset 0x7f + {value: 0x0008, lo: 0x06}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x8132, lo: 0x91, hi: 0x91}, + {value: 0x812d, lo: 0x92, hi: 0x92}, + {value: 0x8132, lo: 0x93, hi: 0x93}, + {value: 0x8132, lo: 0x94, hi: 0x94}, + {value: 0x451c, lo: 0x98, hi: 0x9f}, + // Block 0x10, offset 0x86 + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x11, offset 0x89 + {value: 0x0008, lo: 0x07}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0x2c9e, lo: 0x8b, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + {value: 0x455c, lo: 0x9c, hi: 0x9d}, + {value: 0x456c, lo: 0x9f, hi: 0x9f}, + {value: 0x8132, lo: 0xbe, hi: 0xbe}, + // Block 0x12, offset 0x91 + {value: 0x0000, lo: 0x03}, + {value: 0x4594, lo: 0xb3, hi: 0xb3}, + {value: 0x459c, lo: 0xb6, hi: 0xb6}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + // Block 0x13, offset 0x95 + {value: 0x0008, lo: 0x03}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x4574, lo: 0x99, hi: 0x9b}, + {value: 0x458c, lo: 0x9e, hi: 0x9e}, + // Block 0x14, offset 0x99 + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + // Block 0x15, offset 0x9b + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + // Block 0x16, offset 0x9d + {value: 0x0000, lo: 0x08}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0x2cb6, lo: 0x88, hi: 0x88}, + {value: 0x2cae, lo: 0x8b, hi: 0x8b}, + {value: 0x2cbe, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x96, hi: 0x97}, + {value: 0x45a4, lo: 0x9c, hi: 0x9c}, + {value: 0x45ac, lo: 0x9d, hi: 0x9d}, + // Block 0x17, offset 0xa6 + {value: 0x0000, lo: 0x03}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0x2cc6, lo: 0x94, hi: 0x94}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x18, offset 0xaa + {value: 0x0000, lo: 0x06}, + {value: 0xa000, lo: 0x86, hi: 0x87}, + {value: 0x2cce, lo: 0x8a, hi: 0x8a}, + {value: 0x2cde, lo: 0x8b, hi: 0x8b}, + {value: 0x2cd6, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + // Block 0x19, offset 0xb1 + {value: 0x1801, lo: 0x04}, + {value: 0xa000, lo: 0x86, hi: 0x86}, + {value: 0x3ef0, lo: 0x88, hi: 0x88}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x8120, lo: 0x95, hi: 0x96}, + // Block 0x1a, offset 0xb6 + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + {value: 0xa000, lo: 0xbf, hi: 0xbf}, + // Block 0x1b, offset 0xb9 + {value: 0x0000, lo: 0x09}, + {value: 0x2ce6, lo: 0x80, hi: 0x80}, + {value: 0x9900, lo: 0x82, hi: 0x82}, + {value: 0xa000, lo: 0x86, hi: 0x86}, + {value: 0x2cee, lo: 0x87, hi: 0x87}, + {value: 0x2cf6, lo: 0x88, hi: 0x88}, + {value: 0x2f50, lo: 0x8a, hi: 0x8a}, + {value: 0x2dd8, lo: 0x8b, hi: 0x8b}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x95, hi: 0x96}, + // Block 0x1c, offset 0xc3 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0xbb, hi: 0xbc}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x1d, offset 0xc6 + {value: 0x0000, lo: 0x06}, + {value: 0xa000, lo: 0x86, hi: 0x87}, + {value: 0x2cfe, lo: 0x8a, hi: 0x8a}, + {value: 0x2d0e, lo: 0x8b, hi: 0x8b}, + {value: 0x2d06, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + // Block 0x1e, offset 0xcd + {value: 0x6bea, lo: 0x07}, + {value: 0x9904, lo: 0x8a, hi: 0x8a}, + {value: 0x9900, lo: 0x8f, hi: 0x8f}, + {value: 0xa000, lo: 0x99, hi: 0x99}, + {value: 0x3ef8, lo: 0x9a, hi: 0x9a}, + {value: 0x2f58, lo: 0x9c, hi: 0x9c}, + {value: 0x2de3, lo: 0x9d, hi: 0x9d}, + {value: 0x2d16, lo: 0x9e, hi: 0x9f}, + // Block 0x1f, offset 0xd5 + {value: 0x0000, lo: 0x03}, + {value: 0x2621, lo: 0xb3, hi: 0xb3}, + {value: 0x8122, lo: 0xb8, hi: 0xb9}, + {value: 0x8104, lo: 0xba, hi: 0xba}, + // Block 0x20, offset 0xd9 + {value: 0x0000, lo: 0x01}, + {value: 0x8123, lo: 0x88, hi: 0x8b}, + // Block 0x21, offset 0xdb + {value: 0x0000, lo: 0x02}, + {value: 0x2636, lo: 0xb3, hi: 0xb3}, + {value: 0x8124, lo: 0xb8, hi: 0xb9}, + // Block 0x22, offset 0xde + {value: 0x0000, lo: 0x03}, + {value: 0x8125, lo: 0x88, hi: 0x8b}, + {value: 0x2628, lo: 0x9c, hi: 0x9c}, + {value: 0x262f, lo: 0x9d, hi: 0x9d}, + // Block 0x23, offset 0xe2 + {value: 0x0000, lo: 0x05}, + {value: 0x030b, lo: 0x8c, hi: 0x8c}, + {value: 0x812d, lo: 0x98, hi: 0x99}, + {value: 0x812d, lo: 0xb5, hi: 0xb5}, + {value: 0x812d, lo: 0xb7, hi: 0xb7}, + {value: 0x812b, lo: 0xb9, hi: 0xb9}, + // Block 0x24, offset 0xe8 + {value: 0x0000, lo: 0x10}, + {value: 0x2644, lo: 0x83, hi: 0x83}, + {value: 0x264b, lo: 0x8d, hi: 0x8d}, + {value: 0x2652, lo: 0x92, hi: 0x92}, + {value: 0x2659, lo: 0x97, hi: 0x97}, + {value: 0x2660, lo: 0x9c, hi: 0x9c}, + {value: 0x263d, lo: 0xa9, hi: 0xa9}, + {value: 0x8126, lo: 0xb1, hi: 0xb1}, + {value: 0x8127, lo: 0xb2, hi: 0xb2}, + {value: 0x4a84, lo: 0xb3, hi: 0xb3}, + {value: 0x8128, lo: 0xb4, hi: 0xb4}, + {value: 0x4a8d, lo: 0xb5, hi: 0xb5}, + {value: 0x45b4, lo: 0xb6, hi: 0xb6}, + {value: 0x45f4, lo: 0xb7, hi: 0xb7}, + {value: 0x45bc, lo: 0xb8, hi: 0xb8}, + {value: 0x45ff, lo: 0xb9, hi: 0xb9}, + {value: 0x8127, lo: 0xba, hi: 0xbd}, + // Block 0x25, offset 0xf9 + {value: 0x0000, lo: 0x0b}, + {value: 0x8127, lo: 0x80, hi: 0x80}, + {value: 0x4a96, lo: 0x81, hi: 0x81}, + {value: 0x8132, lo: 0x82, hi: 0x83}, + {value: 0x8104, lo: 0x84, hi: 0x84}, + {value: 0x8132, lo: 0x86, hi: 0x87}, + {value: 0x266e, lo: 0x93, hi: 0x93}, + {value: 0x2675, lo: 0x9d, hi: 0x9d}, + {value: 0x267c, lo: 0xa2, hi: 0xa2}, + {value: 0x2683, lo: 0xa7, hi: 0xa7}, + {value: 0x268a, lo: 0xac, hi: 0xac}, + {value: 0x2667, lo: 0xb9, hi: 0xb9}, + // Block 0x26, offset 0x105 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x86, hi: 0x86}, + // Block 0x27, offset 0x107 + {value: 0x0000, lo: 0x05}, + {value: 0xa000, lo: 0xa5, hi: 0xa5}, + {value: 0x2d1e, lo: 0xa6, hi: 0xa6}, + {value: 0x9900, lo: 0xae, hi: 0xae}, + {value: 0x8102, lo: 0xb7, hi: 0xb7}, + {value: 0x8104, lo: 0xb9, hi: 0xba}, + // Block 0x28, offset 0x10d + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x8d, hi: 0x8d}, + // Block 0x29, offset 0x10f + {value: 0x0000, lo: 0x01}, + {value: 0x030f, lo: 0xbc, hi: 0xbc}, + // Block 0x2a, offset 0x111 + {value: 0x0000, lo: 0x01}, + {value: 0xa000, lo: 0x80, hi: 0x92}, + // Block 0x2b, offset 0x113 + {value: 0x0000, lo: 0x01}, + {value: 0xb900, lo: 0xa1, hi: 0xb5}, + // Block 0x2c, offset 0x115 + {value: 0x0000, lo: 0x01}, + {value: 0x9900, lo: 0xa8, hi: 0xbf}, + // Block 0x2d, offset 0x117 + {value: 0x0000, lo: 0x01}, + {value: 0x9900, lo: 0x80, hi: 0x82}, + // Block 0x2e, offset 0x119 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x9d, hi: 0x9f}, + // Block 0x2f, offset 0x11b + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x94, hi: 0x94}, + {value: 0x8104, lo: 0xb4, hi: 0xb4}, + // Block 0x30, offset 0x11e + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x92, hi: 0x92}, + {value: 0x8132, lo: 0x9d, hi: 0x9d}, + // Block 0x31, offset 0x121 + {value: 0x0000, lo: 0x01}, + {value: 0x8131, lo: 0xa9, hi: 0xa9}, + // Block 0x32, offset 0x123 + {value: 0x0004, lo: 0x02}, + {value: 0x812e, lo: 0xb9, hi: 0xba}, + {value: 0x812d, lo: 0xbb, hi: 0xbb}, + // Block 0x33, offset 0x126 + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0x97, hi: 0x97}, + {value: 0x812d, lo: 0x98, hi: 0x98}, + // Block 0x34, offset 0x129 + {value: 0x0000, lo: 0x03}, + {value: 0x8104, lo: 0xa0, hi: 0xa0}, + {value: 0x8132, lo: 0xb5, hi: 0xbc}, + {value: 0x812d, lo: 0xbf, hi: 0xbf}, + // Block 0x35, offset 0x12d + {value: 0x0000, lo: 0x04}, + {value: 0x8132, lo: 0xb0, hi: 0xb4}, + {value: 0x812d, lo: 0xb5, hi: 0xba}, + {value: 0x8132, lo: 0xbb, hi: 0xbc}, + {value: 0x812d, lo: 0xbd, hi: 0xbd}, + // Block 0x36, offset 0x132 + {value: 0x0000, lo: 0x08}, + {value: 0x2d66, lo: 0x80, hi: 0x80}, + {value: 0x2d6e, lo: 0x81, hi: 0x81}, + {value: 0xa000, lo: 0x82, hi: 0x82}, + {value: 0x2d76, lo: 0x83, hi: 0x83}, + {value: 0x8104, lo: 0x84, hi: 0x84}, + {value: 0x8132, lo: 0xab, hi: 0xab}, + {value: 0x812d, lo: 0xac, hi: 0xac}, + {value: 0x8132, lo: 0xad, hi: 0xb3}, + // Block 0x37, offset 0x13b + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xaa, hi: 0xab}, + // Block 0x38, offset 0x13d + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xa6, hi: 0xa6}, + {value: 0x8104, lo: 0xb2, hi: 0xb3}, + // Block 0x39, offset 0x140 + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0xb7, hi: 0xb7}, + // Block 0x3a, offset 0x142 + {value: 0x0000, lo: 0x0a}, + {value: 0x8132, lo: 0x90, hi: 0x92}, + {value: 0x8101, lo: 0x94, hi: 0x94}, + {value: 0x812d, lo: 0x95, hi: 0x99}, + {value: 0x8132, lo: 0x9a, hi: 0x9b}, + {value: 0x812d, lo: 0x9c, hi: 0x9f}, + {value: 0x8132, lo: 0xa0, hi: 0xa0}, + {value: 0x8101, lo: 0xa2, hi: 0xa8}, + {value: 0x812d, lo: 0xad, hi: 0xad}, + {value: 0x8132, lo: 0xb4, hi: 0xb4}, + {value: 0x8132, lo: 0xb8, hi: 0xb9}, + // Block 0x3b, offset 0x14d + {value: 0x0002, lo: 0x0a}, + {value: 0x0043, lo: 0xac, hi: 0xac}, + {value: 0x00d1, lo: 0xad, hi: 0xad}, + {value: 0x0045, lo: 0xae, hi: 0xae}, + {value: 0x0049, lo: 0xb0, hi: 0xb1}, + {value: 0x00e6, lo: 0xb2, hi: 0xb2}, + {value: 0x004f, lo: 0xb3, hi: 0xba}, + {value: 0x005f, lo: 0xbc, hi: 0xbc}, + {value: 0x00ef, lo: 0xbd, hi: 0xbd}, + {value: 0x0061, lo: 0xbe, hi: 0xbe}, + {value: 0x0065, lo: 0xbf, hi: 0xbf}, + // Block 0x3c, offset 0x158 + {value: 0x0000, lo: 0x0d}, + {value: 0x0001, lo: 0x80, hi: 0x8a}, + {value: 0x043b, lo: 0x91, hi: 0x91}, + {value: 0x429b, lo: 0x97, hi: 0x97}, + {value: 0x001d, lo: 0xa4, hi: 0xa4}, + {value: 0x1873, lo: 0xa5, hi: 0xa5}, + {value: 0x1b5c, lo: 0xa6, hi: 0xa6}, + {value: 0x0001, lo: 0xaf, hi: 0xaf}, + {value: 0x2691, lo: 0xb3, hi: 0xb3}, + {value: 0x27fe, lo: 0xb4, hi: 0xb4}, + {value: 0x2698, lo: 0xb6, hi: 0xb6}, + {value: 0x2808, lo: 0xb7, hi: 0xb7}, + {value: 0x186d, lo: 0xbc, hi: 0xbc}, + {value: 0x4269, lo: 0xbe, hi: 0xbe}, + // Block 0x3d, offset 0x166 + {value: 0x0002, lo: 0x0d}, + {value: 0x1933, lo: 0x87, hi: 0x87}, + {value: 0x1930, lo: 0x88, hi: 0x88}, + {value: 0x1870, lo: 0x89, hi: 0x89}, + {value: 0x298e, lo: 0x97, hi: 0x97}, + {value: 0x0001, lo: 0x9f, hi: 0x9f}, + {value: 0x0021, lo: 0xb0, hi: 0xb0}, + {value: 0x0093, lo: 0xb1, hi: 0xb1}, + {value: 0x0029, lo: 0xb4, hi: 0xb9}, + {value: 0x0017, lo: 0xba, hi: 0xba}, + {value: 0x0467, lo: 0xbb, hi: 0xbb}, + {value: 0x003b, lo: 0xbc, hi: 0xbc}, + {value: 0x0011, lo: 0xbd, hi: 0xbe}, + {value: 0x009d, lo: 0xbf, hi: 0xbf}, + // Block 0x3e, offset 0x174 + {value: 0x0002, lo: 0x0f}, + {value: 0x0021, lo: 0x80, hi: 0x89}, + {value: 0x0017, lo: 0x8a, hi: 0x8a}, + {value: 0x0467, lo: 0x8b, hi: 0x8b}, + {value: 0x003b, lo: 0x8c, hi: 0x8c}, + {value: 0x0011, lo: 0x8d, hi: 0x8e}, + {value: 0x0083, lo: 0x90, hi: 0x90}, + {value: 0x008b, lo: 0x91, hi: 0x91}, + {value: 0x009f, lo: 0x92, hi: 0x92}, + {value: 0x00b1, lo: 0x93, hi: 0x93}, + {value: 0x0104, lo: 0x94, hi: 0x94}, + {value: 0x0091, lo: 0x95, hi: 0x95}, + {value: 0x0097, lo: 0x96, hi: 0x99}, + {value: 0x00a1, lo: 0x9a, hi: 0x9a}, + {value: 0x00a7, lo: 0x9b, hi: 0x9c}, + {value: 0x1999, lo: 0xa8, hi: 0xa8}, + // Block 0x3f, offset 0x184 + {value: 0x0000, lo: 0x0d}, + {value: 0x8132, lo: 0x90, hi: 0x91}, + {value: 0x8101, lo: 0x92, hi: 0x93}, + {value: 0x8132, lo: 0x94, hi: 0x97}, + {value: 0x8101, lo: 0x98, hi: 0x9a}, + {value: 0x8132, lo: 0x9b, hi: 0x9c}, + {value: 0x8132, lo: 0xa1, hi: 0xa1}, + {value: 0x8101, lo: 0xa5, hi: 0xa6}, + {value: 0x8132, lo: 0xa7, hi: 0xa7}, + {value: 0x812d, lo: 0xa8, hi: 0xa8}, + {value: 0x8132, lo: 0xa9, hi: 0xa9}, + {value: 0x8101, lo: 0xaa, hi: 0xab}, + {value: 0x812d, lo: 0xac, hi: 0xaf}, + {value: 0x8132, lo: 0xb0, hi: 0xb0}, + // Block 0x40, offset 0x192 + {value: 0x0007, lo: 0x06}, + {value: 0x2180, lo: 0x89, hi: 0x89}, + {value: 0xa000, lo: 0x90, hi: 0x90}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0xa000, lo: 0x94, hi: 0x94}, + {value: 0x3bb9, lo: 0x9a, hi: 0x9b}, + {value: 0x3bc7, lo: 0xae, hi: 0xae}, + // Block 0x41, offset 0x199 + {value: 0x000e, lo: 0x05}, + {value: 0x3bce, lo: 0x8d, hi: 0x8e}, + {value: 0x3bd5, lo: 0x8f, hi: 0x8f}, + {value: 0xa000, lo: 0x90, hi: 0x90}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0xa000, lo: 0x94, hi: 0x94}, + // Block 0x42, offset 0x19f + {value: 0x0173, lo: 0x0e}, + {value: 0xa000, lo: 0x83, hi: 0x83}, + {value: 0x3be3, lo: 0x84, hi: 0x84}, + {value: 0xa000, lo: 0x88, hi: 0x88}, + {value: 0x3bea, lo: 0x89, hi: 0x89}, + {value: 0xa000, lo: 0x8b, hi: 0x8b}, + {value: 0x3bf1, lo: 0x8c, hi: 0x8c}, + {value: 0xa000, lo: 0xa3, hi: 0xa3}, + {value: 0x3bf8, lo: 0xa4, hi: 0xa4}, + {value: 0xa000, lo: 0xa5, hi: 0xa5}, + {value: 0x3bff, lo: 0xa6, hi: 0xa6}, + {value: 0x269f, lo: 0xac, hi: 0xad}, + {value: 0x26a6, lo: 0xaf, hi: 0xaf}, + {value: 0x281c, lo: 0xb0, hi: 0xb0}, + {value: 0xa000, lo: 0xbc, hi: 0xbc}, + // Block 0x43, offset 0x1ae + {value: 0x0007, lo: 0x03}, + {value: 0x3c68, lo: 0xa0, hi: 0xa1}, + {value: 0x3c92, lo: 0xa2, hi: 0xa3}, + {value: 0x3cbc, lo: 0xaa, hi: 0xad}, + // Block 0x44, offset 0x1b2 + {value: 0x0004, lo: 0x01}, + {value: 0x048b, lo: 0xa9, hi: 0xaa}, + // Block 0x45, offset 0x1b4 + {value: 0x0002, lo: 0x03}, + {value: 0x0057, lo: 0x80, hi: 0x8f}, + {value: 0x0083, lo: 0x90, hi: 0xa9}, + {value: 0x0021, lo: 0xaa, hi: 0xaa}, + // Block 0x46, offset 0x1b8 + {value: 0x0000, lo: 0x01}, + {value: 0x299b, lo: 0x8c, hi: 0x8c}, + // Block 0x47, offset 0x1ba + {value: 0x0263, lo: 0x02}, + {value: 0x1b8c, lo: 0xb4, hi: 0xb4}, + {value: 0x192d, lo: 0xb5, hi: 0xb6}, + // Block 0x48, offset 0x1bd + {value: 0x0000, lo: 0x01}, + {value: 0x44dd, lo: 0x9c, hi: 0x9c}, + // Block 0x49, offset 0x1bf + {value: 0x0000, lo: 0x02}, + {value: 0x0095, lo: 0xbc, hi: 0xbc}, + {value: 0x006d, lo: 0xbd, hi: 0xbd}, + // Block 0x4a, offset 0x1c2 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xaf, hi: 0xb1}, + // Block 0x4b, offset 0x1c4 + {value: 0x0000, lo: 0x02}, + {value: 0x047f, lo: 0xaf, hi: 0xaf}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x4c, offset 0x1c7 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xa0, hi: 0xbf}, + // Block 0x4d, offset 0x1c9 + {value: 0x0000, lo: 0x01}, + {value: 0x0dc3, lo: 0x9f, hi: 0x9f}, + // Block 0x4e, offset 0x1cb + {value: 0x0000, lo: 0x01}, + {value: 0x162f, lo: 0xb3, hi: 0xb3}, + // Block 0x4f, offset 0x1cd + {value: 0x0004, lo: 0x0b}, + {value: 0x1597, lo: 0x80, hi: 0x82}, + {value: 0x15af, lo: 0x83, hi: 0x83}, + {value: 0x15c7, lo: 0x84, hi: 0x85}, + {value: 0x15d7, lo: 0x86, hi: 0x89}, + {value: 0x15eb, lo: 0x8a, hi: 0x8c}, + {value: 0x15ff, lo: 0x8d, hi: 0x8d}, + {value: 0x1607, lo: 0x8e, hi: 0x8e}, + {value: 0x160f, lo: 0x8f, hi: 0x90}, + {value: 0x161b, lo: 0x91, hi: 0x93}, + {value: 0x162b, lo: 0x94, hi: 0x94}, + {value: 0x1633, lo: 0x95, hi: 0x95}, + // Block 0x50, offset 0x1d9 + {value: 0x0004, lo: 0x09}, + {value: 0x0001, lo: 0x80, hi: 0x80}, + {value: 0x812c, lo: 0xaa, hi: 0xaa}, + {value: 0x8131, lo: 0xab, hi: 0xab}, + {value: 0x8133, lo: 0xac, hi: 0xac}, + {value: 0x812e, lo: 0xad, hi: 0xad}, + {value: 0x812f, lo: 0xae, hi: 0xae}, + {value: 0x812f, lo: 0xaf, hi: 0xaf}, + {value: 0x04b3, lo: 0xb6, hi: 0xb6}, + {value: 0x0887, lo: 0xb8, hi: 0xba}, + // Block 0x51, offset 0x1e3 + {value: 0x0006, lo: 0x09}, + {value: 0x0313, lo: 0xb1, hi: 0xb1}, + {value: 0x0317, lo: 0xb2, hi: 0xb2}, + {value: 0x4a3b, lo: 0xb3, hi: 0xb3}, + {value: 0x031b, lo: 0xb4, hi: 0xb4}, + {value: 0x4a41, lo: 0xb5, hi: 0xb6}, + {value: 0x031f, lo: 0xb7, hi: 0xb7}, + {value: 0x0323, lo: 0xb8, hi: 0xb8}, + {value: 0x0327, lo: 0xb9, hi: 0xb9}, + {value: 0x4a4d, lo: 0xba, hi: 0xbf}, + // Block 0x52, offset 0x1ed + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0xaf, hi: 0xaf}, + {value: 0x8132, lo: 0xb4, hi: 0xbd}, + // Block 0x53, offset 0x1f0 + {value: 0x0000, lo: 0x03}, + {value: 0x020f, lo: 0x9c, hi: 0x9c}, + {value: 0x0212, lo: 0x9d, hi: 0x9d}, + {value: 0x8132, lo: 0x9e, hi: 0x9f}, + // Block 0x54, offset 0x1f4 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xb0, hi: 0xb1}, + // Block 0x55, offset 0x1f6 + {value: 0x0000, lo: 0x01}, + {value: 0x163b, lo: 0xb0, hi: 0xb0}, + // Block 0x56, offset 0x1f8 + {value: 0x000c, lo: 0x01}, + {value: 0x00d7, lo: 0xb8, hi: 0xb9}, + // Block 0x57, offset 0x1fa + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x86, hi: 0x86}, + // Block 0x58, offset 0x1fc + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x84, hi: 0x84}, + {value: 0x8132, lo: 0xa0, hi: 0xb1}, + // Block 0x59, offset 0x1ff + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0xab, hi: 0xad}, + // Block 0x5a, offset 0x201 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x93, hi: 0x93}, + // Block 0x5b, offset 0x203 + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0xb3, hi: 0xb3}, + // Block 0x5c, offset 0x205 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x80, hi: 0x80}, + // Block 0x5d, offset 0x207 + {value: 0x0000, lo: 0x05}, + {value: 0x8132, lo: 0xb0, hi: 0xb0}, + {value: 0x8132, lo: 0xb2, hi: 0xb3}, + {value: 0x812d, lo: 0xb4, hi: 0xb4}, + {value: 0x8132, lo: 0xb7, hi: 0xb8}, + {value: 0x8132, lo: 0xbe, hi: 0xbf}, + // Block 0x5e, offset 0x20d + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0x81, hi: 0x81}, + {value: 0x8104, lo: 0xb6, hi: 0xb6}, + // Block 0x5f, offset 0x210 + {value: 0x0008, lo: 0x03}, + {value: 0x1637, lo: 0x9c, hi: 0x9d}, + {value: 0x0125, lo: 0x9e, hi: 0x9e}, + {value: 0x1643, lo: 0x9f, hi: 0x9f}, + // Block 0x60, offset 0x214 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xad, hi: 0xad}, + // Block 0x61, offset 0x216 + {value: 0x0000, lo: 0x06}, + {value: 0xe500, lo: 0x80, hi: 0x80}, + {value: 0xc600, lo: 0x81, hi: 0x9b}, + {value: 0xe500, lo: 0x9c, hi: 0x9c}, + {value: 0xc600, lo: 0x9d, hi: 0xb7}, + {value: 0xe500, lo: 0xb8, hi: 0xb8}, + {value: 0xc600, lo: 0xb9, hi: 0xbf}, + // Block 0x62, offset 0x21d + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x93}, + {value: 0xe500, lo: 0x94, hi: 0x94}, + {value: 0xc600, lo: 0x95, hi: 0xaf}, + {value: 0xe500, lo: 0xb0, hi: 0xb0}, + {value: 0xc600, lo: 0xb1, hi: 0xbf}, + // Block 0x63, offset 0x223 + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x8b}, + {value: 0xe500, lo: 0x8c, hi: 0x8c}, + {value: 0xc600, lo: 0x8d, hi: 0xa7}, + {value: 0xe500, lo: 0xa8, hi: 0xa8}, + {value: 0xc600, lo: 0xa9, hi: 0xbf}, + // Block 0x64, offset 0x229 + {value: 0x0000, lo: 0x07}, + {value: 0xc600, lo: 0x80, hi: 0x83}, + {value: 0xe500, lo: 0x84, hi: 0x84}, + {value: 0xc600, lo: 0x85, hi: 0x9f}, + {value: 0xe500, lo: 0xa0, hi: 0xa0}, + {value: 0xc600, lo: 0xa1, hi: 0xbb}, + {value: 0xe500, lo: 0xbc, hi: 0xbc}, + {value: 0xc600, lo: 0xbd, hi: 0xbf}, + // Block 0x65, offset 0x231 + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x97}, + {value: 0xe500, lo: 0x98, hi: 0x98}, + {value: 0xc600, lo: 0x99, hi: 0xb3}, + {value: 0xe500, lo: 0xb4, hi: 0xb4}, + {value: 0xc600, lo: 0xb5, hi: 0xbf}, + // Block 0x66, offset 0x237 + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x8f}, + {value: 0xe500, lo: 0x90, hi: 0x90}, + {value: 0xc600, lo: 0x91, hi: 0xab}, + {value: 0xe500, lo: 0xac, hi: 0xac}, + {value: 0xc600, lo: 0xad, hi: 0xbf}, + // Block 0x67, offset 0x23d + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x87}, + {value: 0xe500, lo: 0x88, hi: 0x88}, + {value: 0xc600, lo: 0x89, hi: 0xa3}, + {value: 0xe500, lo: 0xa4, hi: 0xa4}, + {value: 0xc600, lo: 0xa5, hi: 0xbf}, + // Block 0x68, offset 0x243 + {value: 0x0000, lo: 0x03}, + {value: 0xc600, lo: 0x80, hi: 0x87}, + {value: 0xe500, lo: 0x88, hi: 0x88}, + {value: 0xc600, lo: 0x89, hi: 0xa3}, + // Block 0x69, offset 0x247 + {value: 0x0002, lo: 0x01}, + {value: 0x0003, lo: 0x81, hi: 0xbf}, + // Block 0x6a, offset 0x249 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0xbd, hi: 0xbd}, + // Block 0x6b, offset 0x24b + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0xa0, hi: 0xa0}, + // Block 0x6c, offset 0x24d + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xb6, hi: 0xba}, + // Block 0x6d, offset 0x24f + {value: 0x002c, lo: 0x05}, + {value: 0x812d, lo: 0x8d, hi: 0x8d}, + {value: 0x8132, lo: 0x8f, hi: 0x8f}, + {value: 0x8132, lo: 0xb8, hi: 0xb8}, + {value: 0x8101, lo: 0xb9, hi: 0xba}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x6e, offset 0x255 + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0xa5, hi: 0xa5}, + {value: 0x812d, lo: 0xa6, hi: 0xa6}, + // Block 0x6f, offset 0x258 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xa4, hi: 0xa7}, + // Block 0x70, offset 0x25a + {value: 0x0000, lo: 0x05}, + {value: 0x812d, lo: 0x86, hi: 0x87}, + {value: 0x8132, lo: 0x88, hi: 0x8a}, + {value: 0x812d, lo: 0x8b, hi: 0x8b}, + {value: 0x8132, lo: 0x8c, hi: 0x8c}, + {value: 0x812d, lo: 0x8d, hi: 0x90}, + // Block 0x71, offset 0x260 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x86, hi: 0x86}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x72, offset 0x263 + {value: 0x17fe, lo: 0x07}, + {value: 0xa000, lo: 0x99, hi: 0x99}, + {value: 0x4238, lo: 0x9a, hi: 0x9a}, + {value: 0xa000, lo: 0x9b, hi: 0x9b}, + {value: 0x4242, lo: 0x9c, hi: 0x9c}, + {value: 0xa000, lo: 0xa5, hi: 0xa5}, + {value: 0x424c, lo: 0xab, hi: 0xab}, + {value: 0x8104, lo: 0xb9, hi: 0xba}, + // Block 0x73, offset 0x26b + {value: 0x0000, lo: 0x06}, + {value: 0x8132, lo: 0x80, hi: 0x82}, + {value: 0x9900, lo: 0xa7, hi: 0xa7}, + {value: 0x2d7e, lo: 0xae, hi: 0xae}, + {value: 0x2d88, lo: 0xaf, hi: 0xaf}, + {value: 0xa000, lo: 0xb1, hi: 0xb2}, + {value: 0x8104, lo: 0xb3, hi: 0xb4}, + // Block 0x74, offset 0x272 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x80, hi: 0x80}, + {value: 0x8102, lo: 0x8a, hi: 0x8a}, + // Block 0x75, offset 0x275 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0xb5, hi: 0xb5}, + {value: 0x8102, lo: 0xb6, hi: 0xb6}, + // Block 0x76, offset 0x278 + {value: 0x0002, lo: 0x01}, + {value: 0x8102, lo: 0xa9, hi: 0xaa}, + // Block 0x77, offset 0x27a + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xbb, hi: 0xbc}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x78, offset 0x27d + {value: 0x0000, lo: 0x07}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0x2d92, lo: 0x8b, hi: 0x8b}, + {value: 0x2d9c, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + {value: 0x8132, lo: 0xa6, hi: 0xac}, + {value: 0x8132, lo: 0xb0, hi: 0xb4}, + // Block 0x79, offset 0x285 + {value: 0x0000, lo: 0x03}, + {value: 0x8104, lo: 0x82, hi: 0x82}, + {value: 0x8102, lo: 0x86, hi: 0x86}, + {value: 0x8132, lo: 0x9e, hi: 0x9e}, + // Block 0x7a, offset 0x289 + {value: 0x6b5a, lo: 0x06}, + {value: 0x9900, lo: 0xb0, hi: 0xb0}, + {value: 0xa000, lo: 0xb9, hi: 0xb9}, + {value: 0x9900, lo: 0xba, hi: 0xba}, + {value: 0x2db0, lo: 0xbb, hi: 0xbb}, + {value: 0x2da6, lo: 0xbc, hi: 0xbd}, + {value: 0x2dba, lo: 0xbe, hi: 0xbe}, + // Block 0x7b, offset 0x290 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x82, hi: 0x82}, + {value: 0x8102, lo: 0x83, hi: 0x83}, + // Block 0x7c, offset 0x293 + {value: 0x0000, lo: 0x05}, + {value: 0x9900, lo: 0xaf, hi: 0xaf}, + {value: 0xa000, lo: 0xb8, hi: 0xb9}, + {value: 0x2dc4, lo: 0xba, hi: 0xba}, + {value: 0x2dce, lo: 0xbb, hi: 0xbb}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x7d, offset 0x299 + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0x80, hi: 0x80}, + // Block 0x7e, offset 0x29b + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x7f, offset 0x29d + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0xb6, hi: 0xb6}, + {value: 0x8102, lo: 0xb7, hi: 0xb7}, + // Block 0x80, offset 0x2a0 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xab, hi: 0xab}, + // Block 0x81, offset 0x2a2 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0xb9, hi: 0xb9}, + {value: 0x8102, lo: 0xba, hi: 0xba}, + // Block 0x82, offset 0x2a5 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xb4, hi: 0xb4}, + // Block 0x83, offset 0x2a7 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x87, hi: 0x87}, + // Block 0x84, offset 0x2a9 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x99, hi: 0x99}, + // Block 0x85, offset 0x2ab + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0x82, hi: 0x82}, + {value: 0x8104, lo: 0x84, hi: 0x85}, + // Block 0x86, offset 0x2ae + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x97, hi: 0x97}, + // Block 0x87, offset 0x2b0 + {value: 0x0000, lo: 0x01}, + {value: 0x8101, lo: 0xb0, hi: 0xb4}, + // Block 0x88, offset 0x2b2 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xb0, hi: 0xb6}, + // Block 0x89, offset 0x2b4 + {value: 0x0000, lo: 0x01}, + {value: 0x8101, lo: 0x9e, hi: 0x9e}, + // Block 0x8a, offset 0x2b6 + {value: 0x0000, lo: 0x0c}, + {value: 0x45cc, lo: 0x9e, hi: 0x9e}, + {value: 0x45d6, lo: 0x9f, hi: 0x9f}, + {value: 0x460a, lo: 0xa0, hi: 0xa0}, + {value: 0x4618, lo: 0xa1, hi: 0xa1}, + {value: 0x4626, lo: 0xa2, hi: 0xa2}, + {value: 0x4634, lo: 0xa3, hi: 0xa3}, + {value: 0x4642, lo: 0xa4, hi: 0xa4}, + {value: 0x812b, lo: 0xa5, hi: 0xa6}, + {value: 0x8101, lo: 0xa7, hi: 0xa9}, + {value: 0x8130, lo: 0xad, hi: 0xad}, + {value: 0x812b, lo: 0xae, hi: 0xb2}, + {value: 0x812d, lo: 0xbb, hi: 0xbf}, + // Block 0x8b, offset 0x2c3 + {value: 0x0000, lo: 0x09}, + {value: 0x812d, lo: 0x80, hi: 0x82}, + {value: 0x8132, lo: 0x85, hi: 0x89}, + {value: 0x812d, lo: 0x8a, hi: 0x8b}, + {value: 0x8132, lo: 0xaa, hi: 0xad}, + {value: 0x45e0, lo: 0xbb, hi: 0xbb}, + {value: 0x45ea, lo: 0xbc, hi: 0xbc}, + {value: 0x4650, lo: 0xbd, hi: 0xbd}, + {value: 0x466c, lo: 0xbe, hi: 0xbe}, + {value: 0x465e, lo: 0xbf, hi: 0xbf}, + // Block 0x8c, offset 0x2cd + {value: 0x0000, lo: 0x01}, + {value: 0x467a, lo: 0x80, hi: 0x80}, + // Block 0x8d, offset 0x2cf + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x82, hi: 0x84}, + // Block 0x8e, offset 0x2d1 + {value: 0x0002, lo: 0x03}, + {value: 0x0043, lo: 0x80, hi: 0x99}, + {value: 0x0083, lo: 0x9a, hi: 0xb3}, + {value: 0x0043, lo: 0xb4, hi: 0xbf}, + // Block 0x8f, offset 0x2d5 + {value: 0x0002, lo: 0x04}, + {value: 0x005b, lo: 0x80, hi: 0x8d}, + {value: 0x0083, lo: 0x8e, hi: 0x94}, + {value: 0x0093, lo: 0x96, hi: 0xa7}, + {value: 0x0043, lo: 0xa8, hi: 0xbf}, + // Block 0x90, offset 0x2da + {value: 0x0002, lo: 0x0b}, + {value: 0x0073, lo: 0x80, hi: 0x81}, + {value: 0x0083, lo: 0x82, hi: 0x9b}, + {value: 0x0043, lo: 0x9c, hi: 0x9c}, + {value: 0x0047, lo: 0x9e, hi: 0x9f}, + {value: 0x004f, lo: 0xa2, hi: 0xa2}, + {value: 0x0055, lo: 0xa5, hi: 0xa6}, + {value: 0x005d, lo: 0xa9, hi: 0xac}, + {value: 0x0067, lo: 0xae, hi: 0xb5}, + {value: 0x0083, lo: 0xb6, hi: 0xb9}, + {value: 0x008d, lo: 0xbb, hi: 0xbb}, + {value: 0x0091, lo: 0xbd, hi: 0xbf}, + // Block 0x91, offset 0x2e6 + {value: 0x0002, lo: 0x04}, + {value: 0x0097, lo: 0x80, hi: 0x83}, + {value: 0x00a1, lo: 0x85, hi: 0x8f}, + {value: 0x0043, lo: 0x90, hi: 0xa9}, + {value: 0x0083, lo: 0xaa, hi: 0xbf}, + // Block 0x92, offset 0x2eb + {value: 0x0002, lo: 0x08}, + {value: 0x00af, lo: 0x80, hi: 0x83}, + {value: 0x0043, lo: 0x84, hi: 0x85}, + {value: 0x0049, lo: 0x87, hi: 0x8a}, + {value: 0x0055, lo: 0x8d, hi: 0x94}, + {value: 0x0067, lo: 0x96, hi: 0x9c}, + {value: 0x0083, lo: 0x9e, hi: 0xb7}, + {value: 0x0043, lo: 0xb8, hi: 0xb9}, + {value: 0x0049, lo: 0xbb, hi: 0xbe}, + // Block 0x93, offset 0x2f4 + {value: 0x0002, lo: 0x05}, + {value: 0x0053, lo: 0x80, hi: 0x84}, + {value: 0x005f, lo: 0x86, hi: 0x86}, + {value: 0x0067, lo: 0x8a, hi: 0x90}, + {value: 0x0083, lo: 0x92, hi: 0xab}, + {value: 0x0043, lo: 0xac, hi: 0xbf}, + // Block 0x94, offset 0x2fa + {value: 0x0002, lo: 0x04}, + {value: 0x006b, lo: 0x80, hi: 0x85}, + {value: 0x0083, lo: 0x86, hi: 0x9f}, + {value: 0x0043, lo: 0xa0, hi: 0xb9}, + {value: 0x0083, lo: 0xba, hi: 0xbf}, + // Block 0x95, offset 0x2ff + {value: 0x0002, lo: 0x03}, + {value: 0x008f, lo: 0x80, hi: 0x93}, + {value: 0x0043, lo: 0x94, hi: 0xad}, + {value: 0x0083, lo: 0xae, hi: 0xbf}, + // Block 0x96, offset 0x303 + {value: 0x0002, lo: 0x04}, + {value: 0x00a7, lo: 0x80, hi: 0x87}, + {value: 0x0043, lo: 0x88, hi: 0xa1}, + {value: 0x0083, lo: 0xa2, hi: 0xbb}, + {value: 0x0043, lo: 0xbc, hi: 0xbf}, + // Block 0x97, offset 0x308 + {value: 0x0002, lo: 0x03}, + {value: 0x004b, lo: 0x80, hi: 0x95}, + {value: 0x0083, lo: 0x96, hi: 0xaf}, + {value: 0x0043, lo: 0xb0, hi: 0xbf}, + // Block 0x98, offset 0x30c + {value: 0x0003, lo: 0x0f}, + {value: 0x01b8, lo: 0x80, hi: 0x80}, + {value: 0x045f, lo: 0x81, hi: 0x81}, + {value: 0x01bb, lo: 0x82, hi: 0x9a}, + {value: 0x045b, lo: 0x9b, hi: 0x9b}, + {value: 0x01c7, lo: 0x9c, hi: 0x9c}, + {value: 0x01d0, lo: 0x9d, hi: 0x9d}, + {value: 0x01d6, lo: 0x9e, hi: 0x9e}, + {value: 0x01fa, lo: 0x9f, hi: 0x9f}, + {value: 0x01eb, lo: 0xa0, hi: 0xa0}, + {value: 0x01e8, lo: 0xa1, hi: 0xa1}, + {value: 0x0173, lo: 0xa2, hi: 0xb2}, + {value: 0x0188, lo: 0xb3, hi: 0xb3}, + {value: 0x01a6, lo: 0xb4, hi: 0xba}, + {value: 0x045f, lo: 0xbb, hi: 0xbb}, + {value: 0x01bb, lo: 0xbc, hi: 0xbf}, + // Block 0x99, offset 0x31c + {value: 0x0003, lo: 0x0d}, + {value: 0x01c7, lo: 0x80, hi: 0x94}, + {value: 0x045b, lo: 0x95, hi: 0x95}, + {value: 0x01c7, lo: 0x96, hi: 0x96}, + {value: 0x01d0, lo: 0x97, hi: 0x97}, + {value: 0x01d6, lo: 0x98, hi: 0x98}, + {value: 0x01fa, lo: 0x99, hi: 0x99}, + {value: 0x01eb, lo: 0x9a, hi: 0x9a}, + {value: 0x01e8, lo: 0x9b, hi: 0x9b}, + {value: 0x0173, lo: 0x9c, hi: 0xac}, + {value: 0x0188, lo: 0xad, hi: 0xad}, + {value: 0x01a6, lo: 0xae, hi: 0xb4}, + {value: 0x045f, lo: 0xb5, hi: 0xb5}, + {value: 0x01bb, lo: 0xb6, hi: 0xbf}, + // Block 0x9a, offset 0x32a + {value: 0x0003, lo: 0x0d}, + {value: 0x01d9, lo: 0x80, hi: 0x8e}, + {value: 0x045b, lo: 0x8f, hi: 0x8f}, + {value: 0x01c7, lo: 0x90, hi: 0x90}, + {value: 0x01d0, lo: 0x91, hi: 0x91}, + {value: 0x01d6, lo: 0x92, hi: 0x92}, + {value: 0x01fa, lo: 0x93, hi: 0x93}, + {value: 0x01eb, lo: 0x94, hi: 0x94}, + {value: 0x01e8, lo: 0x95, hi: 0x95}, + {value: 0x0173, lo: 0x96, hi: 0xa6}, + {value: 0x0188, lo: 0xa7, hi: 0xa7}, + {value: 0x01a6, lo: 0xa8, hi: 0xae}, + {value: 0x045f, lo: 0xaf, hi: 0xaf}, + {value: 0x01bb, lo: 0xb0, hi: 0xbf}, + // Block 0x9b, offset 0x338 + {value: 0x0003, lo: 0x0d}, + {value: 0x01eb, lo: 0x80, hi: 0x88}, + {value: 0x045b, lo: 0x89, hi: 0x89}, + {value: 0x01c7, lo: 0x8a, hi: 0x8a}, + {value: 0x01d0, lo: 0x8b, hi: 0x8b}, + {value: 0x01d6, lo: 0x8c, hi: 0x8c}, + {value: 0x01fa, lo: 0x8d, hi: 0x8d}, + {value: 0x01eb, lo: 0x8e, hi: 0x8e}, + {value: 0x01e8, lo: 0x8f, hi: 0x8f}, + {value: 0x0173, lo: 0x90, hi: 0xa0}, + {value: 0x0188, lo: 0xa1, hi: 0xa1}, + {value: 0x01a6, lo: 0xa2, hi: 0xa8}, + {value: 0x045f, lo: 0xa9, hi: 0xa9}, + {value: 0x01bb, lo: 0xaa, hi: 0xbf}, + // Block 0x9c, offset 0x346 + {value: 0x0000, lo: 0x05}, + {value: 0x8132, lo: 0x80, hi: 0x86}, + {value: 0x8132, lo: 0x88, hi: 0x98}, + {value: 0x8132, lo: 0x9b, hi: 0xa1}, + {value: 0x8132, lo: 0xa3, hi: 0xa4}, + {value: 0x8132, lo: 0xa6, hi: 0xaa}, + // Block 0x9d, offset 0x34c + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x90, hi: 0x96}, + // Block 0x9e, offset 0x34e + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0x84, hi: 0x89}, + {value: 0x8102, lo: 0x8a, hi: 0x8a}, + // Block 0x9f, offset 0x351 + {value: 0x0002, lo: 0x09}, + {value: 0x0063, lo: 0x80, hi: 0x89}, + {value: 0x1951, lo: 0x8a, hi: 0x8a}, + {value: 0x1981, lo: 0x8b, hi: 0x8b}, + {value: 0x199c, lo: 0x8c, hi: 0x8c}, + {value: 0x19a2, lo: 0x8d, hi: 0x8d}, + {value: 0x1bc0, lo: 0x8e, hi: 0x8e}, + {value: 0x19ae, lo: 0x8f, hi: 0x8f}, + {value: 0x197b, lo: 0xaa, hi: 0xaa}, + {value: 0x197e, lo: 0xab, hi: 0xab}, + // Block 0xa0, offset 0x35b + {value: 0x0000, lo: 0x01}, + {value: 0x193f, lo: 0x90, hi: 0x90}, + // Block 0xa1, offset 0x35d + {value: 0x0028, lo: 0x09}, + {value: 0x2862, lo: 0x80, hi: 0x80}, + {value: 0x2826, lo: 0x81, hi: 0x81}, + {value: 0x2830, lo: 0x82, hi: 0x82}, + {value: 0x2844, lo: 0x83, hi: 0x84}, + {value: 0x284e, lo: 0x85, hi: 0x86}, + {value: 0x283a, lo: 0x87, hi: 0x87}, + {value: 0x2858, lo: 0x88, hi: 0x88}, + {value: 0x0b6f, lo: 0x90, hi: 0x90}, + {value: 0x08e7, lo: 0x91, hi: 0x91}, +} + +// recompMap: 7520 bytes (entries only) +var recompMap map[uint32]rune +var recompMapOnce sync.Once + +const recompMapPacked = "" + + "\x00A\x03\x00\x00\x00\x00\xc0" + // 0x00410300: 0x000000C0 + "\x00A\x03\x01\x00\x00\x00\xc1" + // 0x00410301: 0x000000C1 + "\x00A\x03\x02\x00\x00\x00\xc2" + // 0x00410302: 0x000000C2 + "\x00A\x03\x03\x00\x00\x00\xc3" + // 0x00410303: 0x000000C3 + "\x00A\x03\b\x00\x00\x00\xc4" + // 0x00410308: 0x000000C4 + "\x00A\x03\n\x00\x00\x00\xc5" + // 0x0041030A: 0x000000C5 + "\x00C\x03'\x00\x00\x00\xc7" + // 0x00430327: 0x000000C7 + "\x00E\x03\x00\x00\x00\x00\xc8" + // 0x00450300: 0x000000C8 + "\x00E\x03\x01\x00\x00\x00\xc9" + // 0x00450301: 0x000000C9 + "\x00E\x03\x02\x00\x00\x00\xca" + // 0x00450302: 0x000000CA + "\x00E\x03\b\x00\x00\x00\xcb" + // 0x00450308: 0x000000CB + "\x00I\x03\x00\x00\x00\x00\xcc" + // 0x00490300: 0x000000CC + "\x00I\x03\x01\x00\x00\x00\xcd" + // 0x00490301: 0x000000CD + "\x00I\x03\x02\x00\x00\x00\xce" + // 0x00490302: 0x000000CE + "\x00I\x03\b\x00\x00\x00\xcf" + // 0x00490308: 0x000000CF + "\x00N\x03\x03\x00\x00\x00\xd1" + // 0x004E0303: 0x000000D1 + "\x00O\x03\x00\x00\x00\x00\xd2" + // 0x004F0300: 0x000000D2 + "\x00O\x03\x01\x00\x00\x00\xd3" + // 0x004F0301: 0x000000D3 + "\x00O\x03\x02\x00\x00\x00\xd4" + // 0x004F0302: 0x000000D4 + "\x00O\x03\x03\x00\x00\x00\xd5" + // 0x004F0303: 0x000000D5 + "\x00O\x03\b\x00\x00\x00\xd6" + // 0x004F0308: 0x000000D6 + "\x00U\x03\x00\x00\x00\x00\xd9" + // 0x00550300: 0x000000D9 + "\x00U\x03\x01\x00\x00\x00\xda" + // 0x00550301: 0x000000DA + "\x00U\x03\x02\x00\x00\x00\xdb" + // 0x00550302: 0x000000DB + "\x00U\x03\b\x00\x00\x00\xdc" + // 0x00550308: 0x000000DC + "\x00Y\x03\x01\x00\x00\x00\xdd" + // 0x00590301: 0x000000DD + "\x00a\x03\x00\x00\x00\x00\xe0" + // 0x00610300: 0x000000E0 + "\x00a\x03\x01\x00\x00\x00\xe1" + // 0x00610301: 0x000000E1 + "\x00a\x03\x02\x00\x00\x00\xe2" + // 0x00610302: 0x000000E2 + "\x00a\x03\x03\x00\x00\x00\xe3" + // 0x00610303: 0x000000E3 + "\x00a\x03\b\x00\x00\x00\xe4" + // 0x00610308: 0x000000E4 + "\x00a\x03\n\x00\x00\x00\xe5" + // 0x0061030A: 0x000000E5 + "\x00c\x03'\x00\x00\x00\xe7" + // 0x00630327: 0x000000E7 + "\x00e\x03\x00\x00\x00\x00\xe8" + // 0x00650300: 0x000000E8 + "\x00e\x03\x01\x00\x00\x00\xe9" + // 0x00650301: 0x000000E9 + "\x00e\x03\x02\x00\x00\x00\xea" + // 0x00650302: 0x000000EA + "\x00e\x03\b\x00\x00\x00\xeb" + // 0x00650308: 0x000000EB + "\x00i\x03\x00\x00\x00\x00\xec" + // 0x00690300: 0x000000EC + "\x00i\x03\x01\x00\x00\x00\xed" + // 0x00690301: 0x000000ED + "\x00i\x03\x02\x00\x00\x00\xee" + // 0x00690302: 0x000000EE + "\x00i\x03\b\x00\x00\x00\xef" + // 0x00690308: 0x000000EF + "\x00n\x03\x03\x00\x00\x00\xf1" + // 0x006E0303: 0x000000F1 + "\x00o\x03\x00\x00\x00\x00\xf2" + // 0x006F0300: 0x000000F2 + "\x00o\x03\x01\x00\x00\x00\xf3" + // 0x006F0301: 0x000000F3 + "\x00o\x03\x02\x00\x00\x00\xf4" + // 0x006F0302: 0x000000F4 + "\x00o\x03\x03\x00\x00\x00\xf5" + // 0x006F0303: 0x000000F5 + "\x00o\x03\b\x00\x00\x00\xf6" + // 0x006F0308: 0x000000F6 + "\x00u\x03\x00\x00\x00\x00\xf9" + // 0x00750300: 0x000000F9 + "\x00u\x03\x01\x00\x00\x00\xfa" + // 0x00750301: 0x000000FA + "\x00u\x03\x02\x00\x00\x00\xfb" + // 0x00750302: 0x000000FB + "\x00u\x03\b\x00\x00\x00\xfc" + // 0x00750308: 0x000000FC + "\x00y\x03\x01\x00\x00\x00\xfd" + // 0x00790301: 0x000000FD + "\x00y\x03\b\x00\x00\x00\xff" + // 0x00790308: 0x000000FF + "\x00A\x03\x04\x00\x00\x01\x00" + // 0x00410304: 0x00000100 + "\x00a\x03\x04\x00\x00\x01\x01" + // 0x00610304: 0x00000101 + "\x00A\x03\x06\x00\x00\x01\x02" + // 0x00410306: 0x00000102 + "\x00a\x03\x06\x00\x00\x01\x03" + // 0x00610306: 0x00000103 + "\x00A\x03(\x00\x00\x01\x04" + // 0x00410328: 0x00000104 + "\x00a\x03(\x00\x00\x01\x05" + // 0x00610328: 0x00000105 + "\x00C\x03\x01\x00\x00\x01\x06" + // 0x00430301: 0x00000106 + "\x00c\x03\x01\x00\x00\x01\a" + // 0x00630301: 0x00000107 + "\x00C\x03\x02\x00\x00\x01\b" + // 0x00430302: 0x00000108 + "\x00c\x03\x02\x00\x00\x01\t" + // 0x00630302: 0x00000109 + "\x00C\x03\a\x00\x00\x01\n" + // 0x00430307: 0x0000010A + "\x00c\x03\a\x00\x00\x01\v" + // 0x00630307: 0x0000010B + "\x00C\x03\f\x00\x00\x01\f" + // 0x0043030C: 0x0000010C + "\x00c\x03\f\x00\x00\x01\r" + // 0x0063030C: 0x0000010D + "\x00D\x03\f\x00\x00\x01\x0e" + // 0x0044030C: 0x0000010E + "\x00d\x03\f\x00\x00\x01\x0f" + // 0x0064030C: 0x0000010F + "\x00E\x03\x04\x00\x00\x01\x12" + // 0x00450304: 0x00000112 + "\x00e\x03\x04\x00\x00\x01\x13" + // 0x00650304: 0x00000113 + "\x00E\x03\x06\x00\x00\x01\x14" + // 0x00450306: 0x00000114 + "\x00e\x03\x06\x00\x00\x01\x15" + // 0x00650306: 0x00000115 + "\x00E\x03\a\x00\x00\x01\x16" + // 0x00450307: 0x00000116 + "\x00e\x03\a\x00\x00\x01\x17" + // 0x00650307: 0x00000117 + "\x00E\x03(\x00\x00\x01\x18" + // 0x00450328: 0x00000118 + "\x00e\x03(\x00\x00\x01\x19" + // 0x00650328: 0x00000119 + "\x00E\x03\f\x00\x00\x01\x1a" + // 0x0045030C: 0x0000011A + "\x00e\x03\f\x00\x00\x01\x1b" + // 0x0065030C: 0x0000011B + "\x00G\x03\x02\x00\x00\x01\x1c" + // 0x00470302: 0x0000011C + "\x00g\x03\x02\x00\x00\x01\x1d" + // 0x00670302: 0x0000011D + "\x00G\x03\x06\x00\x00\x01\x1e" + // 0x00470306: 0x0000011E + "\x00g\x03\x06\x00\x00\x01\x1f" + // 0x00670306: 0x0000011F + "\x00G\x03\a\x00\x00\x01 " + // 0x00470307: 0x00000120 + "\x00g\x03\a\x00\x00\x01!" + // 0x00670307: 0x00000121 + "\x00G\x03'\x00\x00\x01\"" + // 0x00470327: 0x00000122 + "\x00g\x03'\x00\x00\x01#" + // 0x00670327: 0x00000123 + "\x00H\x03\x02\x00\x00\x01$" + // 0x00480302: 0x00000124 + "\x00h\x03\x02\x00\x00\x01%" + // 0x00680302: 0x00000125 + "\x00I\x03\x03\x00\x00\x01(" + // 0x00490303: 0x00000128 + "\x00i\x03\x03\x00\x00\x01)" + // 0x00690303: 0x00000129 + "\x00I\x03\x04\x00\x00\x01*" + // 0x00490304: 0x0000012A + "\x00i\x03\x04\x00\x00\x01+" + // 0x00690304: 0x0000012B + "\x00I\x03\x06\x00\x00\x01," + // 0x00490306: 0x0000012C + "\x00i\x03\x06\x00\x00\x01-" + // 0x00690306: 0x0000012D + "\x00I\x03(\x00\x00\x01." + // 0x00490328: 0x0000012E + "\x00i\x03(\x00\x00\x01/" + // 0x00690328: 0x0000012F + "\x00I\x03\a\x00\x00\x010" + // 0x00490307: 0x00000130 + "\x00J\x03\x02\x00\x00\x014" + // 0x004A0302: 0x00000134 + "\x00j\x03\x02\x00\x00\x015" + // 0x006A0302: 0x00000135 + "\x00K\x03'\x00\x00\x016" + // 0x004B0327: 0x00000136 + "\x00k\x03'\x00\x00\x017" + // 0x006B0327: 0x00000137 + "\x00L\x03\x01\x00\x00\x019" + // 0x004C0301: 0x00000139 + "\x00l\x03\x01\x00\x00\x01:" + // 0x006C0301: 0x0000013A + "\x00L\x03'\x00\x00\x01;" + // 0x004C0327: 0x0000013B + "\x00l\x03'\x00\x00\x01<" + // 0x006C0327: 0x0000013C + "\x00L\x03\f\x00\x00\x01=" + // 0x004C030C: 0x0000013D + "\x00l\x03\f\x00\x00\x01>" + // 0x006C030C: 0x0000013E + "\x00N\x03\x01\x00\x00\x01C" + // 0x004E0301: 0x00000143 + "\x00n\x03\x01\x00\x00\x01D" + // 0x006E0301: 0x00000144 + "\x00N\x03'\x00\x00\x01E" + // 0x004E0327: 0x00000145 + "\x00n\x03'\x00\x00\x01F" + // 0x006E0327: 0x00000146 + "\x00N\x03\f\x00\x00\x01G" + // 0x004E030C: 0x00000147 + "\x00n\x03\f\x00\x00\x01H" + // 0x006E030C: 0x00000148 + "\x00O\x03\x04\x00\x00\x01L" + // 0x004F0304: 0x0000014C + "\x00o\x03\x04\x00\x00\x01M" + // 0x006F0304: 0x0000014D + "\x00O\x03\x06\x00\x00\x01N" + // 0x004F0306: 0x0000014E + "\x00o\x03\x06\x00\x00\x01O" + // 0x006F0306: 0x0000014F + "\x00O\x03\v\x00\x00\x01P" + // 0x004F030B: 0x00000150 + "\x00o\x03\v\x00\x00\x01Q" + // 0x006F030B: 0x00000151 + "\x00R\x03\x01\x00\x00\x01T" + // 0x00520301: 0x00000154 + "\x00r\x03\x01\x00\x00\x01U" + // 0x00720301: 0x00000155 + "\x00R\x03'\x00\x00\x01V" + // 0x00520327: 0x00000156 + "\x00r\x03'\x00\x00\x01W" + // 0x00720327: 0x00000157 + "\x00R\x03\f\x00\x00\x01X" + // 0x0052030C: 0x00000158 + "\x00r\x03\f\x00\x00\x01Y" + // 0x0072030C: 0x00000159 + "\x00S\x03\x01\x00\x00\x01Z" + // 0x00530301: 0x0000015A + "\x00s\x03\x01\x00\x00\x01[" + // 0x00730301: 0x0000015B + "\x00S\x03\x02\x00\x00\x01\\" + // 0x00530302: 0x0000015C + "\x00s\x03\x02\x00\x00\x01]" + // 0x00730302: 0x0000015D + "\x00S\x03'\x00\x00\x01^" + // 0x00530327: 0x0000015E + "\x00s\x03'\x00\x00\x01_" + // 0x00730327: 0x0000015F + "\x00S\x03\f\x00\x00\x01`" + // 0x0053030C: 0x00000160 + "\x00s\x03\f\x00\x00\x01a" + // 0x0073030C: 0x00000161 + "\x00T\x03'\x00\x00\x01b" + // 0x00540327: 0x00000162 + "\x00t\x03'\x00\x00\x01c" + // 0x00740327: 0x00000163 + "\x00T\x03\f\x00\x00\x01d" + // 0x0054030C: 0x00000164 + "\x00t\x03\f\x00\x00\x01e" + // 0x0074030C: 0x00000165 + "\x00U\x03\x03\x00\x00\x01h" + // 0x00550303: 0x00000168 + "\x00u\x03\x03\x00\x00\x01i" + // 0x00750303: 0x00000169 + "\x00U\x03\x04\x00\x00\x01j" + // 0x00550304: 0x0000016A + "\x00u\x03\x04\x00\x00\x01k" + // 0x00750304: 0x0000016B + "\x00U\x03\x06\x00\x00\x01l" + // 0x00550306: 0x0000016C + "\x00u\x03\x06\x00\x00\x01m" + // 0x00750306: 0x0000016D + "\x00U\x03\n\x00\x00\x01n" + // 0x0055030A: 0x0000016E + "\x00u\x03\n\x00\x00\x01o" + // 0x0075030A: 0x0000016F + "\x00U\x03\v\x00\x00\x01p" + // 0x0055030B: 0x00000170 + "\x00u\x03\v\x00\x00\x01q" + // 0x0075030B: 0x00000171 + "\x00U\x03(\x00\x00\x01r" + // 0x00550328: 0x00000172 + "\x00u\x03(\x00\x00\x01s" + // 0x00750328: 0x00000173 + "\x00W\x03\x02\x00\x00\x01t" + // 0x00570302: 0x00000174 + "\x00w\x03\x02\x00\x00\x01u" + // 0x00770302: 0x00000175 + "\x00Y\x03\x02\x00\x00\x01v" + // 0x00590302: 0x00000176 + "\x00y\x03\x02\x00\x00\x01w" + // 0x00790302: 0x00000177 + "\x00Y\x03\b\x00\x00\x01x" + // 0x00590308: 0x00000178 + "\x00Z\x03\x01\x00\x00\x01y" + // 0x005A0301: 0x00000179 + "\x00z\x03\x01\x00\x00\x01z" + // 0x007A0301: 0x0000017A + "\x00Z\x03\a\x00\x00\x01{" + // 0x005A0307: 0x0000017B + "\x00z\x03\a\x00\x00\x01|" + // 0x007A0307: 0x0000017C + "\x00Z\x03\f\x00\x00\x01}" + // 0x005A030C: 0x0000017D + "\x00z\x03\f\x00\x00\x01~" + // 0x007A030C: 0x0000017E + "\x00O\x03\x1b\x00\x00\x01\xa0" + // 0x004F031B: 0x000001A0 + "\x00o\x03\x1b\x00\x00\x01\xa1" + // 0x006F031B: 0x000001A1 + "\x00U\x03\x1b\x00\x00\x01\xaf" + // 0x0055031B: 0x000001AF + "\x00u\x03\x1b\x00\x00\x01\xb0" + // 0x0075031B: 0x000001B0 + "\x00A\x03\f\x00\x00\x01\xcd" + // 0x0041030C: 0x000001CD + "\x00a\x03\f\x00\x00\x01\xce" + // 0x0061030C: 0x000001CE + "\x00I\x03\f\x00\x00\x01\xcf" + // 0x0049030C: 0x000001CF + "\x00i\x03\f\x00\x00\x01\xd0" + // 0x0069030C: 0x000001D0 + "\x00O\x03\f\x00\x00\x01\xd1" + // 0x004F030C: 0x000001D1 + "\x00o\x03\f\x00\x00\x01\xd2" + // 0x006F030C: 0x000001D2 + "\x00U\x03\f\x00\x00\x01\xd3" + // 0x0055030C: 0x000001D3 + "\x00u\x03\f\x00\x00\x01\xd4" + // 0x0075030C: 0x000001D4 + "\x00\xdc\x03\x04\x00\x00\x01\xd5" + // 0x00DC0304: 0x000001D5 + "\x00\xfc\x03\x04\x00\x00\x01\xd6" + // 0x00FC0304: 0x000001D6 + "\x00\xdc\x03\x01\x00\x00\x01\xd7" + // 0x00DC0301: 0x000001D7 + "\x00\xfc\x03\x01\x00\x00\x01\xd8" + // 0x00FC0301: 0x000001D8 + "\x00\xdc\x03\f\x00\x00\x01\xd9" + // 0x00DC030C: 0x000001D9 + "\x00\xfc\x03\f\x00\x00\x01\xda" + // 0x00FC030C: 0x000001DA + "\x00\xdc\x03\x00\x00\x00\x01\xdb" + // 0x00DC0300: 0x000001DB + "\x00\xfc\x03\x00\x00\x00\x01\xdc" + // 0x00FC0300: 0x000001DC + "\x00\xc4\x03\x04\x00\x00\x01\xde" + // 0x00C40304: 0x000001DE + "\x00\xe4\x03\x04\x00\x00\x01\xdf" + // 0x00E40304: 0x000001DF + "\x02&\x03\x04\x00\x00\x01\xe0" + // 0x02260304: 0x000001E0 + "\x02'\x03\x04\x00\x00\x01\xe1" + // 0x02270304: 0x000001E1 + "\x00\xc6\x03\x04\x00\x00\x01\xe2" + // 0x00C60304: 0x000001E2 + "\x00\xe6\x03\x04\x00\x00\x01\xe3" + // 0x00E60304: 0x000001E3 + "\x00G\x03\f\x00\x00\x01\xe6" + // 0x0047030C: 0x000001E6 + "\x00g\x03\f\x00\x00\x01\xe7" + // 0x0067030C: 0x000001E7 + "\x00K\x03\f\x00\x00\x01\xe8" + // 0x004B030C: 0x000001E8 + "\x00k\x03\f\x00\x00\x01\xe9" + // 0x006B030C: 0x000001E9 + "\x00O\x03(\x00\x00\x01\xea" + // 0x004F0328: 0x000001EA + "\x00o\x03(\x00\x00\x01\xeb" + // 0x006F0328: 0x000001EB + "\x01\xea\x03\x04\x00\x00\x01\xec" + // 0x01EA0304: 0x000001EC + "\x01\xeb\x03\x04\x00\x00\x01\xed" + // 0x01EB0304: 0x000001ED + "\x01\xb7\x03\f\x00\x00\x01\xee" + // 0x01B7030C: 0x000001EE + "\x02\x92\x03\f\x00\x00\x01\xef" + // 0x0292030C: 0x000001EF + "\x00j\x03\f\x00\x00\x01\xf0" + // 0x006A030C: 0x000001F0 + "\x00G\x03\x01\x00\x00\x01\xf4" + // 0x00470301: 0x000001F4 + "\x00g\x03\x01\x00\x00\x01\xf5" + // 0x00670301: 0x000001F5 + "\x00N\x03\x00\x00\x00\x01\xf8" + // 0x004E0300: 0x000001F8 + "\x00n\x03\x00\x00\x00\x01\xf9" + // 0x006E0300: 0x000001F9 + "\x00\xc5\x03\x01\x00\x00\x01\xfa" + // 0x00C50301: 0x000001FA + "\x00\xe5\x03\x01\x00\x00\x01\xfb" + // 0x00E50301: 0x000001FB + "\x00\xc6\x03\x01\x00\x00\x01\xfc" + // 0x00C60301: 0x000001FC + "\x00\xe6\x03\x01\x00\x00\x01\xfd" + // 0x00E60301: 0x000001FD + "\x00\xd8\x03\x01\x00\x00\x01\xfe" + // 0x00D80301: 0x000001FE + "\x00\xf8\x03\x01\x00\x00\x01\xff" + // 0x00F80301: 0x000001FF + "\x00A\x03\x0f\x00\x00\x02\x00" + // 0x0041030F: 0x00000200 + "\x00a\x03\x0f\x00\x00\x02\x01" + // 0x0061030F: 0x00000201 + "\x00A\x03\x11\x00\x00\x02\x02" + // 0x00410311: 0x00000202 + "\x00a\x03\x11\x00\x00\x02\x03" + // 0x00610311: 0x00000203 + "\x00E\x03\x0f\x00\x00\x02\x04" + // 0x0045030F: 0x00000204 + "\x00e\x03\x0f\x00\x00\x02\x05" + // 0x0065030F: 0x00000205 + "\x00E\x03\x11\x00\x00\x02\x06" + // 0x00450311: 0x00000206 + "\x00e\x03\x11\x00\x00\x02\a" + // 0x00650311: 0x00000207 + "\x00I\x03\x0f\x00\x00\x02\b" + // 0x0049030F: 0x00000208 + "\x00i\x03\x0f\x00\x00\x02\t" + // 0x0069030F: 0x00000209 + "\x00I\x03\x11\x00\x00\x02\n" + // 0x00490311: 0x0000020A + "\x00i\x03\x11\x00\x00\x02\v" + // 0x00690311: 0x0000020B + "\x00O\x03\x0f\x00\x00\x02\f" + // 0x004F030F: 0x0000020C + "\x00o\x03\x0f\x00\x00\x02\r" + // 0x006F030F: 0x0000020D + "\x00O\x03\x11\x00\x00\x02\x0e" + // 0x004F0311: 0x0000020E + "\x00o\x03\x11\x00\x00\x02\x0f" + // 0x006F0311: 0x0000020F + "\x00R\x03\x0f\x00\x00\x02\x10" + // 0x0052030F: 0x00000210 + "\x00r\x03\x0f\x00\x00\x02\x11" + // 0x0072030F: 0x00000211 + "\x00R\x03\x11\x00\x00\x02\x12" + // 0x00520311: 0x00000212 + "\x00r\x03\x11\x00\x00\x02\x13" + // 0x00720311: 0x00000213 + "\x00U\x03\x0f\x00\x00\x02\x14" + // 0x0055030F: 0x00000214 + "\x00u\x03\x0f\x00\x00\x02\x15" + // 0x0075030F: 0x00000215 + "\x00U\x03\x11\x00\x00\x02\x16" + // 0x00550311: 0x00000216 + "\x00u\x03\x11\x00\x00\x02\x17" + // 0x00750311: 0x00000217 + "\x00S\x03&\x00\x00\x02\x18" + // 0x00530326: 0x00000218 + "\x00s\x03&\x00\x00\x02\x19" + // 0x00730326: 0x00000219 + "\x00T\x03&\x00\x00\x02\x1a" + // 0x00540326: 0x0000021A + "\x00t\x03&\x00\x00\x02\x1b" + // 0x00740326: 0x0000021B + "\x00H\x03\f\x00\x00\x02\x1e" + // 0x0048030C: 0x0000021E + "\x00h\x03\f\x00\x00\x02\x1f" + // 0x0068030C: 0x0000021F + "\x00A\x03\a\x00\x00\x02&" + // 0x00410307: 0x00000226 + "\x00a\x03\a\x00\x00\x02'" + // 0x00610307: 0x00000227 + "\x00E\x03'\x00\x00\x02(" + // 0x00450327: 0x00000228 + "\x00e\x03'\x00\x00\x02)" + // 0x00650327: 0x00000229 + "\x00\xd6\x03\x04\x00\x00\x02*" + // 0x00D60304: 0x0000022A + "\x00\xf6\x03\x04\x00\x00\x02+" + // 0x00F60304: 0x0000022B + "\x00\xd5\x03\x04\x00\x00\x02," + // 0x00D50304: 0x0000022C + "\x00\xf5\x03\x04\x00\x00\x02-" + // 0x00F50304: 0x0000022D + "\x00O\x03\a\x00\x00\x02." + // 0x004F0307: 0x0000022E + "\x00o\x03\a\x00\x00\x02/" + // 0x006F0307: 0x0000022F + "\x02.\x03\x04\x00\x00\x020" + // 0x022E0304: 0x00000230 + "\x02/\x03\x04\x00\x00\x021" + // 0x022F0304: 0x00000231 + "\x00Y\x03\x04\x00\x00\x022" + // 0x00590304: 0x00000232 + "\x00y\x03\x04\x00\x00\x023" + // 0x00790304: 0x00000233 + "\x00\xa8\x03\x01\x00\x00\x03\x85" + // 0x00A80301: 0x00000385 + "\x03\x91\x03\x01\x00\x00\x03\x86" + // 0x03910301: 0x00000386 + "\x03\x95\x03\x01\x00\x00\x03\x88" + // 0x03950301: 0x00000388 + "\x03\x97\x03\x01\x00\x00\x03\x89" + // 0x03970301: 0x00000389 + "\x03\x99\x03\x01\x00\x00\x03\x8a" + // 0x03990301: 0x0000038A + "\x03\x9f\x03\x01\x00\x00\x03\x8c" + // 0x039F0301: 0x0000038C + "\x03\xa5\x03\x01\x00\x00\x03\x8e" + // 0x03A50301: 0x0000038E + "\x03\xa9\x03\x01\x00\x00\x03\x8f" + // 0x03A90301: 0x0000038F + "\x03\xca\x03\x01\x00\x00\x03\x90" + // 0x03CA0301: 0x00000390 + "\x03\x99\x03\b\x00\x00\x03\xaa" + // 0x03990308: 0x000003AA + "\x03\xa5\x03\b\x00\x00\x03\xab" + // 0x03A50308: 0x000003AB + "\x03\xb1\x03\x01\x00\x00\x03\xac" + // 0x03B10301: 0x000003AC + "\x03\xb5\x03\x01\x00\x00\x03\xad" + // 0x03B50301: 0x000003AD + "\x03\xb7\x03\x01\x00\x00\x03\xae" + // 0x03B70301: 0x000003AE + "\x03\xb9\x03\x01\x00\x00\x03\xaf" + // 0x03B90301: 0x000003AF + "\x03\xcb\x03\x01\x00\x00\x03\xb0" + // 0x03CB0301: 0x000003B0 + "\x03\xb9\x03\b\x00\x00\x03\xca" + // 0x03B90308: 0x000003CA + "\x03\xc5\x03\b\x00\x00\x03\xcb" + // 0x03C50308: 0x000003CB + "\x03\xbf\x03\x01\x00\x00\x03\xcc" + // 0x03BF0301: 0x000003CC + "\x03\xc5\x03\x01\x00\x00\x03\xcd" + // 0x03C50301: 0x000003CD + "\x03\xc9\x03\x01\x00\x00\x03\xce" + // 0x03C90301: 0x000003CE + "\x03\xd2\x03\x01\x00\x00\x03\xd3" + // 0x03D20301: 0x000003D3 + "\x03\xd2\x03\b\x00\x00\x03\xd4" + // 0x03D20308: 0x000003D4 + "\x04\x15\x03\x00\x00\x00\x04\x00" + // 0x04150300: 0x00000400 + "\x04\x15\x03\b\x00\x00\x04\x01" + // 0x04150308: 0x00000401 + "\x04\x13\x03\x01\x00\x00\x04\x03" + // 0x04130301: 0x00000403 + "\x04\x06\x03\b\x00\x00\x04\a" + // 0x04060308: 0x00000407 + "\x04\x1a\x03\x01\x00\x00\x04\f" + // 0x041A0301: 0x0000040C + "\x04\x18\x03\x00\x00\x00\x04\r" + // 0x04180300: 0x0000040D + "\x04#\x03\x06\x00\x00\x04\x0e" + // 0x04230306: 0x0000040E + "\x04\x18\x03\x06\x00\x00\x04\x19" + // 0x04180306: 0x00000419 + "\x048\x03\x06\x00\x00\x049" + // 0x04380306: 0x00000439 + "\x045\x03\x00\x00\x00\x04P" + // 0x04350300: 0x00000450 + "\x045\x03\b\x00\x00\x04Q" + // 0x04350308: 0x00000451 + "\x043\x03\x01\x00\x00\x04S" + // 0x04330301: 0x00000453 + "\x04V\x03\b\x00\x00\x04W" + // 0x04560308: 0x00000457 + "\x04:\x03\x01\x00\x00\x04\\" + // 0x043A0301: 0x0000045C + "\x048\x03\x00\x00\x00\x04]" + // 0x04380300: 0x0000045D + "\x04C\x03\x06\x00\x00\x04^" + // 0x04430306: 0x0000045E + "\x04t\x03\x0f\x00\x00\x04v" + // 0x0474030F: 0x00000476 + "\x04u\x03\x0f\x00\x00\x04w" + // 0x0475030F: 0x00000477 + "\x04\x16\x03\x06\x00\x00\x04\xc1" + // 0x04160306: 0x000004C1 + "\x046\x03\x06\x00\x00\x04\xc2" + // 0x04360306: 0x000004C2 + "\x04\x10\x03\x06\x00\x00\x04\xd0" + // 0x04100306: 0x000004D0 + "\x040\x03\x06\x00\x00\x04\xd1" + // 0x04300306: 0x000004D1 + "\x04\x10\x03\b\x00\x00\x04\xd2" + // 0x04100308: 0x000004D2 + "\x040\x03\b\x00\x00\x04\xd3" + // 0x04300308: 0x000004D3 + "\x04\x15\x03\x06\x00\x00\x04\xd6" + // 0x04150306: 0x000004D6 + "\x045\x03\x06\x00\x00\x04\xd7" + // 0x04350306: 0x000004D7 + "\x04\xd8\x03\b\x00\x00\x04\xda" + // 0x04D80308: 0x000004DA + "\x04\xd9\x03\b\x00\x00\x04\xdb" + // 0x04D90308: 0x000004DB + "\x04\x16\x03\b\x00\x00\x04\xdc" + // 0x04160308: 0x000004DC + "\x046\x03\b\x00\x00\x04\xdd" + // 0x04360308: 0x000004DD + "\x04\x17\x03\b\x00\x00\x04\xde" + // 0x04170308: 0x000004DE + "\x047\x03\b\x00\x00\x04\xdf" + // 0x04370308: 0x000004DF + "\x04\x18\x03\x04\x00\x00\x04\xe2" + // 0x04180304: 0x000004E2 + "\x048\x03\x04\x00\x00\x04\xe3" + // 0x04380304: 0x000004E3 + "\x04\x18\x03\b\x00\x00\x04\xe4" + // 0x04180308: 0x000004E4 + "\x048\x03\b\x00\x00\x04\xe5" + // 0x04380308: 0x000004E5 + "\x04\x1e\x03\b\x00\x00\x04\xe6" + // 0x041E0308: 0x000004E6 + "\x04>\x03\b\x00\x00\x04\xe7" + // 0x043E0308: 0x000004E7 + "\x04\xe8\x03\b\x00\x00\x04\xea" + // 0x04E80308: 0x000004EA + "\x04\xe9\x03\b\x00\x00\x04\xeb" + // 0x04E90308: 0x000004EB + "\x04-\x03\b\x00\x00\x04\xec" + // 0x042D0308: 0x000004EC + "\x04M\x03\b\x00\x00\x04\xed" + // 0x044D0308: 0x000004ED + "\x04#\x03\x04\x00\x00\x04\xee" + // 0x04230304: 0x000004EE + "\x04C\x03\x04\x00\x00\x04\xef" + // 0x04430304: 0x000004EF + "\x04#\x03\b\x00\x00\x04\xf0" + // 0x04230308: 0x000004F0 + "\x04C\x03\b\x00\x00\x04\xf1" + // 0x04430308: 0x000004F1 + "\x04#\x03\v\x00\x00\x04\xf2" + // 0x0423030B: 0x000004F2 + "\x04C\x03\v\x00\x00\x04\xf3" + // 0x0443030B: 0x000004F3 + "\x04'\x03\b\x00\x00\x04\xf4" + // 0x04270308: 0x000004F4 + "\x04G\x03\b\x00\x00\x04\xf5" + // 0x04470308: 0x000004F5 + "\x04+\x03\b\x00\x00\x04\xf8" + // 0x042B0308: 0x000004F8 + "\x04K\x03\b\x00\x00\x04\xf9" + // 0x044B0308: 0x000004F9 + "\x06'\x06S\x00\x00\x06\"" + // 0x06270653: 0x00000622 + "\x06'\x06T\x00\x00\x06#" + // 0x06270654: 0x00000623 + "\x06H\x06T\x00\x00\x06$" + // 0x06480654: 0x00000624 + "\x06'\x06U\x00\x00\x06%" + // 0x06270655: 0x00000625 + "\x06J\x06T\x00\x00\x06&" + // 0x064A0654: 0x00000626 + "\x06\xd5\x06T\x00\x00\x06\xc0" + // 0x06D50654: 0x000006C0 + "\x06\xc1\x06T\x00\x00\x06\xc2" + // 0x06C10654: 0x000006C2 + "\x06\xd2\x06T\x00\x00\x06\xd3" + // 0x06D20654: 0x000006D3 + "\t(\t<\x00\x00\t)" + // 0x0928093C: 0x00000929 + "\t0\t<\x00\x00\t1" + // 0x0930093C: 0x00000931 + "\t3\t<\x00\x00\t4" + // 0x0933093C: 0x00000934 + "\t\xc7\t\xbe\x00\x00\t\xcb" + // 0x09C709BE: 0x000009CB + "\t\xc7\t\xd7\x00\x00\t\xcc" + // 0x09C709D7: 0x000009CC + "\vG\vV\x00\x00\vH" + // 0x0B470B56: 0x00000B48 + "\vG\v>\x00\x00\vK" + // 0x0B470B3E: 0x00000B4B + "\vG\vW\x00\x00\vL" + // 0x0B470B57: 0x00000B4C + "\v\x92\v\xd7\x00\x00\v\x94" + // 0x0B920BD7: 0x00000B94 + "\v\xc6\v\xbe\x00\x00\v\xca" + // 0x0BC60BBE: 0x00000BCA + "\v\xc7\v\xbe\x00\x00\v\xcb" + // 0x0BC70BBE: 0x00000BCB + "\v\xc6\v\xd7\x00\x00\v\xcc" + // 0x0BC60BD7: 0x00000BCC + "\fF\fV\x00\x00\fH" + // 0x0C460C56: 0x00000C48 + "\f\xbf\f\xd5\x00\x00\f\xc0" + // 0x0CBF0CD5: 0x00000CC0 + "\f\xc6\f\xd5\x00\x00\f\xc7" + // 0x0CC60CD5: 0x00000CC7 + "\f\xc6\f\xd6\x00\x00\f\xc8" + // 0x0CC60CD6: 0x00000CC8 + "\f\xc6\f\xc2\x00\x00\f\xca" + // 0x0CC60CC2: 0x00000CCA + "\f\xca\f\xd5\x00\x00\f\xcb" + // 0x0CCA0CD5: 0x00000CCB + "\rF\r>\x00\x00\rJ" + // 0x0D460D3E: 0x00000D4A + "\rG\r>\x00\x00\rK" + // 0x0D470D3E: 0x00000D4B + "\rF\rW\x00\x00\rL" + // 0x0D460D57: 0x00000D4C + "\r\xd9\r\xca\x00\x00\r\xda" + // 0x0DD90DCA: 0x00000DDA + "\r\xd9\r\xcf\x00\x00\r\xdc" + // 0x0DD90DCF: 0x00000DDC + "\r\xdc\r\xca\x00\x00\r\xdd" + // 0x0DDC0DCA: 0x00000DDD + "\r\xd9\r\xdf\x00\x00\r\xde" + // 0x0DD90DDF: 0x00000DDE + "\x10%\x10.\x00\x00\x10&" + // 0x1025102E: 0x00001026 + "\x1b\x05\x1b5\x00\x00\x1b\x06" + // 0x1B051B35: 0x00001B06 + "\x1b\a\x1b5\x00\x00\x1b\b" + // 0x1B071B35: 0x00001B08 + "\x1b\t\x1b5\x00\x00\x1b\n" + // 0x1B091B35: 0x00001B0A + "\x1b\v\x1b5\x00\x00\x1b\f" + // 0x1B0B1B35: 0x00001B0C + "\x1b\r\x1b5\x00\x00\x1b\x0e" + // 0x1B0D1B35: 0x00001B0E + "\x1b\x11\x1b5\x00\x00\x1b\x12" + // 0x1B111B35: 0x00001B12 + "\x1b:\x1b5\x00\x00\x1b;" + // 0x1B3A1B35: 0x00001B3B + "\x1b<\x1b5\x00\x00\x1b=" + // 0x1B3C1B35: 0x00001B3D + "\x1b>\x1b5\x00\x00\x1b@" + // 0x1B3E1B35: 0x00001B40 + "\x1b?\x1b5\x00\x00\x1bA" + // 0x1B3F1B35: 0x00001B41 + "\x1bB\x1b5\x00\x00\x1bC" + // 0x1B421B35: 0x00001B43 + "\x00A\x03%\x00\x00\x1e\x00" + // 0x00410325: 0x00001E00 + "\x00a\x03%\x00\x00\x1e\x01" + // 0x00610325: 0x00001E01 + "\x00B\x03\a\x00\x00\x1e\x02" + // 0x00420307: 0x00001E02 + "\x00b\x03\a\x00\x00\x1e\x03" + // 0x00620307: 0x00001E03 + "\x00B\x03#\x00\x00\x1e\x04" + // 0x00420323: 0x00001E04 + "\x00b\x03#\x00\x00\x1e\x05" + // 0x00620323: 0x00001E05 + "\x00B\x031\x00\x00\x1e\x06" + // 0x00420331: 0x00001E06 + "\x00b\x031\x00\x00\x1e\a" + // 0x00620331: 0x00001E07 + "\x00\xc7\x03\x01\x00\x00\x1e\b" + // 0x00C70301: 0x00001E08 + "\x00\xe7\x03\x01\x00\x00\x1e\t" + // 0x00E70301: 0x00001E09 + "\x00D\x03\a\x00\x00\x1e\n" + // 0x00440307: 0x00001E0A + "\x00d\x03\a\x00\x00\x1e\v" + // 0x00640307: 0x00001E0B + "\x00D\x03#\x00\x00\x1e\f" + // 0x00440323: 0x00001E0C + "\x00d\x03#\x00\x00\x1e\r" + // 0x00640323: 0x00001E0D + "\x00D\x031\x00\x00\x1e\x0e" + // 0x00440331: 0x00001E0E + "\x00d\x031\x00\x00\x1e\x0f" + // 0x00640331: 0x00001E0F + "\x00D\x03'\x00\x00\x1e\x10" + // 0x00440327: 0x00001E10 + "\x00d\x03'\x00\x00\x1e\x11" + // 0x00640327: 0x00001E11 + "\x00D\x03-\x00\x00\x1e\x12" + // 0x0044032D: 0x00001E12 + "\x00d\x03-\x00\x00\x1e\x13" + // 0x0064032D: 0x00001E13 + "\x01\x12\x03\x00\x00\x00\x1e\x14" + // 0x01120300: 0x00001E14 + "\x01\x13\x03\x00\x00\x00\x1e\x15" + // 0x01130300: 0x00001E15 + "\x01\x12\x03\x01\x00\x00\x1e\x16" + // 0x01120301: 0x00001E16 + "\x01\x13\x03\x01\x00\x00\x1e\x17" + // 0x01130301: 0x00001E17 + "\x00E\x03-\x00\x00\x1e\x18" + // 0x0045032D: 0x00001E18 + "\x00e\x03-\x00\x00\x1e\x19" + // 0x0065032D: 0x00001E19 + "\x00E\x030\x00\x00\x1e\x1a" + // 0x00450330: 0x00001E1A + "\x00e\x030\x00\x00\x1e\x1b" + // 0x00650330: 0x00001E1B + "\x02(\x03\x06\x00\x00\x1e\x1c" + // 0x02280306: 0x00001E1C + "\x02)\x03\x06\x00\x00\x1e\x1d" + // 0x02290306: 0x00001E1D + "\x00F\x03\a\x00\x00\x1e\x1e" + // 0x00460307: 0x00001E1E + "\x00f\x03\a\x00\x00\x1e\x1f" + // 0x00660307: 0x00001E1F + "\x00G\x03\x04\x00\x00\x1e " + // 0x00470304: 0x00001E20 + "\x00g\x03\x04\x00\x00\x1e!" + // 0x00670304: 0x00001E21 + "\x00H\x03\a\x00\x00\x1e\"" + // 0x00480307: 0x00001E22 + "\x00h\x03\a\x00\x00\x1e#" + // 0x00680307: 0x00001E23 + "\x00H\x03#\x00\x00\x1e$" + // 0x00480323: 0x00001E24 + "\x00h\x03#\x00\x00\x1e%" + // 0x00680323: 0x00001E25 + "\x00H\x03\b\x00\x00\x1e&" + // 0x00480308: 0x00001E26 + "\x00h\x03\b\x00\x00\x1e'" + // 0x00680308: 0x00001E27 + "\x00H\x03'\x00\x00\x1e(" + // 0x00480327: 0x00001E28 + "\x00h\x03'\x00\x00\x1e)" + // 0x00680327: 0x00001E29 + "\x00H\x03.\x00\x00\x1e*" + // 0x0048032E: 0x00001E2A + "\x00h\x03.\x00\x00\x1e+" + // 0x0068032E: 0x00001E2B + "\x00I\x030\x00\x00\x1e," + // 0x00490330: 0x00001E2C + "\x00i\x030\x00\x00\x1e-" + // 0x00690330: 0x00001E2D + "\x00\xcf\x03\x01\x00\x00\x1e." + // 0x00CF0301: 0x00001E2E + "\x00\xef\x03\x01\x00\x00\x1e/" + // 0x00EF0301: 0x00001E2F + "\x00K\x03\x01\x00\x00\x1e0" + // 0x004B0301: 0x00001E30 + "\x00k\x03\x01\x00\x00\x1e1" + // 0x006B0301: 0x00001E31 + "\x00K\x03#\x00\x00\x1e2" + // 0x004B0323: 0x00001E32 + "\x00k\x03#\x00\x00\x1e3" + // 0x006B0323: 0x00001E33 + "\x00K\x031\x00\x00\x1e4" + // 0x004B0331: 0x00001E34 + "\x00k\x031\x00\x00\x1e5" + // 0x006B0331: 0x00001E35 + "\x00L\x03#\x00\x00\x1e6" + // 0x004C0323: 0x00001E36 + "\x00l\x03#\x00\x00\x1e7" + // 0x006C0323: 0x00001E37 + "\x1e6\x03\x04\x00\x00\x1e8" + // 0x1E360304: 0x00001E38 + "\x1e7\x03\x04\x00\x00\x1e9" + // 0x1E370304: 0x00001E39 + "\x00L\x031\x00\x00\x1e:" + // 0x004C0331: 0x00001E3A + "\x00l\x031\x00\x00\x1e;" + // 0x006C0331: 0x00001E3B + "\x00L\x03-\x00\x00\x1e<" + // 0x004C032D: 0x00001E3C + "\x00l\x03-\x00\x00\x1e=" + // 0x006C032D: 0x00001E3D + "\x00M\x03\x01\x00\x00\x1e>" + // 0x004D0301: 0x00001E3E + "\x00m\x03\x01\x00\x00\x1e?" + // 0x006D0301: 0x00001E3F + "\x00M\x03\a\x00\x00\x1e@" + // 0x004D0307: 0x00001E40 + "\x00m\x03\a\x00\x00\x1eA" + // 0x006D0307: 0x00001E41 + "\x00M\x03#\x00\x00\x1eB" + // 0x004D0323: 0x00001E42 + "\x00m\x03#\x00\x00\x1eC" + // 0x006D0323: 0x00001E43 + "\x00N\x03\a\x00\x00\x1eD" + // 0x004E0307: 0x00001E44 + "\x00n\x03\a\x00\x00\x1eE" + // 0x006E0307: 0x00001E45 + "\x00N\x03#\x00\x00\x1eF" + // 0x004E0323: 0x00001E46 + "\x00n\x03#\x00\x00\x1eG" + // 0x006E0323: 0x00001E47 + "\x00N\x031\x00\x00\x1eH" + // 0x004E0331: 0x00001E48 + "\x00n\x031\x00\x00\x1eI" + // 0x006E0331: 0x00001E49 + "\x00N\x03-\x00\x00\x1eJ" + // 0x004E032D: 0x00001E4A + "\x00n\x03-\x00\x00\x1eK" + // 0x006E032D: 0x00001E4B + "\x00\xd5\x03\x01\x00\x00\x1eL" + // 0x00D50301: 0x00001E4C + "\x00\xf5\x03\x01\x00\x00\x1eM" + // 0x00F50301: 0x00001E4D + "\x00\xd5\x03\b\x00\x00\x1eN" + // 0x00D50308: 0x00001E4E + "\x00\xf5\x03\b\x00\x00\x1eO" + // 0x00F50308: 0x00001E4F + "\x01L\x03\x00\x00\x00\x1eP" + // 0x014C0300: 0x00001E50 + "\x01M\x03\x00\x00\x00\x1eQ" + // 0x014D0300: 0x00001E51 + "\x01L\x03\x01\x00\x00\x1eR" + // 0x014C0301: 0x00001E52 + "\x01M\x03\x01\x00\x00\x1eS" + // 0x014D0301: 0x00001E53 + "\x00P\x03\x01\x00\x00\x1eT" + // 0x00500301: 0x00001E54 + "\x00p\x03\x01\x00\x00\x1eU" + // 0x00700301: 0x00001E55 + "\x00P\x03\a\x00\x00\x1eV" + // 0x00500307: 0x00001E56 + "\x00p\x03\a\x00\x00\x1eW" + // 0x00700307: 0x00001E57 + "\x00R\x03\a\x00\x00\x1eX" + // 0x00520307: 0x00001E58 + "\x00r\x03\a\x00\x00\x1eY" + // 0x00720307: 0x00001E59 + "\x00R\x03#\x00\x00\x1eZ" + // 0x00520323: 0x00001E5A + "\x00r\x03#\x00\x00\x1e[" + // 0x00720323: 0x00001E5B + "\x1eZ\x03\x04\x00\x00\x1e\\" + // 0x1E5A0304: 0x00001E5C + "\x1e[\x03\x04\x00\x00\x1e]" + // 0x1E5B0304: 0x00001E5D + "\x00R\x031\x00\x00\x1e^" + // 0x00520331: 0x00001E5E + "\x00r\x031\x00\x00\x1e_" + // 0x00720331: 0x00001E5F + "\x00S\x03\a\x00\x00\x1e`" + // 0x00530307: 0x00001E60 + "\x00s\x03\a\x00\x00\x1ea" + // 0x00730307: 0x00001E61 + "\x00S\x03#\x00\x00\x1eb" + // 0x00530323: 0x00001E62 + "\x00s\x03#\x00\x00\x1ec" + // 0x00730323: 0x00001E63 + "\x01Z\x03\a\x00\x00\x1ed" + // 0x015A0307: 0x00001E64 + "\x01[\x03\a\x00\x00\x1ee" + // 0x015B0307: 0x00001E65 + "\x01`\x03\a\x00\x00\x1ef" + // 0x01600307: 0x00001E66 + "\x01a\x03\a\x00\x00\x1eg" + // 0x01610307: 0x00001E67 + "\x1eb\x03\a\x00\x00\x1eh" + // 0x1E620307: 0x00001E68 + "\x1ec\x03\a\x00\x00\x1ei" + // 0x1E630307: 0x00001E69 + "\x00T\x03\a\x00\x00\x1ej" + // 0x00540307: 0x00001E6A + "\x00t\x03\a\x00\x00\x1ek" + // 0x00740307: 0x00001E6B + "\x00T\x03#\x00\x00\x1el" + // 0x00540323: 0x00001E6C + "\x00t\x03#\x00\x00\x1em" + // 0x00740323: 0x00001E6D + "\x00T\x031\x00\x00\x1en" + // 0x00540331: 0x00001E6E + "\x00t\x031\x00\x00\x1eo" + // 0x00740331: 0x00001E6F + "\x00T\x03-\x00\x00\x1ep" + // 0x0054032D: 0x00001E70 + "\x00t\x03-\x00\x00\x1eq" + // 0x0074032D: 0x00001E71 + "\x00U\x03$\x00\x00\x1er" + // 0x00550324: 0x00001E72 + "\x00u\x03$\x00\x00\x1es" + // 0x00750324: 0x00001E73 + "\x00U\x030\x00\x00\x1et" + // 0x00550330: 0x00001E74 + "\x00u\x030\x00\x00\x1eu" + // 0x00750330: 0x00001E75 + "\x00U\x03-\x00\x00\x1ev" + // 0x0055032D: 0x00001E76 + "\x00u\x03-\x00\x00\x1ew" + // 0x0075032D: 0x00001E77 + "\x01h\x03\x01\x00\x00\x1ex" + // 0x01680301: 0x00001E78 + "\x01i\x03\x01\x00\x00\x1ey" + // 0x01690301: 0x00001E79 + "\x01j\x03\b\x00\x00\x1ez" + // 0x016A0308: 0x00001E7A + "\x01k\x03\b\x00\x00\x1e{" + // 0x016B0308: 0x00001E7B + "\x00V\x03\x03\x00\x00\x1e|" + // 0x00560303: 0x00001E7C + "\x00v\x03\x03\x00\x00\x1e}" + // 0x00760303: 0x00001E7D + "\x00V\x03#\x00\x00\x1e~" + // 0x00560323: 0x00001E7E + "\x00v\x03#\x00\x00\x1e\u007f" + // 0x00760323: 0x00001E7F + "\x00W\x03\x00\x00\x00\x1e\x80" + // 0x00570300: 0x00001E80 + "\x00w\x03\x00\x00\x00\x1e\x81" + // 0x00770300: 0x00001E81 + "\x00W\x03\x01\x00\x00\x1e\x82" + // 0x00570301: 0x00001E82 + "\x00w\x03\x01\x00\x00\x1e\x83" + // 0x00770301: 0x00001E83 + "\x00W\x03\b\x00\x00\x1e\x84" + // 0x00570308: 0x00001E84 + "\x00w\x03\b\x00\x00\x1e\x85" + // 0x00770308: 0x00001E85 + "\x00W\x03\a\x00\x00\x1e\x86" + // 0x00570307: 0x00001E86 + "\x00w\x03\a\x00\x00\x1e\x87" + // 0x00770307: 0x00001E87 + "\x00W\x03#\x00\x00\x1e\x88" + // 0x00570323: 0x00001E88 + "\x00w\x03#\x00\x00\x1e\x89" + // 0x00770323: 0x00001E89 + "\x00X\x03\a\x00\x00\x1e\x8a" + // 0x00580307: 0x00001E8A + "\x00x\x03\a\x00\x00\x1e\x8b" + // 0x00780307: 0x00001E8B + "\x00X\x03\b\x00\x00\x1e\x8c" + // 0x00580308: 0x00001E8C + "\x00x\x03\b\x00\x00\x1e\x8d" + // 0x00780308: 0x00001E8D + "\x00Y\x03\a\x00\x00\x1e\x8e" + // 0x00590307: 0x00001E8E + "\x00y\x03\a\x00\x00\x1e\x8f" + // 0x00790307: 0x00001E8F + "\x00Z\x03\x02\x00\x00\x1e\x90" + // 0x005A0302: 0x00001E90 + "\x00z\x03\x02\x00\x00\x1e\x91" + // 0x007A0302: 0x00001E91 + "\x00Z\x03#\x00\x00\x1e\x92" + // 0x005A0323: 0x00001E92 + "\x00z\x03#\x00\x00\x1e\x93" + // 0x007A0323: 0x00001E93 + "\x00Z\x031\x00\x00\x1e\x94" + // 0x005A0331: 0x00001E94 + "\x00z\x031\x00\x00\x1e\x95" + // 0x007A0331: 0x00001E95 + "\x00h\x031\x00\x00\x1e\x96" + // 0x00680331: 0x00001E96 + "\x00t\x03\b\x00\x00\x1e\x97" + // 0x00740308: 0x00001E97 + "\x00w\x03\n\x00\x00\x1e\x98" + // 0x0077030A: 0x00001E98 + "\x00y\x03\n\x00\x00\x1e\x99" + // 0x0079030A: 0x00001E99 + "\x01\u007f\x03\a\x00\x00\x1e\x9b" + // 0x017F0307: 0x00001E9B + "\x00A\x03#\x00\x00\x1e\xa0" + // 0x00410323: 0x00001EA0 + "\x00a\x03#\x00\x00\x1e\xa1" + // 0x00610323: 0x00001EA1 + "\x00A\x03\t\x00\x00\x1e\xa2" + // 0x00410309: 0x00001EA2 + "\x00a\x03\t\x00\x00\x1e\xa3" + // 0x00610309: 0x00001EA3 + "\x00\xc2\x03\x01\x00\x00\x1e\xa4" + // 0x00C20301: 0x00001EA4 + "\x00\xe2\x03\x01\x00\x00\x1e\xa5" + // 0x00E20301: 0x00001EA5 + "\x00\xc2\x03\x00\x00\x00\x1e\xa6" + // 0x00C20300: 0x00001EA6 + "\x00\xe2\x03\x00\x00\x00\x1e\xa7" + // 0x00E20300: 0x00001EA7 + "\x00\xc2\x03\t\x00\x00\x1e\xa8" + // 0x00C20309: 0x00001EA8 + "\x00\xe2\x03\t\x00\x00\x1e\xa9" + // 0x00E20309: 0x00001EA9 + "\x00\xc2\x03\x03\x00\x00\x1e\xaa" + // 0x00C20303: 0x00001EAA + "\x00\xe2\x03\x03\x00\x00\x1e\xab" + // 0x00E20303: 0x00001EAB + "\x1e\xa0\x03\x02\x00\x00\x1e\xac" + // 0x1EA00302: 0x00001EAC + "\x1e\xa1\x03\x02\x00\x00\x1e\xad" + // 0x1EA10302: 0x00001EAD + "\x01\x02\x03\x01\x00\x00\x1e\xae" + // 0x01020301: 0x00001EAE + "\x01\x03\x03\x01\x00\x00\x1e\xaf" + // 0x01030301: 0x00001EAF + "\x01\x02\x03\x00\x00\x00\x1e\xb0" + // 0x01020300: 0x00001EB0 + "\x01\x03\x03\x00\x00\x00\x1e\xb1" + // 0x01030300: 0x00001EB1 + "\x01\x02\x03\t\x00\x00\x1e\xb2" + // 0x01020309: 0x00001EB2 + "\x01\x03\x03\t\x00\x00\x1e\xb3" + // 0x01030309: 0x00001EB3 + "\x01\x02\x03\x03\x00\x00\x1e\xb4" + // 0x01020303: 0x00001EB4 + "\x01\x03\x03\x03\x00\x00\x1e\xb5" + // 0x01030303: 0x00001EB5 + "\x1e\xa0\x03\x06\x00\x00\x1e\xb6" + // 0x1EA00306: 0x00001EB6 + "\x1e\xa1\x03\x06\x00\x00\x1e\xb7" + // 0x1EA10306: 0x00001EB7 + "\x00E\x03#\x00\x00\x1e\xb8" + // 0x00450323: 0x00001EB8 + "\x00e\x03#\x00\x00\x1e\xb9" + // 0x00650323: 0x00001EB9 + "\x00E\x03\t\x00\x00\x1e\xba" + // 0x00450309: 0x00001EBA + "\x00e\x03\t\x00\x00\x1e\xbb" + // 0x00650309: 0x00001EBB + "\x00E\x03\x03\x00\x00\x1e\xbc" + // 0x00450303: 0x00001EBC + "\x00e\x03\x03\x00\x00\x1e\xbd" + // 0x00650303: 0x00001EBD + "\x00\xca\x03\x01\x00\x00\x1e\xbe" + // 0x00CA0301: 0x00001EBE + "\x00\xea\x03\x01\x00\x00\x1e\xbf" + // 0x00EA0301: 0x00001EBF + "\x00\xca\x03\x00\x00\x00\x1e\xc0" + // 0x00CA0300: 0x00001EC0 + "\x00\xea\x03\x00\x00\x00\x1e\xc1" + // 0x00EA0300: 0x00001EC1 + "\x00\xca\x03\t\x00\x00\x1e\xc2" + // 0x00CA0309: 0x00001EC2 + "\x00\xea\x03\t\x00\x00\x1e\xc3" + // 0x00EA0309: 0x00001EC3 + "\x00\xca\x03\x03\x00\x00\x1e\xc4" + // 0x00CA0303: 0x00001EC4 + "\x00\xea\x03\x03\x00\x00\x1e\xc5" + // 0x00EA0303: 0x00001EC5 + "\x1e\xb8\x03\x02\x00\x00\x1e\xc6" + // 0x1EB80302: 0x00001EC6 + "\x1e\xb9\x03\x02\x00\x00\x1e\xc7" + // 0x1EB90302: 0x00001EC7 + "\x00I\x03\t\x00\x00\x1e\xc8" + // 0x00490309: 0x00001EC8 + "\x00i\x03\t\x00\x00\x1e\xc9" + // 0x00690309: 0x00001EC9 + "\x00I\x03#\x00\x00\x1e\xca" + // 0x00490323: 0x00001ECA + "\x00i\x03#\x00\x00\x1e\xcb" + // 0x00690323: 0x00001ECB + "\x00O\x03#\x00\x00\x1e\xcc" + // 0x004F0323: 0x00001ECC + "\x00o\x03#\x00\x00\x1e\xcd" + // 0x006F0323: 0x00001ECD + "\x00O\x03\t\x00\x00\x1e\xce" + // 0x004F0309: 0x00001ECE + "\x00o\x03\t\x00\x00\x1e\xcf" + // 0x006F0309: 0x00001ECF + "\x00\xd4\x03\x01\x00\x00\x1e\xd0" + // 0x00D40301: 0x00001ED0 + "\x00\xf4\x03\x01\x00\x00\x1e\xd1" + // 0x00F40301: 0x00001ED1 + "\x00\xd4\x03\x00\x00\x00\x1e\xd2" + // 0x00D40300: 0x00001ED2 + "\x00\xf4\x03\x00\x00\x00\x1e\xd3" + // 0x00F40300: 0x00001ED3 + "\x00\xd4\x03\t\x00\x00\x1e\xd4" + // 0x00D40309: 0x00001ED4 + "\x00\xf4\x03\t\x00\x00\x1e\xd5" + // 0x00F40309: 0x00001ED5 + "\x00\xd4\x03\x03\x00\x00\x1e\xd6" + // 0x00D40303: 0x00001ED6 + "\x00\xf4\x03\x03\x00\x00\x1e\xd7" + // 0x00F40303: 0x00001ED7 + "\x1e\xcc\x03\x02\x00\x00\x1e\xd8" + // 0x1ECC0302: 0x00001ED8 + "\x1e\xcd\x03\x02\x00\x00\x1e\xd9" + // 0x1ECD0302: 0x00001ED9 + "\x01\xa0\x03\x01\x00\x00\x1e\xda" + // 0x01A00301: 0x00001EDA + "\x01\xa1\x03\x01\x00\x00\x1e\xdb" + // 0x01A10301: 0x00001EDB + "\x01\xa0\x03\x00\x00\x00\x1e\xdc" + // 0x01A00300: 0x00001EDC + "\x01\xa1\x03\x00\x00\x00\x1e\xdd" + // 0x01A10300: 0x00001EDD + "\x01\xa0\x03\t\x00\x00\x1e\xde" + // 0x01A00309: 0x00001EDE + "\x01\xa1\x03\t\x00\x00\x1e\xdf" + // 0x01A10309: 0x00001EDF + "\x01\xa0\x03\x03\x00\x00\x1e\xe0" + // 0x01A00303: 0x00001EE0 + "\x01\xa1\x03\x03\x00\x00\x1e\xe1" + // 0x01A10303: 0x00001EE1 + "\x01\xa0\x03#\x00\x00\x1e\xe2" + // 0x01A00323: 0x00001EE2 + "\x01\xa1\x03#\x00\x00\x1e\xe3" + // 0x01A10323: 0x00001EE3 + "\x00U\x03#\x00\x00\x1e\xe4" + // 0x00550323: 0x00001EE4 + "\x00u\x03#\x00\x00\x1e\xe5" + // 0x00750323: 0x00001EE5 + "\x00U\x03\t\x00\x00\x1e\xe6" + // 0x00550309: 0x00001EE6 + "\x00u\x03\t\x00\x00\x1e\xe7" + // 0x00750309: 0x00001EE7 + "\x01\xaf\x03\x01\x00\x00\x1e\xe8" + // 0x01AF0301: 0x00001EE8 + "\x01\xb0\x03\x01\x00\x00\x1e\xe9" + // 0x01B00301: 0x00001EE9 + "\x01\xaf\x03\x00\x00\x00\x1e\xea" + // 0x01AF0300: 0x00001EEA + "\x01\xb0\x03\x00\x00\x00\x1e\xeb" + // 0x01B00300: 0x00001EEB + "\x01\xaf\x03\t\x00\x00\x1e\xec" + // 0x01AF0309: 0x00001EEC + "\x01\xb0\x03\t\x00\x00\x1e\xed" + // 0x01B00309: 0x00001EED + "\x01\xaf\x03\x03\x00\x00\x1e\xee" + // 0x01AF0303: 0x00001EEE + "\x01\xb0\x03\x03\x00\x00\x1e\xef" + // 0x01B00303: 0x00001EEF + "\x01\xaf\x03#\x00\x00\x1e\xf0" + // 0x01AF0323: 0x00001EF0 + "\x01\xb0\x03#\x00\x00\x1e\xf1" + // 0x01B00323: 0x00001EF1 + "\x00Y\x03\x00\x00\x00\x1e\xf2" + // 0x00590300: 0x00001EF2 + "\x00y\x03\x00\x00\x00\x1e\xf3" + // 0x00790300: 0x00001EF3 + "\x00Y\x03#\x00\x00\x1e\xf4" + // 0x00590323: 0x00001EF4 + "\x00y\x03#\x00\x00\x1e\xf5" + // 0x00790323: 0x00001EF5 + "\x00Y\x03\t\x00\x00\x1e\xf6" + // 0x00590309: 0x00001EF6 + "\x00y\x03\t\x00\x00\x1e\xf7" + // 0x00790309: 0x00001EF7 + "\x00Y\x03\x03\x00\x00\x1e\xf8" + // 0x00590303: 0x00001EF8 + "\x00y\x03\x03\x00\x00\x1e\xf9" + // 0x00790303: 0x00001EF9 + "\x03\xb1\x03\x13\x00\x00\x1f\x00" + // 0x03B10313: 0x00001F00 + "\x03\xb1\x03\x14\x00\x00\x1f\x01" + // 0x03B10314: 0x00001F01 + "\x1f\x00\x03\x00\x00\x00\x1f\x02" + // 0x1F000300: 0x00001F02 + "\x1f\x01\x03\x00\x00\x00\x1f\x03" + // 0x1F010300: 0x00001F03 + "\x1f\x00\x03\x01\x00\x00\x1f\x04" + // 0x1F000301: 0x00001F04 + "\x1f\x01\x03\x01\x00\x00\x1f\x05" + // 0x1F010301: 0x00001F05 + "\x1f\x00\x03B\x00\x00\x1f\x06" + // 0x1F000342: 0x00001F06 + "\x1f\x01\x03B\x00\x00\x1f\a" + // 0x1F010342: 0x00001F07 + "\x03\x91\x03\x13\x00\x00\x1f\b" + // 0x03910313: 0x00001F08 + "\x03\x91\x03\x14\x00\x00\x1f\t" + // 0x03910314: 0x00001F09 + "\x1f\b\x03\x00\x00\x00\x1f\n" + // 0x1F080300: 0x00001F0A + "\x1f\t\x03\x00\x00\x00\x1f\v" + // 0x1F090300: 0x00001F0B + "\x1f\b\x03\x01\x00\x00\x1f\f" + // 0x1F080301: 0x00001F0C + "\x1f\t\x03\x01\x00\x00\x1f\r" + // 0x1F090301: 0x00001F0D + "\x1f\b\x03B\x00\x00\x1f\x0e" + // 0x1F080342: 0x00001F0E + "\x1f\t\x03B\x00\x00\x1f\x0f" + // 0x1F090342: 0x00001F0F + "\x03\xb5\x03\x13\x00\x00\x1f\x10" + // 0x03B50313: 0x00001F10 + "\x03\xb5\x03\x14\x00\x00\x1f\x11" + // 0x03B50314: 0x00001F11 + "\x1f\x10\x03\x00\x00\x00\x1f\x12" + // 0x1F100300: 0x00001F12 + "\x1f\x11\x03\x00\x00\x00\x1f\x13" + // 0x1F110300: 0x00001F13 + "\x1f\x10\x03\x01\x00\x00\x1f\x14" + // 0x1F100301: 0x00001F14 + "\x1f\x11\x03\x01\x00\x00\x1f\x15" + // 0x1F110301: 0x00001F15 + "\x03\x95\x03\x13\x00\x00\x1f\x18" + // 0x03950313: 0x00001F18 + "\x03\x95\x03\x14\x00\x00\x1f\x19" + // 0x03950314: 0x00001F19 + "\x1f\x18\x03\x00\x00\x00\x1f\x1a" + // 0x1F180300: 0x00001F1A + "\x1f\x19\x03\x00\x00\x00\x1f\x1b" + // 0x1F190300: 0x00001F1B + "\x1f\x18\x03\x01\x00\x00\x1f\x1c" + // 0x1F180301: 0x00001F1C + "\x1f\x19\x03\x01\x00\x00\x1f\x1d" + // 0x1F190301: 0x00001F1D + "\x03\xb7\x03\x13\x00\x00\x1f " + // 0x03B70313: 0x00001F20 + "\x03\xb7\x03\x14\x00\x00\x1f!" + // 0x03B70314: 0x00001F21 + "\x1f \x03\x00\x00\x00\x1f\"" + // 0x1F200300: 0x00001F22 + "\x1f!\x03\x00\x00\x00\x1f#" + // 0x1F210300: 0x00001F23 + "\x1f \x03\x01\x00\x00\x1f$" + // 0x1F200301: 0x00001F24 + "\x1f!\x03\x01\x00\x00\x1f%" + // 0x1F210301: 0x00001F25 + "\x1f \x03B\x00\x00\x1f&" + // 0x1F200342: 0x00001F26 + "\x1f!\x03B\x00\x00\x1f'" + // 0x1F210342: 0x00001F27 + "\x03\x97\x03\x13\x00\x00\x1f(" + // 0x03970313: 0x00001F28 + "\x03\x97\x03\x14\x00\x00\x1f)" + // 0x03970314: 0x00001F29 + "\x1f(\x03\x00\x00\x00\x1f*" + // 0x1F280300: 0x00001F2A + "\x1f)\x03\x00\x00\x00\x1f+" + // 0x1F290300: 0x00001F2B + "\x1f(\x03\x01\x00\x00\x1f," + // 0x1F280301: 0x00001F2C + "\x1f)\x03\x01\x00\x00\x1f-" + // 0x1F290301: 0x00001F2D + "\x1f(\x03B\x00\x00\x1f." + // 0x1F280342: 0x00001F2E + "\x1f)\x03B\x00\x00\x1f/" + // 0x1F290342: 0x00001F2F + "\x03\xb9\x03\x13\x00\x00\x1f0" + // 0x03B90313: 0x00001F30 + "\x03\xb9\x03\x14\x00\x00\x1f1" + // 0x03B90314: 0x00001F31 + "\x1f0\x03\x00\x00\x00\x1f2" + // 0x1F300300: 0x00001F32 + "\x1f1\x03\x00\x00\x00\x1f3" + // 0x1F310300: 0x00001F33 + "\x1f0\x03\x01\x00\x00\x1f4" + // 0x1F300301: 0x00001F34 + "\x1f1\x03\x01\x00\x00\x1f5" + // 0x1F310301: 0x00001F35 + "\x1f0\x03B\x00\x00\x1f6" + // 0x1F300342: 0x00001F36 + "\x1f1\x03B\x00\x00\x1f7" + // 0x1F310342: 0x00001F37 + "\x03\x99\x03\x13\x00\x00\x1f8" + // 0x03990313: 0x00001F38 + "\x03\x99\x03\x14\x00\x00\x1f9" + // 0x03990314: 0x00001F39 + "\x1f8\x03\x00\x00\x00\x1f:" + // 0x1F380300: 0x00001F3A + "\x1f9\x03\x00\x00\x00\x1f;" + // 0x1F390300: 0x00001F3B + "\x1f8\x03\x01\x00\x00\x1f<" + // 0x1F380301: 0x00001F3C + "\x1f9\x03\x01\x00\x00\x1f=" + // 0x1F390301: 0x00001F3D + "\x1f8\x03B\x00\x00\x1f>" + // 0x1F380342: 0x00001F3E + "\x1f9\x03B\x00\x00\x1f?" + // 0x1F390342: 0x00001F3F + "\x03\xbf\x03\x13\x00\x00\x1f@" + // 0x03BF0313: 0x00001F40 + "\x03\xbf\x03\x14\x00\x00\x1fA" + // 0x03BF0314: 0x00001F41 + "\x1f@\x03\x00\x00\x00\x1fB" + // 0x1F400300: 0x00001F42 + "\x1fA\x03\x00\x00\x00\x1fC" + // 0x1F410300: 0x00001F43 + "\x1f@\x03\x01\x00\x00\x1fD" + // 0x1F400301: 0x00001F44 + "\x1fA\x03\x01\x00\x00\x1fE" + // 0x1F410301: 0x00001F45 + "\x03\x9f\x03\x13\x00\x00\x1fH" + // 0x039F0313: 0x00001F48 + "\x03\x9f\x03\x14\x00\x00\x1fI" + // 0x039F0314: 0x00001F49 + "\x1fH\x03\x00\x00\x00\x1fJ" + // 0x1F480300: 0x00001F4A + "\x1fI\x03\x00\x00\x00\x1fK" + // 0x1F490300: 0x00001F4B + "\x1fH\x03\x01\x00\x00\x1fL" + // 0x1F480301: 0x00001F4C + "\x1fI\x03\x01\x00\x00\x1fM" + // 0x1F490301: 0x00001F4D + "\x03\xc5\x03\x13\x00\x00\x1fP" + // 0x03C50313: 0x00001F50 + "\x03\xc5\x03\x14\x00\x00\x1fQ" + // 0x03C50314: 0x00001F51 + "\x1fP\x03\x00\x00\x00\x1fR" + // 0x1F500300: 0x00001F52 + "\x1fQ\x03\x00\x00\x00\x1fS" + // 0x1F510300: 0x00001F53 + "\x1fP\x03\x01\x00\x00\x1fT" + // 0x1F500301: 0x00001F54 + "\x1fQ\x03\x01\x00\x00\x1fU" + // 0x1F510301: 0x00001F55 + "\x1fP\x03B\x00\x00\x1fV" + // 0x1F500342: 0x00001F56 + "\x1fQ\x03B\x00\x00\x1fW" + // 0x1F510342: 0x00001F57 + "\x03\xa5\x03\x14\x00\x00\x1fY" + // 0x03A50314: 0x00001F59 + "\x1fY\x03\x00\x00\x00\x1f[" + // 0x1F590300: 0x00001F5B + "\x1fY\x03\x01\x00\x00\x1f]" + // 0x1F590301: 0x00001F5D + "\x1fY\x03B\x00\x00\x1f_" + // 0x1F590342: 0x00001F5F + "\x03\xc9\x03\x13\x00\x00\x1f`" + // 0x03C90313: 0x00001F60 + "\x03\xc9\x03\x14\x00\x00\x1fa" + // 0x03C90314: 0x00001F61 + "\x1f`\x03\x00\x00\x00\x1fb" + // 0x1F600300: 0x00001F62 + "\x1fa\x03\x00\x00\x00\x1fc" + // 0x1F610300: 0x00001F63 + "\x1f`\x03\x01\x00\x00\x1fd" + // 0x1F600301: 0x00001F64 + "\x1fa\x03\x01\x00\x00\x1fe" + // 0x1F610301: 0x00001F65 + "\x1f`\x03B\x00\x00\x1ff" + // 0x1F600342: 0x00001F66 + "\x1fa\x03B\x00\x00\x1fg" + // 0x1F610342: 0x00001F67 + "\x03\xa9\x03\x13\x00\x00\x1fh" + // 0x03A90313: 0x00001F68 + "\x03\xa9\x03\x14\x00\x00\x1fi" + // 0x03A90314: 0x00001F69 + "\x1fh\x03\x00\x00\x00\x1fj" + // 0x1F680300: 0x00001F6A + "\x1fi\x03\x00\x00\x00\x1fk" + // 0x1F690300: 0x00001F6B + "\x1fh\x03\x01\x00\x00\x1fl" + // 0x1F680301: 0x00001F6C + "\x1fi\x03\x01\x00\x00\x1fm" + // 0x1F690301: 0x00001F6D + "\x1fh\x03B\x00\x00\x1fn" + // 0x1F680342: 0x00001F6E + "\x1fi\x03B\x00\x00\x1fo" + // 0x1F690342: 0x00001F6F + "\x03\xb1\x03\x00\x00\x00\x1fp" + // 0x03B10300: 0x00001F70 + "\x03\xb5\x03\x00\x00\x00\x1fr" + // 0x03B50300: 0x00001F72 + "\x03\xb7\x03\x00\x00\x00\x1ft" + // 0x03B70300: 0x00001F74 + "\x03\xb9\x03\x00\x00\x00\x1fv" + // 0x03B90300: 0x00001F76 + "\x03\xbf\x03\x00\x00\x00\x1fx" + // 0x03BF0300: 0x00001F78 + "\x03\xc5\x03\x00\x00\x00\x1fz" + // 0x03C50300: 0x00001F7A + "\x03\xc9\x03\x00\x00\x00\x1f|" + // 0x03C90300: 0x00001F7C + "\x1f\x00\x03E\x00\x00\x1f\x80" + // 0x1F000345: 0x00001F80 + "\x1f\x01\x03E\x00\x00\x1f\x81" + // 0x1F010345: 0x00001F81 + "\x1f\x02\x03E\x00\x00\x1f\x82" + // 0x1F020345: 0x00001F82 + "\x1f\x03\x03E\x00\x00\x1f\x83" + // 0x1F030345: 0x00001F83 + "\x1f\x04\x03E\x00\x00\x1f\x84" + // 0x1F040345: 0x00001F84 + "\x1f\x05\x03E\x00\x00\x1f\x85" + // 0x1F050345: 0x00001F85 + "\x1f\x06\x03E\x00\x00\x1f\x86" + // 0x1F060345: 0x00001F86 + "\x1f\a\x03E\x00\x00\x1f\x87" + // 0x1F070345: 0x00001F87 + "\x1f\b\x03E\x00\x00\x1f\x88" + // 0x1F080345: 0x00001F88 + "\x1f\t\x03E\x00\x00\x1f\x89" + // 0x1F090345: 0x00001F89 + "\x1f\n\x03E\x00\x00\x1f\x8a" + // 0x1F0A0345: 0x00001F8A + "\x1f\v\x03E\x00\x00\x1f\x8b" + // 0x1F0B0345: 0x00001F8B + "\x1f\f\x03E\x00\x00\x1f\x8c" + // 0x1F0C0345: 0x00001F8C + "\x1f\r\x03E\x00\x00\x1f\x8d" + // 0x1F0D0345: 0x00001F8D + "\x1f\x0e\x03E\x00\x00\x1f\x8e" + // 0x1F0E0345: 0x00001F8E + "\x1f\x0f\x03E\x00\x00\x1f\x8f" + // 0x1F0F0345: 0x00001F8F + "\x1f \x03E\x00\x00\x1f\x90" + // 0x1F200345: 0x00001F90 + "\x1f!\x03E\x00\x00\x1f\x91" + // 0x1F210345: 0x00001F91 + "\x1f\"\x03E\x00\x00\x1f\x92" + // 0x1F220345: 0x00001F92 + "\x1f#\x03E\x00\x00\x1f\x93" + // 0x1F230345: 0x00001F93 + "\x1f$\x03E\x00\x00\x1f\x94" + // 0x1F240345: 0x00001F94 + "\x1f%\x03E\x00\x00\x1f\x95" + // 0x1F250345: 0x00001F95 + "\x1f&\x03E\x00\x00\x1f\x96" + // 0x1F260345: 0x00001F96 + "\x1f'\x03E\x00\x00\x1f\x97" + // 0x1F270345: 0x00001F97 + "\x1f(\x03E\x00\x00\x1f\x98" + // 0x1F280345: 0x00001F98 + "\x1f)\x03E\x00\x00\x1f\x99" + // 0x1F290345: 0x00001F99 + "\x1f*\x03E\x00\x00\x1f\x9a" + // 0x1F2A0345: 0x00001F9A + "\x1f+\x03E\x00\x00\x1f\x9b" + // 0x1F2B0345: 0x00001F9B + "\x1f,\x03E\x00\x00\x1f\x9c" + // 0x1F2C0345: 0x00001F9C + "\x1f-\x03E\x00\x00\x1f\x9d" + // 0x1F2D0345: 0x00001F9D + "\x1f.\x03E\x00\x00\x1f\x9e" + // 0x1F2E0345: 0x00001F9E + "\x1f/\x03E\x00\x00\x1f\x9f" + // 0x1F2F0345: 0x00001F9F + "\x1f`\x03E\x00\x00\x1f\xa0" + // 0x1F600345: 0x00001FA0 + "\x1fa\x03E\x00\x00\x1f\xa1" + // 0x1F610345: 0x00001FA1 + "\x1fb\x03E\x00\x00\x1f\xa2" + // 0x1F620345: 0x00001FA2 + "\x1fc\x03E\x00\x00\x1f\xa3" + // 0x1F630345: 0x00001FA3 + "\x1fd\x03E\x00\x00\x1f\xa4" + // 0x1F640345: 0x00001FA4 + "\x1fe\x03E\x00\x00\x1f\xa5" + // 0x1F650345: 0x00001FA5 + "\x1ff\x03E\x00\x00\x1f\xa6" + // 0x1F660345: 0x00001FA6 + "\x1fg\x03E\x00\x00\x1f\xa7" + // 0x1F670345: 0x00001FA7 + "\x1fh\x03E\x00\x00\x1f\xa8" + // 0x1F680345: 0x00001FA8 + "\x1fi\x03E\x00\x00\x1f\xa9" + // 0x1F690345: 0x00001FA9 + "\x1fj\x03E\x00\x00\x1f\xaa" + // 0x1F6A0345: 0x00001FAA + "\x1fk\x03E\x00\x00\x1f\xab" + // 0x1F6B0345: 0x00001FAB + "\x1fl\x03E\x00\x00\x1f\xac" + // 0x1F6C0345: 0x00001FAC + "\x1fm\x03E\x00\x00\x1f\xad" + // 0x1F6D0345: 0x00001FAD + "\x1fn\x03E\x00\x00\x1f\xae" + // 0x1F6E0345: 0x00001FAE + "\x1fo\x03E\x00\x00\x1f\xaf" + // 0x1F6F0345: 0x00001FAF + "\x03\xb1\x03\x06\x00\x00\x1f\xb0" + // 0x03B10306: 0x00001FB0 + "\x03\xb1\x03\x04\x00\x00\x1f\xb1" + // 0x03B10304: 0x00001FB1 + "\x1fp\x03E\x00\x00\x1f\xb2" + // 0x1F700345: 0x00001FB2 + "\x03\xb1\x03E\x00\x00\x1f\xb3" + // 0x03B10345: 0x00001FB3 + "\x03\xac\x03E\x00\x00\x1f\xb4" + // 0x03AC0345: 0x00001FB4 + "\x03\xb1\x03B\x00\x00\x1f\xb6" + // 0x03B10342: 0x00001FB6 + "\x1f\xb6\x03E\x00\x00\x1f\xb7" + // 0x1FB60345: 0x00001FB7 + "\x03\x91\x03\x06\x00\x00\x1f\xb8" + // 0x03910306: 0x00001FB8 + "\x03\x91\x03\x04\x00\x00\x1f\xb9" + // 0x03910304: 0x00001FB9 + "\x03\x91\x03\x00\x00\x00\x1f\xba" + // 0x03910300: 0x00001FBA + "\x03\x91\x03E\x00\x00\x1f\xbc" + // 0x03910345: 0x00001FBC + "\x00\xa8\x03B\x00\x00\x1f\xc1" + // 0x00A80342: 0x00001FC1 + "\x1ft\x03E\x00\x00\x1f\xc2" + // 0x1F740345: 0x00001FC2 + "\x03\xb7\x03E\x00\x00\x1f\xc3" + // 0x03B70345: 0x00001FC3 + "\x03\xae\x03E\x00\x00\x1f\xc4" + // 0x03AE0345: 0x00001FC4 + "\x03\xb7\x03B\x00\x00\x1f\xc6" + // 0x03B70342: 0x00001FC6 + "\x1f\xc6\x03E\x00\x00\x1f\xc7" + // 0x1FC60345: 0x00001FC7 + "\x03\x95\x03\x00\x00\x00\x1f\xc8" + // 0x03950300: 0x00001FC8 + "\x03\x97\x03\x00\x00\x00\x1f\xca" + // 0x03970300: 0x00001FCA + "\x03\x97\x03E\x00\x00\x1f\xcc" + // 0x03970345: 0x00001FCC + "\x1f\xbf\x03\x00\x00\x00\x1f\xcd" + // 0x1FBF0300: 0x00001FCD + "\x1f\xbf\x03\x01\x00\x00\x1f\xce" + // 0x1FBF0301: 0x00001FCE + "\x1f\xbf\x03B\x00\x00\x1f\xcf" + // 0x1FBF0342: 0x00001FCF + "\x03\xb9\x03\x06\x00\x00\x1f\xd0" + // 0x03B90306: 0x00001FD0 + "\x03\xb9\x03\x04\x00\x00\x1f\xd1" + // 0x03B90304: 0x00001FD1 + "\x03\xca\x03\x00\x00\x00\x1f\xd2" + // 0x03CA0300: 0x00001FD2 + "\x03\xb9\x03B\x00\x00\x1f\xd6" + // 0x03B90342: 0x00001FD6 + "\x03\xca\x03B\x00\x00\x1f\xd7" + // 0x03CA0342: 0x00001FD7 + "\x03\x99\x03\x06\x00\x00\x1f\xd8" + // 0x03990306: 0x00001FD8 + "\x03\x99\x03\x04\x00\x00\x1f\xd9" + // 0x03990304: 0x00001FD9 + "\x03\x99\x03\x00\x00\x00\x1f\xda" + // 0x03990300: 0x00001FDA + "\x1f\xfe\x03\x00\x00\x00\x1f\xdd" + // 0x1FFE0300: 0x00001FDD + "\x1f\xfe\x03\x01\x00\x00\x1f\xde" + // 0x1FFE0301: 0x00001FDE + "\x1f\xfe\x03B\x00\x00\x1f\xdf" + // 0x1FFE0342: 0x00001FDF + "\x03\xc5\x03\x06\x00\x00\x1f\xe0" + // 0x03C50306: 0x00001FE0 + "\x03\xc5\x03\x04\x00\x00\x1f\xe1" + // 0x03C50304: 0x00001FE1 + "\x03\xcb\x03\x00\x00\x00\x1f\xe2" + // 0x03CB0300: 0x00001FE2 + "\x03\xc1\x03\x13\x00\x00\x1f\xe4" + // 0x03C10313: 0x00001FE4 + "\x03\xc1\x03\x14\x00\x00\x1f\xe5" + // 0x03C10314: 0x00001FE5 + "\x03\xc5\x03B\x00\x00\x1f\xe6" + // 0x03C50342: 0x00001FE6 + "\x03\xcb\x03B\x00\x00\x1f\xe7" + // 0x03CB0342: 0x00001FE7 + "\x03\xa5\x03\x06\x00\x00\x1f\xe8" + // 0x03A50306: 0x00001FE8 + "\x03\xa5\x03\x04\x00\x00\x1f\xe9" + // 0x03A50304: 0x00001FE9 + "\x03\xa5\x03\x00\x00\x00\x1f\xea" + // 0x03A50300: 0x00001FEA + "\x03\xa1\x03\x14\x00\x00\x1f\xec" + // 0x03A10314: 0x00001FEC + "\x00\xa8\x03\x00\x00\x00\x1f\xed" + // 0x00A80300: 0x00001FED + "\x1f|\x03E\x00\x00\x1f\xf2" + // 0x1F7C0345: 0x00001FF2 + "\x03\xc9\x03E\x00\x00\x1f\xf3" + // 0x03C90345: 0x00001FF3 + "\x03\xce\x03E\x00\x00\x1f\xf4" + // 0x03CE0345: 0x00001FF4 + "\x03\xc9\x03B\x00\x00\x1f\xf6" + // 0x03C90342: 0x00001FF6 + "\x1f\xf6\x03E\x00\x00\x1f\xf7" + // 0x1FF60345: 0x00001FF7 + "\x03\x9f\x03\x00\x00\x00\x1f\xf8" + // 0x039F0300: 0x00001FF8 + "\x03\xa9\x03\x00\x00\x00\x1f\xfa" + // 0x03A90300: 0x00001FFA + "\x03\xa9\x03E\x00\x00\x1f\xfc" + // 0x03A90345: 0x00001FFC + "!\x90\x038\x00\x00!\x9a" + // 0x21900338: 0x0000219A + "!\x92\x038\x00\x00!\x9b" + // 0x21920338: 0x0000219B + "!\x94\x038\x00\x00!\xae" + // 0x21940338: 0x000021AE + "!\xd0\x038\x00\x00!\xcd" + // 0x21D00338: 0x000021CD + "!\xd4\x038\x00\x00!\xce" + // 0x21D40338: 0x000021CE + "!\xd2\x038\x00\x00!\xcf" + // 0x21D20338: 0x000021CF + "\"\x03\x038\x00\x00\"\x04" + // 0x22030338: 0x00002204 + "\"\b\x038\x00\x00\"\t" + // 0x22080338: 0x00002209 + "\"\v\x038\x00\x00\"\f" + // 0x220B0338: 0x0000220C + "\"#\x038\x00\x00\"$" + // 0x22230338: 0x00002224 + "\"%\x038\x00\x00\"&" + // 0x22250338: 0x00002226 + "\"<\x038\x00\x00\"A" + // 0x223C0338: 0x00002241 + "\"C\x038\x00\x00\"D" + // 0x22430338: 0x00002244 + "\"E\x038\x00\x00\"G" + // 0x22450338: 0x00002247 + "\"H\x038\x00\x00\"I" + // 0x22480338: 0x00002249 + "\x00=\x038\x00\x00\"`" + // 0x003D0338: 0x00002260 + "\"a\x038\x00\x00\"b" + // 0x22610338: 0x00002262 + "\"M\x038\x00\x00\"m" + // 0x224D0338: 0x0000226D + "\x00<\x038\x00\x00\"n" + // 0x003C0338: 0x0000226E + "\x00>\x038\x00\x00\"o" + // 0x003E0338: 0x0000226F + "\"d\x038\x00\x00\"p" + // 0x22640338: 0x00002270 + "\"e\x038\x00\x00\"q" + // 0x22650338: 0x00002271 + "\"r\x038\x00\x00\"t" + // 0x22720338: 0x00002274 + "\"s\x038\x00\x00\"u" + // 0x22730338: 0x00002275 + "\"v\x038\x00\x00\"x" + // 0x22760338: 0x00002278 + "\"w\x038\x00\x00\"y" + // 0x22770338: 0x00002279 + "\"z\x038\x00\x00\"\x80" + // 0x227A0338: 0x00002280 + "\"{\x038\x00\x00\"\x81" + // 0x227B0338: 0x00002281 + "\"\x82\x038\x00\x00\"\x84" + // 0x22820338: 0x00002284 + "\"\x83\x038\x00\x00\"\x85" + // 0x22830338: 0x00002285 + "\"\x86\x038\x00\x00\"\x88" + // 0x22860338: 0x00002288 + "\"\x87\x038\x00\x00\"\x89" + // 0x22870338: 0x00002289 + "\"\xa2\x038\x00\x00\"\xac" + // 0x22A20338: 0x000022AC + "\"\xa8\x038\x00\x00\"\xad" + // 0x22A80338: 0x000022AD + "\"\xa9\x038\x00\x00\"\xae" + // 0x22A90338: 0x000022AE + "\"\xab\x038\x00\x00\"\xaf" + // 0x22AB0338: 0x000022AF + "\"|\x038\x00\x00\"\xe0" + // 0x227C0338: 0x000022E0 + "\"}\x038\x00\x00\"\xe1" + // 0x227D0338: 0x000022E1 + "\"\x91\x038\x00\x00\"\xe2" + // 0x22910338: 0x000022E2 + "\"\x92\x038\x00\x00\"\xe3" + // 0x22920338: 0x000022E3 + "\"\xb2\x038\x00\x00\"\xea" + // 0x22B20338: 0x000022EA + "\"\xb3\x038\x00\x00\"\xeb" + // 0x22B30338: 0x000022EB + "\"\xb4\x038\x00\x00\"\xec" + // 0x22B40338: 0x000022EC + "\"\xb5\x038\x00\x00\"\xed" + // 0x22B50338: 0x000022ED + "0K0\x99\x00\x000L" + // 0x304B3099: 0x0000304C + "0M0\x99\x00\x000N" + // 0x304D3099: 0x0000304E + "0O0\x99\x00\x000P" + // 0x304F3099: 0x00003050 + "0Q0\x99\x00\x000R" + // 0x30513099: 0x00003052 + "0S0\x99\x00\x000T" + // 0x30533099: 0x00003054 + "0U0\x99\x00\x000V" + // 0x30553099: 0x00003056 + "0W0\x99\x00\x000X" + // 0x30573099: 0x00003058 + "0Y0\x99\x00\x000Z" + // 0x30593099: 0x0000305A + "0[0\x99\x00\x000\\" + // 0x305B3099: 0x0000305C + "0]0\x99\x00\x000^" + // 0x305D3099: 0x0000305E + "0_0\x99\x00\x000`" + // 0x305F3099: 0x00003060 + "0a0\x99\x00\x000b" + // 0x30613099: 0x00003062 + "0d0\x99\x00\x000e" + // 0x30643099: 0x00003065 + "0f0\x99\x00\x000g" + // 0x30663099: 0x00003067 + "0h0\x99\x00\x000i" + // 0x30683099: 0x00003069 + "0o0\x99\x00\x000p" + // 0x306F3099: 0x00003070 + "0o0\x9a\x00\x000q" + // 0x306F309A: 0x00003071 + "0r0\x99\x00\x000s" + // 0x30723099: 0x00003073 + "0r0\x9a\x00\x000t" + // 0x3072309A: 0x00003074 + "0u0\x99\x00\x000v" + // 0x30753099: 0x00003076 + "0u0\x9a\x00\x000w" + // 0x3075309A: 0x00003077 + "0x0\x99\x00\x000y" + // 0x30783099: 0x00003079 + "0x0\x9a\x00\x000z" + // 0x3078309A: 0x0000307A + "0{0\x99\x00\x000|" + // 0x307B3099: 0x0000307C + "0{0\x9a\x00\x000}" + // 0x307B309A: 0x0000307D + "0F0\x99\x00\x000\x94" + // 0x30463099: 0x00003094 + "0\x9d0\x99\x00\x000\x9e" + // 0x309D3099: 0x0000309E + "0\xab0\x99\x00\x000\xac" + // 0x30AB3099: 0x000030AC + "0\xad0\x99\x00\x000\xae" + // 0x30AD3099: 0x000030AE + "0\xaf0\x99\x00\x000\xb0" + // 0x30AF3099: 0x000030B0 + "0\xb10\x99\x00\x000\xb2" + // 0x30B13099: 0x000030B2 + "0\xb30\x99\x00\x000\xb4" + // 0x30B33099: 0x000030B4 + "0\xb50\x99\x00\x000\xb6" + // 0x30B53099: 0x000030B6 + "0\xb70\x99\x00\x000\xb8" + // 0x30B73099: 0x000030B8 + "0\xb90\x99\x00\x000\xba" + // 0x30B93099: 0x000030BA + "0\xbb0\x99\x00\x000\xbc" + // 0x30BB3099: 0x000030BC + "0\xbd0\x99\x00\x000\xbe" + // 0x30BD3099: 0x000030BE + "0\xbf0\x99\x00\x000\xc0" + // 0x30BF3099: 0x000030C0 + "0\xc10\x99\x00\x000\xc2" + // 0x30C13099: 0x000030C2 + "0\xc40\x99\x00\x000\xc5" + // 0x30C43099: 0x000030C5 + "0\xc60\x99\x00\x000\xc7" + // 0x30C63099: 0x000030C7 + "0\xc80\x99\x00\x000\xc9" + // 0x30C83099: 0x000030C9 + "0\xcf0\x99\x00\x000\xd0" + // 0x30CF3099: 0x000030D0 + "0\xcf0\x9a\x00\x000\xd1" + // 0x30CF309A: 0x000030D1 + "0\xd20\x99\x00\x000\xd3" + // 0x30D23099: 0x000030D3 + "0\xd20\x9a\x00\x000\xd4" + // 0x30D2309A: 0x000030D4 + "0\xd50\x99\x00\x000\xd6" + // 0x30D53099: 0x000030D6 + "0\xd50\x9a\x00\x000\xd7" + // 0x30D5309A: 0x000030D7 + "0\xd80\x99\x00\x000\xd9" + // 0x30D83099: 0x000030D9 + "0\xd80\x9a\x00\x000\xda" + // 0x30D8309A: 0x000030DA + "0\xdb0\x99\x00\x000\xdc" + // 0x30DB3099: 0x000030DC + "0\xdb0\x9a\x00\x000\xdd" + // 0x30DB309A: 0x000030DD + "0\xa60\x99\x00\x000\xf4" + // 0x30A63099: 0x000030F4 + "0\xef0\x99\x00\x000\xf7" + // 0x30EF3099: 0x000030F7 + "0\xf00\x99\x00\x000\xf8" + // 0x30F03099: 0x000030F8 + "0\xf10\x99\x00\x000\xf9" + // 0x30F13099: 0x000030F9 + "0\xf20\x99\x00\x000\xfa" + // 0x30F23099: 0x000030FA + "0\xfd0\x99\x00\x000\xfe" + // 0x30FD3099: 0x000030FE + "\x10\x99\x10\xba\x00\x01\x10\x9a" + // 0x109910BA: 0x0001109A + "\x10\x9b\x10\xba\x00\x01\x10\x9c" + // 0x109B10BA: 0x0001109C + "\x10\xa5\x10\xba\x00\x01\x10\xab" + // 0x10A510BA: 0x000110AB + "\x111\x11'\x00\x01\x11." + // 0x11311127: 0x0001112E + "\x112\x11'\x00\x01\x11/" + // 0x11321127: 0x0001112F + "\x13G\x13>\x00\x01\x13K" + // 0x1347133E: 0x0001134B + "\x13G\x13W\x00\x01\x13L" + // 0x13471357: 0x0001134C + "\x14\xb9\x14\xba\x00\x01\x14\xbb" + // 0x14B914BA: 0x000114BB + "\x14\xb9\x14\xb0\x00\x01\x14\xbc" + // 0x14B914B0: 0x000114BC + "\x14\xb9\x14\xbd\x00\x01\x14\xbe" + // 0x14B914BD: 0x000114BE + "\x15\xb8\x15\xaf\x00\x01\x15\xba" + // 0x15B815AF: 0x000115BA + "\x15\xb9\x15\xaf\x00\x01\x15\xbb" + // 0x15B915AF: 0x000115BB + "" + // Total size of tables: 53KB (54514 bytes) diff --git a/vendor/golang.org/x/text/unicode/norm/tables9.0.0.go b/vendor/golang.org/x/text/unicode/norm/tables9.0.0.go index a01274a8..94290692 100644 --- a/vendor/golang.org/x/text/unicode/norm/tables9.0.0.go +++ b/vendor/golang.org/x/text/unicode/norm/tables9.0.0.go @@ -4,6 +4,8 @@ package norm +import "sync" + const ( // Version is the Unicode edition from which the tables are derived. Version = "9.0.0" @@ -6687,947 +6689,949 @@ var nfkcSparseValues = [875]valueRange{ } // recompMap: 7520 bytes (entries only) -var recompMap = map[uint32]rune{ - 0x00410300: 0x00C0, - 0x00410301: 0x00C1, - 0x00410302: 0x00C2, - 0x00410303: 0x00C3, - 0x00410308: 0x00C4, - 0x0041030A: 0x00C5, - 0x00430327: 0x00C7, - 0x00450300: 0x00C8, - 0x00450301: 0x00C9, - 0x00450302: 0x00CA, - 0x00450308: 0x00CB, - 0x00490300: 0x00CC, - 0x00490301: 0x00CD, - 0x00490302: 0x00CE, - 0x00490308: 0x00CF, - 0x004E0303: 0x00D1, - 0x004F0300: 0x00D2, - 0x004F0301: 0x00D3, - 0x004F0302: 0x00D4, - 0x004F0303: 0x00D5, - 0x004F0308: 0x00D6, - 0x00550300: 0x00D9, - 0x00550301: 0x00DA, - 0x00550302: 0x00DB, - 0x00550308: 0x00DC, - 0x00590301: 0x00DD, - 0x00610300: 0x00E0, - 0x00610301: 0x00E1, - 0x00610302: 0x00E2, - 0x00610303: 0x00E3, - 0x00610308: 0x00E4, - 0x0061030A: 0x00E5, - 0x00630327: 0x00E7, - 0x00650300: 0x00E8, - 0x00650301: 0x00E9, - 0x00650302: 0x00EA, - 0x00650308: 0x00EB, - 0x00690300: 0x00EC, - 0x00690301: 0x00ED, - 0x00690302: 0x00EE, - 0x00690308: 0x00EF, - 0x006E0303: 0x00F1, - 0x006F0300: 0x00F2, - 0x006F0301: 0x00F3, - 0x006F0302: 0x00F4, - 0x006F0303: 0x00F5, - 0x006F0308: 0x00F6, - 0x00750300: 0x00F9, - 0x00750301: 0x00FA, - 0x00750302: 0x00FB, - 0x00750308: 0x00FC, - 0x00790301: 0x00FD, - 0x00790308: 0x00FF, - 0x00410304: 0x0100, - 0x00610304: 0x0101, - 0x00410306: 0x0102, - 0x00610306: 0x0103, - 0x00410328: 0x0104, - 0x00610328: 0x0105, - 0x00430301: 0x0106, - 0x00630301: 0x0107, - 0x00430302: 0x0108, - 0x00630302: 0x0109, - 0x00430307: 0x010A, - 0x00630307: 0x010B, - 0x0043030C: 0x010C, - 0x0063030C: 0x010D, - 0x0044030C: 0x010E, - 0x0064030C: 0x010F, - 0x00450304: 0x0112, - 0x00650304: 0x0113, - 0x00450306: 0x0114, - 0x00650306: 0x0115, - 0x00450307: 0x0116, - 0x00650307: 0x0117, - 0x00450328: 0x0118, - 0x00650328: 0x0119, - 0x0045030C: 0x011A, - 0x0065030C: 0x011B, - 0x00470302: 0x011C, - 0x00670302: 0x011D, - 0x00470306: 0x011E, - 0x00670306: 0x011F, - 0x00470307: 0x0120, - 0x00670307: 0x0121, - 0x00470327: 0x0122, - 0x00670327: 0x0123, - 0x00480302: 0x0124, - 0x00680302: 0x0125, - 0x00490303: 0x0128, - 0x00690303: 0x0129, - 0x00490304: 0x012A, - 0x00690304: 0x012B, - 0x00490306: 0x012C, - 0x00690306: 0x012D, - 0x00490328: 0x012E, - 0x00690328: 0x012F, - 0x00490307: 0x0130, - 0x004A0302: 0x0134, - 0x006A0302: 0x0135, - 0x004B0327: 0x0136, - 0x006B0327: 0x0137, - 0x004C0301: 0x0139, - 0x006C0301: 0x013A, - 0x004C0327: 0x013B, - 0x006C0327: 0x013C, - 0x004C030C: 0x013D, - 0x006C030C: 0x013E, - 0x004E0301: 0x0143, - 0x006E0301: 0x0144, - 0x004E0327: 0x0145, - 0x006E0327: 0x0146, - 0x004E030C: 0x0147, - 0x006E030C: 0x0148, - 0x004F0304: 0x014C, - 0x006F0304: 0x014D, - 0x004F0306: 0x014E, - 0x006F0306: 0x014F, - 0x004F030B: 0x0150, - 0x006F030B: 0x0151, - 0x00520301: 0x0154, - 0x00720301: 0x0155, - 0x00520327: 0x0156, - 0x00720327: 0x0157, - 0x0052030C: 0x0158, - 0x0072030C: 0x0159, - 0x00530301: 0x015A, - 0x00730301: 0x015B, - 0x00530302: 0x015C, - 0x00730302: 0x015D, - 0x00530327: 0x015E, - 0x00730327: 0x015F, - 0x0053030C: 0x0160, - 0x0073030C: 0x0161, - 0x00540327: 0x0162, - 0x00740327: 0x0163, - 0x0054030C: 0x0164, - 0x0074030C: 0x0165, - 0x00550303: 0x0168, - 0x00750303: 0x0169, - 0x00550304: 0x016A, - 0x00750304: 0x016B, - 0x00550306: 0x016C, - 0x00750306: 0x016D, - 0x0055030A: 0x016E, - 0x0075030A: 0x016F, - 0x0055030B: 0x0170, - 0x0075030B: 0x0171, - 0x00550328: 0x0172, - 0x00750328: 0x0173, - 0x00570302: 0x0174, - 0x00770302: 0x0175, - 0x00590302: 0x0176, - 0x00790302: 0x0177, - 0x00590308: 0x0178, - 0x005A0301: 0x0179, - 0x007A0301: 0x017A, - 0x005A0307: 0x017B, - 0x007A0307: 0x017C, - 0x005A030C: 0x017D, - 0x007A030C: 0x017E, - 0x004F031B: 0x01A0, - 0x006F031B: 0x01A1, - 0x0055031B: 0x01AF, - 0x0075031B: 0x01B0, - 0x0041030C: 0x01CD, - 0x0061030C: 0x01CE, - 0x0049030C: 0x01CF, - 0x0069030C: 0x01D0, - 0x004F030C: 0x01D1, - 0x006F030C: 0x01D2, - 0x0055030C: 0x01D3, - 0x0075030C: 0x01D4, - 0x00DC0304: 0x01D5, - 0x00FC0304: 0x01D6, - 0x00DC0301: 0x01D7, - 0x00FC0301: 0x01D8, - 0x00DC030C: 0x01D9, - 0x00FC030C: 0x01DA, - 0x00DC0300: 0x01DB, - 0x00FC0300: 0x01DC, - 0x00C40304: 0x01DE, - 0x00E40304: 0x01DF, - 0x02260304: 0x01E0, - 0x02270304: 0x01E1, - 0x00C60304: 0x01E2, - 0x00E60304: 0x01E3, - 0x0047030C: 0x01E6, - 0x0067030C: 0x01E7, - 0x004B030C: 0x01E8, - 0x006B030C: 0x01E9, - 0x004F0328: 0x01EA, - 0x006F0328: 0x01EB, - 0x01EA0304: 0x01EC, - 0x01EB0304: 0x01ED, - 0x01B7030C: 0x01EE, - 0x0292030C: 0x01EF, - 0x006A030C: 0x01F0, - 0x00470301: 0x01F4, - 0x00670301: 0x01F5, - 0x004E0300: 0x01F8, - 0x006E0300: 0x01F9, - 0x00C50301: 0x01FA, - 0x00E50301: 0x01FB, - 0x00C60301: 0x01FC, - 0x00E60301: 0x01FD, - 0x00D80301: 0x01FE, - 0x00F80301: 0x01FF, - 0x0041030F: 0x0200, - 0x0061030F: 0x0201, - 0x00410311: 0x0202, - 0x00610311: 0x0203, - 0x0045030F: 0x0204, - 0x0065030F: 0x0205, - 0x00450311: 0x0206, - 0x00650311: 0x0207, - 0x0049030F: 0x0208, - 0x0069030F: 0x0209, - 0x00490311: 0x020A, - 0x00690311: 0x020B, - 0x004F030F: 0x020C, - 0x006F030F: 0x020D, - 0x004F0311: 0x020E, - 0x006F0311: 0x020F, - 0x0052030F: 0x0210, - 0x0072030F: 0x0211, - 0x00520311: 0x0212, - 0x00720311: 0x0213, - 0x0055030F: 0x0214, - 0x0075030F: 0x0215, - 0x00550311: 0x0216, - 0x00750311: 0x0217, - 0x00530326: 0x0218, - 0x00730326: 0x0219, - 0x00540326: 0x021A, - 0x00740326: 0x021B, - 0x0048030C: 0x021E, - 0x0068030C: 0x021F, - 0x00410307: 0x0226, - 0x00610307: 0x0227, - 0x00450327: 0x0228, - 0x00650327: 0x0229, - 0x00D60304: 0x022A, - 0x00F60304: 0x022B, - 0x00D50304: 0x022C, - 0x00F50304: 0x022D, - 0x004F0307: 0x022E, - 0x006F0307: 0x022F, - 0x022E0304: 0x0230, - 0x022F0304: 0x0231, - 0x00590304: 0x0232, - 0x00790304: 0x0233, - 0x00A80301: 0x0385, - 0x03910301: 0x0386, - 0x03950301: 0x0388, - 0x03970301: 0x0389, - 0x03990301: 0x038A, - 0x039F0301: 0x038C, - 0x03A50301: 0x038E, - 0x03A90301: 0x038F, - 0x03CA0301: 0x0390, - 0x03990308: 0x03AA, - 0x03A50308: 0x03AB, - 0x03B10301: 0x03AC, - 0x03B50301: 0x03AD, - 0x03B70301: 0x03AE, - 0x03B90301: 0x03AF, - 0x03CB0301: 0x03B0, - 0x03B90308: 0x03CA, - 0x03C50308: 0x03CB, - 0x03BF0301: 0x03CC, - 0x03C50301: 0x03CD, - 0x03C90301: 0x03CE, - 0x03D20301: 0x03D3, - 0x03D20308: 0x03D4, - 0x04150300: 0x0400, - 0x04150308: 0x0401, - 0x04130301: 0x0403, - 0x04060308: 0x0407, - 0x041A0301: 0x040C, - 0x04180300: 0x040D, - 0x04230306: 0x040E, - 0x04180306: 0x0419, - 0x04380306: 0x0439, - 0x04350300: 0x0450, - 0x04350308: 0x0451, - 0x04330301: 0x0453, - 0x04560308: 0x0457, - 0x043A0301: 0x045C, - 0x04380300: 0x045D, - 0x04430306: 0x045E, - 0x0474030F: 0x0476, - 0x0475030F: 0x0477, - 0x04160306: 0x04C1, - 0x04360306: 0x04C2, - 0x04100306: 0x04D0, - 0x04300306: 0x04D1, - 0x04100308: 0x04D2, - 0x04300308: 0x04D3, - 0x04150306: 0x04D6, - 0x04350306: 0x04D7, - 0x04D80308: 0x04DA, - 0x04D90308: 0x04DB, - 0x04160308: 0x04DC, - 0x04360308: 0x04DD, - 0x04170308: 0x04DE, - 0x04370308: 0x04DF, - 0x04180304: 0x04E2, - 0x04380304: 0x04E3, - 0x04180308: 0x04E4, - 0x04380308: 0x04E5, - 0x041E0308: 0x04E6, - 0x043E0308: 0x04E7, - 0x04E80308: 0x04EA, - 0x04E90308: 0x04EB, - 0x042D0308: 0x04EC, - 0x044D0308: 0x04ED, - 0x04230304: 0x04EE, - 0x04430304: 0x04EF, - 0x04230308: 0x04F0, - 0x04430308: 0x04F1, - 0x0423030B: 0x04F2, - 0x0443030B: 0x04F3, - 0x04270308: 0x04F4, - 0x04470308: 0x04F5, - 0x042B0308: 0x04F8, - 0x044B0308: 0x04F9, - 0x06270653: 0x0622, - 0x06270654: 0x0623, - 0x06480654: 0x0624, - 0x06270655: 0x0625, - 0x064A0654: 0x0626, - 0x06D50654: 0x06C0, - 0x06C10654: 0x06C2, - 0x06D20654: 0x06D3, - 0x0928093C: 0x0929, - 0x0930093C: 0x0931, - 0x0933093C: 0x0934, - 0x09C709BE: 0x09CB, - 0x09C709D7: 0x09CC, - 0x0B470B56: 0x0B48, - 0x0B470B3E: 0x0B4B, - 0x0B470B57: 0x0B4C, - 0x0B920BD7: 0x0B94, - 0x0BC60BBE: 0x0BCA, - 0x0BC70BBE: 0x0BCB, - 0x0BC60BD7: 0x0BCC, - 0x0C460C56: 0x0C48, - 0x0CBF0CD5: 0x0CC0, - 0x0CC60CD5: 0x0CC7, - 0x0CC60CD6: 0x0CC8, - 0x0CC60CC2: 0x0CCA, - 0x0CCA0CD5: 0x0CCB, - 0x0D460D3E: 0x0D4A, - 0x0D470D3E: 0x0D4B, - 0x0D460D57: 0x0D4C, - 0x0DD90DCA: 0x0DDA, - 0x0DD90DCF: 0x0DDC, - 0x0DDC0DCA: 0x0DDD, - 0x0DD90DDF: 0x0DDE, - 0x1025102E: 0x1026, - 0x1B051B35: 0x1B06, - 0x1B071B35: 0x1B08, - 0x1B091B35: 0x1B0A, - 0x1B0B1B35: 0x1B0C, - 0x1B0D1B35: 0x1B0E, - 0x1B111B35: 0x1B12, - 0x1B3A1B35: 0x1B3B, - 0x1B3C1B35: 0x1B3D, - 0x1B3E1B35: 0x1B40, - 0x1B3F1B35: 0x1B41, - 0x1B421B35: 0x1B43, - 0x00410325: 0x1E00, - 0x00610325: 0x1E01, - 0x00420307: 0x1E02, - 0x00620307: 0x1E03, - 0x00420323: 0x1E04, - 0x00620323: 0x1E05, - 0x00420331: 0x1E06, - 0x00620331: 0x1E07, - 0x00C70301: 0x1E08, - 0x00E70301: 0x1E09, - 0x00440307: 0x1E0A, - 0x00640307: 0x1E0B, - 0x00440323: 0x1E0C, - 0x00640323: 0x1E0D, - 0x00440331: 0x1E0E, - 0x00640331: 0x1E0F, - 0x00440327: 0x1E10, - 0x00640327: 0x1E11, - 0x0044032D: 0x1E12, - 0x0064032D: 0x1E13, - 0x01120300: 0x1E14, - 0x01130300: 0x1E15, - 0x01120301: 0x1E16, - 0x01130301: 0x1E17, - 0x0045032D: 0x1E18, - 0x0065032D: 0x1E19, - 0x00450330: 0x1E1A, - 0x00650330: 0x1E1B, - 0x02280306: 0x1E1C, - 0x02290306: 0x1E1D, - 0x00460307: 0x1E1E, - 0x00660307: 0x1E1F, - 0x00470304: 0x1E20, - 0x00670304: 0x1E21, - 0x00480307: 0x1E22, - 0x00680307: 0x1E23, - 0x00480323: 0x1E24, - 0x00680323: 0x1E25, - 0x00480308: 0x1E26, - 0x00680308: 0x1E27, - 0x00480327: 0x1E28, - 0x00680327: 0x1E29, - 0x0048032E: 0x1E2A, - 0x0068032E: 0x1E2B, - 0x00490330: 0x1E2C, - 0x00690330: 0x1E2D, - 0x00CF0301: 0x1E2E, - 0x00EF0301: 0x1E2F, - 0x004B0301: 0x1E30, - 0x006B0301: 0x1E31, - 0x004B0323: 0x1E32, - 0x006B0323: 0x1E33, - 0x004B0331: 0x1E34, - 0x006B0331: 0x1E35, - 0x004C0323: 0x1E36, - 0x006C0323: 0x1E37, - 0x1E360304: 0x1E38, - 0x1E370304: 0x1E39, - 0x004C0331: 0x1E3A, - 0x006C0331: 0x1E3B, - 0x004C032D: 0x1E3C, - 0x006C032D: 0x1E3D, - 0x004D0301: 0x1E3E, - 0x006D0301: 0x1E3F, - 0x004D0307: 0x1E40, - 0x006D0307: 0x1E41, - 0x004D0323: 0x1E42, - 0x006D0323: 0x1E43, - 0x004E0307: 0x1E44, - 0x006E0307: 0x1E45, - 0x004E0323: 0x1E46, - 0x006E0323: 0x1E47, - 0x004E0331: 0x1E48, - 0x006E0331: 0x1E49, - 0x004E032D: 0x1E4A, - 0x006E032D: 0x1E4B, - 0x00D50301: 0x1E4C, - 0x00F50301: 0x1E4D, - 0x00D50308: 0x1E4E, - 0x00F50308: 0x1E4F, - 0x014C0300: 0x1E50, - 0x014D0300: 0x1E51, - 0x014C0301: 0x1E52, - 0x014D0301: 0x1E53, - 0x00500301: 0x1E54, - 0x00700301: 0x1E55, - 0x00500307: 0x1E56, - 0x00700307: 0x1E57, - 0x00520307: 0x1E58, - 0x00720307: 0x1E59, - 0x00520323: 0x1E5A, - 0x00720323: 0x1E5B, - 0x1E5A0304: 0x1E5C, - 0x1E5B0304: 0x1E5D, - 0x00520331: 0x1E5E, - 0x00720331: 0x1E5F, - 0x00530307: 0x1E60, - 0x00730307: 0x1E61, - 0x00530323: 0x1E62, - 0x00730323: 0x1E63, - 0x015A0307: 0x1E64, - 0x015B0307: 0x1E65, - 0x01600307: 0x1E66, - 0x01610307: 0x1E67, - 0x1E620307: 0x1E68, - 0x1E630307: 0x1E69, - 0x00540307: 0x1E6A, - 0x00740307: 0x1E6B, - 0x00540323: 0x1E6C, - 0x00740323: 0x1E6D, - 0x00540331: 0x1E6E, - 0x00740331: 0x1E6F, - 0x0054032D: 0x1E70, - 0x0074032D: 0x1E71, - 0x00550324: 0x1E72, - 0x00750324: 0x1E73, - 0x00550330: 0x1E74, - 0x00750330: 0x1E75, - 0x0055032D: 0x1E76, - 0x0075032D: 0x1E77, - 0x01680301: 0x1E78, - 0x01690301: 0x1E79, - 0x016A0308: 0x1E7A, - 0x016B0308: 0x1E7B, - 0x00560303: 0x1E7C, - 0x00760303: 0x1E7D, - 0x00560323: 0x1E7E, - 0x00760323: 0x1E7F, - 0x00570300: 0x1E80, - 0x00770300: 0x1E81, - 0x00570301: 0x1E82, - 0x00770301: 0x1E83, - 0x00570308: 0x1E84, - 0x00770308: 0x1E85, - 0x00570307: 0x1E86, - 0x00770307: 0x1E87, - 0x00570323: 0x1E88, - 0x00770323: 0x1E89, - 0x00580307: 0x1E8A, - 0x00780307: 0x1E8B, - 0x00580308: 0x1E8C, - 0x00780308: 0x1E8D, - 0x00590307: 0x1E8E, - 0x00790307: 0x1E8F, - 0x005A0302: 0x1E90, - 0x007A0302: 0x1E91, - 0x005A0323: 0x1E92, - 0x007A0323: 0x1E93, - 0x005A0331: 0x1E94, - 0x007A0331: 0x1E95, - 0x00680331: 0x1E96, - 0x00740308: 0x1E97, - 0x0077030A: 0x1E98, - 0x0079030A: 0x1E99, - 0x017F0307: 0x1E9B, - 0x00410323: 0x1EA0, - 0x00610323: 0x1EA1, - 0x00410309: 0x1EA2, - 0x00610309: 0x1EA3, - 0x00C20301: 0x1EA4, - 0x00E20301: 0x1EA5, - 0x00C20300: 0x1EA6, - 0x00E20300: 0x1EA7, - 0x00C20309: 0x1EA8, - 0x00E20309: 0x1EA9, - 0x00C20303: 0x1EAA, - 0x00E20303: 0x1EAB, - 0x1EA00302: 0x1EAC, - 0x1EA10302: 0x1EAD, - 0x01020301: 0x1EAE, - 0x01030301: 0x1EAF, - 0x01020300: 0x1EB0, - 0x01030300: 0x1EB1, - 0x01020309: 0x1EB2, - 0x01030309: 0x1EB3, - 0x01020303: 0x1EB4, - 0x01030303: 0x1EB5, - 0x1EA00306: 0x1EB6, - 0x1EA10306: 0x1EB7, - 0x00450323: 0x1EB8, - 0x00650323: 0x1EB9, - 0x00450309: 0x1EBA, - 0x00650309: 0x1EBB, - 0x00450303: 0x1EBC, - 0x00650303: 0x1EBD, - 0x00CA0301: 0x1EBE, - 0x00EA0301: 0x1EBF, - 0x00CA0300: 0x1EC0, - 0x00EA0300: 0x1EC1, - 0x00CA0309: 0x1EC2, - 0x00EA0309: 0x1EC3, - 0x00CA0303: 0x1EC4, - 0x00EA0303: 0x1EC5, - 0x1EB80302: 0x1EC6, - 0x1EB90302: 0x1EC7, - 0x00490309: 0x1EC8, - 0x00690309: 0x1EC9, - 0x00490323: 0x1ECA, - 0x00690323: 0x1ECB, - 0x004F0323: 0x1ECC, - 0x006F0323: 0x1ECD, - 0x004F0309: 0x1ECE, - 0x006F0309: 0x1ECF, - 0x00D40301: 0x1ED0, - 0x00F40301: 0x1ED1, - 0x00D40300: 0x1ED2, - 0x00F40300: 0x1ED3, - 0x00D40309: 0x1ED4, - 0x00F40309: 0x1ED5, - 0x00D40303: 0x1ED6, - 0x00F40303: 0x1ED7, - 0x1ECC0302: 0x1ED8, - 0x1ECD0302: 0x1ED9, - 0x01A00301: 0x1EDA, - 0x01A10301: 0x1EDB, - 0x01A00300: 0x1EDC, - 0x01A10300: 0x1EDD, - 0x01A00309: 0x1EDE, - 0x01A10309: 0x1EDF, - 0x01A00303: 0x1EE0, - 0x01A10303: 0x1EE1, - 0x01A00323: 0x1EE2, - 0x01A10323: 0x1EE3, - 0x00550323: 0x1EE4, - 0x00750323: 0x1EE5, - 0x00550309: 0x1EE6, - 0x00750309: 0x1EE7, - 0x01AF0301: 0x1EE8, - 0x01B00301: 0x1EE9, - 0x01AF0300: 0x1EEA, - 0x01B00300: 0x1EEB, - 0x01AF0309: 0x1EEC, - 0x01B00309: 0x1EED, - 0x01AF0303: 0x1EEE, - 0x01B00303: 0x1EEF, - 0x01AF0323: 0x1EF0, - 0x01B00323: 0x1EF1, - 0x00590300: 0x1EF2, - 0x00790300: 0x1EF3, - 0x00590323: 0x1EF4, - 0x00790323: 0x1EF5, - 0x00590309: 0x1EF6, - 0x00790309: 0x1EF7, - 0x00590303: 0x1EF8, - 0x00790303: 0x1EF9, - 0x03B10313: 0x1F00, - 0x03B10314: 0x1F01, - 0x1F000300: 0x1F02, - 0x1F010300: 0x1F03, - 0x1F000301: 0x1F04, - 0x1F010301: 0x1F05, - 0x1F000342: 0x1F06, - 0x1F010342: 0x1F07, - 0x03910313: 0x1F08, - 0x03910314: 0x1F09, - 0x1F080300: 0x1F0A, - 0x1F090300: 0x1F0B, - 0x1F080301: 0x1F0C, - 0x1F090301: 0x1F0D, - 0x1F080342: 0x1F0E, - 0x1F090342: 0x1F0F, - 0x03B50313: 0x1F10, - 0x03B50314: 0x1F11, - 0x1F100300: 0x1F12, - 0x1F110300: 0x1F13, - 0x1F100301: 0x1F14, - 0x1F110301: 0x1F15, - 0x03950313: 0x1F18, - 0x03950314: 0x1F19, - 0x1F180300: 0x1F1A, - 0x1F190300: 0x1F1B, - 0x1F180301: 0x1F1C, - 0x1F190301: 0x1F1D, - 0x03B70313: 0x1F20, - 0x03B70314: 0x1F21, - 0x1F200300: 0x1F22, - 0x1F210300: 0x1F23, - 0x1F200301: 0x1F24, - 0x1F210301: 0x1F25, - 0x1F200342: 0x1F26, - 0x1F210342: 0x1F27, - 0x03970313: 0x1F28, - 0x03970314: 0x1F29, - 0x1F280300: 0x1F2A, - 0x1F290300: 0x1F2B, - 0x1F280301: 0x1F2C, - 0x1F290301: 0x1F2D, - 0x1F280342: 0x1F2E, - 0x1F290342: 0x1F2F, - 0x03B90313: 0x1F30, - 0x03B90314: 0x1F31, - 0x1F300300: 0x1F32, - 0x1F310300: 0x1F33, - 0x1F300301: 0x1F34, - 0x1F310301: 0x1F35, - 0x1F300342: 0x1F36, - 0x1F310342: 0x1F37, - 0x03990313: 0x1F38, - 0x03990314: 0x1F39, - 0x1F380300: 0x1F3A, - 0x1F390300: 0x1F3B, - 0x1F380301: 0x1F3C, - 0x1F390301: 0x1F3D, - 0x1F380342: 0x1F3E, - 0x1F390342: 0x1F3F, - 0x03BF0313: 0x1F40, - 0x03BF0314: 0x1F41, - 0x1F400300: 0x1F42, - 0x1F410300: 0x1F43, - 0x1F400301: 0x1F44, - 0x1F410301: 0x1F45, - 0x039F0313: 0x1F48, - 0x039F0314: 0x1F49, - 0x1F480300: 0x1F4A, - 0x1F490300: 0x1F4B, - 0x1F480301: 0x1F4C, - 0x1F490301: 0x1F4D, - 0x03C50313: 0x1F50, - 0x03C50314: 0x1F51, - 0x1F500300: 0x1F52, - 0x1F510300: 0x1F53, - 0x1F500301: 0x1F54, - 0x1F510301: 0x1F55, - 0x1F500342: 0x1F56, - 0x1F510342: 0x1F57, - 0x03A50314: 0x1F59, - 0x1F590300: 0x1F5B, - 0x1F590301: 0x1F5D, - 0x1F590342: 0x1F5F, - 0x03C90313: 0x1F60, - 0x03C90314: 0x1F61, - 0x1F600300: 0x1F62, - 0x1F610300: 0x1F63, - 0x1F600301: 0x1F64, - 0x1F610301: 0x1F65, - 0x1F600342: 0x1F66, - 0x1F610342: 0x1F67, - 0x03A90313: 0x1F68, - 0x03A90314: 0x1F69, - 0x1F680300: 0x1F6A, - 0x1F690300: 0x1F6B, - 0x1F680301: 0x1F6C, - 0x1F690301: 0x1F6D, - 0x1F680342: 0x1F6E, - 0x1F690342: 0x1F6F, - 0x03B10300: 0x1F70, - 0x03B50300: 0x1F72, - 0x03B70300: 0x1F74, - 0x03B90300: 0x1F76, - 0x03BF0300: 0x1F78, - 0x03C50300: 0x1F7A, - 0x03C90300: 0x1F7C, - 0x1F000345: 0x1F80, - 0x1F010345: 0x1F81, - 0x1F020345: 0x1F82, - 0x1F030345: 0x1F83, - 0x1F040345: 0x1F84, - 0x1F050345: 0x1F85, - 0x1F060345: 0x1F86, - 0x1F070345: 0x1F87, - 0x1F080345: 0x1F88, - 0x1F090345: 0x1F89, - 0x1F0A0345: 0x1F8A, - 0x1F0B0345: 0x1F8B, - 0x1F0C0345: 0x1F8C, - 0x1F0D0345: 0x1F8D, - 0x1F0E0345: 0x1F8E, - 0x1F0F0345: 0x1F8F, - 0x1F200345: 0x1F90, - 0x1F210345: 0x1F91, - 0x1F220345: 0x1F92, - 0x1F230345: 0x1F93, - 0x1F240345: 0x1F94, - 0x1F250345: 0x1F95, - 0x1F260345: 0x1F96, - 0x1F270345: 0x1F97, - 0x1F280345: 0x1F98, - 0x1F290345: 0x1F99, - 0x1F2A0345: 0x1F9A, - 0x1F2B0345: 0x1F9B, - 0x1F2C0345: 0x1F9C, - 0x1F2D0345: 0x1F9D, - 0x1F2E0345: 0x1F9E, - 0x1F2F0345: 0x1F9F, - 0x1F600345: 0x1FA0, - 0x1F610345: 0x1FA1, - 0x1F620345: 0x1FA2, - 0x1F630345: 0x1FA3, - 0x1F640345: 0x1FA4, - 0x1F650345: 0x1FA5, - 0x1F660345: 0x1FA6, - 0x1F670345: 0x1FA7, - 0x1F680345: 0x1FA8, - 0x1F690345: 0x1FA9, - 0x1F6A0345: 0x1FAA, - 0x1F6B0345: 0x1FAB, - 0x1F6C0345: 0x1FAC, - 0x1F6D0345: 0x1FAD, - 0x1F6E0345: 0x1FAE, - 0x1F6F0345: 0x1FAF, - 0x03B10306: 0x1FB0, - 0x03B10304: 0x1FB1, - 0x1F700345: 0x1FB2, - 0x03B10345: 0x1FB3, - 0x03AC0345: 0x1FB4, - 0x03B10342: 0x1FB6, - 0x1FB60345: 0x1FB7, - 0x03910306: 0x1FB8, - 0x03910304: 0x1FB9, - 0x03910300: 0x1FBA, - 0x03910345: 0x1FBC, - 0x00A80342: 0x1FC1, - 0x1F740345: 0x1FC2, - 0x03B70345: 0x1FC3, - 0x03AE0345: 0x1FC4, - 0x03B70342: 0x1FC6, - 0x1FC60345: 0x1FC7, - 0x03950300: 0x1FC8, - 0x03970300: 0x1FCA, - 0x03970345: 0x1FCC, - 0x1FBF0300: 0x1FCD, - 0x1FBF0301: 0x1FCE, - 0x1FBF0342: 0x1FCF, - 0x03B90306: 0x1FD0, - 0x03B90304: 0x1FD1, - 0x03CA0300: 0x1FD2, - 0x03B90342: 0x1FD6, - 0x03CA0342: 0x1FD7, - 0x03990306: 0x1FD8, - 0x03990304: 0x1FD9, - 0x03990300: 0x1FDA, - 0x1FFE0300: 0x1FDD, - 0x1FFE0301: 0x1FDE, - 0x1FFE0342: 0x1FDF, - 0x03C50306: 0x1FE0, - 0x03C50304: 0x1FE1, - 0x03CB0300: 0x1FE2, - 0x03C10313: 0x1FE4, - 0x03C10314: 0x1FE5, - 0x03C50342: 0x1FE6, - 0x03CB0342: 0x1FE7, - 0x03A50306: 0x1FE8, - 0x03A50304: 0x1FE9, - 0x03A50300: 0x1FEA, - 0x03A10314: 0x1FEC, - 0x00A80300: 0x1FED, - 0x1F7C0345: 0x1FF2, - 0x03C90345: 0x1FF3, - 0x03CE0345: 0x1FF4, - 0x03C90342: 0x1FF6, - 0x1FF60345: 0x1FF7, - 0x039F0300: 0x1FF8, - 0x03A90300: 0x1FFA, - 0x03A90345: 0x1FFC, - 0x21900338: 0x219A, - 0x21920338: 0x219B, - 0x21940338: 0x21AE, - 0x21D00338: 0x21CD, - 0x21D40338: 0x21CE, - 0x21D20338: 0x21CF, - 0x22030338: 0x2204, - 0x22080338: 0x2209, - 0x220B0338: 0x220C, - 0x22230338: 0x2224, - 0x22250338: 0x2226, - 0x223C0338: 0x2241, - 0x22430338: 0x2244, - 0x22450338: 0x2247, - 0x22480338: 0x2249, - 0x003D0338: 0x2260, - 0x22610338: 0x2262, - 0x224D0338: 0x226D, - 0x003C0338: 0x226E, - 0x003E0338: 0x226F, - 0x22640338: 0x2270, - 0x22650338: 0x2271, - 0x22720338: 0x2274, - 0x22730338: 0x2275, - 0x22760338: 0x2278, - 0x22770338: 0x2279, - 0x227A0338: 0x2280, - 0x227B0338: 0x2281, - 0x22820338: 0x2284, - 0x22830338: 0x2285, - 0x22860338: 0x2288, - 0x22870338: 0x2289, - 0x22A20338: 0x22AC, - 0x22A80338: 0x22AD, - 0x22A90338: 0x22AE, - 0x22AB0338: 0x22AF, - 0x227C0338: 0x22E0, - 0x227D0338: 0x22E1, - 0x22910338: 0x22E2, - 0x22920338: 0x22E3, - 0x22B20338: 0x22EA, - 0x22B30338: 0x22EB, - 0x22B40338: 0x22EC, - 0x22B50338: 0x22ED, - 0x304B3099: 0x304C, - 0x304D3099: 0x304E, - 0x304F3099: 0x3050, - 0x30513099: 0x3052, - 0x30533099: 0x3054, - 0x30553099: 0x3056, - 0x30573099: 0x3058, - 0x30593099: 0x305A, - 0x305B3099: 0x305C, - 0x305D3099: 0x305E, - 0x305F3099: 0x3060, - 0x30613099: 0x3062, - 0x30643099: 0x3065, - 0x30663099: 0x3067, - 0x30683099: 0x3069, - 0x306F3099: 0x3070, - 0x306F309A: 0x3071, - 0x30723099: 0x3073, - 0x3072309A: 0x3074, - 0x30753099: 0x3076, - 0x3075309A: 0x3077, - 0x30783099: 0x3079, - 0x3078309A: 0x307A, - 0x307B3099: 0x307C, - 0x307B309A: 0x307D, - 0x30463099: 0x3094, - 0x309D3099: 0x309E, - 0x30AB3099: 0x30AC, - 0x30AD3099: 0x30AE, - 0x30AF3099: 0x30B0, - 0x30B13099: 0x30B2, - 0x30B33099: 0x30B4, - 0x30B53099: 0x30B6, - 0x30B73099: 0x30B8, - 0x30B93099: 0x30BA, - 0x30BB3099: 0x30BC, - 0x30BD3099: 0x30BE, - 0x30BF3099: 0x30C0, - 0x30C13099: 0x30C2, - 0x30C43099: 0x30C5, - 0x30C63099: 0x30C7, - 0x30C83099: 0x30C9, - 0x30CF3099: 0x30D0, - 0x30CF309A: 0x30D1, - 0x30D23099: 0x30D3, - 0x30D2309A: 0x30D4, - 0x30D53099: 0x30D6, - 0x30D5309A: 0x30D7, - 0x30D83099: 0x30D9, - 0x30D8309A: 0x30DA, - 0x30DB3099: 0x30DC, - 0x30DB309A: 0x30DD, - 0x30A63099: 0x30F4, - 0x30EF3099: 0x30F7, - 0x30F03099: 0x30F8, - 0x30F13099: 0x30F9, - 0x30F23099: 0x30FA, - 0x30FD3099: 0x30FE, - 0x109910BA: 0x1109A, - 0x109B10BA: 0x1109C, - 0x10A510BA: 0x110AB, - 0x11311127: 0x1112E, - 0x11321127: 0x1112F, - 0x1347133E: 0x1134B, - 0x13471357: 0x1134C, - 0x14B914BA: 0x114BB, - 0x14B914B0: 0x114BC, - 0x14B914BD: 0x114BE, - 0x15B815AF: 0x115BA, - 0x15B915AF: 0x115BB, -} +var recompMap map[uint32]rune +var recompMapOnce sync.Once -// Total size of tables: 53KB (54006 bytes) +const recompMapPacked = "" + + "\x00A\x03\x00\x00\x00\x00\xc0" + // 0x00410300: 0x000000C0 + "\x00A\x03\x01\x00\x00\x00\xc1" + // 0x00410301: 0x000000C1 + "\x00A\x03\x02\x00\x00\x00\xc2" + // 0x00410302: 0x000000C2 + "\x00A\x03\x03\x00\x00\x00\xc3" + // 0x00410303: 0x000000C3 + "\x00A\x03\b\x00\x00\x00\xc4" + // 0x00410308: 0x000000C4 + "\x00A\x03\n\x00\x00\x00\xc5" + // 0x0041030A: 0x000000C5 + "\x00C\x03'\x00\x00\x00\xc7" + // 0x00430327: 0x000000C7 + "\x00E\x03\x00\x00\x00\x00\xc8" + // 0x00450300: 0x000000C8 + "\x00E\x03\x01\x00\x00\x00\xc9" + // 0x00450301: 0x000000C9 + "\x00E\x03\x02\x00\x00\x00\xca" + // 0x00450302: 0x000000CA + "\x00E\x03\b\x00\x00\x00\xcb" + // 0x00450308: 0x000000CB + "\x00I\x03\x00\x00\x00\x00\xcc" + // 0x00490300: 0x000000CC + "\x00I\x03\x01\x00\x00\x00\xcd" + // 0x00490301: 0x000000CD + "\x00I\x03\x02\x00\x00\x00\xce" + // 0x00490302: 0x000000CE + "\x00I\x03\b\x00\x00\x00\xcf" + // 0x00490308: 0x000000CF + "\x00N\x03\x03\x00\x00\x00\xd1" + // 0x004E0303: 0x000000D1 + "\x00O\x03\x00\x00\x00\x00\xd2" + // 0x004F0300: 0x000000D2 + "\x00O\x03\x01\x00\x00\x00\xd3" + // 0x004F0301: 0x000000D3 + "\x00O\x03\x02\x00\x00\x00\xd4" + // 0x004F0302: 0x000000D4 + "\x00O\x03\x03\x00\x00\x00\xd5" + // 0x004F0303: 0x000000D5 + "\x00O\x03\b\x00\x00\x00\xd6" + // 0x004F0308: 0x000000D6 + "\x00U\x03\x00\x00\x00\x00\xd9" + // 0x00550300: 0x000000D9 + "\x00U\x03\x01\x00\x00\x00\xda" + // 0x00550301: 0x000000DA + "\x00U\x03\x02\x00\x00\x00\xdb" + // 0x00550302: 0x000000DB + "\x00U\x03\b\x00\x00\x00\xdc" + // 0x00550308: 0x000000DC + "\x00Y\x03\x01\x00\x00\x00\xdd" + // 0x00590301: 0x000000DD + "\x00a\x03\x00\x00\x00\x00\xe0" + // 0x00610300: 0x000000E0 + "\x00a\x03\x01\x00\x00\x00\xe1" + // 0x00610301: 0x000000E1 + "\x00a\x03\x02\x00\x00\x00\xe2" + // 0x00610302: 0x000000E2 + "\x00a\x03\x03\x00\x00\x00\xe3" + // 0x00610303: 0x000000E3 + "\x00a\x03\b\x00\x00\x00\xe4" + // 0x00610308: 0x000000E4 + "\x00a\x03\n\x00\x00\x00\xe5" + // 0x0061030A: 0x000000E5 + "\x00c\x03'\x00\x00\x00\xe7" + // 0x00630327: 0x000000E7 + "\x00e\x03\x00\x00\x00\x00\xe8" + // 0x00650300: 0x000000E8 + "\x00e\x03\x01\x00\x00\x00\xe9" + // 0x00650301: 0x000000E9 + "\x00e\x03\x02\x00\x00\x00\xea" + // 0x00650302: 0x000000EA + "\x00e\x03\b\x00\x00\x00\xeb" + // 0x00650308: 0x000000EB + "\x00i\x03\x00\x00\x00\x00\xec" + // 0x00690300: 0x000000EC + "\x00i\x03\x01\x00\x00\x00\xed" + // 0x00690301: 0x000000ED + "\x00i\x03\x02\x00\x00\x00\xee" + // 0x00690302: 0x000000EE + "\x00i\x03\b\x00\x00\x00\xef" + // 0x00690308: 0x000000EF + "\x00n\x03\x03\x00\x00\x00\xf1" + // 0x006E0303: 0x000000F1 + "\x00o\x03\x00\x00\x00\x00\xf2" + // 0x006F0300: 0x000000F2 + "\x00o\x03\x01\x00\x00\x00\xf3" + // 0x006F0301: 0x000000F3 + "\x00o\x03\x02\x00\x00\x00\xf4" + // 0x006F0302: 0x000000F4 + "\x00o\x03\x03\x00\x00\x00\xf5" + // 0x006F0303: 0x000000F5 + "\x00o\x03\b\x00\x00\x00\xf6" + // 0x006F0308: 0x000000F6 + "\x00u\x03\x00\x00\x00\x00\xf9" + // 0x00750300: 0x000000F9 + "\x00u\x03\x01\x00\x00\x00\xfa" + // 0x00750301: 0x000000FA + "\x00u\x03\x02\x00\x00\x00\xfb" + // 0x00750302: 0x000000FB + "\x00u\x03\b\x00\x00\x00\xfc" + // 0x00750308: 0x000000FC + "\x00y\x03\x01\x00\x00\x00\xfd" + // 0x00790301: 0x000000FD + "\x00y\x03\b\x00\x00\x00\xff" + // 0x00790308: 0x000000FF + "\x00A\x03\x04\x00\x00\x01\x00" + // 0x00410304: 0x00000100 + "\x00a\x03\x04\x00\x00\x01\x01" + // 0x00610304: 0x00000101 + "\x00A\x03\x06\x00\x00\x01\x02" + // 0x00410306: 0x00000102 + "\x00a\x03\x06\x00\x00\x01\x03" + // 0x00610306: 0x00000103 + "\x00A\x03(\x00\x00\x01\x04" + // 0x00410328: 0x00000104 + "\x00a\x03(\x00\x00\x01\x05" + // 0x00610328: 0x00000105 + "\x00C\x03\x01\x00\x00\x01\x06" + // 0x00430301: 0x00000106 + "\x00c\x03\x01\x00\x00\x01\a" + // 0x00630301: 0x00000107 + "\x00C\x03\x02\x00\x00\x01\b" + // 0x00430302: 0x00000108 + "\x00c\x03\x02\x00\x00\x01\t" + // 0x00630302: 0x00000109 + "\x00C\x03\a\x00\x00\x01\n" + // 0x00430307: 0x0000010A + "\x00c\x03\a\x00\x00\x01\v" + // 0x00630307: 0x0000010B + "\x00C\x03\f\x00\x00\x01\f" + // 0x0043030C: 0x0000010C + "\x00c\x03\f\x00\x00\x01\r" + // 0x0063030C: 0x0000010D + "\x00D\x03\f\x00\x00\x01\x0e" + // 0x0044030C: 0x0000010E + "\x00d\x03\f\x00\x00\x01\x0f" + // 0x0064030C: 0x0000010F + "\x00E\x03\x04\x00\x00\x01\x12" + // 0x00450304: 0x00000112 + "\x00e\x03\x04\x00\x00\x01\x13" + // 0x00650304: 0x00000113 + "\x00E\x03\x06\x00\x00\x01\x14" + // 0x00450306: 0x00000114 + "\x00e\x03\x06\x00\x00\x01\x15" + // 0x00650306: 0x00000115 + "\x00E\x03\a\x00\x00\x01\x16" + // 0x00450307: 0x00000116 + "\x00e\x03\a\x00\x00\x01\x17" + // 0x00650307: 0x00000117 + "\x00E\x03(\x00\x00\x01\x18" + // 0x00450328: 0x00000118 + "\x00e\x03(\x00\x00\x01\x19" + // 0x00650328: 0x00000119 + "\x00E\x03\f\x00\x00\x01\x1a" + // 0x0045030C: 0x0000011A + "\x00e\x03\f\x00\x00\x01\x1b" + // 0x0065030C: 0x0000011B + "\x00G\x03\x02\x00\x00\x01\x1c" + // 0x00470302: 0x0000011C + "\x00g\x03\x02\x00\x00\x01\x1d" + // 0x00670302: 0x0000011D + "\x00G\x03\x06\x00\x00\x01\x1e" + // 0x00470306: 0x0000011E + "\x00g\x03\x06\x00\x00\x01\x1f" + // 0x00670306: 0x0000011F + "\x00G\x03\a\x00\x00\x01 " + // 0x00470307: 0x00000120 + "\x00g\x03\a\x00\x00\x01!" + // 0x00670307: 0x00000121 + "\x00G\x03'\x00\x00\x01\"" + // 0x00470327: 0x00000122 + "\x00g\x03'\x00\x00\x01#" + // 0x00670327: 0x00000123 + "\x00H\x03\x02\x00\x00\x01$" + // 0x00480302: 0x00000124 + "\x00h\x03\x02\x00\x00\x01%" + // 0x00680302: 0x00000125 + "\x00I\x03\x03\x00\x00\x01(" + // 0x00490303: 0x00000128 + "\x00i\x03\x03\x00\x00\x01)" + // 0x00690303: 0x00000129 + "\x00I\x03\x04\x00\x00\x01*" + // 0x00490304: 0x0000012A + "\x00i\x03\x04\x00\x00\x01+" + // 0x00690304: 0x0000012B + "\x00I\x03\x06\x00\x00\x01," + // 0x00490306: 0x0000012C + "\x00i\x03\x06\x00\x00\x01-" + // 0x00690306: 0x0000012D + "\x00I\x03(\x00\x00\x01." + // 0x00490328: 0x0000012E + "\x00i\x03(\x00\x00\x01/" + // 0x00690328: 0x0000012F + "\x00I\x03\a\x00\x00\x010" + // 0x00490307: 0x00000130 + "\x00J\x03\x02\x00\x00\x014" + // 0x004A0302: 0x00000134 + "\x00j\x03\x02\x00\x00\x015" + // 0x006A0302: 0x00000135 + "\x00K\x03'\x00\x00\x016" + // 0x004B0327: 0x00000136 + "\x00k\x03'\x00\x00\x017" + // 0x006B0327: 0x00000137 + "\x00L\x03\x01\x00\x00\x019" + // 0x004C0301: 0x00000139 + "\x00l\x03\x01\x00\x00\x01:" + // 0x006C0301: 0x0000013A + "\x00L\x03'\x00\x00\x01;" + // 0x004C0327: 0x0000013B + "\x00l\x03'\x00\x00\x01<" + // 0x006C0327: 0x0000013C + "\x00L\x03\f\x00\x00\x01=" + // 0x004C030C: 0x0000013D + "\x00l\x03\f\x00\x00\x01>" + // 0x006C030C: 0x0000013E + "\x00N\x03\x01\x00\x00\x01C" + // 0x004E0301: 0x00000143 + "\x00n\x03\x01\x00\x00\x01D" + // 0x006E0301: 0x00000144 + "\x00N\x03'\x00\x00\x01E" + // 0x004E0327: 0x00000145 + "\x00n\x03'\x00\x00\x01F" + // 0x006E0327: 0x00000146 + "\x00N\x03\f\x00\x00\x01G" + // 0x004E030C: 0x00000147 + "\x00n\x03\f\x00\x00\x01H" + // 0x006E030C: 0x00000148 + "\x00O\x03\x04\x00\x00\x01L" + // 0x004F0304: 0x0000014C + "\x00o\x03\x04\x00\x00\x01M" + // 0x006F0304: 0x0000014D + "\x00O\x03\x06\x00\x00\x01N" + // 0x004F0306: 0x0000014E + "\x00o\x03\x06\x00\x00\x01O" + // 0x006F0306: 0x0000014F + "\x00O\x03\v\x00\x00\x01P" + // 0x004F030B: 0x00000150 + "\x00o\x03\v\x00\x00\x01Q" + // 0x006F030B: 0x00000151 + "\x00R\x03\x01\x00\x00\x01T" + // 0x00520301: 0x00000154 + "\x00r\x03\x01\x00\x00\x01U" + // 0x00720301: 0x00000155 + "\x00R\x03'\x00\x00\x01V" + // 0x00520327: 0x00000156 + "\x00r\x03'\x00\x00\x01W" + // 0x00720327: 0x00000157 + "\x00R\x03\f\x00\x00\x01X" + // 0x0052030C: 0x00000158 + "\x00r\x03\f\x00\x00\x01Y" + // 0x0072030C: 0x00000159 + "\x00S\x03\x01\x00\x00\x01Z" + // 0x00530301: 0x0000015A + "\x00s\x03\x01\x00\x00\x01[" + // 0x00730301: 0x0000015B + "\x00S\x03\x02\x00\x00\x01\\" + // 0x00530302: 0x0000015C + "\x00s\x03\x02\x00\x00\x01]" + // 0x00730302: 0x0000015D + "\x00S\x03'\x00\x00\x01^" + // 0x00530327: 0x0000015E + "\x00s\x03'\x00\x00\x01_" + // 0x00730327: 0x0000015F + "\x00S\x03\f\x00\x00\x01`" + // 0x0053030C: 0x00000160 + "\x00s\x03\f\x00\x00\x01a" + // 0x0073030C: 0x00000161 + "\x00T\x03'\x00\x00\x01b" + // 0x00540327: 0x00000162 + "\x00t\x03'\x00\x00\x01c" + // 0x00740327: 0x00000163 + "\x00T\x03\f\x00\x00\x01d" + // 0x0054030C: 0x00000164 + "\x00t\x03\f\x00\x00\x01e" + // 0x0074030C: 0x00000165 + "\x00U\x03\x03\x00\x00\x01h" + // 0x00550303: 0x00000168 + "\x00u\x03\x03\x00\x00\x01i" + // 0x00750303: 0x00000169 + "\x00U\x03\x04\x00\x00\x01j" + // 0x00550304: 0x0000016A + "\x00u\x03\x04\x00\x00\x01k" + // 0x00750304: 0x0000016B + "\x00U\x03\x06\x00\x00\x01l" + // 0x00550306: 0x0000016C + "\x00u\x03\x06\x00\x00\x01m" + // 0x00750306: 0x0000016D + "\x00U\x03\n\x00\x00\x01n" + // 0x0055030A: 0x0000016E + "\x00u\x03\n\x00\x00\x01o" + // 0x0075030A: 0x0000016F + "\x00U\x03\v\x00\x00\x01p" + // 0x0055030B: 0x00000170 + "\x00u\x03\v\x00\x00\x01q" + // 0x0075030B: 0x00000171 + "\x00U\x03(\x00\x00\x01r" + // 0x00550328: 0x00000172 + "\x00u\x03(\x00\x00\x01s" + // 0x00750328: 0x00000173 + "\x00W\x03\x02\x00\x00\x01t" + // 0x00570302: 0x00000174 + "\x00w\x03\x02\x00\x00\x01u" + // 0x00770302: 0x00000175 + "\x00Y\x03\x02\x00\x00\x01v" + // 0x00590302: 0x00000176 + "\x00y\x03\x02\x00\x00\x01w" + // 0x00790302: 0x00000177 + "\x00Y\x03\b\x00\x00\x01x" + // 0x00590308: 0x00000178 + "\x00Z\x03\x01\x00\x00\x01y" + // 0x005A0301: 0x00000179 + "\x00z\x03\x01\x00\x00\x01z" + // 0x007A0301: 0x0000017A + "\x00Z\x03\a\x00\x00\x01{" + // 0x005A0307: 0x0000017B + "\x00z\x03\a\x00\x00\x01|" + // 0x007A0307: 0x0000017C + "\x00Z\x03\f\x00\x00\x01}" + // 0x005A030C: 0x0000017D + "\x00z\x03\f\x00\x00\x01~" + // 0x007A030C: 0x0000017E + "\x00O\x03\x1b\x00\x00\x01\xa0" + // 0x004F031B: 0x000001A0 + "\x00o\x03\x1b\x00\x00\x01\xa1" + // 0x006F031B: 0x000001A1 + "\x00U\x03\x1b\x00\x00\x01\xaf" + // 0x0055031B: 0x000001AF + "\x00u\x03\x1b\x00\x00\x01\xb0" + // 0x0075031B: 0x000001B0 + "\x00A\x03\f\x00\x00\x01\xcd" + // 0x0041030C: 0x000001CD + "\x00a\x03\f\x00\x00\x01\xce" + // 0x0061030C: 0x000001CE + "\x00I\x03\f\x00\x00\x01\xcf" + // 0x0049030C: 0x000001CF + "\x00i\x03\f\x00\x00\x01\xd0" + // 0x0069030C: 0x000001D0 + "\x00O\x03\f\x00\x00\x01\xd1" + // 0x004F030C: 0x000001D1 + "\x00o\x03\f\x00\x00\x01\xd2" + // 0x006F030C: 0x000001D2 + "\x00U\x03\f\x00\x00\x01\xd3" + // 0x0055030C: 0x000001D3 + "\x00u\x03\f\x00\x00\x01\xd4" + // 0x0075030C: 0x000001D4 + "\x00\xdc\x03\x04\x00\x00\x01\xd5" + // 0x00DC0304: 0x000001D5 + "\x00\xfc\x03\x04\x00\x00\x01\xd6" + // 0x00FC0304: 0x000001D6 + "\x00\xdc\x03\x01\x00\x00\x01\xd7" + // 0x00DC0301: 0x000001D7 + "\x00\xfc\x03\x01\x00\x00\x01\xd8" + // 0x00FC0301: 0x000001D8 + "\x00\xdc\x03\f\x00\x00\x01\xd9" + // 0x00DC030C: 0x000001D9 + "\x00\xfc\x03\f\x00\x00\x01\xda" + // 0x00FC030C: 0x000001DA + "\x00\xdc\x03\x00\x00\x00\x01\xdb" + // 0x00DC0300: 0x000001DB + "\x00\xfc\x03\x00\x00\x00\x01\xdc" + // 0x00FC0300: 0x000001DC + "\x00\xc4\x03\x04\x00\x00\x01\xde" + // 0x00C40304: 0x000001DE + "\x00\xe4\x03\x04\x00\x00\x01\xdf" + // 0x00E40304: 0x000001DF + "\x02&\x03\x04\x00\x00\x01\xe0" + // 0x02260304: 0x000001E0 + "\x02'\x03\x04\x00\x00\x01\xe1" + // 0x02270304: 0x000001E1 + "\x00\xc6\x03\x04\x00\x00\x01\xe2" + // 0x00C60304: 0x000001E2 + "\x00\xe6\x03\x04\x00\x00\x01\xe3" + // 0x00E60304: 0x000001E3 + "\x00G\x03\f\x00\x00\x01\xe6" + // 0x0047030C: 0x000001E6 + "\x00g\x03\f\x00\x00\x01\xe7" + // 0x0067030C: 0x000001E7 + "\x00K\x03\f\x00\x00\x01\xe8" + // 0x004B030C: 0x000001E8 + "\x00k\x03\f\x00\x00\x01\xe9" + // 0x006B030C: 0x000001E9 + "\x00O\x03(\x00\x00\x01\xea" + // 0x004F0328: 0x000001EA + "\x00o\x03(\x00\x00\x01\xeb" + // 0x006F0328: 0x000001EB + "\x01\xea\x03\x04\x00\x00\x01\xec" + // 0x01EA0304: 0x000001EC + "\x01\xeb\x03\x04\x00\x00\x01\xed" + // 0x01EB0304: 0x000001ED + "\x01\xb7\x03\f\x00\x00\x01\xee" + // 0x01B7030C: 0x000001EE + "\x02\x92\x03\f\x00\x00\x01\xef" + // 0x0292030C: 0x000001EF + "\x00j\x03\f\x00\x00\x01\xf0" + // 0x006A030C: 0x000001F0 + "\x00G\x03\x01\x00\x00\x01\xf4" + // 0x00470301: 0x000001F4 + "\x00g\x03\x01\x00\x00\x01\xf5" + // 0x00670301: 0x000001F5 + "\x00N\x03\x00\x00\x00\x01\xf8" + // 0x004E0300: 0x000001F8 + "\x00n\x03\x00\x00\x00\x01\xf9" + // 0x006E0300: 0x000001F9 + "\x00\xc5\x03\x01\x00\x00\x01\xfa" + // 0x00C50301: 0x000001FA + "\x00\xe5\x03\x01\x00\x00\x01\xfb" + // 0x00E50301: 0x000001FB + "\x00\xc6\x03\x01\x00\x00\x01\xfc" + // 0x00C60301: 0x000001FC + "\x00\xe6\x03\x01\x00\x00\x01\xfd" + // 0x00E60301: 0x000001FD + "\x00\xd8\x03\x01\x00\x00\x01\xfe" + // 0x00D80301: 0x000001FE + "\x00\xf8\x03\x01\x00\x00\x01\xff" + // 0x00F80301: 0x000001FF + "\x00A\x03\x0f\x00\x00\x02\x00" + // 0x0041030F: 0x00000200 + "\x00a\x03\x0f\x00\x00\x02\x01" + // 0x0061030F: 0x00000201 + "\x00A\x03\x11\x00\x00\x02\x02" + // 0x00410311: 0x00000202 + "\x00a\x03\x11\x00\x00\x02\x03" + // 0x00610311: 0x00000203 + "\x00E\x03\x0f\x00\x00\x02\x04" + // 0x0045030F: 0x00000204 + "\x00e\x03\x0f\x00\x00\x02\x05" + // 0x0065030F: 0x00000205 + "\x00E\x03\x11\x00\x00\x02\x06" + // 0x00450311: 0x00000206 + "\x00e\x03\x11\x00\x00\x02\a" + // 0x00650311: 0x00000207 + "\x00I\x03\x0f\x00\x00\x02\b" + // 0x0049030F: 0x00000208 + "\x00i\x03\x0f\x00\x00\x02\t" + // 0x0069030F: 0x00000209 + "\x00I\x03\x11\x00\x00\x02\n" + // 0x00490311: 0x0000020A + "\x00i\x03\x11\x00\x00\x02\v" + // 0x00690311: 0x0000020B + "\x00O\x03\x0f\x00\x00\x02\f" + // 0x004F030F: 0x0000020C + "\x00o\x03\x0f\x00\x00\x02\r" + // 0x006F030F: 0x0000020D + "\x00O\x03\x11\x00\x00\x02\x0e" + // 0x004F0311: 0x0000020E + "\x00o\x03\x11\x00\x00\x02\x0f" + // 0x006F0311: 0x0000020F + "\x00R\x03\x0f\x00\x00\x02\x10" + // 0x0052030F: 0x00000210 + "\x00r\x03\x0f\x00\x00\x02\x11" + // 0x0072030F: 0x00000211 + "\x00R\x03\x11\x00\x00\x02\x12" + // 0x00520311: 0x00000212 + "\x00r\x03\x11\x00\x00\x02\x13" + // 0x00720311: 0x00000213 + "\x00U\x03\x0f\x00\x00\x02\x14" + // 0x0055030F: 0x00000214 + "\x00u\x03\x0f\x00\x00\x02\x15" + // 0x0075030F: 0x00000215 + "\x00U\x03\x11\x00\x00\x02\x16" + // 0x00550311: 0x00000216 + "\x00u\x03\x11\x00\x00\x02\x17" + // 0x00750311: 0x00000217 + "\x00S\x03&\x00\x00\x02\x18" + // 0x00530326: 0x00000218 + "\x00s\x03&\x00\x00\x02\x19" + // 0x00730326: 0x00000219 + "\x00T\x03&\x00\x00\x02\x1a" + // 0x00540326: 0x0000021A + "\x00t\x03&\x00\x00\x02\x1b" + // 0x00740326: 0x0000021B + "\x00H\x03\f\x00\x00\x02\x1e" + // 0x0048030C: 0x0000021E + "\x00h\x03\f\x00\x00\x02\x1f" + // 0x0068030C: 0x0000021F + "\x00A\x03\a\x00\x00\x02&" + // 0x00410307: 0x00000226 + "\x00a\x03\a\x00\x00\x02'" + // 0x00610307: 0x00000227 + "\x00E\x03'\x00\x00\x02(" + // 0x00450327: 0x00000228 + "\x00e\x03'\x00\x00\x02)" + // 0x00650327: 0x00000229 + "\x00\xd6\x03\x04\x00\x00\x02*" + // 0x00D60304: 0x0000022A + "\x00\xf6\x03\x04\x00\x00\x02+" + // 0x00F60304: 0x0000022B + "\x00\xd5\x03\x04\x00\x00\x02," + // 0x00D50304: 0x0000022C + "\x00\xf5\x03\x04\x00\x00\x02-" + // 0x00F50304: 0x0000022D + "\x00O\x03\a\x00\x00\x02." + // 0x004F0307: 0x0000022E + "\x00o\x03\a\x00\x00\x02/" + // 0x006F0307: 0x0000022F + "\x02.\x03\x04\x00\x00\x020" + // 0x022E0304: 0x00000230 + "\x02/\x03\x04\x00\x00\x021" + // 0x022F0304: 0x00000231 + "\x00Y\x03\x04\x00\x00\x022" + // 0x00590304: 0x00000232 + "\x00y\x03\x04\x00\x00\x023" + // 0x00790304: 0x00000233 + "\x00\xa8\x03\x01\x00\x00\x03\x85" + // 0x00A80301: 0x00000385 + "\x03\x91\x03\x01\x00\x00\x03\x86" + // 0x03910301: 0x00000386 + "\x03\x95\x03\x01\x00\x00\x03\x88" + // 0x03950301: 0x00000388 + "\x03\x97\x03\x01\x00\x00\x03\x89" + // 0x03970301: 0x00000389 + "\x03\x99\x03\x01\x00\x00\x03\x8a" + // 0x03990301: 0x0000038A + "\x03\x9f\x03\x01\x00\x00\x03\x8c" + // 0x039F0301: 0x0000038C + "\x03\xa5\x03\x01\x00\x00\x03\x8e" + // 0x03A50301: 0x0000038E + "\x03\xa9\x03\x01\x00\x00\x03\x8f" + // 0x03A90301: 0x0000038F + "\x03\xca\x03\x01\x00\x00\x03\x90" + // 0x03CA0301: 0x00000390 + "\x03\x99\x03\b\x00\x00\x03\xaa" + // 0x03990308: 0x000003AA + "\x03\xa5\x03\b\x00\x00\x03\xab" + // 0x03A50308: 0x000003AB + "\x03\xb1\x03\x01\x00\x00\x03\xac" + // 0x03B10301: 0x000003AC + "\x03\xb5\x03\x01\x00\x00\x03\xad" + // 0x03B50301: 0x000003AD + "\x03\xb7\x03\x01\x00\x00\x03\xae" + // 0x03B70301: 0x000003AE + "\x03\xb9\x03\x01\x00\x00\x03\xaf" + // 0x03B90301: 0x000003AF + "\x03\xcb\x03\x01\x00\x00\x03\xb0" + // 0x03CB0301: 0x000003B0 + "\x03\xb9\x03\b\x00\x00\x03\xca" + // 0x03B90308: 0x000003CA + "\x03\xc5\x03\b\x00\x00\x03\xcb" + // 0x03C50308: 0x000003CB + "\x03\xbf\x03\x01\x00\x00\x03\xcc" + // 0x03BF0301: 0x000003CC + "\x03\xc5\x03\x01\x00\x00\x03\xcd" + // 0x03C50301: 0x000003CD + "\x03\xc9\x03\x01\x00\x00\x03\xce" + // 0x03C90301: 0x000003CE + "\x03\xd2\x03\x01\x00\x00\x03\xd3" + // 0x03D20301: 0x000003D3 + "\x03\xd2\x03\b\x00\x00\x03\xd4" + // 0x03D20308: 0x000003D4 + "\x04\x15\x03\x00\x00\x00\x04\x00" + // 0x04150300: 0x00000400 + "\x04\x15\x03\b\x00\x00\x04\x01" + // 0x04150308: 0x00000401 + "\x04\x13\x03\x01\x00\x00\x04\x03" + // 0x04130301: 0x00000403 + "\x04\x06\x03\b\x00\x00\x04\a" + // 0x04060308: 0x00000407 + "\x04\x1a\x03\x01\x00\x00\x04\f" + // 0x041A0301: 0x0000040C + "\x04\x18\x03\x00\x00\x00\x04\r" + // 0x04180300: 0x0000040D + "\x04#\x03\x06\x00\x00\x04\x0e" + // 0x04230306: 0x0000040E + "\x04\x18\x03\x06\x00\x00\x04\x19" + // 0x04180306: 0x00000419 + "\x048\x03\x06\x00\x00\x049" + // 0x04380306: 0x00000439 + "\x045\x03\x00\x00\x00\x04P" + // 0x04350300: 0x00000450 + "\x045\x03\b\x00\x00\x04Q" + // 0x04350308: 0x00000451 + "\x043\x03\x01\x00\x00\x04S" + // 0x04330301: 0x00000453 + "\x04V\x03\b\x00\x00\x04W" + // 0x04560308: 0x00000457 + "\x04:\x03\x01\x00\x00\x04\\" + // 0x043A0301: 0x0000045C + "\x048\x03\x00\x00\x00\x04]" + // 0x04380300: 0x0000045D + "\x04C\x03\x06\x00\x00\x04^" + // 0x04430306: 0x0000045E + "\x04t\x03\x0f\x00\x00\x04v" + // 0x0474030F: 0x00000476 + "\x04u\x03\x0f\x00\x00\x04w" + // 0x0475030F: 0x00000477 + "\x04\x16\x03\x06\x00\x00\x04\xc1" + // 0x04160306: 0x000004C1 + "\x046\x03\x06\x00\x00\x04\xc2" + // 0x04360306: 0x000004C2 + "\x04\x10\x03\x06\x00\x00\x04\xd0" + // 0x04100306: 0x000004D0 + "\x040\x03\x06\x00\x00\x04\xd1" + // 0x04300306: 0x000004D1 + "\x04\x10\x03\b\x00\x00\x04\xd2" + // 0x04100308: 0x000004D2 + "\x040\x03\b\x00\x00\x04\xd3" + // 0x04300308: 0x000004D3 + "\x04\x15\x03\x06\x00\x00\x04\xd6" + // 0x04150306: 0x000004D6 + "\x045\x03\x06\x00\x00\x04\xd7" + // 0x04350306: 0x000004D7 + "\x04\xd8\x03\b\x00\x00\x04\xda" + // 0x04D80308: 0x000004DA + "\x04\xd9\x03\b\x00\x00\x04\xdb" + // 0x04D90308: 0x000004DB + "\x04\x16\x03\b\x00\x00\x04\xdc" + // 0x04160308: 0x000004DC + "\x046\x03\b\x00\x00\x04\xdd" + // 0x04360308: 0x000004DD + "\x04\x17\x03\b\x00\x00\x04\xde" + // 0x04170308: 0x000004DE + "\x047\x03\b\x00\x00\x04\xdf" + // 0x04370308: 0x000004DF + "\x04\x18\x03\x04\x00\x00\x04\xe2" + // 0x04180304: 0x000004E2 + "\x048\x03\x04\x00\x00\x04\xe3" + // 0x04380304: 0x000004E3 + "\x04\x18\x03\b\x00\x00\x04\xe4" + // 0x04180308: 0x000004E4 + "\x048\x03\b\x00\x00\x04\xe5" + // 0x04380308: 0x000004E5 + "\x04\x1e\x03\b\x00\x00\x04\xe6" + // 0x041E0308: 0x000004E6 + "\x04>\x03\b\x00\x00\x04\xe7" + // 0x043E0308: 0x000004E7 + "\x04\xe8\x03\b\x00\x00\x04\xea" + // 0x04E80308: 0x000004EA + "\x04\xe9\x03\b\x00\x00\x04\xeb" + // 0x04E90308: 0x000004EB + "\x04-\x03\b\x00\x00\x04\xec" + // 0x042D0308: 0x000004EC + "\x04M\x03\b\x00\x00\x04\xed" + // 0x044D0308: 0x000004ED + "\x04#\x03\x04\x00\x00\x04\xee" + // 0x04230304: 0x000004EE + "\x04C\x03\x04\x00\x00\x04\xef" + // 0x04430304: 0x000004EF + "\x04#\x03\b\x00\x00\x04\xf0" + // 0x04230308: 0x000004F0 + "\x04C\x03\b\x00\x00\x04\xf1" + // 0x04430308: 0x000004F1 + "\x04#\x03\v\x00\x00\x04\xf2" + // 0x0423030B: 0x000004F2 + "\x04C\x03\v\x00\x00\x04\xf3" + // 0x0443030B: 0x000004F3 + "\x04'\x03\b\x00\x00\x04\xf4" + // 0x04270308: 0x000004F4 + "\x04G\x03\b\x00\x00\x04\xf5" + // 0x04470308: 0x000004F5 + "\x04+\x03\b\x00\x00\x04\xf8" + // 0x042B0308: 0x000004F8 + "\x04K\x03\b\x00\x00\x04\xf9" + // 0x044B0308: 0x000004F9 + "\x06'\x06S\x00\x00\x06\"" + // 0x06270653: 0x00000622 + "\x06'\x06T\x00\x00\x06#" + // 0x06270654: 0x00000623 + "\x06H\x06T\x00\x00\x06$" + // 0x06480654: 0x00000624 + "\x06'\x06U\x00\x00\x06%" + // 0x06270655: 0x00000625 + "\x06J\x06T\x00\x00\x06&" + // 0x064A0654: 0x00000626 + "\x06\xd5\x06T\x00\x00\x06\xc0" + // 0x06D50654: 0x000006C0 + "\x06\xc1\x06T\x00\x00\x06\xc2" + // 0x06C10654: 0x000006C2 + "\x06\xd2\x06T\x00\x00\x06\xd3" + // 0x06D20654: 0x000006D3 + "\t(\t<\x00\x00\t)" + // 0x0928093C: 0x00000929 + "\t0\t<\x00\x00\t1" + // 0x0930093C: 0x00000931 + "\t3\t<\x00\x00\t4" + // 0x0933093C: 0x00000934 + "\t\xc7\t\xbe\x00\x00\t\xcb" + // 0x09C709BE: 0x000009CB + "\t\xc7\t\xd7\x00\x00\t\xcc" + // 0x09C709D7: 0x000009CC + "\vG\vV\x00\x00\vH" + // 0x0B470B56: 0x00000B48 + "\vG\v>\x00\x00\vK" + // 0x0B470B3E: 0x00000B4B + "\vG\vW\x00\x00\vL" + // 0x0B470B57: 0x00000B4C + "\v\x92\v\xd7\x00\x00\v\x94" + // 0x0B920BD7: 0x00000B94 + "\v\xc6\v\xbe\x00\x00\v\xca" + // 0x0BC60BBE: 0x00000BCA + "\v\xc7\v\xbe\x00\x00\v\xcb" + // 0x0BC70BBE: 0x00000BCB + "\v\xc6\v\xd7\x00\x00\v\xcc" + // 0x0BC60BD7: 0x00000BCC + "\fF\fV\x00\x00\fH" + // 0x0C460C56: 0x00000C48 + "\f\xbf\f\xd5\x00\x00\f\xc0" + // 0x0CBF0CD5: 0x00000CC0 + "\f\xc6\f\xd5\x00\x00\f\xc7" + // 0x0CC60CD5: 0x00000CC7 + "\f\xc6\f\xd6\x00\x00\f\xc8" + // 0x0CC60CD6: 0x00000CC8 + "\f\xc6\f\xc2\x00\x00\f\xca" + // 0x0CC60CC2: 0x00000CCA + "\f\xca\f\xd5\x00\x00\f\xcb" + // 0x0CCA0CD5: 0x00000CCB + "\rF\r>\x00\x00\rJ" + // 0x0D460D3E: 0x00000D4A + "\rG\r>\x00\x00\rK" + // 0x0D470D3E: 0x00000D4B + "\rF\rW\x00\x00\rL" + // 0x0D460D57: 0x00000D4C + "\r\xd9\r\xca\x00\x00\r\xda" + // 0x0DD90DCA: 0x00000DDA + "\r\xd9\r\xcf\x00\x00\r\xdc" + // 0x0DD90DCF: 0x00000DDC + "\r\xdc\r\xca\x00\x00\r\xdd" + // 0x0DDC0DCA: 0x00000DDD + "\r\xd9\r\xdf\x00\x00\r\xde" + // 0x0DD90DDF: 0x00000DDE + "\x10%\x10.\x00\x00\x10&" + // 0x1025102E: 0x00001026 + "\x1b\x05\x1b5\x00\x00\x1b\x06" + // 0x1B051B35: 0x00001B06 + "\x1b\a\x1b5\x00\x00\x1b\b" + // 0x1B071B35: 0x00001B08 + "\x1b\t\x1b5\x00\x00\x1b\n" + // 0x1B091B35: 0x00001B0A + "\x1b\v\x1b5\x00\x00\x1b\f" + // 0x1B0B1B35: 0x00001B0C + "\x1b\r\x1b5\x00\x00\x1b\x0e" + // 0x1B0D1B35: 0x00001B0E + "\x1b\x11\x1b5\x00\x00\x1b\x12" + // 0x1B111B35: 0x00001B12 + "\x1b:\x1b5\x00\x00\x1b;" + // 0x1B3A1B35: 0x00001B3B + "\x1b<\x1b5\x00\x00\x1b=" + // 0x1B3C1B35: 0x00001B3D + "\x1b>\x1b5\x00\x00\x1b@" + // 0x1B3E1B35: 0x00001B40 + "\x1b?\x1b5\x00\x00\x1bA" + // 0x1B3F1B35: 0x00001B41 + "\x1bB\x1b5\x00\x00\x1bC" + // 0x1B421B35: 0x00001B43 + "\x00A\x03%\x00\x00\x1e\x00" + // 0x00410325: 0x00001E00 + "\x00a\x03%\x00\x00\x1e\x01" + // 0x00610325: 0x00001E01 + "\x00B\x03\a\x00\x00\x1e\x02" + // 0x00420307: 0x00001E02 + "\x00b\x03\a\x00\x00\x1e\x03" + // 0x00620307: 0x00001E03 + "\x00B\x03#\x00\x00\x1e\x04" + // 0x00420323: 0x00001E04 + "\x00b\x03#\x00\x00\x1e\x05" + // 0x00620323: 0x00001E05 + "\x00B\x031\x00\x00\x1e\x06" + // 0x00420331: 0x00001E06 + "\x00b\x031\x00\x00\x1e\a" + // 0x00620331: 0x00001E07 + "\x00\xc7\x03\x01\x00\x00\x1e\b" + // 0x00C70301: 0x00001E08 + "\x00\xe7\x03\x01\x00\x00\x1e\t" + // 0x00E70301: 0x00001E09 + "\x00D\x03\a\x00\x00\x1e\n" + // 0x00440307: 0x00001E0A + "\x00d\x03\a\x00\x00\x1e\v" + // 0x00640307: 0x00001E0B + "\x00D\x03#\x00\x00\x1e\f" + // 0x00440323: 0x00001E0C + "\x00d\x03#\x00\x00\x1e\r" + // 0x00640323: 0x00001E0D + "\x00D\x031\x00\x00\x1e\x0e" + // 0x00440331: 0x00001E0E + "\x00d\x031\x00\x00\x1e\x0f" + // 0x00640331: 0x00001E0F + "\x00D\x03'\x00\x00\x1e\x10" + // 0x00440327: 0x00001E10 + "\x00d\x03'\x00\x00\x1e\x11" + // 0x00640327: 0x00001E11 + "\x00D\x03-\x00\x00\x1e\x12" + // 0x0044032D: 0x00001E12 + "\x00d\x03-\x00\x00\x1e\x13" + // 0x0064032D: 0x00001E13 + "\x01\x12\x03\x00\x00\x00\x1e\x14" + // 0x01120300: 0x00001E14 + "\x01\x13\x03\x00\x00\x00\x1e\x15" + // 0x01130300: 0x00001E15 + "\x01\x12\x03\x01\x00\x00\x1e\x16" + // 0x01120301: 0x00001E16 + "\x01\x13\x03\x01\x00\x00\x1e\x17" + // 0x01130301: 0x00001E17 + "\x00E\x03-\x00\x00\x1e\x18" + // 0x0045032D: 0x00001E18 + "\x00e\x03-\x00\x00\x1e\x19" + // 0x0065032D: 0x00001E19 + "\x00E\x030\x00\x00\x1e\x1a" + // 0x00450330: 0x00001E1A + "\x00e\x030\x00\x00\x1e\x1b" + // 0x00650330: 0x00001E1B + "\x02(\x03\x06\x00\x00\x1e\x1c" + // 0x02280306: 0x00001E1C + "\x02)\x03\x06\x00\x00\x1e\x1d" + // 0x02290306: 0x00001E1D + "\x00F\x03\a\x00\x00\x1e\x1e" + // 0x00460307: 0x00001E1E + "\x00f\x03\a\x00\x00\x1e\x1f" + // 0x00660307: 0x00001E1F + "\x00G\x03\x04\x00\x00\x1e " + // 0x00470304: 0x00001E20 + "\x00g\x03\x04\x00\x00\x1e!" + // 0x00670304: 0x00001E21 + "\x00H\x03\a\x00\x00\x1e\"" + // 0x00480307: 0x00001E22 + "\x00h\x03\a\x00\x00\x1e#" + // 0x00680307: 0x00001E23 + "\x00H\x03#\x00\x00\x1e$" + // 0x00480323: 0x00001E24 + "\x00h\x03#\x00\x00\x1e%" + // 0x00680323: 0x00001E25 + "\x00H\x03\b\x00\x00\x1e&" + // 0x00480308: 0x00001E26 + "\x00h\x03\b\x00\x00\x1e'" + // 0x00680308: 0x00001E27 + "\x00H\x03'\x00\x00\x1e(" + // 0x00480327: 0x00001E28 + "\x00h\x03'\x00\x00\x1e)" + // 0x00680327: 0x00001E29 + "\x00H\x03.\x00\x00\x1e*" + // 0x0048032E: 0x00001E2A + "\x00h\x03.\x00\x00\x1e+" + // 0x0068032E: 0x00001E2B + "\x00I\x030\x00\x00\x1e," + // 0x00490330: 0x00001E2C + "\x00i\x030\x00\x00\x1e-" + // 0x00690330: 0x00001E2D + "\x00\xcf\x03\x01\x00\x00\x1e." + // 0x00CF0301: 0x00001E2E + "\x00\xef\x03\x01\x00\x00\x1e/" + // 0x00EF0301: 0x00001E2F + "\x00K\x03\x01\x00\x00\x1e0" + // 0x004B0301: 0x00001E30 + "\x00k\x03\x01\x00\x00\x1e1" + // 0x006B0301: 0x00001E31 + "\x00K\x03#\x00\x00\x1e2" + // 0x004B0323: 0x00001E32 + "\x00k\x03#\x00\x00\x1e3" + // 0x006B0323: 0x00001E33 + "\x00K\x031\x00\x00\x1e4" + // 0x004B0331: 0x00001E34 + "\x00k\x031\x00\x00\x1e5" + // 0x006B0331: 0x00001E35 + "\x00L\x03#\x00\x00\x1e6" + // 0x004C0323: 0x00001E36 + "\x00l\x03#\x00\x00\x1e7" + // 0x006C0323: 0x00001E37 + "\x1e6\x03\x04\x00\x00\x1e8" + // 0x1E360304: 0x00001E38 + "\x1e7\x03\x04\x00\x00\x1e9" + // 0x1E370304: 0x00001E39 + "\x00L\x031\x00\x00\x1e:" + // 0x004C0331: 0x00001E3A + "\x00l\x031\x00\x00\x1e;" + // 0x006C0331: 0x00001E3B + "\x00L\x03-\x00\x00\x1e<" + // 0x004C032D: 0x00001E3C + "\x00l\x03-\x00\x00\x1e=" + // 0x006C032D: 0x00001E3D + "\x00M\x03\x01\x00\x00\x1e>" + // 0x004D0301: 0x00001E3E + "\x00m\x03\x01\x00\x00\x1e?" + // 0x006D0301: 0x00001E3F + "\x00M\x03\a\x00\x00\x1e@" + // 0x004D0307: 0x00001E40 + "\x00m\x03\a\x00\x00\x1eA" + // 0x006D0307: 0x00001E41 + "\x00M\x03#\x00\x00\x1eB" + // 0x004D0323: 0x00001E42 + "\x00m\x03#\x00\x00\x1eC" + // 0x006D0323: 0x00001E43 + "\x00N\x03\a\x00\x00\x1eD" + // 0x004E0307: 0x00001E44 + "\x00n\x03\a\x00\x00\x1eE" + // 0x006E0307: 0x00001E45 + "\x00N\x03#\x00\x00\x1eF" + // 0x004E0323: 0x00001E46 + "\x00n\x03#\x00\x00\x1eG" + // 0x006E0323: 0x00001E47 + "\x00N\x031\x00\x00\x1eH" + // 0x004E0331: 0x00001E48 + "\x00n\x031\x00\x00\x1eI" + // 0x006E0331: 0x00001E49 + "\x00N\x03-\x00\x00\x1eJ" + // 0x004E032D: 0x00001E4A + "\x00n\x03-\x00\x00\x1eK" + // 0x006E032D: 0x00001E4B + "\x00\xd5\x03\x01\x00\x00\x1eL" + // 0x00D50301: 0x00001E4C + "\x00\xf5\x03\x01\x00\x00\x1eM" + // 0x00F50301: 0x00001E4D + "\x00\xd5\x03\b\x00\x00\x1eN" + // 0x00D50308: 0x00001E4E + "\x00\xf5\x03\b\x00\x00\x1eO" + // 0x00F50308: 0x00001E4F + "\x01L\x03\x00\x00\x00\x1eP" + // 0x014C0300: 0x00001E50 + "\x01M\x03\x00\x00\x00\x1eQ" + // 0x014D0300: 0x00001E51 + "\x01L\x03\x01\x00\x00\x1eR" + // 0x014C0301: 0x00001E52 + "\x01M\x03\x01\x00\x00\x1eS" + // 0x014D0301: 0x00001E53 + "\x00P\x03\x01\x00\x00\x1eT" + // 0x00500301: 0x00001E54 + "\x00p\x03\x01\x00\x00\x1eU" + // 0x00700301: 0x00001E55 + "\x00P\x03\a\x00\x00\x1eV" + // 0x00500307: 0x00001E56 + "\x00p\x03\a\x00\x00\x1eW" + // 0x00700307: 0x00001E57 + "\x00R\x03\a\x00\x00\x1eX" + // 0x00520307: 0x00001E58 + "\x00r\x03\a\x00\x00\x1eY" + // 0x00720307: 0x00001E59 + "\x00R\x03#\x00\x00\x1eZ" + // 0x00520323: 0x00001E5A + "\x00r\x03#\x00\x00\x1e[" + // 0x00720323: 0x00001E5B + "\x1eZ\x03\x04\x00\x00\x1e\\" + // 0x1E5A0304: 0x00001E5C + "\x1e[\x03\x04\x00\x00\x1e]" + // 0x1E5B0304: 0x00001E5D + "\x00R\x031\x00\x00\x1e^" + // 0x00520331: 0x00001E5E + "\x00r\x031\x00\x00\x1e_" + // 0x00720331: 0x00001E5F + "\x00S\x03\a\x00\x00\x1e`" + // 0x00530307: 0x00001E60 + "\x00s\x03\a\x00\x00\x1ea" + // 0x00730307: 0x00001E61 + "\x00S\x03#\x00\x00\x1eb" + // 0x00530323: 0x00001E62 + "\x00s\x03#\x00\x00\x1ec" + // 0x00730323: 0x00001E63 + "\x01Z\x03\a\x00\x00\x1ed" + // 0x015A0307: 0x00001E64 + "\x01[\x03\a\x00\x00\x1ee" + // 0x015B0307: 0x00001E65 + "\x01`\x03\a\x00\x00\x1ef" + // 0x01600307: 0x00001E66 + "\x01a\x03\a\x00\x00\x1eg" + // 0x01610307: 0x00001E67 + "\x1eb\x03\a\x00\x00\x1eh" + // 0x1E620307: 0x00001E68 + "\x1ec\x03\a\x00\x00\x1ei" + // 0x1E630307: 0x00001E69 + "\x00T\x03\a\x00\x00\x1ej" + // 0x00540307: 0x00001E6A + "\x00t\x03\a\x00\x00\x1ek" + // 0x00740307: 0x00001E6B + "\x00T\x03#\x00\x00\x1el" + // 0x00540323: 0x00001E6C + "\x00t\x03#\x00\x00\x1em" + // 0x00740323: 0x00001E6D + "\x00T\x031\x00\x00\x1en" + // 0x00540331: 0x00001E6E + "\x00t\x031\x00\x00\x1eo" + // 0x00740331: 0x00001E6F + "\x00T\x03-\x00\x00\x1ep" + // 0x0054032D: 0x00001E70 + "\x00t\x03-\x00\x00\x1eq" + // 0x0074032D: 0x00001E71 + "\x00U\x03$\x00\x00\x1er" + // 0x00550324: 0x00001E72 + "\x00u\x03$\x00\x00\x1es" + // 0x00750324: 0x00001E73 + "\x00U\x030\x00\x00\x1et" + // 0x00550330: 0x00001E74 + "\x00u\x030\x00\x00\x1eu" + // 0x00750330: 0x00001E75 + "\x00U\x03-\x00\x00\x1ev" + // 0x0055032D: 0x00001E76 + "\x00u\x03-\x00\x00\x1ew" + // 0x0075032D: 0x00001E77 + "\x01h\x03\x01\x00\x00\x1ex" + // 0x01680301: 0x00001E78 + "\x01i\x03\x01\x00\x00\x1ey" + // 0x01690301: 0x00001E79 + "\x01j\x03\b\x00\x00\x1ez" + // 0x016A0308: 0x00001E7A + "\x01k\x03\b\x00\x00\x1e{" + // 0x016B0308: 0x00001E7B + "\x00V\x03\x03\x00\x00\x1e|" + // 0x00560303: 0x00001E7C + "\x00v\x03\x03\x00\x00\x1e}" + // 0x00760303: 0x00001E7D + "\x00V\x03#\x00\x00\x1e~" + // 0x00560323: 0x00001E7E + "\x00v\x03#\x00\x00\x1e\u007f" + // 0x00760323: 0x00001E7F + "\x00W\x03\x00\x00\x00\x1e\x80" + // 0x00570300: 0x00001E80 + "\x00w\x03\x00\x00\x00\x1e\x81" + // 0x00770300: 0x00001E81 + "\x00W\x03\x01\x00\x00\x1e\x82" + // 0x00570301: 0x00001E82 + "\x00w\x03\x01\x00\x00\x1e\x83" + // 0x00770301: 0x00001E83 + "\x00W\x03\b\x00\x00\x1e\x84" + // 0x00570308: 0x00001E84 + "\x00w\x03\b\x00\x00\x1e\x85" + // 0x00770308: 0x00001E85 + "\x00W\x03\a\x00\x00\x1e\x86" + // 0x00570307: 0x00001E86 + "\x00w\x03\a\x00\x00\x1e\x87" + // 0x00770307: 0x00001E87 + "\x00W\x03#\x00\x00\x1e\x88" + // 0x00570323: 0x00001E88 + "\x00w\x03#\x00\x00\x1e\x89" + // 0x00770323: 0x00001E89 + "\x00X\x03\a\x00\x00\x1e\x8a" + // 0x00580307: 0x00001E8A + "\x00x\x03\a\x00\x00\x1e\x8b" + // 0x00780307: 0x00001E8B + "\x00X\x03\b\x00\x00\x1e\x8c" + // 0x00580308: 0x00001E8C + "\x00x\x03\b\x00\x00\x1e\x8d" + // 0x00780308: 0x00001E8D + "\x00Y\x03\a\x00\x00\x1e\x8e" + // 0x00590307: 0x00001E8E + "\x00y\x03\a\x00\x00\x1e\x8f" + // 0x00790307: 0x00001E8F + "\x00Z\x03\x02\x00\x00\x1e\x90" + // 0x005A0302: 0x00001E90 + "\x00z\x03\x02\x00\x00\x1e\x91" + // 0x007A0302: 0x00001E91 + "\x00Z\x03#\x00\x00\x1e\x92" + // 0x005A0323: 0x00001E92 + "\x00z\x03#\x00\x00\x1e\x93" + // 0x007A0323: 0x00001E93 + "\x00Z\x031\x00\x00\x1e\x94" + // 0x005A0331: 0x00001E94 + "\x00z\x031\x00\x00\x1e\x95" + // 0x007A0331: 0x00001E95 + "\x00h\x031\x00\x00\x1e\x96" + // 0x00680331: 0x00001E96 + "\x00t\x03\b\x00\x00\x1e\x97" + // 0x00740308: 0x00001E97 + "\x00w\x03\n\x00\x00\x1e\x98" + // 0x0077030A: 0x00001E98 + "\x00y\x03\n\x00\x00\x1e\x99" + // 0x0079030A: 0x00001E99 + "\x01\u007f\x03\a\x00\x00\x1e\x9b" + // 0x017F0307: 0x00001E9B + "\x00A\x03#\x00\x00\x1e\xa0" + // 0x00410323: 0x00001EA0 + "\x00a\x03#\x00\x00\x1e\xa1" + // 0x00610323: 0x00001EA1 + "\x00A\x03\t\x00\x00\x1e\xa2" + // 0x00410309: 0x00001EA2 + "\x00a\x03\t\x00\x00\x1e\xa3" + // 0x00610309: 0x00001EA3 + "\x00\xc2\x03\x01\x00\x00\x1e\xa4" + // 0x00C20301: 0x00001EA4 + "\x00\xe2\x03\x01\x00\x00\x1e\xa5" + // 0x00E20301: 0x00001EA5 + "\x00\xc2\x03\x00\x00\x00\x1e\xa6" + // 0x00C20300: 0x00001EA6 + "\x00\xe2\x03\x00\x00\x00\x1e\xa7" + // 0x00E20300: 0x00001EA7 + "\x00\xc2\x03\t\x00\x00\x1e\xa8" + // 0x00C20309: 0x00001EA8 + "\x00\xe2\x03\t\x00\x00\x1e\xa9" + // 0x00E20309: 0x00001EA9 + "\x00\xc2\x03\x03\x00\x00\x1e\xaa" + // 0x00C20303: 0x00001EAA + "\x00\xe2\x03\x03\x00\x00\x1e\xab" + // 0x00E20303: 0x00001EAB + "\x1e\xa0\x03\x02\x00\x00\x1e\xac" + // 0x1EA00302: 0x00001EAC + "\x1e\xa1\x03\x02\x00\x00\x1e\xad" + // 0x1EA10302: 0x00001EAD + "\x01\x02\x03\x01\x00\x00\x1e\xae" + // 0x01020301: 0x00001EAE + "\x01\x03\x03\x01\x00\x00\x1e\xaf" + // 0x01030301: 0x00001EAF + "\x01\x02\x03\x00\x00\x00\x1e\xb0" + // 0x01020300: 0x00001EB0 + "\x01\x03\x03\x00\x00\x00\x1e\xb1" + // 0x01030300: 0x00001EB1 + "\x01\x02\x03\t\x00\x00\x1e\xb2" + // 0x01020309: 0x00001EB2 + "\x01\x03\x03\t\x00\x00\x1e\xb3" + // 0x01030309: 0x00001EB3 + "\x01\x02\x03\x03\x00\x00\x1e\xb4" + // 0x01020303: 0x00001EB4 + "\x01\x03\x03\x03\x00\x00\x1e\xb5" + // 0x01030303: 0x00001EB5 + "\x1e\xa0\x03\x06\x00\x00\x1e\xb6" + // 0x1EA00306: 0x00001EB6 + "\x1e\xa1\x03\x06\x00\x00\x1e\xb7" + // 0x1EA10306: 0x00001EB7 + "\x00E\x03#\x00\x00\x1e\xb8" + // 0x00450323: 0x00001EB8 + "\x00e\x03#\x00\x00\x1e\xb9" + // 0x00650323: 0x00001EB9 + "\x00E\x03\t\x00\x00\x1e\xba" + // 0x00450309: 0x00001EBA + "\x00e\x03\t\x00\x00\x1e\xbb" + // 0x00650309: 0x00001EBB + "\x00E\x03\x03\x00\x00\x1e\xbc" + // 0x00450303: 0x00001EBC + "\x00e\x03\x03\x00\x00\x1e\xbd" + // 0x00650303: 0x00001EBD + "\x00\xca\x03\x01\x00\x00\x1e\xbe" + // 0x00CA0301: 0x00001EBE + "\x00\xea\x03\x01\x00\x00\x1e\xbf" + // 0x00EA0301: 0x00001EBF + "\x00\xca\x03\x00\x00\x00\x1e\xc0" + // 0x00CA0300: 0x00001EC0 + "\x00\xea\x03\x00\x00\x00\x1e\xc1" + // 0x00EA0300: 0x00001EC1 + "\x00\xca\x03\t\x00\x00\x1e\xc2" + // 0x00CA0309: 0x00001EC2 + "\x00\xea\x03\t\x00\x00\x1e\xc3" + // 0x00EA0309: 0x00001EC3 + "\x00\xca\x03\x03\x00\x00\x1e\xc4" + // 0x00CA0303: 0x00001EC4 + "\x00\xea\x03\x03\x00\x00\x1e\xc5" + // 0x00EA0303: 0x00001EC5 + "\x1e\xb8\x03\x02\x00\x00\x1e\xc6" + // 0x1EB80302: 0x00001EC6 + "\x1e\xb9\x03\x02\x00\x00\x1e\xc7" + // 0x1EB90302: 0x00001EC7 + "\x00I\x03\t\x00\x00\x1e\xc8" + // 0x00490309: 0x00001EC8 + "\x00i\x03\t\x00\x00\x1e\xc9" + // 0x00690309: 0x00001EC9 + "\x00I\x03#\x00\x00\x1e\xca" + // 0x00490323: 0x00001ECA + "\x00i\x03#\x00\x00\x1e\xcb" + // 0x00690323: 0x00001ECB + "\x00O\x03#\x00\x00\x1e\xcc" + // 0x004F0323: 0x00001ECC + "\x00o\x03#\x00\x00\x1e\xcd" + // 0x006F0323: 0x00001ECD + "\x00O\x03\t\x00\x00\x1e\xce" + // 0x004F0309: 0x00001ECE + "\x00o\x03\t\x00\x00\x1e\xcf" + // 0x006F0309: 0x00001ECF + "\x00\xd4\x03\x01\x00\x00\x1e\xd0" + // 0x00D40301: 0x00001ED0 + "\x00\xf4\x03\x01\x00\x00\x1e\xd1" + // 0x00F40301: 0x00001ED1 + "\x00\xd4\x03\x00\x00\x00\x1e\xd2" + // 0x00D40300: 0x00001ED2 + "\x00\xf4\x03\x00\x00\x00\x1e\xd3" + // 0x00F40300: 0x00001ED3 + "\x00\xd4\x03\t\x00\x00\x1e\xd4" + // 0x00D40309: 0x00001ED4 + "\x00\xf4\x03\t\x00\x00\x1e\xd5" + // 0x00F40309: 0x00001ED5 + "\x00\xd4\x03\x03\x00\x00\x1e\xd6" + // 0x00D40303: 0x00001ED6 + "\x00\xf4\x03\x03\x00\x00\x1e\xd7" + // 0x00F40303: 0x00001ED7 + "\x1e\xcc\x03\x02\x00\x00\x1e\xd8" + // 0x1ECC0302: 0x00001ED8 + "\x1e\xcd\x03\x02\x00\x00\x1e\xd9" + // 0x1ECD0302: 0x00001ED9 + "\x01\xa0\x03\x01\x00\x00\x1e\xda" + // 0x01A00301: 0x00001EDA + "\x01\xa1\x03\x01\x00\x00\x1e\xdb" + // 0x01A10301: 0x00001EDB + "\x01\xa0\x03\x00\x00\x00\x1e\xdc" + // 0x01A00300: 0x00001EDC + "\x01\xa1\x03\x00\x00\x00\x1e\xdd" + // 0x01A10300: 0x00001EDD + "\x01\xa0\x03\t\x00\x00\x1e\xde" + // 0x01A00309: 0x00001EDE + "\x01\xa1\x03\t\x00\x00\x1e\xdf" + // 0x01A10309: 0x00001EDF + "\x01\xa0\x03\x03\x00\x00\x1e\xe0" + // 0x01A00303: 0x00001EE0 + "\x01\xa1\x03\x03\x00\x00\x1e\xe1" + // 0x01A10303: 0x00001EE1 + "\x01\xa0\x03#\x00\x00\x1e\xe2" + // 0x01A00323: 0x00001EE2 + "\x01\xa1\x03#\x00\x00\x1e\xe3" + // 0x01A10323: 0x00001EE3 + "\x00U\x03#\x00\x00\x1e\xe4" + // 0x00550323: 0x00001EE4 + "\x00u\x03#\x00\x00\x1e\xe5" + // 0x00750323: 0x00001EE5 + "\x00U\x03\t\x00\x00\x1e\xe6" + // 0x00550309: 0x00001EE6 + "\x00u\x03\t\x00\x00\x1e\xe7" + // 0x00750309: 0x00001EE7 + "\x01\xaf\x03\x01\x00\x00\x1e\xe8" + // 0x01AF0301: 0x00001EE8 + "\x01\xb0\x03\x01\x00\x00\x1e\xe9" + // 0x01B00301: 0x00001EE9 + "\x01\xaf\x03\x00\x00\x00\x1e\xea" + // 0x01AF0300: 0x00001EEA + "\x01\xb0\x03\x00\x00\x00\x1e\xeb" + // 0x01B00300: 0x00001EEB + "\x01\xaf\x03\t\x00\x00\x1e\xec" + // 0x01AF0309: 0x00001EEC + "\x01\xb0\x03\t\x00\x00\x1e\xed" + // 0x01B00309: 0x00001EED + "\x01\xaf\x03\x03\x00\x00\x1e\xee" + // 0x01AF0303: 0x00001EEE + "\x01\xb0\x03\x03\x00\x00\x1e\xef" + // 0x01B00303: 0x00001EEF + "\x01\xaf\x03#\x00\x00\x1e\xf0" + // 0x01AF0323: 0x00001EF0 + "\x01\xb0\x03#\x00\x00\x1e\xf1" + // 0x01B00323: 0x00001EF1 + "\x00Y\x03\x00\x00\x00\x1e\xf2" + // 0x00590300: 0x00001EF2 + "\x00y\x03\x00\x00\x00\x1e\xf3" + // 0x00790300: 0x00001EF3 + "\x00Y\x03#\x00\x00\x1e\xf4" + // 0x00590323: 0x00001EF4 + "\x00y\x03#\x00\x00\x1e\xf5" + // 0x00790323: 0x00001EF5 + "\x00Y\x03\t\x00\x00\x1e\xf6" + // 0x00590309: 0x00001EF6 + "\x00y\x03\t\x00\x00\x1e\xf7" + // 0x00790309: 0x00001EF7 + "\x00Y\x03\x03\x00\x00\x1e\xf8" + // 0x00590303: 0x00001EF8 + "\x00y\x03\x03\x00\x00\x1e\xf9" + // 0x00790303: 0x00001EF9 + "\x03\xb1\x03\x13\x00\x00\x1f\x00" + // 0x03B10313: 0x00001F00 + "\x03\xb1\x03\x14\x00\x00\x1f\x01" + // 0x03B10314: 0x00001F01 + "\x1f\x00\x03\x00\x00\x00\x1f\x02" + // 0x1F000300: 0x00001F02 + "\x1f\x01\x03\x00\x00\x00\x1f\x03" + // 0x1F010300: 0x00001F03 + "\x1f\x00\x03\x01\x00\x00\x1f\x04" + // 0x1F000301: 0x00001F04 + "\x1f\x01\x03\x01\x00\x00\x1f\x05" + // 0x1F010301: 0x00001F05 + "\x1f\x00\x03B\x00\x00\x1f\x06" + // 0x1F000342: 0x00001F06 + "\x1f\x01\x03B\x00\x00\x1f\a" + // 0x1F010342: 0x00001F07 + "\x03\x91\x03\x13\x00\x00\x1f\b" + // 0x03910313: 0x00001F08 + "\x03\x91\x03\x14\x00\x00\x1f\t" + // 0x03910314: 0x00001F09 + "\x1f\b\x03\x00\x00\x00\x1f\n" + // 0x1F080300: 0x00001F0A + "\x1f\t\x03\x00\x00\x00\x1f\v" + // 0x1F090300: 0x00001F0B + "\x1f\b\x03\x01\x00\x00\x1f\f" + // 0x1F080301: 0x00001F0C + "\x1f\t\x03\x01\x00\x00\x1f\r" + // 0x1F090301: 0x00001F0D + "\x1f\b\x03B\x00\x00\x1f\x0e" + // 0x1F080342: 0x00001F0E + "\x1f\t\x03B\x00\x00\x1f\x0f" + // 0x1F090342: 0x00001F0F + "\x03\xb5\x03\x13\x00\x00\x1f\x10" + // 0x03B50313: 0x00001F10 + "\x03\xb5\x03\x14\x00\x00\x1f\x11" + // 0x03B50314: 0x00001F11 + "\x1f\x10\x03\x00\x00\x00\x1f\x12" + // 0x1F100300: 0x00001F12 + "\x1f\x11\x03\x00\x00\x00\x1f\x13" + // 0x1F110300: 0x00001F13 + "\x1f\x10\x03\x01\x00\x00\x1f\x14" + // 0x1F100301: 0x00001F14 + "\x1f\x11\x03\x01\x00\x00\x1f\x15" + // 0x1F110301: 0x00001F15 + "\x03\x95\x03\x13\x00\x00\x1f\x18" + // 0x03950313: 0x00001F18 + "\x03\x95\x03\x14\x00\x00\x1f\x19" + // 0x03950314: 0x00001F19 + "\x1f\x18\x03\x00\x00\x00\x1f\x1a" + // 0x1F180300: 0x00001F1A + "\x1f\x19\x03\x00\x00\x00\x1f\x1b" + // 0x1F190300: 0x00001F1B + "\x1f\x18\x03\x01\x00\x00\x1f\x1c" + // 0x1F180301: 0x00001F1C + "\x1f\x19\x03\x01\x00\x00\x1f\x1d" + // 0x1F190301: 0x00001F1D + "\x03\xb7\x03\x13\x00\x00\x1f " + // 0x03B70313: 0x00001F20 + "\x03\xb7\x03\x14\x00\x00\x1f!" + // 0x03B70314: 0x00001F21 + "\x1f \x03\x00\x00\x00\x1f\"" + // 0x1F200300: 0x00001F22 + "\x1f!\x03\x00\x00\x00\x1f#" + // 0x1F210300: 0x00001F23 + "\x1f \x03\x01\x00\x00\x1f$" + // 0x1F200301: 0x00001F24 + "\x1f!\x03\x01\x00\x00\x1f%" + // 0x1F210301: 0x00001F25 + "\x1f \x03B\x00\x00\x1f&" + // 0x1F200342: 0x00001F26 + "\x1f!\x03B\x00\x00\x1f'" + // 0x1F210342: 0x00001F27 + "\x03\x97\x03\x13\x00\x00\x1f(" + // 0x03970313: 0x00001F28 + "\x03\x97\x03\x14\x00\x00\x1f)" + // 0x03970314: 0x00001F29 + "\x1f(\x03\x00\x00\x00\x1f*" + // 0x1F280300: 0x00001F2A + "\x1f)\x03\x00\x00\x00\x1f+" + // 0x1F290300: 0x00001F2B + "\x1f(\x03\x01\x00\x00\x1f," + // 0x1F280301: 0x00001F2C + "\x1f)\x03\x01\x00\x00\x1f-" + // 0x1F290301: 0x00001F2D + "\x1f(\x03B\x00\x00\x1f." + // 0x1F280342: 0x00001F2E + "\x1f)\x03B\x00\x00\x1f/" + // 0x1F290342: 0x00001F2F + "\x03\xb9\x03\x13\x00\x00\x1f0" + // 0x03B90313: 0x00001F30 + "\x03\xb9\x03\x14\x00\x00\x1f1" + // 0x03B90314: 0x00001F31 + "\x1f0\x03\x00\x00\x00\x1f2" + // 0x1F300300: 0x00001F32 + "\x1f1\x03\x00\x00\x00\x1f3" + // 0x1F310300: 0x00001F33 + "\x1f0\x03\x01\x00\x00\x1f4" + // 0x1F300301: 0x00001F34 + "\x1f1\x03\x01\x00\x00\x1f5" + // 0x1F310301: 0x00001F35 + "\x1f0\x03B\x00\x00\x1f6" + // 0x1F300342: 0x00001F36 + "\x1f1\x03B\x00\x00\x1f7" + // 0x1F310342: 0x00001F37 + "\x03\x99\x03\x13\x00\x00\x1f8" + // 0x03990313: 0x00001F38 + "\x03\x99\x03\x14\x00\x00\x1f9" + // 0x03990314: 0x00001F39 + "\x1f8\x03\x00\x00\x00\x1f:" + // 0x1F380300: 0x00001F3A + "\x1f9\x03\x00\x00\x00\x1f;" + // 0x1F390300: 0x00001F3B + "\x1f8\x03\x01\x00\x00\x1f<" + // 0x1F380301: 0x00001F3C + "\x1f9\x03\x01\x00\x00\x1f=" + // 0x1F390301: 0x00001F3D + "\x1f8\x03B\x00\x00\x1f>" + // 0x1F380342: 0x00001F3E + "\x1f9\x03B\x00\x00\x1f?" + // 0x1F390342: 0x00001F3F + "\x03\xbf\x03\x13\x00\x00\x1f@" + // 0x03BF0313: 0x00001F40 + "\x03\xbf\x03\x14\x00\x00\x1fA" + // 0x03BF0314: 0x00001F41 + "\x1f@\x03\x00\x00\x00\x1fB" + // 0x1F400300: 0x00001F42 + "\x1fA\x03\x00\x00\x00\x1fC" + // 0x1F410300: 0x00001F43 + "\x1f@\x03\x01\x00\x00\x1fD" + // 0x1F400301: 0x00001F44 + "\x1fA\x03\x01\x00\x00\x1fE" + // 0x1F410301: 0x00001F45 + "\x03\x9f\x03\x13\x00\x00\x1fH" + // 0x039F0313: 0x00001F48 + "\x03\x9f\x03\x14\x00\x00\x1fI" + // 0x039F0314: 0x00001F49 + "\x1fH\x03\x00\x00\x00\x1fJ" + // 0x1F480300: 0x00001F4A + "\x1fI\x03\x00\x00\x00\x1fK" + // 0x1F490300: 0x00001F4B + "\x1fH\x03\x01\x00\x00\x1fL" + // 0x1F480301: 0x00001F4C + "\x1fI\x03\x01\x00\x00\x1fM" + // 0x1F490301: 0x00001F4D + "\x03\xc5\x03\x13\x00\x00\x1fP" + // 0x03C50313: 0x00001F50 + "\x03\xc5\x03\x14\x00\x00\x1fQ" + // 0x03C50314: 0x00001F51 + "\x1fP\x03\x00\x00\x00\x1fR" + // 0x1F500300: 0x00001F52 + "\x1fQ\x03\x00\x00\x00\x1fS" + // 0x1F510300: 0x00001F53 + "\x1fP\x03\x01\x00\x00\x1fT" + // 0x1F500301: 0x00001F54 + "\x1fQ\x03\x01\x00\x00\x1fU" + // 0x1F510301: 0x00001F55 + "\x1fP\x03B\x00\x00\x1fV" + // 0x1F500342: 0x00001F56 + "\x1fQ\x03B\x00\x00\x1fW" + // 0x1F510342: 0x00001F57 + "\x03\xa5\x03\x14\x00\x00\x1fY" + // 0x03A50314: 0x00001F59 + "\x1fY\x03\x00\x00\x00\x1f[" + // 0x1F590300: 0x00001F5B + "\x1fY\x03\x01\x00\x00\x1f]" + // 0x1F590301: 0x00001F5D + "\x1fY\x03B\x00\x00\x1f_" + // 0x1F590342: 0x00001F5F + "\x03\xc9\x03\x13\x00\x00\x1f`" + // 0x03C90313: 0x00001F60 + "\x03\xc9\x03\x14\x00\x00\x1fa" + // 0x03C90314: 0x00001F61 + "\x1f`\x03\x00\x00\x00\x1fb" + // 0x1F600300: 0x00001F62 + "\x1fa\x03\x00\x00\x00\x1fc" + // 0x1F610300: 0x00001F63 + "\x1f`\x03\x01\x00\x00\x1fd" + // 0x1F600301: 0x00001F64 + "\x1fa\x03\x01\x00\x00\x1fe" + // 0x1F610301: 0x00001F65 + "\x1f`\x03B\x00\x00\x1ff" + // 0x1F600342: 0x00001F66 + "\x1fa\x03B\x00\x00\x1fg" + // 0x1F610342: 0x00001F67 + "\x03\xa9\x03\x13\x00\x00\x1fh" + // 0x03A90313: 0x00001F68 + "\x03\xa9\x03\x14\x00\x00\x1fi" + // 0x03A90314: 0x00001F69 + "\x1fh\x03\x00\x00\x00\x1fj" + // 0x1F680300: 0x00001F6A + "\x1fi\x03\x00\x00\x00\x1fk" + // 0x1F690300: 0x00001F6B + "\x1fh\x03\x01\x00\x00\x1fl" + // 0x1F680301: 0x00001F6C + "\x1fi\x03\x01\x00\x00\x1fm" + // 0x1F690301: 0x00001F6D + "\x1fh\x03B\x00\x00\x1fn" + // 0x1F680342: 0x00001F6E + "\x1fi\x03B\x00\x00\x1fo" + // 0x1F690342: 0x00001F6F + "\x03\xb1\x03\x00\x00\x00\x1fp" + // 0x03B10300: 0x00001F70 + "\x03\xb5\x03\x00\x00\x00\x1fr" + // 0x03B50300: 0x00001F72 + "\x03\xb7\x03\x00\x00\x00\x1ft" + // 0x03B70300: 0x00001F74 + "\x03\xb9\x03\x00\x00\x00\x1fv" + // 0x03B90300: 0x00001F76 + "\x03\xbf\x03\x00\x00\x00\x1fx" + // 0x03BF0300: 0x00001F78 + "\x03\xc5\x03\x00\x00\x00\x1fz" + // 0x03C50300: 0x00001F7A + "\x03\xc9\x03\x00\x00\x00\x1f|" + // 0x03C90300: 0x00001F7C + "\x1f\x00\x03E\x00\x00\x1f\x80" + // 0x1F000345: 0x00001F80 + "\x1f\x01\x03E\x00\x00\x1f\x81" + // 0x1F010345: 0x00001F81 + "\x1f\x02\x03E\x00\x00\x1f\x82" + // 0x1F020345: 0x00001F82 + "\x1f\x03\x03E\x00\x00\x1f\x83" + // 0x1F030345: 0x00001F83 + "\x1f\x04\x03E\x00\x00\x1f\x84" + // 0x1F040345: 0x00001F84 + "\x1f\x05\x03E\x00\x00\x1f\x85" + // 0x1F050345: 0x00001F85 + "\x1f\x06\x03E\x00\x00\x1f\x86" + // 0x1F060345: 0x00001F86 + "\x1f\a\x03E\x00\x00\x1f\x87" + // 0x1F070345: 0x00001F87 + "\x1f\b\x03E\x00\x00\x1f\x88" + // 0x1F080345: 0x00001F88 + "\x1f\t\x03E\x00\x00\x1f\x89" + // 0x1F090345: 0x00001F89 + "\x1f\n\x03E\x00\x00\x1f\x8a" + // 0x1F0A0345: 0x00001F8A + "\x1f\v\x03E\x00\x00\x1f\x8b" + // 0x1F0B0345: 0x00001F8B + "\x1f\f\x03E\x00\x00\x1f\x8c" + // 0x1F0C0345: 0x00001F8C + "\x1f\r\x03E\x00\x00\x1f\x8d" + // 0x1F0D0345: 0x00001F8D + "\x1f\x0e\x03E\x00\x00\x1f\x8e" + // 0x1F0E0345: 0x00001F8E + "\x1f\x0f\x03E\x00\x00\x1f\x8f" + // 0x1F0F0345: 0x00001F8F + "\x1f \x03E\x00\x00\x1f\x90" + // 0x1F200345: 0x00001F90 + "\x1f!\x03E\x00\x00\x1f\x91" + // 0x1F210345: 0x00001F91 + "\x1f\"\x03E\x00\x00\x1f\x92" + // 0x1F220345: 0x00001F92 + "\x1f#\x03E\x00\x00\x1f\x93" + // 0x1F230345: 0x00001F93 + "\x1f$\x03E\x00\x00\x1f\x94" + // 0x1F240345: 0x00001F94 + "\x1f%\x03E\x00\x00\x1f\x95" + // 0x1F250345: 0x00001F95 + "\x1f&\x03E\x00\x00\x1f\x96" + // 0x1F260345: 0x00001F96 + "\x1f'\x03E\x00\x00\x1f\x97" + // 0x1F270345: 0x00001F97 + "\x1f(\x03E\x00\x00\x1f\x98" + // 0x1F280345: 0x00001F98 + "\x1f)\x03E\x00\x00\x1f\x99" + // 0x1F290345: 0x00001F99 + "\x1f*\x03E\x00\x00\x1f\x9a" + // 0x1F2A0345: 0x00001F9A + "\x1f+\x03E\x00\x00\x1f\x9b" + // 0x1F2B0345: 0x00001F9B + "\x1f,\x03E\x00\x00\x1f\x9c" + // 0x1F2C0345: 0x00001F9C + "\x1f-\x03E\x00\x00\x1f\x9d" + // 0x1F2D0345: 0x00001F9D + "\x1f.\x03E\x00\x00\x1f\x9e" + // 0x1F2E0345: 0x00001F9E + "\x1f/\x03E\x00\x00\x1f\x9f" + // 0x1F2F0345: 0x00001F9F + "\x1f`\x03E\x00\x00\x1f\xa0" + // 0x1F600345: 0x00001FA0 + "\x1fa\x03E\x00\x00\x1f\xa1" + // 0x1F610345: 0x00001FA1 + "\x1fb\x03E\x00\x00\x1f\xa2" + // 0x1F620345: 0x00001FA2 + "\x1fc\x03E\x00\x00\x1f\xa3" + // 0x1F630345: 0x00001FA3 + "\x1fd\x03E\x00\x00\x1f\xa4" + // 0x1F640345: 0x00001FA4 + "\x1fe\x03E\x00\x00\x1f\xa5" + // 0x1F650345: 0x00001FA5 + "\x1ff\x03E\x00\x00\x1f\xa6" + // 0x1F660345: 0x00001FA6 + "\x1fg\x03E\x00\x00\x1f\xa7" + // 0x1F670345: 0x00001FA7 + "\x1fh\x03E\x00\x00\x1f\xa8" + // 0x1F680345: 0x00001FA8 + "\x1fi\x03E\x00\x00\x1f\xa9" + // 0x1F690345: 0x00001FA9 + "\x1fj\x03E\x00\x00\x1f\xaa" + // 0x1F6A0345: 0x00001FAA + "\x1fk\x03E\x00\x00\x1f\xab" + // 0x1F6B0345: 0x00001FAB + "\x1fl\x03E\x00\x00\x1f\xac" + // 0x1F6C0345: 0x00001FAC + "\x1fm\x03E\x00\x00\x1f\xad" + // 0x1F6D0345: 0x00001FAD + "\x1fn\x03E\x00\x00\x1f\xae" + // 0x1F6E0345: 0x00001FAE + "\x1fo\x03E\x00\x00\x1f\xaf" + // 0x1F6F0345: 0x00001FAF + "\x03\xb1\x03\x06\x00\x00\x1f\xb0" + // 0x03B10306: 0x00001FB0 + "\x03\xb1\x03\x04\x00\x00\x1f\xb1" + // 0x03B10304: 0x00001FB1 + "\x1fp\x03E\x00\x00\x1f\xb2" + // 0x1F700345: 0x00001FB2 + "\x03\xb1\x03E\x00\x00\x1f\xb3" + // 0x03B10345: 0x00001FB3 + "\x03\xac\x03E\x00\x00\x1f\xb4" + // 0x03AC0345: 0x00001FB4 + "\x03\xb1\x03B\x00\x00\x1f\xb6" + // 0x03B10342: 0x00001FB6 + "\x1f\xb6\x03E\x00\x00\x1f\xb7" + // 0x1FB60345: 0x00001FB7 + "\x03\x91\x03\x06\x00\x00\x1f\xb8" + // 0x03910306: 0x00001FB8 + "\x03\x91\x03\x04\x00\x00\x1f\xb9" + // 0x03910304: 0x00001FB9 + "\x03\x91\x03\x00\x00\x00\x1f\xba" + // 0x03910300: 0x00001FBA + "\x03\x91\x03E\x00\x00\x1f\xbc" + // 0x03910345: 0x00001FBC + "\x00\xa8\x03B\x00\x00\x1f\xc1" + // 0x00A80342: 0x00001FC1 + "\x1ft\x03E\x00\x00\x1f\xc2" + // 0x1F740345: 0x00001FC2 + "\x03\xb7\x03E\x00\x00\x1f\xc3" + // 0x03B70345: 0x00001FC3 + "\x03\xae\x03E\x00\x00\x1f\xc4" + // 0x03AE0345: 0x00001FC4 + "\x03\xb7\x03B\x00\x00\x1f\xc6" + // 0x03B70342: 0x00001FC6 + "\x1f\xc6\x03E\x00\x00\x1f\xc7" + // 0x1FC60345: 0x00001FC7 + "\x03\x95\x03\x00\x00\x00\x1f\xc8" + // 0x03950300: 0x00001FC8 + "\x03\x97\x03\x00\x00\x00\x1f\xca" + // 0x03970300: 0x00001FCA + "\x03\x97\x03E\x00\x00\x1f\xcc" + // 0x03970345: 0x00001FCC + "\x1f\xbf\x03\x00\x00\x00\x1f\xcd" + // 0x1FBF0300: 0x00001FCD + "\x1f\xbf\x03\x01\x00\x00\x1f\xce" + // 0x1FBF0301: 0x00001FCE + "\x1f\xbf\x03B\x00\x00\x1f\xcf" + // 0x1FBF0342: 0x00001FCF + "\x03\xb9\x03\x06\x00\x00\x1f\xd0" + // 0x03B90306: 0x00001FD0 + "\x03\xb9\x03\x04\x00\x00\x1f\xd1" + // 0x03B90304: 0x00001FD1 + "\x03\xca\x03\x00\x00\x00\x1f\xd2" + // 0x03CA0300: 0x00001FD2 + "\x03\xb9\x03B\x00\x00\x1f\xd6" + // 0x03B90342: 0x00001FD6 + "\x03\xca\x03B\x00\x00\x1f\xd7" + // 0x03CA0342: 0x00001FD7 + "\x03\x99\x03\x06\x00\x00\x1f\xd8" + // 0x03990306: 0x00001FD8 + "\x03\x99\x03\x04\x00\x00\x1f\xd9" + // 0x03990304: 0x00001FD9 + "\x03\x99\x03\x00\x00\x00\x1f\xda" + // 0x03990300: 0x00001FDA + "\x1f\xfe\x03\x00\x00\x00\x1f\xdd" + // 0x1FFE0300: 0x00001FDD + "\x1f\xfe\x03\x01\x00\x00\x1f\xde" + // 0x1FFE0301: 0x00001FDE + "\x1f\xfe\x03B\x00\x00\x1f\xdf" + // 0x1FFE0342: 0x00001FDF + "\x03\xc5\x03\x06\x00\x00\x1f\xe0" + // 0x03C50306: 0x00001FE0 + "\x03\xc5\x03\x04\x00\x00\x1f\xe1" + // 0x03C50304: 0x00001FE1 + "\x03\xcb\x03\x00\x00\x00\x1f\xe2" + // 0x03CB0300: 0x00001FE2 + "\x03\xc1\x03\x13\x00\x00\x1f\xe4" + // 0x03C10313: 0x00001FE4 + "\x03\xc1\x03\x14\x00\x00\x1f\xe5" + // 0x03C10314: 0x00001FE5 + "\x03\xc5\x03B\x00\x00\x1f\xe6" + // 0x03C50342: 0x00001FE6 + "\x03\xcb\x03B\x00\x00\x1f\xe7" + // 0x03CB0342: 0x00001FE7 + "\x03\xa5\x03\x06\x00\x00\x1f\xe8" + // 0x03A50306: 0x00001FE8 + "\x03\xa5\x03\x04\x00\x00\x1f\xe9" + // 0x03A50304: 0x00001FE9 + "\x03\xa5\x03\x00\x00\x00\x1f\xea" + // 0x03A50300: 0x00001FEA + "\x03\xa1\x03\x14\x00\x00\x1f\xec" + // 0x03A10314: 0x00001FEC + "\x00\xa8\x03\x00\x00\x00\x1f\xed" + // 0x00A80300: 0x00001FED + "\x1f|\x03E\x00\x00\x1f\xf2" + // 0x1F7C0345: 0x00001FF2 + "\x03\xc9\x03E\x00\x00\x1f\xf3" + // 0x03C90345: 0x00001FF3 + "\x03\xce\x03E\x00\x00\x1f\xf4" + // 0x03CE0345: 0x00001FF4 + "\x03\xc9\x03B\x00\x00\x1f\xf6" + // 0x03C90342: 0x00001FF6 + "\x1f\xf6\x03E\x00\x00\x1f\xf7" + // 0x1FF60345: 0x00001FF7 + "\x03\x9f\x03\x00\x00\x00\x1f\xf8" + // 0x039F0300: 0x00001FF8 + "\x03\xa9\x03\x00\x00\x00\x1f\xfa" + // 0x03A90300: 0x00001FFA + "\x03\xa9\x03E\x00\x00\x1f\xfc" + // 0x03A90345: 0x00001FFC + "!\x90\x038\x00\x00!\x9a" + // 0x21900338: 0x0000219A + "!\x92\x038\x00\x00!\x9b" + // 0x21920338: 0x0000219B + "!\x94\x038\x00\x00!\xae" + // 0x21940338: 0x000021AE + "!\xd0\x038\x00\x00!\xcd" + // 0x21D00338: 0x000021CD + "!\xd4\x038\x00\x00!\xce" + // 0x21D40338: 0x000021CE + "!\xd2\x038\x00\x00!\xcf" + // 0x21D20338: 0x000021CF + "\"\x03\x038\x00\x00\"\x04" + // 0x22030338: 0x00002204 + "\"\b\x038\x00\x00\"\t" + // 0x22080338: 0x00002209 + "\"\v\x038\x00\x00\"\f" + // 0x220B0338: 0x0000220C + "\"#\x038\x00\x00\"$" + // 0x22230338: 0x00002224 + "\"%\x038\x00\x00\"&" + // 0x22250338: 0x00002226 + "\"<\x038\x00\x00\"A" + // 0x223C0338: 0x00002241 + "\"C\x038\x00\x00\"D" + // 0x22430338: 0x00002244 + "\"E\x038\x00\x00\"G" + // 0x22450338: 0x00002247 + "\"H\x038\x00\x00\"I" + // 0x22480338: 0x00002249 + "\x00=\x038\x00\x00\"`" + // 0x003D0338: 0x00002260 + "\"a\x038\x00\x00\"b" + // 0x22610338: 0x00002262 + "\"M\x038\x00\x00\"m" + // 0x224D0338: 0x0000226D + "\x00<\x038\x00\x00\"n" + // 0x003C0338: 0x0000226E + "\x00>\x038\x00\x00\"o" + // 0x003E0338: 0x0000226F + "\"d\x038\x00\x00\"p" + // 0x22640338: 0x00002270 + "\"e\x038\x00\x00\"q" + // 0x22650338: 0x00002271 + "\"r\x038\x00\x00\"t" + // 0x22720338: 0x00002274 + "\"s\x038\x00\x00\"u" + // 0x22730338: 0x00002275 + "\"v\x038\x00\x00\"x" + // 0x22760338: 0x00002278 + "\"w\x038\x00\x00\"y" + // 0x22770338: 0x00002279 + "\"z\x038\x00\x00\"\x80" + // 0x227A0338: 0x00002280 + "\"{\x038\x00\x00\"\x81" + // 0x227B0338: 0x00002281 + "\"\x82\x038\x00\x00\"\x84" + // 0x22820338: 0x00002284 + "\"\x83\x038\x00\x00\"\x85" + // 0x22830338: 0x00002285 + "\"\x86\x038\x00\x00\"\x88" + // 0x22860338: 0x00002288 + "\"\x87\x038\x00\x00\"\x89" + // 0x22870338: 0x00002289 + "\"\xa2\x038\x00\x00\"\xac" + // 0x22A20338: 0x000022AC + "\"\xa8\x038\x00\x00\"\xad" + // 0x22A80338: 0x000022AD + "\"\xa9\x038\x00\x00\"\xae" + // 0x22A90338: 0x000022AE + "\"\xab\x038\x00\x00\"\xaf" + // 0x22AB0338: 0x000022AF + "\"|\x038\x00\x00\"\xe0" + // 0x227C0338: 0x000022E0 + "\"}\x038\x00\x00\"\xe1" + // 0x227D0338: 0x000022E1 + "\"\x91\x038\x00\x00\"\xe2" + // 0x22910338: 0x000022E2 + "\"\x92\x038\x00\x00\"\xe3" + // 0x22920338: 0x000022E3 + "\"\xb2\x038\x00\x00\"\xea" + // 0x22B20338: 0x000022EA + "\"\xb3\x038\x00\x00\"\xeb" + // 0x22B30338: 0x000022EB + "\"\xb4\x038\x00\x00\"\xec" + // 0x22B40338: 0x000022EC + "\"\xb5\x038\x00\x00\"\xed" + // 0x22B50338: 0x000022ED + "0K0\x99\x00\x000L" + // 0x304B3099: 0x0000304C + "0M0\x99\x00\x000N" + // 0x304D3099: 0x0000304E + "0O0\x99\x00\x000P" + // 0x304F3099: 0x00003050 + "0Q0\x99\x00\x000R" + // 0x30513099: 0x00003052 + "0S0\x99\x00\x000T" + // 0x30533099: 0x00003054 + "0U0\x99\x00\x000V" + // 0x30553099: 0x00003056 + "0W0\x99\x00\x000X" + // 0x30573099: 0x00003058 + "0Y0\x99\x00\x000Z" + // 0x30593099: 0x0000305A + "0[0\x99\x00\x000\\" + // 0x305B3099: 0x0000305C + "0]0\x99\x00\x000^" + // 0x305D3099: 0x0000305E + "0_0\x99\x00\x000`" + // 0x305F3099: 0x00003060 + "0a0\x99\x00\x000b" + // 0x30613099: 0x00003062 + "0d0\x99\x00\x000e" + // 0x30643099: 0x00003065 + "0f0\x99\x00\x000g" + // 0x30663099: 0x00003067 + "0h0\x99\x00\x000i" + // 0x30683099: 0x00003069 + "0o0\x99\x00\x000p" + // 0x306F3099: 0x00003070 + "0o0\x9a\x00\x000q" + // 0x306F309A: 0x00003071 + "0r0\x99\x00\x000s" + // 0x30723099: 0x00003073 + "0r0\x9a\x00\x000t" + // 0x3072309A: 0x00003074 + "0u0\x99\x00\x000v" + // 0x30753099: 0x00003076 + "0u0\x9a\x00\x000w" + // 0x3075309A: 0x00003077 + "0x0\x99\x00\x000y" + // 0x30783099: 0x00003079 + "0x0\x9a\x00\x000z" + // 0x3078309A: 0x0000307A + "0{0\x99\x00\x000|" + // 0x307B3099: 0x0000307C + "0{0\x9a\x00\x000}" + // 0x307B309A: 0x0000307D + "0F0\x99\x00\x000\x94" + // 0x30463099: 0x00003094 + "0\x9d0\x99\x00\x000\x9e" + // 0x309D3099: 0x0000309E + "0\xab0\x99\x00\x000\xac" + // 0x30AB3099: 0x000030AC + "0\xad0\x99\x00\x000\xae" + // 0x30AD3099: 0x000030AE + "0\xaf0\x99\x00\x000\xb0" + // 0x30AF3099: 0x000030B0 + "0\xb10\x99\x00\x000\xb2" + // 0x30B13099: 0x000030B2 + "0\xb30\x99\x00\x000\xb4" + // 0x30B33099: 0x000030B4 + "0\xb50\x99\x00\x000\xb6" + // 0x30B53099: 0x000030B6 + "0\xb70\x99\x00\x000\xb8" + // 0x30B73099: 0x000030B8 + "0\xb90\x99\x00\x000\xba" + // 0x30B93099: 0x000030BA + "0\xbb0\x99\x00\x000\xbc" + // 0x30BB3099: 0x000030BC + "0\xbd0\x99\x00\x000\xbe" + // 0x30BD3099: 0x000030BE + "0\xbf0\x99\x00\x000\xc0" + // 0x30BF3099: 0x000030C0 + "0\xc10\x99\x00\x000\xc2" + // 0x30C13099: 0x000030C2 + "0\xc40\x99\x00\x000\xc5" + // 0x30C43099: 0x000030C5 + "0\xc60\x99\x00\x000\xc7" + // 0x30C63099: 0x000030C7 + "0\xc80\x99\x00\x000\xc9" + // 0x30C83099: 0x000030C9 + "0\xcf0\x99\x00\x000\xd0" + // 0x30CF3099: 0x000030D0 + "0\xcf0\x9a\x00\x000\xd1" + // 0x30CF309A: 0x000030D1 + "0\xd20\x99\x00\x000\xd3" + // 0x30D23099: 0x000030D3 + "0\xd20\x9a\x00\x000\xd4" + // 0x30D2309A: 0x000030D4 + "0\xd50\x99\x00\x000\xd6" + // 0x30D53099: 0x000030D6 + "0\xd50\x9a\x00\x000\xd7" + // 0x30D5309A: 0x000030D7 + "0\xd80\x99\x00\x000\xd9" + // 0x30D83099: 0x000030D9 + "0\xd80\x9a\x00\x000\xda" + // 0x30D8309A: 0x000030DA + "0\xdb0\x99\x00\x000\xdc" + // 0x30DB3099: 0x000030DC + "0\xdb0\x9a\x00\x000\xdd" + // 0x30DB309A: 0x000030DD + "0\xa60\x99\x00\x000\xf4" + // 0x30A63099: 0x000030F4 + "0\xef0\x99\x00\x000\xf7" + // 0x30EF3099: 0x000030F7 + "0\xf00\x99\x00\x000\xf8" + // 0x30F03099: 0x000030F8 + "0\xf10\x99\x00\x000\xf9" + // 0x30F13099: 0x000030F9 + "0\xf20\x99\x00\x000\xfa" + // 0x30F23099: 0x000030FA + "0\xfd0\x99\x00\x000\xfe" + // 0x30FD3099: 0x000030FE + "\x10\x99\x10\xba\x00\x01\x10\x9a" + // 0x109910BA: 0x0001109A + "\x10\x9b\x10\xba\x00\x01\x10\x9c" + // 0x109B10BA: 0x0001109C + "\x10\xa5\x10\xba\x00\x01\x10\xab" + // 0x10A510BA: 0x000110AB + "\x111\x11'\x00\x01\x11." + // 0x11311127: 0x0001112E + "\x112\x11'\x00\x01\x11/" + // 0x11321127: 0x0001112F + "\x13G\x13>\x00\x01\x13K" + // 0x1347133E: 0x0001134B + "\x13G\x13W\x00\x01\x13L" + // 0x13471357: 0x0001134C + "\x14\xb9\x14\xba\x00\x01\x14\xbb" + // 0x14B914BA: 0x000114BB + "\x14\xb9\x14\xb0\x00\x01\x14\xbc" + // 0x14B914B0: 0x000114BC + "\x14\xb9\x14\xbd\x00\x01\x14\xbe" + // 0x14B914BD: 0x000114BE + "\x15\xb8\x15\xaf\x00\x01\x15\xba" + // 0x15B815AF: 0x000115BA + "\x15\xb9\x15\xaf\x00\x01\x15\xbb" + // 0x15B915AF: 0x000115BB + "" + // Total size of tables: 53KB (54006 bytes) diff --git a/vendor/golang.org/x/text/unicode/norm/transform.go b/vendor/golang.org/x/text/unicode/norm/transform.go index 9f47efba..a1d366ae 100644 --- a/vendor/golang.org/x/text/unicode/norm/transform.go +++ b/vendor/golang.org/x/text/unicode/norm/transform.go @@ -18,7 +18,6 @@ func (Form) Reset() {} // Users should either catch ErrShortDst and allow dst to grow or have dst be at // least of size MaxTransformChunkSize to be guaranteed of progress. func (f Form) Transform(dst, src []byte, atEOF bool) (nDst, nSrc int, err error) { - n := 0 // Cap the maximum number of src bytes to check. b := src eof := atEOF @@ -27,13 +26,14 @@ func (f Form) Transform(dst, src []byte, atEOF bool) (nDst, nSrc int, err error) eof = false b = b[:ns] } - i, ok := formTable[f].quickSpan(inputBytes(b), n, len(b), eof) - n += copy(dst[n:], b[n:i]) + i, ok := formTable[f].quickSpan(inputBytes(b), 0, len(b), eof) + n := copy(dst, b[:i]) if !ok { nDst, nSrc, err = f.transform(dst[n:], src[n:], atEOF) return nDst + n, nSrc + n, err } - if n < len(src) && !atEOF { + + if err == nil && n < len(src) && !atEOF { err = transform.ErrShortSrc } return n, n, err @@ -79,7 +79,7 @@ func (f Form) transform(dst, src []byte, atEOF bool) (nDst, nSrc int, err error) nSrc += n nDst += n if ok { - if n < rb.nsrc && !atEOF { + if err == nil && n < rb.nsrc && !atEOF { err = transform.ErrShortSrc } return nDst, nSrc, err diff --git a/vendor/google.golang.org/appengine/.travis.yml b/vendor/google.golang.org/appengine/.travis.yml index 7ef8b6c7..70ffe89d 100644 --- a/vendor/google.golang.org/appengine/.travis.yml +++ b/vendor/google.golang.org/appengine/.travis.yml @@ -1,24 +1,20 @@ language: go -go: - - 1.6.x - - 1.7.x - - 1.8.x - - 1.9.x - go_import_path: google.golang.org/appengine install: - - go get -u -v $(go list -f '{{join .Imports "\n"}}{{"\n"}}{{join .TestImports "\n"}}' ./... | sort | uniq | grep -v appengine) - - mkdir /tmp/sdk - - curl -o /tmp/sdk.zip "https://storage.googleapis.com/appengine-sdks/featured/go_appengine_sdk_linux_amd64-1.9.40.zip" - - unzip -q /tmp/sdk.zip -d /tmp/sdk - - export PATH="$PATH:/tmp/sdk/go_appengine" - - export APPENGINE_DEV_APPSERVER=/tmp/sdk/go_appengine/dev_appserver.py + - ./travis_install.sh script: - - goapp version - - go version - - go test -v google.golang.org/appengine/... - - go test -v -race google.golang.org/appengine/... - - goapp test -v google.golang.org/appengine/... + - ./travis_test.sh + +matrix: + include: + - go: 1.8.x + env: GOAPP=true + - go: 1.9.x + env: GOAPP=true + - go: 1.10.x + env: GOAPP=false + - go: 1.11.x + env: GO111MODULE=on diff --git a/vendor/google.golang.org/appengine/appengine.go b/vendor/google.golang.org/appengine/appengine.go index 76dedc81..0cca033d 100644 --- a/vendor/google.golang.org/appengine/appengine.go +++ b/vendor/google.golang.org/appengine/appengine.go @@ -60,6 +60,30 @@ func IsDevAppServer() bool { return internal.IsDevAppServer() } +// IsStandard reports whether the App Engine app is running in the standard +// environment. This includes both the first generation runtimes (<= Go 1.9) +// and the second generation runtimes (>= Go 1.11). +func IsStandard() bool { + return internal.IsStandard() +} + +// IsFlex reports whether the App Engine app is running in the flexible environment. +func IsFlex() bool { + return internal.IsFlex() +} + +// IsAppEngine reports whether the App Engine app is running on App Engine, in either +// the standard or flexible environment. +func IsAppEngine() bool { + return internal.IsAppEngine() +} + +// IsSecondGen reports whether the App Engine app is running on the second generation +// runtimes (>= Go 1.11). +func IsSecondGen() bool { + return internal.IsSecondGen() +} + // NewContext returns a context for an in-flight HTTP request. // This function is cheap. func NewContext(req *http.Request) context.Context { diff --git a/vendor/google.golang.org/appengine/go.mod b/vendor/google.golang.org/appengine/go.mod new file mode 100644 index 00000000..f449359d --- /dev/null +++ b/vendor/google.golang.org/appengine/go.mod @@ -0,0 +1,7 @@ +module google.golang.org/appengine + +require ( + github.com/golang/protobuf v1.2.0 + golang.org/x/net v0.0.0-20180724234803-3673e40ba225 + golang.org/x/text v0.3.0 +) diff --git a/vendor/google.golang.org/appengine/go.sum b/vendor/google.golang.org/appengine/go.sum new file mode 100644 index 00000000..1a221c08 --- /dev/null +++ b/vendor/google.golang.org/appengine/go.sum @@ -0,0 +1,6 @@ +github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= +github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225 h1:kNX+jCowfMYzvlSvJu5pQWEmyWFrBXJ3PBy10xKMXK8= +golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= +golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= diff --git a/vendor/google.golang.org/appengine/internal/api.go b/vendor/google.golang.org/appengine/internal/api.go index 16f87c5d..bbc1cb9c 100644 --- a/vendor/google.golang.org/appengine/internal/api.go +++ b/vendor/google.golang.org/appengine/internal/api.go @@ -3,7 +3,6 @@ // license that can be found in the LICENSE file. // +build !appengine -// +build go1.7 package internal @@ -130,7 +129,13 @@ func handleHTTP(w http.ResponseWriter, r *http.Request) { flushes++ } c.pendingLogs.Unlock() - go c.flushLog(false) + flushed := make(chan struct{}) + go func() { + defer close(flushed) + // Force a log flush, because with very short requests we + // may not ever flush logs. + c.flushLog(true) + }() w.Header().Set(logFlushHeader, strconv.Itoa(flushes)) // Avoid nil Write call if c.Write is never called. @@ -140,6 +145,9 @@ func handleHTTP(w http.ResponseWriter, r *http.Request) { if c.outBody != nil { w.Write(c.outBody) } + // Wait for the last flush to complete before returning, + // otherwise the security ticket will not be valid. + <-flushed } func executeRequestSafely(c *context, r *http.Request) { @@ -571,7 +579,10 @@ func logf(c *context, level int64, format string, args ...interface{}) { Level: &level, Message: &s, }) - log.Print(logLevelName[level] + ": " + s) + // Only duplicate log to stderr if not running on App Engine second generation + if !IsSecondGen() { + log.Print(logLevelName[level] + ": " + s) + } } // flushLog attempts to flush any pending logs to the appserver. diff --git a/vendor/google.golang.org/appengine/internal/api_pre17.go b/vendor/google.golang.org/appengine/internal/api_pre17.go deleted file mode 100644 index 028b4f05..00000000 --- a/vendor/google.golang.org/appengine/internal/api_pre17.go +++ /dev/null @@ -1,682 +0,0 @@ -// Copyright 2011 Google Inc. All rights reserved. -// Use of this source code is governed by the Apache 2.0 -// license that can be found in the LICENSE file. - -// +build !appengine -// +build !go1.7 - -package internal - -import ( - "bytes" - "errors" - "fmt" - "io/ioutil" - "log" - "net" - "net/http" - "net/url" - "os" - "runtime" - "strconv" - "strings" - "sync" - "sync/atomic" - "time" - - "github.com/golang/protobuf/proto" - netcontext "golang.org/x/net/context" - - basepb "google.golang.org/appengine/internal/base" - logpb "google.golang.org/appengine/internal/log" - remotepb "google.golang.org/appengine/internal/remote_api" -) - -const ( - apiPath = "/rpc_http" - defaultTicketSuffix = "/default.20150612t184001.0" -) - -var ( - // Incoming headers. - ticketHeader = http.CanonicalHeaderKey("X-AppEngine-API-Ticket") - dapperHeader = http.CanonicalHeaderKey("X-Google-DapperTraceInfo") - traceHeader = http.CanonicalHeaderKey("X-Cloud-Trace-Context") - curNamespaceHeader = http.CanonicalHeaderKey("X-AppEngine-Current-Namespace") - userIPHeader = http.CanonicalHeaderKey("X-AppEngine-User-IP") - remoteAddrHeader = http.CanonicalHeaderKey("X-AppEngine-Remote-Addr") - - // Outgoing headers. - apiEndpointHeader = http.CanonicalHeaderKey("X-Google-RPC-Service-Endpoint") - apiEndpointHeaderValue = []string{"app-engine-apis"} - apiMethodHeader = http.CanonicalHeaderKey("X-Google-RPC-Service-Method") - apiMethodHeaderValue = []string{"/VMRemoteAPI.CallRemoteAPI"} - apiDeadlineHeader = http.CanonicalHeaderKey("X-Google-RPC-Service-Deadline") - apiContentType = http.CanonicalHeaderKey("Content-Type") - apiContentTypeValue = []string{"application/octet-stream"} - logFlushHeader = http.CanonicalHeaderKey("X-AppEngine-Log-Flush-Count") - - apiHTTPClient = &http.Client{ - Transport: &http.Transport{ - Proxy: http.ProxyFromEnvironment, - Dial: limitDial, - }, - } - - defaultTicketOnce sync.Once - defaultTicket string -) - -func apiURL() *url.URL { - host, port := "appengine.googleapis.internal", "10001" - if h := os.Getenv("API_HOST"); h != "" { - host = h - } - if p := os.Getenv("API_PORT"); p != "" { - port = p - } - return &url.URL{ - Scheme: "http", - Host: host + ":" + port, - Path: apiPath, - } -} - -func handleHTTP(w http.ResponseWriter, r *http.Request) { - c := &context{ - req: r, - outHeader: w.Header(), - apiURL: apiURL(), - } - stopFlushing := make(chan int) - - ctxs.Lock() - ctxs.m[r] = c - ctxs.Unlock() - defer func() { - ctxs.Lock() - delete(ctxs.m, r) - ctxs.Unlock() - }() - - // Patch up RemoteAddr so it looks reasonable. - if addr := r.Header.Get(userIPHeader); addr != "" { - r.RemoteAddr = addr - } else if addr = r.Header.Get(remoteAddrHeader); addr != "" { - r.RemoteAddr = addr - } else { - // Should not normally reach here, but pick a sensible default anyway. - r.RemoteAddr = "127.0.0.1" - } - // The address in the headers will most likely be of these forms: - // 123.123.123.123 - // 2001:db8::1 - // net/http.Request.RemoteAddr is specified to be in "IP:port" form. - if _, _, err := net.SplitHostPort(r.RemoteAddr); err != nil { - // Assume the remote address is only a host; add a default port. - r.RemoteAddr = net.JoinHostPort(r.RemoteAddr, "80") - } - - // Start goroutine responsible for flushing app logs. - // This is done after adding c to ctx.m (and stopped before removing it) - // because flushing logs requires making an API call. - go c.logFlusher(stopFlushing) - - executeRequestSafely(c, r) - c.outHeader = nil // make sure header changes aren't respected any more - - stopFlushing <- 1 // any logging beyond this point will be dropped - - // Flush any pending logs asynchronously. - c.pendingLogs.Lock() - flushes := c.pendingLogs.flushes - if len(c.pendingLogs.lines) > 0 { - flushes++ - } - c.pendingLogs.Unlock() - go c.flushLog(false) - w.Header().Set(logFlushHeader, strconv.Itoa(flushes)) - - // Avoid nil Write call if c.Write is never called. - if c.outCode != 0 { - w.WriteHeader(c.outCode) - } - if c.outBody != nil { - w.Write(c.outBody) - } -} - -func executeRequestSafely(c *context, r *http.Request) { - defer func() { - if x := recover(); x != nil { - logf(c, 4, "%s", renderPanic(x)) // 4 == critical - c.outCode = 500 - } - }() - - http.DefaultServeMux.ServeHTTP(c, r) -} - -func renderPanic(x interface{}) string { - buf := make([]byte, 16<<10) // 16 KB should be plenty - buf = buf[:runtime.Stack(buf, false)] - - // Remove the first few stack frames: - // this func - // the recover closure in the caller - // That will root the stack trace at the site of the panic. - const ( - skipStart = "internal.renderPanic" - skipFrames = 2 - ) - start := bytes.Index(buf, []byte(skipStart)) - p := start - for i := 0; i < skipFrames*2 && p+1 < len(buf); i++ { - p = bytes.IndexByte(buf[p+1:], '\n') + p + 1 - if p < 0 { - break - } - } - if p >= 0 { - // buf[start:p+1] is the block to remove. - // Copy buf[p+1:] over buf[start:] and shrink buf. - copy(buf[start:], buf[p+1:]) - buf = buf[:len(buf)-(p+1-start)] - } - - // Add panic heading. - head := fmt.Sprintf("panic: %v\n\n", x) - if len(head) > len(buf) { - // Extremely unlikely to happen. - return head - } - copy(buf[len(head):], buf) - copy(buf, head) - - return string(buf) -} - -var ctxs = struct { - sync.Mutex - m map[*http.Request]*context - bg *context // background context, lazily initialized - // dec is used by tests to decorate the netcontext.Context returned - // for a given request. This allows tests to add overrides (such as - // WithAppIDOverride) to the context. The map is nil outside tests. - dec map[*http.Request]func(netcontext.Context) netcontext.Context -}{ - m: make(map[*http.Request]*context), -} - -// context represents the context of an in-flight HTTP request. -// It implements the appengine.Context and http.ResponseWriter interfaces. -type context struct { - req *http.Request - - outCode int - outHeader http.Header - outBody []byte - - pendingLogs struct { - sync.Mutex - lines []*logpb.UserAppLogLine - flushes int - } - - apiURL *url.URL -} - -var contextKey = "holds a *context" - -// fromContext returns the App Engine context or nil if ctx is not -// derived from an App Engine context. -func fromContext(ctx netcontext.Context) *context { - c, _ := ctx.Value(&contextKey).(*context) - return c -} - -func withContext(parent netcontext.Context, c *context) netcontext.Context { - ctx := netcontext.WithValue(parent, &contextKey, c) - if ns := c.req.Header.Get(curNamespaceHeader); ns != "" { - ctx = withNamespace(ctx, ns) - } - return ctx -} - -func toContext(c *context) netcontext.Context { - return withContext(netcontext.Background(), c) -} - -func IncomingHeaders(ctx netcontext.Context) http.Header { - if c := fromContext(ctx); c != nil { - return c.req.Header - } - return nil -} - -func ReqContext(req *http.Request) netcontext.Context { - return WithContext(netcontext.Background(), req) -} - -func WithContext(parent netcontext.Context, req *http.Request) netcontext.Context { - ctxs.Lock() - c := ctxs.m[req] - d := ctxs.dec[req] - ctxs.Unlock() - - if d != nil { - parent = d(parent) - } - - if c == nil { - // Someone passed in an http.Request that is not in-flight. - // We panic here rather than panicking at a later point - // so that stack traces will be more sensible. - log.Panic("appengine: NewContext passed an unknown http.Request") - } - return withContext(parent, c) -} - -// DefaultTicket returns a ticket used for background context or dev_appserver. -func DefaultTicket() string { - defaultTicketOnce.Do(func() { - if IsDevAppServer() { - defaultTicket = "testapp" + defaultTicketSuffix - return - } - appID := partitionlessAppID() - escAppID := strings.Replace(strings.Replace(appID, ":", "_", -1), ".", "_", -1) - majVersion := VersionID(nil) - if i := strings.Index(majVersion, "."); i > 0 { - majVersion = majVersion[:i] - } - defaultTicket = fmt.Sprintf("%s/%s.%s.%s", escAppID, ModuleName(nil), majVersion, InstanceID()) - }) - return defaultTicket -} - -func BackgroundContext() netcontext.Context { - ctxs.Lock() - defer ctxs.Unlock() - - if ctxs.bg != nil { - return toContext(ctxs.bg) - } - - // Compute background security ticket. - ticket := DefaultTicket() - - ctxs.bg = &context{ - req: &http.Request{ - Header: http.Header{ - ticketHeader: []string{ticket}, - }, - }, - apiURL: apiURL(), - } - - // TODO(dsymonds): Wire up the shutdown handler to do a final flush. - go ctxs.bg.logFlusher(make(chan int)) - - return toContext(ctxs.bg) -} - -// RegisterTestRequest registers the HTTP request req for testing, such that -// any API calls are sent to the provided URL. It returns a closure to delete -// the registration. -// It should only be used by aetest package. -func RegisterTestRequest(req *http.Request, apiURL *url.URL, decorate func(netcontext.Context) netcontext.Context) (*http.Request, func()) { - c := &context{ - req: req, - apiURL: apiURL, - } - ctxs.Lock() - defer ctxs.Unlock() - if _, ok := ctxs.m[req]; ok { - log.Panic("req already associated with context") - } - if _, ok := ctxs.dec[req]; ok { - log.Panic("req already associated with context") - } - if ctxs.dec == nil { - ctxs.dec = make(map[*http.Request]func(netcontext.Context) netcontext.Context) - } - ctxs.m[req] = c - ctxs.dec[req] = decorate - - return req, func() { - ctxs.Lock() - delete(ctxs.m, req) - delete(ctxs.dec, req) - ctxs.Unlock() - } -} - -var errTimeout = &CallError{ - Detail: "Deadline exceeded", - Code: int32(remotepb.RpcError_CANCELLED), - Timeout: true, -} - -func (c *context) Header() http.Header { return c.outHeader } - -// Copied from $GOROOT/src/pkg/net/http/transfer.go. Some response status -// codes do not permit a response body (nor response entity headers such as -// Content-Length, Content-Type, etc). -func bodyAllowedForStatus(status int) bool { - switch { - case status >= 100 && status <= 199: - return false - case status == 204: - return false - case status == 304: - return false - } - return true -} - -func (c *context) Write(b []byte) (int, error) { - if c.outCode == 0 { - c.WriteHeader(http.StatusOK) - } - if len(b) > 0 && !bodyAllowedForStatus(c.outCode) { - return 0, http.ErrBodyNotAllowed - } - c.outBody = append(c.outBody, b...) - return len(b), nil -} - -func (c *context) WriteHeader(code int) { - if c.outCode != 0 { - logf(c, 3, "WriteHeader called multiple times on request.") // error level - return - } - c.outCode = code -} - -func (c *context) post(body []byte, timeout time.Duration) (b []byte, err error) { - hreq := &http.Request{ - Method: "POST", - URL: c.apiURL, - Header: http.Header{ - apiEndpointHeader: apiEndpointHeaderValue, - apiMethodHeader: apiMethodHeaderValue, - apiContentType: apiContentTypeValue, - apiDeadlineHeader: []string{strconv.FormatFloat(timeout.Seconds(), 'f', -1, 64)}, - }, - Body: ioutil.NopCloser(bytes.NewReader(body)), - ContentLength: int64(len(body)), - Host: c.apiURL.Host, - } - if info := c.req.Header.Get(dapperHeader); info != "" { - hreq.Header.Set(dapperHeader, info) - } - if info := c.req.Header.Get(traceHeader); info != "" { - hreq.Header.Set(traceHeader, info) - } - - tr := apiHTTPClient.Transport.(*http.Transport) - - var timedOut int32 // atomic; set to 1 if timed out - t := time.AfterFunc(timeout, func() { - atomic.StoreInt32(&timedOut, 1) - tr.CancelRequest(hreq) - }) - defer t.Stop() - defer func() { - // Check if timeout was exceeded. - if atomic.LoadInt32(&timedOut) != 0 { - err = errTimeout - } - }() - - hresp, err := apiHTTPClient.Do(hreq) - if err != nil { - return nil, &CallError{ - Detail: fmt.Sprintf("service bridge HTTP failed: %v", err), - Code: int32(remotepb.RpcError_UNKNOWN), - } - } - defer hresp.Body.Close() - hrespBody, err := ioutil.ReadAll(hresp.Body) - if hresp.StatusCode != 200 { - return nil, &CallError{ - Detail: fmt.Sprintf("service bridge returned HTTP %d (%q)", hresp.StatusCode, hrespBody), - Code: int32(remotepb.RpcError_UNKNOWN), - } - } - if err != nil { - return nil, &CallError{ - Detail: fmt.Sprintf("service bridge response bad: %v", err), - Code: int32(remotepb.RpcError_UNKNOWN), - } - } - return hrespBody, nil -} - -func Call(ctx netcontext.Context, service, method string, in, out proto.Message) error { - if ns := NamespaceFromContext(ctx); ns != "" { - if fn, ok := NamespaceMods[service]; ok { - fn(in, ns) - } - } - - if f, ctx, ok := callOverrideFromContext(ctx); ok { - return f(ctx, service, method, in, out) - } - - // Handle already-done contexts quickly. - select { - case <-ctx.Done(): - return ctx.Err() - default: - } - - c := fromContext(ctx) - if c == nil { - // Give a good error message rather than a panic lower down. - return errNotAppEngineContext - } - - // Apply transaction modifications if we're in a transaction. - if t := transactionFromContext(ctx); t != nil { - if t.finished { - return errors.New("transaction context has expired") - } - applyTransaction(in, &t.transaction) - } - - // Default RPC timeout is 60s. - timeout := 60 * time.Second - if deadline, ok := ctx.Deadline(); ok { - timeout = deadline.Sub(time.Now()) - } - - data, err := proto.Marshal(in) - if err != nil { - return err - } - - ticket := c.req.Header.Get(ticketHeader) - // Use a test ticket under test environment. - if ticket == "" { - if appid := ctx.Value(&appIDOverrideKey); appid != nil { - ticket = appid.(string) + defaultTicketSuffix - } - } - // Fall back to use background ticket when the request ticket is not available in Flex or dev_appserver. - if ticket == "" { - ticket = DefaultTicket() - } - req := &remotepb.Request{ - ServiceName: &service, - Method: &method, - Request: data, - RequestId: &ticket, - } - hreqBody, err := proto.Marshal(req) - if err != nil { - return err - } - - hrespBody, err := c.post(hreqBody, timeout) - if err != nil { - return err - } - - res := &remotepb.Response{} - if err := proto.Unmarshal(hrespBody, res); err != nil { - return err - } - if res.RpcError != nil { - ce := &CallError{ - Detail: res.RpcError.GetDetail(), - Code: *res.RpcError.Code, - } - switch remotepb.RpcError_ErrorCode(ce.Code) { - case remotepb.RpcError_CANCELLED, remotepb.RpcError_DEADLINE_EXCEEDED: - ce.Timeout = true - } - return ce - } - if res.ApplicationError != nil { - return &APIError{ - Service: *req.ServiceName, - Detail: res.ApplicationError.GetDetail(), - Code: *res.ApplicationError.Code, - } - } - if res.Exception != nil || res.JavaException != nil { - // This shouldn't happen, but let's be defensive. - return &CallError{ - Detail: "service bridge returned exception", - Code: int32(remotepb.RpcError_UNKNOWN), - } - } - return proto.Unmarshal(res.Response, out) -} - -func (c *context) Request() *http.Request { - return c.req -} - -func (c *context) addLogLine(ll *logpb.UserAppLogLine) { - // Truncate long log lines. - // TODO(dsymonds): Check if this is still necessary. - const lim = 8 << 10 - if len(*ll.Message) > lim { - suffix := fmt.Sprintf("...(length %d)", len(*ll.Message)) - ll.Message = proto.String((*ll.Message)[:lim-len(suffix)] + suffix) - } - - c.pendingLogs.Lock() - c.pendingLogs.lines = append(c.pendingLogs.lines, ll) - c.pendingLogs.Unlock() -} - -var logLevelName = map[int64]string{ - 0: "DEBUG", - 1: "INFO", - 2: "WARNING", - 3: "ERROR", - 4: "CRITICAL", -} - -func logf(c *context, level int64, format string, args ...interface{}) { - if c == nil { - panic("not an App Engine context") - } - s := fmt.Sprintf(format, args...) - s = strings.TrimRight(s, "\n") // Remove any trailing newline characters. - c.addLogLine(&logpb.UserAppLogLine{ - TimestampUsec: proto.Int64(time.Now().UnixNano() / 1e3), - Level: &level, - Message: &s, - }) - log.Print(logLevelName[level] + ": " + s) -} - -// flushLog attempts to flush any pending logs to the appserver. -// It should not be called concurrently. -func (c *context) flushLog(force bool) (flushed bool) { - c.pendingLogs.Lock() - // Grab up to 30 MB. We can get away with up to 32 MB, but let's be cautious. - n, rem := 0, 30<<20 - for ; n < len(c.pendingLogs.lines); n++ { - ll := c.pendingLogs.lines[n] - // Each log line will require about 3 bytes of overhead. - nb := proto.Size(ll) + 3 - if nb > rem { - break - } - rem -= nb - } - lines := c.pendingLogs.lines[:n] - c.pendingLogs.lines = c.pendingLogs.lines[n:] - c.pendingLogs.Unlock() - - if len(lines) == 0 && !force { - // Nothing to flush. - return false - } - - rescueLogs := false - defer func() { - if rescueLogs { - c.pendingLogs.Lock() - c.pendingLogs.lines = append(lines, c.pendingLogs.lines...) - c.pendingLogs.Unlock() - } - }() - - buf, err := proto.Marshal(&logpb.UserAppLogGroup{ - LogLine: lines, - }) - if err != nil { - log.Printf("internal.flushLog: marshaling UserAppLogGroup: %v", err) - rescueLogs = true - return false - } - - req := &logpb.FlushRequest{ - Logs: buf, - } - res := &basepb.VoidProto{} - c.pendingLogs.Lock() - c.pendingLogs.flushes++ - c.pendingLogs.Unlock() - if err := Call(toContext(c), "logservice", "Flush", req, res); err != nil { - log.Printf("internal.flushLog: Flush RPC: %v", err) - rescueLogs = true - return false - } - return true -} - -const ( - // Log flushing parameters. - flushInterval = 1 * time.Second - forceFlushInterval = 60 * time.Second -) - -func (c *context) logFlusher(stop <-chan int) { - lastFlush := time.Now() - tick := time.NewTicker(flushInterval) - for { - select { - case <-stop: - // Request finished. - tick.Stop() - return - case <-tick.C: - force := time.Now().Sub(lastFlush) > forceFlushInterval - if c.flushLog(force) { - lastFlush = time.Now() - } - } - } -} - -func ContextForTesting(req *http.Request) netcontext.Context { - return toContext(&context{req: req}) -} diff --git a/vendor/google.golang.org/appengine/internal/app_identity/app_identity_service.pb.go b/vendor/google.golang.org/appengine/internal/app_identity/app_identity_service.pb.go index 89d3ea9c..9a2ff77a 100644 --- a/vendor/google.golang.org/appengine/internal/app_identity/app_identity_service.pb.go +++ b/vendor/google.golang.org/appengine/internal/app_identity/app_identity_service.pb.go @@ -1,26 +1,6 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // source: google.golang.org/appengine/internal/app_identity/app_identity_service.proto -/* -Package app_identity is a generated protocol buffer package. - -It is generated from these files: - google.golang.org/appengine/internal/app_identity/app_identity_service.proto - -It has these top-level messages: - AppIdentityServiceError - SignForAppRequest - SignForAppResponse - GetPublicCertificateForAppRequest - PublicCertificate - GetPublicCertificateForAppResponse - GetServiceAccountNameRequest - GetServiceAccountNameResponse - GetAccessTokenRequest - GetAccessTokenResponse - GetDefaultGcsBucketNameRequest - GetDefaultGcsBucketNameResponse -*/ package app_identity import proto "github.com/golang/protobuf/proto" @@ -89,27 +69,69 @@ func (x *AppIdentityServiceError_ErrorCode) UnmarshalJSON(data []byte) error { return nil } func (AppIdentityServiceError_ErrorCode) EnumDescriptor() ([]byte, []int) { - return fileDescriptor0, []int{0, 0} + return fileDescriptor_app_identity_service_08a6e3f74b04cfa4, []int{0, 0} } type AppIdentityServiceError struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *AppIdentityServiceError) Reset() { *m = AppIdentityServiceError{} } -func (m *AppIdentityServiceError) String() string { return proto.CompactTextString(m) } -func (*AppIdentityServiceError) ProtoMessage() {} -func (*AppIdentityServiceError) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{0} } +func (m *AppIdentityServiceError) Reset() { *m = AppIdentityServiceError{} } +func (m *AppIdentityServiceError) String() string { return proto.CompactTextString(m) } +func (*AppIdentityServiceError) ProtoMessage() {} +func (*AppIdentityServiceError) Descriptor() ([]byte, []int) { + return fileDescriptor_app_identity_service_08a6e3f74b04cfa4, []int{0} +} +func (m *AppIdentityServiceError) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_AppIdentityServiceError.Unmarshal(m, b) +} +func (m *AppIdentityServiceError) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_AppIdentityServiceError.Marshal(b, m, deterministic) +} +func (dst *AppIdentityServiceError) XXX_Merge(src proto.Message) { + xxx_messageInfo_AppIdentityServiceError.Merge(dst, src) +} +func (m *AppIdentityServiceError) XXX_Size() int { + return xxx_messageInfo_AppIdentityServiceError.Size(m) +} +func (m *AppIdentityServiceError) XXX_DiscardUnknown() { + xxx_messageInfo_AppIdentityServiceError.DiscardUnknown(m) +} + +var xxx_messageInfo_AppIdentityServiceError proto.InternalMessageInfo type SignForAppRequest struct { - BytesToSign []byte `protobuf:"bytes,1,opt,name=bytes_to_sign,json=bytesToSign" json:"bytes_to_sign,omitempty"` - XXX_unrecognized []byte `json:"-"` + BytesToSign []byte `protobuf:"bytes,1,opt,name=bytes_to_sign,json=bytesToSign" json:"bytes_to_sign,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *SignForAppRequest) Reset() { *m = SignForAppRequest{} } -func (m *SignForAppRequest) String() string { return proto.CompactTextString(m) } -func (*SignForAppRequest) ProtoMessage() {} -func (*SignForAppRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1} } +func (m *SignForAppRequest) Reset() { *m = SignForAppRequest{} } +func (m *SignForAppRequest) String() string { return proto.CompactTextString(m) } +func (*SignForAppRequest) ProtoMessage() {} +func (*SignForAppRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_app_identity_service_08a6e3f74b04cfa4, []int{1} +} +func (m *SignForAppRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_SignForAppRequest.Unmarshal(m, b) +} +func (m *SignForAppRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_SignForAppRequest.Marshal(b, m, deterministic) +} +func (dst *SignForAppRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_SignForAppRequest.Merge(dst, src) +} +func (m *SignForAppRequest) XXX_Size() int { + return xxx_messageInfo_SignForAppRequest.Size(m) +} +func (m *SignForAppRequest) XXX_DiscardUnknown() { + xxx_messageInfo_SignForAppRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_SignForAppRequest proto.InternalMessageInfo func (m *SignForAppRequest) GetBytesToSign() []byte { if m != nil { @@ -119,15 +141,36 @@ func (m *SignForAppRequest) GetBytesToSign() []byte { } type SignForAppResponse struct { - KeyName *string `protobuf:"bytes,1,opt,name=key_name,json=keyName" json:"key_name,omitempty"` - SignatureBytes []byte `protobuf:"bytes,2,opt,name=signature_bytes,json=signatureBytes" json:"signature_bytes,omitempty"` - XXX_unrecognized []byte `json:"-"` + KeyName *string `protobuf:"bytes,1,opt,name=key_name,json=keyName" json:"key_name,omitempty"` + SignatureBytes []byte `protobuf:"bytes,2,opt,name=signature_bytes,json=signatureBytes" json:"signature_bytes,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *SignForAppResponse) Reset() { *m = SignForAppResponse{} } +func (m *SignForAppResponse) String() string { return proto.CompactTextString(m) } +func (*SignForAppResponse) ProtoMessage() {} +func (*SignForAppResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_app_identity_service_08a6e3f74b04cfa4, []int{2} +} +func (m *SignForAppResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_SignForAppResponse.Unmarshal(m, b) +} +func (m *SignForAppResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_SignForAppResponse.Marshal(b, m, deterministic) +} +func (dst *SignForAppResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_SignForAppResponse.Merge(dst, src) +} +func (m *SignForAppResponse) XXX_Size() int { + return xxx_messageInfo_SignForAppResponse.Size(m) +} +func (m *SignForAppResponse) XXX_DiscardUnknown() { + xxx_messageInfo_SignForAppResponse.DiscardUnknown(m) } -func (m *SignForAppResponse) Reset() { *m = SignForAppResponse{} } -func (m *SignForAppResponse) String() string { return proto.CompactTextString(m) } -func (*SignForAppResponse) ProtoMessage() {} -func (*SignForAppResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{2} } +var xxx_messageInfo_SignForAppResponse proto.InternalMessageInfo func (m *SignForAppResponse) GetKeyName() string { if m != nil && m.KeyName != nil { @@ -144,26 +187,66 @@ func (m *SignForAppResponse) GetSignatureBytes() []byte { } type GetPublicCertificateForAppRequest struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } func (m *GetPublicCertificateForAppRequest) Reset() { *m = GetPublicCertificateForAppRequest{} } func (m *GetPublicCertificateForAppRequest) String() string { return proto.CompactTextString(m) } func (*GetPublicCertificateForAppRequest) ProtoMessage() {} func (*GetPublicCertificateForAppRequest) Descriptor() ([]byte, []int) { - return fileDescriptor0, []int{3} + return fileDescriptor_app_identity_service_08a6e3f74b04cfa4, []int{3} +} +func (m *GetPublicCertificateForAppRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetPublicCertificateForAppRequest.Unmarshal(m, b) +} +func (m *GetPublicCertificateForAppRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetPublicCertificateForAppRequest.Marshal(b, m, deterministic) +} +func (dst *GetPublicCertificateForAppRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetPublicCertificateForAppRequest.Merge(dst, src) +} +func (m *GetPublicCertificateForAppRequest) XXX_Size() int { + return xxx_messageInfo_GetPublicCertificateForAppRequest.Size(m) +} +func (m *GetPublicCertificateForAppRequest) XXX_DiscardUnknown() { + xxx_messageInfo_GetPublicCertificateForAppRequest.DiscardUnknown(m) } +var xxx_messageInfo_GetPublicCertificateForAppRequest proto.InternalMessageInfo + type PublicCertificate struct { - KeyName *string `protobuf:"bytes,1,opt,name=key_name,json=keyName" json:"key_name,omitempty"` - X509CertificatePem *string `protobuf:"bytes,2,opt,name=x509_certificate_pem,json=x509CertificatePem" json:"x509_certificate_pem,omitempty"` - XXX_unrecognized []byte `json:"-"` + KeyName *string `protobuf:"bytes,1,opt,name=key_name,json=keyName" json:"key_name,omitempty"` + X509CertificatePem *string `protobuf:"bytes,2,opt,name=x509_certificate_pem,json=x509CertificatePem" json:"x509_certificate_pem,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *PublicCertificate) Reset() { *m = PublicCertificate{} } +func (m *PublicCertificate) String() string { return proto.CompactTextString(m) } +func (*PublicCertificate) ProtoMessage() {} +func (*PublicCertificate) Descriptor() ([]byte, []int) { + return fileDescriptor_app_identity_service_08a6e3f74b04cfa4, []int{4} +} +func (m *PublicCertificate) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_PublicCertificate.Unmarshal(m, b) +} +func (m *PublicCertificate) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_PublicCertificate.Marshal(b, m, deterministic) +} +func (dst *PublicCertificate) XXX_Merge(src proto.Message) { + xxx_messageInfo_PublicCertificate.Merge(dst, src) +} +func (m *PublicCertificate) XXX_Size() int { + return xxx_messageInfo_PublicCertificate.Size(m) +} +func (m *PublicCertificate) XXX_DiscardUnknown() { + xxx_messageInfo_PublicCertificate.DiscardUnknown(m) } -func (m *PublicCertificate) Reset() { *m = PublicCertificate{} } -func (m *PublicCertificate) String() string { return proto.CompactTextString(m) } -func (*PublicCertificate) ProtoMessage() {} -func (*PublicCertificate) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{4} } +var xxx_messageInfo_PublicCertificate proto.InternalMessageInfo func (m *PublicCertificate) GetKeyName() string { if m != nil && m.KeyName != nil { @@ -182,16 +265,35 @@ func (m *PublicCertificate) GetX509CertificatePem() string { type GetPublicCertificateForAppResponse struct { PublicCertificateList []*PublicCertificate `protobuf:"bytes,1,rep,name=public_certificate_list,json=publicCertificateList" json:"public_certificate_list,omitempty"` MaxClientCacheTimeInSecond *int64 `protobuf:"varint,2,opt,name=max_client_cache_time_in_second,json=maxClientCacheTimeInSecond" json:"max_client_cache_time_in_second,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } func (m *GetPublicCertificateForAppResponse) Reset() { *m = GetPublicCertificateForAppResponse{} } func (m *GetPublicCertificateForAppResponse) String() string { return proto.CompactTextString(m) } func (*GetPublicCertificateForAppResponse) ProtoMessage() {} func (*GetPublicCertificateForAppResponse) Descriptor() ([]byte, []int) { - return fileDescriptor0, []int{5} + return fileDescriptor_app_identity_service_08a6e3f74b04cfa4, []int{5} +} +func (m *GetPublicCertificateForAppResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetPublicCertificateForAppResponse.Unmarshal(m, b) +} +func (m *GetPublicCertificateForAppResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetPublicCertificateForAppResponse.Marshal(b, m, deterministic) +} +func (dst *GetPublicCertificateForAppResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetPublicCertificateForAppResponse.Merge(dst, src) +} +func (m *GetPublicCertificateForAppResponse) XXX_Size() int { + return xxx_messageInfo_GetPublicCertificateForAppResponse.Size(m) +} +func (m *GetPublicCertificateForAppResponse) XXX_DiscardUnknown() { + xxx_messageInfo_GetPublicCertificateForAppResponse.DiscardUnknown(m) } +var xxx_messageInfo_GetPublicCertificateForAppResponse proto.InternalMessageInfo + func (m *GetPublicCertificateForAppResponse) GetPublicCertificateList() []*PublicCertificate { if m != nil { return m.PublicCertificateList @@ -207,23 +309,65 @@ func (m *GetPublicCertificateForAppResponse) GetMaxClientCacheTimeInSecond() int } type GetServiceAccountNameRequest struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *GetServiceAccountNameRequest) Reset() { *m = GetServiceAccountNameRequest{} } -func (m *GetServiceAccountNameRequest) String() string { return proto.CompactTextString(m) } -func (*GetServiceAccountNameRequest) ProtoMessage() {} -func (*GetServiceAccountNameRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{6} } +func (m *GetServiceAccountNameRequest) Reset() { *m = GetServiceAccountNameRequest{} } +func (m *GetServiceAccountNameRequest) String() string { return proto.CompactTextString(m) } +func (*GetServiceAccountNameRequest) ProtoMessage() {} +func (*GetServiceAccountNameRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_app_identity_service_08a6e3f74b04cfa4, []int{6} +} +func (m *GetServiceAccountNameRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetServiceAccountNameRequest.Unmarshal(m, b) +} +func (m *GetServiceAccountNameRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetServiceAccountNameRequest.Marshal(b, m, deterministic) +} +func (dst *GetServiceAccountNameRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetServiceAccountNameRequest.Merge(dst, src) +} +func (m *GetServiceAccountNameRequest) XXX_Size() int { + return xxx_messageInfo_GetServiceAccountNameRequest.Size(m) +} +func (m *GetServiceAccountNameRequest) XXX_DiscardUnknown() { + xxx_messageInfo_GetServiceAccountNameRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_GetServiceAccountNameRequest proto.InternalMessageInfo type GetServiceAccountNameResponse struct { - ServiceAccountName *string `protobuf:"bytes,1,opt,name=service_account_name,json=serviceAccountName" json:"service_account_name,omitempty"` - XXX_unrecognized []byte `json:"-"` + ServiceAccountName *string `protobuf:"bytes,1,opt,name=service_account_name,json=serviceAccountName" json:"service_account_name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GetServiceAccountNameResponse) Reset() { *m = GetServiceAccountNameResponse{} } +func (m *GetServiceAccountNameResponse) String() string { return proto.CompactTextString(m) } +func (*GetServiceAccountNameResponse) ProtoMessage() {} +func (*GetServiceAccountNameResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_app_identity_service_08a6e3f74b04cfa4, []int{7} +} +func (m *GetServiceAccountNameResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetServiceAccountNameResponse.Unmarshal(m, b) +} +func (m *GetServiceAccountNameResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetServiceAccountNameResponse.Marshal(b, m, deterministic) +} +func (dst *GetServiceAccountNameResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetServiceAccountNameResponse.Merge(dst, src) +} +func (m *GetServiceAccountNameResponse) XXX_Size() int { + return xxx_messageInfo_GetServiceAccountNameResponse.Size(m) +} +func (m *GetServiceAccountNameResponse) XXX_DiscardUnknown() { + xxx_messageInfo_GetServiceAccountNameResponse.DiscardUnknown(m) } -func (m *GetServiceAccountNameResponse) Reset() { *m = GetServiceAccountNameResponse{} } -func (m *GetServiceAccountNameResponse) String() string { return proto.CompactTextString(m) } -func (*GetServiceAccountNameResponse) ProtoMessage() {} -func (*GetServiceAccountNameResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{7} } +var xxx_messageInfo_GetServiceAccountNameResponse proto.InternalMessageInfo func (m *GetServiceAccountNameResponse) GetServiceAccountName() string { if m != nil && m.ServiceAccountName != nil { @@ -233,16 +377,37 @@ func (m *GetServiceAccountNameResponse) GetServiceAccountName() string { } type GetAccessTokenRequest struct { - Scope []string `protobuf:"bytes,1,rep,name=scope" json:"scope,omitempty"` - ServiceAccountId *int64 `protobuf:"varint,2,opt,name=service_account_id,json=serviceAccountId" json:"service_account_id,omitempty"` - ServiceAccountName *string `protobuf:"bytes,3,opt,name=service_account_name,json=serviceAccountName" json:"service_account_name,omitempty"` - XXX_unrecognized []byte `json:"-"` + Scope []string `protobuf:"bytes,1,rep,name=scope" json:"scope,omitempty"` + ServiceAccountId *int64 `protobuf:"varint,2,opt,name=service_account_id,json=serviceAccountId" json:"service_account_id,omitempty"` + ServiceAccountName *string `protobuf:"bytes,3,opt,name=service_account_name,json=serviceAccountName" json:"service_account_name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GetAccessTokenRequest) Reset() { *m = GetAccessTokenRequest{} } +func (m *GetAccessTokenRequest) String() string { return proto.CompactTextString(m) } +func (*GetAccessTokenRequest) ProtoMessage() {} +func (*GetAccessTokenRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_app_identity_service_08a6e3f74b04cfa4, []int{8} +} +func (m *GetAccessTokenRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetAccessTokenRequest.Unmarshal(m, b) +} +func (m *GetAccessTokenRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetAccessTokenRequest.Marshal(b, m, deterministic) +} +func (dst *GetAccessTokenRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetAccessTokenRequest.Merge(dst, src) +} +func (m *GetAccessTokenRequest) XXX_Size() int { + return xxx_messageInfo_GetAccessTokenRequest.Size(m) +} +func (m *GetAccessTokenRequest) XXX_DiscardUnknown() { + xxx_messageInfo_GetAccessTokenRequest.DiscardUnknown(m) } -func (m *GetAccessTokenRequest) Reset() { *m = GetAccessTokenRequest{} } -func (m *GetAccessTokenRequest) String() string { return proto.CompactTextString(m) } -func (*GetAccessTokenRequest) ProtoMessage() {} -func (*GetAccessTokenRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{8} } +var xxx_messageInfo_GetAccessTokenRequest proto.InternalMessageInfo func (m *GetAccessTokenRequest) GetScope() []string { if m != nil { @@ -266,15 +431,36 @@ func (m *GetAccessTokenRequest) GetServiceAccountName() string { } type GetAccessTokenResponse struct { - AccessToken *string `protobuf:"bytes,1,opt,name=access_token,json=accessToken" json:"access_token,omitempty"` - ExpirationTime *int64 `protobuf:"varint,2,opt,name=expiration_time,json=expirationTime" json:"expiration_time,omitempty"` - XXX_unrecognized []byte `json:"-"` + AccessToken *string `protobuf:"bytes,1,opt,name=access_token,json=accessToken" json:"access_token,omitempty"` + ExpirationTime *int64 `protobuf:"varint,2,opt,name=expiration_time,json=expirationTime" json:"expiration_time,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *GetAccessTokenResponse) Reset() { *m = GetAccessTokenResponse{} } -func (m *GetAccessTokenResponse) String() string { return proto.CompactTextString(m) } -func (*GetAccessTokenResponse) ProtoMessage() {} -func (*GetAccessTokenResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{9} } +func (m *GetAccessTokenResponse) Reset() { *m = GetAccessTokenResponse{} } +func (m *GetAccessTokenResponse) String() string { return proto.CompactTextString(m) } +func (*GetAccessTokenResponse) ProtoMessage() {} +func (*GetAccessTokenResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_app_identity_service_08a6e3f74b04cfa4, []int{9} +} +func (m *GetAccessTokenResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetAccessTokenResponse.Unmarshal(m, b) +} +func (m *GetAccessTokenResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetAccessTokenResponse.Marshal(b, m, deterministic) +} +func (dst *GetAccessTokenResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetAccessTokenResponse.Merge(dst, src) +} +func (m *GetAccessTokenResponse) XXX_Size() int { + return xxx_messageInfo_GetAccessTokenResponse.Size(m) +} +func (m *GetAccessTokenResponse) XXX_DiscardUnknown() { + xxx_messageInfo_GetAccessTokenResponse.DiscardUnknown(m) +} + +var xxx_messageInfo_GetAccessTokenResponse proto.InternalMessageInfo func (m *GetAccessTokenResponse) GetAccessToken() string { if m != nil && m.AccessToken != nil { @@ -291,25 +477,65 @@ func (m *GetAccessTokenResponse) GetExpirationTime() int64 { } type GetDefaultGcsBucketNameRequest struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GetDefaultGcsBucketNameRequest) Reset() { *m = GetDefaultGcsBucketNameRequest{} } +func (m *GetDefaultGcsBucketNameRequest) String() string { return proto.CompactTextString(m) } +func (*GetDefaultGcsBucketNameRequest) ProtoMessage() {} +func (*GetDefaultGcsBucketNameRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_app_identity_service_08a6e3f74b04cfa4, []int{10} +} +func (m *GetDefaultGcsBucketNameRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetDefaultGcsBucketNameRequest.Unmarshal(m, b) +} +func (m *GetDefaultGcsBucketNameRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetDefaultGcsBucketNameRequest.Marshal(b, m, deterministic) +} +func (dst *GetDefaultGcsBucketNameRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetDefaultGcsBucketNameRequest.Merge(dst, src) +} +func (m *GetDefaultGcsBucketNameRequest) XXX_Size() int { + return xxx_messageInfo_GetDefaultGcsBucketNameRequest.Size(m) +} +func (m *GetDefaultGcsBucketNameRequest) XXX_DiscardUnknown() { + xxx_messageInfo_GetDefaultGcsBucketNameRequest.DiscardUnknown(m) } -func (m *GetDefaultGcsBucketNameRequest) Reset() { *m = GetDefaultGcsBucketNameRequest{} } -func (m *GetDefaultGcsBucketNameRequest) String() string { return proto.CompactTextString(m) } -func (*GetDefaultGcsBucketNameRequest) ProtoMessage() {} -func (*GetDefaultGcsBucketNameRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{10} } +var xxx_messageInfo_GetDefaultGcsBucketNameRequest proto.InternalMessageInfo type GetDefaultGcsBucketNameResponse struct { - DefaultGcsBucketName *string `protobuf:"bytes,1,opt,name=default_gcs_bucket_name,json=defaultGcsBucketName" json:"default_gcs_bucket_name,omitempty"` - XXX_unrecognized []byte `json:"-"` + DefaultGcsBucketName *string `protobuf:"bytes,1,opt,name=default_gcs_bucket_name,json=defaultGcsBucketName" json:"default_gcs_bucket_name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } func (m *GetDefaultGcsBucketNameResponse) Reset() { *m = GetDefaultGcsBucketNameResponse{} } func (m *GetDefaultGcsBucketNameResponse) String() string { return proto.CompactTextString(m) } func (*GetDefaultGcsBucketNameResponse) ProtoMessage() {} func (*GetDefaultGcsBucketNameResponse) Descriptor() ([]byte, []int) { - return fileDescriptor0, []int{11} + return fileDescriptor_app_identity_service_08a6e3f74b04cfa4, []int{11} +} +func (m *GetDefaultGcsBucketNameResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetDefaultGcsBucketNameResponse.Unmarshal(m, b) } +func (m *GetDefaultGcsBucketNameResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetDefaultGcsBucketNameResponse.Marshal(b, m, deterministic) +} +func (dst *GetDefaultGcsBucketNameResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetDefaultGcsBucketNameResponse.Merge(dst, src) +} +func (m *GetDefaultGcsBucketNameResponse) XXX_Size() int { + return xxx_messageInfo_GetDefaultGcsBucketNameResponse.Size(m) +} +func (m *GetDefaultGcsBucketNameResponse) XXX_DiscardUnknown() { + xxx_messageInfo_GetDefaultGcsBucketNameResponse.DiscardUnknown(m) +} + +var xxx_messageInfo_GetDefaultGcsBucketNameResponse proto.InternalMessageInfo func (m *GetDefaultGcsBucketNameResponse) GetDefaultGcsBucketName() string { if m != nil && m.DefaultGcsBucketName != nil { @@ -334,10 +560,10 @@ func init() { } func init() { - proto.RegisterFile("google.golang.org/appengine/internal/app_identity/app_identity_service.proto", fileDescriptor0) + proto.RegisterFile("google.golang.org/appengine/internal/app_identity/app_identity_service.proto", fileDescriptor_app_identity_service_08a6e3f74b04cfa4) } -var fileDescriptor0 = []byte{ +var fileDescriptor_app_identity_service_08a6e3f74b04cfa4 = []byte{ // 676 bytes of a gzipped FileDescriptorProto 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x7c, 0x54, 0xdb, 0x6e, 0xda, 0x58, 0x14, 0x1d, 0x26, 0x1a, 0x31, 0x6c, 0x12, 0x62, 0xce, 0x90, 0xcb, 0x8c, 0x32, 0xb9, 0x78, 0x1e, diff --git a/vendor/google.golang.org/appengine/internal/base/api_base.pb.go b/vendor/google.golang.org/appengine/internal/base/api_base.pb.go index 6205a7ae..db4777e6 100644 --- a/vendor/google.golang.org/appengine/internal/base/api_base.pb.go +++ b/vendor/google.golang.org/appengine/internal/base/api_base.pb.go @@ -1,21 +1,6 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // source: google.golang.org/appengine/internal/base/api_base.proto -/* -Package base is a generated protocol buffer package. - -It is generated from these files: - google.golang.org/appengine/internal/base/api_base.proto - -It has these top-level messages: - StringProto - Integer32Proto - Integer64Proto - BoolProto - DoubleProto - BytesProto - VoidProto -*/ package base import proto "github.com/golang/protobuf/proto" @@ -34,14 +19,35 @@ var _ = math.Inf const _ = proto.ProtoPackageIsVersion2 // please upgrade the proto package type StringProto struct { - Value *string `protobuf:"bytes,1,req,name=value" json:"value,omitempty"` - XXX_unrecognized []byte `json:"-"` + Value *string `protobuf:"bytes,1,req,name=value" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *StringProto) Reset() { *m = StringProto{} } -func (m *StringProto) String() string { return proto.CompactTextString(m) } -func (*StringProto) ProtoMessage() {} -func (*StringProto) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{0} } +func (m *StringProto) Reset() { *m = StringProto{} } +func (m *StringProto) String() string { return proto.CompactTextString(m) } +func (*StringProto) ProtoMessage() {} +func (*StringProto) Descriptor() ([]byte, []int) { + return fileDescriptor_api_base_9d49f8792e0c1140, []int{0} +} +func (m *StringProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_StringProto.Unmarshal(m, b) +} +func (m *StringProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_StringProto.Marshal(b, m, deterministic) +} +func (dst *StringProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_StringProto.Merge(dst, src) +} +func (m *StringProto) XXX_Size() int { + return xxx_messageInfo_StringProto.Size(m) +} +func (m *StringProto) XXX_DiscardUnknown() { + xxx_messageInfo_StringProto.DiscardUnknown(m) +} + +var xxx_messageInfo_StringProto proto.InternalMessageInfo func (m *StringProto) GetValue() string { if m != nil && m.Value != nil { @@ -51,14 +57,35 @@ func (m *StringProto) GetValue() string { } type Integer32Proto struct { - Value *int32 `protobuf:"varint,1,req,name=value" json:"value,omitempty"` - XXX_unrecognized []byte `json:"-"` + Value *int32 `protobuf:"varint,1,req,name=value" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *Integer32Proto) Reset() { *m = Integer32Proto{} } -func (m *Integer32Proto) String() string { return proto.CompactTextString(m) } -func (*Integer32Proto) ProtoMessage() {} -func (*Integer32Proto) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1} } +func (m *Integer32Proto) Reset() { *m = Integer32Proto{} } +func (m *Integer32Proto) String() string { return proto.CompactTextString(m) } +func (*Integer32Proto) ProtoMessage() {} +func (*Integer32Proto) Descriptor() ([]byte, []int) { + return fileDescriptor_api_base_9d49f8792e0c1140, []int{1} +} +func (m *Integer32Proto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Integer32Proto.Unmarshal(m, b) +} +func (m *Integer32Proto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Integer32Proto.Marshal(b, m, deterministic) +} +func (dst *Integer32Proto) XXX_Merge(src proto.Message) { + xxx_messageInfo_Integer32Proto.Merge(dst, src) +} +func (m *Integer32Proto) XXX_Size() int { + return xxx_messageInfo_Integer32Proto.Size(m) +} +func (m *Integer32Proto) XXX_DiscardUnknown() { + xxx_messageInfo_Integer32Proto.DiscardUnknown(m) +} + +var xxx_messageInfo_Integer32Proto proto.InternalMessageInfo func (m *Integer32Proto) GetValue() int32 { if m != nil && m.Value != nil { @@ -68,14 +95,35 @@ func (m *Integer32Proto) GetValue() int32 { } type Integer64Proto struct { - Value *int64 `protobuf:"varint,1,req,name=value" json:"value,omitempty"` - XXX_unrecognized []byte `json:"-"` + Value *int64 `protobuf:"varint,1,req,name=value" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Integer64Proto) Reset() { *m = Integer64Proto{} } +func (m *Integer64Proto) String() string { return proto.CompactTextString(m) } +func (*Integer64Proto) ProtoMessage() {} +func (*Integer64Proto) Descriptor() ([]byte, []int) { + return fileDescriptor_api_base_9d49f8792e0c1140, []int{2} +} +func (m *Integer64Proto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Integer64Proto.Unmarshal(m, b) +} +func (m *Integer64Proto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Integer64Proto.Marshal(b, m, deterministic) +} +func (dst *Integer64Proto) XXX_Merge(src proto.Message) { + xxx_messageInfo_Integer64Proto.Merge(dst, src) +} +func (m *Integer64Proto) XXX_Size() int { + return xxx_messageInfo_Integer64Proto.Size(m) +} +func (m *Integer64Proto) XXX_DiscardUnknown() { + xxx_messageInfo_Integer64Proto.DiscardUnknown(m) } -func (m *Integer64Proto) Reset() { *m = Integer64Proto{} } -func (m *Integer64Proto) String() string { return proto.CompactTextString(m) } -func (*Integer64Proto) ProtoMessage() {} -func (*Integer64Proto) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{2} } +var xxx_messageInfo_Integer64Proto proto.InternalMessageInfo func (m *Integer64Proto) GetValue() int64 { if m != nil && m.Value != nil { @@ -85,14 +133,35 @@ func (m *Integer64Proto) GetValue() int64 { } type BoolProto struct { - Value *bool `protobuf:"varint,1,req,name=value" json:"value,omitempty"` - XXX_unrecognized []byte `json:"-"` + Value *bool `protobuf:"varint,1,req,name=value" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *BoolProto) Reset() { *m = BoolProto{} } -func (m *BoolProto) String() string { return proto.CompactTextString(m) } -func (*BoolProto) ProtoMessage() {} -func (*BoolProto) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{3} } +func (m *BoolProto) Reset() { *m = BoolProto{} } +func (m *BoolProto) String() string { return proto.CompactTextString(m) } +func (*BoolProto) ProtoMessage() {} +func (*BoolProto) Descriptor() ([]byte, []int) { + return fileDescriptor_api_base_9d49f8792e0c1140, []int{3} +} +func (m *BoolProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_BoolProto.Unmarshal(m, b) +} +func (m *BoolProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_BoolProto.Marshal(b, m, deterministic) +} +func (dst *BoolProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_BoolProto.Merge(dst, src) +} +func (m *BoolProto) XXX_Size() int { + return xxx_messageInfo_BoolProto.Size(m) +} +func (m *BoolProto) XXX_DiscardUnknown() { + xxx_messageInfo_BoolProto.DiscardUnknown(m) +} + +var xxx_messageInfo_BoolProto proto.InternalMessageInfo func (m *BoolProto) GetValue() bool { if m != nil && m.Value != nil { @@ -102,14 +171,35 @@ func (m *BoolProto) GetValue() bool { } type DoubleProto struct { - Value *float64 `protobuf:"fixed64,1,req,name=value" json:"value,omitempty"` - XXX_unrecognized []byte `json:"-"` + Value *float64 `protobuf:"fixed64,1,req,name=value" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *DoubleProto) Reset() { *m = DoubleProto{} } +func (m *DoubleProto) String() string { return proto.CompactTextString(m) } +func (*DoubleProto) ProtoMessage() {} +func (*DoubleProto) Descriptor() ([]byte, []int) { + return fileDescriptor_api_base_9d49f8792e0c1140, []int{4} +} +func (m *DoubleProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DoubleProto.Unmarshal(m, b) +} +func (m *DoubleProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DoubleProto.Marshal(b, m, deterministic) +} +func (dst *DoubleProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_DoubleProto.Merge(dst, src) +} +func (m *DoubleProto) XXX_Size() int { + return xxx_messageInfo_DoubleProto.Size(m) +} +func (m *DoubleProto) XXX_DiscardUnknown() { + xxx_messageInfo_DoubleProto.DiscardUnknown(m) } -func (m *DoubleProto) Reset() { *m = DoubleProto{} } -func (m *DoubleProto) String() string { return proto.CompactTextString(m) } -func (*DoubleProto) ProtoMessage() {} -func (*DoubleProto) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{4} } +var xxx_messageInfo_DoubleProto proto.InternalMessageInfo func (m *DoubleProto) GetValue() float64 { if m != nil && m.Value != nil { @@ -119,14 +209,35 @@ func (m *DoubleProto) GetValue() float64 { } type BytesProto struct { - Value []byte `protobuf:"bytes,1,req,name=value" json:"value,omitempty"` - XXX_unrecognized []byte `json:"-"` + Value []byte `protobuf:"bytes,1,req,name=value" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BytesProto) Reset() { *m = BytesProto{} } +func (m *BytesProto) String() string { return proto.CompactTextString(m) } +func (*BytesProto) ProtoMessage() {} +func (*BytesProto) Descriptor() ([]byte, []int) { + return fileDescriptor_api_base_9d49f8792e0c1140, []int{5} +} +func (m *BytesProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_BytesProto.Unmarshal(m, b) +} +func (m *BytesProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_BytesProto.Marshal(b, m, deterministic) +} +func (dst *BytesProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_BytesProto.Merge(dst, src) +} +func (m *BytesProto) XXX_Size() int { + return xxx_messageInfo_BytesProto.Size(m) +} +func (m *BytesProto) XXX_DiscardUnknown() { + xxx_messageInfo_BytesProto.DiscardUnknown(m) } -func (m *BytesProto) Reset() { *m = BytesProto{} } -func (m *BytesProto) String() string { return proto.CompactTextString(m) } -func (*BytesProto) ProtoMessage() {} -func (*BytesProto) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{5} } +var xxx_messageInfo_BytesProto proto.InternalMessageInfo func (m *BytesProto) GetValue() []byte { if m != nil { @@ -136,13 +247,34 @@ func (m *BytesProto) GetValue() []byte { } type VoidProto struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *VoidProto) Reset() { *m = VoidProto{} } +func (m *VoidProto) String() string { return proto.CompactTextString(m) } +func (*VoidProto) ProtoMessage() {} +func (*VoidProto) Descriptor() ([]byte, []int) { + return fileDescriptor_api_base_9d49f8792e0c1140, []int{6} +} +func (m *VoidProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_VoidProto.Unmarshal(m, b) +} +func (m *VoidProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_VoidProto.Marshal(b, m, deterministic) +} +func (dst *VoidProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_VoidProto.Merge(dst, src) +} +func (m *VoidProto) XXX_Size() int { + return xxx_messageInfo_VoidProto.Size(m) +} +func (m *VoidProto) XXX_DiscardUnknown() { + xxx_messageInfo_VoidProto.DiscardUnknown(m) } -func (m *VoidProto) Reset() { *m = VoidProto{} } -func (m *VoidProto) String() string { return proto.CompactTextString(m) } -func (*VoidProto) ProtoMessage() {} -func (*VoidProto) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{6} } +var xxx_messageInfo_VoidProto proto.InternalMessageInfo func init() { proto.RegisterType((*StringProto)(nil), "appengine.base.StringProto") @@ -155,10 +287,10 @@ func init() { } func init() { - proto.RegisterFile("google.golang.org/appengine/internal/base/api_base.proto", fileDescriptor0) + proto.RegisterFile("google.golang.org/appengine/internal/base/api_base.proto", fileDescriptor_api_base_9d49f8792e0c1140) } -var fileDescriptor0 = []byte{ +var fileDescriptor_api_base_9d49f8792e0c1140 = []byte{ // 199 bytes of a gzipped FileDescriptorProto 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x6c, 0xcf, 0x3f, 0x4b, 0xc6, 0x30, 0x10, 0x06, 0x70, 0x5a, 0xad, 0xb4, 0x57, 0xe9, 0x20, 0x0e, 0x1d, 0xb5, 0x05, 0x71, 0x4a, 0x40, diff --git a/vendor/google.golang.org/appengine/internal/datastore/datastore_v3.pb.go b/vendor/google.golang.org/appengine/internal/datastore/datastore_v3.pb.go index 393342c1..2fb74828 100644 --- a/vendor/google.golang.org/appengine/internal/datastore/datastore_v3.pb.go +++ b/vendor/google.golang.org/appengine/internal/datastore/datastore_v3.pb.go @@ -1,52 +1,6 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // source: google.golang.org/appengine/internal/datastore/datastore_v3.proto -/* -Package datastore is a generated protocol buffer package. - -It is generated from these files: - google.golang.org/appengine/internal/datastore/datastore_v3.proto - -It has these top-level messages: - Action - PropertyValue - Property - Path - Reference - User - EntityProto - CompositeProperty - Index - CompositeIndex - IndexPostfix - IndexPosition - Snapshot - InternalHeader - Transaction - Query - CompiledQuery - CompiledCursor - Cursor - Error - Cost - GetRequest - GetResponse - PutRequest - PutResponse - TouchRequest - TouchResponse - DeleteRequest - DeleteResponse - NextRequest - QueryResult - AllocateIdsRequest - AllocateIdsResponse - CompositeIndices - AddActionsRequest - AddActionsResponse - BeginTransactionRequest - CommitResponse -*/ package datastore import proto "github.com/golang/protobuf/proto" @@ -150,7 +104,9 @@ func (x *Property_Meaning) UnmarshalJSON(data []byte) error { *x = Property_Meaning(value) return nil } -func (Property_Meaning) EnumDescriptor() ([]byte, []int) { return fileDescriptor0, []int{2, 0} } +func (Property_Meaning) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{2, 0} +} type Property_FtsTokenizationOption int32 @@ -185,7 +141,7 @@ func (x *Property_FtsTokenizationOption) UnmarshalJSON(data []byte) error { return nil } func (Property_FtsTokenizationOption) EnumDescriptor() ([]byte, []int) { - return fileDescriptor0, []int{2, 1} + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{2, 1} } type EntityProto_Kind int32 @@ -223,7 +179,9 @@ func (x *EntityProto_Kind) UnmarshalJSON(data []byte) error { *x = EntityProto_Kind(value) return nil } -func (EntityProto_Kind) EnumDescriptor() ([]byte, []int) { return fileDescriptor0, []int{6, 0} } +func (EntityProto_Kind) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{6, 0} +} type Index_Property_Direction int32 @@ -258,7 +216,7 @@ func (x *Index_Property_Direction) UnmarshalJSON(data []byte) error { return nil } func (Index_Property_Direction) EnumDescriptor() ([]byte, []int) { - return fileDescriptor0, []int{8, 0, 0} + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{8, 0, 0} } type CompositeIndex_State int32 @@ -299,7 +257,9 @@ func (x *CompositeIndex_State) UnmarshalJSON(data []byte) error { *x = CompositeIndex_State(value) return nil } -func (CompositeIndex_State) EnumDescriptor() ([]byte, []int) { return fileDescriptor0, []int{9, 0} } +func (CompositeIndex_State) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{9, 0} +} type Snapshot_Status int32 @@ -333,7 +293,9 @@ func (x *Snapshot_Status) UnmarshalJSON(data []byte) error { *x = Snapshot_Status(value) return nil } -func (Snapshot_Status) EnumDescriptor() ([]byte, []int) { return fileDescriptor0, []int{12, 0} } +func (Snapshot_Status) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{12, 0} +} type Query_Hint int32 @@ -370,7 +332,9 @@ func (x *Query_Hint) UnmarshalJSON(data []byte) error { *x = Query_Hint(value) return nil } -func (Query_Hint) EnumDescriptor() ([]byte, []int) { return fileDescriptor0, []int{15, 0} } +func (Query_Hint) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{15, 0} +} type Query_Filter_Operator int32 @@ -419,7 +383,9 @@ func (x *Query_Filter_Operator) UnmarshalJSON(data []byte) error { *x = Query_Filter_Operator(value) return nil } -func (Query_Filter_Operator) EnumDescriptor() ([]byte, []int) { return fileDescriptor0, []int{15, 0, 0} } +func (Query_Filter_Operator) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{15, 0, 0} +} type Query_Order_Direction int32 @@ -453,7 +419,9 @@ func (x *Query_Order_Direction) UnmarshalJSON(data []byte) error { *x = Query_Order_Direction(value) return nil } -func (Query_Order_Direction) EnumDescriptor() ([]byte, []int) { return fileDescriptor0, []int{15, 1, 0} } +func (Query_Order_Direction) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{15, 1, 0} +} type Error_ErrorCode int32 @@ -514,7 +482,9 @@ func (x *Error_ErrorCode) UnmarshalJSON(data []byte) error { *x = Error_ErrorCode(value) return nil } -func (Error_ErrorCode) EnumDescriptor() ([]byte, []int) { return fileDescriptor0, []int{19, 0} } +func (Error_ErrorCode) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{19, 0} +} type PutRequest_AutoIdPolicy int32 @@ -548,7 +518,9 @@ func (x *PutRequest_AutoIdPolicy) UnmarshalJSON(data []byte) error { *x = PutRequest_AutoIdPolicy(value) return nil } -func (PutRequest_AutoIdPolicy) EnumDescriptor() ([]byte, []int) { return fileDescriptor0, []int{23, 0} } +func (PutRequest_AutoIdPolicy) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{23, 0} +} type BeginTransactionRequest_TransactionMode int32 @@ -586,33 +558,75 @@ func (x *BeginTransactionRequest_TransactionMode) UnmarshalJSON(data []byte) err return nil } func (BeginTransactionRequest_TransactionMode) EnumDescriptor() ([]byte, []int) { - return fileDescriptor0, []int{36, 0} + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{36, 0} } type Action struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *Action) Reset() { *m = Action{} } -func (m *Action) String() string { return proto.CompactTextString(m) } -func (*Action) ProtoMessage() {} -func (*Action) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{0} } +func (m *Action) Reset() { *m = Action{} } +func (m *Action) String() string { return proto.CompactTextString(m) } +func (*Action) ProtoMessage() {} +func (*Action) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{0} +} +func (m *Action) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Action.Unmarshal(m, b) +} +func (m *Action) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Action.Marshal(b, m, deterministic) +} +func (dst *Action) XXX_Merge(src proto.Message) { + xxx_messageInfo_Action.Merge(dst, src) +} +func (m *Action) XXX_Size() int { + return xxx_messageInfo_Action.Size(m) +} +func (m *Action) XXX_DiscardUnknown() { + xxx_messageInfo_Action.DiscardUnknown(m) +} + +var xxx_messageInfo_Action proto.InternalMessageInfo type PropertyValue struct { - Int64Value *int64 `protobuf:"varint,1,opt,name=int64Value" json:"int64Value,omitempty"` - BooleanValue *bool `protobuf:"varint,2,opt,name=booleanValue" json:"booleanValue,omitempty"` - StringValue *string `protobuf:"bytes,3,opt,name=stringValue" json:"stringValue,omitempty"` - DoubleValue *float64 `protobuf:"fixed64,4,opt,name=doubleValue" json:"doubleValue,omitempty"` - Pointvalue *PropertyValue_PointValue `protobuf:"group,5,opt,name=PointValue,json=pointvalue" json:"pointvalue,omitempty"` - Uservalue *PropertyValue_UserValue `protobuf:"group,8,opt,name=UserValue,json=uservalue" json:"uservalue,omitempty"` - Referencevalue *PropertyValue_ReferenceValue `protobuf:"group,12,opt,name=ReferenceValue,json=referencevalue" json:"referencevalue,omitempty"` - XXX_unrecognized []byte `json:"-"` + Int64Value *int64 `protobuf:"varint,1,opt,name=int64Value" json:"int64Value,omitempty"` + BooleanValue *bool `protobuf:"varint,2,opt,name=booleanValue" json:"booleanValue,omitempty"` + StringValue *string `protobuf:"bytes,3,opt,name=stringValue" json:"stringValue,omitempty"` + DoubleValue *float64 `protobuf:"fixed64,4,opt,name=doubleValue" json:"doubleValue,omitempty"` + Pointvalue *PropertyValue_PointValue `protobuf:"group,5,opt,name=PointValue,json=pointvalue" json:"pointvalue,omitempty"` + Uservalue *PropertyValue_UserValue `protobuf:"group,8,opt,name=UserValue,json=uservalue" json:"uservalue,omitempty"` + Referencevalue *PropertyValue_ReferenceValue `protobuf:"group,12,opt,name=ReferenceValue,json=referencevalue" json:"referencevalue,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *PropertyValue) Reset() { *m = PropertyValue{} } +func (m *PropertyValue) String() string { return proto.CompactTextString(m) } +func (*PropertyValue) ProtoMessage() {} +func (*PropertyValue) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{1} +} +func (m *PropertyValue) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_PropertyValue.Unmarshal(m, b) +} +func (m *PropertyValue) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_PropertyValue.Marshal(b, m, deterministic) +} +func (dst *PropertyValue) XXX_Merge(src proto.Message) { + xxx_messageInfo_PropertyValue.Merge(dst, src) +} +func (m *PropertyValue) XXX_Size() int { + return xxx_messageInfo_PropertyValue.Size(m) +} +func (m *PropertyValue) XXX_DiscardUnknown() { + xxx_messageInfo_PropertyValue.DiscardUnknown(m) } -func (m *PropertyValue) Reset() { *m = PropertyValue{} } -func (m *PropertyValue) String() string { return proto.CompactTextString(m) } -func (*PropertyValue) ProtoMessage() {} -func (*PropertyValue) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1} } +var xxx_messageInfo_PropertyValue proto.InternalMessageInfo func (m *PropertyValue) GetInt64Value() int64 { if m != nil && m.Int64Value != nil { @@ -664,15 +678,36 @@ func (m *PropertyValue) GetReferencevalue() *PropertyValue_ReferenceValue { } type PropertyValue_PointValue struct { - X *float64 `protobuf:"fixed64,6,req,name=x" json:"x,omitempty"` - Y *float64 `protobuf:"fixed64,7,req,name=y" json:"y,omitempty"` - XXX_unrecognized []byte `json:"-"` + X *float64 `protobuf:"fixed64,6,req,name=x" json:"x,omitempty"` + Y *float64 `protobuf:"fixed64,7,req,name=y" json:"y,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *PropertyValue_PointValue) Reset() { *m = PropertyValue_PointValue{} } +func (m *PropertyValue_PointValue) String() string { return proto.CompactTextString(m) } +func (*PropertyValue_PointValue) ProtoMessage() {} +func (*PropertyValue_PointValue) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{1, 0} +} +func (m *PropertyValue_PointValue) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_PropertyValue_PointValue.Unmarshal(m, b) +} +func (m *PropertyValue_PointValue) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_PropertyValue_PointValue.Marshal(b, m, deterministic) +} +func (dst *PropertyValue_PointValue) XXX_Merge(src proto.Message) { + xxx_messageInfo_PropertyValue_PointValue.Merge(dst, src) +} +func (m *PropertyValue_PointValue) XXX_Size() int { + return xxx_messageInfo_PropertyValue_PointValue.Size(m) +} +func (m *PropertyValue_PointValue) XXX_DiscardUnknown() { + xxx_messageInfo_PropertyValue_PointValue.DiscardUnknown(m) } -func (m *PropertyValue_PointValue) Reset() { *m = PropertyValue_PointValue{} } -func (m *PropertyValue_PointValue) String() string { return proto.CompactTextString(m) } -func (*PropertyValue_PointValue) ProtoMessage() {} -func (*PropertyValue_PointValue) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1, 0} } +var xxx_messageInfo_PropertyValue_PointValue proto.InternalMessageInfo func (m *PropertyValue_PointValue) GetX() float64 { if m != nil && m.X != nil { @@ -689,18 +724,39 @@ func (m *PropertyValue_PointValue) GetY() float64 { } type PropertyValue_UserValue struct { - Email *string `protobuf:"bytes,9,req,name=email" json:"email,omitempty"` - AuthDomain *string `protobuf:"bytes,10,req,name=auth_domain,json=authDomain" json:"auth_domain,omitempty"` - Nickname *string `protobuf:"bytes,11,opt,name=nickname" json:"nickname,omitempty"` - FederatedIdentity *string `protobuf:"bytes,21,opt,name=federated_identity,json=federatedIdentity" json:"federated_identity,omitempty"` - FederatedProvider *string `protobuf:"bytes,22,opt,name=federated_provider,json=federatedProvider" json:"federated_provider,omitempty"` - XXX_unrecognized []byte `json:"-"` + Email *string `protobuf:"bytes,9,req,name=email" json:"email,omitempty"` + AuthDomain *string `protobuf:"bytes,10,req,name=auth_domain,json=authDomain" json:"auth_domain,omitempty"` + Nickname *string `protobuf:"bytes,11,opt,name=nickname" json:"nickname,omitempty"` + FederatedIdentity *string `protobuf:"bytes,21,opt,name=federated_identity,json=federatedIdentity" json:"federated_identity,omitempty"` + FederatedProvider *string `protobuf:"bytes,22,opt,name=federated_provider,json=federatedProvider" json:"federated_provider,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *PropertyValue_UserValue) Reset() { *m = PropertyValue_UserValue{} } -func (m *PropertyValue_UserValue) String() string { return proto.CompactTextString(m) } -func (*PropertyValue_UserValue) ProtoMessage() {} -func (*PropertyValue_UserValue) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1, 1} } +func (m *PropertyValue_UserValue) Reset() { *m = PropertyValue_UserValue{} } +func (m *PropertyValue_UserValue) String() string { return proto.CompactTextString(m) } +func (*PropertyValue_UserValue) ProtoMessage() {} +func (*PropertyValue_UserValue) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{1, 1} +} +func (m *PropertyValue_UserValue) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_PropertyValue_UserValue.Unmarshal(m, b) +} +func (m *PropertyValue_UserValue) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_PropertyValue_UserValue.Marshal(b, m, deterministic) +} +func (dst *PropertyValue_UserValue) XXX_Merge(src proto.Message) { + xxx_messageInfo_PropertyValue_UserValue.Merge(dst, src) +} +func (m *PropertyValue_UserValue) XXX_Size() int { + return xxx_messageInfo_PropertyValue_UserValue.Size(m) +} +func (m *PropertyValue_UserValue) XXX_DiscardUnknown() { + xxx_messageInfo_PropertyValue_UserValue.DiscardUnknown(m) +} + +var xxx_messageInfo_PropertyValue_UserValue proto.InternalMessageInfo func (m *PropertyValue_UserValue) GetEmail() string { if m != nil && m.Email != nil { @@ -738,16 +794,37 @@ func (m *PropertyValue_UserValue) GetFederatedProvider() string { } type PropertyValue_ReferenceValue struct { - App *string `protobuf:"bytes,13,req,name=app" json:"app,omitempty"` - NameSpace *string `protobuf:"bytes,20,opt,name=name_space,json=nameSpace" json:"name_space,omitempty"` - Pathelement []*PropertyValue_ReferenceValue_PathElement `protobuf:"group,14,rep,name=PathElement,json=pathelement" json:"pathelement,omitempty"` - XXX_unrecognized []byte `json:"-"` + App *string `protobuf:"bytes,13,req,name=app" json:"app,omitempty"` + NameSpace *string `protobuf:"bytes,20,opt,name=name_space,json=nameSpace" json:"name_space,omitempty"` + Pathelement []*PropertyValue_ReferenceValue_PathElement `protobuf:"group,14,rep,name=PathElement,json=pathelement" json:"pathelement,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *PropertyValue_ReferenceValue) Reset() { *m = PropertyValue_ReferenceValue{} } -func (m *PropertyValue_ReferenceValue) String() string { return proto.CompactTextString(m) } -func (*PropertyValue_ReferenceValue) ProtoMessage() {} -func (*PropertyValue_ReferenceValue) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1, 2} } +func (m *PropertyValue_ReferenceValue) Reset() { *m = PropertyValue_ReferenceValue{} } +func (m *PropertyValue_ReferenceValue) String() string { return proto.CompactTextString(m) } +func (*PropertyValue_ReferenceValue) ProtoMessage() {} +func (*PropertyValue_ReferenceValue) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{1, 2} +} +func (m *PropertyValue_ReferenceValue) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_PropertyValue_ReferenceValue.Unmarshal(m, b) +} +func (m *PropertyValue_ReferenceValue) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_PropertyValue_ReferenceValue.Marshal(b, m, deterministic) +} +func (dst *PropertyValue_ReferenceValue) XXX_Merge(src proto.Message) { + xxx_messageInfo_PropertyValue_ReferenceValue.Merge(dst, src) +} +func (m *PropertyValue_ReferenceValue) XXX_Size() int { + return xxx_messageInfo_PropertyValue_ReferenceValue.Size(m) +} +func (m *PropertyValue_ReferenceValue) XXX_DiscardUnknown() { + xxx_messageInfo_PropertyValue_ReferenceValue.DiscardUnknown(m) +} + +var xxx_messageInfo_PropertyValue_ReferenceValue proto.InternalMessageInfo func (m *PropertyValue_ReferenceValue) GetApp() string { if m != nil && m.App != nil { @@ -771,10 +848,12 @@ func (m *PropertyValue_ReferenceValue) GetPathelement() []*PropertyValue_Referen } type PropertyValue_ReferenceValue_PathElement struct { - Type *string `protobuf:"bytes,15,req,name=type" json:"type,omitempty"` - Id *int64 `protobuf:"varint,16,opt,name=id" json:"id,omitempty"` - Name *string `protobuf:"bytes,17,opt,name=name" json:"name,omitempty"` - XXX_unrecognized []byte `json:"-"` + Type *string `protobuf:"bytes,15,req,name=type" json:"type,omitempty"` + Id *int64 `protobuf:"varint,16,opt,name=id" json:"id,omitempty"` + Name *string `protobuf:"bytes,17,opt,name=name" json:"name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } func (m *PropertyValue_ReferenceValue_PathElement) Reset() { @@ -783,8 +862,25 @@ func (m *PropertyValue_ReferenceValue_PathElement) Reset() { func (m *PropertyValue_ReferenceValue_PathElement) String() string { return proto.CompactTextString(m) } func (*PropertyValue_ReferenceValue_PathElement) ProtoMessage() {} func (*PropertyValue_ReferenceValue_PathElement) Descriptor() ([]byte, []int) { - return fileDescriptor0, []int{1, 2, 0} + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{1, 2, 0} } +func (m *PropertyValue_ReferenceValue_PathElement) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_PropertyValue_ReferenceValue_PathElement.Unmarshal(m, b) +} +func (m *PropertyValue_ReferenceValue_PathElement) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_PropertyValue_ReferenceValue_PathElement.Marshal(b, m, deterministic) +} +func (dst *PropertyValue_ReferenceValue_PathElement) XXX_Merge(src proto.Message) { + xxx_messageInfo_PropertyValue_ReferenceValue_PathElement.Merge(dst, src) +} +func (m *PropertyValue_ReferenceValue_PathElement) XXX_Size() int { + return xxx_messageInfo_PropertyValue_ReferenceValue_PathElement.Size(m) +} +func (m *PropertyValue_ReferenceValue_PathElement) XXX_DiscardUnknown() { + xxx_messageInfo_PropertyValue_ReferenceValue_PathElement.DiscardUnknown(m) +} + +var xxx_messageInfo_PropertyValue_ReferenceValue_PathElement proto.InternalMessageInfo func (m *PropertyValue_ReferenceValue_PathElement) GetType() string { if m != nil && m.Type != nil { @@ -816,13 +912,34 @@ type Property struct { Searchable *bool `protobuf:"varint,6,opt,name=searchable,def=0" json:"searchable,omitempty"` FtsTokenizationOption *Property_FtsTokenizationOption `protobuf:"varint,8,opt,name=fts_tokenization_option,json=ftsTokenizationOption,enum=appengine.Property_FtsTokenizationOption" json:"fts_tokenization_option,omitempty"` Locale *string `protobuf:"bytes,9,opt,name=locale,def=en" json:"locale,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *Property) Reset() { *m = Property{} } -func (m *Property) String() string { return proto.CompactTextString(m) } -func (*Property) ProtoMessage() {} -func (*Property) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{2} } +func (m *Property) Reset() { *m = Property{} } +func (m *Property) String() string { return proto.CompactTextString(m) } +func (*Property) ProtoMessage() {} +func (*Property) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{2} +} +func (m *Property) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Property.Unmarshal(m, b) +} +func (m *Property) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Property.Marshal(b, m, deterministic) +} +func (dst *Property) XXX_Merge(src proto.Message) { + xxx_messageInfo_Property.Merge(dst, src) +} +func (m *Property) XXX_Size() int { + return xxx_messageInfo_Property.Size(m) +} +func (m *Property) XXX_DiscardUnknown() { + xxx_messageInfo_Property.DiscardUnknown(m) +} + +var xxx_messageInfo_Property proto.InternalMessageInfo const Default_Property_Meaning Property_Meaning = Property_NO_MEANING const Default_Property_Searchable bool = false @@ -885,14 +1002,35 @@ func (m *Property) GetLocale() string { } type Path struct { - Element []*Path_Element `protobuf:"group,1,rep,name=Element,json=element" json:"element,omitempty"` - XXX_unrecognized []byte `json:"-"` + Element []*Path_Element `protobuf:"group,1,rep,name=Element,json=element" json:"element,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *Path) Reset() { *m = Path{} } -func (m *Path) String() string { return proto.CompactTextString(m) } -func (*Path) ProtoMessage() {} -func (*Path) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{3} } +func (m *Path) Reset() { *m = Path{} } +func (m *Path) String() string { return proto.CompactTextString(m) } +func (*Path) ProtoMessage() {} +func (*Path) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{3} +} +func (m *Path) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Path.Unmarshal(m, b) +} +func (m *Path) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Path.Marshal(b, m, deterministic) +} +func (dst *Path) XXX_Merge(src proto.Message) { + xxx_messageInfo_Path.Merge(dst, src) +} +func (m *Path) XXX_Size() int { + return xxx_messageInfo_Path.Size(m) +} +func (m *Path) XXX_DiscardUnknown() { + xxx_messageInfo_Path.DiscardUnknown(m) +} + +var xxx_messageInfo_Path proto.InternalMessageInfo func (m *Path) GetElement() []*Path_Element { if m != nil { @@ -902,16 +1040,37 @@ func (m *Path) GetElement() []*Path_Element { } type Path_Element struct { - Type *string `protobuf:"bytes,2,req,name=type" json:"type,omitempty"` - Id *int64 `protobuf:"varint,3,opt,name=id" json:"id,omitempty"` - Name *string `protobuf:"bytes,4,opt,name=name" json:"name,omitempty"` - XXX_unrecognized []byte `json:"-"` + Type *string `protobuf:"bytes,2,req,name=type" json:"type,omitempty"` + Id *int64 `protobuf:"varint,3,opt,name=id" json:"id,omitempty"` + Name *string `protobuf:"bytes,4,opt,name=name" json:"name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Path_Element) Reset() { *m = Path_Element{} } +func (m *Path_Element) String() string { return proto.CompactTextString(m) } +func (*Path_Element) ProtoMessage() {} +func (*Path_Element) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{3, 0} +} +func (m *Path_Element) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Path_Element.Unmarshal(m, b) +} +func (m *Path_Element) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Path_Element.Marshal(b, m, deterministic) +} +func (dst *Path_Element) XXX_Merge(src proto.Message) { + xxx_messageInfo_Path_Element.Merge(dst, src) +} +func (m *Path_Element) XXX_Size() int { + return xxx_messageInfo_Path_Element.Size(m) +} +func (m *Path_Element) XXX_DiscardUnknown() { + xxx_messageInfo_Path_Element.DiscardUnknown(m) } -func (m *Path_Element) Reset() { *m = Path_Element{} } -func (m *Path_Element) String() string { return proto.CompactTextString(m) } -func (*Path_Element) ProtoMessage() {} -func (*Path_Element) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{3, 0} } +var xxx_messageInfo_Path_Element proto.InternalMessageInfo func (m *Path_Element) GetType() string { if m != nil && m.Type != nil { @@ -935,16 +1094,37 @@ func (m *Path_Element) GetName() string { } type Reference struct { - App *string `protobuf:"bytes,13,req,name=app" json:"app,omitempty"` - NameSpace *string `protobuf:"bytes,20,opt,name=name_space,json=nameSpace" json:"name_space,omitempty"` - Path *Path `protobuf:"bytes,14,req,name=path" json:"path,omitempty"` - XXX_unrecognized []byte `json:"-"` + App *string `protobuf:"bytes,13,req,name=app" json:"app,omitempty"` + NameSpace *string `protobuf:"bytes,20,opt,name=name_space,json=nameSpace" json:"name_space,omitempty"` + Path *Path `protobuf:"bytes,14,req,name=path" json:"path,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *Reference) Reset() { *m = Reference{} } -func (m *Reference) String() string { return proto.CompactTextString(m) } -func (*Reference) ProtoMessage() {} -func (*Reference) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{4} } +func (m *Reference) Reset() { *m = Reference{} } +func (m *Reference) String() string { return proto.CompactTextString(m) } +func (*Reference) ProtoMessage() {} +func (*Reference) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{4} +} +func (m *Reference) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Reference.Unmarshal(m, b) +} +func (m *Reference) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Reference.Marshal(b, m, deterministic) +} +func (dst *Reference) XXX_Merge(src proto.Message) { + xxx_messageInfo_Reference.Merge(dst, src) +} +func (m *Reference) XXX_Size() int { + return xxx_messageInfo_Reference.Size(m) +} +func (m *Reference) XXX_DiscardUnknown() { + xxx_messageInfo_Reference.DiscardUnknown(m) +} + +var xxx_messageInfo_Reference proto.InternalMessageInfo func (m *Reference) GetApp() string { if m != nil && m.App != nil { @@ -968,18 +1148,39 @@ func (m *Reference) GetPath() *Path { } type User struct { - Email *string `protobuf:"bytes,1,req,name=email" json:"email,omitempty"` - AuthDomain *string `protobuf:"bytes,2,req,name=auth_domain,json=authDomain" json:"auth_domain,omitempty"` - Nickname *string `protobuf:"bytes,3,opt,name=nickname" json:"nickname,omitempty"` - FederatedIdentity *string `protobuf:"bytes,6,opt,name=federated_identity,json=federatedIdentity" json:"federated_identity,omitempty"` - FederatedProvider *string `protobuf:"bytes,7,opt,name=federated_provider,json=federatedProvider" json:"federated_provider,omitempty"` - XXX_unrecognized []byte `json:"-"` + Email *string `protobuf:"bytes,1,req,name=email" json:"email,omitempty"` + AuthDomain *string `protobuf:"bytes,2,req,name=auth_domain,json=authDomain" json:"auth_domain,omitempty"` + Nickname *string `protobuf:"bytes,3,opt,name=nickname" json:"nickname,omitempty"` + FederatedIdentity *string `protobuf:"bytes,6,opt,name=federated_identity,json=federatedIdentity" json:"federated_identity,omitempty"` + FederatedProvider *string `protobuf:"bytes,7,opt,name=federated_provider,json=federatedProvider" json:"federated_provider,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *User) Reset() { *m = User{} } +func (m *User) String() string { return proto.CompactTextString(m) } +func (*User) ProtoMessage() {} +func (*User) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{5} +} +func (m *User) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_User.Unmarshal(m, b) +} +func (m *User) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_User.Marshal(b, m, deterministic) +} +func (dst *User) XXX_Merge(src proto.Message) { + xxx_messageInfo_User.Merge(dst, src) +} +func (m *User) XXX_Size() int { + return xxx_messageInfo_User.Size(m) +} +func (m *User) XXX_DiscardUnknown() { + xxx_messageInfo_User.DiscardUnknown(m) } -func (m *User) Reset() { *m = User{} } -func (m *User) String() string { return proto.CompactTextString(m) } -func (*User) ProtoMessage() {} -func (*User) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{5} } +var xxx_messageInfo_User proto.InternalMessageInfo func (m *User) GetEmail() string { if m != nil && m.Email != nil { @@ -1017,21 +1218,42 @@ func (m *User) GetFederatedProvider() string { } type EntityProto struct { - Key *Reference `protobuf:"bytes,13,req,name=key" json:"key,omitempty"` - EntityGroup *Path `protobuf:"bytes,16,req,name=entity_group,json=entityGroup" json:"entity_group,omitempty"` - Owner *User `protobuf:"bytes,17,opt,name=owner" json:"owner,omitempty"` - Kind *EntityProto_Kind `protobuf:"varint,4,opt,name=kind,enum=appengine.EntityProto_Kind" json:"kind,omitempty"` - KindUri *string `protobuf:"bytes,5,opt,name=kind_uri,json=kindUri" json:"kind_uri,omitempty"` - Property []*Property `protobuf:"bytes,14,rep,name=property" json:"property,omitempty"` - RawProperty []*Property `protobuf:"bytes,15,rep,name=raw_property,json=rawProperty" json:"raw_property,omitempty"` - Rank *int32 `protobuf:"varint,18,opt,name=rank" json:"rank,omitempty"` - XXX_unrecognized []byte `json:"-"` -} - -func (m *EntityProto) Reset() { *m = EntityProto{} } -func (m *EntityProto) String() string { return proto.CompactTextString(m) } -func (*EntityProto) ProtoMessage() {} -func (*EntityProto) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{6} } + Key *Reference `protobuf:"bytes,13,req,name=key" json:"key,omitempty"` + EntityGroup *Path `protobuf:"bytes,16,req,name=entity_group,json=entityGroup" json:"entity_group,omitempty"` + Owner *User `protobuf:"bytes,17,opt,name=owner" json:"owner,omitempty"` + Kind *EntityProto_Kind `protobuf:"varint,4,opt,name=kind,enum=appengine.EntityProto_Kind" json:"kind,omitempty"` + KindUri *string `protobuf:"bytes,5,opt,name=kind_uri,json=kindUri" json:"kind_uri,omitempty"` + Property []*Property `protobuf:"bytes,14,rep,name=property" json:"property,omitempty"` + RawProperty []*Property `protobuf:"bytes,15,rep,name=raw_property,json=rawProperty" json:"raw_property,omitempty"` + Rank *int32 `protobuf:"varint,18,opt,name=rank" json:"rank,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *EntityProto) Reset() { *m = EntityProto{} } +func (m *EntityProto) String() string { return proto.CompactTextString(m) } +func (*EntityProto) ProtoMessage() {} +func (*EntityProto) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{6} +} +func (m *EntityProto) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_EntityProto.Unmarshal(m, b) +} +func (m *EntityProto) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_EntityProto.Marshal(b, m, deterministic) +} +func (dst *EntityProto) XXX_Merge(src proto.Message) { + xxx_messageInfo_EntityProto.Merge(dst, src) +} +func (m *EntityProto) XXX_Size() int { + return xxx_messageInfo_EntityProto.Size(m) +} +func (m *EntityProto) XXX_DiscardUnknown() { + xxx_messageInfo_EntityProto.DiscardUnknown(m) +} + +var xxx_messageInfo_EntityProto proto.InternalMessageInfo func (m *EntityProto) GetKey() *Reference { if m != nil { @@ -1090,15 +1312,36 @@ func (m *EntityProto) GetRank() int32 { } type CompositeProperty struct { - IndexId *int64 `protobuf:"varint,1,req,name=index_id,json=indexId" json:"index_id,omitempty"` - Value []string `protobuf:"bytes,2,rep,name=value" json:"value,omitempty"` - XXX_unrecognized []byte `json:"-"` + IndexId *int64 `protobuf:"varint,1,req,name=index_id,json=indexId" json:"index_id,omitempty"` + Value []string `protobuf:"bytes,2,rep,name=value" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *CompositeProperty) Reset() { *m = CompositeProperty{} } -func (m *CompositeProperty) String() string { return proto.CompactTextString(m) } -func (*CompositeProperty) ProtoMessage() {} -func (*CompositeProperty) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{7} } +func (m *CompositeProperty) Reset() { *m = CompositeProperty{} } +func (m *CompositeProperty) String() string { return proto.CompactTextString(m) } +func (*CompositeProperty) ProtoMessage() {} +func (*CompositeProperty) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{7} +} +func (m *CompositeProperty) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_CompositeProperty.Unmarshal(m, b) +} +func (m *CompositeProperty) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_CompositeProperty.Marshal(b, m, deterministic) +} +func (dst *CompositeProperty) XXX_Merge(src proto.Message) { + xxx_messageInfo_CompositeProperty.Merge(dst, src) +} +func (m *CompositeProperty) XXX_Size() int { + return xxx_messageInfo_CompositeProperty.Size(m) +} +func (m *CompositeProperty) XXX_DiscardUnknown() { + xxx_messageInfo_CompositeProperty.DiscardUnknown(m) +} + +var xxx_messageInfo_CompositeProperty proto.InternalMessageInfo func (m *CompositeProperty) GetIndexId() int64 { if m != nil && m.IndexId != nil { @@ -1115,16 +1358,37 @@ func (m *CompositeProperty) GetValue() []string { } type Index struct { - EntityType *string `protobuf:"bytes,1,req,name=entity_type,json=entityType" json:"entity_type,omitempty"` - Ancestor *bool `protobuf:"varint,5,req,name=ancestor" json:"ancestor,omitempty"` - Property []*Index_Property `protobuf:"group,2,rep,name=Property,json=property" json:"property,omitempty"` - XXX_unrecognized []byte `json:"-"` + EntityType *string `protobuf:"bytes,1,req,name=entity_type,json=entityType" json:"entity_type,omitempty"` + Ancestor *bool `protobuf:"varint,5,req,name=ancestor" json:"ancestor,omitempty"` + Property []*Index_Property `protobuf:"group,2,rep,name=Property,json=property" json:"property,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *Index) Reset() { *m = Index{} } -func (m *Index) String() string { return proto.CompactTextString(m) } -func (*Index) ProtoMessage() {} -func (*Index) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{8} } +func (m *Index) Reset() { *m = Index{} } +func (m *Index) String() string { return proto.CompactTextString(m) } +func (*Index) ProtoMessage() {} +func (*Index) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{8} +} +func (m *Index) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Index.Unmarshal(m, b) +} +func (m *Index) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Index.Marshal(b, m, deterministic) +} +func (dst *Index) XXX_Merge(src proto.Message) { + xxx_messageInfo_Index.Merge(dst, src) +} +func (m *Index) XXX_Size() int { + return xxx_messageInfo_Index.Size(m) +} +func (m *Index) XXX_DiscardUnknown() { + xxx_messageInfo_Index.DiscardUnknown(m) +} + +var xxx_messageInfo_Index proto.InternalMessageInfo func (m *Index) GetEntityType() string { if m != nil && m.EntityType != nil { @@ -1148,15 +1412,36 @@ func (m *Index) GetProperty() []*Index_Property { } type Index_Property struct { - Name *string `protobuf:"bytes,3,req,name=name" json:"name,omitempty"` - Direction *Index_Property_Direction `protobuf:"varint,4,opt,name=direction,enum=appengine.Index_Property_Direction,def=1" json:"direction,omitempty"` - XXX_unrecognized []byte `json:"-"` + Name *string `protobuf:"bytes,3,req,name=name" json:"name,omitempty"` + Direction *Index_Property_Direction `protobuf:"varint,4,opt,name=direction,enum=appengine.Index_Property_Direction,def=1" json:"direction,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *Index_Property) Reset() { *m = Index_Property{} } -func (m *Index_Property) String() string { return proto.CompactTextString(m) } -func (*Index_Property) ProtoMessage() {} -func (*Index_Property) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{8, 0} } +func (m *Index_Property) Reset() { *m = Index_Property{} } +func (m *Index_Property) String() string { return proto.CompactTextString(m) } +func (*Index_Property) ProtoMessage() {} +func (*Index_Property) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{8, 0} +} +func (m *Index_Property) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Index_Property.Unmarshal(m, b) +} +func (m *Index_Property) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Index_Property.Marshal(b, m, deterministic) +} +func (dst *Index_Property) XXX_Merge(src proto.Message) { + xxx_messageInfo_Index_Property.Merge(dst, src) +} +func (m *Index_Property) XXX_Size() int { + return xxx_messageInfo_Index_Property.Size(m) +} +func (m *Index_Property) XXX_DiscardUnknown() { + xxx_messageInfo_Index_Property.DiscardUnknown(m) +} + +var xxx_messageInfo_Index_Property proto.InternalMessageInfo const Default_Index_Property_Direction Index_Property_Direction = Index_Property_ASCENDING @@ -1175,18 +1460,39 @@ func (m *Index_Property) GetDirection() Index_Property_Direction { } type CompositeIndex struct { - AppId *string `protobuf:"bytes,1,req,name=app_id,json=appId" json:"app_id,omitempty"` - Id *int64 `protobuf:"varint,2,req,name=id" json:"id,omitempty"` - Definition *Index `protobuf:"bytes,3,req,name=definition" json:"definition,omitempty"` - State *CompositeIndex_State `protobuf:"varint,4,req,name=state,enum=appengine.CompositeIndex_State" json:"state,omitempty"` - OnlyUseIfRequired *bool `protobuf:"varint,6,opt,name=only_use_if_required,json=onlyUseIfRequired,def=0" json:"only_use_if_required,omitempty"` - XXX_unrecognized []byte `json:"-"` + AppId *string `protobuf:"bytes,1,req,name=app_id,json=appId" json:"app_id,omitempty"` + Id *int64 `protobuf:"varint,2,req,name=id" json:"id,omitempty"` + Definition *Index `protobuf:"bytes,3,req,name=definition" json:"definition,omitempty"` + State *CompositeIndex_State `protobuf:"varint,4,req,name=state,enum=appengine.CompositeIndex_State" json:"state,omitempty"` + OnlyUseIfRequired *bool `protobuf:"varint,6,opt,name=only_use_if_required,json=onlyUseIfRequired,def=0" json:"only_use_if_required,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CompositeIndex) Reset() { *m = CompositeIndex{} } +func (m *CompositeIndex) String() string { return proto.CompactTextString(m) } +func (*CompositeIndex) ProtoMessage() {} +func (*CompositeIndex) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{9} +} +func (m *CompositeIndex) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_CompositeIndex.Unmarshal(m, b) +} +func (m *CompositeIndex) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_CompositeIndex.Marshal(b, m, deterministic) +} +func (dst *CompositeIndex) XXX_Merge(src proto.Message) { + xxx_messageInfo_CompositeIndex.Merge(dst, src) +} +func (m *CompositeIndex) XXX_Size() int { + return xxx_messageInfo_CompositeIndex.Size(m) +} +func (m *CompositeIndex) XXX_DiscardUnknown() { + xxx_messageInfo_CompositeIndex.DiscardUnknown(m) } -func (m *CompositeIndex) Reset() { *m = CompositeIndex{} } -func (m *CompositeIndex) String() string { return proto.CompactTextString(m) } -func (*CompositeIndex) ProtoMessage() {} -func (*CompositeIndex) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{9} } +var xxx_messageInfo_CompositeIndex proto.InternalMessageInfo const Default_CompositeIndex_OnlyUseIfRequired bool = false @@ -1226,16 +1532,37 @@ func (m *CompositeIndex) GetOnlyUseIfRequired() bool { } type IndexPostfix struct { - IndexValue []*IndexPostfix_IndexValue `protobuf:"bytes,1,rep,name=index_value,json=indexValue" json:"index_value,omitempty"` - Key *Reference `protobuf:"bytes,2,opt,name=key" json:"key,omitempty"` - Before *bool `protobuf:"varint,3,opt,name=before,def=1" json:"before,omitempty"` - XXX_unrecognized []byte `json:"-"` + IndexValue []*IndexPostfix_IndexValue `protobuf:"bytes,1,rep,name=index_value,json=indexValue" json:"index_value,omitempty"` + Key *Reference `protobuf:"bytes,2,opt,name=key" json:"key,omitempty"` + Before *bool `protobuf:"varint,3,opt,name=before,def=1" json:"before,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *IndexPostfix) Reset() { *m = IndexPostfix{} } -func (m *IndexPostfix) String() string { return proto.CompactTextString(m) } -func (*IndexPostfix) ProtoMessage() {} -func (*IndexPostfix) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{10} } +func (m *IndexPostfix) Reset() { *m = IndexPostfix{} } +func (m *IndexPostfix) String() string { return proto.CompactTextString(m) } +func (*IndexPostfix) ProtoMessage() {} +func (*IndexPostfix) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{10} +} +func (m *IndexPostfix) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_IndexPostfix.Unmarshal(m, b) +} +func (m *IndexPostfix) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_IndexPostfix.Marshal(b, m, deterministic) +} +func (dst *IndexPostfix) XXX_Merge(src proto.Message) { + xxx_messageInfo_IndexPostfix.Merge(dst, src) +} +func (m *IndexPostfix) XXX_Size() int { + return xxx_messageInfo_IndexPostfix.Size(m) +} +func (m *IndexPostfix) XXX_DiscardUnknown() { + xxx_messageInfo_IndexPostfix.DiscardUnknown(m) +} + +var xxx_messageInfo_IndexPostfix proto.InternalMessageInfo const Default_IndexPostfix_Before bool = true @@ -1261,15 +1588,36 @@ func (m *IndexPostfix) GetBefore() bool { } type IndexPostfix_IndexValue struct { - PropertyName *string `protobuf:"bytes,1,req,name=property_name,json=propertyName" json:"property_name,omitempty"` - Value *PropertyValue `protobuf:"bytes,2,req,name=value" json:"value,omitempty"` - XXX_unrecognized []byte `json:"-"` + PropertyName *string `protobuf:"bytes,1,req,name=property_name,json=propertyName" json:"property_name,omitempty"` + Value *PropertyValue `protobuf:"bytes,2,req,name=value" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *IndexPostfix_IndexValue) Reset() { *m = IndexPostfix_IndexValue{} } +func (m *IndexPostfix_IndexValue) String() string { return proto.CompactTextString(m) } +func (*IndexPostfix_IndexValue) ProtoMessage() {} +func (*IndexPostfix_IndexValue) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{10, 0} +} +func (m *IndexPostfix_IndexValue) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_IndexPostfix_IndexValue.Unmarshal(m, b) +} +func (m *IndexPostfix_IndexValue) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_IndexPostfix_IndexValue.Marshal(b, m, deterministic) +} +func (dst *IndexPostfix_IndexValue) XXX_Merge(src proto.Message) { + xxx_messageInfo_IndexPostfix_IndexValue.Merge(dst, src) +} +func (m *IndexPostfix_IndexValue) XXX_Size() int { + return xxx_messageInfo_IndexPostfix_IndexValue.Size(m) +} +func (m *IndexPostfix_IndexValue) XXX_DiscardUnknown() { + xxx_messageInfo_IndexPostfix_IndexValue.DiscardUnknown(m) } -func (m *IndexPostfix_IndexValue) Reset() { *m = IndexPostfix_IndexValue{} } -func (m *IndexPostfix_IndexValue) String() string { return proto.CompactTextString(m) } -func (*IndexPostfix_IndexValue) ProtoMessage() {} -func (*IndexPostfix_IndexValue) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{10, 0} } +var xxx_messageInfo_IndexPostfix_IndexValue proto.InternalMessageInfo func (m *IndexPostfix_IndexValue) GetPropertyName() string { if m != nil && m.PropertyName != nil { @@ -1286,15 +1634,36 @@ func (m *IndexPostfix_IndexValue) GetValue() *PropertyValue { } type IndexPosition struct { - Key *string `protobuf:"bytes,1,opt,name=key" json:"key,omitempty"` - Before *bool `protobuf:"varint,2,opt,name=before,def=1" json:"before,omitempty"` - XXX_unrecognized []byte `json:"-"` + Key *string `protobuf:"bytes,1,opt,name=key" json:"key,omitempty"` + Before *bool `protobuf:"varint,2,opt,name=before,def=1" json:"before,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *IndexPosition) Reset() { *m = IndexPosition{} } -func (m *IndexPosition) String() string { return proto.CompactTextString(m) } -func (*IndexPosition) ProtoMessage() {} -func (*IndexPosition) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{11} } +func (m *IndexPosition) Reset() { *m = IndexPosition{} } +func (m *IndexPosition) String() string { return proto.CompactTextString(m) } +func (*IndexPosition) ProtoMessage() {} +func (*IndexPosition) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{11} +} +func (m *IndexPosition) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_IndexPosition.Unmarshal(m, b) +} +func (m *IndexPosition) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_IndexPosition.Marshal(b, m, deterministic) +} +func (dst *IndexPosition) XXX_Merge(src proto.Message) { + xxx_messageInfo_IndexPosition.Merge(dst, src) +} +func (m *IndexPosition) XXX_Size() int { + return xxx_messageInfo_IndexPosition.Size(m) +} +func (m *IndexPosition) XXX_DiscardUnknown() { + xxx_messageInfo_IndexPosition.DiscardUnknown(m) +} + +var xxx_messageInfo_IndexPosition proto.InternalMessageInfo const Default_IndexPosition_Before bool = true @@ -1313,14 +1682,35 @@ func (m *IndexPosition) GetBefore() bool { } type Snapshot struct { - Ts *int64 `protobuf:"varint,1,req,name=ts" json:"ts,omitempty"` - XXX_unrecognized []byte `json:"-"` + Ts *int64 `protobuf:"varint,1,req,name=ts" json:"ts,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Snapshot) Reset() { *m = Snapshot{} } +func (m *Snapshot) String() string { return proto.CompactTextString(m) } +func (*Snapshot) ProtoMessage() {} +func (*Snapshot) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{12} +} +func (m *Snapshot) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Snapshot.Unmarshal(m, b) +} +func (m *Snapshot) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Snapshot.Marshal(b, m, deterministic) +} +func (dst *Snapshot) XXX_Merge(src proto.Message) { + xxx_messageInfo_Snapshot.Merge(dst, src) +} +func (m *Snapshot) XXX_Size() int { + return xxx_messageInfo_Snapshot.Size(m) +} +func (m *Snapshot) XXX_DiscardUnknown() { + xxx_messageInfo_Snapshot.DiscardUnknown(m) } -func (m *Snapshot) Reset() { *m = Snapshot{} } -func (m *Snapshot) String() string { return proto.CompactTextString(m) } -func (*Snapshot) ProtoMessage() {} -func (*Snapshot) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{12} } +var xxx_messageInfo_Snapshot proto.InternalMessageInfo func (m *Snapshot) GetTs() int64 { if m != nil && m.Ts != nil { @@ -1330,14 +1720,35 @@ func (m *Snapshot) GetTs() int64 { } type InternalHeader struct { - Qos *string `protobuf:"bytes,1,opt,name=qos" json:"qos,omitempty"` - XXX_unrecognized []byte `json:"-"` + Qos *string `protobuf:"bytes,1,opt,name=qos" json:"qos,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *InternalHeader) Reset() { *m = InternalHeader{} } -func (m *InternalHeader) String() string { return proto.CompactTextString(m) } -func (*InternalHeader) ProtoMessage() {} -func (*InternalHeader) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{13} } +func (m *InternalHeader) Reset() { *m = InternalHeader{} } +func (m *InternalHeader) String() string { return proto.CompactTextString(m) } +func (*InternalHeader) ProtoMessage() {} +func (*InternalHeader) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{13} +} +func (m *InternalHeader) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_InternalHeader.Unmarshal(m, b) +} +func (m *InternalHeader) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_InternalHeader.Marshal(b, m, deterministic) +} +func (dst *InternalHeader) XXX_Merge(src proto.Message) { + xxx_messageInfo_InternalHeader.Merge(dst, src) +} +func (m *InternalHeader) XXX_Size() int { + return xxx_messageInfo_InternalHeader.Size(m) +} +func (m *InternalHeader) XXX_DiscardUnknown() { + xxx_messageInfo_InternalHeader.DiscardUnknown(m) +} + +var xxx_messageInfo_InternalHeader proto.InternalMessageInfo func (m *InternalHeader) GetQos() string { if m != nil && m.Qos != nil { @@ -1347,17 +1758,38 @@ func (m *InternalHeader) GetQos() string { } type Transaction struct { - Header *InternalHeader `protobuf:"bytes,4,opt,name=header" json:"header,omitempty"` - Handle *uint64 `protobuf:"fixed64,1,req,name=handle" json:"handle,omitempty"` - App *string `protobuf:"bytes,2,req,name=app" json:"app,omitempty"` - MarkChanges *bool `protobuf:"varint,3,opt,name=mark_changes,json=markChanges,def=0" json:"mark_changes,omitempty"` - XXX_unrecognized []byte `json:"-"` + Header *InternalHeader `protobuf:"bytes,4,opt,name=header" json:"header,omitempty"` + Handle *uint64 `protobuf:"fixed64,1,req,name=handle" json:"handle,omitempty"` + App *string `protobuf:"bytes,2,req,name=app" json:"app,omitempty"` + MarkChanges *bool `protobuf:"varint,3,opt,name=mark_changes,json=markChanges,def=0" json:"mark_changes,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *Transaction) Reset() { *m = Transaction{} } -func (m *Transaction) String() string { return proto.CompactTextString(m) } -func (*Transaction) ProtoMessage() {} -func (*Transaction) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{14} } +func (m *Transaction) Reset() { *m = Transaction{} } +func (m *Transaction) String() string { return proto.CompactTextString(m) } +func (*Transaction) ProtoMessage() {} +func (*Transaction) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{14} +} +func (m *Transaction) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Transaction.Unmarshal(m, b) +} +func (m *Transaction) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Transaction.Marshal(b, m, deterministic) +} +func (dst *Transaction) XXX_Merge(src proto.Message) { + xxx_messageInfo_Transaction.Merge(dst, src) +} +func (m *Transaction) XXX_Size() int { + return xxx_messageInfo_Transaction.Size(m) +} +func (m *Transaction) XXX_DiscardUnknown() { + xxx_messageInfo_Transaction.DiscardUnknown(m) +} + +var xxx_messageInfo_Transaction proto.InternalMessageInfo const Default_Transaction_MarkChanges bool = false @@ -1390,40 +1822,61 @@ func (m *Transaction) GetMarkChanges() bool { } type Query struct { - Header *InternalHeader `protobuf:"bytes,39,opt,name=header" json:"header,omitempty"` - App *string `protobuf:"bytes,1,req,name=app" json:"app,omitempty"` - NameSpace *string `protobuf:"bytes,29,opt,name=name_space,json=nameSpace" json:"name_space,omitempty"` - Kind *string `protobuf:"bytes,3,opt,name=kind" json:"kind,omitempty"` - Ancestor *Reference `protobuf:"bytes,17,opt,name=ancestor" json:"ancestor,omitempty"` - Filter []*Query_Filter `protobuf:"group,4,rep,name=Filter,json=filter" json:"filter,omitempty"` - SearchQuery *string `protobuf:"bytes,8,opt,name=search_query,json=searchQuery" json:"search_query,omitempty"` - Order []*Query_Order `protobuf:"group,9,rep,name=Order,json=order" json:"order,omitempty"` - Hint *Query_Hint `protobuf:"varint,18,opt,name=hint,enum=appengine.Query_Hint" json:"hint,omitempty"` - Count *int32 `protobuf:"varint,23,opt,name=count" json:"count,omitempty"` - Offset *int32 `protobuf:"varint,12,opt,name=offset,def=0" json:"offset,omitempty"` - Limit *int32 `protobuf:"varint,16,opt,name=limit" json:"limit,omitempty"` - CompiledCursor *CompiledCursor `protobuf:"bytes,30,opt,name=compiled_cursor,json=compiledCursor" json:"compiled_cursor,omitempty"` - EndCompiledCursor *CompiledCursor `protobuf:"bytes,31,opt,name=end_compiled_cursor,json=endCompiledCursor" json:"end_compiled_cursor,omitempty"` - CompositeIndex []*CompositeIndex `protobuf:"bytes,19,rep,name=composite_index,json=compositeIndex" json:"composite_index,omitempty"` - RequirePerfectPlan *bool `protobuf:"varint,20,opt,name=require_perfect_plan,json=requirePerfectPlan,def=0" json:"require_perfect_plan,omitempty"` - KeysOnly *bool `protobuf:"varint,21,opt,name=keys_only,json=keysOnly,def=0" json:"keys_only,omitempty"` - Transaction *Transaction `protobuf:"bytes,22,opt,name=transaction" json:"transaction,omitempty"` - Compile *bool `protobuf:"varint,25,opt,name=compile,def=0" json:"compile,omitempty"` - FailoverMs *int64 `protobuf:"varint,26,opt,name=failover_ms,json=failoverMs" json:"failover_ms,omitempty"` - Strong *bool `protobuf:"varint,32,opt,name=strong" json:"strong,omitempty"` - PropertyName []string `protobuf:"bytes,33,rep,name=property_name,json=propertyName" json:"property_name,omitempty"` - GroupByPropertyName []string `protobuf:"bytes,34,rep,name=group_by_property_name,json=groupByPropertyName" json:"group_by_property_name,omitempty"` - Distinct *bool `protobuf:"varint,24,opt,name=distinct" json:"distinct,omitempty"` - MinSafeTimeSeconds *int64 `protobuf:"varint,35,opt,name=min_safe_time_seconds,json=minSafeTimeSeconds" json:"min_safe_time_seconds,omitempty"` - SafeReplicaName []string `protobuf:"bytes,36,rep,name=safe_replica_name,json=safeReplicaName" json:"safe_replica_name,omitempty"` - PersistOffset *bool `protobuf:"varint,37,opt,name=persist_offset,json=persistOffset,def=0" json:"persist_offset,omitempty"` - XXX_unrecognized []byte `json:"-"` -} - -func (m *Query) Reset() { *m = Query{} } -func (m *Query) String() string { return proto.CompactTextString(m) } -func (*Query) ProtoMessage() {} -func (*Query) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{15} } + Header *InternalHeader `protobuf:"bytes,39,opt,name=header" json:"header,omitempty"` + App *string `protobuf:"bytes,1,req,name=app" json:"app,omitempty"` + NameSpace *string `protobuf:"bytes,29,opt,name=name_space,json=nameSpace" json:"name_space,omitempty"` + Kind *string `protobuf:"bytes,3,opt,name=kind" json:"kind,omitempty"` + Ancestor *Reference `protobuf:"bytes,17,opt,name=ancestor" json:"ancestor,omitempty"` + Filter []*Query_Filter `protobuf:"group,4,rep,name=Filter,json=filter" json:"filter,omitempty"` + SearchQuery *string `protobuf:"bytes,8,opt,name=search_query,json=searchQuery" json:"search_query,omitempty"` + Order []*Query_Order `protobuf:"group,9,rep,name=Order,json=order" json:"order,omitempty"` + Hint *Query_Hint `protobuf:"varint,18,opt,name=hint,enum=appengine.Query_Hint" json:"hint,omitempty"` + Count *int32 `protobuf:"varint,23,opt,name=count" json:"count,omitempty"` + Offset *int32 `protobuf:"varint,12,opt,name=offset,def=0" json:"offset,omitempty"` + Limit *int32 `protobuf:"varint,16,opt,name=limit" json:"limit,omitempty"` + CompiledCursor *CompiledCursor `protobuf:"bytes,30,opt,name=compiled_cursor,json=compiledCursor" json:"compiled_cursor,omitempty"` + EndCompiledCursor *CompiledCursor `protobuf:"bytes,31,opt,name=end_compiled_cursor,json=endCompiledCursor" json:"end_compiled_cursor,omitempty"` + CompositeIndex []*CompositeIndex `protobuf:"bytes,19,rep,name=composite_index,json=compositeIndex" json:"composite_index,omitempty"` + RequirePerfectPlan *bool `protobuf:"varint,20,opt,name=require_perfect_plan,json=requirePerfectPlan,def=0" json:"require_perfect_plan,omitempty"` + KeysOnly *bool `protobuf:"varint,21,opt,name=keys_only,json=keysOnly,def=0" json:"keys_only,omitempty"` + Transaction *Transaction `protobuf:"bytes,22,opt,name=transaction" json:"transaction,omitempty"` + Compile *bool `protobuf:"varint,25,opt,name=compile,def=0" json:"compile,omitempty"` + FailoverMs *int64 `protobuf:"varint,26,opt,name=failover_ms,json=failoverMs" json:"failover_ms,omitempty"` + Strong *bool `protobuf:"varint,32,opt,name=strong" json:"strong,omitempty"` + PropertyName []string `protobuf:"bytes,33,rep,name=property_name,json=propertyName" json:"property_name,omitempty"` + GroupByPropertyName []string `protobuf:"bytes,34,rep,name=group_by_property_name,json=groupByPropertyName" json:"group_by_property_name,omitempty"` + Distinct *bool `protobuf:"varint,24,opt,name=distinct" json:"distinct,omitempty"` + MinSafeTimeSeconds *int64 `protobuf:"varint,35,opt,name=min_safe_time_seconds,json=minSafeTimeSeconds" json:"min_safe_time_seconds,omitempty"` + SafeReplicaName []string `protobuf:"bytes,36,rep,name=safe_replica_name,json=safeReplicaName" json:"safe_replica_name,omitempty"` + PersistOffset *bool `protobuf:"varint,37,opt,name=persist_offset,json=persistOffset,def=0" json:"persist_offset,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Query) Reset() { *m = Query{} } +func (m *Query) String() string { return proto.CompactTextString(m) } +func (*Query) ProtoMessage() {} +func (*Query) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{15} +} +func (m *Query) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Query.Unmarshal(m, b) +} +func (m *Query) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Query.Marshal(b, m, deterministic) +} +func (dst *Query) XXX_Merge(src proto.Message) { + xxx_messageInfo_Query.Merge(dst, src) +} +func (m *Query) XXX_Size() int { + return xxx_messageInfo_Query.Size(m) +} +func (m *Query) XXX_DiscardUnknown() { + xxx_messageInfo_Query.DiscardUnknown(m) +} + +var xxx_messageInfo_Query proto.InternalMessageInfo const Default_Query_Offset int32 = 0 const Default_Query_RequirePerfectPlan bool = false @@ -1621,15 +2074,36 @@ func (m *Query) GetPersistOffset() bool { } type Query_Filter struct { - Op *Query_Filter_Operator `protobuf:"varint,6,req,name=op,enum=appengine.Query_Filter_Operator" json:"op,omitempty"` - Property []*Property `protobuf:"bytes,14,rep,name=property" json:"property,omitempty"` - XXX_unrecognized []byte `json:"-"` + Op *Query_Filter_Operator `protobuf:"varint,6,req,name=op,enum=appengine.Query_Filter_Operator" json:"op,omitempty"` + Property []*Property `protobuf:"bytes,14,rep,name=property" json:"property,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Query_Filter) Reset() { *m = Query_Filter{} } +func (m *Query_Filter) String() string { return proto.CompactTextString(m) } +func (*Query_Filter) ProtoMessage() {} +func (*Query_Filter) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{15, 0} +} +func (m *Query_Filter) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Query_Filter.Unmarshal(m, b) +} +func (m *Query_Filter) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Query_Filter.Marshal(b, m, deterministic) +} +func (dst *Query_Filter) XXX_Merge(src proto.Message) { + xxx_messageInfo_Query_Filter.Merge(dst, src) +} +func (m *Query_Filter) XXX_Size() int { + return xxx_messageInfo_Query_Filter.Size(m) +} +func (m *Query_Filter) XXX_DiscardUnknown() { + xxx_messageInfo_Query_Filter.DiscardUnknown(m) } -func (m *Query_Filter) Reset() { *m = Query_Filter{} } -func (m *Query_Filter) String() string { return proto.CompactTextString(m) } -func (*Query_Filter) ProtoMessage() {} -func (*Query_Filter) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{15, 0} } +var xxx_messageInfo_Query_Filter proto.InternalMessageInfo func (m *Query_Filter) GetOp() Query_Filter_Operator { if m != nil && m.Op != nil { @@ -1646,15 +2120,36 @@ func (m *Query_Filter) GetProperty() []*Property { } type Query_Order struct { - Property *string `protobuf:"bytes,10,req,name=property" json:"property,omitempty"` - Direction *Query_Order_Direction `protobuf:"varint,11,opt,name=direction,enum=appengine.Query_Order_Direction,def=1" json:"direction,omitempty"` - XXX_unrecognized []byte `json:"-"` + Property *string `protobuf:"bytes,10,req,name=property" json:"property,omitempty"` + Direction *Query_Order_Direction `protobuf:"varint,11,opt,name=direction,enum=appengine.Query_Order_Direction,def=1" json:"direction,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *Query_Order) Reset() { *m = Query_Order{} } -func (m *Query_Order) String() string { return proto.CompactTextString(m) } -func (*Query_Order) ProtoMessage() {} -func (*Query_Order) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{15, 1} } +func (m *Query_Order) Reset() { *m = Query_Order{} } +func (m *Query_Order) String() string { return proto.CompactTextString(m) } +func (*Query_Order) ProtoMessage() {} +func (*Query_Order) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{15, 1} +} +func (m *Query_Order) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Query_Order.Unmarshal(m, b) +} +func (m *Query_Order) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Query_Order.Marshal(b, m, deterministic) +} +func (dst *Query_Order) XXX_Merge(src proto.Message) { + xxx_messageInfo_Query_Order.Merge(dst, src) +} +func (m *Query_Order) XXX_Size() int { + return xxx_messageInfo_Query_Order.Size(m) +} +func (m *Query_Order) XXX_DiscardUnknown() { + xxx_messageInfo_Query_Order.DiscardUnknown(m) +} + +var xxx_messageInfo_Query_Order proto.InternalMessageInfo const Default_Query_Order_Direction Query_Order_Direction = Query_Order_ASCENDING @@ -1673,22 +2168,43 @@ func (m *Query_Order) GetDirection() Query_Order_Direction { } type CompiledQuery struct { - Primaryscan *CompiledQuery_PrimaryScan `protobuf:"group,1,req,name=PrimaryScan,json=primaryscan" json:"primaryscan,omitempty"` - Mergejoinscan []*CompiledQuery_MergeJoinScan `protobuf:"group,7,rep,name=MergeJoinScan,json=mergejoinscan" json:"mergejoinscan,omitempty"` - IndexDef *Index `protobuf:"bytes,21,opt,name=index_def,json=indexDef" json:"index_def,omitempty"` - Offset *int32 `protobuf:"varint,10,opt,name=offset,def=0" json:"offset,omitempty"` - Limit *int32 `protobuf:"varint,11,opt,name=limit" json:"limit,omitempty"` - KeysOnly *bool `protobuf:"varint,12,req,name=keys_only,json=keysOnly" json:"keys_only,omitempty"` - PropertyName []string `protobuf:"bytes,24,rep,name=property_name,json=propertyName" json:"property_name,omitempty"` - DistinctInfixSize *int32 `protobuf:"varint,25,opt,name=distinct_infix_size,json=distinctInfixSize" json:"distinct_infix_size,omitempty"` - Entityfilter *CompiledQuery_EntityFilter `protobuf:"group,13,opt,name=EntityFilter,json=entityfilter" json:"entityfilter,omitempty"` - XXX_unrecognized []byte `json:"-"` -} - -func (m *CompiledQuery) Reset() { *m = CompiledQuery{} } -func (m *CompiledQuery) String() string { return proto.CompactTextString(m) } -func (*CompiledQuery) ProtoMessage() {} -func (*CompiledQuery) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{16} } + Primaryscan *CompiledQuery_PrimaryScan `protobuf:"group,1,req,name=PrimaryScan,json=primaryscan" json:"primaryscan,omitempty"` + Mergejoinscan []*CompiledQuery_MergeJoinScan `protobuf:"group,7,rep,name=MergeJoinScan,json=mergejoinscan" json:"mergejoinscan,omitempty"` + IndexDef *Index `protobuf:"bytes,21,opt,name=index_def,json=indexDef" json:"index_def,omitempty"` + Offset *int32 `protobuf:"varint,10,opt,name=offset,def=0" json:"offset,omitempty"` + Limit *int32 `protobuf:"varint,11,opt,name=limit" json:"limit,omitempty"` + KeysOnly *bool `protobuf:"varint,12,req,name=keys_only,json=keysOnly" json:"keys_only,omitempty"` + PropertyName []string `protobuf:"bytes,24,rep,name=property_name,json=propertyName" json:"property_name,omitempty"` + DistinctInfixSize *int32 `protobuf:"varint,25,opt,name=distinct_infix_size,json=distinctInfixSize" json:"distinct_infix_size,omitempty"` + Entityfilter *CompiledQuery_EntityFilter `protobuf:"group,13,opt,name=EntityFilter,json=entityfilter" json:"entityfilter,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CompiledQuery) Reset() { *m = CompiledQuery{} } +func (m *CompiledQuery) String() string { return proto.CompactTextString(m) } +func (*CompiledQuery) ProtoMessage() {} +func (*CompiledQuery) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{16} +} +func (m *CompiledQuery) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_CompiledQuery.Unmarshal(m, b) +} +func (m *CompiledQuery) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_CompiledQuery.Marshal(b, m, deterministic) +} +func (dst *CompiledQuery) XXX_Merge(src proto.Message) { + xxx_messageInfo_CompiledQuery.Merge(dst, src) +} +func (m *CompiledQuery) XXX_Size() int { + return xxx_messageInfo_CompiledQuery.Size(m) +} +func (m *CompiledQuery) XXX_DiscardUnknown() { + xxx_messageInfo_CompiledQuery.DiscardUnknown(m) +} + +var xxx_messageInfo_CompiledQuery proto.InternalMessageInfo const Default_CompiledQuery_Offset int32 = 0 @@ -1764,13 +2280,34 @@ type CompiledQuery_PrimaryScan struct { StartPostfixValue []string `protobuf:"bytes,22,rep,name=start_postfix_value,json=startPostfixValue" json:"start_postfix_value,omitempty"` EndPostfixValue []string `protobuf:"bytes,23,rep,name=end_postfix_value,json=endPostfixValue" json:"end_postfix_value,omitempty"` EndUnappliedLogTimestampUs *int64 `protobuf:"varint,19,opt,name=end_unapplied_log_timestamp_us,json=endUnappliedLogTimestampUs" json:"end_unapplied_log_timestamp_us,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CompiledQuery_PrimaryScan) Reset() { *m = CompiledQuery_PrimaryScan{} } +func (m *CompiledQuery_PrimaryScan) String() string { return proto.CompactTextString(m) } +func (*CompiledQuery_PrimaryScan) ProtoMessage() {} +func (*CompiledQuery_PrimaryScan) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{16, 0} +} +func (m *CompiledQuery_PrimaryScan) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_CompiledQuery_PrimaryScan.Unmarshal(m, b) +} +func (m *CompiledQuery_PrimaryScan) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_CompiledQuery_PrimaryScan.Marshal(b, m, deterministic) +} +func (dst *CompiledQuery_PrimaryScan) XXX_Merge(src proto.Message) { + xxx_messageInfo_CompiledQuery_PrimaryScan.Merge(dst, src) +} +func (m *CompiledQuery_PrimaryScan) XXX_Size() int { + return xxx_messageInfo_CompiledQuery_PrimaryScan.Size(m) +} +func (m *CompiledQuery_PrimaryScan) XXX_DiscardUnknown() { + xxx_messageInfo_CompiledQuery_PrimaryScan.DiscardUnknown(m) } -func (m *CompiledQuery_PrimaryScan) Reset() { *m = CompiledQuery_PrimaryScan{} } -func (m *CompiledQuery_PrimaryScan) String() string { return proto.CompactTextString(m) } -func (*CompiledQuery_PrimaryScan) ProtoMessage() {} -func (*CompiledQuery_PrimaryScan) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{16, 0} } +var xxx_messageInfo_CompiledQuery_PrimaryScan proto.InternalMessageInfo func (m *CompiledQuery_PrimaryScan) GetIndexName() string { if m != nil && m.IndexName != nil { @@ -1829,16 +2366,37 @@ func (m *CompiledQuery_PrimaryScan) GetEndUnappliedLogTimestampUs() int64 { } type CompiledQuery_MergeJoinScan struct { - IndexName *string `protobuf:"bytes,8,req,name=index_name,json=indexName" json:"index_name,omitempty"` - PrefixValue []string `protobuf:"bytes,9,rep,name=prefix_value,json=prefixValue" json:"prefix_value,omitempty"` - ValuePrefix *bool `protobuf:"varint,20,opt,name=value_prefix,json=valuePrefix,def=0" json:"value_prefix,omitempty"` - XXX_unrecognized []byte `json:"-"` + IndexName *string `protobuf:"bytes,8,req,name=index_name,json=indexName" json:"index_name,omitempty"` + PrefixValue []string `protobuf:"bytes,9,rep,name=prefix_value,json=prefixValue" json:"prefix_value,omitempty"` + ValuePrefix *bool `protobuf:"varint,20,opt,name=value_prefix,json=valuePrefix,def=0" json:"value_prefix,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *CompiledQuery_MergeJoinScan) Reset() { *m = CompiledQuery_MergeJoinScan{} } -func (m *CompiledQuery_MergeJoinScan) String() string { return proto.CompactTextString(m) } -func (*CompiledQuery_MergeJoinScan) ProtoMessage() {} -func (*CompiledQuery_MergeJoinScan) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{16, 1} } +func (m *CompiledQuery_MergeJoinScan) Reset() { *m = CompiledQuery_MergeJoinScan{} } +func (m *CompiledQuery_MergeJoinScan) String() string { return proto.CompactTextString(m) } +func (*CompiledQuery_MergeJoinScan) ProtoMessage() {} +func (*CompiledQuery_MergeJoinScan) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{16, 1} +} +func (m *CompiledQuery_MergeJoinScan) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_CompiledQuery_MergeJoinScan.Unmarshal(m, b) +} +func (m *CompiledQuery_MergeJoinScan) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_CompiledQuery_MergeJoinScan.Marshal(b, m, deterministic) +} +func (dst *CompiledQuery_MergeJoinScan) XXX_Merge(src proto.Message) { + xxx_messageInfo_CompiledQuery_MergeJoinScan.Merge(dst, src) +} +func (m *CompiledQuery_MergeJoinScan) XXX_Size() int { + return xxx_messageInfo_CompiledQuery_MergeJoinScan.Size(m) +} +func (m *CompiledQuery_MergeJoinScan) XXX_DiscardUnknown() { + xxx_messageInfo_CompiledQuery_MergeJoinScan.DiscardUnknown(m) +} + +var xxx_messageInfo_CompiledQuery_MergeJoinScan proto.InternalMessageInfo const Default_CompiledQuery_MergeJoinScan_ValuePrefix bool = false @@ -1864,16 +2422,37 @@ func (m *CompiledQuery_MergeJoinScan) GetValuePrefix() bool { } type CompiledQuery_EntityFilter struct { - Distinct *bool `protobuf:"varint,14,opt,name=distinct,def=0" json:"distinct,omitempty"` - Kind *string `protobuf:"bytes,17,opt,name=kind" json:"kind,omitempty"` - Ancestor *Reference `protobuf:"bytes,18,opt,name=ancestor" json:"ancestor,omitempty"` - XXX_unrecognized []byte `json:"-"` + Distinct *bool `protobuf:"varint,14,opt,name=distinct,def=0" json:"distinct,omitempty"` + Kind *string `protobuf:"bytes,17,opt,name=kind" json:"kind,omitempty"` + Ancestor *Reference `protobuf:"bytes,18,opt,name=ancestor" json:"ancestor,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *CompiledQuery_EntityFilter) Reset() { *m = CompiledQuery_EntityFilter{} } -func (m *CompiledQuery_EntityFilter) String() string { return proto.CompactTextString(m) } -func (*CompiledQuery_EntityFilter) ProtoMessage() {} -func (*CompiledQuery_EntityFilter) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{16, 2} } +func (m *CompiledQuery_EntityFilter) Reset() { *m = CompiledQuery_EntityFilter{} } +func (m *CompiledQuery_EntityFilter) String() string { return proto.CompactTextString(m) } +func (*CompiledQuery_EntityFilter) ProtoMessage() {} +func (*CompiledQuery_EntityFilter) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{16, 2} +} +func (m *CompiledQuery_EntityFilter) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_CompiledQuery_EntityFilter.Unmarshal(m, b) +} +func (m *CompiledQuery_EntityFilter) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_CompiledQuery_EntityFilter.Marshal(b, m, deterministic) +} +func (dst *CompiledQuery_EntityFilter) XXX_Merge(src proto.Message) { + xxx_messageInfo_CompiledQuery_EntityFilter.Merge(dst, src) +} +func (m *CompiledQuery_EntityFilter) XXX_Size() int { + return xxx_messageInfo_CompiledQuery_EntityFilter.Size(m) +} +func (m *CompiledQuery_EntityFilter) XXX_DiscardUnknown() { + xxx_messageInfo_CompiledQuery_EntityFilter.DiscardUnknown(m) +} + +var xxx_messageInfo_CompiledQuery_EntityFilter proto.InternalMessageInfo const Default_CompiledQuery_EntityFilter_Distinct bool = false @@ -1899,14 +2478,35 @@ func (m *CompiledQuery_EntityFilter) GetAncestor() *Reference { } type CompiledCursor struct { - Position *CompiledCursor_Position `protobuf:"group,2,opt,name=Position,json=position" json:"position,omitempty"` - XXX_unrecognized []byte `json:"-"` + Position *CompiledCursor_Position `protobuf:"group,2,opt,name=Position,json=position" json:"position,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *CompiledCursor) Reset() { *m = CompiledCursor{} } -func (m *CompiledCursor) String() string { return proto.CompactTextString(m) } -func (*CompiledCursor) ProtoMessage() {} -func (*CompiledCursor) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{17} } +func (m *CompiledCursor) Reset() { *m = CompiledCursor{} } +func (m *CompiledCursor) String() string { return proto.CompactTextString(m) } +func (*CompiledCursor) ProtoMessage() {} +func (*CompiledCursor) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{17} +} +func (m *CompiledCursor) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_CompiledCursor.Unmarshal(m, b) +} +func (m *CompiledCursor) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_CompiledCursor.Marshal(b, m, deterministic) +} +func (dst *CompiledCursor) XXX_Merge(src proto.Message) { + xxx_messageInfo_CompiledCursor.Merge(dst, src) +} +func (m *CompiledCursor) XXX_Size() int { + return xxx_messageInfo_CompiledCursor.Size(m) +} +func (m *CompiledCursor) XXX_DiscardUnknown() { + xxx_messageInfo_CompiledCursor.DiscardUnknown(m) +} + +var xxx_messageInfo_CompiledCursor proto.InternalMessageInfo func (m *CompiledCursor) GetPosition() *CompiledCursor_Position { if m != nil { @@ -1916,17 +2516,38 @@ func (m *CompiledCursor) GetPosition() *CompiledCursor_Position { } type CompiledCursor_Position struct { - StartKey *string `protobuf:"bytes,27,opt,name=start_key,json=startKey" json:"start_key,omitempty"` - Indexvalue []*CompiledCursor_Position_IndexValue `protobuf:"group,29,rep,name=IndexValue,json=indexvalue" json:"indexvalue,omitempty"` - Key *Reference `protobuf:"bytes,32,opt,name=key" json:"key,omitempty"` - StartInclusive *bool `protobuf:"varint,28,opt,name=start_inclusive,json=startInclusive,def=1" json:"start_inclusive,omitempty"` - XXX_unrecognized []byte `json:"-"` + StartKey *string `protobuf:"bytes,27,opt,name=start_key,json=startKey" json:"start_key,omitempty"` + Indexvalue []*CompiledCursor_Position_IndexValue `protobuf:"group,29,rep,name=IndexValue,json=indexvalue" json:"indexvalue,omitempty"` + Key *Reference `protobuf:"bytes,32,opt,name=key" json:"key,omitempty"` + StartInclusive *bool `protobuf:"varint,28,opt,name=start_inclusive,json=startInclusive,def=1" json:"start_inclusive,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CompiledCursor_Position) Reset() { *m = CompiledCursor_Position{} } +func (m *CompiledCursor_Position) String() string { return proto.CompactTextString(m) } +func (*CompiledCursor_Position) ProtoMessage() {} +func (*CompiledCursor_Position) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{17, 0} +} +func (m *CompiledCursor_Position) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_CompiledCursor_Position.Unmarshal(m, b) +} +func (m *CompiledCursor_Position) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_CompiledCursor_Position.Marshal(b, m, deterministic) +} +func (dst *CompiledCursor_Position) XXX_Merge(src proto.Message) { + xxx_messageInfo_CompiledCursor_Position.Merge(dst, src) +} +func (m *CompiledCursor_Position) XXX_Size() int { + return xxx_messageInfo_CompiledCursor_Position.Size(m) +} +func (m *CompiledCursor_Position) XXX_DiscardUnknown() { + xxx_messageInfo_CompiledCursor_Position.DiscardUnknown(m) } -func (m *CompiledCursor_Position) Reset() { *m = CompiledCursor_Position{} } -func (m *CompiledCursor_Position) String() string { return proto.CompactTextString(m) } -func (*CompiledCursor_Position) ProtoMessage() {} -func (*CompiledCursor_Position) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{17, 0} } +var xxx_messageInfo_CompiledCursor_Position proto.InternalMessageInfo const Default_CompiledCursor_Position_StartInclusive bool = true @@ -1959,17 +2580,36 @@ func (m *CompiledCursor_Position) GetStartInclusive() bool { } type CompiledCursor_Position_IndexValue struct { - Property *string `protobuf:"bytes,30,opt,name=property" json:"property,omitempty"` - Value *PropertyValue `protobuf:"bytes,31,req,name=value" json:"value,omitempty"` - XXX_unrecognized []byte `json:"-"` + Property *string `protobuf:"bytes,30,opt,name=property" json:"property,omitempty"` + Value *PropertyValue `protobuf:"bytes,31,req,name=value" json:"value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } func (m *CompiledCursor_Position_IndexValue) Reset() { *m = CompiledCursor_Position_IndexValue{} } func (m *CompiledCursor_Position_IndexValue) String() string { return proto.CompactTextString(m) } func (*CompiledCursor_Position_IndexValue) ProtoMessage() {} func (*CompiledCursor_Position_IndexValue) Descriptor() ([]byte, []int) { - return fileDescriptor0, []int{17, 0, 0} + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{17, 0, 0} } +func (m *CompiledCursor_Position_IndexValue) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_CompiledCursor_Position_IndexValue.Unmarshal(m, b) +} +func (m *CompiledCursor_Position_IndexValue) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_CompiledCursor_Position_IndexValue.Marshal(b, m, deterministic) +} +func (dst *CompiledCursor_Position_IndexValue) XXX_Merge(src proto.Message) { + xxx_messageInfo_CompiledCursor_Position_IndexValue.Merge(dst, src) +} +func (m *CompiledCursor_Position_IndexValue) XXX_Size() int { + return xxx_messageInfo_CompiledCursor_Position_IndexValue.Size(m) +} +func (m *CompiledCursor_Position_IndexValue) XXX_DiscardUnknown() { + xxx_messageInfo_CompiledCursor_Position_IndexValue.DiscardUnknown(m) +} + +var xxx_messageInfo_CompiledCursor_Position_IndexValue proto.InternalMessageInfo func (m *CompiledCursor_Position_IndexValue) GetProperty() string { if m != nil && m.Property != nil { @@ -1986,15 +2626,36 @@ func (m *CompiledCursor_Position_IndexValue) GetValue() *PropertyValue { } type Cursor struct { - Cursor *uint64 `protobuf:"fixed64,1,req,name=cursor" json:"cursor,omitempty"` - App *string `protobuf:"bytes,2,opt,name=app" json:"app,omitempty"` - XXX_unrecognized []byte `json:"-"` + Cursor *uint64 `protobuf:"fixed64,1,req,name=cursor" json:"cursor,omitempty"` + App *string `protobuf:"bytes,2,opt,name=app" json:"app,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Cursor) Reset() { *m = Cursor{} } +func (m *Cursor) String() string { return proto.CompactTextString(m) } +func (*Cursor) ProtoMessage() {} +func (*Cursor) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{18} +} +func (m *Cursor) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Cursor.Unmarshal(m, b) +} +func (m *Cursor) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Cursor.Marshal(b, m, deterministic) +} +func (dst *Cursor) XXX_Merge(src proto.Message) { + xxx_messageInfo_Cursor.Merge(dst, src) +} +func (m *Cursor) XXX_Size() int { + return xxx_messageInfo_Cursor.Size(m) +} +func (m *Cursor) XXX_DiscardUnknown() { + xxx_messageInfo_Cursor.DiscardUnknown(m) } -func (m *Cursor) Reset() { *m = Cursor{} } -func (m *Cursor) String() string { return proto.CompactTextString(m) } -func (*Cursor) ProtoMessage() {} -func (*Cursor) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{18} } +var xxx_messageInfo_Cursor proto.InternalMessageInfo func (m *Cursor) GetCursor() uint64 { if m != nil && m.Cursor != nil { @@ -2011,13 +2672,34 @@ func (m *Cursor) GetApp() string { } type Error struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Error) Reset() { *m = Error{} } +func (m *Error) String() string { return proto.CompactTextString(m) } +func (*Error) ProtoMessage() {} +func (*Error) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{19} +} +func (m *Error) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Error.Unmarshal(m, b) +} +func (m *Error) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Error.Marshal(b, m, deterministic) +} +func (dst *Error) XXX_Merge(src proto.Message) { + xxx_messageInfo_Error.Merge(dst, src) +} +func (m *Error) XXX_Size() int { + return xxx_messageInfo_Error.Size(m) +} +func (m *Error) XXX_DiscardUnknown() { + xxx_messageInfo_Error.DiscardUnknown(m) } -func (m *Error) Reset() { *m = Error{} } -func (m *Error) String() string { return proto.CompactTextString(m) } -func (*Error) ProtoMessage() {} -func (*Error) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{19} } +var xxx_messageInfo_Error proto.InternalMessageInfo type Cost struct { IndexWrites *int32 `protobuf:"varint,1,opt,name=index_writes,json=indexWrites" json:"index_writes,omitempty"` @@ -2027,13 +2709,34 @@ type Cost struct { Commitcost *Cost_CommitCost `protobuf:"group,5,opt,name=CommitCost,json=commitcost" json:"commitcost,omitempty"` ApproximateStorageDelta *int32 `protobuf:"varint,8,opt,name=approximate_storage_delta,json=approximateStorageDelta" json:"approximate_storage_delta,omitempty"` IdSequenceUpdates *int32 `protobuf:"varint,9,opt,name=id_sequence_updates,json=idSequenceUpdates" json:"id_sequence_updates,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Cost) Reset() { *m = Cost{} } +func (m *Cost) String() string { return proto.CompactTextString(m) } +func (*Cost) ProtoMessage() {} +func (*Cost) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{20} +} +func (m *Cost) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Cost.Unmarshal(m, b) +} +func (m *Cost) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Cost.Marshal(b, m, deterministic) +} +func (dst *Cost) XXX_Merge(src proto.Message) { + xxx_messageInfo_Cost.Merge(dst, src) +} +func (m *Cost) XXX_Size() int { + return xxx_messageInfo_Cost.Size(m) +} +func (m *Cost) XXX_DiscardUnknown() { + xxx_messageInfo_Cost.DiscardUnknown(m) } -func (m *Cost) Reset() { *m = Cost{} } -func (m *Cost) String() string { return proto.CompactTextString(m) } -func (*Cost) ProtoMessage() {} -func (*Cost) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{20} } +var xxx_messageInfo_Cost proto.InternalMessageInfo func (m *Cost) GetIndexWrites() int32 { if m != nil && m.IndexWrites != nil { @@ -2085,15 +2788,36 @@ func (m *Cost) GetIdSequenceUpdates() int32 { } type Cost_CommitCost struct { - RequestedEntityPuts *int32 `protobuf:"varint,6,opt,name=requested_entity_puts,json=requestedEntityPuts" json:"requested_entity_puts,omitempty"` - RequestedEntityDeletes *int32 `protobuf:"varint,7,opt,name=requested_entity_deletes,json=requestedEntityDeletes" json:"requested_entity_deletes,omitempty"` - XXX_unrecognized []byte `json:"-"` + RequestedEntityPuts *int32 `protobuf:"varint,6,opt,name=requested_entity_puts,json=requestedEntityPuts" json:"requested_entity_puts,omitempty"` + RequestedEntityDeletes *int32 `protobuf:"varint,7,opt,name=requested_entity_deletes,json=requestedEntityDeletes" json:"requested_entity_deletes,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *Cost_CommitCost) Reset() { *m = Cost_CommitCost{} } -func (m *Cost_CommitCost) String() string { return proto.CompactTextString(m) } -func (*Cost_CommitCost) ProtoMessage() {} -func (*Cost_CommitCost) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{20, 0} } +func (m *Cost_CommitCost) Reset() { *m = Cost_CommitCost{} } +func (m *Cost_CommitCost) String() string { return proto.CompactTextString(m) } +func (*Cost_CommitCost) ProtoMessage() {} +func (*Cost_CommitCost) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{20, 0} +} +func (m *Cost_CommitCost) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Cost_CommitCost.Unmarshal(m, b) +} +func (m *Cost_CommitCost) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Cost_CommitCost.Marshal(b, m, deterministic) +} +func (dst *Cost_CommitCost) XXX_Merge(src proto.Message) { + xxx_messageInfo_Cost_CommitCost.Merge(dst, src) +} +func (m *Cost_CommitCost) XXX_Size() int { + return xxx_messageInfo_Cost_CommitCost.Size(m) +} +func (m *Cost_CommitCost) XXX_DiscardUnknown() { + xxx_messageInfo_Cost_CommitCost.DiscardUnknown(m) +} + +var xxx_messageInfo_Cost_CommitCost proto.InternalMessageInfo func (m *Cost_CommitCost) GetRequestedEntityPuts() int32 { if m != nil && m.RequestedEntityPuts != nil { @@ -2110,19 +2834,40 @@ func (m *Cost_CommitCost) GetRequestedEntityDeletes() int32 { } type GetRequest struct { - Header *InternalHeader `protobuf:"bytes,6,opt,name=header" json:"header,omitempty"` - Key []*Reference `protobuf:"bytes,1,rep,name=key" json:"key,omitempty"` - Transaction *Transaction `protobuf:"bytes,2,opt,name=transaction" json:"transaction,omitempty"` - FailoverMs *int64 `protobuf:"varint,3,opt,name=failover_ms,json=failoverMs" json:"failover_ms,omitempty"` - Strong *bool `protobuf:"varint,4,opt,name=strong" json:"strong,omitempty"` - AllowDeferred *bool `protobuf:"varint,5,opt,name=allow_deferred,json=allowDeferred,def=0" json:"allow_deferred,omitempty"` - XXX_unrecognized []byte `json:"-"` + Header *InternalHeader `protobuf:"bytes,6,opt,name=header" json:"header,omitempty"` + Key []*Reference `protobuf:"bytes,1,rep,name=key" json:"key,omitempty"` + Transaction *Transaction `protobuf:"bytes,2,opt,name=transaction" json:"transaction,omitempty"` + FailoverMs *int64 `protobuf:"varint,3,opt,name=failover_ms,json=failoverMs" json:"failover_ms,omitempty"` + Strong *bool `protobuf:"varint,4,opt,name=strong" json:"strong,omitempty"` + AllowDeferred *bool `protobuf:"varint,5,opt,name=allow_deferred,json=allowDeferred,def=0" json:"allow_deferred,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *GetRequest) Reset() { *m = GetRequest{} } -func (m *GetRequest) String() string { return proto.CompactTextString(m) } -func (*GetRequest) ProtoMessage() {} -func (*GetRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{21} } +func (m *GetRequest) Reset() { *m = GetRequest{} } +func (m *GetRequest) String() string { return proto.CompactTextString(m) } +func (*GetRequest) ProtoMessage() {} +func (*GetRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{21} +} +func (m *GetRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetRequest.Unmarshal(m, b) +} +func (m *GetRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetRequest.Marshal(b, m, deterministic) +} +func (dst *GetRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetRequest.Merge(dst, src) +} +func (m *GetRequest) XXX_Size() int { + return xxx_messageInfo_GetRequest.Size(m) +} +func (m *GetRequest) XXX_DiscardUnknown() { + xxx_messageInfo_GetRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_GetRequest proto.InternalMessageInfo const Default_GetRequest_AllowDeferred bool = false @@ -2169,16 +2914,37 @@ func (m *GetRequest) GetAllowDeferred() bool { } type GetResponse struct { - Entity []*GetResponse_Entity `protobuf:"group,1,rep,name=Entity,json=entity" json:"entity,omitempty"` - Deferred []*Reference `protobuf:"bytes,5,rep,name=deferred" json:"deferred,omitempty"` - InOrder *bool `protobuf:"varint,6,opt,name=in_order,json=inOrder,def=1" json:"in_order,omitempty"` - XXX_unrecognized []byte `json:"-"` + Entity []*GetResponse_Entity `protobuf:"group,1,rep,name=Entity,json=entity" json:"entity,omitempty"` + Deferred []*Reference `protobuf:"bytes,5,rep,name=deferred" json:"deferred,omitempty"` + InOrder *bool `protobuf:"varint,6,opt,name=in_order,json=inOrder,def=1" json:"in_order,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GetResponse) Reset() { *m = GetResponse{} } +func (m *GetResponse) String() string { return proto.CompactTextString(m) } +func (*GetResponse) ProtoMessage() {} +func (*GetResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{22} +} +func (m *GetResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetResponse.Unmarshal(m, b) +} +func (m *GetResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetResponse.Marshal(b, m, deterministic) +} +func (dst *GetResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetResponse.Merge(dst, src) +} +func (m *GetResponse) XXX_Size() int { + return xxx_messageInfo_GetResponse.Size(m) +} +func (m *GetResponse) XXX_DiscardUnknown() { + xxx_messageInfo_GetResponse.DiscardUnknown(m) } -func (m *GetResponse) Reset() { *m = GetResponse{} } -func (m *GetResponse) String() string { return proto.CompactTextString(m) } -func (*GetResponse) ProtoMessage() {} -func (*GetResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{22} } +var xxx_messageInfo_GetResponse proto.InternalMessageInfo const Default_GetResponse_InOrder bool = true @@ -2204,16 +2970,37 @@ func (m *GetResponse) GetInOrder() bool { } type GetResponse_Entity struct { - Entity *EntityProto `protobuf:"bytes,2,opt,name=entity" json:"entity,omitempty"` - Key *Reference `protobuf:"bytes,4,opt,name=key" json:"key,omitempty"` - Version *int64 `protobuf:"varint,3,opt,name=version" json:"version,omitempty"` - XXX_unrecognized []byte `json:"-"` + Entity *EntityProto `protobuf:"bytes,2,opt,name=entity" json:"entity,omitempty"` + Key *Reference `protobuf:"bytes,4,opt,name=key" json:"key,omitempty"` + Version *int64 `protobuf:"varint,3,opt,name=version" json:"version,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *GetResponse_Entity) Reset() { *m = GetResponse_Entity{} } -func (m *GetResponse_Entity) String() string { return proto.CompactTextString(m) } -func (*GetResponse_Entity) ProtoMessage() {} -func (*GetResponse_Entity) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{22, 0} } +func (m *GetResponse_Entity) Reset() { *m = GetResponse_Entity{} } +func (m *GetResponse_Entity) String() string { return proto.CompactTextString(m) } +func (*GetResponse_Entity) ProtoMessage() {} +func (*GetResponse_Entity) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{22, 0} +} +func (m *GetResponse_Entity) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetResponse_Entity.Unmarshal(m, b) +} +func (m *GetResponse_Entity) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetResponse_Entity.Marshal(b, m, deterministic) +} +func (dst *GetResponse_Entity) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetResponse_Entity.Merge(dst, src) +} +func (m *GetResponse_Entity) XXX_Size() int { + return xxx_messageInfo_GetResponse_Entity.Size(m) +} +func (m *GetResponse_Entity) XXX_DiscardUnknown() { + xxx_messageInfo_GetResponse_Entity.DiscardUnknown(m) +} + +var xxx_messageInfo_GetResponse_Entity proto.InternalMessageInfo func (m *GetResponse_Entity) GetEntity() *EntityProto { if m != nil { @@ -2237,22 +3024,43 @@ func (m *GetResponse_Entity) GetVersion() int64 { } type PutRequest struct { - Header *InternalHeader `protobuf:"bytes,11,opt,name=header" json:"header,omitempty"` - Entity []*EntityProto `protobuf:"bytes,1,rep,name=entity" json:"entity,omitempty"` - Transaction *Transaction `protobuf:"bytes,2,opt,name=transaction" json:"transaction,omitempty"` - CompositeIndex []*CompositeIndex `protobuf:"bytes,3,rep,name=composite_index,json=compositeIndex" json:"composite_index,omitempty"` - Trusted *bool `protobuf:"varint,4,opt,name=trusted,def=0" json:"trusted,omitempty"` - Force *bool `protobuf:"varint,7,opt,name=force,def=0" json:"force,omitempty"` - MarkChanges *bool `protobuf:"varint,8,opt,name=mark_changes,json=markChanges,def=0" json:"mark_changes,omitempty"` - Snapshot []*Snapshot `protobuf:"bytes,9,rep,name=snapshot" json:"snapshot,omitempty"` - AutoIdPolicy *PutRequest_AutoIdPolicy `protobuf:"varint,10,opt,name=auto_id_policy,json=autoIdPolicy,enum=appengine.PutRequest_AutoIdPolicy,def=0" json:"auto_id_policy,omitempty"` - XXX_unrecognized []byte `json:"-"` -} - -func (m *PutRequest) Reset() { *m = PutRequest{} } -func (m *PutRequest) String() string { return proto.CompactTextString(m) } -func (*PutRequest) ProtoMessage() {} -func (*PutRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{23} } + Header *InternalHeader `protobuf:"bytes,11,opt,name=header" json:"header,omitempty"` + Entity []*EntityProto `protobuf:"bytes,1,rep,name=entity" json:"entity,omitempty"` + Transaction *Transaction `protobuf:"bytes,2,opt,name=transaction" json:"transaction,omitempty"` + CompositeIndex []*CompositeIndex `protobuf:"bytes,3,rep,name=composite_index,json=compositeIndex" json:"composite_index,omitempty"` + Trusted *bool `protobuf:"varint,4,opt,name=trusted,def=0" json:"trusted,omitempty"` + Force *bool `protobuf:"varint,7,opt,name=force,def=0" json:"force,omitempty"` + MarkChanges *bool `protobuf:"varint,8,opt,name=mark_changes,json=markChanges,def=0" json:"mark_changes,omitempty"` + Snapshot []*Snapshot `protobuf:"bytes,9,rep,name=snapshot" json:"snapshot,omitempty"` + AutoIdPolicy *PutRequest_AutoIdPolicy `protobuf:"varint,10,opt,name=auto_id_policy,json=autoIdPolicy,enum=appengine.PutRequest_AutoIdPolicy,def=0" json:"auto_id_policy,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *PutRequest) Reset() { *m = PutRequest{} } +func (m *PutRequest) String() string { return proto.CompactTextString(m) } +func (*PutRequest) ProtoMessage() {} +func (*PutRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{23} +} +func (m *PutRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_PutRequest.Unmarshal(m, b) +} +func (m *PutRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_PutRequest.Marshal(b, m, deterministic) +} +func (dst *PutRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_PutRequest.Merge(dst, src) +} +func (m *PutRequest) XXX_Size() int { + return xxx_messageInfo_PutRequest.Size(m) +} +func (m *PutRequest) XXX_DiscardUnknown() { + xxx_messageInfo_PutRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_PutRequest proto.InternalMessageInfo const Default_PutRequest_Trusted bool = false const Default_PutRequest_Force bool = false @@ -2323,16 +3131,37 @@ func (m *PutRequest) GetAutoIdPolicy() PutRequest_AutoIdPolicy { } type PutResponse struct { - Key []*Reference `protobuf:"bytes,1,rep,name=key" json:"key,omitempty"` - Cost *Cost `protobuf:"bytes,2,opt,name=cost" json:"cost,omitempty"` - Version []int64 `protobuf:"varint,3,rep,name=version" json:"version,omitempty"` - XXX_unrecognized []byte `json:"-"` + Key []*Reference `protobuf:"bytes,1,rep,name=key" json:"key,omitempty"` + Cost *Cost `protobuf:"bytes,2,opt,name=cost" json:"cost,omitempty"` + Version []int64 `protobuf:"varint,3,rep,name=version" json:"version,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *PutResponse) Reset() { *m = PutResponse{} } +func (m *PutResponse) String() string { return proto.CompactTextString(m) } +func (*PutResponse) ProtoMessage() {} +func (*PutResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{24} +} +func (m *PutResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_PutResponse.Unmarshal(m, b) +} +func (m *PutResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_PutResponse.Marshal(b, m, deterministic) +} +func (dst *PutResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_PutResponse.Merge(dst, src) +} +func (m *PutResponse) XXX_Size() int { + return xxx_messageInfo_PutResponse.Size(m) +} +func (m *PutResponse) XXX_DiscardUnknown() { + xxx_messageInfo_PutResponse.DiscardUnknown(m) } -func (m *PutResponse) Reset() { *m = PutResponse{} } -func (m *PutResponse) String() string { return proto.CompactTextString(m) } -func (*PutResponse) ProtoMessage() {} -func (*PutResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{24} } +var xxx_messageInfo_PutResponse proto.InternalMessageInfo func (m *PutResponse) GetKey() []*Reference { if m != nil { @@ -2356,18 +3185,39 @@ func (m *PutResponse) GetVersion() []int64 { } type TouchRequest struct { - Header *InternalHeader `protobuf:"bytes,10,opt,name=header" json:"header,omitempty"` - Key []*Reference `protobuf:"bytes,1,rep,name=key" json:"key,omitempty"` - CompositeIndex []*CompositeIndex `protobuf:"bytes,2,rep,name=composite_index,json=compositeIndex" json:"composite_index,omitempty"` - Force *bool `protobuf:"varint,3,opt,name=force,def=0" json:"force,omitempty"` - Snapshot []*Snapshot `protobuf:"bytes,9,rep,name=snapshot" json:"snapshot,omitempty"` - XXX_unrecognized []byte `json:"-"` + Header *InternalHeader `protobuf:"bytes,10,opt,name=header" json:"header,omitempty"` + Key []*Reference `protobuf:"bytes,1,rep,name=key" json:"key,omitempty"` + CompositeIndex []*CompositeIndex `protobuf:"bytes,2,rep,name=composite_index,json=compositeIndex" json:"composite_index,omitempty"` + Force *bool `protobuf:"varint,3,opt,name=force,def=0" json:"force,omitempty"` + Snapshot []*Snapshot `protobuf:"bytes,9,rep,name=snapshot" json:"snapshot,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *TouchRequest) Reset() { *m = TouchRequest{} } +func (m *TouchRequest) String() string { return proto.CompactTextString(m) } +func (*TouchRequest) ProtoMessage() {} +func (*TouchRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{25} +} +func (m *TouchRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_TouchRequest.Unmarshal(m, b) +} +func (m *TouchRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_TouchRequest.Marshal(b, m, deterministic) +} +func (dst *TouchRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_TouchRequest.Merge(dst, src) +} +func (m *TouchRequest) XXX_Size() int { + return xxx_messageInfo_TouchRequest.Size(m) +} +func (m *TouchRequest) XXX_DiscardUnknown() { + xxx_messageInfo_TouchRequest.DiscardUnknown(m) } -func (m *TouchRequest) Reset() { *m = TouchRequest{} } -func (m *TouchRequest) String() string { return proto.CompactTextString(m) } -func (*TouchRequest) ProtoMessage() {} -func (*TouchRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{25} } +var xxx_messageInfo_TouchRequest proto.InternalMessageInfo const Default_TouchRequest_Force bool = false @@ -2407,14 +3257,35 @@ func (m *TouchRequest) GetSnapshot() []*Snapshot { } type TouchResponse struct { - Cost *Cost `protobuf:"bytes,1,opt,name=cost" json:"cost,omitempty"` - XXX_unrecognized []byte `json:"-"` + Cost *Cost `protobuf:"bytes,1,opt,name=cost" json:"cost,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *TouchResponse) Reset() { *m = TouchResponse{} } -func (m *TouchResponse) String() string { return proto.CompactTextString(m) } -func (*TouchResponse) ProtoMessage() {} -func (*TouchResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{26} } +func (m *TouchResponse) Reset() { *m = TouchResponse{} } +func (m *TouchResponse) String() string { return proto.CompactTextString(m) } +func (*TouchResponse) ProtoMessage() {} +func (*TouchResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{26} +} +func (m *TouchResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_TouchResponse.Unmarshal(m, b) +} +func (m *TouchResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_TouchResponse.Marshal(b, m, deterministic) +} +func (dst *TouchResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_TouchResponse.Merge(dst, src) +} +func (m *TouchResponse) XXX_Size() int { + return xxx_messageInfo_TouchResponse.Size(m) +} +func (m *TouchResponse) XXX_DiscardUnknown() { + xxx_messageInfo_TouchResponse.DiscardUnknown(m) +} + +var xxx_messageInfo_TouchResponse proto.InternalMessageInfo func (m *TouchResponse) GetCost() *Cost { if m != nil { @@ -2424,20 +3295,41 @@ func (m *TouchResponse) GetCost() *Cost { } type DeleteRequest struct { - Header *InternalHeader `protobuf:"bytes,10,opt,name=header" json:"header,omitempty"` - Key []*Reference `protobuf:"bytes,6,rep,name=key" json:"key,omitempty"` - Transaction *Transaction `protobuf:"bytes,5,opt,name=transaction" json:"transaction,omitempty"` - Trusted *bool `protobuf:"varint,4,opt,name=trusted,def=0" json:"trusted,omitempty"` - Force *bool `protobuf:"varint,7,opt,name=force,def=0" json:"force,omitempty"` - MarkChanges *bool `protobuf:"varint,8,opt,name=mark_changes,json=markChanges,def=0" json:"mark_changes,omitempty"` - Snapshot []*Snapshot `protobuf:"bytes,9,rep,name=snapshot" json:"snapshot,omitempty"` - XXX_unrecognized []byte `json:"-"` + Header *InternalHeader `protobuf:"bytes,10,opt,name=header" json:"header,omitempty"` + Key []*Reference `protobuf:"bytes,6,rep,name=key" json:"key,omitempty"` + Transaction *Transaction `protobuf:"bytes,5,opt,name=transaction" json:"transaction,omitempty"` + Trusted *bool `protobuf:"varint,4,opt,name=trusted,def=0" json:"trusted,omitempty"` + Force *bool `protobuf:"varint,7,opt,name=force,def=0" json:"force,omitempty"` + MarkChanges *bool `protobuf:"varint,8,opt,name=mark_changes,json=markChanges,def=0" json:"mark_changes,omitempty"` + Snapshot []*Snapshot `protobuf:"bytes,9,rep,name=snapshot" json:"snapshot,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *DeleteRequest) Reset() { *m = DeleteRequest{} } -func (m *DeleteRequest) String() string { return proto.CompactTextString(m) } -func (*DeleteRequest) ProtoMessage() {} -func (*DeleteRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{27} } +func (m *DeleteRequest) Reset() { *m = DeleteRequest{} } +func (m *DeleteRequest) String() string { return proto.CompactTextString(m) } +func (*DeleteRequest) ProtoMessage() {} +func (*DeleteRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{27} +} +func (m *DeleteRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DeleteRequest.Unmarshal(m, b) +} +func (m *DeleteRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DeleteRequest.Marshal(b, m, deterministic) +} +func (dst *DeleteRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_DeleteRequest.Merge(dst, src) +} +func (m *DeleteRequest) XXX_Size() int { + return xxx_messageInfo_DeleteRequest.Size(m) +} +func (m *DeleteRequest) XXX_DiscardUnknown() { + xxx_messageInfo_DeleteRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_DeleteRequest proto.InternalMessageInfo const Default_DeleteRequest_Trusted bool = false const Default_DeleteRequest_Force bool = false @@ -2493,15 +3385,36 @@ func (m *DeleteRequest) GetSnapshot() []*Snapshot { } type DeleteResponse struct { - Cost *Cost `protobuf:"bytes,1,opt,name=cost" json:"cost,omitempty"` - Version []int64 `protobuf:"varint,3,rep,name=version" json:"version,omitempty"` - XXX_unrecognized []byte `json:"-"` + Cost *Cost `protobuf:"bytes,1,opt,name=cost" json:"cost,omitempty"` + Version []int64 `protobuf:"varint,3,rep,name=version" json:"version,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *DeleteResponse) Reset() { *m = DeleteResponse{} } -func (m *DeleteResponse) String() string { return proto.CompactTextString(m) } -func (*DeleteResponse) ProtoMessage() {} -func (*DeleteResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{28} } +func (m *DeleteResponse) Reset() { *m = DeleteResponse{} } +func (m *DeleteResponse) String() string { return proto.CompactTextString(m) } +func (*DeleteResponse) ProtoMessage() {} +func (*DeleteResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{28} +} +func (m *DeleteResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_DeleteResponse.Unmarshal(m, b) +} +func (m *DeleteResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_DeleteResponse.Marshal(b, m, deterministic) +} +func (dst *DeleteResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_DeleteResponse.Merge(dst, src) +} +func (m *DeleteResponse) XXX_Size() int { + return xxx_messageInfo_DeleteResponse.Size(m) +} +func (m *DeleteResponse) XXX_DiscardUnknown() { + xxx_messageInfo_DeleteResponse.DiscardUnknown(m) +} + +var xxx_messageInfo_DeleteResponse proto.InternalMessageInfo func (m *DeleteResponse) GetCost() *Cost { if m != nil { @@ -2518,18 +3431,39 @@ func (m *DeleteResponse) GetVersion() []int64 { } type NextRequest struct { - Header *InternalHeader `protobuf:"bytes,5,opt,name=header" json:"header,omitempty"` - Cursor *Cursor `protobuf:"bytes,1,req,name=cursor" json:"cursor,omitempty"` - Count *int32 `protobuf:"varint,2,opt,name=count" json:"count,omitempty"` - Offset *int32 `protobuf:"varint,4,opt,name=offset,def=0" json:"offset,omitempty"` - Compile *bool `protobuf:"varint,3,opt,name=compile,def=0" json:"compile,omitempty"` - XXX_unrecognized []byte `json:"-"` + Header *InternalHeader `protobuf:"bytes,5,opt,name=header" json:"header,omitempty"` + Cursor *Cursor `protobuf:"bytes,1,req,name=cursor" json:"cursor,omitempty"` + Count *int32 `protobuf:"varint,2,opt,name=count" json:"count,omitempty"` + Offset *int32 `protobuf:"varint,4,opt,name=offset,def=0" json:"offset,omitempty"` + Compile *bool `protobuf:"varint,3,opt,name=compile,def=0" json:"compile,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *NextRequest) Reset() { *m = NextRequest{} } +func (m *NextRequest) String() string { return proto.CompactTextString(m) } +func (*NextRequest) ProtoMessage() {} +func (*NextRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{29} +} +func (m *NextRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_NextRequest.Unmarshal(m, b) +} +func (m *NextRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_NextRequest.Marshal(b, m, deterministic) +} +func (dst *NextRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_NextRequest.Merge(dst, src) +} +func (m *NextRequest) XXX_Size() int { + return xxx_messageInfo_NextRequest.Size(m) +} +func (m *NextRequest) XXX_DiscardUnknown() { + xxx_messageInfo_NextRequest.DiscardUnknown(m) } -func (m *NextRequest) Reset() { *m = NextRequest{} } -func (m *NextRequest) String() string { return proto.CompactTextString(m) } -func (*NextRequest) ProtoMessage() {} -func (*NextRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{29} } +var xxx_messageInfo_NextRequest proto.InternalMessageInfo const Default_NextRequest_Offset int32 = 0 const Default_NextRequest_Compile bool = false @@ -2570,24 +3504,45 @@ func (m *NextRequest) GetCompile() bool { } type QueryResult struct { - Cursor *Cursor `protobuf:"bytes,1,opt,name=cursor" json:"cursor,omitempty"` - Result []*EntityProto `protobuf:"bytes,2,rep,name=result" json:"result,omitempty"` - SkippedResults *int32 `protobuf:"varint,7,opt,name=skipped_results,json=skippedResults" json:"skipped_results,omitempty"` - MoreResults *bool `protobuf:"varint,3,req,name=more_results,json=moreResults" json:"more_results,omitempty"` - KeysOnly *bool `protobuf:"varint,4,opt,name=keys_only,json=keysOnly" json:"keys_only,omitempty"` - IndexOnly *bool `protobuf:"varint,9,opt,name=index_only,json=indexOnly" json:"index_only,omitempty"` - SmallOps *bool `protobuf:"varint,10,opt,name=small_ops,json=smallOps" json:"small_ops,omitempty"` - CompiledQuery *CompiledQuery `protobuf:"bytes,5,opt,name=compiled_query,json=compiledQuery" json:"compiled_query,omitempty"` - CompiledCursor *CompiledCursor `protobuf:"bytes,6,opt,name=compiled_cursor,json=compiledCursor" json:"compiled_cursor,omitempty"` - Index []*CompositeIndex `protobuf:"bytes,8,rep,name=index" json:"index,omitempty"` - Version []int64 `protobuf:"varint,11,rep,name=version" json:"version,omitempty"` - XXX_unrecognized []byte `json:"-"` -} - -func (m *QueryResult) Reset() { *m = QueryResult{} } -func (m *QueryResult) String() string { return proto.CompactTextString(m) } -func (*QueryResult) ProtoMessage() {} -func (*QueryResult) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{30} } + Cursor *Cursor `protobuf:"bytes,1,opt,name=cursor" json:"cursor,omitempty"` + Result []*EntityProto `protobuf:"bytes,2,rep,name=result" json:"result,omitempty"` + SkippedResults *int32 `protobuf:"varint,7,opt,name=skipped_results,json=skippedResults" json:"skipped_results,omitempty"` + MoreResults *bool `protobuf:"varint,3,req,name=more_results,json=moreResults" json:"more_results,omitempty"` + KeysOnly *bool `protobuf:"varint,4,opt,name=keys_only,json=keysOnly" json:"keys_only,omitempty"` + IndexOnly *bool `protobuf:"varint,9,opt,name=index_only,json=indexOnly" json:"index_only,omitempty"` + SmallOps *bool `protobuf:"varint,10,opt,name=small_ops,json=smallOps" json:"small_ops,omitempty"` + CompiledQuery *CompiledQuery `protobuf:"bytes,5,opt,name=compiled_query,json=compiledQuery" json:"compiled_query,omitempty"` + CompiledCursor *CompiledCursor `protobuf:"bytes,6,opt,name=compiled_cursor,json=compiledCursor" json:"compiled_cursor,omitempty"` + Index []*CompositeIndex `protobuf:"bytes,8,rep,name=index" json:"index,omitempty"` + Version []int64 `protobuf:"varint,11,rep,name=version" json:"version,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *QueryResult) Reset() { *m = QueryResult{} } +func (m *QueryResult) String() string { return proto.CompactTextString(m) } +func (*QueryResult) ProtoMessage() {} +func (*QueryResult) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{30} +} +func (m *QueryResult) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_QueryResult.Unmarshal(m, b) +} +func (m *QueryResult) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_QueryResult.Marshal(b, m, deterministic) +} +func (dst *QueryResult) XXX_Merge(src proto.Message) { + xxx_messageInfo_QueryResult.Merge(dst, src) +} +func (m *QueryResult) XXX_Size() int { + return xxx_messageInfo_QueryResult.Size(m) +} +func (m *QueryResult) XXX_DiscardUnknown() { + xxx_messageInfo_QueryResult.DiscardUnknown(m) +} + +var xxx_messageInfo_QueryResult proto.InternalMessageInfo func (m *QueryResult) GetCursor() *Cursor { if m != nil { @@ -2667,18 +3622,39 @@ func (m *QueryResult) GetVersion() []int64 { } type AllocateIdsRequest struct { - Header *InternalHeader `protobuf:"bytes,4,opt,name=header" json:"header,omitempty"` - ModelKey *Reference `protobuf:"bytes,1,opt,name=model_key,json=modelKey" json:"model_key,omitempty"` - Size *int64 `protobuf:"varint,2,opt,name=size" json:"size,omitempty"` - Max *int64 `protobuf:"varint,3,opt,name=max" json:"max,omitempty"` - Reserve []*Reference `protobuf:"bytes,5,rep,name=reserve" json:"reserve,omitempty"` - XXX_unrecognized []byte `json:"-"` + Header *InternalHeader `protobuf:"bytes,4,opt,name=header" json:"header,omitempty"` + ModelKey *Reference `protobuf:"bytes,1,opt,name=model_key,json=modelKey" json:"model_key,omitempty"` + Size *int64 `protobuf:"varint,2,opt,name=size" json:"size,omitempty"` + Max *int64 `protobuf:"varint,3,opt,name=max" json:"max,omitempty"` + Reserve []*Reference `protobuf:"bytes,5,rep,name=reserve" json:"reserve,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *AllocateIdsRequest) Reset() { *m = AllocateIdsRequest{} } +func (m *AllocateIdsRequest) String() string { return proto.CompactTextString(m) } +func (*AllocateIdsRequest) ProtoMessage() {} +func (*AllocateIdsRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{31} +} +func (m *AllocateIdsRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_AllocateIdsRequest.Unmarshal(m, b) +} +func (m *AllocateIdsRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_AllocateIdsRequest.Marshal(b, m, deterministic) +} +func (dst *AllocateIdsRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_AllocateIdsRequest.Merge(dst, src) +} +func (m *AllocateIdsRequest) XXX_Size() int { + return xxx_messageInfo_AllocateIdsRequest.Size(m) +} +func (m *AllocateIdsRequest) XXX_DiscardUnknown() { + xxx_messageInfo_AllocateIdsRequest.DiscardUnknown(m) } -func (m *AllocateIdsRequest) Reset() { *m = AllocateIdsRequest{} } -func (m *AllocateIdsRequest) String() string { return proto.CompactTextString(m) } -func (*AllocateIdsRequest) ProtoMessage() {} -func (*AllocateIdsRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{31} } +var xxx_messageInfo_AllocateIdsRequest proto.InternalMessageInfo func (m *AllocateIdsRequest) GetHeader() *InternalHeader { if m != nil { @@ -2716,16 +3692,37 @@ func (m *AllocateIdsRequest) GetReserve() []*Reference { } type AllocateIdsResponse struct { - Start *int64 `protobuf:"varint,1,req,name=start" json:"start,omitempty"` - End *int64 `protobuf:"varint,2,req,name=end" json:"end,omitempty"` - Cost *Cost `protobuf:"bytes,3,opt,name=cost" json:"cost,omitempty"` - XXX_unrecognized []byte `json:"-"` + Start *int64 `protobuf:"varint,1,req,name=start" json:"start,omitempty"` + End *int64 `protobuf:"varint,2,req,name=end" json:"end,omitempty"` + Cost *Cost `protobuf:"bytes,3,opt,name=cost" json:"cost,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *AllocateIdsResponse) Reset() { *m = AllocateIdsResponse{} } -func (m *AllocateIdsResponse) String() string { return proto.CompactTextString(m) } -func (*AllocateIdsResponse) ProtoMessage() {} -func (*AllocateIdsResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{32} } +func (m *AllocateIdsResponse) Reset() { *m = AllocateIdsResponse{} } +func (m *AllocateIdsResponse) String() string { return proto.CompactTextString(m) } +func (*AllocateIdsResponse) ProtoMessage() {} +func (*AllocateIdsResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{32} +} +func (m *AllocateIdsResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_AllocateIdsResponse.Unmarshal(m, b) +} +func (m *AllocateIdsResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_AllocateIdsResponse.Marshal(b, m, deterministic) +} +func (dst *AllocateIdsResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_AllocateIdsResponse.Merge(dst, src) +} +func (m *AllocateIdsResponse) XXX_Size() int { + return xxx_messageInfo_AllocateIdsResponse.Size(m) +} +func (m *AllocateIdsResponse) XXX_DiscardUnknown() { + xxx_messageInfo_AllocateIdsResponse.DiscardUnknown(m) +} + +var xxx_messageInfo_AllocateIdsResponse proto.InternalMessageInfo func (m *AllocateIdsResponse) GetStart() int64 { if m != nil && m.Start != nil { @@ -2749,14 +3746,35 @@ func (m *AllocateIdsResponse) GetCost() *Cost { } type CompositeIndices struct { - Index []*CompositeIndex `protobuf:"bytes,1,rep,name=index" json:"index,omitempty"` - XXX_unrecognized []byte `json:"-"` + Index []*CompositeIndex `protobuf:"bytes,1,rep,name=index" json:"index,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *CompositeIndices) Reset() { *m = CompositeIndices{} } -func (m *CompositeIndices) String() string { return proto.CompactTextString(m) } -func (*CompositeIndices) ProtoMessage() {} -func (*CompositeIndices) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{33} } +func (m *CompositeIndices) Reset() { *m = CompositeIndices{} } +func (m *CompositeIndices) String() string { return proto.CompactTextString(m) } +func (*CompositeIndices) ProtoMessage() {} +func (*CompositeIndices) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{33} +} +func (m *CompositeIndices) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_CompositeIndices.Unmarshal(m, b) +} +func (m *CompositeIndices) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_CompositeIndices.Marshal(b, m, deterministic) +} +func (dst *CompositeIndices) XXX_Merge(src proto.Message) { + xxx_messageInfo_CompositeIndices.Merge(dst, src) +} +func (m *CompositeIndices) XXX_Size() int { + return xxx_messageInfo_CompositeIndices.Size(m) +} +func (m *CompositeIndices) XXX_DiscardUnknown() { + xxx_messageInfo_CompositeIndices.DiscardUnknown(m) +} + +var xxx_messageInfo_CompositeIndices proto.InternalMessageInfo func (m *CompositeIndices) GetIndex() []*CompositeIndex { if m != nil { @@ -2766,16 +3784,37 @@ func (m *CompositeIndices) GetIndex() []*CompositeIndex { } type AddActionsRequest struct { - Header *InternalHeader `protobuf:"bytes,3,opt,name=header" json:"header,omitempty"` - Transaction *Transaction `protobuf:"bytes,1,req,name=transaction" json:"transaction,omitempty"` - Action []*Action `protobuf:"bytes,2,rep,name=action" json:"action,omitempty"` - XXX_unrecognized []byte `json:"-"` + Header *InternalHeader `protobuf:"bytes,3,opt,name=header" json:"header,omitempty"` + Transaction *Transaction `protobuf:"bytes,1,req,name=transaction" json:"transaction,omitempty"` + Action []*Action `protobuf:"bytes,2,rep,name=action" json:"action,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *AddActionsRequest) Reset() { *m = AddActionsRequest{} } +func (m *AddActionsRequest) String() string { return proto.CompactTextString(m) } +func (*AddActionsRequest) ProtoMessage() {} +func (*AddActionsRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{34} +} +func (m *AddActionsRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_AddActionsRequest.Unmarshal(m, b) +} +func (m *AddActionsRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_AddActionsRequest.Marshal(b, m, deterministic) +} +func (dst *AddActionsRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_AddActionsRequest.Merge(dst, src) +} +func (m *AddActionsRequest) XXX_Size() int { + return xxx_messageInfo_AddActionsRequest.Size(m) +} +func (m *AddActionsRequest) XXX_DiscardUnknown() { + xxx_messageInfo_AddActionsRequest.DiscardUnknown(m) } -func (m *AddActionsRequest) Reset() { *m = AddActionsRequest{} } -func (m *AddActionsRequest) String() string { return proto.CompactTextString(m) } -func (*AddActionsRequest) ProtoMessage() {} -func (*AddActionsRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{34} } +var xxx_messageInfo_AddActionsRequest proto.InternalMessageInfo func (m *AddActionsRequest) GetHeader() *InternalHeader { if m != nil { @@ -2799,28 +3838,70 @@ func (m *AddActionsRequest) GetAction() []*Action { } type AddActionsResponse struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *AddActionsResponse) Reset() { *m = AddActionsResponse{} } -func (m *AddActionsResponse) String() string { return proto.CompactTextString(m) } -func (*AddActionsResponse) ProtoMessage() {} -func (*AddActionsResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{35} } +func (m *AddActionsResponse) Reset() { *m = AddActionsResponse{} } +func (m *AddActionsResponse) String() string { return proto.CompactTextString(m) } +func (*AddActionsResponse) ProtoMessage() {} +func (*AddActionsResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{35} +} +func (m *AddActionsResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_AddActionsResponse.Unmarshal(m, b) +} +func (m *AddActionsResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_AddActionsResponse.Marshal(b, m, deterministic) +} +func (dst *AddActionsResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_AddActionsResponse.Merge(dst, src) +} +func (m *AddActionsResponse) XXX_Size() int { + return xxx_messageInfo_AddActionsResponse.Size(m) +} +func (m *AddActionsResponse) XXX_DiscardUnknown() { + xxx_messageInfo_AddActionsResponse.DiscardUnknown(m) +} + +var xxx_messageInfo_AddActionsResponse proto.InternalMessageInfo type BeginTransactionRequest struct { - Header *InternalHeader `protobuf:"bytes,3,opt,name=header" json:"header,omitempty"` - App *string `protobuf:"bytes,1,req,name=app" json:"app,omitempty"` - AllowMultipleEg *bool `protobuf:"varint,2,opt,name=allow_multiple_eg,json=allowMultipleEg,def=0" json:"allow_multiple_eg,omitempty"` - DatabaseId *string `protobuf:"bytes,4,opt,name=database_id,json=databaseId" json:"database_id,omitempty"` - Mode *BeginTransactionRequest_TransactionMode `protobuf:"varint,5,opt,name=mode,enum=appengine.BeginTransactionRequest_TransactionMode,def=0" json:"mode,omitempty"` - PreviousTransaction *Transaction `protobuf:"bytes,7,opt,name=previous_transaction,json=previousTransaction" json:"previous_transaction,omitempty"` - XXX_unrecognized []byte `json:"-"` + Header *InternalHeader `protobuf:"bytes,3,opt,name=header" json:"header,omitempty"` + App *string `protobuf:"bytes,1,req,name=app" json:"app,omitempty"` + AllowMultipleEg *bool `protobuf:"varint,2,opt,name=allow_multiple_eg,json=allowMultipleEg,def=0" json:"allow_multiple_eg,omitempty"` + DatabaseId *string `protobuf:"bytes,4,opt,name=database_id,json=databaseId" json:"database_id,omitempty"` + Mode *BeginTransactionRequest_TransactionMode `protobuf:"varint,5,opt,name=mode,enum=appengine.BeginTransactionRequest_TransactionMode,def=0" json:"mode,omitempty"` + PreviousTransaction *Transaction `protobuf:"bytes,7,opt,name=previous_transaction,json=previousTransaction" json:"previous_transaction,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *BeginTransactionRequest) Reset() { *m = BeginTransactionRequest{} } +func (m *BeginTransactionRequest) String() string { return proto.CompactTextString(m) } +func (*BeginTransactionRequest) ProtoMessage() {} +func (*BeginTransactionRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{36} +} +func (m *BeginTransactionRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_BeginTransactionRequest.Unmarshal(m, b) +} +func (m *BeginTransactionRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_BeginTransactionRequest.Marshal(b, m, deterministic) +} +func (dst *BeginTransactionRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_BeginTransactionRequest.Merge(dst, src) +} +func (m *BeginTransactionRequest) XXX_Size() int { + return xxx_messageInfo_BeginTransactionRequest.Size(m) +} +func (m *BeginTransactionRequest) XXX_DiscardUnknown() { + xxx_messageInfo_BeginTransactionRequest.DiscardUnknown(m) } -func (m *BeginTransactionRequest) Reset() { *m = BeginTransactionRequest{} } -func (m *BeginTransactionRequest) String() string { return proto.CompactTextString(m) } -func (*BeginTransactionRequest) ProtoMessage() {} -func (*BeginTransactionRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{36} } +var xxx_messageInfo_BeginTransactionRequest proto.InternalMessageInfo const Default_BeginTransactionRequest_AllowMultipleEg bool = false const Default_BeginTransactionRequest_Mode BeginTransactionRequest_TransactionMode = BeginTransactionRequest_UNKNOWN @@ -2868,15 +3949,36 @@ func (m *BeginTransactionRequest) GetPreviousTransaction() *Transaction { } type CommitResponse struct { - Cost *Cost `protobuf:"bytes,1,opt,name=cost" json:"cost,omitempty"` - Version []*CommitResponse_Version `protobuf:"group,3,rep,name=Version,json=version" json:"version,omitempty"` - XXX_unrecognized []byte `json:"-"` + Cost *Cost `protobuf:"bytes,1,opt,name=cost" json:"cost,omitempty"` + Version []*CommitResponse_Version `protobuf:"group,3,rep,name=Version,json=version" json:"version,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CommitResponse) Reset() { *m = CommitResponse{} } +func (m *CommitResponse) String() string { return proto.CompactTextString(m) } +func (*CommitResponse) ProtoMessage() {} +func (*CommitResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{37} +} +func (m *CommitResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_CommitResponse.Unmarshal(m, b) +} +func (m *CommitResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_CommitResponse.Marshal(b, m, deterministic) +} +func (dst *CommitResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_CommitResponse.Merge(dst, src) +} +func (m *CommitResponse) XXX_Size() int { + return xxx_messageInfo_CommitResponse.Size(m) +} +func (m *CommitResponse) XXX_DiscardUnknown() { + xxx_messageInfo_CommitResponse.DiscardUnknown(m) } -func (m *CommitResponse) Reset() { *m = CommitResponse{} } -func (m *CommitResponse) String() string { return proto.CompactTextString(m) } -func (*CommitResponse) ProtoMessage() {} -func (*CommitResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{37} } +var xxx_messageInfo_CommitResponse proto.InternalMessageInfo func (m *CommitResponse) GetCost() *Cost { if m != nil { @@ -2893,15 +3995,36 @@ func (m *CommitResponse) GetVersion() []*CommitResponse_Version { } type CommitResponse_Version struct { - RootEntityKey *Reference `protobuf:"bytes,4,req,name=root_entity_key,json=rootEntityKey" json:"root_entity_key,omitempty"` - Version *int64 `protobuf:"varint,5,req,name=version" json:"version,omitempty"` - XXX_unrecognized []byte `json:"-"` + RootEntityKey *Reference `protobuf:"bytes,4,req,name=root_entity_key,json=rootEntityKey" json:"root_entity_key,omitempty"` + Version *int64 `protobuf:"varint,5,req,name=version" json:"version,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *CommitResponse_Version) Reset() { *m = CommitResponse_Version{} } +func (m *CommitResponse_Version) String() string { return proto.CompactTextString(m) } +func (*CommitResponse_Version) ProtoMessage() {} +func (*CommitResponse_Version) Descriptor() ([]byte, []int) { + return fileDescriptor_datastore_v3_83b17b80c34f6179, []int{37, 0} +} +func (m *CommitResponse_Version) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_CommitResponse_Version.Unmarshal(m, b) +} +func (m *CommitResponse_Version) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_CommitResponse_Version.Marshal(b, m, deterministic) +} +func (dst *CommitResponse_Version) XXX_Merge(src proto.Message) { + xxx_messageInfo_CommitResponse_Version.Merge(dst, src) +} +func (m *CommitResponse_Version) XXX_Size() int { + return xxx_messageInfo_CommitResponse_Version.Size(m) +} +func (m *CommitResponse_Version) XXX_DiscardUnknown() { + xxx_messageInfo_CommitResponse_Version.DiscardUnknown(m) } -func (m *CommitResponse_Version) Reset() { *m = CommitResponse_Version{} } -func (m *CommitResponse_Version) String() string { return proto.CompactTextString(m) } -func (*CommitResponse_Version) ProtoMessage() {} -func (*CommitResponse_Version) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{37, 0} } +var xxx_messageInfo_CommitResponse_Version proto.InternalMessageInfo func (m *CommitResponse_Version) GetRootEntityKey() *Reference { if m != nil { @@ -2976,10 +4099,10 @@ func init() { } func init() { - proto.RegisterFile("google.golang.org/appengine/internal/datastore/datastore_v3.proto", fileDescriptor0) + proto.RegisterFile("google.golang.org/appengine/internal/datastore/datastore_v3.proto", fileDescriptor_datastore_v3_83b17b80c34f6179) } -var fileDescriptor0 = []byte{ +var fileDescriptor_datastore_v3_83b17b80c34f6179 = []byte{ // 4156 bytes of a gzipped FileDescriptorProto 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xcc, 0x5a, 0xcd, 0x73, 0xe3, 0x46, 0x76, 0x37, 0xc1, 0xef, 0x47, 0x89, 0x82, 0x5a, 0xf3, 0xc1, 0xa1, 0x3f, 0x46, 0xc6, 0xac, 0x6d, diff --git a/vendor/google.golang.org/appengine/internal/identity.go b/vendor/google.golang.org/appengine/internal/identity.go index d538701a..9b4134e4 100644 --- a/vendor/google.golang.org/appengine/internal/identity.go +++ b/vendor/google.golang.org/appengine/internal/identity.go @@ -4,11 +4,52 @@ package internal -import netcontext "golang.org/x/net/context" +import ( + "os" -// These functions are implementations of the wrapper functions -// in ../appengine/identity.go. See that file for commentary. + netcontext "golang.org/x/net/context" +) +var ( + // This is set to true in identity_classic.go, which is behind the appengine build tag. + // The appengine build tag is set for the first generation runtimes (<= Go 1.9) but not + // the second generation runtimes (>= Go 1.11), so this indicates whether we're on a + // first-gen runtime. See IsStandard below for the second-gen check. + appengineStandard bool + + // This is set to true in identity_flex.go, which is behind the appenginevm build tag. + appengineFlex bool +) + +// AppID is the implementation of the wrapper function of the same name in +// ../identity.go. See that file for commentary. func AppID(c netcontext.Context) string { return appID(FullyQualifiedAppID(c)) } + +// IsStandard is the implementation of the wrapper function of the same name in +// ../appengine.go. See that file for commentary. +func IsStandard() bool { + // appengineStandard will be true for first-gen runtimes (<= Go 1.9) but not + // second-gen (>= Go 1.11). + return appengineStandard || IsSecondGen() +} + +// IsStandard is the implementation of the wrapper function of the same name in +// ../appengine.go. See that file for commentary. +func IsSecondGen() bool { + // Second-gen runtimes set $GAE_ENV so we use that to check if we're on a second-gen runtime. + return os.Getenv("GAE_ENV") == "standard" +} + +// IsFlex is the implementation of the wrapper function of the same name in +// ../appengine.go. See that file for commentary. +func IsFlex() bool { + return appengineFlex +} + +// IsAppEngine is the implementation of the wrapper function of the same name in +// ../appengine.go. See that file for commentary. +func IsAppEngine() bool { + return IsStandard() || IsFlex() +} diff --git a/vendor/google.golang.org/appengine/internal/identity_classic.go b/vendor/google.golang.org/appengine/internal/identity_classic.go index b59603f1..4e979f45 100644 --- a/vendor/google.golang.org/appengine/internal/identity_classic.go +++ b/vendor/google.golang.org/appengine/internal/identity_classic.go @@ -12,6 +12,10 @@ import ( netcontext "golang.org/x/net/context" ) +func init() { + appengineStandard = true +} + func DefaultVersionHostname(ctx netcontext.Context) string { c := fromContext(ctx) if c == nil { diff --git a/vendor/google.golang.org/appengine/internal/identity_flex.go b/vendor/google.golang.org/appengine/internal/identity_flex.go new file mode 100644 index 00000000..d5e2e7b5 --- /dev/null +++ b/vendor/google.golang.org/appengine/internal/identity_flex.go @@ -0,0 +1,11 @@ +// Copyright 2018 Google LLC. All rights reserved. +// Use of this source code is governed by the Apache 2.0 +// license that can be found in the LICENSE file. + +// +build appenginevm + +package internal + +func init() { + appengineFlex = true +} diff --git a/vendor/google.golang.org/appengine/internal/identity_vm.go b/vendor/google.golang.org/appengine/internal/identity_vm.go index d5fa75be..5d806726 100644 --- a/vendor/google.golang.org/appengine/internal/identity_vm.go +++ b/vendor/google.golang.org/appengine/internal/identity_vm.go @@ -7,8 +7,10 @@ package internal import ( + "log" "net/http" "os" + "strings" netcontext "golang.org/x/net/context" ) @@ -39,7 +41,21 @@ func RequestID(ctx netcontext.Context) string { } func Datacenter(ctx netcontext.Context) string { - return ctxHeaders(ctx).Get(hDatacenter) + if dc := ctxHeaders(ctx).Get(hDatacenter); dc != "" { + return dc + } + // If the header isn't set, read zone from the metadata service. + // It has the format projects/[NUMERIC_PROJECT_ID]/zones/[ZONE] + zone, err := getMetadata("instance/zone") + if err != nil { + log.Printf("Datacenter: %v", err) + return "" + } + parts := strings.Split(string(zone), "/") + if len(parts) == 0 { + return "" + } + return parts[len(parts)-1] } func ServerSoftware() string { @@ -47,6 +63,9 @@ func ServerSoftware() string { if s := os.Getenv("SERVER_SOFTWARE"); s != "" { return s } + if s := os.Getenv("GAE_ENV"); s != "" { + return s + } return "Google App Engine/1.x.x" } @@ -56,6 +75,9 @@ func ModuleName(_ netcontext.Context) string { if s := os.Getenv("GAE_MODULE_NAME"); s != "" { return s } + if s := os.Getenv("GAE_SERVICE"); s != "" { + return s + } return string(mustGetMetadata("instance/attributes/gae_backend_name")) } @@ -63,6 +85,9 @@ func VersionID(_ netcontext.Context) string { if s1, s2 := os.Getenv("GAE_MODULE_VERSION"), os.Getenv("GAE_MINOR_VERSION"); s1 != "" && s2 != "" { return s1 + "." + s2 } + if s1, s2 := os.Getenv("GAE_VERSION"), os.Getenv("GAE_DEPLOYMENT_ID"); s1 != "" && s2 != "" { + return s1 + "." + s2 + } return string(mustGetMetadata("instance/attributes/gae_backend_version")) + "." + string(mustGetMetadata("instance/attributes/gae_backend_minor_version")) } @@ -70,19 +95,27 @@ func InstanceID() string { if s := os.Getenv("GAE_MODULE_INSTANCE"); s != "" { return s } + if s := os.Getenv("GAE_INSTANCE"); s != "" { + return s + } return string(mustGetMetadata("instance/attributes/gae_backend_instance")) } func partitionlessAppID() string { // gae_project has everything except the partition prefix. - appID := os.Getenv("GAE_LONG_APP_ID") - if appID == "" { - appID = string(mustGetMetadata("instance/attributes/gae_project")) + if appID := os.Getenv("GAE_LONG_APP_ID"); appID != "" { + return appID } - return appID + if project := os.Getenv("GOOGLE_CLOUD_PROJECT"); project != "" { + return project + } + return string(mustGetMetadata("instance/attributes/gae_project")) } func fullyQualifiedAppID(_ netcontext.Context) string { + if s := os.Getenv("GAE_APPLICATION"); s != "" { + return s + } appID := partitionlessAppID() part := os.Getenv("GAE_PARTITION") diff --git a/vendor/google.golang.org/appengine/internal/log/log_service.pb.go b/vendor/google.golang.org/appengine/internal/log/log_service.pb.go index 5549605a..8545ac4a 100644 --- a/vendor/google.golang.org/appengine/internal/log/log_service.pb.go +++ b/vendor/google.golang.org/appengine/internal/log/log_service.pb.go @@ -1,28 +1,6 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // source: google.golang.org/appengine/internal/log/log_service.proto -/* -Package log is a generated protocol buffer package. - -It is generated from these files: - google.golang.org/appengine/internal/log/log_service.proto - -It has these top-level messages: - LogServiceError - UserAppLogLine - UserAppLogGroup - FlushRequest - SetStatusRequest - LogOffset - LogLine - RequestLog - LogModuleVersion - LogReadRequest - LogReadResponse - LogUsageRecord - LogUsageRequest - LogUsageResponse -*/ package log import proto "github.com/golang/protobuf/proto" @@ -75,28 +53,72 @@ func (x *LogServiceError_ErrorCode) UnmarshalJSON(data []byte) error { *x = LogServiceError_ErrorCode(value) return nil } -func (LogServiceError_ErrorCode) EnumDescriptor() ([]byte, []int) { return fileDescriptor0, []int{0, 0} } +func (LogServiceError_ErrorCode) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{0, 0} +} type LogServiceError struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *LogServiceError) Reset() { *m = LogServiceError{} } +func (m *LogServiceError) String() string { return proto.CompactTextString(m) } +func (*LogServiceError) ProtoMessage() {} +func (*LogServiceError) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{0} +} +func (m *LogServiceError) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_LogServiceError.Unmarshal(m, b) +} +func (m *LogServiceError) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_LogServiceError.Marshal(b, m, deterministic) +} +func (dst *LogServiceError) XXX_Merge(src proto.Message) { + xxx_messageInfo_LogServiceError.Merge(dst, src) +} +func (m *LogServiceError) XXX_Size() int { + return xxx_messageInfo_LogServiceError.Size(m) +} +func (m *LogServiceError) XXX_DiscardUnknown() { + xxx_messageInfo_LogServiceError.DiscardUnknown(m) } -func (m *LogServiceError) Reset() { *m = LogServiceError{} } -func (m *LogServiceError) String() string { return proto.CompactTextString(m) } -func (*LogServiceError) ProtoMessage() {} -func (*LogServiceError) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{0} } +var xxx_messageInfo_LogServiceError proto.InternalMessageInfo type UserAppLogLine struct { - TimestampUsec *int64 `protobuf:"varint,1,req,name=timestamp_usec,json=timestampUsec" json:"timestamp_usec,omitempty"` - Level *int64 `protobuf:"varint,2,req,name=level" json:"level,omitempty"` - Message *string `protobuf:"bytes,3,req,name=message" json:"message,omitempty"` - XXX_unrecognized []byte `json:"-"` + TimestampUsec *int64 `protobuf:"varint,1,req,name=timestamp_usec,json=timestampUsec" json:"timestamp_usec,omitempty"` + Level *int64 `protobuf:"varint,2,req,name=level" json:"level,omitempty"` + Message *string `protobuf:"bytes,3,req,name=message" json:"message,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *UserAppLogLine) Reset() { *m = UserAppLogLine{} } +func (m *UserAppLogLine) String() string { return proto.CompactTextString(m) } +func (*UserAppLogLine) ProtoMessage() {} +func (*UserAppLogLine) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{1} +} +func (m *UserAppLogLine) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_UserAppLogLine.Unmarshal(m, b) +} +func (m *UserAppLogLine) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_UserAppLogLine.Marshal(b, m, deterministic) +} +func (dst *UserAppLogLine) XXX_Merge(src proto.Message) { + xxx_messageInfo_UserAppLogLine.Merge(dst, src) +} +func (m *UserAppLogLine) XXX_Size() int { + return xxx_messageInfo_UserAppLogLine.Size(m) +} +func (m *UserAppLogLine) XXX_DiscardUnknown() { + xxx_messageInfo_UserAppLogLine.DiscardUnknown(m) } -func (m *UserAppLogLine) Reset() { *m = UserAppLogLine{} } -func (m *UserAppLogLine) String() string { return proto.CompactTextString(m) } -func (*UserAppLogLine) ProtoMessage() {} -func (*UserAppLogLine) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1} } +var xxx_messageInfo_UserAppLogLine proto.InternalMessageInfo func (m *UserAppLogLine) GetTimestampUsec() int64 { if m != nil && m.TimestampUsec != nil { @@ -120,14 +142,35 @@ func (m *UserAppLogLine) GetMessage() string { } type UserAppLogGroup struct { - LogLine []*UserAppLogLine `protobuf:"bytes,2,rep,name=log_line,json=logLine" json:"log_line,omitempty"` - XXX_unrecognized []byte `json:"-"` + LogLine []*UserAppLogLine `protobuf:"bytes,2,rep,name=log_line,json=logLine" json:"log_line,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *UserAppLogGroup) Reset() { *m = UserAppLogGroup{} } +func (m *UserAppLogGroup) String() string { return proto.CompactTextString(m) } +func (*UserAppLogGroup) ProtoMessage() {} +func (*UserAppLogGroup) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{2} +} +func (m *UserAppLogGroup) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_UserAppLogGroup.Unmarshal(m, b) +} +func (m *UserAppLogGroup) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_UserAppLogGroup.Marshal(b, m, deterministic) +} +func (dst *UserAppLogGroup) XXX_Merge(src proto.Message) { + xxx_messageInfo_UserAppLogGroup.Merge(dst, src) +} +func (m *UserAppLogGroup) XXX_Size() int { + return xxx_messageInfo_UserAppLogGroup.Size(m) +} +func (m *UserAppLogGroup) XXX_DiscardUnknown() { + xxx_messageInfo_UserAppLogGroup.DiscardUnknown(m) } -func (m *UserAppLogGroup) Reset() { *m = UserAppLogGroup{} } -func (m *UserAppLogGroup) String() string { return proto.CompactTextString(m) } -func (*UserAppLogGroup) ProtoMessage() {} -func (*UserAppLogGroup) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{2} } +var xxx_messageInfo_UserAppLogGroup proto.InternalMessageInfo func (m *UserAppLogGroup) GetLogLine() []*UserAppLogLine { if m != nil { @@ -137,14 +180,35 @@ func (m *UserAppLogGroup) GetLogLine() []*UserAppLogLine { } type FlushRequest struct { - Logs []byte `protobuf:"bytes,1,opt,name=logs" json:"logs,omitempty"` - XXX_unrecognized []byte `json:"-"` + Logs []byte `protobuf:"bytes,1,opt,name=logs" json:"logs,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *FlushRequest) Reset() { *m = FlushRequest{} } -func (m *FlushRequest) String() string { return proto.CompactTextString(m) } -func (*FlushRequest) ProtoMessage() {} -func (*FlushRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{3} } +func (m *FlushRequest) Reset() { *m = FlushRequest{} } +func (m *FlushRequest) String() string { return proto.CompactTextString(m) } +func (*FlushRequest) ProtoMessage() {} +func (*FlushRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{3} +} +func (m *FlushRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_FlushRequest.Unmarshal(m, b) +} +func (m *FlushRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_FlushRequest.Marshal(b, m, deterministic) +} +func (dst *FlushRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_FlushRequest.Merge(dst, src) +} +func (m *FlushRequest) XXX_Size() int { + return xxx_messageInfo_FlushRequest.Size(m) +} +func (m *FlushRequest) XXX_DiscardUnknown() { + xxx_messageInfo_FlushRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_FlushRequest proto.InternalMessageInfo func (m *FlushRequest) GetLogs() []byte { if m != nil { @@ -154,14 +218,35 @@ func (m *FlushRequest) GetLogs() []byte { } type SetStatusRequest struct { - Status *string `protobuf:"bytes,1,req,name=status" json:"status,omitempty"` - XXX_unrecognized []byte `json:"-"` + Status *string `protobuf:"bytes,1,req,name=status" json:"status,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *SetStatusRequest) Reset() { *m = SetStatusRequest{} } +func (m *SetStatusRequest) String() string { return proto.CompactTextString(m) } +func (*SetStatusRequest) ProtoMessage() {} +func (*SetStatusRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{4} +} +func (m *SetStatusRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_SetStatusRequest.Unmarshal(m, b) +} +func (m *SetStatusRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_SetStatusRequest.Marshal(b, m, deterministic) +} +func (dst *SetStatusRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_SetStatusRequest.Merge(dst, src) +} +func (m *SetStatusRequest) XXX_Size() int { + return xxx_messageInfo_SetStatusRequest.Size(m) +} +func (m *SetStatusRequest) XXX_DiscardUnknown() { + xxx_messageInfo_SetStatusRequest.DiscardUnknown(m) } -func (m *SetStatusRequest) Reset() { *m = SetStatusRequest{} } -func (m *SetStatusRequest) String() string { return proto.CompactTextString(m) } -func (*SetStatusRequest) ProtoMessage() {} -func (*SetStatusRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{4} } +var xxx_messageInfo_SetStatusRequest proto.InternalMessageInfo func (m *SetStatusRequest) GetStatus() string { if m != nil && m.Status != nil { @@ -171,14 +256,35 @@ func (m *SetStatusRequest) GetStatus() string { } type LogOffset struct { - RequestId []byte `protobuf:"bytes,1,opt,name=request_id,json=requestId" json:"request_id,omitempty"` - XXX_unrecognized []byte `json:"-"` + RequestId []byte `protobuf:"bytes,1,opt,name=request_id,json=requestId" json:"request_id,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *LogOffset) Reset() { *m = LogOffset{} } -func (m *LogOffset) String() string { return proto.CompactTextString(m) } -func (*LogOffset) ProtoMessage() {} -func (*LogOffset) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{5} } +func (m *LogOffset) Reset() { *m = LogOffset{} } +func (m *LogOffset) String() string { return proto.CompactTextString(m) } +func (*LogOffset) ProtoMessage() {} +func (*LogOffset) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{5} +} +func (m *LogOffset) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_LogOffset.Unmarshal(m, b) +} +func (m *LogOffset) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_LogOffset.Marshal(b, m, deterministic) +} +func (dst *LogOffset) XXX_Merge(src proto.Message) { + xxx_messageInfo_LogOffset.Merge(dst, src) +} +func (m *LogOffset) XXX_Size() int { + return xxx_messageInfo_LogOffset.Size(m) +} +func (m *LogOffset) XXX_DiscardUnknown() { + xxx_messageInfo_LogOffset.DiscardUnknown(m) +} + +var xxx_messageInfo_LogOffset proto.InternalMessageInfo func (m *LogOffset) GetRequestId() []byte { if m != nil { @@ -188,16 +294,37 @@ func (m *LogOffset) GetRequestId() []byte { } type LogLine struct { - Time *int64 `protobuf:"varint,1,req,name=time" json:"time,omitempty"` - Level *int32 `protobuf:"varint,2,req,name=level" json:"level,omitempty"` - LogMessage *string `protobuf:"bytes,3,req,name=log_message,json=logMessage" json:"log_message,omitempty"` - XXX_unrecognized []byte `json:"-"` + Time *int64 `protobuf:"varint,1,req,name=time" json:"time,omitempty"` + Level *int32 `protobuf:"varint,2,req,name=level" json:"level,omitempty"` + LogMessage *string `protobuf:"bytes,3,req,name=log_message,json=logMessage" json:"log_message,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *LogLine) Reset() { *m = LogLine{} } +func (m *LogLine) String() string { return proto.CompactTextString(m) } +func (*LogLine) ProtoMessage() {} +func (*LogLine) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{6} +} +func (m *LogLine) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_LogLine.Unmarshal(m, b) +} +func (m *LogLine) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_LogLine.Marshal(b, m, deterministic) +} +func (dst *LogLine) XXX_Merge(src proto.Message) { + xxx_messageInfo_LogLine.Merge(dst, src) +} +func (m *LogLine) XXX_Size() int { + return xxx_messageInfo_LogLine.Size(m) +} +func (m *LogLine) XXX_DiscardUnknown() { + xxx_messageInfo_LogLine.DiscardUnknown(m) } -func (m *LogLine) Reset() { *m = LogLine{} } -func (m *LogLine) String() string { return proto.CompactTextString(m) } -func (*LogLine) ProtoMessage() {} -func (*LogLine) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{6} } +var xxx_messageInfo_LogLine proto.InternalMessageInfo func (m *LogLine) GetTime() int64 { if m != nil && m.Time != nil { @@ -259,13 +386,34 @@ type RequestLog struct { WasThrottledForRequests *bool `protobuf:"varint,32,opt,name=was_throttled_for_requests,json=wasThrottledForRequests" json:"was_throttled_for_requests,omitempty"` ThrottledTime *int64 `protobuf:"varint,33,opt,name=throttled_time,json=throttledTime" json:"throttled_time,omitempty"` ServerName []byte `protobuf:"bytes,34,opt,name=server_name,json=serverName" json:"server_name,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *RequestLog) Reset() { *m = RequestLog{} } +func (m *RequestLog) String() string { return proto.CompactTextString(m) } +func (*RequestLog) ProtoMessage() {} +func (*RequestLog) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{7} +} +func (m *RequestLog) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_RequestLog.Unmarshal(m, b) +} +func (m *RequestLog) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_RequestLog.Marshal(b, m, deterministic) +} +func (dst *RequestLog) XXX_Merge(src proto.Message) { + xxx_messageInfo_RequestLog.Merge(dst, src) +} +func (m *RequestLog) XXX_Size() int { + return xxx_messageInfo_RequestLog.Size(m) +} +func (m *RequestLog) XXX_DiscardUnknown() { + xxx_messageInfo_RequestLog.DiscardUnknown(m) } -func (m *RequestLog) Reset() { *m = RequestLog{} } -func (m *RequestLog) String() string { return proto.CompactTextString(m) } -func (*RequestLog) ProtoMessage() {} -func (*RequestLog) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{7} } +var xxx_messageInfo_RequestLog proto.InternalMessageInfo const Default_RequestLog_ModuleId string = "default" const Default_RequestLog_ReplicaIndex int32 = -1 @@ -538,15 +686,36 @@ func (m *RequestLog) GetServerName() []byte { } type LogModuleVersion struct { - ModuleId *string `protobuf:"bytes,1,opt,name=module_id,json=moduleId,def=default" json:"module_id,omitempty"` - VersionId *string `protobuf:"bytes,2,opt,name=version_id,json=versionId" json:"version_id,omitempty"` - XXX_unrecognized []byte `json:"-"` + ModuleId *string `protobuf:"bytes,1,opt,name=module_id,json=moduleId,def=default" json:"module_id,omitempty"` + VersionId *string `protobuf:"bytes,2,opt,name=version_id,json=versionId" json:"version_id,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *LogModuleVersion) Reset() { *m = LogModuleVersion{} } +func (m *LogModuleVersion) String() string { return proto.CompactTextString(m) } +func (*LogModuleVersion) ProtoMessage() {} +func (*LogModuleVersion) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{8} +} +func (m *LogModuleVersion) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_LogModuleVersion.Unmarshal(m, b) +} +func (m *LogModuleVersion) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_LogModuleVersion.Marshal(b, m, deterministic) +} +func (dst *LogModuleVersion) XXX_Merge(src proto.Message) { + xxx_messageInfo_LogModuleVersion.Merge(dst, src) +} +func (m *LogModuleVersion) XXX_Size() int { + return xxx_messageInfo_LogModuleVersion.Size(m) +} +func (m *LogModuleVersion) XXX_DiscardUnknown() { + xxx_messageInfo_LogModuleVersion.DiscardUnknown(m) } -func (m *LogModuleVersion) Reset() { *m = LogModuleVersion{} } -func (m *LogModuleVersion) String() string { return proto.CompactTextString(m) } -func (*LogModuleVersion) ProtoMessage() {} -func (*LogModuleVersion) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{8} } +var xxx_messageInfo_LogModuleVersion proto.InternalMessageInfo const Default_LogModuleVersion_ModuleId string = "default" @@ -565,32 +734,53 @@ func (m *LogModuleVersion) GetVersionId() string { } type LogReadRequest struct { - AppId *string `protobuf:"bytes,1,req,name=app_id,json=appId" json:"app_id,omitempty"` - VersionId []string `protobuf:"bytes,2,rep,name=version_id,json=versionId" json:"version_id,omitempty"` - ModuleVersion []*LogModuleVersion `protobuf:"bytes,19,rep,name=module_version,json=moduleVersion" json:"module_version,omitempty"` - StartTime *int64 `protobuf:"varint,3,opt,name=start_time,json=startTime" json:"start_time,omitempty"` - EndTime *int64 `protobuf:"varint,4,opt,name=end_time,json=endTime" json:"end_time,omitempty"` - Offset *LogOffset `protobuf:"bytes,5,opt,name=offset" json:"offset,omitempty"` - RequestId [][]byte `protobuf:"bytes,6,rep,name=request_id,json=requestId" json:"request_id,omitempty"` - MinimumLogLevel *int32 `protobuf:"varint,7,opt,name=minimum_log_level,json=minimumLogLevel" json:"minimum_log_level,omitempty"` - IncludeIncomplete *bool `protobuf:"varint,8,opt,name=include_incomplete,json=includeIncomplete" json:"include_incomplete,omitempty"` - Count *int64 `protobuf:"varint,9,opt,name=count" json:"count,omitempty"` - CombinedLogRegex *string `protobuf:"bytes,14,opt,name=combined_log_regex,json=combinedLogRegex" json:"combined_log_regex,omitempty"` - HostRegex *string `protobuf:"bytes,15,opt,name=host_regex,json=hostRegex" json:"host_regex,omitempty"` - ReplicaIndex *int32 `protobuf:"varint,16,opt,name=replica_index,json=replicaIndex" json:"replica_index,omitempty"` - IncludeAppLogs *bool `protobuf:"varint,10,opt,name=include_app_logs,json=includeAppLogs" json:"include_app_logs,omitempty"` - AppLogsPerRequest *int32 `protobuf:"varint,17,opt,name=app_logs_per_request,json=appLogsPerRequest" json:"app_logs_per_request,omitempty"` - IncludeHost *bool `protobuf:"varint,11,opt,name=include_host,json=includeHost" json:"include_host,omitempty"` - IncludeAll *bool `protobuf:"varint,12,opt,name=include_all,json=includeAll" json:"include_all,omitempty"` - CacheIterator *bool `protobuf:"varint,13,opt,name=cache_iterator,json=cacheIterator" json:"cache_iterator,omitempty"` - NumShards *int32 `protobuf:"varint,18,opt,name=num_shards,json=numShards" json:"num_shards,omitempty"` - XXX_unrecognized []byte `json:"-"` -} - -func (m *LogReadRequest) Reset() { *m = LogReadRequest{} } -func (m *LogReadRequest) String() string { return proto.CompactTextString(m) } -func (*LogReadRequest) ProtoMessage() {} -func (*LogReadRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{9} } + AppId *string `protobuf:"bytes,1,req,name=app_id,json=appId" json:"app_id,omitempty"` + VersionId []string `protobuf:"bytes,2,rep,name=version_id,json=versionId" json:"version_id,omitempty"` + ModuleVersion []*LogModuleVersion `protobuf:"bytes,19,rep,name=module_version,json=moduleVersion" json:"module_version,omitempty"` + StartTime *int64 `protobuf:"varint,3,opt,name=start_time,json=startTime" json:"start_time,omitempty"` + EndTime *int64 `protobuf:"varint,4,opt,name=end_time,json=endTime" json:"end_time,omitempty"` + Offset *LogOffset `protobuf:"bytes,5,opt,name=offset" json:"offset,omitempty"` + RequestId [][]byte `protobuf:"bytes,6,rep,name=request_id,json=requestId" json:"request_id,omitempty"` + MinimumLogLevel *int32 `protobuf:"varint,7,opt,name=minimum_log_level,json=minimumLogLevel" json:"minimum_log_level,omitempty"` + IncludeIncomplete *bool `protobuf:"varint,8,opt,name=include_incomplete,json=includeIncomplete" json:"include_incomplete,omitempty"` + Count *int64 `protobuf:"varint,9,opt,name=count" json:"count,omitempty"` + CombinedLogRegex *string `protobuf:"bytes,14,opt,name=combined_log_regex,json=combinedLogRegex" json:"combined_log_regex,omitempty"` + HostRegex *string `protobuf:"bytes,15,opt,name=host_regex,json=hostRegex" json:"host_regex,omitempty"` + ReplicaIndex *int32 `protobuf:"varint,16,opt,name=replica_index,json=replicaIndex" json:"replica_index,omitempty"` + IncludeAppLogs *bool `protobuf:"varint,10,opt,name=include_app_logs,json=includeAppLogs" json:"include_app_logs,omitempty"` + AppLogsPerRequest *int32 `protobuf:"varint,17,opt,name=app_logs_per_request,json=appLogsPerRequest" json:"app_logs_per_request,omitempty"` + IncludeHost *bool `protobuf:"varint,11,opt,name=include_host,json=includeHost" json:"include_host,omitempty"` + IncludeAll *bool `protobuf:"varint,12,opt,name=include_all,json=includeAll" json:"include_all,omitempty"` + CacheIterator *bool `protobuf:"varint,13,opt,name=cache_iterator,json=cacheIterator" json:"cache_iterator,omitempty"` + NumShards *int32 `protobuf:"varint,18,opt,name=num_shards,json=numShards" json:"num_shards,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *LogReadRequest) Reset() { *m = LogReadRequest{} } +func (m *LogReadRequest) String() string { return proto.CompactTextString(m) } +func (*LogReadRequest) ProtoMessage() {} +func (*LogReadRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{9} +} +func (m *LogReadRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_LogReadRequest.Unmarshal(m, b) +} +func (m *LogReadRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_LogReadRequest.Marshal(b, m, deterministic) +} +func (dst *LogReadRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_LogReadRequest.Merge(dst, src) +} +func (m *LogReadRequest) XXX_Size() int { + return xxx_messageInfo_LogReadRequest.Size(m) +} +func (m *LogReadRequest) XXX_DiscardUnknown() { + xxx_messageInfo_LogReadRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_LogReadRequest proto.InternalMessageInfo func (m *LogReadRequest) GetAppId() string { if m != nil && m.AppId != nil { @@ -726,16 +916,37 @@ func (m *LogReadRequest) GetNumShards() int32 { } type LogReadResponse struct { - Log []*RequestLog `protobuf:"bytes,1,rep,name=log" json:"log,omitempty"` - Offset *LogOffset `protobuf:"bytes,2,opt,name=offset" json:"offset,omitempty"` - LastEndTime *int64 `protobuf:"varint,3,opt,name=last_end_time,json=lastEndTime" json:"last_end_time,omitempty"` - XXX_unrecognized []byte `json:"-"` + Log []*RequestLog `protobuf:"bytes,1,rep,name=log" json:"log,omitempty"` + Offset *LogOffset `protobuf:"bytes,2,opt,name=offset" json:"offset,omitempty"` + LastEndTime *int64 `protobuf:"varint,3,opt,name=last_end_time,json=lastEndTime" json:"last_end_time,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *LogReadResponse) Reset() { *m = LogReadResponse{} } +func (m *LogReadResponse) String() string { return proto.CompactTextString(m) } +func (*LogReadResponse) ProtoMessage() {} +func (*LogReadResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{10} +} +func (m *LogReadResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_LogReadResponse.Unmarshal(m, b) +} +func (m *LogReadResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_LogReadResponse.Marshal(b, m, deterministic) +} +func (dst *LogReadResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_LogReadResponse.Merge(dst, src) +} +func (m *LogReadResponse) XXX_Size() int { + return xxx_messageInfo_LogReadResponse.Size(m) +} +func (m *LogReadResponse) XXX_DiscardUnknown() { + xxx_messageInfo_LogReadResponse.DiscardUnknown(m) } -func (m *LogReadResponse) Reset() { *m = LogReadResponse{} } -func (m *LogReadResponse) String() string { return proto.CompactTextString(m) } -func (*LogReadResponse) ProtoMessage() {} -func (*LogReadResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{10} } +var xxx_messageInfo_LogReadResponse proto.InternalMessageInfo func (m *LogReadResponse) GetLog() []*RequestLog { if m != nil { @@ -759,19 +970,40 @@ func (m *LogReadResponse) GetLastEndTime() int64 { } type LogUsageRecord struct { - VersionId *string `protobuf:"bytes,1,opt,name=version_id,json=versionId" json:"version_id,omitempty"` - StartTime *int32 `protobuf:"varint,2,opt,name=start_time,json=startTime" json:"start_time,omitempty"` - EndTime *int32 `protobuf:"varint,3,opt,name=end_time,json=endTime" json:"end_time,omitempty"` - Count *int64 `protobuf:"varint,4,opt,name=count" json:"count,omitempty"` - TotalSize *int64 `protobuf:"varint,5,opt,name=total_size,json=totalSize" json:"total_size,omitempty"` - Records *int32 `protobuf:"varint,6,opt,name=records" json:"records,omitempty"` - XXX_unrecognized []byte `json:"-"` + VersionId *string `protobuf:"bytes,1,opt,name=version_id,json=versionId" json:"version_id,omitempty"` + StartTime *int32 `protobuf:"varint,2,opt,name=start_time,json=startTime" json:"start_time,omitempty"` + EndTime *int32 `protobuf:"varint,3,opt,name=end_time,json=endTime" json:"end_time,omitempty"` + Count *int64 `protobuf:"varint,4,opt,name=count" json:"count,omitempty"` + TotalSize *int64 `protobuf:"varint,5,opt,name=total_size,json=totalSize" json:"total_size,omitempty"` + Records *int32 `protobuf:"varint,6,opt,name=records" json:"records,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *LogUsageRecord) Reset() { *m = LogUsageRecord{} } -func (m *LogUsageRecord) String() string { return proto.CompactTextString(m) } -func (*LogUsageRecord) ProtoMessage() {} -func (*LogUsageRecord) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{11} } +func (m *LogUsageRecord) Reset() { *m = LogUsageRecord{} } +func (m *LogUsageRecord) String() string { return proto.CompactTextString(m) } +func (*LogUsageRecord) ProtoMessage() {} +func (*LogUsageRecord) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{11} +} +func (m *LogUsageRecord) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_LogUsageRecord.Unmarshal(m, b) +} +func (m *LogUsageRecord) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_LogUsageRecord.Marshal(b, m, deterministic) +} +func (dst *LogUsageRecord) XXX_Merge(src proto.Message) { + xxx_messageInfo_LogUsageRecord.Merge(dst, src) +} +func (m *LogUsageRecord) XXX_Size() int { + return xxx_messageInfo_LogUsageRecord.Size(m) +} +func (m *LogUsageRecord) XXX_DiscardUnknown() { + xxx_messageInfo_LogUsageRecord.DiscardUnknown(m) +} + +var xxx_messageInfo_LogUsageRecord proto.InternalMessageInfo func (m *LogUsageRecord) GetVersionId() string { if m != nil && m.VersionId != nil { @@ -816,21 +1048,42 @@ func (m *LogUsageRecord) GetRecords() int32 { } type LogUsageRequest struct { - AppId *string `protobuf:"bytes,1,req,name=app_id,json=appId" json:"app_id,omitempty"` - VersionId []string `protobuf:"bytes,2,rep,name=version_id,json=versionId" json:"version_id,omitempty"` - StartTime *int32 `protobuf:"varint,3,opt,name=start_time,json=startTime" json:"start_time,omitempty"` - EndTime *int32 `protobuf:"varint,4,opt,name=end_time,json=endTime" json:"end_time,omitempty"` - ResolutionHours *uint32 `protobuf:"varint,5,opt,name=resolution_hours,json=resolutionHours,def=1" json:"resolution_hours,omitempty"` - CombineVersions *bool `protobuf:"varint,6,opt,name=combine_versions,json=combineVersions" json:"combine_versions,omitempty"` - UsageVersion *int32 `protobuf:"varint,7,opt,name=usage_version,json=usageVersion" json:"usage_version,omitempty"` - VersionsOnly *bool `protobuf:"varint,8,opt,name=versions_only,json=versionsOnly" json:"versions_only,omitempty"` - XXX_unrecognized []byte `json:"-"` -} - -func (m *LogUsageRequest) Reset() { *m = LogUsageRequest{} } -func (m *LogUsageRequest) String() string { return proto.CompactTextString(m) } -func (*LogUsageRequest) ProtoMessage() {} -func (*LogUsageRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{12} } + AppId *string `protobuf:"bytes,1,req,name=app_id,json=appId" json:"app_id,omitempty"` + VersionId []string `protobuf:"bytes,2,rep,name=version_id,json=versionId" json:"version_id,omitempty"` + StartTime *int32 `protobuf:"varint,3,opt,name=start_time,json=startTime" json:"start_time,omitempty"` + EndTime *int32 `protobuf:"varint,4,opt,name=end_time,json=endTime" json:"end_time,omitempty"` + ResolutionHours *uint32 `protobuf:"varint,5,opt,name=resolution_hours,json=resolutionHours,def=1" json:"resolution_hours,omitempty"` + CombineVersions *bool `protobuf:"varint,6,opt,name=combine_versions,json=combineVersions" json:"combine_versions,omitempty"` + UsageVersion *int32 `protobuf:"varint,7,opt,name=usage_version,json=usageVersion" json:"usage_version,omitempty"` + VersionsOnly *bool `protobuf:"varint,8,opt,name=versions_only,json=versionsOnly" json:"versions_only,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *LogUsageRequest) Reset() { *m = LogUsageRequest{} } +func (m *LogUsageRequest) String() string { return proto.CompactTextString(m) } +func (*LogUsageRequest) ProtoMessage() {} +func (*LogUsageRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{12} +} +func (m *LogUsageRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_LogUsageRequest.Unmarshal(m, b) +} +func (m *LogUsageRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_LogUsageRequest.Marshal(b, m, deterministic) +} +func (dst *LogUsageRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_LogUsageRequest.Merge(dst, src) +} +func (m *LogUsageRequest) XXX_Size() int { + return xxx_messageInfo_LogUsageRequest.Size(m) +} +func (m *LogUsageRequest) XXX_DiscardUnknown() { + xxx_messageInfo_LogUsageRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_LogUsageRequest proto.InternalMessageInfo const Default_LogUsageRequest_ResolutionHours uint32 = 1 @@ -891,15 +1144,36 @@ func (m *LogUsageRequest) GetVersionsOnly() bool { } type LogUsageResponse struct { - Usage []*LogUsageRecord `protobuf:"bytes,1,rep,name=usage" json:"usage,omitempty"` - Summary *LogUsageRecord `protobuf:"bytes,2,opt,name=summary" json:"summary,omitempty"` - XXX_unrecognized []byte `json:"-"` + Usage []*LogUsageRecord `protobuf:"bytes,1,rep,name=usage" json:"usage,omitempty"` + Summary *LogUsageRecord `protobuf:"bytes,2,opt,name=summary" json:"summary,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *LogUsageResponse) Reset() { *m = LogUsageResponse{} } +func (m *LogUsageResponse) String() string { return proto.CompactTextString(m) } +func (*LogUsageResponse) ProtoMessage() {} +func (*LogUsageResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_log_service_f054fd4b5012319d, []int{13} +} +func (m *LogUsageResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_LogUsageResponse.Unmarshal(m, b) +} +func (m *LogUsageResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_LogUsageResponse.Marshal(b, m, deterministic) +} +func (dst *LogUsageResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_LogUsageResponse.Merge(dst, src) +} +func (m *LogUsageResponse) XXX_Size() int { + return xxx_messageInfo_LogUsageResponse.Size(m) +} +func (m *LogUsageResponse) XXX_DiscardUnknown() { + xxx_messageInfo_LogUsageResponse.DiscardUnknown(m) } -func (m *LogUsageResponse) Reset() { *m = LogUsageResponse{} } -func (m *LogUsageResponse) String() string { return proto.CompactTextString(m) } -func (*LogUsageResponse) ProtoMessage() {} -func (*LogUsageResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{13} } +var xxx_messageInfo_LogUsageResponse proto.InternalMessageInfo func (m *LogUsageResponse) GetUsage() []*LogUsageRecord { if m != nil { @@ -933,10 +1207,10 @@ func init() { } func init() { - proto.RegisterFile("google.golang.org/appengine/internal/log/log_service.proto", fileDescriptor0) + proto.RegisterFile("google.golang.org/appengine/internal/log/log_service.proto", fileDescriptor_log_service_f054fd4b5012319d) } -var fileDescriptor0 = []byte{ +var fileDescriptor_log_service_f054fd4b5012319d = []byte{ // 1553 bytes of a gzipped FileDescriptorProto 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xa4, 0x56, 0xdd, 0x72, 0xdb, 0xc6, 0x15, 0x2e, 0x48, 0x51, 0x24, 0x0f, 0x49, 0x91, 0x5a, 0xcb, 0xce, 0xda, 0xae, 0x6b, 0x1a, 0x4e, diff --git a/vendor/google.golang.org/appengine/internal/main.go b/vendor/google.golang.org/appengine/internal/main.go index 49036163..1e765312 100644 --- a/vendor/google.golang.org/appengine/internal/main.go +++ b/vendor/google.golang.org/appengine/internal/main.go @@ -11,5 +11,6 @@ import ( ) func Main() { + MainPath = "" appengine_internal.Main() } diff --git a/vendor/google.golang.org/appengine/internal/main_common.go b/vendor/google.golang.org/appengine/internal/main_common.go new file mode 100644 index 00000000..357dce4d --- /dev/null +++ b/vendor/google.golang.org/appengine/internal/main_common.go @@ -0,0 +1,7 @@ +package internal + +// MainPath stores the file path of the main package. On App Engine Standard +// using Go version 1.9 and below, this will be unset. On App Engine Flex and +// App Engine Standard second-gen (Go 1.11 and above), this will be the +// filepath to package main. +var MainPath string diff --git a/vendor/google.golang.org/appengine/internal/main_vm.go b/vendor/google.golang.org/appengine/internal/main_vm.go index 822e784a..ddb79a33 100644 --- a/vendor/google.golang.org/appengine/internal/main_vm.go +++ b/vendor/google.golang.org/appengine/internal/main_vm.go @@ -12,9 +12,12 @@ import ( "net/http" "net/url" "os" + "path/filepath" + "runtime" ) func Main() { + MainPath = filepath.Dir(findMainPath()) installHealthChecker(http.DefaultServeMux) port := "8080" @@ -31,6 +34,24 @@ func Main() { } } +// Find the path to package main by looking at the root Caller. +func findMainPath() string { + pc := make([]uintptr, 100) + n := runtime.Callers(2, pc) + frames := runtime.CallersFrames(pc[:n]) + for { + frame, more := frames.Next() + // Tests won't have package main, instead they have testing.tRunner + if frame.Function == "main.main" || frame.Function == "testing.tRunner" { + return frame.File + } + if !more { + break + } + } + return "" +} + func installHealthChecker(mux *http.ServeMux) { // If no health check handler has been installed by this point, add a trivial one. const healthPath = "/_ah/health" diff --git a/vendor/google.golang.org/appengine/internal/metadata.go b/vendor/google.golang.org/appengine/internal/metadata.go index 9cc1f71d..c4ba63bb 100644 --- a/vendor/google.golang.org/appengine/internal/metadata.go +++ b/vendor/google.golang.org/appengine/internal/metadata.go @@ -12,7 +12,6 @@ package internal import ( "fmt" "io/ioutil" - "log" "net/http" "net/url" ) @@ -32,7 +31,7 @@ var ( func mustGetMetadata(key string) []byte { b, err := getMetadata(key) if err != nil { - log.Fatalf("Metadata fetch failed: %v", err) + panic(fmt.Sprintf("Metadata fetch failed for '%s': %v", key, err)) } return b } diff --git a/vendor/google.golang.org/appengine/internal/modules/modules_service.pb.go b/vendor/google.golang.org/appengine/internal/modules/modules_service.pb.go index 51800525..ddfc0c04 100644 --- a/vendor/google.golang.org/appengine/internal/modules/modules_service.pb.go +++ b/vendor/google.golang.org/appengine/internal/modules/modules_service.pb.go @@ -1,31 +1,6 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // source: google.golang.org/appengine/internal/modules/modules_service.proto -/* -Package modules is a generated protocol buffer package. - -It is generated from these files: - google.golang.org/appengine/internal/modules/modules_service.proto - -It has these top-level messages: - ModulesServiceError - GetModulesRequest - GetModulesResponse - GetVersionsRequest - GetVersionsResponse - GetDefaultVersionRequest - GetDefaultVersionResponse - GetNumInstancesRequest - GetNumInstancesResponse - SetNumInstancesRequest - SetNumInstancesResponse - StartModuleRequest - StartModuleResponse - StopModuleRequest - StopModuleResponse - GetHostnameRequest - GetHostnameResponse -*/ package modules import proto "github.com/golang/protobuf/proto" @@ -88,36 +63,99 @@ func (x *ModulesServiceError_ErrorCode) UnmarshalJSON(data []byte) error { return nil } func (ModulesServiceError_ErrorCode) EnumDescriptor() ([]byte, []int) { - return fileDescriptor0, []int{0, 0} + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{0, 0} } type ModulesServiceError struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *ModulesServiceError) Reset() { *m = ModulesServiceError{} } -func (m *ModulesServiceError) String() string { return proto.CompactTextString(m) } -func (*ModulesServiceError) ProtoMessage() {} -func (*ModulesServiceError) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{0} } +func (m *ModulesServiceError) Reset() { *m = ModulesServiceError{} } +func (m *ModulesServiceError) String() string { return proto.CompactTextString(m) } +func (*ModulesServiceError) ProtoMessage() {} +func (*ModulesServiceError) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{0} +} +func (m *ModulesServiceError) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ModulesServiceError.Unmarshal(m, b) +} +func (m *ModulesServiceError) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ModulesServiceError.Marshal(b, m, deterministic) +} +func (dst *ModulesServiceError) XXX_Merge(src proto.Message) { + xxx_messageInfo_ModulesServiceError.Merge(dst, src) +} +func (m *ModulesServiceError) XXX_Size() int { + return xxx_messageInfo_ModulesServiceError.Size(m) +} +func (m *ModulesServiceError) XXX_DiscardUnknown() { + xxx_messageInfo_ModulesServiceError.DiscardUnknown(m) +} + +var xxx_messageInfo_ModulesServiceError proto.InternalMessageInfo type GetModulesRequest struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *GetModulesRequest) Reset() { *m = GetModulesRequest{} } -func (m *GetModulesRequest) String() string { return proto.CompactTextString(m) } -func (*GetModulesRequest) ProtoMessage() {} -func (*GetModulesRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1} } +func (m *GetModulesRequest) Reset() { *m = GetModulesRequest{} } +func (m *GetModulesRequest) String() string { return proto.CompactTextString(m) } +func (*GetModulesRequest) ProtoMessage() {} +func (*GetModulesRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{1} +} +func (m *GetModulesRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetModulesRequest.Unmarshal(m, b) +} +func (m *GetModulesRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetModulesRequest.Marshal(b, m, deterministic) +} +func (dst *GetModulesRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetModulesRequest.Merge(dst, src) +} +func (m *GetModulesRequest) XXX_Size() int { + return xxx_messageInfo_GetModulesRequest.Size(m) +} +func (m *GetModulesRequest) XXX_DiscardUnknown() { + xxx_messageInfo_GetModulesRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_GetModulesRequest proto.InternalMessageInfo type GetModulesResponse struct { - Module []string `protobuf:"bytes,1,rep,name=module" json:"module,omitempty"` - XXX_unrecognized []byte `json:"-"` + Module []string `protobuf:"bytes,1,rep,name=module" json:"module,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GetModulesResponse) Reset() { *m = GetModulesResponse{} } +func (m *GetModulesResponse) String() string { return proto.CompactTextString(m) } +func (*GetModulesResponse) ProtoMessage() {} +func (*GetModulesResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{2} +} +func (m *GetModulesResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetModulesResponse.Unmarshal(m, b) +} +func (m *GetModulesResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetModulesResponse.Marshal(b, m, deterministic) +} +func (dst *GetModulesResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetModulesResponse.Merge(dst, src) +} +func (m *GetModulesResponse) XXX_Size() int { + return xxx_messageInfo_GetModulesResponse.Size(m) +} +func (m *GetModulesResponse) XXX_DiscardUnknown() { + xxx_messageInfo_GetModulesResponse.DiscardUnknown(m) } -func (m *GetModulesResponse) Reset() { *m = GetModulesResponse{} } -func (m *GetModulesResponse) String() string { return proto.CompactTextString(m) } -func (*GetModulesResponse) ProtoMessage() {} -func (*GetModulesResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{2} } +var xxx_messageInfo_GetModulesResponse proto.InternalMessageInfo func (m *GetModulesResponse) GetModule() []string { if m != nil { @@ -127,14 +165,35 @@ func (m *GetModulesResponse) GetModule() []string { } type GetVersionsRequest struct { - Module *string `protobuf:"bytes,1,opt,name=module" json:"module,omitempty"` - XXX_unrecognized []byte `json:"-"` + Module *string `protobuf:"bytes,1,opt,name=module" json:"module,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *GetVersionsRequest) Reset() { *m = GetVersionsRequest{} } -func (m *GetVersionsRequest) String() string { return proto.CompactTextString(m) } -func (*GetVersionsRequest) ProtoMessage() {} -func (*GetVersionsRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{3} } +func (m *GetVersionsRequest) Reset() { *m = GetVersionsRequest{} } +func (m *GetVersionsRequest) String() string { return proto.CompactTextString(m) } +func (*GetVersionsRequest) ProtoMessage() {} +func (*GetVersionsRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{3} +} +func (m *GetVersionsRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetVersionsRequest.Unmarshal(m, b) +} +func (m *GetVersionsRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetVersionsRequest.Marshal(b, m, deterministic) +} +func (dst *GetVersionsRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetVersionsRequest.Merge(dst, src) +} +func (m *GetVersionsRequest) XXX_Size() int { + return xxx_messageInfo_GetVersionsRequest.Size(m) +} +func (m *GetVersionsRequest) XXX_DiscardUnknown() { + xxx_messageInfo_GetVersionsRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_GetVersionsRequest proto.InternalMessageInfo func (m *GetVersionsRequest) GetModule() string { if m != nil && m.Module != nil { @@ -144,14 +203,35 @@ func (m *GetVersionsRequest) GetModule() string { } type GetVersionsResponse struct { - Version []string `protobuf:"bytes,1,rep,name=version" json:"version,omitempty"` - XXX_unrecognized []byte `json:"-"` + Version []string `protobuf:"bytes,1,rep,name=version" json:"version,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GetVersionsResponse) Reset() { *m = GetVersionsResponse{} } +func (m *GetVersionsResponse) String() string { return proto.CompactTextString(m) } +func (*GetVersionsResponse) ProtoMessage() {} +func (*GetVersionsResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{4} +} +func (m *GetVersionsResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetVersionsResponse.Unmarshal(m, b) +} +func (m *GetVersionsResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetVersionsResponse.Marshal(b, m, deterministic) +} +func (dst *GetVersionsResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetVersionsResponse.Merge(dst, src) +} +func (m *GetVersionsResponse) XXX_Size() int { + return xxx_messageInfo_GetVersionsResponse.Size(m) +} +func (m *GetVersionsResponse) XXX_DiscardUnknown() { + xxx_messageInfo_GetVersionsResponse.DiscardUnknown(m) } -func (m *GetVersionsResponse) Reset() { *m = GetVersionsResponse{} } -func (m *GetVersionsResponse) String() string { return proto.CompactTextString(m) } -func (*GetVersionsResponse) ProtoMessage() {} -func (*GetVersionsResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{4} } +var xxx_messageInfo_GetVersionsResponse proto.InternalMessageInfo func (m *GetVersionsResponse) GetVersion() []string { if m != nil { @@ -161,14 +241,35 @@ func (m *GetVersionsResponse) GetVersion() []string { } type GetDefaultVersionRequest struct { - Module *string `protobuf:"bytes,1,opt,name=module" json:"module,omitempty"` - XXX_unrecognized []byte `json:"-"` + Module *string `protobuf:"bytes,1,opt,name=module" json:"module,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *GetDefaultVersionRequest) Reset() { *m = GetDefaultVersionRequest{} } -func (m *GetDefaultVersionRequest) String() string { return proto.CompactTextString(m) } -func (*GetDefaultVersionRequest) ProtoMessage() {} -func (*GetDefaultVersionRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{5} } +func (m *GetDefaultVersionRequest) Reset() { *m = GetDefaultVersionRequest{} } +func (m *GetDefaultVersionRequest) String() string { return proto.CompactTextString(m) } +func (*GetDefaultVersionRequest) ProtoMessage() {} +func (*GetDefaultVersionRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{5} +} +func (m *GetDefaultVersionRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetDefaultVersionRequest.Unmarshal(m, b) +} +func (m *GetDefaultVersionRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetDefaultVersionRequest.Marshal(b, m, deterministic) +} +func (dst *GetDefaultVersionRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetDefaultVersionRequest.Merge(dst, src) +} +func (m *GetDefaultVersionRequest) XXX_Size() int { + return xxx_messageInfo_GetDefaultVersionRequest.Size(m) +} +func (m *GetDefaultVersionRequest) XXX_DiscardUnknown() { + xxx_messageInfo_GetDefaultVersionRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_GetDefaultVersionRequest proto.InternalMessageInfo func (m *GetDefaultVersionRequest) GetModule() string { if m != nil && m.Module != nil { @@ -178,14 +279,35 @@ func (m *GetDefaultVersionRequest) GetModule() string { } type GetDefaultVersionResponse struct { - Version *string `protobuf:"bytes,1,req,name=version" json:"version,omitempty"` - XXX_unrecognized []byte `json:"-"` + Version *string `protobuf:"bytes,1,req,name=version" json:"version,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GetDefaultVersionResponse) Reset() { *m = GetDefaultVersionResponse{} } +func (m *GetDefaultVersionResponse) String() string { return proto.CompactTextString(m) } +func (*GetDefaultVersionResponse) ProtoMessage() {} +func (*GetDefaultVersionResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{6} +} +func (m *GetDefaultVersionResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetDefaultVersionResponse.Unmarshal(m, b) +} +func (m *GetDefaultVersionResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetDefaultVersionResponse.Marshal(b, m, deterministic) +} +func (dst *GetDefaultVersionResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetDefaultVersionResponse.Merge(dst, src) +} +func (m *GetDefaultVersionResponse) XXX_Size() int { + return xxx_messageInfo_GetDefaultVersionResponse.Size(m) +} +func (m *GetDefaultVersionResponse) XXX_DiscardUnknown() { + xxx_messageInfo_GetDefaultVersionResponse.DiscardUnknown(m) } -func (m *GetDefaultVersionResponse) Reset() { *m = GetDefaultVersionResponse{} } -func (m *GetDefaultVersionResponse) String() string { return proto.CompactTextString(m) } -func (*GetDefaultVersionResponse) ProtoMessage() {} -func (*GetDefaultVersionResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{6} } +var xxx_messageInfo_GetDefaultVersionResponse proto.InternalMessageInfo func (m *GetDefaultVersionResponse) GetVersion() string { if m != nil && m.Version != nil { @@ -195,15 +317,36 @@ func (m *GetDefaultVersionResponse) GetVersion() string { } type GetNumInstancesRequest struct { - Module *string `protobuf:"bytes,1,opt,name=module" json:"module,omitempty"` - Version *string `protobuf:"bytes,2,opt,name=version" json:"version,omitempty"` - XXX_unrecognized []byte `json:"-"` + Module *string `protobuf:"bytes,1,opt,name=module" json:"module,omitempty"` + Version *string `protobuf:"bytes,2,opt,name=version" json:"version,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *GetNumInstancesRequest) Reset() { *m = GetNumInstancesRequest{} } -func (m *GetNumInstancesRequest) String() string { return proto.CompactTextString(m) } -func (*GetNumInstancesRequest) ProtoMessage() {} -func (*GetNumInstancesRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{7} } +func (m *GetNumInstancesRequest) Reset() { *m = GetNumInstancesRequest{} } +func (m *GetNumInstancesRequest) String() string { return proto.CompactTextString(m) } +func (*GetNumInstancesRequest) ProtoMessage() {} +func (*GetNumInstancesRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{7} +} +func (m *GetNumInstancesRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetNumInstancesRequest.Unmarshal(m, b) +} +func (m *GetNumInstancesRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetNumInstancesRequest.Marshal(b, m, deterministic) +} +func (dst *GetNumInstancesRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetNumInstancesRequest.Merge(dst, src) +} +func (m *GetNumInstancesRequest) XXX_Size() int { + return xxx_messageInfo_GetNumInstancesRequest.Size(m) +} +func (m *GetNumInstancesRequest) XXX_DiscardUnknown() { + xxx_messageInfo_GetNumInstancesRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_GetNumInstancesRequest proto.InternalMessageInfo func (m *GetNumInstancesRequest) GetModule() string { if m != nil && m.Module != nil { @@ -220,14 +363,35 @@ func (m *GetNumInstancesRequest) GetVersion() string { } type GetNumInstancesResponse struct { - Instances *int64 `protobuf:"varint,1,req,name=instances" json:"instances,omitempty"` - XXX_unrecognized []byte `json:"-"` + Instances *int64 `protobuf:"varint,1,req,name=instances" json:"instances,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *GetNumInstancesResponse) Reset() { *m = GetNumInstancesResponse{} } -func (m *GetNumInstancesResponse) String() string { return proto.CompactTextString(m) } -func (*GetNumInstancesResponse) ProtoMessage() {} -func (*GetNumInstancesResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{8} } +func (m *GetNumInstancesResponse) Reset() { *m = GetNumInstancesResponse{} } +func (m *GetNumInstancesResponse) String() string { return proto.CompactTextString(m) } +func (*GetNumInstancesResponse) ProtoMessage() {} +func (*GetNumInstancesResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{8} +} +func (m *GetNumInstancesResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetNumInstancesResponse.Unmarshal(m, b) +} +func (m *GetNumInstancesResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetNumInstancesResponse.Marshal(b, m, deterministic) +} +func (dst *GetNumInstancesResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetNumInstancesResponse.Merge(dst, src) +} +func (m *GetNumInstancesResponse) XXX_Size() int { + return xxx_messageInfo_GetNumInstancesResponse.Size(m) +} +func (m *GetNumInstancesResponse) XXX_DiscardUnknown() { + xxx_messageInfo_GetNumInstancesResponse.DiscardUnknown(m) +} + +var xxx_messageInfo_GetNumInstancesResponse proto.InternalMessageInfo func (m *GetNumInstancesResponse) GetInstances() int64 { if m != nil && m.Instances != nil { @@ -237,16 +401,37 @@ func (m *GetNumInstancesResponse) GetInstances() int64 { } type SetNumInstancesRequest struct { - Module *string `protobuf:"bytes,1,opt,name=module" json:"module,omitempty"` - Version *string `protobuf:"bytes,2,opt,name=version" json:"version,omitempty"` - Instances *int64 `protobuf:"varint,3,req,name=instances" json:"instances,omitempty"` - XXX_unrecognized []byte `json:"-"` + Module *string `protobuf:"bytes,1,opt,name=module" json:"module,omitempty"` + Version *string `protobuf:"bytes,2,opt,name=version" json:"version,omitempty"` + Instances *int64 `protobuf:"varint,3,req,name=instances" json:"instances,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *SetNumInstancesRequest) Reset() { *m = SetNumInstancesRequest{} } -func (m *SetNumInstancesRequest) String() string { return proto.CompactTextString(m) } -func (*SetNumInstancesRequest) ProtoMessage() {} -func (*SetNumInstancesRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{9} } +func (m *SetNumInstancesRequest) Reset() { *m = SetNumInstancesRequest{} } +func (m *SetNumInstancesRequest) String() string { return proto.CompactTextString(m) } +func (*SetNumInstancesRequest) ProtoMessage() {} +func (*SetNumInstancesRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{9} +} +func (m *SetNumInstancesRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_SetNumInstancesRequest.Unmarshal(m, b) +} +func (m *SetNumInstancesRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_SetNumInstancesRequest.Marshal(b, m, deterministic) +} +func (dst *SetNumInstancesRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_SetNumInstancesRequest.Merge(dst, src) +} +func (m *SetNumInstancesRequest) XXX_Size() int { + return xxx_messageInfo_SetNumInstancesRequest.Size(m) +} +func (m *SetNumInstancesRequest) XXX_DiscardUnknown() { + xxx_messageInfo_SetNumInstancesRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_SetNumInstancesRequest proto.InternalMessageInfo func (m *SetNumInstancesRequest) GetModule() string { if m != nil && m.Module != nil { @@ -270,24 +455,66 @@ func (m *SetNumInstancesRequest) GetInstances() int64 { } type SetNumInstancesResponse struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *SetNumInstancesResponse) Reset() { *m = SetNumInstancesResponse{} } +func (m *SetNumInstancesResponse) String() string { return proto.CompactTextString(m) } +func (*SetNumInstancesResponse) ProtoMessage() {} +func (*SetNumInstancesResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{10} +} +func (m *SetNumInstancesResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_SetNumInstancesResponse.Unmarshal(m, b) +} +func (m *SetNumInstancesResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_SetNumInstancesResponse.Marshal(b, m, deterministic) +} +func (dst *SetNumInstancesResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_SetNumInstancesResponse.Merge(dst, src) +} +func (m *SetNumInstancesResponse) XXX_Size() int { + return xxx_messageInfo_SetNumInstancesResponse.Size(m) +} +func (m *SetNumInstancesResponse) XXX_DiscardUnknown() { + xxx_messageInfo_SetNumInstancesResponse.DiscardUnknown(m) } -func (m *SetNumInstancesResponse) Reset() { *m = SetNumInstancesResponse{} } -func (m *SetNumInstancesResponse) String() string { return proto.CompactTextString(m) } -func (*SetNumInstancesResponse) ProtoMessage() {} -func (*SetNumInstancesResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{10} } +var xxx_messageInfo_SetNumInstancesResponse proto.InternalMessageInfo type StartModuleRequest struct { - Module *string `protobuf:"bytes,1,req,name=module" json:"module,omitempty"` - Version *string `protobuf:"bytes,2,req,name=version" json:"version,omitempty"` - XXX_unrecognized []byte `json:"-"` + Module *string `protobuf:"bytes,1,req,name=module" json:"module,omitempty"` + Version *string `protobuf:"bytes,2,req,name=version" json:"version,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *StartModuleRequest) Reset() { *m = StartModuleRequest{} } -func (m *StartModuleRequest) String() string { return proto.CompactTextString(m) } -func (*StartModuleRequest) ProtoMessage() {} -func (*StartModuleRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{11} } +func (m *StartModuleRequest) Reset() { *m = StartModuleRequest{} } +func (m *StartModuleRequest) String() string { return proto.CompactTextString(m) } +func (*StartModuleRequest) ProtoMessage() {} +func (*StartModuleRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{11} +} +func (m *StartModuleRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_StartModuleRequest.Unmarshal(m, b) +} +func (m *StartModuleRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_StartModuleRequest.Marshal(b, m, deterministic) +} +func (dst *StartModuleRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_StartModuleRequest.Merge(dst, src) +} +func (m *StartModuleRequest) XXX_Size() int { + return xxx_messageInfo_StartModuleRequest.Size(m) +} +func (m *StartModuleRequest) XXX_DiscardUnknown() { + xxx_messageInfo_StartModuleRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_StartModuleRequest proto.InternalMessageInfo func (m *StartModuleRequest) GetModule() string { if m != nil && m.Module != nil { @@ -304,24 +531,66 @@ func (m *StartModuleRequest) GetVersion() string { } type StartModuleResponse struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *StartModuleResponse) Reset() { *m = StartModuleResponse{} } -func (m *StartModuleResponse) String() string { return proto.CompactTextString(m) } -func (*StartModuleResponse) ProtoMessage() {} -func (*StartModuleResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{12} } +func (m *StartModuleResponse) Reset() { *m = StartModuleResponse{} } +func (m *StartModuleResponse) String() string { return proto.CompactTextString(m) } +func (*StartModuleResponse) ProtoMessage() {} +func (*StartModuleResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{12} +} +func (m *StartModuleResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_StartModuleResponse.Unmarshal(m, b) +} +func (m *StartModuleResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_StartModuleResponse.Marshal(b, m, deterministic) +} +func (dst *StartModuleResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_StartModuleResponse.Merge(dst, src) +} +func (m *StartModuleResponse) XXX_Size() int { + return xxx_messageInfo_StartModuleResponse.Size(m) +} +func (m *StartModuleResponse) XXX_DiscardUnknown() { + xxx_messageInfo_StartModuleResponse.DiscardUnknown(m) +} + +var xxx_messageInfo_StartModuleResponse proto.InternalMessageInfo type StopModuleRequest struct { - Module *string `protobuf:"bytes,1,opt,name=module" json:"module,omitempty"` - Version *string `protobuf:"bytes,2,opt,name=version" json:"version,omitempty"` - XXX_unrecognized []byte `json:"-"` + Module *string `protobuf:"bytes,1,opt,name=module" json:"module,omitempty"` + Version *string `protobuf:"bytes,2,opt,name=version" json:"version,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *StopModuleRequest) Reset() { *m = StopModuleRequest{} } +func (m *StopModuleRequest) String() string { return proto.CompactTextString(m) } +func (*StopModuleRequest) ProtoMessage() {} +func (*StopModuleRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{13} +} +func (m *StopModuleRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_StopModuleRequest.Unmarshal(m, b) +} +func (m *StopModuleRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_StopModuleRequest.Marshal(b, m, deterministic) +} +func (dst *StopModuleRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_StopModuleRequest.Merge(dst, src) +} +func (m *StopModuleRequest) XXX_Size() int { + return xxx_messageInfo_StopModuleRequest.Size(m) +} +func (m *StopModuleRequest) XXX_DiscardUnknown() { + xxx_messageInfo_StopModuleRequest.DiscardUnknown(m) } -func (m *StopModuleRequest) Reset() { *m = StopModuleRequest{} } -func (m *StopModuleRequest) String() string { return proto.CompactTextString(m) } -func (*StopModuleRequest) ProtoMessage() {} -func (*StopModuleRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{13} } +var xxx_messageInfo_StopModuleRequest proto.InternalMessageInfo func (m *StopModuleRequest) GetModule() string { if m != nil && m.Module != nil { @@ -338,25 +607,67 @@ func (m *StopModuleRequest) GetVersion() string { } type StopModuleResponse struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *StopModuleResponse) Reset() { *m = StopModuleResponse{} } +func (m *StopModuleResponse) String() string { return proto.CompactTextString(m) } +func (*StopModuleResponse) ProtoMessage() {} +func (*StopModuleResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{14} +} +func (m *StopModuleResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_StopModuleResponse.Unmarshal(m, b) +} +func (m *StopModuleResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_StopModuleResponse.Marshal(b, m, deterministic) +} +func (dst *StopModuleResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_StopModuleResponse.Merge(dst, src) +} +func (m *StopModuleResponse) XXX_Size() int { + return xxx_messageInfo_StopModuleResponse.Size(m) +} +func (m *StopModuleResponse) XXX_DiscardUnknown() { + xxx_messageInfo_StopModuleResponse.DiscardUnknown(m) } -func (m *StopModuleResponse) Reset() { *m = StopModuleResponse{} } -func (m *StopModuleResponse) String() string { return proto.CompactTextString(m) } -func (*StopModuleResponse) ProtoMessage() {} -func (*StopModuleResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{14} } +var xxx_messageInfo_StopModuleResponse proto.InternalMessageInfo type GetHostnameRequest struct { - Module *string `protobuf:"bytes,1,opt,name=module" json:"module,omitempty"` - Version *string `protobuf:"bytes,2,opt,name=version" json:"version,omitempty"` - Instance *string `protobuf:"bytes,3,opt,name=instance" json:"instance,omitempty"` - XXX_unrecognized []byte `json:"-"` + Module *string `protobuf:"bytes,1,opt,name=module" json:"module,omitempty"` + Version *string `protobuf:"bytes,2,opt,name=version" json:"version,omitempty"` + Instance *string `protobuf:"bytes,3,opt,name=instance" json:"instance,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *GetHostnameRequest) Reset() { *m = GetHostnameRequest{} } -func (m *GetHostnameRequest) String() string { return proto.CompactTextString(m) } -func (*GetHostnameRequest) ProtoMessage() {} -func (*GetHostnameRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{15} } +func (m *GetHostnameRequest) Reset() { *m = GetHostnameRequest{} } +func (m *GetHostnameRequest) String() string { return proto.CompactTextString(m) } +func (*GetHostnameRequest) ProtoMessage() {} +func (*GetHostnameRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{15} +} +func (m *GetHostnameRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetHostnameRequest.Unmarshal(m, b) +} +func (m *GetHostnameRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetHostnameRequest.Marshal(b, m, deterministic) +} +func (dst *GetHostnameRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetHostnameRequest.Merge(dst, src) +} +func (m *GetHostnameRequest) XXX_Size() int { + return xxx_messageInfo_GetHostnameRequest.Size(m) +} +func (m *GetHostnameRequest) XXX_DiscardUnknown() { + xxx_messageInfo_GetHostnameRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_GetHostnameRequest proto.InternalMessageInfo func (m *GetHostnameRequest) GetModule() string { if m != nil && m.Module != nil { @@ -380,14 +691,35 @@ func (m *GetHostnameRequest) GetInstance() string { } type GetHostnameResponse struct { - Hostname *string `protobuf:"bytes,1,req,name=hostname" json:"hostname,omitempty"` - XXX_unrecognized []byte `json:"-"` + Hostname *string `protobuf:"bytes,1,req,name=hostname" json:"hostname,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *GetHostnameResponse) Reset() { *m = GetHostnameResponse{} } +func (m *GetHostnameResponse) String() string { return proto.CompactTextString(m) } +func (*GetHostnameResponse) ProtoMessage() {} +func (*GetHostnameResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_modules_service_9cd3bffe4e91c59a, []int{16} +} +func (m *GetHostnameResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_GetHostnameResponse.Unmarshal(m, b) +} +func (m *GetHostnameResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_GetHostnameResponse.Marshal(b, m, deterministic) +} +func (dst *GetHostnameResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_GetHostnameResponse.Merge(dst, src) +} +func (m *GetHostnameResponse) XXX_Size() int { + return xxx_messageInfo_GetHostnameResponse.Size(m) +} +func (m *GetHostnameResponse) XXX_DiscardUnknown() { + xxx_messageInfo_GetHostnameResponse.DiscardUnknown(m) } -func (m *GetHostnameResponse) Reset() { *m = GetHostnameResponse{} } -func (m *GetHostnameResponse) String() string { return proto.CompactTextString(m) } -func (*GetHostnameResponse) ProtoMessage() {} -func (*GetHostnameResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{16} } +var xxx_messageInfo_GetHostnameResponse proto.InternalMessageInfo func (m *GetHostnameResponse) GetHostname() string { if m != nil && m.Hostname != nil { @@ -417,10 +749,10 @@ func init() { } func init() { - proto.RegisterFile("google.golang.org/appengine/internal/modules/modules_service.proto", fileDescriptor0) + proto.RegisterFile("google.golang.org/appengine/internal/modules/modules_service.proto", fileDescriptor_modules_service_9cd3bffe4e91c59a) } -var fileDescriptor0 = []byte{ +var fileDescriptor_modules_service_9cd3bffe4e91c59a = []byte{ // 457 bytes of a gzipped FileDescriptorProto 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xac, 0x94, 0xc1, 0x6f, 0xd3, 0x30, 0x14, 0xc6, 0x69, 0x02, 0xdb, 0xf2, 0x0e, 0x90, 0x3a, 0x5b, 0xd7, 0x4d, 0x1c, 0x50, 0x4e, 0x1c, diff --git a/vendor/google.golang.org/appengine/internal/remote_api/remote_api.pb.go b/vendor/google.golang.org/appengine/internal/remote_api/remote_api.pb.go index 172aebe8..8d782a38 100644 --- a/vendor/google.golang.org/appengine/internal/remote_api/remote_api.pb.go +++ b/vendor/google.golang.org/appengine/internal/remote_api/remote_api.pb.go @@ -1,18 +1,6 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // source: google.golang.org/appengine/internal/remote_api/remote_api.proto -/* -Package remote_api is a generated protocol buffer package. - -It is generated from these files: - google.golang.org/appengine/internal/remote_api/remote_api.proto - -It has these top-level messages: - Request - ApplicationError - RpcError - Response -*/ package remote_api import proto "github.com/golang/protobuf/proto" @@ -95,20 +83,43 @@ func (x *RpcError_ErrorCode) UnmarshalJSON(data []byte) error { *x = RpcError_ErrorCode(value) return nil } -func (RpcError_ErrorCode) EnumDescriptor() ([]byte, []int) { return fileDescriptor0, []int{2, 0} } +func (RpcError_ErrorCode) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_remote_api_1978114ec33a273d, []int{2, 0} +} type Request struct { - ServiceName *string `protobuf:"bytes,2,req,name=service_name,json=serviceName" json:"service_name,omitempty"` - Method *string `protobuf:"bytes,3,req,name=method" json:"method,omitempty"` - Request []byte `protobuf:"bytes,4,req,name=request" json:"request,omitempty"` - RequestId *string `protobuf:"bytes,5,opt,name=request_id,json=requestId" json:"request_id,omitempty"` - XXX_unrecognized []byte `json:"-"` + ServiceName *string `protobuf:"bytes,2,req,name=service_name,json=serviceName" json:"service_name,omitempty"` + Method *string `protobuf:"bytes,3,req,name=method" json:"method,omitempty"` + Request []byte `protobuf:"bytes,4,req,name=request" json:"request,omitempty"` + RequestId *string `protobuf:"bytes,5,opt,name=request_id,json=requestId" json:"request_id,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Request) Reset() { *m = Request{} } +func (m *Request) String() string { return proto.CompactTextString(m) } +func (*Request) ProtoMessage() {} +func (*Request) Descriptor() ([]byte, []int) { + return fileDescriptor_remote_api_1978114ec33a273d, []int{0} +} +func (m *Request) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Request.Unmarshal(m, b) +} +func (m *Request) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Request.Marshal(b, m, deterministic) +} +func (dst *Request) XXX_Merge(src proto.Message) { + xxx_messageInfo_Request.Merge(dst, src) +} +func (m *Request) XXX_Size() int { + return xxx_messageInfo_Request.Size(m) +} +func (m *Request) XXX_DiscardUnknown() { + xxx_messageInfo_Request.DiscardUnknown(m) } -func (m *Request) Reset() { *m = Request{} } -func (m *Request) String() string { return proto.CompactTextString(m) } -func (*Request) ProtoMessage() {} -func (*Request) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{0} } +var xxx_messageInfo_Request proto.InternalMessageInfo func (m *Request) GetServiceName() string { if m != nil && m.ServiceName != nil { @@ -139,15 +150,36 @@ func (m *Request) GetRequestId() string { } type ApplicationError struct { - Code *int32 `protobuf:"varint,1,req,name=code" json:"code,omitempty"` - Detail *string `protobuf:"bytes,2,req,name=detail" json:"detail,omitempty"` - XXX_unrecognized []byte `json:"-"` + Code *int32 `protobuf:"varint,1,req,name=code" json:"code,omitempty"` + Detail *string `protobuf:"bytes,2,req,name=detail" json:"detail,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ApplicationError) Reset() { *m = ApplicationError{} } +func (m *ApplicationError) String() string { return proto.CompactTextString(m) } +func (*ApplicationError) ProtoMessage() {} +func (*ApplicationError) Descriptor() ([]byte, []int) { + return fileDescriptor_remote_api_1978114ec33a273d, []int{1} +} +func (m *ApplicationError) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_ApplicationError.Unmarshal(m, b) +} +func (m *ApplicationError) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_ApplicationError.Marshal(b, m, deterministic) +} +func (dst *ApplicationError) XXX_Merge(src proto.Message) { + xxx_messageInfo_ApplicationError.Merge(dst, src) +} +func (m *ApplicationError) XXX_Size() int { + return xxx_messageInfo_ApplicationError.Size(m) +} +func (m *ApplicationError) XXX_DiscardUnknown() { + xxx_messageInfo_ApplicationError.DiscardUnknown(m) } -func (m *ApplicationError) Reset() { *m = ApplicationError{} } -func (m *ApplicationError) String() string { return proto.CompactTextString(m) } -func (*ApplicationError) ProtoMessage() {} -func (*ApplicationError) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1} } +var xxx_messageInfo_ApplicationError proto.InternalMessageInfo func (m *ApplicationError) GetCode() int32 { if m != nil && m.Code != nil { @@ -164,15 +196,36 @@ func (m *ApplicationError) GetDetail() string { } type RpcError struct { - Code *int32 `protobuf:"varint,1,req,name=code" json:"code,omitempty"` - Detail *string `protobuf:"bytes,2,opt,name=detail" json:"detail,omitempty"` - XXX_unrecognized []byte `json:"-"` + Code *int32 `protobuf:"varint,1,req,name=code" json:"code,omitempty"` + Detail *string `protobuf:"bytes,2,opt,name=detail" json:"detail,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *RpcError) Reset() { *m = RpcError{} } -func (m *RpcError) String() string { return proto.CompactTextString(m) } -func (*RpcError) ProtoMessage() {} -func (*RpcError) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{2} } +func (m *RpcError) Reset() { *m = RpcError{} } +func (m *RpcError) String() string { return proto.CompactTextString(m) } +func (*RpcError) ProtoMessage() {} +func (*RpcError) Descriptor() ([]byte, []int) { + return fileDescriptor_remote_api_1978114ec33a273d, []int{2} +} +func (m *RpcError) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_RpcError.Unmarshal(m, b) +} +func (m *RpcError) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_RpcError.Marshal(b, m, deterministic) +} +func (dst *RpcError) XXX_Merge(src proto.Message) { + xxx_messageInfo_RpcError.Merge(dst, src) +} +func (m *RpcError) XXX_Size() int { + return xxx_messageInfo_RpcError.Size(m) +} +func (m *RpcError) XXX_DiscardUnknown() { + xxx_messageInfo_RpcError.DiscardUnknown(m) +} + +var xxx_messageInfo_RpcError proto.InternalMessageInfo func (m *RpcError) GetCode() int32 { if m != nil && m.Code != nil { @@ -189,18 +242,39 @@ func (m *RpcError) GetDetail() string { } type Response struct { - Response []byte `protobuf:"bytes,1,opt,name=response" json:"response,omitempty"` - Exception []byte `protobuf:"bytes,2,opt,name=exception" json:"exception,omitempty"` - ApplicationError *ApplicationError `protobuf:"bytes,3,opt,name=application_error,json=applicationError" json:"application_error,omitempty"` - JavaException []byte `protobuf:"bytes,4,opt,name=java_exception,json=javaException" json:"java_exception,omitempty"` - RpcError *RpcError `protobuf:"bytes,5,opt,name=rpc_error,json=rpcError" json:"rpc_error,omitempty"` - XXX_unrecognized []byte `json:"-"` + Response []byte `protobuf:"bytes,1,opt,name=response" json:"response,omitempty"` + Exception []byte `protobuf:"bytes,2,opt,name=exception" json:"exception,omitempty"` + ApplicationError *ApplicationError `protobuf:"bytes,3,opt,name=application_error,json=applicationError" json:"application_error,omitempty"` + JavaException []byte `protobuf:"bytes,4,opt,name=java_exception,json=javaException" json:"java_exception,omitempty"` + RpcError *RpcError `protobuf:"bytes,5,opt,name=rpc_error,json=rpcError" json:"rpc_error,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Response) Reset() { *m = Response{} } +func (m *Response) String() string { return proto.CompactTextString(m) } +func (*Response) ProtoMessage() {} +func (*Response) Descriptor() ([]byte, []int) { + return fileDescriptor_remote_api_1978114ec33a273d, []int{3} +} +func (m *Response) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_Response.Unmarshal(m, b) +} +func (m *Response) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_Response.Marshal(b, m, deterministic) +} +func (dst *Response) XXX_Merge(src proto.Message) { + xxx_messageInfo_Response.Merge(dst, src) +} +func (m *Response) XXX_Size() int { + return xxx_messageInfo_Response.Size(m) +} +func (m *Response) XXX_DiscardUnknown() { + xxx_messageInfo_Response.DiscardUnknown(m) } -func (m *Response) Reset() { *m = Response{} } -func (m *Response) String() string { return proto.CompactTextString(m) } -func (*Response) ProtoMessage() {} -func (*Response) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{3} } +var xxx_messageInfo_Response proto.InternalMessageInfo func (m *Response) GetResponse() []byte { if m != nil { @@ -245,10 +319,10 @@ func init() { } func init() { - proto.RegisterFile("google.golang.org/appengine/internal/remote_api/remote_api.proto", fileDescriptor0) + proto.RegisterFile("google.golang.org/appengine/internal/remote_api/remote_api.proto", fileDescriptor_remote_api_1978114ec33a273d) } -var fileDescriptor0 = []byte{ +var fileDescriptor_remote_api_1978114ec33a273d = []byte{ // 531 bytes of a gzipped FileDescriptorProto 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x8c, 0x93, 0x51, 0x6e, 0xd3, 0x40, 0x10, 0x86, 0xb1, 0x9b, 0x34, 0xf1, 0xc4, 0x2d, 0xdb, 0xa5, 0x14, 0x0b, 0x15, 0x29, 0x44, 0x42, diff --git a/vendor/google.golang.org/appengine/internal/urlfetch/urlfetch_service.pb.go b/vendor/google.golang.org/appengine/internal/urlfetch/urlfetch_service.pb.go index 7c96c9d4..5f727750 100644 --- a/vendor/google.golang.org/appengine/internal/urlfetch/urlfetch_service.pb.go +++ b/vendor/google.golang.org/appengine/internal/urlfetch/urlfetch_service.pb.go @@ -1,17 +1,6 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // source: google.golang.org/appengine/internal/urlfetch/urlfetch_service.proto -/* -Package urlfetch is a generated protocol buffer package. - -It is generated from these files: - google.golang.org/appengine/internal/urlfetch/urlfetch_service.proto - -It has these top-level messages: - URLFetchServiceError - URLFetchRequest - URLFetchResponse -*/ package urlfetch import proto "github.com/golang/protobuf/proto" @@ -95,7 +84,7 @@ func (x *URLFetchServiceError_ErrorCode) UnmarshalJSON(data []byte) error { return nil } func (URLFetchServiceError_ErrorCode) EnumDescriptor() ([]byte, []int) { - return fileDescriptor0, []int{0, 0} + return fileDescriptor_urlfetch_service_b245a7065f33bced, []int{0, 0} } type URLFetchRequest_RequestMethod int32 @@ -143,17 +132,38 @@ func (x *URLFetchRequest_RequestMethod) UnmarshalJSON(data []byte) error { return nil } func (URLFetchRequest_RequestMethod) EnumDescriptor() ([]byte, []int) { - return fileDescriptor0, []int{1, 0} + return fileDescriptor_urlfetch_service_b245a7065f33bced, []int{1, 0} } type URLFetchServiceError struct { - XXX_unrecognized []byte `json:"-"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *URLFetchServiceError) Reset() { *m = URLFetchServiceError{} } +func (m *URLFetchServiceError) String() string { return proto.CompactTextString(m) } +func (*URLFetchServiceError) ProtoMessage() {} +func (*URLFetchServiceError) Descriptor() ([]byte, []int) { + return fileDescriptor_urlfetch_service_b245a7065f33bced, []int{0} +} +func (m *URLFetchServiceError) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_URLFetchServiceError.Unmarshal(m, b) +} +func (m *URLFetchServiceError) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_URLFetchServiceError.Marshal(b, m, deterministic) +} +func (dst *URLFetchServiceError) XXX_Merge(src proto.Message) { + xxx_messageInfo_URLFetchServiceError.Merge(dst, src) +} +func (m *URLFetchServiceError) XXX_Size() int { + return xxx_messageInfo_URLFetchServiceError.Size(m) +} +func (m *URLFetchServiceError) XXX_DiscardUnknown() { + xxx_messageInfo_URLFetchServiceError.DiscardUnknown(m) } -func (m *URLFetchServiceError) Reset() { *m = URLFetchServiceError{} } -func (m *URLFetchServiceError) String() string { return proto.CompactTextString(m) } -func (*URLFetchServiceError) ProtoMessage() {} -func (*URLFetchServiceError) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{0} } +var xxx_messageInfo_URLFetchServiceError proto.InternalMessageInfo type URLFetchRequest struct { Method *URLFetchRequest_RequestMethod `protobuf:"varint,1,req,name=Method,enum=appengine.URLFetchRequest_RequestMethod" json:"Method,omitempty"` @@ -163,13 +173,34 @@ type URLFetchRequest struct { FollowRedirects *bool `protobuf:"varint,7,opt,name=FollowRedirects,def=1" json:"FollowRedirects,omitempty"` Deadline *float64 `protobuf:"fixed64,8,opt,name=Deadline" json:"Deadline,omitempty"` MustValidateServerCertificate *bool `protobuf:"varint,9,opt,name=MustValidateServerCertificate,def=1" json:"MustValidateServerCertificate,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *URLFetchRequest) Reset() { *m = URLFetchRequest{} } -func (m *URLFetchRequest) String() string { return proto.CompactTextString(m) } -func (*URLFetchRequest) ProtoMessage() {} -func (*URLFetchRequest) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1} } +func (m *URLFetchRequest) Reset() { *m = URLFetchRequest{} } +func (m *URLFetchRequest) String() string { return proto.CompactTextString(m) } +func (*URLFetchRequest) ProtoMessage() {} +func (*URLFetchRequest) Descriptor() ([]byte, []int) { + return fileDescriptor_urlfetch_service_b245a7065f33bced, []int{1} +} +func (m *URLFetchRequest) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_URLFetchRequest.Unmarshal(m, b) +} +func (m *URLFetchRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_URLFetchRequest.Marshal(b, m, deterministic) +} +func (dst *URLFetchRequest) XXX_Merge(src proto.Message) { + xxx_messageInfo_URLFetchRequest.Merge(dst, src) +} +func (m *URLFetchRequest) XXX_Size() int { + return xxx_messageInfo_URLFetchRequest.Size(m) +} +func (m *URLFetchRequest) XXX_DiscardUnknown() { + xxx_messageInfo_URLFetchRequest.DiscardUnknown(m) +} + +var xxx_messageInfo_URLFetchRequest proto.InternalMessageInfo const Default_URLFetchRequest_FollowRedirects bool = true const Default_URLFetchRequest_MustValidateServerCertificate bool = true @@ -224,15 +255,36 @@ func (m *URLFetchRequest) GetMustValidateServerCertificate() bool { } type URLFetchRequest_Header struct { - Key *string `protobuf:"bytes,4,req,name=Key" json:"Key,omitempty"` - Value *string `protobuf:"bytes,5,req,name=Value" json:"Value,omitempty"` - XXX_unrecognized []byte `json:"-"` + Key *string `protobuf:"bytes,4,req,name=Key" json:"Key,omitempty"` + Value *string `protobuf:"bytes,5,req,name=Value" json:"Value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *URLFetchRequest_Header) Reset() { *m = URLFetchRequest_Header{} } -func (m *URLFetchRequest_Header) String() string { return proto.CompactTextString(m) } -func (*URLFetchRequest_Header) ProtoMessage() {} -func (*URLFetchRequest_Header) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{1, 0} } +func (m *URLFetchRequest_Header) Reset() { *m = URLFetchRequest_Header{} } +func (m *URLFetchRequest_Header) String() string { return proto.CompactTextString(m) } +func (*URLFetchRequest_Header) ProtoMessage() {} +func (*URLFetchRequest_Header) Descriptor() ([]byte, []int) { + return fileDescriptor_urlfetch_service_b245a7065f33bced, []int{1, 0} +} +func (m *URLFetchRequest_Header) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_URLFetchRequest_Header.Unmarshal(m, b) +} +func (m *URLFetchRequest_Header) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_URLFetchRequest_Header.Marshal(b, m, deterministic) +} +func (dst *URLFetchRequest_Header) XXX_Merge(src proto.Message) { + xxx_messageInfo_URLFetchRequest_Header.Merge(dst, src) +} +func (m *URLFetchRequest_Header) XXX_Size() int { + return xxx_messageInfo_URLFetchRequest_Header.Size(m) +} +func (m *URLFetchRequest_Header) XXX_DiscardUnknown() { + xxx_messageInfo_URLFetchRequest_Header.DiscardUnknown(m) +} + +var xxx_messageInfo_URLFetchRequest_Header proto.InternalMessageInfo func (m *URLFetchRequest_Header) GetKey() string { if m != nil && m.Key != nil { @@ -259,13 +311,34 @@ type URLFetchResponse struct { ApiCpuMilliseconds *int64 `protobuf:"varint,10,opt,name=ApiCpuMilliseconds,def=0" json:"ApiCpuMilliseconds,omitempty"` ApiBytesSent *int64 `protobuf:"varint,11,opt,name=ApiBytesSent,def=0" json:"ApiBytesSent,omitempty"` ApiBytesReceived *int64 `protobuf:"varint,12,opt,name=ApiBytesReceived,def=0" json:"ApiBytesReceived,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *URLFetchResponse) Reset() { *m = URLFetchResponse{} } +func (m *URLFetchResponse) String() string { return proto.CompactTextString(m) } +func (*URLFetchResponse) ProtoMessage() {} +func (*URLFetchResponse) Descriptor() ([]byte, []int) { + return fileDescriptor_urlfetch_service_b245a7065f33bced, []int{2} +} +func (m *URLFetchResponse) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_URLFetchResponse.Unmarshal(m, b) +} +func (m *URLFetchResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_URLFetchResponse.Marshal(b, m, deterministic) +} +func (dst *URLFetchResponse) XXX_Merge(src proto.Message) { + xxx_messageInfo_URLFetchResponse.Merge(dst, src) +} +func (m *URLFetchResponse) XXX_Size() int { + return xxx_messageInfo_URLFetchResponse.Size(m) +} +func (m *URLFetchResponse) XXX_DiscardUnknown() { + xxx_messageInfo_URLFetchResponse.DiscardUnknown(m) } -func (m *URLFetchResponse) Reset() { *m = URLFetchResponse{} } -func (m *URLFetchResponse) String() string { return proto.CompactTextString(m) } -func (*URLFetchResponse) ProtoMessage() {} -func (*URLFetchResponse) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{2} } +var xxx_messageInfo_URLFetchResponse proto.InternalMessageInfo const Default_URLFetchResponse_ContentWasTruncated bool = false const Default_URLFetchResponse_ApiCpuMilliseconds int64 = 0 @@ -343,15 +416,36 @@ func (m *URLFetchResponse) GetApiBytesReceived() int64 { } type URLFetchResponse_Header struct { - Key *string `protobuf:"bytes,4,req,name=Key" json:"Key,omitempty"` - Value *string `protobuf:"bytes,5,req,name=Value" json:"Value,omitempty"` - XXX_unrecognized []byte `json:"-"` + Key *string `protobuf:"bytes,4,req,name=Key" json:"Key,omitempty"` + Value *string `protobuf:"bytes,5,req,name=Value" json:"Value,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *URLFetchResponse_Header) Reset() { *m = URLFetchResponse_Header{} } +func (m *URLFetchResponse_Header) String() string { return proto.CompactTextString(m) } +func (*URLFetchResponse_Header) ProtoMessage() {} +func (*URLFetchResponse_Header) Descriptor() ([]byte, []int) { + return fileDescriptor_urlfetch_service_b245a7065f33bced, []int{2, 0} +} +func (m *URLFetchResponse_Header) XXX_Unmarshal(b []byte) error { + return xxx_messageInfo_URLFetchResponse_Header.Unmarshal(m, b) +} +func (m *URLFetchResponse_Header) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + return xxx_messageInfo_URLFetchResponse_Header.Marshal(b, m, deterministic) +} +func (dst *URLFetchResponse_Header) XXX_Merge(src proto.Message) { + xxx_messageInfo_URLFetchResponse_Header.Merge(dst, src) +} +func (m *URLFetchResponse_Header) XXX_Size() int { + return xxx_messageInfo_URLFetchResponse_Header.Size(m) +} +func (m *URLFetchResponse_Header) XXX_DiscardUnknown() { + xxx_messageInfo_URLFetchResponse_Header.DiscardUnknown(m) } -func (m *URLFetchResponse_Header) Reset() { *m = URLFetchResponse_Header{} } -func (m *URLFetchResponse_Header) String() string { return proto.CompactTextString(m) } -func (*URLFetchResponse_Header) ProtoMessage() {} -func (*URLFetchResponse_Header) Descriptor() ([]byte, []int) { return fileDescriptor0, []int{2, 0} } +var xxx_messageInfo_URLFetchResponse_Header proto.InternalMessageInfo func (m *URLFetchResponse_Header) GetKey() string { if m != nil && m.Key != nil { @@ -376,10 +470,10 @@ func init() { } func init() { - proto.RegisterFile("google.golang.org/appengine/internal/urlfetch/urlfetch_service.proto", fileDescriptor0) + proto.RegisterFile("google.golang.org/appengine/internal/urlfetch/urlfetch_service.proto", fileDescriptor_urlfetch_service_b245a7065f33bced) } -var fileDescriptor0 = []byte{ +var fileDescriptor_urlfetch_service_b245a7065f33bced = []byte{ // 770 bytes of a gzipped FileDescriptorProto 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x94, 0x54, 0xdd, 0x6e, 0xe3, 0x54, 0x10, 0xc6, 0x76, 0x7e, 0xa7, 0x5d, 0x7a, 0x76, 0xb6, 0x45, 0x66, 0xb5, 0xa0, 0x10, 0x09, 0x29, diff --git a/vendor/google.golang.org/appengine/travis_install.sh b/vendor/google.golang.org/appengine/travis_install.sh new file mode 100644 index 00000000..785b62f4 --- /dev/null +++ b/vendor/google.golang.org/appengine/travis_install.sh @@ -0,0 +1,18 @@ +#!/bin/bash +set -e + +if [[ $GO111MODULE == "on" ]]; then + go get . +else + go get -u -v $(go list -f '{{join .Imports "\n"}}{{"\n"}}{{join .TestImports "\n"}}' ./... | sort | uniq | grep -v appengine) +fi + +if [[ $GOAPP == "true" ]]; then + mkdir /tmp/sdk + curl -o /tmp/sdk.zip "https://storage.googleapis.com/appengine-sdks/featured/go_appengine_sdk_linux_amd64-1.9.68.zip" + unzip -q /tmp/sdk.zip -d /tmp/sdk + # NOTE: Set the following env vars in the test script: + # export PATH="$PATH:/tmp/sdk/go_appengine" + # export APPENGINE_DEV_APPSERVER=/tmp/sdk/go_appengine/dev_appserver.py +fi + diff --git a/vendor/google.golang.org/appengine/travis_test.sh b/vendor/google.golang.org/appengine/travis_test.sh new file mode 100644 index 00000000..d4390f04 --- /dev/null +++ b/vendor/google.golang.org/appengine/travis_test.sh @@ -0,0 +1,12 @@ +#!/bin/bash +set -e + +go version +go test -v google.golang.org/appengine/... +go test -v -race google.golang.org/appengine/... +if [[ $GOAPP == "true" ]]; then + export PATH="$PATH:/tmp/sdk/go_appengine" + export APPENGINE_DEV_APPSERVER=/tmp/sdk/go_appengine/dev_appserver.py + goapp version + goapp test -v google.golang.org/appengine/... +fi diff --git a/vendor/google.golang.org/genproto/googleapis/rpc/status/status.pb.go b/vendor/google.golang.org/genproto/googleapis/rpc/status/status.pb.go index 7bfe37a3..57ae35f6 100644 --- a/vendor/google.golang.org/genproto/googleapis/rpc/status/status.pb.go +++ b/vendor/google.golang.org/genproto/googleapis/rpc/status/status.pb.go @@ -19,24 +19,25 @@ var _ = math.Inf // proto package needs to be updated. const _ = proto.ProtoPackageIsVersion2 // please upgrade the proto package -// The `Status` type defines a logical error model that is suitable for different -// programming environments, including REST APIs and RPC APIs. It is used by -// [gRPC](https://github.com/grpc). The error model is designed to be: +// The `Status` type defines a logical error model that is suitable for +// different programming environments, including REST APIs and RPC APIs. It is +// used by [gRPC](https://github.com/grpc). The error model is designed to be: // // - Simple to use and understand for most users // - Flexible enough to meet unexpected needs // // # Overview // -// The `Status` message contains three pieces of data: error code, error message, -// and error details. The error code should be an enum value of -// [google.rpc.Code][google.rpc.Code], but it may accept additional error codes if needed. The -// error message should be a developer-facing English message that helps -// developers *understand* and *resolve* the error. If a localized user-facing -// error message is needed, put the localized message in the error details or -// localize it in the client. The optional error details may contain arbitrary -// information about the error. There is a predefined set of error detail types -// in the package `google.rpc` that can be used for common error conditions. +// The `Status` message contains three pieces of data: error code, error +// message, and error details. The error code should be an enum value of +// [google.rpc.Code][google.rpc.Code], but it may accept additional error codes +// if needed. The error message should be a developer-facing English message +// that helps developers *understand* and *resolve* the error. If a localized +// user-facing error message is needed, put the localized message in the error +// details or localize it in the client. The optional error details may contain +// arbitrary information about the error. There is a predefined set of error +// detail types in the package `google.rpc` that can be used for common error +// conditions. // // # Language mapping // @@ -72,11 +73,13 @@ const _ = proto.ProtoPackageIsVersion2 // please upgrade the proto package // - Logging. If some API errors are stored in logs, the message `Status` could // be used directly after any stripping needed for security/privacy reasons. type Status struct { - // The status code, which should be an enum value of [google.rpc.Code][google.rpc.Code]. + // The status code, which should be an enum value of + // [google.rpc.Code][google.rpc.Code]. Code int32 `protobuf:"varint,1,opt,name=code,proto3" json:"code,omitempty"` // A developer-facing error message, which should be in English. Any // user-facing error message should be localized and sent in the - // [google.rpc.Status.details][google.rpc.Status.details] field, or localized by the client. + // [google.rpc.Status.details][google.rpc.Status.details] field, or localized + // by the client. Message string `protobuf:"bytes,2,opt,name=message,proto3" json:"message,omitempty"` // A list of messages that carry the error details. There is a common set of // message types for APIs to use. @@ -90,7 +93,7 @@ func (m *Status) Reset() { *m = Status{} } func (m *Status) String() string { return proto.CompactTextString(m) } func (*Status) ProtoMessage() {} func (*Status) Descriptor() ([]byte, []int) { - return fileDescriptor_status_c6e4de62dcdf2edf, []int{0} + return fileDescriptor_status_ced6ddf76350620b, []int{0} } func (m *Status) XXX_Unmarshal(b []byte) error { return xxx_messageInfo_Status.Unmarshal(m, b) @@ -135,9 +138,9 @@ func init() { proto.RegisterType((*Status)(nil), "google.rpc.Status") } -func init() { proto.RegisterFile("google/rpc/status.proto", fileDescriptor_status_c6e4de62dcdf2edf) } +func init() { proto.RegisterFile("google/rpc/status.proto", fileDescriptor_status_ced6ddf76350620b) } -var fileDescriptor_status_c6e4de62dcdf2edf = []byte{ +var fileDescriptor_status_ced6ddf76350620b = []byte{ // 209 bytes of a gzipped FileDescriptorProto 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xe2, 0x12, 0x4f, 0xcf, 0xcf, 0x4f, 0xcf, 0x49, 0xd5, 0x2f, 0x2a, 0x48, 0xd6, 0x2f, 0x2e, 0x49, 0x2c, 0x29, 0x2d, 0xd6, 0x2b, 0x28, diff --git a/vendor/modules.txt b/vendor/modules.txt index 87bdc0ef..4e392703 100644 --- a/vendor/modules.txt +++ b/vendor/modules.txt @@ -3,24 +3,26 @@ cloud.google.com/go/compute/metadata # github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 github.com/Azure/go-ansiterm/winterm github.com/Azure/go-ansiterm -# github.com/Microsoft/go-winio v0.4.14 +# github.com/Microsoft/go-winio v0.4.15-0.20190919025122-fc70bd9a86b5 github.com/Microsoft/go-winio github.com/Microsoft/go-winio/pkg/guid -# github.com/Microsoft/hcsshim v0.8.6 +# github.com/Microsoft/hcsshim v0.8.7 github.com/Microsoft/hcsshim/osversion github.com/Microsoft/hcsshim -github.com/Microsoft/hcsshim/internal/guid github.com/Microsoft/hcsshim/internal/hcs github.com/Microsoft/hcsshim/internal/hcserror github.com/Microsoft/hcsshim/internal/hns github.com/Microsoft/hcsshim/internal/mergemaps github.com/Microsoft/hcsshim/internal/schema1 github.com/Microsoft/hcsshim/internal/wclayer -github.com/Microsoft/hcsshim/internal/guestrequest +github.com/Microsoft/hcsshim/internal/cow github.com/Microsoft/hcsshim/internal/interop +github.com/Microsoft/hcsshim/internal/log github.com/Microsoft/hcsshim/internal/logfields -github.com/Microsoft/hcsshim/internal/timeout +github.com/Microsoft/hcsshim/internal/oc github.com/Microsoft/hcsshim/internal/schema2 +github.com/Microsoft/hcsshim/internal/timeout +github.com/Microsoft/hcsshim/internal/vmcompute github.com/Microsoft/hcsshim/internal/longpath github.com/Microsoft/hcsshim/internal/safefile # github.com/agl/ed25519 v0.0.0-20170116200512-5312a6153412 @@ -28,6 +30,8 @@ github.com/agl/ed25519 github.com/agl/ed25519/edwards25519 # github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973 github.com/beorn7/perks/quantile +# github.com/containerd/cgroups v0.0.0-20190919134610-bf292b21730f +github.com/containerd/cgroups/stats/v1 # github.com/containerd/console v0.0.0-20191206165004-02ecf6a7291e github.com/containerd/console # github.com/containerd/containerd v1.4.0-0.20191014053712-acdcf13d5eaf @@ -197,7 +201,7 @@ github.com/docker/go-connections/tlsconfig github.com/docker/go-events # github.com/docker/go-metrics v0.0.0-20170502235133-d466d4f6fd96 github.com/docker/go-metrics -# github.com/docker/go-units v0.3.1 +# github.com/docker/go-units v0.4.0 github.com/docker/go-units # github.com/docker/spdystream v0.0.0-20181023171402-6480d4af844c github.com/docker/spdystream @@ -249,6 +253,8 @@ github.com/gregjones/httpcache/diskcache github.com/grpc-ecosystem/grpc-opentracing/go/otgrpc # github.com/hashicorp/go-version v1.1.0 github.com/hashicorp/go-version +# github.com/hashicorp/golang-lru v0.5.1 +github.com/hashicorp/golang-lru/simplelru # github.com/hashicorp/hcl v1.0.0 github.com/hashicorp/hcl github.com/hashicorp/hcl/hcl/ast @@ -344,9 +350,10 @@ github.com/prometheus/client_model/go github.com/prometheus/common/expfmt github.com/prometheus/common/model github.com/prometheus/common/internal/bitbucket.org/ww/goautoneg -# github.com/prometheus/procfs v0.0.3 +# github.com/prometheus/procfs v0.0.5 github.com/prometheus/procfs github.com/prometheus/procfs/internal/fs +github.com/prometheus/procfs/internal/util # github.com/serialx/hashring v0.0.0-20190422032157-8b2912629002 github.com/serialx/hashring # github.com/sirupsen/logrus v1.4.1 @@ -384,8 +391,14 @@ github.com/tonistiigi/units github.com/xeipuuv/gojsonpointer # github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 github.com/xeipuuv/gojsonreference -# github.com/xeipuuv/gojsonschema v0.0.0-20160323030313-93e72a773fad +# github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f github.com/xeipuuv/gojsonschema +# go.opencensus.io v0.22.0 +go.opencensus.io/trace +go.opencensus.io/internal +go.opencensus.io/trace/internal +go.opencensus.io/trace/tracestate +go.opencensus.io # golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2 golang.org/x/crypto/ssh golang.org/x/crypto/ssh/agent @@ -421,14 +434,14 @@ golang.org/x/sync/semaphore golang.org/x/sys/unix golang.org/x/sys/windows golang.org/x/sys/cpu -# golang.org/x/text v0.3.0 +# golang.org/x/text v0.3.2 golang.org/x/text/secure/bidirule golang.org/x/text/unicode/bidi golang.org/x/text/unicode/norm golang.org/x/text/transform # golang.org/x/time v0.0.0-20190308202827-9d24e82272b4 golang.org/x/time/rate -# google.golang.org/appengine v1.1.0 +# google.golang.org/appengine v1.4.0 google.golang.org/appengine google.golang.org/appengine/urlfetch google.golang.org/appengine/internal @@ -439,7 +452,7 @@ google.golang.org/appengine/internal/base google.golang.org/appengine/internal/datastore google.golang.org/appengine/internal/log google.golang.org/appengine/internal/remote_api -# google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 +# google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb google.golang.org/genproto/googleapis/rpc/status # google.golang.org/grpc v1.23.0 google.golang.org/grpc